babylon.2.0-beta.debug.js 1.3 MB

12345678910111213141516171819202122232425262728293031323334353637383940414243444546474849505152535455565758596061626364656667686970717273747576777879808182838485868788899091929394959697989910010110210310410510610710810911011111211311411511611711811912012112212312412512612712812913013113213313413513613713813914014114214314414514614714814915015115215315415515615715815916016116216316416516616716816917017117217317417517617717817918018118218318418518618718818919019119219319419519619719819920020120220320420520620720820921021121221321421521621721821922022122222322422522622722822923023123223323423523623723823924024124224324424524624724824925025125225325425525625725825926026126226326426526626726826927027127227327427527627727827928028128228328428528628728828929029129229329429529629729829930030130230330430530630730830931031131231331431531631731831932032132232332432532632732832933033133233333433533633733833934034134234334434534634734834935035135235335435535635735835936036136236336436536636736836937037137237337437537637737837938038138238338438538638738838939039139239339439539639739839940040140240340440540640740840941041141241341441541641741841942042142242342442542642742842943043143243343443543643743843944044144244344444544644744844945045145245345445545645745845946046146246346446546646746846947047147247347447547647747847948048148248348448548648748848949049149249349449549649749849950050150250350450550650750850951051151251351451551651751851952052152252352452552652752852953053153253353453553653753853954054154254354454554654754854955055155255355455555655755855956056156256356456556656756856957057157257357457557657757857958058158258358458558658758858959059159259359459559659759859960060160260360460560660760860961061161261361461561661761861962062162262362462562662762862963063163263363463563663763863964064164264364464564664764864965065165265365465565665765865966066166266366466566666766866967067167267367467567667767867968068168268368468568668768868969069169269369469569669769869970070170270370470570670770870971071171271371471571671771871972072172272372472572672772872973073173273373473573673773873974074174274374474574674774874975075175275375475575675775875976076176276376476576676776876977077177277377477577677777877978078178278378478578678778878979079179279379479579679779879980080180280380480580680780880981081181281381481581681781881982082182282382482582682782882983083183283383483583683783883984084184284384484584684784884985085185285385485585685785885986086186286386486586686786886987087187287387487587687787887988088188288388488588688788888989089189289389489589689789889990090190290390490590690790890991091191291391491591691791891992092192292392492592692792892993093193293393493593693793893994094194294394494594694794894995095195295395495595695795895996096196296396496596696796896997097197297397497597697797897998098198298398498598698798898999099199299399499599699799899910001001100210031004100510061007100810091010101110121013101410151016101710181019102010211022102310241025102610271028102910301031103210331034103510361037103810391040104110421043104410451046104710481049105010511052105310541055105610571058105910601061106210631064106510661067106810691070107110721073107410751076107710781079108010811082108310841085108610871088108910901091109210931094109510961097109810991100110111021103110411051106110711081109111011111112111311141115111611171118111911201121112211231124112511261127112811291130113111321133113411351136113711381139114011411142114311441145114611471148114911501151115211531154115511561157115811591160116111621163116411651166116711681169117011711172117311741175117611771178117911801181118211831184118511861187118811891190119111921193119411951196119711981199120012011202120312041205120612071208120912101211121212131214121512161217121812191220122112221223122412251226122712281229123012311232123312341235123612371238123912401241124212431244124512461247124812491250125112521253125412551256125712581259126012611262126312641265126612671268126912701271127212731274127512761277127812791280128112821283128412851286128712881289129012911292129312941295129612971298129913001301130213031304130513061307130813091310131113121313131413151316131713181319132013211322132313241325132613271328132913301331133213331334133513361337133813391340134113421343134413451346134713481349135013511352135313541355135613571358135913601361136213631364136513661367136813691370137113721373137413751376137713781379138013811382138313841385138613871388138913901391139213931394139513961397139813991400140114021403140414051406140714081409141014111412141314141415141614171418141914201421142214231424142514261427142814291430143114321433143414351436143714381439144014411442144314441445144614471448144914501451145214531454145514561457145814591460146114621463146414651466146714681469147014711472147314741475147614771478147914801481148214831484148514861487148814891490149114921493149414951496149714981499150015011502150315041505150615071508150915101511151215131514151515161517151815191520152115221523152415251526152715281529153015311532153315341535153615371538153915401541154215431544154515461547154815491550155115521553155415551556155715581559156015611562156315641565156615671568156915701571157215731574157515761577157815791580158115821583158415851586158715881589159015911592159315941595159615971598159916001601160216031604160516061607160816091610161116121613161416151616161716181619162016211622162316241625162616271628162916301631163216331634163516361637163816391640164116421643164416451646164716481649165016511652165316541655165616571658165916601661166216631664166516661667166816691670167116721673167416751676167716781679168016811682168316841685168616871688168916901691169216931694169516961697169816991700170117021703170417051706170717081709171017111712171317141715171617171718171917201721172217231724172517261727172817291730173117321733173417351736173717381739174017411742174317441745174617471748174917501751175217531754175517561757175817591760176117621763176417651766176717681769177017711772177317741775177617771778177917801781178217831784178517861787178817891790179117921793179417951796179717981799180018011802180318041805180618071808180918101811181218131814181518161817181818191820182118221823182418251826182718281829183018311832183318341835183618371838183918401841184218431844184518461847184818491850185118521853185418551856185718581859186018611862186318641865186618671868186918701871187218731874187518761877187818791880188118821883188418851886188718881889189018911892189318941895189618971898189919001901190219031904190519061907190819091910191119121913191419151916191719181919192019211922192319241925192619271928192919301931193219331934193519361937193819391940194119421943194419451946194719481949195019511952195319541955195619571958195919601961196219631964196519661967196819691970197119721973197419751976197719781979198019811982198319841985198619871988198919901991199219931994199519961997199819992000200120022003200420052006200720082009201020112012201320142015201620172018201920202021202220232024202520262027202820292030203120322033203420352036203720382039204020412042204320442045204620472048204920502051205220532054205520562057205820592060206120622063206420652066206720682069207020712072207320742075207620772078207920802081208220832084208520862087208820892090209120922093209420952096209720982099210021012102210321042105210621072108210921102111211221132114211521162117211821192120212121222123212421252126212721282129213021312132213321342135213621372138213921402141214221432144214521462147214821492150215121522153215421552156215721582159216021612162216321642165216621672168216921702171217221732174217521762177217821792180218121822183218421852186218721882189219021912192219321942195219621972198219922002201220222032204220522062207220822092210221122122213221422152216221722182219222022212222222322242225222622272228222922302231223222332234223522362237223822392240224122422243224422452246224722482249225022512252225322542255225622572258225922602261226222632264226522662267226822692270227122722273227422752276227722782279228022812282228322842285228622872288228922902291229222932294229522962297229822992300230123022303230423052306230723082309231023112312231323142315231623172318231923202321232223232324232523262327232823292330233123322333233423352336233723382339234023412342234323442345234623472348234923502351235223532354235523562357235823592360236123622363236423652366236723682369237023712372237323742375237623772378237923802381238223832384238523862387238823892390239123922393239423952396239723982399240024012402240324042405240624072408240924102411241224132414241524162417241824192420242124222423242424252426242724282429243024312432243324342435243624372438243924402441244224432444244524462447244824492450245124522453245424552456245724582459246024612462246324642465246624672468246924702471247224732474247524762477247824792480248124822483248424852486248724882489249024912492249324942495249624972498249925002501250225032504250525062507250825092510251125122513251425152516251725182519252025212522252325242525252625272528252925302531253225332534253525362537253825392540254125422543254425452546254725482549255025512552255325542555255625572558255925602561256225632564256525662567256825692570257125722573257425752576257725782579258025812582258325842585258625872588258925902591259225932594259525962597259825992600260126022603260426052606260726082609261026112612261326142615261626172618261926202621262226232624262526262627262826292630263126322633263426352636263726382639264026412642264326442645264626472648264926502651265226532654265526562657265826592660266126622663266426652666266726682669267026712672267326742675267626772678267926802681268226832684268526862687268826892690269126922693269426952696269726982699270027012702270327042705270627072708270927102711271227132714271527162717271827192720272127222723272427252726272727282729273027312732273327342735273627372738273927402741274227432744274527462747274827492750275127522753275427552756275727582759276027612762276327642765276627672768276927702771277227732774277527762777277827792780278127822783278427852786278727882789279027912792279327942795279627972798279928002801280228032804280528062807280828092810281128122813281428152816281728182819282028212822282328242825282628272828282928302831283228332834283528362837283828392840284128422843284428452846284728482849285028512852285328542855285628572858285928602861286228632864286528662867286828692870287128722873287428752876287728782879288028812882288328842885288628872888288928902891289228932894289528962897289828992900290129022903290429052906290729082909291029112912291329142915291629172918291929202921292229232924292529262927292829292930293129322933293429352936293729382939294029412942294329442945294629472948294929502951295229532954295529562957295829592960296129622963296429652966296729682969297029712972297329742975297629772978297929802981298229832984298529862987298829892990299129922993299429952996299729982999300030013002300330043005300630073008300930103011301230133014301530163017301830193020302130223023302430253026302730283029303030313032303330343035303630373038303930403041304230433044304530463047304830493050305130523053305430553056305730583059306030613062306330643065306630673068306930703071307230733074307530763077307830793080308130823083308430853086308730883089309030913092309330943095309630973098309931003101310231033104310531063107310831093110311131123113311431153116311731183119312031213122312331243125312631273128312931303131313231333134313531363137313831393140314131423143314431453146314731483149315031513152315331543155315631573158315931603161316231633164316531663167316831693170317131723173317431753176317731783179318031813182318331843185318631873188318931903191319231933194319531963197319831993200320132023203320432053206320732083209321032113212321332143215321632173218321932203221322232233224322532263227322832293230323132323233323432353236323732383239324032413242324332443245324632473248324932503251325232533254325532563257325832593260326132623263326432653266326732683269327032713272327332743275327632773278327932803281328232833284328532863287328832893290329132923293329432953296329732983299330033013302330333043305330633073308330933103311331233133314331533163317331833193320332133223323332433253326332733283329333033313332333333343335333633373338333933403341334233433344334533463347334833493350335133523353335433553356335733583359336033613362336333643365336633673368336933703371337233733374337533763377337833793380338133823383338433853386338733883389339033913392339333943395339633973398339934003401340234033404340534063407340834093410341134123413341434153416341734183419342034213422342334243425342634273428342934303431343234333434343534363437343834393440344134423443344434453446344734483449345034513452345334543455345634573458345934603461346234633464346534663467346834693470347134723473347434753476347734783479348034813482348334843485348634873488348934903491349234933494349534963497349834993500350135023503350435053506350735083509351035113512351335143515351635173518351935203521352235233524352535263527352835293530353135323533353435353536353735383539354035413542354335443545354635473548354935503551355235533554355535563557355835593560356135623563356435653566356735683569357035713572357335743575357635773578357935803581358235833584358535863587358835893590359135923593359435953596359735983599360036013602360336043605360636073608360936103611361236133614361536163617361836193620362136223623362436253626362736283629363036313632363336343635363636373638363936403641364236433644364536463647364836493650365136523653365436553656365736583659366036613662366336643665366636673668366936703671367236733674367536763677367836793680368136823683368436853686368736883689369036913692369336943695369636973698369937003701370237033704370537063707370837093710371137123713371437153716371737183719372037213722372337243725372637273728372937303731373237333734373537363737373837393740374137423743374437453746374737483749375037513752375337543755375637573758375937603761376237633764376537663767376837693770377137723773377437753776377737783779378037813782378337843785378637873788378937903791379237933794379537963797379837993800380138023803380438053806380738083809381038113812381338143815381638173818381938203821382238233824382538263827382838293830383138323833383438353836383738383839384038413842384338443845384638473848384938503851385238533854385538563857385838593860386138623863386438653866386738683869387038713872387338743875387638773878387938803881388238833884388538863887388838893890389138923893389438953896389738983899390039013902390339043905390639073908390939103911391239133914391539163917391839193920392139223923392439253926392739283929393039313932393339343935393639373938393939403941394239433944394539463947394839493950395139523953395439553956395739583959396039613962396339643965396639673968396939703971397239733974397539763977397839793980398139823983398439853986398739883989399039913992399339943995399639973998399940004001400240034004400540064007400840094010401140124013401440154016401740184019402040214022402340244025402640274028402940304031403240334034403540364037403840394040404140424043404440454046404740484049405040514052405340544055405640574058405940604061406240634064406540664067406840694070407140724073407440754076407740784079408040814082408340844085408640874088408940904091409240934094409540964097409840994100410141024103410441054106410741084109411041114112411341144115411641174118411941204121412241234124412541264127412841294130413141324133413441354136413741384139414041414142414341444145414641474148414941504151415241534154415541564157415841594160416141624163416441654166416741684169417041714172417341744175417641774178417941804181418241834184418541864187418841894190419141924193419441954196419741984199420042014202420342044205420642074208420942104211421242134214421542164217421842194220422142224223422442254226422742284229423042314232423342344235423642374238423942404241424242434244424542464247424842494250425142524253425442554256425742584259426042614262426342644265426642674268426942704271427242734274427542764277427842794280428142824283428442854286428742884289429042914292429342944295429642974298429943004301430243034304430543064307430843094310431143124313431443154316431743184319432043214322432343244325432643274328432943304331433243334334433543364337433843394340434143424343434443454346434743484349435043514352435343544355435643574358435943604361436243634364436543664367436843694370437143724373437443754376437743784379438043814382438343844385438643874388438943904391439243934394439543964397439843994400440144024403440444054406440744084409441044114412441344144415441644174418441944204421442244234424442544264427442844294430443144324433443444354436443744384439444044414442444344444445444644474448444944504451445244534454445544564457445844594460446144624463446444654466446744684469447044714472447344744475447644774478447944804481448244834484448544864487448844894490449144924493449444954496449744984499450045014502450345044505450645074508450945104511451245134514451545164517451845194520452145224523452445254526452745284529453045314532453345344535453645374538453945404541454245434544454545464547454845494550455145524553455445554556455745584559456045614562456345644565456645674568456945704571457245734574457545764577457845794580458145824583458445854586458745884589459045914592459345944595459645974598459946004601460246034604460546064607460846094610461146124613461446154616461746184619462046214622462346244625462646274628462946304631463246334634463546364637463846394640464146424643464446454646464746484649465046514652465346544655465646574658465946604661466246634664466546664667466846694670467146724673467446754676467746784679468046814682468346844685468646874688468946904691469246934694469546964697469846994700470147024703470447054706470747084709471047114712471347144715471647174718471947204721472247234724472547264727472847294730473147324733473447354736473747384739474047414742474347444745474647474748474947504751475247534754475547564757475847594760476147624763476447654766476747684769477047714772477347744775477647774778477947804781478247834784478547864787478847894790479147924793479447954796479747984799480048014802480348044805480648074808480948104811481248134814481548164817481848194820482148224823482448254826482748284829483048314832483348344835483648374838483948404841484248434844484548464847484848494850485148524853485448554856485748584859486048614862486348644865486648674868486948704871487248734874487548764877487848794880488148824883488448854886488748884889489048914892489348944895489648974898489949004901490249034904490549064907490849094910491149124913491449154916491749184919492049214922492349244925492649274928492949304931493249334934493549364937493849394940494149424943494449454946494749484949495049514952495349544955495649574958495949604961496249634964496549664967496849694970497149724973497449754976497749784979498049814982498349844985498649874988498949904991499249934994499549964997499849995000500150025003500450055006500750085009501050115012501350145015501650175018501950205021502250235024502550265027502850295030503150325033503450355036503750385039504050415042504350445045504650475048504950505051505250535054505550565057505850595060506150625063506450655066506750685069507050715072507350745075507650775078507950805081508250835084508550865087508850895090509150925093509450955096509750985099510051015102510351045105510651075108510951105111511251135114511551165117511851195120512151225123512451255126512751285129513051315132513351345135513651375138513951405141514251435144514551465147514851495150515151525153515451555156515751585159516051615162516351645165516651675168516951705171517251735174517551765177517851795180518151825183518451855186518751885189519051915192519351945195519651975198519952005201520252035204520552065207520852095210521152125213521452155216521752185219522052215222522352245225522652275228522952305231523252335234523552365237523852395240524152425243524452455246524752485249525052515252525352545255525652575258525952605261526252635264526552665267526852695270527152725273527452755276527752785279528052815282528352845285528652875288528952905291529252935294529552965297529852995300530153025303530453055306530753085309531053115312531353145315531653175318531953205321532253235324532553265327532853295330533153325333533453355336533753385339534053415342534353445345534653475348534953505351535253535354535553565357535853595360536153625363536453655366536753685369537053715372537353745375537653775378537953805381538253835384538553865387538853895390539153925393539453955396539753985399540054015402540354045405540654075408540954105411541254135414541554165417541854195420542154225423542454255426542754285429543054315432543354345435543654375438543954405441544254435444544554465447544854495450545154525453545454555456545754585459546054615462546354645465546654675468546954705471547254735474547554765477547854795480548154825483548454855486548754885489549054915492549354945495549654975498549955005501550255035504550555065507550855095510551155125513551455155516551755185519552055215522552355245525552655275528552955305531553255335534553555365537553855395540554155425543554455455546554755485549555055515552555355545555555655575558555955605561556255635564556555665567556855695570557155725573557455755576557755785579558055815582558355845585558655875588558955905591559255935594559555965597559855995600560156025603560456055606560756085609561056115612561356145615561656175618561956205621562256235624562556265627562856295630563156325633563456355636563756385639564056415642564356445645564656475648564956505651565256535654565556565657565856595660566156625663566456655666566756685669567056715672567356745675567656775678567956805681568256835684568556865687568856895690569156925693569456955696569756985699570057015702570357045705570657075708570957105711571257135714571557165717571857195720572157225723572457255726572757285729573057315732573357345735573657375738573957405741574257435744574557465747574857495750575157525753575457555756575757585759576057615762576357645765576657675768576957705771577257735774577557765777577857795780578157825783578457855786578757885789579057915792579357945795579657975798579958005801580258035804580558065807580858095810581158125813581458155816581758185819582058215822582358245825582658275828582958305831583258335834583558365837583858395840584158425843584458455846584758485849585058515852585358545855585658575858585958605861586258635864586558665867586858695870587158725873587458755876587758785879588058815882588358845885588658875888588958905891589258935894589558965897589858995900590159025903590459055906590759085909591059115912591359145915591659175918591959205921592259235924592559265927592859295930593159325933593459355936593759385939594059415942594359445945594659475948594959505951595259535954595559565957595859595960596159625963596459655966596759685969597059715972597359745975597659775978597959805981598259835984598559865987598859895990599159925993599459955996599759985999600060016002600360046005600660076008600960106011601260136014601560166017601860196020602160226023602460256026602760286029603060316032603360346035603660376038603960406041604260436044604560466047604860496050605160526053605460556056605760586059606060616062606360646065606660676068606960706071607260736074607560766077607860796080608160826083608460856086608760886089609060916092609360946095609660976098609961006101610261036104610561066107610861096110611161126113611461156116611761186119612061216122612361246125612661276128612961306131613261336134613561366137613861396140614161426143614461456146614761486149615061516152615361546155615661576158615961606161616261636164616561666167616861696170617161726173617461756176617761786179618061816182618361846185618661876188618961906191619261936194619561966197619861996200620162026203620462056206620762086209621062116212621362146215621662176218621962206221622262236224622562266227622862296230623162326233623462356236623762386239624062416242624362446245624662476248624962506251625262536254625562566257625862596260626162626263626462656266626762686269627062716272627362746275627662776278627962806281628262836284628562866287628862896290629162926293629462956296629762986299630063016302630363046305630663076308630963106311631263136314631563166317631863196320632163226323632463256326632763286329633063316332633363346335633663376338633963406341634263436344634563466347634863496350635163526353635463556356635763586359636063616362636363646365636663676368636963706371637263736374637563766377637863796380638163826383638463856386638763886389639063916392639363946395639663976398639964006401640264036404640564066407640864096410641164126413641464156416641764186419642064216422642364246425642664276428642964306431643264336434643564366437643864396440644164426443644464456446644764486449645064516452645364546455645664576458645964606461646264636464646564666467646864696470647164726473647464756476647764786479648064816482648364846485648664876488648964906491649264936494649564966497649864996500650165026503650465056506650765086509651065116512651365146515651665176518651965206521652265236524652565266527652865296530653165326533653465356536653765386539654065416542654365446545654665476548654965506551655265536554655565566557655865596560656165626563656465656566656765686569657065716572657365746575657665776578657965806581658265836584658565866587658865896590659165926593659465956596659765986599660066016602660366046605660666076608660966106611661266136614661566166617661866196620662166226623662466256626662766286629663066316632663366346635663666376638663966406641664266436644664566466647664866496650665166526653665466556656665766586659666066616662666366646665666666676668666966706671667266736674667566766677667866796680668166826683668466856686668766886689669066916692669366946695669666976698669967006701670267036704670567066707670867096710671167126713671467156716671767186719672067216722672367246725672667276728672967306731673267336734673567366737673867396740674167426743674467456746674767486749675067516752675367546755675667576758675967606761676267636764676567666767676867696770677167726773677467756776677767786779678067816782678367846785678667876788678967906791679267936794679567966797679867996800680168026803680468056806680768086809681068116812681368146815681668176818681968206821682268236824682568266827682868296830683168326833683468356836683768386839684068416842684368446845684668476848684968506851685268536854685568566857685868596860686168626863686468656866686768686869687068716872687368746875687668776878687968806881688268836884688568866887688868896890689168926893689468956896689768986899690069016902690369046905690669076908690969106911691269136914691569166917691869196920692169226923692469256926692769286929693069316932693369346935693669376938693969406941694269436944694569466947694869496950695169526953695469556956695769586959696069616962696369646965696669676968696969706971697269736974697569766977697869796980698169826983698469856986698769886989699069916992699369946995699669976998699970007001700270037004700570067007700870097010701170127013701470157016701770187019702070217022702370247025702670277028702970307031703270337034703570367037703870397040704170427043704470457046704770487049705070517052705370547055705670577058705970607061706270637064706570667067706870697070707170727073707470757076707770787079708070817082708370847085708670877088708970907091709270937094709570967097709870997100710171027103710471057106710771087109711071117112711371147115711671177118711971207121712271237124712571267127712871297130713171327133713471357136713771387139714071417142714371447145714671477148714971507151715271537154715571567157715871597160716171627163716471657166716771687169717071717172717371747175717671777178717971807181718271837184718571867187718871897190719171927193719471957196719771987199720072017202720372047205720672077208720972107211721272137214721572167217721872197220722172227223722472257226722772287229723072317232723372347235723672377238723972407241724272437244724572467247724872497250725172527253725472557256725772587259726072617262726372647265726672677268726972707271727272737274727572767277727872797280728172827283728472857286728772887289729072917292729372947295729672977298729973007301730273037304730573067307730873097310731173127313731473157316731773187319732073217322732373247325732673277328732973307331733273337334733573367337733873397340734173427343734473457346734773487349735073517352735373547355735673577358735973607361736273637364736573667367736873697370737173727373737473757376737773787379738073817382738373847385738673877388738973907391739273937394739573967397739873997400740174027403740474057406740774087409741074117412741374147415741674177418741974207421742274237424742574267427742874297430743174327433743474357436743774387439744074417442744374447445744674477448744974507451745274537454745574567457745874597460746174627463746474657466746774687469747074717472747374747475747674777478747974807481748274837484748574867487748874897490749174927493749474957496749774987499750075017502750375047505750675077508750975107511751275137514751575167517751875197520752175227523752475257526752775287529753075317532753375347535753675377538753975407541754275437544754575467547754875497550755175527553755475557556755775587559756075617562756375647565756675677568756975707571757275737574757575767577757875797580758175827583758475857586758775887589759075917592759375947595759675977598759976007601760276037604760576067607760876097610761176127613761476157616761776187619762076217622762376247625762676277628762976307631763276337634763576367637763876397640764176427643764476457646764776487649765076517652765376547655765676577658765976607661766276637664766576667667766876697670767176727673767476757676767776787679768076817682768376847685768676877688768976907691769276937694769576967697769876997700770177027703770477057706770777087709771077117712771377147715771677177718771977207721772277237724772577267727772877297730773177327733773477357736773777387739774077417742774377447745774677477748774977507751775277537754775577567757775877597760776177627763776477657766776777687769777077717772777377747775777677777778777977807781778277837784778577867787778877897790779177927793779477957796779777987799780078017802780378047805780678077808780978107811781278137814781578167817781878197820782178227823782478257826782778287829783078317832783378347835783678377838783978407841784278437844784578467847784878497850785178527853785478557856785778587859786078617862786378647865786678677868786978707871787278737874787578767877787878797880788178827883788478857886788778887889789078917892789378947895789678977898789979007901790279037904790579067907790879097910791179127913791479157916791779187919792079217922792379247925792679277928792979307931793279337934793579367937793879397940794179427943794479457946794779487949795079517952795379547955795679577958795979607961796279637964796579667967796879697970797179727973797479757976797779787979798079817982798379847985798679877988798979907991799279937994799579967997799879998000800180028003800480058006800780088009801080118012801380148015801680178018801980208021802280238024802580268027802880298030803180328033803480358036803780388039804080418042804380448045804680478048804980508051805280538054805580568057805880598060806180628063806480658066806780688069807080718072807380748075807680778078807980808081808280838084808580868087808880898090809180928093809480958096809780988099810081018102810381048105810681078108810981108111811281138114811581168117811881198120812181228123812481258126812781288129813081318132813381348135813681378138813981408141814281438144814581468147814881498150815181528153815481558156815781588159816081618162816381648165816681678168816981708171817281738174817581768177817881798180818181828183818481858186818781888189819081918192819381948195819681978198819982008201820282038204820582068207820882098210821182128213821482158216821782188219822082218222822382248225822682278228822982308231823282338234823582368237823882398240824182428243824482458246824782488249825082518252825382548255825682578258825982608261826282638264826582668267826882698270827182728273827482758276827782788279828082818282828382848285828682878288828982908291829282938294829582968297829882998300830183028303830483058306830783088309831083118312831383148315831683178318831983208321832283238324832583268327832883298330833183328333833483358336833783388339834083418342834383448345834683478348834983508351835283538354835583568357835883598360836183628363836483658366836783688369837083718372837383748375837683778378837983808381838283838384838583868387838883898390839183928393839483958396839783988399840084018402840384048405840684078408840984108411841284138414841584168417841884198420842184228423842484258426842784288429843084318432843384348435843684378438843984408441844284438444844584468447844884498450845184528453845484558456845784588459846084618462846384648465846684678468846984708471847284738474847584768477847884798480848184828483848484858486848784888489849084918492849384948495849684978498849985008501850285038504850585068507850885098510851185128513851485158516851785188519852085218522852385248525852685278528852985308531853285338534853585368537853885398540854185428543854485458546854785488549855085518552855385548555855685578558855985608561856285638564856585668567856885698570857185728573857485758576857785788579858085818582858385848585858685878588858985908591859285938594859585968597859885998600860186028603860486058606860786088609861086118612861386148615861686178618861986208621862286238624862586268627862886298630863186328633863486358636863786388639864086418642864386448645864686478648864986508651865286538654865586568657865886598660866186628663866486658666866786688669867086718672867386748675867686778678867986808681868286838684868586868687868886898690869186928693869486958696869786988699870087018702870387048705870687078708870987108711871287138714871587168717871887198720872187228723872487258726872787288729873087318732873387348735873687378738873987408741874287438744874587468747874887498750875187528753875487558756875787588759876087618762876387648765876687678768876987708771877287738774877587768777877887798780878187828783878487858786878787888789879087918792879387948795879687978798879988008801880288038804880588068807880888098810881188128813881488158816881788188819882088218822882388248825882688278828882988308831883288338834883588368837883888398840884188428843884488458846884788488849885088518852885388548855885688578858885988608861886288638864886588668867886888698870887188728873887488758876887788788879888088818882888388848885888688878888888988908891889288938894889588968897889888998900890189028903890489058906890789088909891089118912891389148915891689178918891989208921892289238924892589268927892889298930893189328933893489358936893789388939894089418942894389448945894689478948894989508951895289538954895589568957895889598960896189628963896489658966896789688969897089718972897389748975897689778978897989808981898289838984898589868987898889898990899189928993899489958996899789988999900090019002900390049005900690079008900990109011901290139014901590169017901890199020902190229023902490259026902790289029903090319032903390349035903690379038903990409041904290439044904590469047904890499050905190529053905490559056905790589059906090619062906390649065906690679068906990709071907290739074907590769077907890799080908190829083908490859086908790889089909090919092909390949095909690979098909991009101910291039104910591069107910891099110911191129113911491159116911791189119912091219122912391249125912691279128912991309131913291339134913591369137913891399140914191429143914491459146914791489149915091519152915391549155915691579158915991609161916291639164916591669167916891699170917191729173917491759176917791789179918091819182918391849185918691879188918991909191919291939194919591969197919891999200920192029203920492059206920792089209921092119212921392149215921692179218921992209221922292239224922592269227922892299230923192329233923492359236923792389239924092419242924392449245924692479248924992509251925292539254925592569257925892599260926192629263926492659266926792689269927092719272927392749275927692779278927992809281928292839284928592869287928892899290929192929293929492959296929792989299930093019302930393049305930693079308930993109311931293139314931593169317931893199320932193229323932493259326932793289329933093319332933393349335933693379338933993409341934293439344934593469347934893499350935193529353935493559356935793589359936093619362936393649365936693679368936993709371937293739374937593769377937893799380938193829383938493859386938793889389939093919392939393949395939693979398939994009401940294039404940594069407940894099410941194129413941494159416941794189419942094219422942394249425942694279428942994309431943294339434943594369437943894399440944194429443944494459446944794489449945094519452945394549455945694579458945994609461946294639464946594669467946894699470947194729473947494759476947794789479948094819482948394849485948694879488948994909491949294939494949594969497949894999500950195029503950495059506950795089509951095119512951395149515951695179518951995209521952295239524952595269527952895299530953195329533953495359536953795389539954095419542954395449545954695479548954995509551955295539554955595569557955895599560956195629563956495659566956795689569957095719572957395749575957695779578957995809581958295839584958595869587958895899590959195929593959495959596959795989599960096019602960396049605960696079608960996109611961296139614961596169617961896199620962196229623962496259626962796289629963096319632963396349635963696379638963996409641964296439644964596469647964896499650965196529653965496559656965796589659966096619662966396649665966696679668966996709671967296739674967596769677967896799680968196829683968496859686968796889689969096919692969396949695969696979698969997009701970297039704970597069707970897099710971197129713971497159716971797189719972097219722972397249725972697279728972997309731973297339734973597369737973897399740974197429743974497459746974797489749975097519752975397549755975697579758975997609761976297639764976597669767976897699770977197729773977497759776977797789779978097819782978397849785978697879788978997909791979297939794979597969797979897999800980198029803980498059806980798089809981098119812981398149815981698179818981998209821982298239824982598269827982898299830983198329833983498359836983798389839984098419842984398449845984698479848984998509851985298539854985598569857985898599860986198629863986498659866986798689869987098719872987398749875987698779878987998809881988298839884988598869887988898899890989198929893989498959896989798989899990099019902990399049905990699079908990999109911991299139914991599169917991899199920992199229923992499259926992799289929993099319932993399349935993699379938993999409941994299439944994599469947994899499950995199529953995499559956995799589959996099619962996399649965996699679968996999709971997299739974997599769977997899799980998199829983998499859986998799889989999099919992999399949995999699979998999910000100011000210003100041000510006100071000810009100101001110012100131001410015100161001710018100191002010021100221002310024100251002610027100281002910030100311003210033100341003510036100371003810039100401004110042100431004410045100461004710048100491005010051100521005310054100551005610057100581005910060100611006210063100641006510066100671006810069100701007110072100731007410075100761007710078100791008010081100821008310084100851008610087100881008910090100911009210093100941009510096100971009810099101001010110102101031010410105101061010710108101091011010111101121011310114101151011610117101181011910120101211012210123101241012510126101271012810129101301013110132101331013410135101361013710138101391014010141101421014310144101451014610147101481014910150101511015210153101541015510156101571015810159101601016110162101631016410165101661016710168101691017010171101721017310174101751017610177101781017910180101811018210183101841018510186101871018810189101901019110192101931019410195101961019710198101991020010201102021020310204102051020610207102081020910210102111021210213102141021510216102171021810219102201022110222102231022410225102261022710228102291023010231102321023310234102351023610237102381023910240102411024210243102441024510246102471024810249102501025110252102531025410255102561025710258102591026010261102621026310264102651026610267102681026910270102711027210273102741027510276102771027810279102801028110282102831028410285102861028710288102891029010291102921029310294102951029610297102981029910300103011030210303103041030510306103071030810309103101031110312103131031410315103161031710318103191032010321103221032310324103251032610327103281032910330103311033210333103341033510336103371033810339103401034110342103431034410345103461034710348103491035010351103521035310354103551035610357103581035910360103611036210363103641036510366103671036810369103701037110372103731037410375103761037710378103791038010381103821038310384103851038610387103881038910390103911039210393103941039510396103971039810399104001040110402104031040410405104061040710408104091041010411104121041310414104151041610417104181041910420104211042210423104241042510426104271042810429104301043110432104331043410435104361043710438104391044010441104421044310444104451044610447104481044910450104511045210453104541045510456104571045810459104601046110462104631046410465104661046710468104691047010471104721047310474104751047610477104781047910480104811048210483104841048510486104871048810489104901049110492104931049410495104961049710498104991050010501105021050310504105051050610507105081050910510105111051210513105141051510516105171051810519105201052110522105231052410525105261052710528105291053010531105321053310534105351053610537105381053910540105411054210543105441054510546105471054810549105501055110552105531055410555105561055710558105591056010561105621056310564105651056610567105681056910570105711057210573105741057510576105771057810579105801058110582105831058410585105861058710588105891059010591105921059310594105951059610597105981059910600106011060210603106041060510606106071060810609106101061110612106131061410615106161061710618106191062010621106221062310624106251062610627106281062910630106311063210633106341063510636106371063810639106401064110642106431064410645106461064710648106491065010651106521065310654106551065610657106581065910660106611066210663106641066510666106671066810669106701067110672106731067410675106761067710678106791068010681106821068310684106851068610687106881068910690106911069210693106941069510696106971069810699107001070110702107031070410705107061070710708107091071010711107121071310714107151071610717107181071910720107211072210723107241072510726107271072810729107301073110732107331073410735107361073710738107391074010741107421074310744107451074610747107481074910750107511075210753107541075510756107571075810759107601076110762107631076410765107661076710768107691077010771107721077310774107751077610777107781077910780107811078210783107841078510786107871078810789107901079110792107931079410795107961079710798107991080010801108021080310804108051080610807108081080910810108111081210813108141081510816108171081810819108201082110822108231082410825108261082710828108291083010831108321083310834108351083610837108381083910840108411084210843108441084510846108471084810849108501085110852108531085410855108561085710858108591086010861108621086310864108651086610867108681086910870108711087210873108741087510876108771087810879108801088110882108831088410885108861088710888108891089010891108921089310894108951089610897108981089910900109011090210903109041090510906109071090810909109101091110912109131091410915109161091710918109191092010921109221092310924109251092610927109281092910930109311093210933109341093510936109371093810939109401094110942109431094410945109461094710948109491095010951109521095310954109551095610957109581095910960109611096210963109641096510966109671096810969109701097110972109731097410975109761097710978109791098010981109821098310984109851098610987109881098910990109911099210993109941099510996109971099810999110001100111002110031100411005110061100711008110091101011011110121101311014110151101611017110181101911020110211102211023110241102511026110271102811029110301103111032110331103411035110361103711038110391104011041110421104311044110451104611047110481104911050110511105211053110541105511056110571105811059110601106111062110631106411065110661106711068110691107011071110721107311074110751107611077110781107911080110811108211083110841108511086110871108811089110901109111092110931109411095110961109711098110991110011101111021110311104111051110611107111081110911110111111111211113111141111511116111171111811119111201112111122111231112411125111261112711128111291113011131111321113311134111351113611137111381113911140111411114211143111441114511146111471114811149111501115111152111531115411155111561115711158111591116011161111621116311164111651116611167111681116911170111711117211173111741117511176111771117811179111801118111182111831118411185111861118711188111891119011191111921119311194111951119611197111981119911200112011120211203112041120511206112071120811209112101121111212112131121411215112161121711218112191122011221112221122311224112251122611227112281122911230112311123211233112341123511236112371123811239112401124111242112431124411245112461124711248112491125011251112521125311254112551125611257112581125911260112611126211263112641126511266112671126811269112701127111272112731127411275112761127711278112791128011281112821128311284112851128611287112881128911290112911129211293112941129511296112971129811299113001130111302113031130411305113061130711308113091131011311113121131311314113151131611317113181131911320113211132211323113241132511326113271132811329113301133111332113331133411335113361133711338113391134011341113421134311344113451134611347113481134911350113511135211353113541135511356113571135811359113601136111362113631136411365113661136711368113691137011371113721137311374113751137611377113781137911380113811138211383113841138511386113871138811389113901139111392113931139411395113961139711398113991140011401114021140311404114051140611407114081140911410114111141211413114141141511416114171141811419114201142111422114231142411425114261142711428114291143011431114321143311434114351143611437114381143911440114411144211443114441144511446114471144811449114501145111452114531145411455114561145711458114591146011461114621146311464114651146611467114681146911470114711147211473114741147511476114771147811479114801148111482114831148411485114861148711488114891149011491114921149311494114951149611497114981149911500115011150211503115041150511506115071150811509115101151111512115131151411515115161151711518115191152011521115221152311524115251152611527115281152911530115311153211533115341153511536115371153811539115401154111542115431154411545115461154711548115491155011551115521155311554115551155611557115581155911560115611156211563115641156511566115671156811569115701157111572115731157411575115761157711578115791158011581115821158311584115851158611587115881158911590115911159211593115941159511596115971159811599116001160111602116031160411605116061160711608116091161011611116121161311614116151161611617116181161911620116211162211623116241162511626116271162811629116301163111632116331163411635116361163711638116391164011641116421164311644116451164611647116481164911650116511165211653116541165511656116571165811659116601166111662116631166411665116661166711668116691167011671116721167311674116751167611677116781167911680116811168211683116841168511686116871168811689116901169111692116931169411695116961169711698116991170011701117021170311704117051170611707117081170911710117111171211713117141171511716117171171811719117201172111722117231172411725117261172711728117291173011731117321173311734117351173611737117381173911740117411174211743117441174511746117471174811749117501175111752117531175411755117561175711758117591176011761117621176311764117651176611767117681176911770117711177211773117741177511776117771177811779117801178111782117831178411785117861178711788117891179011791117921179311794117951179611797117981179911800118011180211803118041180511806118071180811809118101181111812118131181411815118161181711818118191182011821118221182311824118251182611827118281182911830118311183211833118341183511836118371183811839118401184111842118431184411845118461184711848118491185011851118521185311854118551185611857118581185911860118611186211863118641186511866118671186811869118701187111872118731187411875118761187711878118791188011881118821188311884118851188611887118881188911890118911189211893118941189511896118971189811899119001190111902119031190411905119061190711908119091191011911119121191311914119151191611917119181191911920119211192211923119241192511926119271192811929119301193111932119331193411935119361193711938119391194011941119421194311944119451194611947119481194911950119511195211953119541195511956119571195811959119601196111962119631196411965119661196711968119691197011971119721197311974119751197611977119781197911980119811198211983119841198511986119871198811989119901199111992119931199411995119961199711998119991200012001120021200312004120051200612007120081200912010120111201212013120141201512016120171201812019120201202112022120231202412025120261202712028120291203012031120321203312034120351203612037120381203912040120411204212043120441204512046120471204812049120501205112052120531205412055120561205712058120591206012061120621206312064120651206612067120681206912070120711207212073120741207512076120771207812079120801208112082120831208412085120861208712088120891209012091120921209312094120951209612097120981209912100121011210212103121041210512106121071210812109121101211112112121131211412115121161211712118121191212012121121221212312124121251212612127121281212912130121311213212133121341213512136121371213812139121401214112142121431214412145121461214712148121491215012151121521215312154121551215612157121581215912160121611216212163121641216512166121671216812169121701217112172121731217412175121761217712178121791218012181121821218312184121851218612187121881218912190121911219212193121941219512196121971219812199122001220112202122031220412205122061220712208122091221012211122121221312214122151221612217122181221912220122211222212223122241222512226122271222812229122301223112232122331223412235122361223712238122391224012241122421224312244122451224612247122481224912250122511225212253122541225512256122571225812259122601226112262122631226412265122661226712268122691227012271122721227312274122751227612277122781227912280122811228212283122841228512286122871228812289122901229112292122931229412295122961229712298122991230012301123021230312304123051230612307123081230912310123111231212313123141231512316123171231812319123201232112322123231232412325123261232712328123291233012331123321233312334123351233612337123381233912340123411234212343123441234512346123471234812349123501235112352123531235412355123561235712358123591236012361123621236312364123651236612367123681236912370123711237212373123741237512376123771237812379123801238112382123831238412385123861238712388123891239012391123921239312394123951239612397123981239912400124011240212403124041240512406124071240812409124101241112412124131241412415124161241712418124191242012421124221242312424124251242612427124281242912430124311243212433124341243512436124371243812439124401244112442124431244412445124461244712448124491245012451124521245312454124551245612457124581245912460124611246212463124641246512466124671246812469124701247112472124731247412475124761247712478124791248012481124821248312484124851248612487124881248912490124911249212493124941249512496124971249812499125001250112502125031250412505125061250712508125091251012511125121251312514125151251612517125181251912520125211252212523125241252512526125271252812529125301253112532125331253412535125361253712538125391254012541125421254312544125451254612547125481254912550125511255212553125541255512556125571255812559125601256112562125631256412565125661256712568125691257012571125721257312574125751257612577125781257912580125811258212583125841258512586125871258812589125901259112592125931259412595125961259712598125991260012601126021260312604126051260612607126081260912610126111261212613126141261512616126171261812619126201262112622126231262412625126261262712628126291263012631126321263312634126351263612637126381263912640126411264212643126441264512646126471264812649126501265112652126531265412655126561265712658126591266012661126621266312664126651266612667126681266912670126711267212673126741267512676126771267812679126801268112682126831268412685126861268712688126891269012691126921269312694126951269612697126981269912700127011270212703127041270512706127071270812709127101271112712127131271412715127161271712718127191272012721127221272312724127251272612727127281272912730127311273212733127341273512736127371273812739127401274112742127431274412745127461274712748127491275012751127521275312754127551275612757127581275912760127611276212763127641276512766127671276812769127701277112772127731277412775127761277712778127791278012781127821278312784127851278612787127881278912790127911279212793127941279512796127971279812799128001280112802128031280412805128061280712808128091281012811128121281312814128151281612817128181281912820128211282212823128241282512826128271282812829128301283112832128331283412835128361283712838128391284012841128421284312844128451284612847128481284912850128511285212853128541285512856128571285812859128601286112862128631286412865128661286712868128691287012871128721287312874128751287612877128781287912880128811288212883128841288512886128871288812889128901289112892128931289412895128961289712898128991290012901129021290312904129051290612907129081290912910129111291212913129141291512916129171291812919129201292112922129231292412925129261292712928129291293012931129321293312934129351293612937129381293912940129411294212943129441294512946129471294812949129501295112952129531295412955129561295712958129591296012961129621296312964129651296612967129681296912970129711297212973129741297512976129771297812979129801298112982129831298412985129861298712988129891299012991129921299312994129951299612997129981299913000130011300213003130041300513006130071300813009130101301113012130131301413015130161301713018130191302013021130221302313024130251302613027130281302913030130311303213033130341303513036130371303813039130401304113042130431304413045130461304713048130491305013051130521305313054130551305613057130581305913060130611306213063130641306513066130671306813069130701307113072130731307413075130761307713078130791308013081130821308313084130851308613087130881308913090130911309213093130941309513096130971309813099131001310113102131031310413105131061310713108131091311013111131121311313114131151311613117131181311913120131211312213123131241312513126131271312813129131301313113132131331313413135131361313713138131391314013141131421314313144131451314613147131481314913150131511315213153131541315513156131571315813159131601316113162131631316413165131661316713168131691317013171131721317313174131751317613177131781317913180131811318213183131841318513186131871318813189131901319113192131931319413195131961319713198131991320013201132021320313204132051320613207132081320913210132111321213213132141321513216132171321813219132201322113222132231322413225132261322713228132291323013231132321323313234132351323613237132381323913240132411324213243132441324513246132471324813249132501325113252132531325413255132561325713258132591326013261132621326313264132651326613267132681326913270132711327213273132741327513276132771327813279132801328113282132831328413285132861328713288132891329013291132921329313294132951329613297132981329913300133011330213303133041330513306133071330813309133101331113312133131331413315133161331713318133191332013321133221332313324133251332613327133281332913330133311333213333133341333513336133371333813339133401334113342133431334413345133461334713348133491335013351133521335313354133551335613357133581335913360133611336213363133641336513366133671336813369133701337113372133731337413375133761337713378133791338013381133821338313384133851338613387133881338913390133911339213393133941339513396133971339813399134001340113402134031340413405134061340713408134091341013411134121341313414134151341613417134181341913420134211342213423134241342513426134271342813429134301343113432134331343413435134361343713438134391344013441134421344313444134451344613447134481344913450134511345213453134541345513456134571345813459134601346113462134631346413465134661346713468134691347013471134721347313474134751347613477134781347913480134811348213483134841348513486134871348813489134901349113492134931349413495134961349713498134991350013501135021350313504135051350613507135081350913510135111351213513135141351513516135171351813519135201352113522135231352413525135261352713528135291353013531135321353313534135351353613537135381353913540135411354213543135441354513546135471354813549135501355113552135531355413555135561355713558135591356013561135621356313564135651356613567135681356913570135711357213573135741357513576135771357813579135801358113582135831358413585135861358713588135891359013591135921359313594135951359613597135981359913600136011360213603136041360513606136071360813609136101361113612136131361413615136161361713618136191362013621136221362313624136251362613627136281362913630136311363213633136341363513636136371363813639136401364113642136431364413645136461364713648136491365013651136521365313654136551365613657136581365913660136611366213663136641366513666136671366813669136701367113672136731367413675136761367713678136791368013681136821368313684136851368613687136881368913690136911369213693136941369513696136971369813699137001370113702137031370413705137061370713708137091371013711137121371313714137151371613717137181371913720137211372213723137241372513726137271372813729137301373113732137331373413735137361373713738137391374013741137421374313744137451374613747137481374913750137511375213753137541375513756137571375813759137601376113762137631376413765137661376713768137691377013771137721377313774137751377613777137781377913780137811378213783137841378513786137871378813789137901379113792137931379413795137961379713798137991380013801138021380313804138051380613807138081380913810138111381213813138141381513816138171381813819138201382113822138231382413825138261382713828138291383013831138321383313834138351383613837138381383913840138411384213843138441384513846138471384813849138501385113852138531385413855138561385713858138591386013861138621386313864138651386613867138681386913870138711387213873138741387513876138771387813879138801388113882138831388413885138861388713888138891389013891138921389313894138951389613897138981389913900139011390213903139041390513906139071390813909139101391113912139131391413915139161391713918139191392013921139221392313924139251392613927139281392913930139311393213933139341393513936139371393813939139401394113942139431394413945139461394713948139491395013951139521395313954139551395613957139581395913960139611396213963139641396513966139671396813969139701397113972139731397413975139761397713978139791398013981139821398313984139851398613987139881398913990139911399213993139941399513996139971399813999140001400114002140031400414005140061400714008140091401014011140121401314014140151401614017140181401914020140211402214023140241402514026140271402814029140301403114032140331403414035140361403714038140391404014041140421404314044140451404614047140481404914050140511405214053140541405514056140571405814059140601406114062140631406414065140661406714068140691407014071140721407314074140751407614077140781407914080140811408214083140841408514086140871408814089140901409114092140931409414095140961409714098140991410014101141021410314104141051410614107141081410914110141111411214113141141411514116141171411814119141201412114122141231412414125141261412714128141291413014131141321413314134141351413614137141381413914140141411414214143141441414514146141471414814149141501415114152141531415414155141561415714158141591416014161141621416314164141651416614167141681416914170141711417214173141741417514176141771417814179141801418114182141831418414185141861418714188141891419014191141921419314194141951419614197141981419914200142011420214203142041420514206142071420814209142101421114212142131421414215142161421714218142191422014221142221422314224142251422614227142281422914230142311423214233142341423514236142371423814239142401424114242142431424414245142461424714248142491425014251142521425314254142551425614257142581425914260142611426214263142641426514266142671426814269142701427114272142731427414275142761427714278142791428014281142821428314284142851428614287142881428914290142911429214293142941429514296142971429814299143001430114302143031430414305143061430714308143091431014311143121431314314143151431614317143181431914320143211432214323143241432514326143271432814329143301433114332143331433414335143361433714338143391434014341143421434314344143451434614347143481434914350143511435214353143541435514356143571435814359143601436114362143631436414365143661436714368143691437014371143721437314374143751437614377143781437914380143811438214383143841438514386143871438814389143901439114392143931439414395143961439714398143991440014401144021440314404144051440614407144081440914410144111441214413144141441514416144171441814419144201442114422144231442414425144261442714428144291443014431144321443314434144351443614437144381443914440144411444214443144441444514446144471444814449144501445114452144531445414455144561445714458144591446014461144621446314464144651446614467144681446914470144711447214473144741447514476144771447814479144801448114482144831448414485144861448714488144891449014491144921449314494144951449614497144981449914500145011450214503145041450514506145071450814509145101451114512145131451414515145161451714518145191452014521145221452314524145251452614527145281452914530145311453214533145341453514536145371453814539145401454114542145431454414545145461454714548145491455014551145521455314554145551455614557145581455914560145611456214563145641456514566145671456814569145701457114572145731457414575145761457714578145791458014581145821458314584145851458614587145881458914590145911459214593145941459514596145971459814599146001460114602146031460414605146061460714608146091461014611146121461314614146151461614617146181461914620146211462214623146241462514626146271462814629146301463114632146331463414635146361463714638146391464014641146421464314644146451464614647146481464914650146511465214653146541465514656146571465814659146601466114662146631466414665146661466714668146691467014671146721467314674146751467614677146781467914680146811468214683146841468514686146871468814689146901469114692146931469414695146961469714698146991470014701147021470314704147051470614707147081470914710147111471214713147141471514716147171471814719147201472114722147231472414725147261472714728147291473014731147321473314734147351473614737147381473914740147411474214743147441474514746147471474814749147501475114752147531475414755147561475714758147591476014761147621476314764147651476614767147681476914770147711477214773147741477514776147771477814779147801478114782147831478414785147861478714788147891479014791147921479314794147951479614797147981479914800148011480214803148041480514806148071480814809148101481114812148131481414815148161481714818148191482014821148221482314824148251482614827148281482914830148311483214833148341483514836148371483814839148401484114842148431484414845148461484714848148491485014851148521485314854148551485614857148581485914860148611486214863148641486514866148671486814869148701487114872148731487414875148761487714878148791488014881148821488314884148851488614887148881488914890148911489214893148941489514896148971489814899149001490114902149031490414905149061490714908149091491014911149121491314914149151491614917149181491914920149211492214923149241492514926149271492814929149301493114932149331493414935149361493714938149391494014941149421494314944149451494614947149481494914950149511495214953149541495514956149571495814959149601496114962149631496414965149661496714968149691497014971149721497314974149751497614977149781497914980149811498214983149841498514986149871498814989149901499114992149931499414995149961499714998149991500015001150021500315004150051500615007150081500915010150111501215013150141501515016150171501815019150201502115022150231502415025150261502715028150291503015031150321503315034150351503615037150381503915040150411504215043150441504515046150471504815049150501505115052150531505415055150561505715058150591506015061150621506315064150651506615067150681506915070150711507215073150741507515076150771507815079150801508115082150831508415085150861508715088150891509015091150921509315094150951509615097150981509915100151011510215103151041510515106151071510815109151101511115112151131511415115151161511715118151191512015121151221512315124151251512615127151281512915130151311513215133151341513515136151371513815139151401514115142151431514415145151461514715148151491515015151151521515315154151551515615157151581515915160151611516215163151641516515166151671516815169151701517115172151731517415175151761517715178151791518015181151821518315184151851518615187151881518915190151911519215193151941519515196151971519815199152001520115202152031520415205152061520715208152091521015211152121521315214152151521615217152181521915220152211522215223152241522515226152271522815229152301523115232152331523415235152361523715238152391524015241152421524315244152451524615247152481524915250152511525215253152541525515256152571525815259152601526115262152631526415265152661526715268152691527015271152721527315274152751527615277152781527915280152811528215283152841528515286152871528815289152901529115292152931529415295152961529715298152991530015301153021530315304153051530615307153081530915310153111531215313153141531515316153171531815319153201532115322153231532415325153261532715328153291533015331153321533315334153351533615337153381533915340153411534215343153441534515346153471534815349153501535115352153531535415355153561535715358153591536015361153621536315364153651536615367153681536915370153711537215373153741537515376153771537815379153801538115382153831538415385153861538715388153891539015391153921539315394153951539615397153981539915400154011540215403154041540515406154071540815409154101541115412154131541415415154161541715418154191542015421154221542315424154251542615427154281542915430154311543215433154341543515436154371543815439154401544115442154431544415445154461544715448154491545015451154521545315454154551545615457154581545915460154611546215463154641546515466154671546815469154701547115472154731547415475154761547715478154791548015481154821548315484154851548615487154881548915490154911549215493154941549515496154971549815499155001550115502155031550415505155061550715508155091551015511155121551315514155151551615517155181551915520155211552215523155241552515526155271552815529155301553115532155331553415535155361553715538155391554015541155421554315544155451554615547155481554915550155511555215553155541555515556155571555815559155601556115562155631556415565155661556715568155691557015571155721557315574155751557615577155781557915580155811558215583155841558515586155871558815589155901559115592155931559415595155961559715598155991560015601156021560315604156051560615607156081560915610156111561215613156141561515616156171561815619156201562115622156231562415625156261562715628156291563015631156321563315634156351563615637156381563915640156411564215643156441564515646156471564815649156501565115652156531565415655156561565715658156591566015661156621566315664156651566615667156681566915670156711567215673156741567515676156771567815679156801568115682156831568415685156861568715688156891569015691156921569315694156951569615697156981569915700157011570215703157041570515706157071570815709157101571115712157131571415715157161571715718157191572015721157221572315724157251572615727157281572915730157311573215733157341573515736157371573815739157401574115742157431574415745157461574715748157491575015751157521575315754157551575615757157581575915760157611576215763157641576515766157671576815769157701577115772157731577415775157761577715778157791578015781157821578315784157851578615787157881578915790157911579215793157941579515796157971579815799158001580115802158031580415805158061580715808158091581015811158121581315814158151581615817158181581915820158211582215823158241582515826158271582815829158301583115832158331583415835158361583715838158391584015841158421584315844158451584615847158481584915850158511585215853158541585515856158571585815859158601586115862158631586415865158661586715868158691587015871158721587315874158751587615877158781587915880158811588215883158841588515886158871588815889158901589115892158931589415895158961589715898158991590015901159021590315904159051590615907159081590915910159111591215913159141591515916159171591815919159201592115922159231592415925159261592715928159291593015931159321593315934159351593615937159381593915940159411594215943159441594515946159471594815949159501595115952159531595415955159561595715958159591596015961159621596315964159651596615967159681596915970159711597215973159741597515976159771597815979159801598115982159831598415985159861598715988159891599015991159921599315994159951599615997159981599916000160011600216003160041600516006160071600816009160101601116012160131601416015160161601716018160191602016021160221602316024160251602616027160281602916030160311603216033160341603516036160371603816039160401604116042160431604416045160461604716048160491605016051160521605316054160551605616057160581605916060160611606216063160641606516066160671606816069160701607116072160731607416075160761607716078160791608016081160821608316084160851608616087160881608916090160911609216093160941609516096160971609816099161001610116102161031610416105161061610716108161091611016111161121611316114161151611616117161181611916120161211612216123161241612516126161271612816129161301613116132161331613416135161361613716138161391614016141161421614316144161451614616147161481614916150161511615216153161541615516156161571615816159161601616116162161631616416165161661616716168161691617016171161721617316174161751617616177161781617916180161811618216183161841618516186161871618816189161901619116192161931619416195161961619716198161991620016201162021620316204162051620616207162081620916210162111621216213162141621516216162171621816219162201622116222162231622416225162261622716228162291623016231162321623316234162351623616237162381623916240162411624216243162441624516246162471624816249162501625116252162531625416255162561625716258162591626016261162621626316264162651626616267162681626916270162711627216273162741627516276162771627816279162801628116282162831628416285162861628716288162891629016291162921629316294162951629616297162981629916300163011630216303163041630516306163071630816309163101631116312163131631416315163161631716318163191632016321163221632316324163251632616327163281632916330163311633216333163341633516336163371633816339163401634116342163431634416345163461634716348163491635016351163521635316354163551635616357163581635916360163611636216363163641636516366163671636816369163701637116372163731637416375163761637716378163791638016381163821638316384163851638616387163881638916390163911639216393163941639516396163971639816399164001640116402164031640416405164061640716408164091641016411164121641316414164151641616417164181641916420164211642216423164241642516426164271642816429164301643116432164331643416435164361643716438164391644016441164421644316444164451644616447164481644916450164511645216453164541645516456164571645816459164601646116462164631646416465164661646716468164691647016471164721647316474164751647616477164781647916480164811648216483164841648516486164871648816489164901649116492164931649416495164961649716498164991650016501165021650316504165051650616507165081650916510165111651216513165141651516516165171651816519165201652116522165231652416525165261652716528165291653016531165321653316534165351653616537165381653916540165411654216543165441654516546165471654816549165501655116552165531655416555165561655716558165591656016561165621656316564165651656616567165681656916570165711657216573165741657516576165771657816579165801658116582165831658416585165861658716588165891659016591165921659316594165951659616597165981659916600166011660216603166041660516606166071660816609166101661116612166131661416615166161661716618166191662016621166221662316624166251662616627166281662916630166311663216633166341663516636166371663816639166401664116642166431664416645166461664716648166491665016651166521665316654166551665616657166581665916660166611666216663166641666516666166671666816669166701667116672166731667416675166761667716678166791668016681166821668316684166851668616687166881668916690166911669216693166941669516696166971669816699167001670116702167031670416705167061670716708167091671016711167121671316714167151671616717167181671916720167211672216723167241672516726167271672816729167301673116732167331673416735167361673716738167391674016741167421674316744167451674616747167481674916750167511675216753167541675516756167571675816759167601676116762167631676416765167661676716768167691677016771167721677316774167751677616777167781677916780167811678216783167841678516786167871678816789167901679116792167931679416795167961679716798167991680016801168021680316804168051680616807168081680916810168111681216813168141681516816168171681816819168201682116822168231682416825168261682716828168291683016831168321683316834168351683616837168381683916840168411684216843168441684516846168471684816849168501685116852168531685416855168561685716858168591686016861168621686316864168651686616867168681686916870168711687216873168741687516876168771687816879168801688116882168831688416885168861688716888168891689016891168921689316894168951689616897168981689916900169011690216903169041690516906169071690816909169101691116912169131691416915169161691716918169191692016921169221692316924169251692616927169281692916930169311693216933169341693516936169371693816939169401694116942169431694416945169461694716948169491695016951169521695316954169551695616957169581695916960169611696216963169641696516966169671696816969169701697116972169731697416975169761697716978169791698016981169821698316984169851698616987169881698916990169911699216993169941699516996169971699816999170001700117002170031700417005170061700717008170091701017011170121701317014170151701617017170181701917020170211702217023170241702517026170271702817029170301703117032170331703417035170361703717038170391704017041170421704317044170451704617047170481704917050170511705217053170541705517056170571705817059170601706117062170631706417065170661706717068170691707017071170721707317074170751707617077170781707917080170811708217083170841708517086170871708817089170901709117092170931709417095170961709717098170991710017101171021710317104171051710617107171081710917110171111711217113171141711517116171171711817119171201712117122171231712417125171261712717128171291713017131171321713317134171351713617137171381713917140171411714217143171441714517146171471714817149171501715117152171531715417155171561715717158171591716017161171621716317164171651716617167171681716917170171711717217173171741717517176171771717817179171801718117182171831718417185171861718717188171891719017191171921719317194171951719617197171981719917200172011720217203172041720517206172071720817209172101721117212172131721417215172161721717218172191722017221172221722317224172251722617227172281722917230172311723217233172341723517236172371723817239172401724117242172431724417245172461724717248172491725017251172521725317254172551725617257172581725917260172611726217263172641726517266172671726817269172701727117272172731727417275172761727717278172791728017281172821728317284172851728617287172881728917290172911729217293172941729517296172971729817299173001730117302173031730417305173061730717308173091731017311173121731317314173151731617317173181731917320173211732217323173241732517326173271732817329173301733117332173331733417335173361733717338173391734017341173421734317344173451734617347173481734917350173511735217353173541735517356173571735817359173601736117362173631736417365173661736717368173691737017371173721737317374173751737617377173781737917380173811738217383173841738517386173871738817389173901739117392173931739417395173961739717398173991740017401174021740317404174051740617407174081740917410174111741217413174141741517416174171741817419174201742117422174231742417425174261742717428174291743017431174321743317434174351743617437174381743917440174411744217443174441744517446174471744817449174501745117452174531745417455174561745717458174591746017461174621746317464174651746617467174681746917470174711747217473174741747517476174771747817479174801748117482174831748417485174861748717488174891749017491174921749317494174951749617497174981749917500175011750217503175041750517506175071750817509175101751117512175131751417515175161751717518175191752017521175221752317524175251752617527175281752917530175311753217533175341753517536175371753817539175401754117542175431754417545175461754717548175491755017551175521755317554175551755617557175581755917560175611756217563175641756517566175671756817569175701757117572175731757417575175761757717578175791758017581175821758317584175851758617587175881758917590175911759217593175941759517596175971759817599176001760117602176031760417605176061760717608176091761017611176121761317614176151761617617176181761917620176211762217623176241762517626176271762817629176301763117632176331763417635176361763717638176391764017641176421764317644176451764617647176481764917650176511765217653176541765517656176571765817659176601766117662176631766417665176661766717668176691767017671176721767317674176751767617677176781767917680176811768217683176841768517686176871768817689176901769117692176931769417695176961769717698176991770017701177021770317704177051770617707177081770917710177111771217713177141771517716177171771817719177201772117722177231772417725177261772717728177291773017731177321773317734177351773617737177381773917740177411774217743177441774517746177471774817749177501775117752177531775417755177561775717758177591776017761177621776317764177651776617767177681776917770177711777217773177741777517776177771777817779177801778117782177831778417785177861778717788177891779017791177921779317794177951779617797177981779917800178011780217803178041780517806178071780817809178101781117812178131781417815178161781717818178191782017821178221782317824178251782617827178281782917830178311783217833178341783517836178371783817839178401784117842178431784417845178461784717848178491785017851178521785317854178551785617857178581785917860178611786217863178641786517866178671786817869178701787117872178731787417875178761787717878178791788017881178821788317884178851788617887178881788917890178911789217893178941789517896178971789817899179001790117902179031790417905179061790717908179091791017911179121791317914179151791617917179181791917920179211792217923179241792517926179271792817929179301793117932179331793417935179361793717938179391794017941179421794317944179451794617947179481794917950179511795217953179541795517956179571795817959179601796117962179631796417965179661796717968179691797017971179721797317974179751797617977179781797917980179811798217983179841798517986179871798817989179901799117992179931799417995179961799717998179991800018001180021800318004180051800618007180081800918010180111801218013180141801518016180171801818019180201802118022180231802418025180261802718028180291803018031180321803318034180351803618037180381803918040180411804218043180441804518046180471804818049180501805118052180531805418055180561805718058180591806018061180621806318064180651806618067180681806918070180711807218073180741807518076180771807818079180801808118082180831808418085180861808718088180891809018091180921809318094180951809618097180981809918100181011810218103181041810518106181071810818109181101811118112181131811418115181161811718118181191812018121181221812318124181251812618127181281812918130181311813218133181341813518136181371813818139181401814118142181431814418145181461814718148181491815018151181521815318154181551815618157181581815918160181611816218163181641816518166181671816818169181701817118172181731817418175181761817718178181791818018181181821818318184181851818618187181881818918190181911819218193181941819518196181971819818199182001820118202182031820418205182061820718208182091821018211182121821318214182151821618217182181821918220182211822218223182241822518226182271822818229182301823118232182331823418235182361823718238182391824018241182421824318244182451824618247182481824918250182511825218253182541825518256182571825818259182601826118262182631826418265182661826718268182691827018271182721827318274182751827618277182781827918280182811828218283182841828518286182871828818289182901829118292182931829418295182961829718298182991830018301183021830318304183051830618307183081830918310183111831218313183141831518316183171831818319183201832118322183231832418325183261832718328183291833018331183321833318334183351833618337183381833918340183411834218343183441834518346183471834818349183501835118352183531835418355183561835718358183591836018361183621836318364183651836618367183681836918370183711837218373183741837518376183771837818379183801838118382183831838418385183861838718388183891839018391183921839318394183951839618397183981839918400184011840218403184041840518406184071840818409184101841118412184131841418415184161841718418184191842018421184221842318424184251842618427184281842918430184311843218433184341843518436184371843818439184401844118442184431844418445184461844718448184491845018451184521845318454184551845618457184581845918460184611846218463184641846518466184671846818469184701847118472184731847418475184761847718478184791848018481184821848318484184851848618487184881848918490184911849218493184941849518496184971849818499185001850118502185031850418505185061850718508185091851018511185121851318514185151851618517185181851918520185211852218523185241852518526185271852818529185301853118532185331853418535185361853718538185391854018541185421854318544185451854618547185481854918550185511855218553185541855518556185571855818559185601856118562185631856418565185661856718568185691857018571185721857318574185751857618577185781857918580185811858218583185841858518586185871858818589185901859118592185931859418595185961859718598185991860018601186021860318604186051860618607186081860918610186111861218613186141861518616186171861818619186201862118622186231862418625186261862718628186291863018631186321863318634186351863618637186381863918640186411864218643186441864518646186471864818649186501865118652186531865418655186561865718658186591866018661186621866318664186651866618667186681866918670186711867218673186741867518676186771867818679186801868118682186831868418685186861868718688186891869018691186921869318694186951869618697186981869918700187011870218703187041870518706187071870818709187101871118712187131871418715187161871718718187191872018721187221872318724187251872618727187281872918730187311873218733187341873518736187371873818739187401874118742187431874418745187461874718748187491875018751187521875318754187551875618757187581875918760187611876218763187641876518766187671876818769187701877118772187731877418775187761877718778187791878018781187821878318784187851878618787187881878918790187911879218793187941879518796187971879818799188001880118802188031880418805188061880718808188091881018811188121881318814188151881618817188181881918820188211882218823188241882518826188271882818829188301883118832188331883418835188361883718838188391884018841188421884318844188451884618847188481884918850188511885218853188541885518856188571885818859188601886118862188631886418865188661886718868188691887018871188721887318874188751887618877188781887918880188811888218883188841888518886188871888818889188901889118892188931889418895188961889718898188991890018901189021890318904189051890618907189081890918910189111891218913189141891518916189171891818919189201892118922189231892418925189261892718928189291893018931189321893318934189351893618937189381893918940189411894218943189441894518946189471894818949189501895118952189531895418955189561895718958189591896018961189621896318964189651896618967189681896918970189711897218973189741897518976189771897818979189801898118982189831898418985189861898718988189891899018991189921899318994189951899618997189981899919000190011900219003190041900519006190071900819009190101901119012190131901419015190161901719018190191902019021190221902319024190251902619027190281902919030190311903219033190341903519036190371903819039190401904119042190431904419045190461904719048190491905019051190521905319054190551905619057190581905919060190611906219063190641906519066190671906819069190701907119072190731907419075190761907719078190791908019081190821908319084190851908619087190881908919090190911909219093190941909519096190971909819099191001910119102191031910419105191061910719108191091911019111191121911319114191151911619117191181911919120191211912219123191241912519126191271912819129191301913119132191331913419135191361913719138191391914019141191421914319144191451914619147191481914919150191511915219153191541915519156191571915819159191601916119162191631916419165191661916719168191691917019171191721917319174191751917619177191781917919180191811918219183191841918519186191871918819189191901919119192191931919419195191961919719198191991920019201192021920319204192051920619207192081920919210192111921219213192141921519216192171921819219192201922119222192231922419225192261922719228192291923019231192321923319234192351923619237192381923919240192411924219243192441924519246192471924819249192501925119252192531925419255192561925719258192591926019261192621926319264192651926619267192681926919270192711927219273192741927519276192771927819279192801928119282192831928419285192861928719288192891929019291192921929319294192951929619297192981929919300193011930219303193041930519306193071930819309193101931119312193131931419315193161931719318193191932019321193221932319324193251932619327193281932919330193311933219333193341933519336193371933819339193401934119342193431934419345193461934719348193491935019351193521935319354193551935619357193581935919360193611936219363193641936519366193671936819369193701937119372193731937419375193761937719378193791938019381193821938319384193851938619387193881938919390193911939219393193941939519396193971939819399194001940119402194031940419405194061940719408194091941019411194121941319414194151941619417194181941919420194211942219423194241942519426194271942819429194301943119432194331943419435194361943719438194391944019441194421944319444194451944619447194481944919450194511945219453194541945519456194571945819459194601946119462194631946419465194661946719468194691947019471194721947319474194751947619477194781947919480194811948219483194841948519486194871948819489194901949119492194931949419495194961949719498194991950019501195021950319504195051950619507195081950919510195111951219513195141951519516195171951819519195201952119522195231952419525195261952719528195291953019531195321953319534195351953619537195381953919540195411954219543195441954519546195471954819549195501955119552195531955419555195561955719558195591956019561195621956319564195651956619567195681956919570195711957219573195741957519576195771957819579195801958119582195831958419585195861958719588195891959019591195921959319594195951959619597195981959919600196011960219603196041960519606196071960819609196101961119612196131961419615196161961719618196191962019621196221962319624196251962619627196281962919630196311963219633196341963519636196371963819639196401964119642196431964419645196461964719648196491965019651196521965319654196551965619657196581965919660196611966219663196641966519666196671966819669196701967119672196731967419675196761967719678196791968019681196821968319684196851968619687196881968919690196911969219693196941969519696196971969819699197001970119702197031970419705197061970719708197091971019711197121971319714197151971619717197181971919720197211972219723197241972519726197271972819729197301973119732197331973419735197361973719738197391974019741197421974319744197451974619747197481974919750197511975219753197541975519756197571975819759197601976119762197631976419765197661976719768197691977019771197721977319774197751977619777197781977919780197811978219783197841978519786197871978819789197901979119792197931979419795197961979719798197991980019801198021980319804198051980619807198081980919810198111981219813198141981519816198171981819819198201982119822198231982419825198261982719828198291983019831198321983319834198351983619837198381983919840198411984219843198441984519846198471984819849198501985119852198531985419855198561985719858198591986019861198621986319864198651986619867198681986919870198711987219873198741987519876198771987819879198801988119882198831988419885198861988719888198891989019891198921989319894198951989619897198981989919900199011990219903199041990519906199071990819909199101991119912199131991419915199161991719918199191992019921199221992319924199251992619927199281992919930199311993219933199341993519936199371993819939199401994119942199431994419945199461994719948199491995019951199521995319954199551995619957199581995919960199611996219963199641996519966199671996819969199701997119972199731997419975199761997719978199791998019981199821998319984199851998619987199881998919990199911999219993199941999519996199971999819999200002000120002200032000420005200062000720008200092001020011200122001320014200152001620017200182001920020200212002220023200242002520026200272002820029200302003120032200332003420035200362003720038200392004020041200422004320044200452004620047200482004920050200512005220053200542005520056200572005820059200602006120062200632006420065200662006720068200692007020071200722007320074200752007620077200782007920080200812008220083200842008520086200872008820089200902009120092200932009420095200962009720098200992010020101201022010320104201052010620107201082010920110201112011220113201142011520116201172011820119201202012120122201232012420125201262012720128201292013020131201322013320134201352013620137201382013920140201412014220143201442014520146201472014820149201502015120152201532015420155201562015720158201592016020161201622016320164201652016620167201682016920170201712017220173201742017520176201772017820179201802018120182201832018420185201862018720188201892019020191201922019320194201952019620197201982019920200202012020220203202042020520206202072020820209202102021120212202132021420215202162021720218202192022020221202222022320224202252022620227202282022920230202312023220233202342023520236202372023820239202402024120242202432024420245202462024720248202492025020251202522025320254202552025620257202582025920260202612026220263202642026520266202672026820269202702027120272202732027420275202762027720278202792028020281202822028320284202852028620287202882028920290202912029220293202942029520296202972029820299203002030120302203032030420305203062030720308203092031020311203122031320314203152031620317203182031920320203212032220323203242032520326203272032820329203302033120332203332033420335203362033720338203392034020341203422034320344203452034620347203482034920350203512035220353203542035520356203572035820359203602036120362203632036420365203662036720368203692037020371203722037320374203752037620377203782037920380203812038220383203842038520386203872038820389203902039120392203932039420395203962039720398203992040020401204022040320404204052040620407204082040920410204112041220413204142041520416204172041820419204202042120422204232042420425204262042720428204292043020431204322043320434204352043620437204382043920440204412044220443204442044520446204472044820449204502045120452204532045420455204562045720458204592046020461204622046320464204652046620467204682046920470204712047220473204742047520476204772047820479204802048120482204832048420485204862048720488204892049020491204922049320494204952049620497204982049920500205012050220503205042050520506205072050820509205102051120512205132051420515205162051720518205192052020521205222052320524205252052620527205282052920530205312053220533205342053520536205372053820539205402054120542205432054420545205462054720548205492055020551205522055320554205552055620557205582055920560205612056220563205642056520566205672056820569205702057120572205732057420575205762057720578205792058020581205822058320584205852058620587205882058920590205912059220593205942059520596205972059820599206002060120602206032060420605206062060720608206092061020611206122061320614206152061620617206182061920620206212062220623206242062520626206272062820629206302063120632206332063420635206362063720638206392064020641206422064320644206452064620647206482064920650206512065220653206542065520656206572065820659206602066120662206632066420665206662066720668206692067020671206722067320674206752067620677206782067920680206812068220683206842068520686206872068820689206902069120692206932069420695206962069720698206992070020701207022070320704207052070620707207082070920710207112071220713207142071520716207172071820719207202072120722207232072420725207262072720728207292073020731207322073320734207352073620737207382073920740207412074220743207442074520746207472074820749207502075120752207532075420755207562075720758207592076020761207622076320764207652076620767207682076920770207712077220773207742077520776207772077820779207802078120782207832078420785207862078720788207892079020791207922079320794207952079620797207982079920800208012080220803208042080520806208072080820809208102081120812208132081420815208162081720818208192082020821208222082320824208252082620827208282082920830208312083220833208342083520836208372083820839208402084120842208432084420845208462084720848208492085020851208522085320854208552085620857208582085920860208612086220863208642086520866208672086820869208702087120872208732087420875208762087720878208792088020881208822088320884208852088620887208882088920890208912089220893208942089520896208972089820899209002090120902209032090420905209062090720908209092091020911209122091320914209152091620917209182091920920209212092220923209242092520926209272092820929209302093120932209332093420935209362093720938209392094020941209422094320944209452094620947209482094920950209512095220953209542095520956209572095820959209602096120962209632096420965209662096720968209692097020971209722097320974209752097620977209782097920980209812098220983209842098520986209872098820989209902099120992209932099420995209962099720998209992100021001210022100321004210052100621007210082100921010210112101221013210142101521016210172101821019210202102121022210232102421025210262102721028210292103021031210322103321034210352103621037210382103921040210412104221043210442104521046210472104821049210502105121052210532105421055210562105721058210592106021061210622106321064210652106621067210682106921070210712107221073210742107521076210772107821079210802108121082210832108421085210862108721088210892109021091210922109321094210952109621097210982109921100211012110221103211042110521106211072110821109211102111121112211132111421115211162111721118211192112021121211222112321124211252112621127211282112921130211312113221133211342113521136211372113821139211402114121142211432114421145211462114721148211492115021151211522115321154211552115621157211582115921160211612116221163211642116521166211672116821169211702117121172211732117421175211762117721178211792118021181211822118321184211852118621187211882118921190211912119221193211942119521196211972119821199212002120121202212032120421205212062120721208212092121021211212122121321214212152121621217212182121921220212212122221223212242122521226212272122821229212302123121232212332123421235212362123721238212392124021241212422124321244212452124621247212482124921250212512125221253212542125521256212572125821259212602126121262212632126421265212662126721268212692127021271212722127321274212752127621277212782127921280212812128221283212842128521286212872128821289212902129121292212932129421295212962129721298212992130021301213022130321304213052130621307213082130921310213112131221313213142131521316213172131821319213202132121322213232132421325213262132721328213292133021331213322133321334213352133621337213382133921340213412134221343213442134521346213472134821349213502135121352213532135421355213562135721358213592136021361213622136321364213652136621367213682136921370213712137221373213742137521376213772137821379213802138121382213832138421385213862138721388213892139021391213922139321394213952139621397213982139921400214012140221403214042140521406214072140821409214102141121412214132141421415214162141721418214192142021421214222142321424214252142621427214282142921430214312143221433214342143521436214372143821439214402144121442214432144421445214462144721448214492145021451214522145321454214552145621457214582145921460214612146221463214642146521466214672146821469214702147121472214732147421475214762147721478214792148021481214822148321484214852148621487214882148921490214912149221493214942149521496214972149821499215002150121502215032150421505215062150721508215092151021511215122151321514215152151621517215182151921520215212152221523215242152521526215272152821529215302153121532215332153421535215362153721538215392154021541215422154321544215452154621547215482154921550215512155221553215542155521556215572155821559215602156121562215632156421565215662156721568215692157021571215722157321574215752157621577215782157921580215812158221583215842158521586215872158821589215902159121592215932159421595215962159721598215992160021601216022160321604216052160621607216082160921610216112161221613216142161521616216172161821619216202162121622216232162421625216262162721628216292163021631216322163321634216352163621637216382163921640216412164221643216442164521646216472164821649216502165121652216532165421655216562165721658216592166021661216622166321664216652166621667216682166921670216712167221673216742167521676216772167821679216802168121682216832168421685216862168721688216892169021691216922169321694216952169621697216982169921700217012170221703217042170521706217072170821709217102171121712217132171421715217162171721718217192172021721217222172321724217252172621727217282172921730217312173221733217342173521736217372173821739217402174121742217432174421745217462174721748217492175021751217522175321754217552175621757217582175921760217612176221763217642176521766217672176821769217702177121772217732177421775217762177721778217792178021781217822178321784217852178621787217882178921790217912179221793217942179521796217972179821799218002180121802218032180421805218062180721808218092181021811218122181321814218152181621817218182181921820218212182221823218242182521826218272182821829218302183121832218332183421835218362183721838218392184021841218422184321844218452184621847218482184921850218512185221853218542185521856218572185821859218602186121862218632186421865218662186721868218692187021871218722187321874218752187621877218782187921880218812188221883218842188521886218872188821889218902189121892218932189421895218962189721898218992190021901219022190321904219052190621907219082190921910219112191221913219142191521916219172191821919219202192121922219232192421925219262192721928219292193021931219322193321934219352193621937219382193921940219412194221943219442194521946219472194821949219502195121952219532195421955219562195721958219592196021961219622196321964219652196621967219682196921970219712197221973219742197521976219772197821979219802198121982219832198421985219862198721988219892199021991219922199321994219952199621997219982199922000220012200222003220042200522006220072200822009220102201122012220132201422015220162201722018220192202022021220222202322024220252202622027220282202922030220312203222033220342203522036220372203822039220402204122042220432204422045220462204722048220492205022051220522205322054220552205622057220582205922060220612206222063220642206522066220672206822069220702207122072220732207422075220762207722078220792208022081220822208322084220852208622087220882208922090220912209222093220942209522096220972209822099221002210122102221032210422105221062210722108221092211022111221122211322114221152211622117221182211922120221212212222123221242212522126221272212822129221302213122132221332213422135221362213722138221392214022141221422214322144221452214622147221482214922150221512215222153221542215522156221572215822159221602216122162221632216422165221662216722168221692217022171221722217322174221752217622177221782217922180221812218222183221842218522186221872218822189221902219122192221932219422195221962219722198221992220022201222022220322204222052220622207222082220922210222112221222213222142221522216222172221822219222202222122222222232222422225222262222722228222292223022231222322223322234222352223622237222382223922240222412224222243222442224522246222472224822249222502225122252222532225422255222562225722258222592226022261222622226322264222652226622267222682226922270222712227222273222742227522276222772227822279222802228122282222832228422285222862228722288222892229022291222922229322294222952229622297222982229922300223012230222303223042230522306223072230822309223102231122312223132231422315223162231722318223192232022321223222232322324223252232622327223282232922330223312233222333223342233522336223372233822339223402234122342223432234422345223462234722348223492235022351223522235322354223552235622357223582235922360223612236222363223642236522366223672236822369223702237122372223732237422375223762237722378223792238022381223822238322384223852238622387223882238922390223912239222393223942239522396223972239822399224002240122402224032240422405224062240722408224092241022411224122241322414224152241622417224182241922420224212242222423224242242522426224272242822429224302243122432224332243422435224362243722438224392244022441224422244322444224452244622447224482244922450224512245222453224542245522456224572245822459224602246122462224632246422465224662246722468224692247022471224722247322474224752247622477224782247922480224812248222483224842248522486224872248822489224902249122492224932249422495224962249722498224992250022501225022250322504225052250622507225082250922510225112251222513225142251522516225172251822519225202252122522225232252422525225262252722528225292253022531225322253322534225352253622537225382253922540225412254222543225442254522546225472254822549225502255122552225532255422555225562255722558225592256022561225622256322564225652256622567225682256922570225712257222573225742257522576225772257822579225802258122582225832258422585225862258722588225892259022591225922259322594225952259622597225982259922600226012260222603226042260522606226072260822609226102261122612226132261422615226162261722618226192262022621226222262322624226252262622627226282262922630226312263222633226342263522636226372263822639226402264122642226432264422645226462264722648226492265022651226522265322654226552265622657226582265922660226612266222663226642266522666226672266822669226702267122672226732267422675226762267722678226792268022681226822268322684226852268622687226882268922690226912269222693226942269522696226972269822699227002270122702227032270422705227062270722708227092271022711227122271322714227152271622717227182271922720227212272222723227242272522726227272272822729227302273122732227332273422735227362273722738227392274022741227422274322744227452274622747227482274922750227512275222753227542275522756227572275822759227602276122762227632276422765227662276722768227692277022771227722277322774227752277622777227782277922780227812278222783227842278522786227872278822789227902279122792227932279422795227962279722798227992280022801228022280322804228052280622807228082280922810228112281222813228142281522816228172281822819228202282122822228232282422825228262282722828228292283022831228322283322834228352283622837228382283922840228412284222843228442284522846228472284822849228502285122852228532285422855228562285722858228592286022861228622286322864228652286622867228682286922870228712287222873228742287522876228772287822879228802288122882228832288422885228862288722888228892289022891228922289322894228952289622897228982289922900229012290222903229042290522906229072290822909229102291122912229132291422915229162291722918229192292022921229222292322924229252292622927229282292922930229312293222933229342293522936229372293822939229402294122942229432294422945229462294722948229492295022951229522295322954229552295622957229582295922960229612296222963229642296522966229672296822969229702297122972229732297422975229762297722978229792298022981229822298322984229852298622987229882298922990229912299222993229942299522996229972299822999230002300123002230032300423005230062300723008230092301023011230122301323014230152301623017230182301923020230212302223023230242302523026230272302823029230302303123032230332303423035230362303723038230392304023041230422304323044230452304623047230482304923050230512305223053230542305523056230572305823059230602306123062230632306423065230662306723068230692307023071230722307323074230752307623077230782307923080230812308223083230842308523086230872308823089230902309123092230932309423095230962309723098230992310023101231022310323104231052310623107231082310923110231112311223113231142311523116231172311823119231202312123122231232312423125231262312723128231292313023131231322313323134231352313623137231382313923140231412314223143231442314523146231472314823149231502315123152231532315423155231562315723158231592316023161231622316323164231652316623167231682316923170231712317223173231742317523176231772317823179231802318123182231832318423185231862318723188231892319023191231922319323194231952319623197231982319923200232012320223203232042320523206232072320823209232102321123212232132321423215232162321723218232192322023221232222322323224232252322623227232282322923230232312323223233232342323523236232372323823239232402324123242232432324423245232462324723248232492325023251232522325323254232552325623257232582325923260232612326223263232642326523266232672326823269232702327123272232732327423275232762327723278232792328023281232822328323284232852328623287232882328923290232912329223293232942329523296232972329823299233002330123302233032330423305233062330723308233092331023311233122331323314233152331623317233182331923320233212332223323233242332523326233272332823329233302333123332233332333423335233362333723338233392334023341233422334323344233452334623347233482334923350233512335223353233542335523356233572335823359233602336123362233632336423365233662336723368233692337023371233722337323374233752337623377233782337923380233812338223383233842338523386233872338823389233902339123392233932339423395233962339723398233992340023401234022340323404234052340623407234082340923410234112341223413234142341523416234172341823419234202342123422234232342423425234262342723428234292343023431234322343323434234352343623437234382343923440234412344223443234442344523446234472344823449234502345123452234532345423455234562345723458234592346023461234622346323464234652346623467234682346923470234712347223473234742347523476234772347823479234802348123482234832348423485234862348723488234892349023491234922349323494234952349623497234982349923500235012350223503235042350523506235072350823509235102351123512235132351423515235162351723518235192352023521235222352323524235252352623527235282352923530235312353223533235342353523536235372353823539235402354123542235432354423545235462354723548235492355023551235522355323554235552355623557235582355923560235612356223563235642356523566235672356823569235702357123572235732357423575235762357723578235792358023581235822358323584235852358623587235882358923590235912359223593235942359523596235972359823599236002360123602236032360423605236062360723608236092361023611236122361323614236152361623617236182361923620236212362223623236242362523626236272362823629236302363123632236332363423635236362363723638236392364023641236422364323644236452364623647236482364923650236512365223653236542365523656236572365823659236602366123662236632366423665236662366723668236692367023671236722367323674236752367623677236782367923680236812368223683236842368523686236872368823689236902369123692236932369423695236962369723698236992370023701237022370323704237052370623707237082370923710237112371223713237142371523716237172371823719237202372123722237232372423725237262372723728237292373023731237322373323734237352373623737237382373923740237412374223743237442374523746237472374823749237502375123752237532375423755237562375723758237592376023761237622376323764237652376623767237682376923770237712377223773237742377523776237772377823779237802378123782237832378423785237862378723788237892379023791237922379323794237952379623797237982379923800238012380223803238042380523806238072380823809238102381123812238132381423815238162381723818238192382023821238222382323824238252382623827238282382923830238312383223833238342383523836238372383823839238402384123842238432384423845238462384723848238492385023851238522385323854238552385623857238582385923860238612386223863238642386523866238672386823869238702387123872238732387423875238762387723878238792388023881238822388323884238852388623887238882388923890238912389223893238942389523896238972389823899239002390123902239032390423905239062390723908239092391023911239122391323914239152391623917239182391923920239212392223923239242392523926239272392823929239302393123932239332393423935239362393723938239392394023941239422394323944239452394623947239482394923950239512395223953239542395523956239572395823959239602396123962239632396423965239662396723968239692397023971239722397323974239752397623977239782397923980239812398223983239842398523986239872398823989239902399123992239932399423995239962399723998239992400024001240022400324004240052400624007240082400924010240112401224013240142401524016240172401824019240202402124022240232402424025240262402724028240292403024031240322403324034240352403624037240382403924040240412404224043240442404524046240472404824049240502405124052240532405424055240562405724058240592406024061240622406324064240652406624067240682406924070240712407224073240742407524076240772407824079240802408124082240832408424085240862408724088240892409024091240922409324094240952409624097240982409924100241012410224103241042410524106241072410824109241102411124112241132411424115241162411724118241192412024121241222412324124241252412624127241282412924130241312413224133241342413524136241372413824139241402414124142241432414424145241462414724148241492415024151241522415324154241552415624157241582415924160241612416224163241642416524166241672416824169241702417124172241732417424175241762417724178241792418024181241822418324184241852418624187241882418924190241912419224193241942419524196241972419824199242002420124202242032420424205242062420724208242092421024211242122421324214242152421624217242182421924220242212422224223242242422524226242272422824229242302423124232242332423424235242362423724238242392424024241242422424324244242452424624247242482424924250242512425224253242542425524256242572425824259242602426124262242632426424265242662426724268242692427024271242722427324274242752427624277242782427924280242812428224283242842428524286242872428824289242902429124292242932429424295242962429724298242992430024301243022430324304243052430624307243082430924310243112431224313243142431524316243172431824319243202432124322243232432424325243262432724328243292433024331243322433324334243352433624337243382433924340243412434224343243442434524346243472434824349243502435124352243532435424355243562435724358243592436024361243622436324364243652436624367243682436924370243712437224373243742437524376243772437824379243802438124382243832438424385243862438724388243892439024391243922439324394243952439624397243982439924400244012440224403244042440524406244072440824409244102441124412244132441424415244162441724418244192442024421244222442324424244252442624427244282442924430244312443224433244342443524436244372443824439244402444124442244432444424445244462444724448244492445024451244522445324454244552445624457244582445924460244612446224463244642446524466244672446824469244702447124472244732447424475244762447724478244792448024481244822448324484244852448624487244882448924490244912449224493244942449524496244972449824499245002450124502245032450424505245062450724508245092451024511245122451324514245152451624517245182451924520245212452224523245242452524526245272452824529245302453124532245332453424535245362453724538245392454024541245422454324544245452454624547245482454924550245512455224553245542455524556245572455824559245602456124562245632456424565245662456724568245692457024571245722457324574245752457624577245782457924580245812458224583245842458524586245872458824589245902459124592245932459424595245962459724598245992460024601246022460324604246052460624607246082460924610246112461224613246142461524616246172461824619246202462124622246232462424625246262462724628246292463024631246322463324634246352463624637246382463924640246412464224643246442464524646246472464824649246502465124652246532465424655246562465724658246592466024661246622466324664246652466624667246682466924670246712467224673246742467524676246772467824679246802468124682246832468424685246862468724688246892469024691246922469324694246952469624697246982469924700247012470224703247042470524706247072470824709247102471124712247132471424715247162471724718247192472024721247222472324724247252472624727247282472924730247312473224733247342473524736247372473824739247402474124742247432474424745247462474724748247492475024751247522475324754247552475624757247582475924760247612476224763247642476524766247672476824769247702477124772247732477424775247762477724778247792478024781247822478324784247852478624787247882478924790247912479224793247942479524796247972479824799248002480124802248032480424805248062480724808248092481024811248122481324814248152481624817248182481924820248212482224823248242482524826248272482824829248302483124832248332483424835248362483724838248392484024841248422484324844248452484624847248482484924850248512485224853248542485524856248572485824859248602486124862248632486424865248662486724868248692487024871248722487324874248752487624877248782487924880248812488224883248842488524886248872488824889248902489124892248932489424895248962489724898248992490024901249022490324904249052490624907249082490924910249112491224913249142491524916249172491824919249202492124922249232492424925249262492724928249292493024931249322493324934249352493624937249382493924940249412494224943249442494524946249472494824949249502495124952249532495424955249562495724958249592496024961249622496324964249652496624967249682496924970249712497224973249742497524976249772497824979249802498124982249832498424985249862498724988249892499024991249922499324994249952499624997249982499925000250012500225003250042500525006250072500825009250102501125012250132501425015250162501725018250192502025021250222502325024250252502625027250282502925030250312503225033250342503525036250372503825039250402504125042250432504425045250462504725048250492505025051250522505325054250552505625057250582505925060250612506225063250642506525066250672506825069250702507125072250732507425075250762507725078250792508025081250822508325084250852508625087250882508925090250912509225093250942509525096250972509825099251002510125102251032510425105251062510725108251092511025111251122511325114251152511625117251182511925120251212512225123251242512525126251272512825129251302513125132251332513425135251362513725138251392514025141251422514325144251452514625147251482514925150251512515225153251542515525156251572515825159251602516125162251632516425165251662516725168251692517025171251722517325174251752517625177251782517925180251812518225183251842518525186251872518825189251902519125192251932519425195251962519725198251992520025201252022520325204252052520625207252082520925210252112521225213252142521525216252172521825219252202522125222252232522425225252262522725228252292523025231252322523325234252352523625237252382523925240252412524225243252442524525246252472524825249252502525125252252532525425255252562525725258252592526025261252622526325264252652526625267252682526925270252712527225273252742527525276252772527825279252802528125282252832528425285252862528725288252892529025291252922529325294252952529625297252982529925300253012530225303253042530525306253072530825309253102531125312253132531425315253162531725318253192532025321253222532325324253252532625327253282532925330253312533225333253342533525336253372533825339253402534125342253432534425345253462534725348253492535025351253522535325354253552535625357253582535925360253612536225363253642536525366253672536825369253702537125372253732537425375253762537725378253792538025381253822538325384253852538625387253882538925390253912539225393253942539525396253972539825399254002540125402254032540425405254062540725408254092541025411254122541325414254152541625417254182541925420254212542225423254242542525426254272542825429254302543125432254332543425435254362543725438254392544025441254422544325444254452544625447254482544925450254512545225453254542545525456254572545825459254602546125462254632546425465254662546725468254692547025471254722547325474254752547625477254782547925480254812548225483254842548525486254872548825489254902549125492254932549425495254962549725498254992550025501255022550325504255052550625507255082550925510255112551225513255142551525516255172551825519255202552125522255232552425525255262552725528255292553025531255322553325534255352553625537255382553925540255412554225543255442554525546255472554825549255502555125552255532555425555255562555725558255592556025561255622556325564255652556625567255682556925570255712557225573255742557525576255772557825579255802558125582255832558425585255862558725588255892559025591255922559325594255952559625597255982559925600256012560225603256042560525606256072560825609256102561125612256132561425615256162561725618256192562025621256222562325624256252562625627256282562925630256312563225633256342563525636256372563825639256402564125642256432564425645256462564725648256492565025651256522565325654256552565625657256582565925660256612566225663256642566525666256672566825669256702567125672256732567425675256762567725678256792568025681256822568325684256852568625687256882568925690256912569225693256942569525696256972569825699257002570125702257032570425705257062570725708257092571025711257122571325714257152571625717257182571925720257212572225723257242572525726257272572825729257302573125732257332573425735257362573725738257392574025741257422574325744257452574625747257482574925750257512575225753257542575525756257572575825759257602576125762257632576425765257662576725768257692577025771257722577325774257752577625777257782577925780257812578225783257842578525786257872578825789257902579125792257932579425795257962579725798257992580025801258022580325804258052580625807258082580925810258112581225813258142581525816258172581825819258202582125822258232582425825258262582725828258292583025831258322583325834258352583625837258382583925840258412584225843258442584525846258472584825849258502585125852258532585425855258562585725858258592586025861258622586325864258652586625867258682586925870258712587225873258742587525876258772587825879258802588125882258832588425885258862588725888258892589025891258922589325894258952589625897258982589925900259012590225903259042590525906259072590825909259102591125912259132591425915259162591725918259192592025921259222592325924259252592625927259282592925930259312593225933259342593525936259372593825939259402594125942259432594425945259462594725948259492595025951259522595325954259552595625957259582595925960259612596225963259642596525966259672596825969259702597125972259732597425975259762597725978259792598025981259822598325984259852598625987259882598925990259912599225993259942599525996259972599825999260002600126002260032600426005260062600726008260092601026011260122601326014260152601626017260182601926020260212602226023260242602526026260272602826029260302603126032260332603426035260362603726038260392604026041260422604326044260452604626047260482604926050260512605226053260542605526056260572605826059260602606126062260632606426065260662606726068260692607026071260722607326074260752607626077260782607926080260812608226083260842608526086260872608826089260902609126092260932609426095260962609726098260992610026101261022610326104261052610626107261082610926110261112611226113261142611526116261172611826119261202612126122261232612426125261262612726128261292613026131261322613326134261352613626137261382613926140261412614226143261442614526146261472614826149261502615126152261532615426155261562615726158261592616026161261622616326164261652616626167261682616926170261712617226173261742617526176261772617826179261802618126182261832618426185261862618726188261892619026191261922619326194261952619626197261982619926200262012620226203262042620526206262072620826209262102621126212262132621426215262162621726218262192622026221262222622326224262252622626227262282622926230262312623226233262342623526236262372623826239262402624126242262432624426245262462624726248262492625026251262522625326254262552625626257262582625926260262612626226263262642626526266262672626826269262702627126272262732627426275262762627726278262792628026281262822628326284262852628626287262882628926290262912629226293262942629526296262972629826299263002630126302263032630426305263062630726308263092631026311263122631326314263152631626317263182631926320263212632226323263242632526326263272632826329263302633126332263332633426335263362633726338263392634026341263422634326344263452634626347263482634926350263512635226353263542635526356263572635826359263602636126362263632636426365263662636726368263692637026371263722637326374263752637626377263782637926380263812638226383263842638526386263872638826389263902639126392263932639426395263962639726398263992640026401264022640326404264052640626407264082640926410264112641226413264142641526416264172641826419264202642126422264232642426425264262642726428264292643026431264322643326434264352643626437264382643926440264412644226443264442644526446264472644826449264502645126452264532645426455264562645726458264592646026461264622646326464264652646626467264682646926470264712647226473264742647526476264772647826479264802648126482264832648426485264862648726488264892649026491264922649326494264952649626497264982649926500265012650226503265042650526506265072650826509265102651126512265132651426515265162651726518265192652026521265222652326524265252652626527265282652926530265312653226533265342653526536265372653826539265402654126542265432654426545265462654726548265492655026551265522655326554265552655626557265582655926560265612656226563265642656526566265672656826569265702657126572265732657426575265762657726578265792658026581265822658326584265852658626587265882658926590265912659226593265942659526596265972659826599266002660126602266032660426605266062660726608266092661026611266122661326614266152661626617266182661926620266212662226623266242662526626266272662826629266302663126632266332663426635266362663726638266392664026641266422664326644266452664626647266482664926650266512665226653266542665526656266572665826659266602666126662266632666426665266662666726668266692667026671266722667326674266752667626677266782667926680266812668226683266842668526686266872668826689266902669126692266932669426695266962669726698266992670026701267022670326704267052670626707267082670926710267112671226713267142671526716267172671826719267202672126722267232672426725267262672726728267292673026731267322673326734267352673626737267382673926740267412674226743267442674526746267472674826749267502675126752267532675426755267562675726758267592676026761267622676326764267652676626767267682676926770267712677226773267742677526776267772677826779267802678126782267832678426785267862678726788267892679026791267922679326794267952679626797267982679926800268012680226803268042680526806268072680826809268102681126812268132681426815268162681726818268192682026821268222682326824268252682626827268282682926830268312683226833268342683526836268372683826839268402684126842268432684426845268462684726848268492685026851268522685326854268552685626857268582685926860268612686226863268642686526866268672686826869268702687126872268732687426875268762687726878268792688026881268822688326884268852688626887268882688926890268912689226893268942689526896268972689826899269002690126902269032690426905269062690726908269092691026911269122691326914269152691626917269182691926920269212692226923269242692526926269272692826929269302693126932269332693426935269362693726938269392694026941269422694326944269452694626947269482694926950269512695226953269542695526956269572695826959269602696126962269632696426965269662696726968269692697026971269722697326974269752697626977269782697926980269812698226983269842698526986269872698826989269902699126992269932699426995269962699726998269992700027001270022700327004270052700627007270082700927010270112701227013270142701527016270172701827019270202702127022270232702427025270262702727028270292703027031270322703327034270352703627037270382703927040270412704227043270442704527046270472704827049270502705127052270532705427055270562705727058270592706027061270622706327064270652706627067270682706927070270712707227073270742707527076270772707827079270802708127082270832708427085270862708727088270892709027091270922709327094270952709627097270982709927100271012710227103271042710527106271072710827109271102711127112271132711427115271162711727118271192712027121271222712327124271252712627127271282712927130271312713227133271342713527136271372713827139271402714127142271432714427145271462714727148271492715027151271522715327154271552715627157271582715927160271612716227163271642716527166271672716827169271702717127172271732717427175271762717727178271792718027181271822718327184271852718627187271882718927190271912719227193271942719527196271972719827199272002720127202272032720427205272062720727208272092721027211272122721327214272152721627217272182721927220272212722227223272242722527226272272722827229272302723127232272332723427235272362723727238272392724027241272422724327244272452724627247272482724927250272512725227253272542725527256272572725827259272602726127262272632726427265272662726727268272692727027271272722727327274272752727627277272782727927280272812728227283272842728527286272872728827289272902729127292272932729427295272962729727298272992730027301273022730327304273052730627307273082730927310273112731227313273142731527316273172731827319273202732127322273232732427325273262732727328273292733027331273322733327334273352733627337273382733927340273412734227343273442734527346273472734827349273502735127352273532735427355273562735727358273592736027361273622736327364273652736627367273682736927370273712737227373273742737527376273772737827379273802738127382273832738427385273862738727388273892739027391273922739327394273952739627397273982739927400274012740227403274042740527406274072740827409274102741127412274132741427415274162741727418274192742027421274222742327424274252742627427274282742927430274312743227433274342743527436274372743827439274402744127442274432744427445274462744727448274492745027451274522745327454274552745627457274582745927460274612746227463274642746527466274672746827469274702747127472274732747427475274762747727478274792748027481274822748327484274852748627487274882748927490274912749227493274942749527496274972749827499275002750127502275032750427505275062750727508275092751027511275122751327514275152751627517275182751927520275212752227523275242752527526275272752827529275302753127532275332753427535275362753727538275392754027541275422754327544275452754627547275482754927550275512755227553275542755527556275572755827559275602756127562275632756427565275662756727568275692757027571275722757327574275752757627577275782757927580275812758227583275842758527586275872758827589275902759127592275932759427595275962759727598275992760027601276022760327604276052760627607276082760927610276112761227613276142761527616276172761827619276202762127622276232762427625276262762727628276292763027631276322763327634276352763627637276382763927640276412764227643276442764527646276472764827649276502765127652276532765427655276562765727658276592766027661276622766327664276652766627667276682766927670276712767227673276742767527676276772767827679276802768127682276832768427685276862768727688276892769027691276922769327694276952769627697276982769927700277012770227703277042770527706277072770827709277102771127712277132771427715277162771727718277192772027721277222772327724277252772627727277282772927730277312773227733277342773527736277372773827739277402774127742277432774427745277462774727748277492775027751277522775327754277552775627757277582775927760277612776227763277642776527766277672776827769277702777127772277732777427775277762777727778277792778027781277822778327784277852778627787277882778927790277912779227793277942779527796277972779827799278002780127802278032780427805278062780727808278092781027811278122781327814278152781627817278182781927820278212782227823278242782527826278272782827829278302783127832278332783427835278362783727838278392784027841278422784327844278452784627847278482784927850278512785227853278542785527856278572785827859278602786127862278632786427865278662786727868278692787027871278722787327874278752787627877278782787927880278812788227883278842788527886278872788827889278902789127892278932789427895278962789727898278992790027901279022790327904279052790627907279082790927910279112791227913279142791527916279172791827919279202792127922279232792427925279262792727928279292793027931279322793327934279352793627937279382793927940
  1. var __extends = this.__extends || function (d, b) {
  2. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  3. function __() { this.constructor = d; }
  4. __.prototype = b.prototype;
  5. d.prototype = new __();
  6. };var BABYLON;
  7. (function (BABYLON) {
  8. var Color3 = (function () {
  9. function Color3(r, g, b) {
  10. if (r === void 0) { r = 0; }
  11. if (g === void 0) { g = 0; }
  12. if (b === void 0) { b = 0; }
  13. this.r = r;
  14. this.g = g;
  15. this.b = b;
  16. }
  17. Color3.prototype.toString = function () {
  18. return "{R: " + this.r + " G:" + this.g + " B:" + this.b + "}";
  19. };
  20. // Operators
  21. Color3.prototype.toArray = function (array, index) {
  22. if (index === undefined) {
  23. index = 0;
  24. }
  25. array[index] = this.r;
  26. array[index + 1] = this.g;
  27. array[index + 2] = this.b;
  28. return this;
  29. };
  30. Color3.prototype.toColor4 = function (alpha) {
  31. if (alpha === void 0) { alpha = 1; }
  32. return new Color4(this.r, this.g, this.b, alpha);
  33. };
  34. Color3.prototype.asArray = function () {
  35. var result = [];
  36. this.toArray(result, 0);
  37. return result;
  38. };
  39. Color3.prototype.toLuminance = function () {
  40. return this.r * 0.3 + this.g * 0.59 + this.b * 0.11;
  41. };
  42. Color3.prototype.multiply = function (otherColor) {
  43. return new Color3(this.r * otherColor.r, this.g * otherColor.g, this.b * otherColor.b);
  44. };
  45. Color3.prototype.multiplyToRef = function (otherColor, result) {
  46. result.r = this.r * otherColor.r;
  47. result.g = this.g * otherColor.g;
  48. result.b = this.b * otherColor.b;
  49. return this;
  50. };
  51. Color3.prototype.equals = function (otherColor) {
  52. return otherColor && this.r === otherColor.r && this.g === otherColor.g && this.b === otherColor.b;
  53. };
  54. Color3.prototype.scale = function (scale) {
  55. return new Color3(this.r * scale, this.g * scale, this.b * scale);
  56. };
  57. Color3.prototype.scaleToRef = function (scale, result) {
  58. result.r = this.r * scale;
  59. result.g = this.g * scale;
  60. result.b = this.b * scale;
  61. return this;
  62. };
  63. Color3.prototype.add = function (otherColor) {
  64. return new Color3(this.r + otherColor.r, this.g + otherColor.g, this.b + otherColor.b);
  65. };
  66. Color3.prototype.addToRef = function (otherColor, result) {
  67. result.r = this.r + otherColor.r;
  68. result.g = this.g + otherColor.g;
  69. result.b = this.b + otherColor.b;
  70. return this;
  71. };
  72. Color3.prototype.subtract = function (otherColor) {
  73. return new Color3(this.r - otherColor.r, this.g - otherColor.g, this.b - otherColor.b);
  74. };
  75. Color3.prototype.subtractToRef = function (otherColor, result) {
  76. result.r = this.r - otherColor.r;
  77. result.g = this.g - otherColor.g;
  78. result.b = this.b - otherColor.b;
  79. return this;
  80. };
  81. Color3.prototype.clone = function () {
  82. return new Color3(this.r, this.g, this.b);
  83. };
  84. Color3.prototype.copyFrom = function (source) {
  85. this.r = source.r;
  86. this.g = source.g;
  87. this.b = source.b;
  88. return this;
  89. };
  90. Color3.prototype.copyFromFloats = function (r, g, b) {
  91. this.r = r;
  92. this.g = g;
  93. this.b = b;
  94. return this;
  95. };
  96. // Statics
  97. Color3.FromArray = function (array, offset) {
  98. if (offset === void 0) { offset = 0; }
  99. return new Color3(array[offset], array[offset + 1], array[offset + 2]);
  100. };
  101. Color3.FromInts = function (r, g, b) {
  102. return new Color3(r / 255.0, g / 255.0, b / 255.0);
  103. };
  104. Color3.Lerp = function (start, end, amount) {
  105. var r = start.r + ((end.r - start.r) * amount);
  106. var g = start.g + ((end.g - start.g) * amount);
  107. var b = start.b + ((end.b - start.b) * amount);
  108. return new Color3(r, g, b);
  109. };
  110. Color3.Red = function () {
  111. return new Color3(1, 0, 0);
  112. };
  113. Color3.Green = function () {
  114. return new Color3(0, 1, 0);
  115. };
  116. Color3.Blue = function () {
  117. return new Color3(0, 0, 1);
  118. };
  119. Color3.Black = function () {
  120. return new Color3(0, 0, 0);
  121. };
  122. Color3.White = function () {
  123. return new Color3(1, 1, 1);
  124. };
  125. Color3.Purple = function () {
  126. return new Color3(0.5, 0, 0.5);
  127. };
  128. Color3.Magenta = function () {
  129. return new Color3(1, 0, 1);
  130. };
  131. Color3.Yellow = function () {
  132. return new Color3(1, 1, 0);
  133. };
  134. Color3.Gray = function () {
  135. return new Color3(0.5, 0.5, 0.5);
  136. };
  137. return Color3;
  138. })();
  139. BABYLON.Color3 = Color3;
  140. var Color4 = (function () {
  141. function Color4(r, g, b, a) {
  142. this.r = r;
  143. this.g = g;
  144. this.b = b;
  145. this.a = a;
  146. }
  147. // Operators
  148. Color4.prototype.addInPlace = function (right) {
  149. this.r += right.r;
  150. this.g += right.g;
  151. this.b += right.b;
  152. this.a += right.a;
  153. return this;
  154. };
  155. Color4.prototype.asArray = function () {
  156. var result = [];
  157. this.toArray(result, 0);
  158. return result;
  159. };
  160. Color4.prototype.toArray = function (array, index) {
  161. if (index === undefined) {
  162. index = 0;
  163. }
  164. array[index] = this.r;
  165. array[index + 1] = this.g;
  166. array[index + 2] = this.b;
  167. array[index + 3] = this.a;
  168. return this;
  169. };
  170. Color4.prototype.add = function (right) {
  171. return new Color4(this.r + right.r, this.g + right.g, this.b + right.b, this.a + right.a);
  172. };
  173. Color4.prototype.subtract = function (right) {
  174. return new Color4(this.r - right.r, this.g - right.g, this.b - right.b, this.a - right.a);
  175. };
  176. Color4.prototype.subtractToRef = function (right, result) {
  177. result.r = this.r - right.r;
  178. result.g = this.g - right.g;
  179. result.b = this.b - right.b;
  180. result.a = this.a - right.a;
  181. return this;
  182. };
  183. Color4.prototype.scale = function (scale) {
  184. return new Color4(this.r * scale, this.g * scale, this.b * scale, this.a * scale);
  185. };
  186. Color4.prototype.scaleToRef = function (scale, result) {
  187. result.r = this.r * scale;
  188. result.g = this.g * scale;
  189. result.b = this.b * scale;
  190. result.a = this.a * scale;
  191. return this;
  192. };
  193. Color4.prototype.toString = function () {
  194. return "{R: " + this.r + " G:" + this.g + " B:" + this.b + " A:" + this.a + "}";
  195. };
  196. Color4.prototype.clone = function () {
  197. return new Color4(this.r, this.g, this.b, this.a);
  198. };
  199. Color4.prototype.copyFrom = function (source) {
  200. this.r = source.r;
  201. this.g = source.g;
  202. this.b = source.b;
  203. this.a = source.a;
  204. return this;
  205. };
  206. // Statics
  207. Color4.Lerp = function (left, right, amount) {
  208. var result = new Color4(0, 0, 0, 0);
  209. Color4.LerpToRef(left, right, amount, result);
  210. return result;
  211. };
  212. Color4.LerpToRef = function (left, right, amount, result) {
  213. result.r = left.r + (right.r - left.r) * amount;
  214. result.g = left.g + (right.g - left.g) * amount;
  215. result.b = left.b + (right.b - left.b) * amount;
  216. result.a = left.a + (right.a - left.a) * amount;
  217. };
  218. Color4.FromArray = function (array, offset) {
  219. if (offset === void 0) { offset = 0; }
  220. return new Color4(array[offset], array[offset + 1], array[offset + 2], array[offset + 3]);
  221. };
  222. Color4.FromInts = function (r, g, b, a) {
  223. return new Color4(r / 255.0, g / 255.0, b / 255.0, a / 255.0);
  224. };
  225. return Color4;
  226. })();
  227. BABYLON.Color4 = Color4;
  228. var Vector2 = (function () {
  229. function Vector2(x, y) {
  230. this.x = x;
  231. this.y = y;
  232. }
  233. Vector2.prototype.toString = function () {
  234. return "{X: " + this.x + " Y:" + this.y + "}";
  235. };
  236. // Operators
  237. Vector2.prototype.toArray = function (array, index) {
  238. if (index === void 0) { index = 0; }
  239. array[index] = this.x;
  240. array[index + 1] = this.y;
  241. return this;
  242. };
  243. Vector2.prototype.asArray = function () {
  244. var result = [];
  245. this.toArray(result, 0);
  246. return result;
  247. };
  248. Vector2.prototype.copyFrom = function (source) {
  249. this.x = source.x;
  250. this.y = source.y;
  251. return this;
  252. };
  253. Vector2.prototype.copyFromFloats = function (x, y) {
  254. this.x = x;
  255. this.y = y;
  256. return this;
  257. };
  258. Vector2.prototype.add = function (otherVector) {
  259. return new Vector2(this.x + otherVector.x, this.y + otherVector.y);
  260. };
  261. Vector2.prototype.addVector3 = function (otherVector) {
  262. return new Vector2(this.x + otherVector.x, this.y + otherVector.y);
  263. };
  264. Vector2.prototype.subtract = function (otherVector) {
  265. return new Vector2(this.x - otherVector.x, this.y - otherVector.y);
  266. };
  267. Vector2.prototype.subtractInPlace = function (otherVector) {
  268. this.x -= otherVector.x;
  269. this.y -= otherVector.y;
  270. return this;
  271. };
  272. Vector2.prototype.multiplyInPlace = function (otherVector) {
  273. this.x *= otherVector.x;
  274. this.y *= otherVector.y;
  275. return this;
  276. };
  277. Vector2.prototype.multiply = function (otherVector) {
  278. return new Vector2(this.x * otherVector.x, this.y * otherVector.y);
  279. };
  280. Vector2.prototype.multiplyToRef = function (otherVector, result) {
  281. result.x = this.x * otherVector.x;
  282. result.y = this.y * otherVector.y;
  283. return this;
  284. };
  285. Vector2.prototype.multiplyByFloats = function (x, y) {
  286. return new Vector2(this.x * x, this.y * y);
  287. };
  288. Vector2.prototype.divide = function (otherVector) {
  289. return new Vector2(this.x / otherVector.x, this.y / otherVector.y);
  290. };
  291. Vector2.prototype.divideToRef = function (otherVector, result) {
  292. result.x = this.x / otherVector.x;
  293. result.y = this.y / otherVector.y;
  294. return this;
  295. };
  296. Vector2.prototype.negate = function () {
  297. return new Vector2(-this.x, -this.y);
  298. };
  299. Vector2.prototype.scaleInPlace = function (scale) {
  300. this.x *= scale;
  301. this.y *= scale;
  302. return this;
  303. };
  304. Vector2.prototype.scale = function (scale) {
  305. return new Vector2(this.x * scale, this.y * scale);
  306. };
  307. Vector2.prototype.equals = function (otherVector) {
  308. return otherVector && this.x === otherVector.x && this.y === otherVector.y;
  309. };
  310. // Properties
  311. Vector2.prototype.length = function () {
  312. return Math.sqrt(this.x * this.x + this.y * this.y);
  313. };
  314. Vector2.prototype.lengthSquared = function () {
  315. return (this.x * this.x + this.y * this.y);
  316. };
  317. // Methods
  318. Vector2.prototype.normalize = function () {
  319. var len = this.length();
  320. if (len === 0)
  321. return this;
  322. var num = 1.0 / len;
  323. this.x *= num;
  324. this.y *= num;
  325. return this;
  326. };
  327. Vector2.prototype.clone = function () {
  328. return new Vector2(this.x, this.y);
  329. };
  330. // Statics
  331. Vector2.Zero = function () {
  332. return new Vector2(0, 0);
  333. };
  334. Vector2.FromArray = function (array, offset) {
  335. if (offset === void 0) { offset = 0; }
  336. return new Vector2(array[offset], array[offset + 1]);
  337. };
  338. Vector2.FromArrayToRef = function (array, offset, result) {
  339. result.x = array[offset];
  340. result.y = array[offset + 1];
  341. };
  342. Vector2.CatmullRom = function (value1, value2, value3, value4, amount) {
  343. var squared = amount * amount;
  344. var cubed = amount * squared;
  345. var x = 0.5 * ((((2.0 * value2.x) + ((-value1.x + value3.x) * amount)) + (((((2.0 * value1.x) - (5.0 * value2.x)) + (4.0 * value3.x)) - value4.x) * squared)) + ((((-value1.x + (3.0 * value2.x)) - (3.0 * value3.x)) + value4.x) * cubed));
  346. var y = 0.5 * ((((2.0 * value2.y) + ((-value1.y + value3.y) * amount)) + (((((2.0 * value1.y) - (5.0 * value2.y)) + (4.0 * value3.y)) - value4.y) * squared)) + ((((-value1.y + (3.0 * value2.y)) - (3.0 * value3.y)) + value4.y) * cubed));
  347. return new Vector2(x, y);
  348. };
  349. Vector2.Clamp = function (value, min, max) {
  350. var x = value.x;
  351. x = (x > max.x) ? max.x : x;
  352. x = (x < min.x) ? min.x : x;
  353. var y = value.y;
  354. y = (y > max.y) ? max.y : y;
  355. y = (y < min.y) ? min.y : y;
  356. return new Vector2(x, y);
  357. };
  358. Vector2.Hermite = function (value1, tangent1, value2, tangent2, amount) {
  359. var squared = amount * amount;
  360. var cubed = amount * squared;
  361. var part1 = ((2.0 * cubed) - (3.0 * squared)) + 1.0;
  362. var part2 = (-2.0 * cubed) + (3.0 * squared);
  363. var part3 = (cubed - (2.0 * squared)) + amount;
  364. var part4 = cubed - squared;
  365. var x = (((value1.x * part1) + (value2.x * part2)) + (tangent1.x * part3)) + (tangent2.x * part4);
  366. var y = (((value1.y * part1) + (value2.y * part2)) + (tangent1.y * part3)) + (tangent2.y * part4);
  367. return new Vector2(x, y);
  368. };
  369. Vector2.Lerp = function (start, end, amount) {
  370. var x = start.x + ((end.x - start.x) * amount);
  371. var y = start.y + ((end.y - start.y) * amount);
  372. return new Vector2(x, y);
  373. };
  374. Vector2.Dot = function (left, right) {
  375. return left.x * right.x + left.y * right.y;
  376. };
  377. Vector2.Normalize = function (vector) {
  378. var newVector = vector.clone();
  379. newVector.normalize();
  380. return newVector;
  381. };
  382. Vector2.Minimize = function (left, right) {
  383. var x = (left.x < right.x) ? left.x : right.x;
  384. var y = (left.y < right.y) ? left.y : right.y;
  385. return new Vector2(x, y);
  386. };
  387. Vector2.Maximize = function (left, right) {
  388. var x = (left.x > right.x) ? left.x : right.x;
  389. var y = (left.y > right.y) ? left.y : right.y;
  390. return new Vector2(x, y);
  391. };
  392. Vector2.Transform = function (vector, transformation) {
  393. var x = (vector.x * transformation.m[0]) + (vector.y * transformation.m[4]);
  394. var y = (vector.x * transformation.m[1]) + (vector.y * transformation.m[5]);
  395. return new Vector2(x, y);
  396. };
  397. Vector2.Distance = function (value1, value2) {
  398. return Math.sqrt(Vector2.DistanceSquared(value1, value2));
  399. };
  400. Vector2.DistanceSquared = function (value1, value2) {
  401. var x = value1.x - value2.x;
  402. var y = value1.y - value2.y;
  403. return (x * x) + (y * y);
  404. };
  405. return Vector2;
  406. })();
  407. BABYLON.Vector2 = Vector2;
  408. var Vector3 = (function () {
  409. function Vector3(x, y, z) {
  410. this.x = x;
  411. this.y = y;
  412. this.z = z;
  413. }
  414. Vector3.prototype.toString = function () {
  415. return "{X: " + this.x + " Y:" + this.y + " Z:" + this.z + "}";
  416. };
  417. // Operators
  418. Vector3.prototype.asArray = function () {
  419. var result = [];
  420. this.toArray(result, 0);
  421. return result;
  422. };
  423. Vector3.prototype.toArray = function (array, index) {
  424. if (index === void 0) { index = 0; }
  425. array[index] = this.x;
  426. array[index + 1] = this.y;
  427. array[index + 2] = this.z;
  428. return this;
  429. };
  430. Vector3.prototype.toQuaternion = function () {
  431. var result = new Quaternion(0, 0, 0, 1);
  432. var cosxPlusz = Math.cos((this.x + this.z) * 0.5);
  433. var sinxPlusz = Math.sin((this.x + this.z) * 0.5);
  434. var coszMinusx = Math.cos((this.z - this.x) * 0.5);
  435. var sinzMinusx = Math.sin((this.z - this.x) * 0.5);
  436. var cosy = Math.cos(this.y * 0.5);
  437. var siny = Math.sin(this.y * 0.5);
  438. result.x = coszMinusx * siny;
  439. result.y = -sinzMinusx * siny;
  440. result.z = sinxPlusz * cosy;
  441. result.w = cosxPlusz * cosy;
  442. return result;
  443. };
  444. Vector3.prototype.addInPlace = function (otherVector) {
  445. this.x += otherVector.x;
  446. this.y += otherVector.y;
  447. this.z += otherVector.z;
  448. return this;
  449. };
  450. Vector3.prototype.add = function (otherVector) {
  451. return new Vector3(this.x + otherVector.x, this.y + otherVector.y, this.z + otherVector.z);
  452. };
  453. Vector3.prototype.addToRef = function (otherVector, result) {
  454. result.x = this.x + otherVector.x;
  455. result.y = this.y + otherVector.y;
  456. result.z = this.z + otherVector.z;
  457. return this;
  458. };
  459. Vector3.prototype.subtractInPlace = function (otherVector) {
  460. this.x -= otherVector.x;
  461. this.y -= otherVector.y;
  462. this.z -= otherVector.z;
  463. return this;
  464. };
  465. Vector3.prototype.subtract = function (otherVector) {
  466. return new Vector3(this.x - otherVector.x, this.y - otherVector.y, this.z - otherVector.z);
  467. };
  468. Vector3.prototype.subtractToRef = function (otherVector, result) {
  469. result.x = this.x - otherVector.x;
  470. result.y = this.y - otherVector.y;
  471. result.z = this.z - otherVector.z;
  472. return this;
  473. };
  474. Vector3.prototype.subtractFromFloats = function (x, y, z) {
  475. return new Vector3(this.x - x, this.y - y, this.z - z);
  476. };
  477. Vector3.prototype.subtractFromFloatsToRef = function (x, y, z, result) {
  478. result.x = this.x - x;
  479. result.y = this.y - y;
  480. result.z = this.z - z;
  481. return this;
  482. };
  483. Vector3.prototype.negate = function () {
  484. return new Vector3(-this.x, -this.y, -this.z);
  485. };
  486. Vector3.prototype.scaleInPlace = function (scale) {
  487. this.x *= scale;
  488. this.y *= scale;
  489. this.z *= scale;
  490. return this;
  491. };
  492. Vector3.prototype.scale = function (scale) {
  493. return new Vector3(this.x * scale, this.y * scale, this.z * scale);
  494. };
  495. Vector3.prototype.scaleToRef = function (scale, result) {
  496. result.x = this.x * scale;
  497. result.y = this.y * scale;
  498. result.z = this.z * scale;
  499. };
  500. Vector3.prototype.equals = function (otherVector) {
  501. return otherVector && this.x === otherVector.x && this.y === otherVector.y && this.z === otherVector.z;
  502. };
  503. Vector3.prototype.equalsWithEpsilon = function (otherVector) {
  504. return Math.abs(this.x - otherVector.x) < BABYLON.Engine.Epsilon && Math.abs(this.y - otherVector.y) < BABYLON.Engine.Epsilon && Math.abs(this.z - otherVector.z) < BABYLON.Engine.Epsilon;
  505. };
  506. Vector3.prototype.equalsToFloats = function (x, y, z) {
  507. return this.x === x && this.y === y && this.z === z;
  508. };
  509. Vector3.prototype.multiplyInPlace = function (otherVector) {
  510. this.x *= otherVector.x;
  511. this.y *= otherVector.y;
  512. this.z *= otherVector.z;
  513. return this;
  514. };
  515. Vector3.prototype.multiply = function (otherVector) {
  516. return new Vector3(this.x * otherVector.x, this.y * otherVector.y, this.z * otherVector.z);
  517. };
  518. Vector3.prototype.multiplyToRef = function (otherVector, result) {
  519. result.x = this.x * otherVector.x;
  520. result.y = this.y * otherVector.y;
  521. result.z = this.z * otherVector.z;
  522. return this;
  523. };
  524. Vector3.prototype.multiplyByFloats = function (x, y, z) {
  525. return new Vector3(this.x * x, this.y * y, this.z * z);
  526. };
  527. Vector3.prototype.divide = function (otherVector) {
  528. return new Vector3(this.x / otherVector.x, this.y / otherVector.y, this.z / otherVector.z);
  529. };
  530. Vector3.prototype.divideToRef = function (otherVector, result) {
  531. result.x = this.x / otherVector.x;
  532. result.y = this.y / otherVector.y;
  533. result.z = this.z / otherVector.z;
  534. return this;
  535. };
  536. Vector3.prototype.MinimizeInPlace = function (other) {
  537. if (other.x < this.x)
  538. this.x = other.x;
  539. if (other.y < this.y)
  540. this.y = other.y;
  541. if (other.z < this.z)
  542. this.z = other.z;
  543. return this;
  544. };
  545. Vector3.prototype.MaximizeInPlace = function (other) {
  546. if (other.x > this.x)
  547. this.x = other.x;
  548. if (other.y > this.y)
  549. this.y = other.y;
  550. if (other.z > this.z)
  551. this.z = other.z;
  552. return this;
  553. };
  554. // Properties
  555. Vector3.prototype.length = function () {
  556. return Math.sqrt(this.x * this.x + this.y * this.y + this.z * this.z);
  557. };
  558. Vector3.prototype.lengthSquared = function () {
  559. return (this.x * this.x + this.y * this.y + this.z * this.z);
  560. };
  561. // Methods
  562. Vector3.prototype.normalize = function () {
  563. var len = this.length();
  564. if (len === 0)
  565. return this;
  566. var num = 1.0 / len;
  567. this.x *= num;
  568. this.y *= num;
  569. this.z *= num;
  570. return this;
  571. };
  572. Vector3.prototype.clone = function () {
  573. return new Vector3(this.x, this.y, this.z);
  574. };
  575. Vector3.prototype.copyFrom = function (source) {
  576. this.x = source.x;
  577. this.y = source.y;
  578. this.z = source.z;
  579. return this;
  580. };
  581. Vector3.prototype.copyFromFloats = function (x, y, z) {
  582. this.x = x;
  583. this.y = y;
  584. this.z = z;
  585. return this;
  586. };
  587. // Statics
  588. Vector3.FromArray = function (array, offset) {
  589. if (!offset) {
  590. offset = 0;
  591. }
  592. return new Vector3(array[offset], array[offset + 1], array[offset + 2]);
  593. };
  594. Vector3.FromArrayToRef = function (array, offset, result) {
  595. result.x = array[offset];
  596. result.y = array[offset + 1];
  597. result.z = array[offset + 2];
  598. };
  599. Vector3.FromFloatArrayToRef = function (array, offset, result) {
  600. result.x = array[offset];
  601. result.y = array[offset + 1];
  602. result.z = array[offset + 2];
  603. };
  604. Vector3.FromFloatsToRef = function (x, y, z, result) {
  605. result.x = x;
  606. result.y = y;
  607. result.z = z;
  608. };
  609. Vector3.Zero = function () {
  610. return new Vector3(0, 0, 0);
  611. };
  612. Vector3.Up = function () {
  613. return new Vector3(0, 1.0, 0);
  614. };
  615. Vector3.TransformCoordinates = function (vector, transformation) {
  616. var result = Vector3.Zero();
  617. Vector3.TransformCoordinatesToRef(vector, transformation, result);
  618. return result;
  619. };
  620. Vector3.TransformCoordinatesToRef = function (vector, transformation, result) {
  621. var x = (vector.x * transformation.m[0]) + (vector.y * transformation.m[4]) + (vector.z * transformation.m[8]) + transformation.m[12];
  622. var y = (vector.x * transformation.m[1]) + (vector.y * transformation.m[5]) + (vector.z * transformation.m[9]) + transformation.m[13];
  623. var z = (vector.x * transformation.m[2]) + (vector.y * transformation.m[6]) + (vector.z * transformation.m[10]) + transformation.m[14];
  624. var w = (vector.x * transformation.m[3]) + (vector.y * transformation.m[7]) + (vector.z * transformation.m[11]) + transformation.m[15];
  625. result.x = x / w;
  626. result.y = y / w;
  627. result.z = z / w;
  628. };
  629. Vector3.TransformCoordinatesFromFloatsToRef = function (x, y, z, transformation, result) {
  630. var rx = (x * transformation.m[0]) + (y * transformation.m[4]) + (z * transformation.m[8]) + transformation.m[12];
  631. var ry = (x * transformation.m[1]) + (y * transformation.m[5]) + (z * transformation.m[9]) + transformation.m[13];
  632. var rz = (x * transformation.m[2]) + (y * transformation.m[6]) + (z * transformation.m[10]) + transformation.m[14];
  633. var rw = (x * transformation.m[3]) + (y * transformation.m[7]) + (z * transformation.m[11]) + transformation.m[15];
  634. result.x = rx / rw;
  635. result.y = ry / rw;
  636. result.z = rz / rw;
  637. };
  638. Vector3.TransformNormal = function (vector, transformation) {
  639. var result = Vector3.Zero();
  640. Vector3.TransformNormalToRef(vector, transformation, result);
  641. return result;
  642. };
  643. Vector3.TransformNormalToRef = function (vector, transformation, result) {
  644. result.x = (vector.x * transformation.m[0]) + (vector.y * transformation.m[4]) + (vector.z * transformation.m[8]);
  645. result.y = (vector.x * transformation.m[1]) + (vector.y * transformation.m[5]) + (vector.z * transformation.m[9]);
  646. result.z = (vector.x * transformation.m[2]) + (vector.y * transformation.m[6]) + (vector.z * transformation.m[10]);
  647. };
  648. Vector3.TransformNormalFromFloatsToRef = function (x, y, z, transformation, result) {
  649. result.x = (x * transformation.m[0]) + (y * transformation.m[4]) + (z * transformation.m[8]);
  650. result.y = (x * transformation.m[1]) + (y * transformation.m[5]) + (z * transformation.m[9]);
  651. result.z = (x * transformation.m[2]) + (y * transformation.m[6]) + (z * transformation.m[10]);
  652. };
  653. Vector3.CatmullRom = function (value1, value2, value3, value4, amount) {
  654. var squared = amount * amount;
  655. var cubed = amount * squared;
  656. var x = 0.5 * ((((2.0 * value2.x) + ((-value1.x + value3.x) * amount)) + (((((2.0 * value1.x) - (5.0 * value2.x)) + (4.0 * value3.x)) - value4.x) * squared)) + ((((-value1.x + (3.0 * value2.x)) - (3.0 * value3.x)) + value4.x) * cubed));
  657. var y = 0.5 * ((((2.0 * value2.y) + ((-value1.y + value3.y) * amount)) + (((((2.0 * value1.y) - (5.0 * value2.y)) + (4.0 * value3.y)) - value4.y) * squared)) + ((((-value1.y + (3.0 * value2.y)) - (3.0 * value3.y)) + value4.y) * cubed));
  658. var z = 0.5 * ((((2.0 * value2.z) + ((-value1.z + value3.z) * amount)) + (((((2.0 * value1.z) - (5.0 * value2.z)) + (4.0 * value3.z)) - value4.z) * squared)) + ((((-value1.z + (3.0 * value2.z)) - (3.0 * value3.z)) + value4.z) * cubed));
  659. return new Vector3(x, y, z);
  660. };
  661. Vector3.Clamp = function (value, min, max) {
  662. var x = value.x;
  663. x = (x > max.x) ? max.x : x;
  664. x = (x < min.x) ? min.x : x;
  665. var y = value.y;
  666. y = (y > max.y) ? max.y : y;
  667. y = (y < min.y) ? min.y : y;
  668. var z = value.z;
  669. z = (z > max.z) ? max.z : z;
  670. z = (z < min.z) ? min.z : z;
  671. return new Vector3(x, y, z);
  672. };
  673. Vector3.Hermite = function (value1, tangent1, value2, tangent2, amount) {
  674. var squared = amount * amount;
  675. var cubed = amount * squared;
  676. var part1 = ((2.0 * cubed) - (3.0 * squared)) + 1.0;
  677. var part2 = (-2.0 * cubed) + (3.0 * squared);
  678. var part3 = (cubed - (2.0 * squared)) + amount;
  679. var part4 = cubed - squared;
  680. var x = (((value1.x * part1) + (value2.x * part2)) + (tangent1.x * part3)) + (tangent2.x * part4);
  681. var y = (((value1.y * part1) + (value2.y * part2)) + (tangent1.y * part3)) + (tangent2.y * part4);
  682. var z = (((value1.z * part1) + (value2.z * part2)) + (tangent1.z * part3)) + (tangent2.z * part4);
  683. return new Vector3(x, y, z);
  684. };
  685. Vector3.Lerp = function (start, end, amount) {
  686. var x = start.x + ((end.x - start.x) * amount);
  687. var y = start.y + ((end.y - start.y) * amount);
  688. var z = start.z + ((end.z - start.z) * amount);
  689. return new Vector3(x, y, z);
  690. };
  691. Vector3.Dot = function (left, right) {
  692. return (left.x * right.x + left.y * right.y + left.z * right.z);
  693. };
  694. Vector3.Cross = function (left, right) {
  695. var result = Vector3.Zero();
  696. Vector3.CrossToRef(left, right, result);
  697. return result;
  698. };
  699. Vector3.CrossToRef = function (left, right, result) {
  700. result.x = left.y * right.z - left.z * right.y;
  701. result.y = left.z * right.x - left.x * right.z;
  702. result.z = left.x * right.y - left.y * right.x;
  703. };
  704. Vector3.Normalize = function (vector) {
  705. var result = Vector3.Zero();
  706. Vector3.NormalizeToRef(vector, result);
  707. return result;
  708. };
  709. Vector3.NormalizeToRef = function (vector, result) {
  710. result.copyFrom(vector);
  711. result.normalize();
  712. };
  713. Vector3.Project = function (vector, world, transform, viewport) {
  714. var cw = viewport.width;
  715. var ch = viewport.height;
  716. var cx = viewport.x;
  717. var cy = viewport.y;
  718. var viewportMatrix = Matrix.FromValues(cw / 2.0, 0, 0, 0, 0, -ch / 2.0, 0, 0, 0, 0, 1, 0, cx + cw / 2.0, ch / 2.0 + cy, 0, 1);
  719. var finalMatrix = world.multiply(transform).multiply(viewportMatrix);
  720. return Vector3.TransformCoordinates(vector, finalMatrix);
  721. };
  722. Vector3.UnprojectFromTransform = function (source, viewportWidth, viewportHeight, world, transform) {
  723. var matrix = world.multiply(transform);
  724. matrix.invert();
  725. source.x = source.x / viewportWidth * 2 - 1;
  726. source.y = -(source.y / viewportHeight * 2 - 1);
  727. var vector = Vector3.TransformCoordinates(source, matrix);
  728. var num = source.x * matrix.m[3] + source.y * matrix.m[7] + source.z * matrix.m[11] + matrix.m[15];
  729. if (BABYLON.Tools.WithinEpsilon(num, 1.0)) {
  730. vector = vector.scale(1.0 / num);
  731. }
  732. return vector;
  733. };
  734. Vector3.Unproject = function (source, viewportWidth, viewportHeight, world, view, projection) {
  735. var matrix = world.multiply(view).multiply(projection);
  736. matrix.invert();
  737. source.x = source.x / viewportWidth * 2 - 1;
  738. source.y = -(source.y / viewportHeight * 2 - 1);
  739. var vector = Vector3.TransformCoordinates(source, matrix);
  740. var num = source.x * matrix.m[3] + source.y * matrix.m[7] + source.z * matrix.m[11] + matrix.m[15];
  741. if (BABYLON.Tools.WithinEpsilon(num, 1.0)) {
  742. vector = vector.scale(1.0 / num);
  743. }
  744. return vector;
  745. };
  746. Vector3.Minimize = function (left, right) {
  747. var min = left.clone();
  748. min.MinimizeInPlace(right);
  749. return min;
  750. };
  751. Vector3.Maximize = function (left, right) {
  752. var max = left.clone();
  753. max.MaximizeInPlace(right);
  754. return max;
  755. };
  756. Vector3.Distance = function (value1, value2) {
  757. return Math.sqrt(Vector3.DistanceSquared(value1, value2));
  758. };
  759. Vector3.DistanceSquared = function (value1, value2) {
  760. var x = value1.x - value2.x;
  761. var y = value1.y - value2.y;
  762. var z = value1.z - value2.z;
  763. return (x * x) + (y * y) + (z * z);
  764. };
  765. Vector3.Center = function (value1, value2) {
  766. var center = value1.add(value2);
  767. center.scaleInPlace(0.5);
  768. return center;
  769. };
  770. return Vector3;
  771. })();
  772. BABYLON.Vector3 = Vector3;
  773. //Vector4 class created for EulerAngle class conversion to Quaternion
  774. var Vector4 = (function () {
  775. function Vector4(x, y, z, w) {
  776. this.x = x;
  777. this.y = y;
  778. this.z = z;
  779. this.w = w;
  780. }
  781. Vector4.prototype.toString = function () {
  782. return "{X: " + this.x + " Y:" + this.y + " Z:" + this.z + "W:" + this.w + "}";
  783. };
  784. // Operators
  785. Vector4.prototype.asArray = function () {
  786. var result = [];
  787. this.toArray(result, 0);
  788. return result;
  789. };
  790. Vector4.prototype.toArray = function (array, index) {
  791. if (index === undefined) {
  792. index = 0;
  793. }
  794. array[index] = this.x;
  795. array[index + 1] = this.y;
  796. array[index + 2] = this.z;
  797. array[index + 3] = this.w;
  798. return this;
  799. };
  800. Vector4.prototype.addInPlace = function (otherVector) {
  801. this.x += otherVector.x;
  802. this.y += otherVector.y;
  803. this.z += otherVector.z;
  804. this.w += otherVector.w;
  805. return this;
  806. };
  807. Vector4.prototype.add = function (otherVector) {
  808. return new Vector4(this.x + otherVector.x, this.y + otherVector.y, this.z + otherVector.z, this.w + otherVector.w);
  809. };
  810. Vector4.prototype.addToRef = function (otherVector, result) {
  811. result.x = this.x + otherVector.x;
  812. result.y = this.y + otherVector.y;
  813. result.z = this.z + otherVector.z;
  814. result.w = this.w + otherVector.w;
  815. return this;
  816. };
  817. Vector4.prototype.subtractInPlace = function (otherVector) {
  818. this.x -= otherVector.x;
  819. this.y -= otherVector.y;
  820. this.z -= otherVector.z;
  821. this.w -= otherVector.w;
  822. return this;
  823. };
  824. Vector4.prototype.subtract = function (otherVector) {
  825. return new Vector4(this.x - otherVector.x, this.y - otherVector.y, this.z - otherVector.z, this.w - otherVector.w);
  826. };
  827. Vector4.prototype.subtractToRef = function (otherVector, result) {
  828. result.x = this.x - otherVector.x;
  829. result.y = this.y - otherVector.y;
  830. result.z = this.z - otherVector.z;
  831. result.w = this.w - otherVector.w;
  832. return this;
  833. };
  834. Vector4.prototype.subtractFromFloats = function (x, y, z, w) {
  835. return new Vector4(this.x - x, this.y - y, this.z - z, this.w - w);
  836. };
  837. Vector4.prototype.subtractFromFloatsToRef = function (x, y, z, w, result) {
  838. result.x = this.x - x;
  839. result.y = this.y - y;
  840. result.z = this.z - z;
  841. result.w = this.w - w;
  842. return this;
  843. };
  844. Vector4.prototype.negate = function () {
  845. return new Vector4(-this.x, -this.y, -this.z, -this.w);
  846. };
  847. Vector4.prototype.scaleInPlace = function (scale) {
  848. this.x *= scale;
  849. this.y *= scale;
  850. this.z *= scale;
  851. this.w *= scale;
  852. return this;
  853. };
  854. Vector4.prototype.scale = function (scale) {
  855. return new Vector4(this.x * scale, this.y * scale, this.z * scale, this.w * scale);
  856. };
  857. Vector4.prototype.scaleToRef = function (scale, result) {
  858. result.x = this.x * scale;
  859. result.y = this.y * scale;
  860. result.z = this.z * scale;
  861. result.w = this.w * scale;
  862. };
  863. Vector4.prototype.equals = function (otherVector) {
  864. return otherVector && this.x === otherVector.x && this.y === otherVector.y && this.z === otherVector.z && this.w === otherVector.w;
  865. };
  866. Vector4.prototype.equalsWithEpsilon = function (otherVector) {
  867. return Math.abs(this.x - otherVector.x) < BABYLON.Engine.Epsilon && Math.abs(this.y - otherVector.y) < BABYLON.Engine.Epsilon && Math.abs(this.z - otherVector.z) < BABYLON.Engine.Epsilon && Math.abs(this.w - otherVector.w) < BABYLON.Engine.Epsilon;
  868. };
  869. Vector4.prototype.equalsToFloats = function (x, y, z, w) {
  870. return this.x === x && this.y === y && this.z === z && this.w === w;
  871. };
  872. Vector4.prototype.multiplyInPlace = function (otherVector) {
  873. this.x *= otherVector.x;
  874. this.y *= otherVector.y;
  875. this.z *= otherVector.z;
  876. this.w *= otherVector.w;
  877. return this;
  878. };
  879. Vector4.prototype.multiply = function (otherVector) {
  880. return new Vector4(this.x * otherVector.x, this.y * otherVector.y, this.z * otherVector.z, this.w * otherVector.w);
  881. };
  882. Vector4.prototype.multiplyToRef = function (otherVector, result) {
  883. result.x = this.x * otherVector.x;
  884. result.y = this.y * otherVector.y;
  885. result.z = this.z * otherVector.z;
  886. result.w = this.w * otherVector.w;
  887. return this;
  888. };
  889. Vector4.prototype.multiplyByFloats = function (x, y, z, w) {
  890. return new Vector4(this.x * x, this.y * y, this.z * z, this.w * w);
  891. };
  892. Vector4.prototype.divide = function (otherVector) {
  893. return new Vector4(this.x / otherVector.x, this.y / otherVector.y, this.z / otherVector.z, this.w / otherVector.w);
  894. };
  895. Vector4.prototype.divideToRef = function (otherVector, result) {
  896. result.x = this.x / otherVector.x;
  897. result.y = this.y / otherVector.y;
  898. result.z = this.z / otherVector.z;
  899. result.w = this.w / otherVector.w;
  900. return this;
  901. };
  902. Vector4.prototype.MinimizeInPlace = function (other) {
  903. if (other.x < this.x)
  904. this.x = other.x;
  905. if (other.y < this.y)
  906. this.y = other.y;
  907. if (other.z < this.z)
  908. this.z = other.z;
  909. if (other.w < this.w)
  910. this.w = other.w;
  911. return this;
  912. };
  913. Vector4.prototype.MaximizeInPlace = function (other) {
  914. if (other.x > this.x)
  915. this.x = other.x;
  916. if (other.y > this.y)
  917. this.y = other.y;
  918. if (other.z > this.z)
  919. this.z = other.z;
  920. if (other.w > this.w)
  921. this.w = other.w;
  922. return this;
  923. };
  924. // Properties
  925. Vector4.prototype.length = function () {
  926. return Math.sqrt(this.x * this.x + this.y * this.y + this.z * this.z + this.w * this.w);
  927. };
  928. Vector4.prototype.lengthSquared = function () {
  929. return (this.x * this.x + this.y * this.y + this.z * this.z + this.w * this.w);
  930. };
  931. // Methods
  932. Vector4.prototype.normalize = function () {
  933. var len = this.length();
  934. if (len === 0)
  935. return this;
  936. var num = 1.0 / len;
  937. this.x *= num;
  938. this.y *= num;
  939. this.z *= num;
  940. this.w *= num;
  941. return this;
  942. };
  943. Vector4.prototype.clone = function () {
  944. return new Vector4(this.x, this.y, this.z, this.w);
  945. };
  946. Vector4.prototype.copyFrom = function (source) {
  947. this.x = source.x;
  948. this.y = source.y;
  949. this.z = source.z;
  950. this.w = source.w;
  951. return this;
  952. };
  953. Vector4.prototype.copyFromFloats = function (x, y, z, w) {
  954. this.x = x;
  955. this.y = y;
  956. this.z = z;
  957. this.w = w;
  958. return this;
  959. };
  960. // Statics
  961. Vector4.FromArray = function (array, offset) {
  962. if (!offset) {
  963. offset = 0;
  964. }
  965. return new Vector4(array[offset], array[offset + 1], array[offset + 2], array[offset + 3]);
  966. };
  967. Vector4.FromArrayToRef = function (array, offset, result) {
  968. result.x = array[offset];
  969. result.y = array[offset + 1];
  970. result.z = array[offset + 2];
  971. result.w = array[offset + 3];
  972. };
  973. Vector4.FromFloatArrayToRef = function (array, offset, result) {
  974. result.x = array[offset];
  975. result.y = array[offset + 1];
  976. result.z = array[offset + 2];
  977. result.w = array[offset + 3];
  978. };
  979. Vector4.FromFloatsToRef = function (x, y, z, w, result) {
  980. result.x = x;
  981. result.y = y;
  982. result.z = z;
  983. result.w = w;
  984. };
  985. Vector4.Zero = function () {
  986. return new Vector4(0, 0, 0, 0);
  987. };
  988. Vector4.Normalize = function (vector) {
  989. var result = Vector4.Zero();
  990. Vector4.NormalizeToRef(vector, result);
  991. return result;
  992. };
  993. Vector4.NormalizeToRef = function (vector, result) {
  994. result.copyFrom(vector);
  995. result.normalize();
  996. };
  997. Vector4.Minimize = function (left, right) {
  998. var min = left.clone();
  999. min.MinimizeInPlace(right);
  1000. return min;
  1001. };
  1002. Vector4.Maximize = function (left, right) {
  1003. var max = left.clone();
  1004. max.MaximizeInPlace(right);
  1005. return max;
  1006. };
  1007. Vector4.Distance = function (value1, value2) {
  1008. return Math.sqrt(Vector4.DistanceSquared(value1, value2));
  1009. };
  1010. Vector4.DistanceSquared = function (value1, value2) {
  1011. var x = value1.x - value2.x;
  1012. var y = value1.y - value2.y;
  1013. var z = value1.z - value2.z;
  1014. var w = value1.w - value2.w;
  1015. return (x * x) + (y * y) + (z * z) + (w * w);
  1016. };
  1017. Vector4.Center = function (value1, value2) {
  1018. var center = value1.add(value2);
  1019. center.scaleInPlace(0.5);
  1020. return center;
  1021. };
  1022. return Vector4;
  1023. })();
  1024. BABYLON.Vector4 = Vector4;
  1025. var Quaternion = (function () {
  1026. function Quaternion(x, y, z, w) {
  1027. if (x === void 0) { x = 0; }
  1028. if (y === void 0) { y = 0; }
  1029. if (z === void 0) { z = 0; }
  1030. if (w === void 0) { w = 1; }
  1031. this.x = x;
  1032. this.y = y;
  1033. this.z = z;
  1034. this.w = w;
  1035. }
  1036. Quaternion.prototype.toString = function () {
  1037. return "{X: " + this.x + " Y:" + this.y + " Z:" + this.z + " W:" + this.w + "}";
  1038. };
  1039. Quaternion.prototype.asArray = function () {
  1040. return [this.x, this.y, this.z, this.w];
  1041. };
  1042. Quaternion.prototype.equals = function (otherQuaternion) {
  1043. return otherQuaternion && this.x === otherQuaternion.x && this.y === otherQuaternion.y && this.z === otherQuaternion.z && this.w === otherQuaternion.w;
  1044. };
  1045. Quaternion.prototype.clone = function () {
  1046. return new Quaternion(this.x, this.y, this.z, this.w);
  1047. };
  1048. Quaternion.prototype.copyFrom = function (other) {
  1049. this.x = other.x;
  1050. this.y = other.y;
  1051. this.z = other.z;
  1052. this.w = other.w;
  1053. return this;
  1054. };
  1055. Quaternion.prototype.copyFromFloats = function (x, y, z, w) {
  1056. this.x = x;
  1057. this.y = y;
  1058. this.z = z;
  1059. this.w = w;
  1060. return this;
  1061. };
  1062. Quaternion.prototype.add = function (other) {
  1063. return new Quaternion(this.x + other.x, this.y + other.y, this.z + other.z, this.w + other.w);
  1064. };
  1065. Quaternion.prototype.subtract = function (other) {
  1066. return new Quaternion(this.x - other.x, this.y - other.y, this.z - other.z, this.w - other.w);
  1067. };
  1068. Quaternion.prototype.scale = function (value) {
  1069. return new Quaternion(this.x * value, this.y * value, this.z * value, this.w * value);
  1070. };
  1071. Quaternion.prototype.multiply = function (q1) {
  1072. var result = new Quaternion(0, 0, 0, 1.0);
  1073. this.multiplyToRef(q1, result);
  1074. return result;
  1075. };
  1076. Quaternion.prototype.multiplyToRef = function (q1, result) {
  1077. result.x = this.x * q1.w + this.y * q1.z - this.z * q1.y + this.w * q1.x;
  1078. result.y = -this.x * q1.z + this.y * q1.w + this.z * q1.x + this.w * q1.y;
  1079. result.z = this.x * q1.y - this.y * q1.x + this.z * q1.w + this.w * q1.z;
  1080. result.w = -this.x * q1.x - this.y * q1.y - this.z * q1.z + this.w * q1.w;
  1081. return this;
  1082. };
  1083. Quaternion.prototype.length = function () {
  1084. return Math.sqrt((this.x * this.x) + (this.y * this.y) + (this.z * this.z) + (this.w * this.w));
  1085. };
  1086. Quaternion.prototype.normalize = function () {
  1087. var length = 1.0 / this.length();
  1088. this.x *= length;
  1089. this.y *= length;
  1090. this.z *= length;
  1091. this.w *= length;
  1092. return this;
  1093. };
  1094. Quaternion.prototype.toEulerAngles = function () {
  1095. var result = Vector3.Zero();
  1096. this.toEulerAnglesToRef(result);
  1097. return result;
  1098. };
  1099. Quaternion.prototype.toEulerAnglesToRef = function (result) {
  1100. //result is an EulerAngles in the in the z-x-z convention
  1101. var qx = this.x;
  1102. var qy = this.y;
  1103. var qz = this.z;
  1104. var qw = this.w;
  1105. var qxy = qx * qy;
  1106. var qxz = qx * qz;
  1107. var qwy = qw * qy;
  1108. var qwz = qw * qz;
  1109. var qwx = qw * qx;
  1110. var qyz = qy * qz;
  1111. var sqx = qx * qx;
  1112. var sqy = qy * qy;
  1113. var determinant = sqx + sqy;
  1114. if (determinant !== 0.000 && determinant !== 1.000) {
  1115. result.x = Math.atan2(qxz + qwy, qwx - qyz);
  1116. result.y = Math.acos(1 - 2 * determinant);
  1117. result.z = Math.atan2(qxz - qwy, qwx + qyz);
  1118. }
  1119. else {
  1120. if (determinant === 0.0) {
  1121. result.x = 0.0;
  1122. result.y = 0.0;
  1123. result.z = Math.atan2(qxy - qwz, 0.5 - sqy - qz * qz); //actually, degeneracy gives us choice with x+z=Math.atan2(qxy-qwz,0.5-sqy-qz*qz)
  1124. }
  1125. else {
  1126. result.x = Math.atan2(qxy - qwz, 0.5 - sqy - qz * qz); //actually, degeneracy gives us choice with x-z=Math.atan2(qxy-qwz,0.5-sqy-qz*qz)
  1127. result.y = Math.PI;
  1128. result.z = 0.0;
  1129. }
  1130. }
  1131. return this;
  1132. };
  1133. Quaternion.prototype.toRotationMatrix = function (result) {
  1134. var xx = this.x * this.x;
  1135. var yy = this.y * this.y;
  1136. var zz = this.z * this.z;
  1137. var xy = this.x * this.y;
  1138. var zw = this.z * this.w;
  1139. var zx = this.z * this.x;
  1140. var yw = this.y * this.w;
  1141. var yz = this.y * this.z;
  1142. var xw = this.x * this.w;
  1143. result.m[0] = 1.0 - (2.0 * (yy + zz));
  1144. result.m[1] = 2.0 * (xy + zw);
  1145. result.m[2] = 2.0 * (zx - yw);
  1146. result.m[3] = 0;
  1147. result.m[4] = 2.0 * (xy - zw);
  1148. result.m[5] = 1.0 - (2.0 * (zz + xx));
  1149. result.m[6] = 2.0 * (yz + xw);
  1150. result.m[7] = 0;
  1151. result.m[8] = 2.0 * (zx + yw);
  1152. result.m[9] = 2.0 * (yz - xw);
  1153. result.m[10] = 1.0 - (2.0 * (yy + xx));
  1154. result.m[11] = 0;
  1155. result.m[12] = 0;
  1156. result.m[13] = 0;
  1157. result.m[14] = 0;
  1158. result.m[15] = 1.0;
  1159. return this;
  1160. };
  1161. Quaternion.prototype.fromRotationMatrix = function (matrix) {
  1162. Quaternion.FromRotationMatrixToRef(matrix, this);
  1163. return this;
  1164. };
  1165. // Statics
  1166. Quaternion.FromRotationMatrix = function (matrix) {
  1167. var result = new Quaternion();
  1168. Quaternion.FromRotationMatrixToRef(matrix, result);
  1169. return result;
  1170. };
  1171. Quaternion.FromRotationMatrixToRef = function (matrix, result) {
  1172. var data = matrix.m;
  1173. var m11 = data[0], m12 = data[4], m13 = data[8];
  1174. var m21 = data[1], m22 = data[5], m23 = data[9];
  1175. var m31 = data[2], m32 = data[6], m33 = data[10];
  1176. var trace = m11 + m22 + m33;
  1177. var s;
  1178. if (trace > 0) {
  1179. s = 0.5 / Math.sqrt(trace + 1.0);
  1180. result.w = 0.25 / s;
  1181. result.x = (m32 - m23) * s;
  1182. result.y = (m13 - m31) * s;
  1183. result.z = (m21 - m12) * s;
  1184. }
  1185. else if (m11 > m22 && m11 > m33) {
  1186. s = 2.0 * Math.sqrt(1.0 + m11 - m22 - m33);
  1187. result.w = (m32 - m23) / s;
  1188. result.x = 0.25 * s;
  1189. result.y = (m12 + m21) / s;
  1190. result.z = (m13 + m31) / s;
  1191. }
  1192. else if (m22 > m33) {
  1193. s = 2.0 * Math.sqrt(1.0 + m22 - m11 - m33);
  1194. result.w = (m13 - m31) / s;
  1195. result.x = (m12 + m21) / s;
  1196. result.y = 0.25 * s;
  1197. result.z = (m23 + m32) / s;
  1198. }
  1199. else {
  1200. s = 2.0 * Math.sqrt(1.0 + m33 - m11 - m22);
  1201. result.w = (m21 - m12) / s;
  1202. result.x = (m13 + m31) / s;
  1203. result.y = (m23 + m32) / s;
  1204. result.z = 0.25 * s;
  1205. }
  1206. };
  1207. Quaternion.Inverse = function (q) {
  1208. return new Quaternion(-q.x, -q.y, -q.z, q.w);
  1209. };
  1210. Quaternion.Identity = function () {
  1211. return new Quaternion(0, 0, 0, 1);
  1212. };
  1213. Quaternion.RotationAxis = function (axis, angle) {
  1214. var result = new Quaternion();
  1215. var sin = Math.sin(angle / 2);
  1216. result.w = Math.cos(angle / 2);
  1217. result.x = axis.x * sin;
  1218. result.y = axis.y * sin;
  1219. result.z = axis.z * sin;
  1220. return result;
  1221. };
  1222. Quaternion.FromArray = function (array, offset) {
  1223. if (!offset) {
  1224. offset = 0;
  1225. }
  1226. return new Quaternion(array[offset], array[offset + 1], array[offset + 2], array[offset + 3]);
  1227. };
  1228. Quaternion.RotationYawPitchRoll = function (yaw, pitch, roll) {
  1229. var result = new Quaternion();
  1230. Quaternion.RotationYawPitchRollToRef(yaw, pitch, roll, result);
  1231. return result;
  1232. };
  1233. Quaternion.RotationYawPitchRollToRef = function (yaw, pitch, roll, result) {
  1234. var halfRoll = roll * 0.5;
  1235. var halfPitch = pitch * 0.5;
  1236. var halfYaw = yaw * 0.5;
  1237. var sinRoll = Math.sin(halfRoll);
  1238. var cosRoll = Math.cos(halfRoll);
  1239. var sinPitch = Math.sin(halfPitch);
  1240. var cosPitch = Math.cos(halfPitch);
  1241. var sinYaw = Math.sin(halfYaw);
  1242. var cosYaw = Math.cos(halfYaw);
  1243. result.x = (cosYaw * sinPitch * cosRoll) + (sinYaw * cosPitch * sinRoll);
  1244. result.y = (sinYaw * cosPitch * cosRoll) - (cosYaw * sinPitch * sinRoll);
  1245. result.z = (cosYaw * cosPitch * sinRoll) - (sinYaw * sinPitch * cosRoll);
  1246. result.w = (cosYaw * cosPitch * cosRoll) + (sinYaw * sinPitch * sinRoll);
  1247. };
  1248. Quaternion.Slerp = function (left, right, amount) {
  1249. var num2;
  1250. var num3;
  1251. var num = amount;
  1252. var num4 = (((left.x * right.x) + (left.y * right.y)) + (left.z * right.z)) + (left.w * right.w);
  1253. var flag = false;
  1254. if (num4 < 0) {
  1255. flag = true;
  1256. num4 = -num4;
  1257. }
  1258. if (num4 > 0.999999) {
  1259. num3 = 1 - num;
  1260. num2 = flag ? -num : num;
  1261. }
  1262. else {
  1263. var num5 = Math.acos(num4);
  1264. var num6 = (1.0 / Math.sin(num5));
  1265. num3 = (Math.sin((1.0 - num) * num5)) * num6;
  1266. num2 = flag ? ((-Math.sin(num * num5)) * num6) : ((Math.sin(num * num5)) * num6);
  1267. }
  1268. return new Quaternion((num3 * left.x) + (num2 * right.x), (num3 * left.y) + (num2 * right.y), (num3 * left.z) + (num2 * right.z), (num3 * left.w) + (num2 * right.w));
  1269. };
  1270. return Quaternion;
  1271. })();
  1272. BABYLON.Quaternion = Quaternion;
  1273. var Matrix = (function () {
  1274. function Matrix() {
  1275. this.m = new Float32Array(16);
  1276. }
  1277. // Properties
  1278. Matrix.prototype.isIdentity = function () {
  1279. if (this.m[0] !== 1.0 || this.m[5] !== 1.0 || this.m[10] !== 1.0 || this.m[15] !== 1.0)
  1280. return false;
  1281. if (this.m[1] !== 0.0 || this.m[2] !== 0.0 || this.m[3] !== 0.0 || this.m[4] !== 0.0 || this.m[6] !== 0.0 || this.m[7] !== 0.0 || this.m[8] !== 0.0 || this.m[9] !== 0.0 || this.m[11] !== 0.0 || this.m[12] !== 0.0 || this.m[13] !== 0.0 || this.m[14] !== 0.0)
  1282. return false;
  1283. return true;
  1284. };
  1285. Matrix.prototype.determinant = function () {
  1286. var temp1 = (this.m[10] * this.m[15]) - (this.m[11] * this.m[14]);
  1287. var temp2 = (this.m[9] * this.m[15]) - (this.m[11] * this.m[13]);
  1288. var temp3 = (this.m[9] * this.m[14]) - (this.m[10] * this.m[13]);
  1289. var temp4 = (this.m[8] * this.m[15]) - (this.m[11] * this.m[12]);
  1290. var temp5 = (this.m[8] * this.m[14]) - (this.m[10] * this.m[12]);
  1291. var temp6 = (this.m[8] * this.m[13]) - (this.m[9] * this.m[12]);
  1292. return ((((this.m[0] * (((this.m[5] * temp1) - (this.m[6] * temp2)) + (this.m[7] * temp3))) - (this.m[1] * (((this.m[4] * temp1) - (this.m[6] * temp4)) + (this.m[7] * temp5)))) + (this.m[2] * (((this.m[4] * temp2) - (this.m[5] * temp4)) + (this.m[7] * temp6)))) - (this.m[3] * (((this.m[4] * temp3) - (this.m[5] * temp5)) + (this.m[6] * temp6))));
  1293. };
  1294. // Methods
  1295. Matrix.prototype.toArray = function () {
  1296. return this.m;
  1297. };
  1298. Matrix.prototype.asArray = function () {
  1299. return this.toArray();
  1300. };
  1301. Matrix.prototype.invert = function () {
  1302. this.invertToRef(this);
  1303. return this;
  1304. };
  1305. Matrix.prototype.invertToRef = function (other) {
  1306. var l1 = this.m[0];
  1307. var l2 = this.m[1];
  1308. var l3 = this.m[2];
  1309. var l4 = this.m[3];
  1310. var l5 = this.m[4];
  1311. var l6 = this.m[5];
  1312. var l7 = this.m[6];
  1313. var l8 = this.m[7];
  1314. var l9 = this.m[8];
  1315. var l10 = this.m[9];
  1316. var l11 = this.m[10];
  1317. var l12 = this.m[11];
  1318. var l13 = this.m[12];
  1319. var l14 = this.m[13];
  1320. var l15 = this.m[14];
  1321. var l16 = this.m[15];
  1322. var l17 = (l11 * l16) - (l12 * l15);
  1323. var l18 = (l10 * l16) - (l12 * l14);
  1324. var l19 = (l10 * l15) - (l11 * l14);
  1325. var l20 = (l9 * l16) - (l12 * l13);
  1326. var l21 = (l9 * l15) - (l11 * l13);
  1327. var l22 = (l9 * l14) - (l10 * l13);
  1328. var l23 = ((l6 * l17) - (l7 * l18)) + (l8 * l19);
  1329. var l24 = -(((l5 * l17) - (l7 * l20)) + (l8 * l21));
  1330. var l25 = ((l5 * l18) - (l6 * l20)) + (l8 * l22);
  1331. var l26 = -(((l5 * l19) - (l6 * l21)) + (l7 * l22));
  1332. var l27 = 1.0 / ((((l1 * l23) + (l2 * l24)) + (l3 * l25)) + (l4 * l26));
  1333. var l28 = (l7 * l16) - (l8 * l15);
  1334. var l29 = (l6 * l16) - (l8 * l14);
  1335. var l30 = (l6 * l15) - (l7 * l14);
  1336. var l31 = (l5 * l16) - (l8 * l13);
  1337. var l32 = (l5 * l15) - (l7 * l13);
  1338. var l33 = (l5 * l14) - (l6 * l13);
  1339. var l34 = (l7 * l12) - (l8 * l11);
  1340. var l35 = (l6 * l12) - (l8 * l10);
  1341. var l36 = (l6 * l11) - (l7 * l10);
  1342. var l37 = (l5 * l12) - (l8 * l9);
  1343. var l38 = (l5 * l11) - (l7 * l9);
  1344. var l39 = (l5 * l10) - (l6 * l9);
  1345. other.m[0] = l23 * l27;
  1346. other.m[4] = l24 * l27;
  1347. other.m[8] = l25 * l27;
  1348. other.m[12] = l26 * l27;
  1349. other.m[1] = -(((l2 * l17) - (l3 * l18)) + (l4 * l19)) * l27;
  1350. other.m[5] = (((l1 * l17) - (l3 * l20)) + (l4 * l21)) * l27;
  1351. other.m[9] = -(((l1 * l18) - (l2 * l20)) + (l4 * l22)) * l27;
  1352. other.m[13] = (((l1 * l19) - (l2 * l21)) + (l3 * l22)) * l27;
  1353. other.m[2] = (((l2 * l28) - (l3 * l29)) + (l4 * l30)) * l27;
  1354. other.m[6] = -(((l1 * l28) - (l3 * l31)) + (l4 * l32)) * l27;
  1355. other.m[10] = (((l1 * l29) - (l2 * l31)) + (l4 * l33)) * l27;
  1356. other.m[14] = -(((l1 * l30) - (l2 * l32)) + (l3 * l33)) * l27;
  1357. other.m[3] = -(((l2 * l34) - (l3 * l35)) + (l4 * l36)) * l27;
  1358. other.m[7] = (((l1 * l34) - (l3 * l37)) + (l4 * l38)) * l27;
  1359. other.m[11] = -(((l1 * l35) - (l2 * l37)) + (l4 * l39)) * l27;
  1360. other.m[15] = (((l1 * l36) - (l2 * l38)) + (l3 * l39)) * l27;
  1361. return this;
  1362. };
  1363. Matrix.prototype.setTranslation = function (vector3) {
  1364. this.m[12] = vector3.x;
  1365. this.m[13] = vector3.y;
  1366. this.m[14] = vector3.z;
  1367. return this;
  1368. };
  1369. Matrix.prototype.multiply = function (other) {
  1370. var result = new Matrix();
  1371. this.multiplyToRef(other, result);
  1372. return result;
  1373. };
  1374. Matrix.prototype.copyFrom = function (other) {
  1375. for (var index = 0; index < 16; index++) {
  1376. this.m[index] = other.m[index];
  1377. }
  1378. return this;
  1379. };
  1380. Matrix.prototype.copyToArray = function (array, offset) {
  1381. if (offset === void 0) { offset = 0; }
  1382. for (var index = 0; index < 16; index++) {
  1383. array[offset + index] = this.m[index];
  1384. }
  1385. return this;
  1386. };
  1387. Matrix.prototype.multiplyToRef = function (other, result) {
  1388. this.multiplyToArray(other, result.m, 0);
  1389. return this;
  1390. };
  1391. Matrix.prototype.multiplyToArray = function (other, result, offset) {
  1392. var tm0 = this.m[0];
  1393. var tm1 = this.m[1];
  1394. var tm2 = this.m[2];
  1395. var tm3 = this.m[3];
  1396. var tm4 = this.m[4];
  1397. var tm5 = this.m[5];
  1398. var tm6 = this.m[6];
  1399. var tm7 = this.m[7];
  1400. var tm8 = this.m[8];
  1401. var tm9 = this.m[9];
  1402. var tm10 = this.m[10];
  1403. var tm11 = this.m[11];
  1404. var tm12 = this.m[12];
  1405. var tm13 = this.m[13];
  1406. var tm14 = this.m[14];
  1407. var tm15 = this.m[15];
  1408. var om0 = other.m[0];
  1409. var om1 = other.m[1];
  1410. var om2 = other.m[2];
  1411. var om3 = other.m[3];
  1412. var om4 = other.m[4];
  1413. var om5 = other.m[5];
  1414. var om6 = other.m[6];
  1415. var om7 = other.m[7];
  1416. var om8 = other.m[8];
  1417. var om9 = other.m[9];
  1418. var om10 = other.m[10];
  1419. var om11 = other.m[11];
  1420. var om12 = other.m[12];
  1421. var om13 = other.m[13];
  1422. var om14 = other.m[14];
  1423. var om15 = other.m[15];
  1424. result[offset] = tm0 * om0 + tm1 * om4 + tm2 * om8 + tm3 * om12;
  1425. result[offset + 1] = tm0 * om1 + tm1 * om5 + tm2 * om9 + tm3 * om13;
  1426. result[offset + 2] = tm0 * om2 + tm1 * om6 + tm2 * om10 + tm3 * om14;
  1427. result[offset + 3] = tm0 * om3 + tm1 * om7 + tm2 * om11 + tm3 * om15;
  1428. result[offset + 4] = tm4 * om0 + tm5 * om4 + tm6 * om8 + tm7 * om12;
  1429. result[offset + 5] = tm4 * om1 + tm5 * om5 + tm6 * om9 + tm7 * om13;
  1430. result[offset + 6] = tm4 * om2 + tm5 * om6 + tm6 * om10 + tm7 * om14;
  1431. result[offset + 7] = tm4 * om3 + tm5 * om7 + tm6 * om11 + tm7 * om15;
  1432. result[offset + 8] = tm8 * om0 + tm9 * om4 + tm10 * om8 + tm11 * om12;
  1433. result[offset + 9] = tm8 * om1 + tm9 * om5 + tm10 * om9 + tm11 * om13;
  1434. result[offset + 10] = tm8 * om2 + tm9 * om6 + tm10 * om10 + tm11 * om14;
  1435. result[offset + 11] = tm8 * om3 + tm9 * om7 + tm10 * om11 + tm11 * om15;
  1436. result[offset + 12] = tm12 * om0 + tm13 * om4 + tm14 * om8 + tm15 * om12;
  1437. result[offset + 13] = tm12 * om1 + tm13 * om5 + tm14 * om9 + tm15 * om13;
  1438. result[offset + 14] = tm12 * om2 + tm13 * om6 + tm14 * om10 + tm15 * om14;
  1439. result[offset + 15] = tm12 * om3 + tm13 * om7 + tm14 * om11 + tm15 * om15;
  1440. return this;
  1441. };
  1442. Matrix.prototype.equals = function (value) {
  1443. return value && (this.m[0] === value.m[0] && this.m[1] === value.m[1] && this.m[2] === value.m[2] && this.m[3] === value.m[3] && this.m[4] === value.m[4] && this.m[5] === value.m[5] && this.m[6] === value.m[6] && this.m[7] === value.m[7] && this.m[8] === value.m[8] && this.m[9] === value.m[9] && this.m[10] === value.m[10] && this.m[11] === value.m[11] && this.m[12] === value.m[12] && this.m[13] === value.m[13] && this.m[14] === value.m[14] && this.m[15] === value.m[15]);
  1444. };
  1445. Matrix.prototype.clone = function () {
  1446. return Matrix.FromValues(this.m[0], this.m[1], this.m[2], this.m[3], this.m[4], this.m[5], this.m[6], this.m[7], this.m[8], this.m[9], this.m[10], this.m[11], this.m[12], this.m[13], this.m[14], this.m[15]);
  1447. };
  1448. Matrix.prototype.decompose = function (scale, rotation, translation) {
  1449. translation.x = this.m[12];
  1450. translation.y = this.m[13];
  1451. translation.z = this.m[14];
  1452. var xs = BABYLON.Tools.Sign(this.m[0] * this.m[1] * this.m[2] * this.m[3]) < 0 ? -1 : 1;
  1453. var ys = BABYLON.Tools.Sign(this.m[4] * this.m[5] * this.m[6] * this.m[7]) < 0 ? -1 : 1;
  1454. var zs = BABYLON.Tools.Sign(this.m[8] * this.m[9] * this.m[10] * this.m[11]) < 0 ? -1 : 1;
  1455. scale.x = xs * Math.sqrt(this.m[0] * this.m[0] + this.m[1] * this.m[1] + this.m[2] * this.m[2]);
  1456. scale.y = ys * Math.sqrt(this.m[4] * this.m[4] + this.m[5] * this.m[5] + this.m[6] * this.m[6]);
  1457. scale.z = zs * Math.sqrt(this.m[8] * this.m[8] + this.m[9] * this.m[9] + this.m[10] * this.m[10]);
  1458. if (scale.x === 0 || scale.y === 0 || scale.z === 0) {
  1459. rotation.x = 0;
  1460. rotation.y = 0;
  1461. rotation.z = 0;
  1462. rotation.w = 1;
  1463. return false;
  1464. }
  1465. var rotationMatrix = Matrix.FromValues(this.m[0] / scale.x, this.m[1] / scale.x, this.m[2] / scale.x, 0, this.m[4] / scale.y, this.m[5] / scale.y, this.m[6] / scale.y, 0, this.m[8] / scale.z, this.m[9] / scale.z, this.m[10] / scale.z, 0, 0, 0, 0, 1);
  1466. Quaternion.FromRotationMatrixToRef(rotationMatrix, rotation);
  1467. return true;
  1468. };
  1469. // Statics
  1470. Matrix.FromArray = function (array, offset) {
  1471. var result = new Matrix();
  1472. if (!offset) {
  1473. offset = 0;
  1474. }
  1475. Matrix.FromArrayToRef(array, offset, result);
  1476. return result;
  1477. };
  1478. Matrix.FromArrayToRef = function (array, offset, result) {
  1479. for (var index = 0; index < 16; index++) {
  1480. result.m[index] = array[index + offset];
  1481. }
  1482. };
  1483. Matrix.FromValuesToRef = function (initialM11, initialM12, initialM13, initialM14, initialM21, initialM22, initialM23, initialM24, initialM31, initialM32, initialM33, initialM34, initialM41, initialM42, initialM43, initialM44, result) {
  1484. result.m[0] = initialM11;
  1485. result.m[1] = initialM12;
  1486. result.m[2] = initialM13;
  1487. result.m[3] = initialM14;
  1488. result.m[4] = initialM21;
  1489. result.m[5] = initialM22;
  1490. result.m[6] = initialM23;
  1491. result.m[7] = initialM24;
  1492. result.m[8] = initialM31;
  1493. result.m[9] = initialM32;
  1494. result.m[10] = initialM33;
  1495. result.m[11] = initialM34;
  1496. result.m[12] = initialM41;
  1497. result.m[13] = initialM42;
  1498. result.m[14] = initialM43;
  1499. result.m[15] = initialM44;
  1500. };
  1501. Matrix.FromValues = function (initialM11, initialM12, initialM13, initialM14, initialM21, initialM22, initialM23, initialM24, initialM31, initialM32, initialM33, initialM34, initialM41, initialM42, initialM43, initialM44) {
  1502. var result = new Matrix();
  1503. result.m[0] = initialM11;
  1504. result.m[1] = initialM12;
  1505. result.m[2] = initialM13;
  1506. result.m[3] = initialM14;
  1507. result.m[4] = initialM21;
  1508. result.m[5] = initialM22;
  1509. result.m[6] = initialM23;
  1510. result.m[7] = initialM24;
  1511. result.m[8] = initialM31;
  1512. result.m[9] = initialM32;
  1513. result.m[10] = initialM33;
  1514. result.m[11] = initialM34;
  1515. result.m[12] = initialM41;
  1516. result.m[13] = initialM42;
  1517. result.m[14] = initialM43;
  1518. result.m[15] = initialM44;
  1519. return result;
  1520. };
  1521. Matrix.Compose = function (scale, rotation, translation) {
  1522. var result = Matrix.FromValues(scale.x, 0, 0, 0, 0, scale.y, 0, 0, 0, 0, scale.z, 0, 0, 0, 0, 1);
  1523. var rotationMatrix = Matrix.Identity();
  1524. rotation.toRotationMatrix(rotationMatrix);
  1525. result = result.multiply(rotationMatrix);
  1526. result.setTranslation(translation);
  1527. return result;
  1528. };
  1529. Matrix.Identity = function () {
  1530. return Matrix.FromValues(1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0);
  1531. };
  1532. Matrix.IdentityToRef = function (result) {
  1533. Matrix.FromValuesToRef(1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0, result);
  1534. };
  1535. Matrix.Zero = function () {
  1536. return Matrix.FromValues(0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0);
  1537. };
  1538. Matrix.RotationX = function (angle) {
  1539. var result = new Matrix();
  1540. Matrix.RotationXToRef(angle, result);
  1541. return result;
  1542. };
  1543. Matrix.Invert = function (source) {
  1544. var result = new Matrix();
  1545. source.invertToRef(result);
  1546. return result;
  1547. };
  1548. Matrix.RotationXToRef = function (angle, result) {
  1549. var s = Math.sin(angle);
  1550. var c = Math.cos(angle);
  1551. result.m[0] = 1.0;
  1552. result.m[15] = 1.0;
  1553. result.m[5] = c;
  1554. result.m[10] = c;
  1555. result.m[9] = -s;
  1556. result.m[6] = s;
  1557. result.m[1] = 0;
  1558. result.m[2] = 0;
  1559. result.m[3] = 0;
  1560. result.m[4] = 0;
  1561. result.m[7] = 0;
  1562. result.m[8] = 0;
  1563. result.m[11] = 0;
  1564. result.m[12] = 0;
  1565. result.m[13] = 0;
  1566. result.m[14] = 0;
  1567. };
  1568. Matrix.RotationY = function (angle) {
  1569. var result = new Matrix();
  1570. Matrix.RotationYToRef(angle, result);
  1571. return result;
  1572. };
  1573. Matrix.RotationYToRef = function (angle, result) {
  1574. var s = Math.sin(angle);
  1575. var c = Math.cos(angle);
  1576. result.m[5] = 1.0;
  1577. result.m[15] = 1.0;
  1578. result.m[0] = c;
  1579. result.m[2] = -s;
  1580. result.m[8] = s;
  1581. result.m[10] = c;
  1582. result.m[1] = 0;
  1583. result.m[3] = 0;
  1584. result.m[4] = 0;
  1585. result.m[6] = 0;
  1586. result.m[7] = 0;
  1587. result.m[9] = 0;
  1588. result.m[11] = 0;
  1589. result.m[12] = 0;
  1590. result.m[13] = 0;
  1591. result.m[14] = 0;
  1592. };
  1593. Matrix.RotationZ = function (angle) {
  1594. var result = new Matrix();
  1595. Matrix.RotationZToRef(angle, result);
  1596. return result;
  1597. };
  1598. Matrix.RotationZToRef = function (angle, result) {
  1599. var s = Math.sin(angle);
  1600. var c = Math.cos(angle);
  1601. result.m[10] = 1.0;
  1602. result.m[15] = 1.0;
  1603. result.m[0] = c;
  1604. result.m[1] = s;
  1605. result.m[4] = -s;
  1606. result.m[5] = c;
  1607. result.m[2] = 0;
  1608. result.m[3] = 0;
  1609. result.m[6] = 0;
  1610. result.m[7] = 0;
  1611. result.m[8] = 0;
  1612. result.m[9] = 0;
  1613. result.m[11] = 0;
  1614. result.m[12] = 0;
  1615. result.m[13] = 0;
  1616. result.m[14] = 0;
  1617. };
  1618. Matrix.RotationAxis = function (axis, angle) {
  1619. var s = Math.sin(-angle);
  1620. var c = Math.cos(-angle);
  1621. var c1 = 1 - c;
  1622. axis.normalize();
  1623. var result = Matrix.Zero();
  1624. result.m[0] = (axis.x * axis.x) * c1 + c;
  1625. result.m[1] = (axis.x * axis.y) * c1 - (axis.z * s);
  1626. result.m[2] = (axis.x * axis.z) * c1 + (axis.y * s);
  1627. result.m[3] = 0.0;
  1628. result.m[4] = (axis.y * axis.x) * c1 + (axis.z * s);
  1629. result.m[5] = (axis.y * axis.y) * c1 + c;
  1630. result.m[6] = (axis.y * axis.z) * c1 - (axis.x * s);
  1631. result.m[7] = 0.0;
  1632. result.m[8] = (axis.z * axis.x) * c1 - (axis.y * s);
  1633. result.m[9] = (axis.z * axis.y) * c1 + (axis.x * s);
  1634. result.m[10] = (axis.z * axis.z) * c1 + c;
  1635. result.m[11] = 0.0;
  1636. result.m[15] = 1.0;
  1637. return result;
  1638. };
  1639. Matrix.RotationYawPitchRoll = function (yaw, pitch, roll) {
  1640. var result = new Matrix();
  1641. Matrix.RotationYawPitchRollToRef(yaw, pitch, roll, result);
  1642. return result;
  1643. };
  1644. Matrix.RotationYawPitchRollToRef = function (yaw, pitch, roll, result) {
  1645. Quaternion.RotationYawPitchRollToRef(yaw, pitch, roll, this._tempQuaternion);
  1646. this._tempQuaternion.toRotationMatrix(result);
  1647. };
  1648. Matrix.Scaling = function (x, y, z) {
  1649. var result = Matrix.Zero();
  1650. Matrix.ScalingToRef(x, y, z, result);
  1651. return result;
  1652. };
  1653. Matrix.ScalingToRef = function (x, y, z, result) {
  1654. result.m[0] = x;
  1655. result.m[1] = 0;
  1656. result.m[2] = 0;
  1657. result.m[3] = 0;
  1658. result.m[4] = 0;
  1659. result.m[5] = y;
  1660. result.m[6] = 0;
  1661. result.m[7] = 0;
  1662. result.m[8] = 0;
  1663. result.m[9] = 0;
  1664. result.m[10] = z;
  1665. result.m[11] = 0;
  1666. result.m[12] = 0;
  1667. result.m[13] = 0;
  1668. result.m[14] = 0;
  1669. result.m[15] = 1.0;
  1670. };
  1671. Matrix.Translation = function (x, y, z) {
  1672. var result = Matrix.Identity();
  1673. Matrix.TranslationToRef(x, y, z, result);
  1674. return result;
  1675. };
  1676. Matrix.TranslationToRef = function (x, y, z, result) {
  1677. Matrix.FromValuesToRef(1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0, 0, x, y, z, 1.0, result);
  1678. };
  1679. Matrix.LookAtLH = function (eye, target, up) {
  1680. var result = Matrix.Zero();
  1681. Matrix.LookAtLHToRef(eye, target, up, result);
  1682. return result;
  1683. };
  1684. Matrix.LookAtLHToRef = function (eye, target, up, result) {
  1685. // Z axis
  1686. target.subtractToRef(eye, this._zAxis);
  1687. this._zAxis.normalize();
  1688. // X axis
  1689. Vector3.CrossToRef(up, this._zAxis, this._xAxis);
  1690. this._xAxis.normalize();
  1691. // Y axis
  1692. Vector3.CrossToRef(this._zAxis, this._xAxis, this._yAxis);
  1693. this._yAxis.normalize();
  1694. // Eye angles
  1695. var ex = -Vector3.Dot(this._xAxis, eye);
  1696. var ey = -Vector3.Dot(this._yAxis, eye);
  1697. var ez = -Vector3.Dot(this._zAxis, eye);
  1698. return Matrix.FromValuesToRef(this._xAxis.x, this._yAxis.x, this._zAxis.x, 0, this._xAxis.y, this._yAxis.y, this._zAxis.y, 0, this._xAxis.z, this._yAxis.z, this._zAxis.z, 0, ex, ey, ez, 1, result);
  1699. };
  1700. Matrix.OrthoLH = function (width, height, znear, zfar) {
  1701. var hw = 2.0 / width;
  1702. var hh = 2.0 / height;
  1703. var id = 1.0 / (zfar - znear);
  1704. var nid = znear / (znear - zfar);
  1705. return Matrix.FromValues(hw, 0, 0, 0, 0, hh, 0, 0, 0, 0, id, 0, 0, 0, nid, 1);
  1706. };
  1707. Matrix.OrthoOffCenterLH = function (left, right, bottom, top, znear, zfar) {
  1708. var matrix = Matrix.Zero();
  1709. Matrix.OrthoOffCenterLHToRef(left, right, bottom, top, znear, zfar, matrix);
  1710. return matrix;
  1711. };
  1712. Matrix.OrthoOffCenterLHToRef = function (left, right, bottom, top, znear, zfar, result) {
  1713. result.m[0] = 2.0 / (right - left);
  1714. result.m[1] = result.m[2] = result.m[3] = 0;
  1715. result.m[5] = 2.0 / (top - bottom);
  1716. result.m[4] = result.m[6] = result.m[7] = 0;
  1717. result.m[10] = -1.0 / (znear - zfar);
  1718. result.m[8] = result.m[9] = result.m[11] = 0;
  1719. result.m[12] = (left + right) / (left - right);
  1720. result.m[13] = (top + bottom) / (bottom - top);
  1721. result.m[14] = znear / (znear - zfar);
  1722. result.m[15] = 1.0;
  1723. };
  1724. Matrix.PerspectiveLH = function (width, height, znear, zfar) {
  1725. var matrix = Matrix.Zero();
  1726. matrix.m[0] = (2.0 * znear) / width;
  1727. matrix.m[1] = matrix.m[2] = matrix.m[3] = 0.0;
  1728. matrix.m[5] = (2.0 * znear) / height;
  1729. matrix.m[4] = matrix.m[6] = matrix.m[7] = 0.0;
  1730. matrix.m[10] = -zfar / (znear - zfar);
  1731. matrix.m[8] = matrix.m[9] = 0.0;
  1732. matrix.m[11] = 1.0;
  1733. matrix.m[12] = matrix.m[13] = matrix.m[15] = 0.0;
  1734. matrix.m[14] = (znear * zfar) / (znear - zfar);
  1735. return matrix;
  1736. };
  1737. Matrix.PerspectiveFovLH = function (fov, aspect, znear, zfar) {
  1738. var matrix = Matrix.Zero();
  1739. Matrix.PerspectiveFovLHToRef(fov, aspect, znear, zfar, matrix);
  1740. return matrix;
  1741. };
  1742. Matrix.PerspectiveFovLHToRef = function (fov, aspect, znear, zfar, result, fovMode) {
  1743. if (fovMode === void 0) { fovMode = BABYLON.Camera.FOVMODE_VERTICAL_FIXED; }
  1744. var tan = 1.0 / (Math.tan(fov * 0.5));
  1745. var v_fixed = (fovMode === BABYLON.Camera.FOVMODE_VERTICAL_FIXED);
  1746. if (v_fixed) {
  1747. result.m[0] = tan / aspect;
  1748. }
  1749. else {
  1750. result.m[0] = tan;
  1751. }
  1752. result.m[1] = result.m[2] = result.m[3] = 0.0;
  1753. if (v_fixed) {
  1754. result.m[5] = tan;
  1755. }
  1756. else {
  1757. result.m[5] = tan * aspect;
  1758. }
  1759. result.m[4] = result.m[6] = result.m[7] = 0.0;
  1760. result.m[8] = result.m[9] = 0.0;
  1761. result.m[10] = -zfar / (znear - zfar);
  1762. result.m[11] = 1.0;
  1763. result.m[12] = result.m[13] = result.m[15] = 0.0;
  1764. result.m[14] = (znear * zfar) / (znear - zfar);
  1765. };
  1766. Matrix.GetFinalMatrix = function (viewport, world, view, projection, zmin, zmax) {
  1767. var cw = viewport.width;
  1768. var ch = viewport.height;
  1769. var cx = viewport.x;
  1770. var cy = viewport.y;
  1771. var viewportMatrix = Matrix.FromValues(cw / 2.0, 0, 0, 0, 0, -ch / 2.0, 0, 0, 0, 0, zmax - zmin, 0, cx + cw / 2.0, ch / 2.0 + cy, zmin, 1);
  1772. return world.multiply(view).multiply(projection).multiply(viewportMatrix);
  1773. };
  1774. Matrix.Transpose = function (matrix) {
  1775. var result = new Matrix();
  1776. result.m[0] = matrix.m[0];
  1777. result.m[1] = matrix.m[4];
  1778. result.m[2] = matrix.m[8];
  1779. result.m[3] = matrix.m[12];
  1780. result.m[4] = matrix.m[1];
  1781. result.m[5] = matrix.m[5];
  1782. result.m[6] = matrix.m[9];
  1783. result.m[7] = matrix.m[13];
  1784. result.m[8] = matrix.m[2];
  1785. result.m[9] = matrix.m[6];
  1786. result.m[10] = matrix.m[10];
  1787. result.m[11] = matrix.m[14];
  1788. result.m[12] = matrix.m[3];
  1789. result.m[13] = matrix.m[7];
  1790. result.m[14] = matrix.m[11];
  1791. result.m[15] = matrix.m[15];
  1792. return result;
  1793. };
  1794. Matrix.Reflection = function (plane) {
  1795. var matrix = new Matrix();
  1796. Matrix.ReflectionToRef(plane, matrix);
  1797. return matrix;
  1798. };
  1799. Matrix.ReflectionToRef = function (plane, result) {
  1800. plane.normalize();
  1801. var x = plane.normal.x;
  1802. var y = plane.normal.y;
  1803. var z = plane.normal.z;
  1804. var temp = -2 * x;
  1805. var temp2 = -2 * y;
  1806. var temp3 = -2 * z;
  1807. result.m[0] = (temp * x) + 1;
  1808. result.m[1] = temp2 * x;
  1809. result.m[2] = temp3 * x;
  1810. result.m[3] = 0.0;
  1811. result.m[4] = temp * y;
  1812. result.m[5] = (temp2 * y) + 1;
  1813. result.m[6] = temp3 * y;
  1814. result.m[7] = 0.0;
  1815. result.m[8] = temp * z;
  1816. result.m[9] = temp2 * z;
  1817. result.m[10] = (temp3 * z) + 1;
  1818. result.m[11] = 0.0;
  1819. result.m[12] = temp * plane.d;
  1820. result.m[13] = temp2 * plane.d;
  1821. result.m[14] = temp3 * plane.d;
  1822. result.m[15] = 1.0;
  1823. };
  1824. Matrix._tempQuaternion = new Quaternion();
  1825. Matrix._xAxis = Vector3.Zero();
  1826. Matrix._yAxis = Vector3.Zero();
  1827. Matrix._zAxis = Vector3.Zero();
  1828. return Matrix;
  1829. })();
  1830. BABYLON.Matrix = Matrix;
  1831. var Plane = (function () {
  1832. function Plane(a, b, c, d) {
  1833. this.normal = new Vector3(a, b, c);
  1834. this.d = d;
  1835. }
  1836. Plane.prototype.asArray = function () {
  1837. return [this.normal.x, this.normal.y, this.normal.z, this.d];
  1838. };
  1839. // Methods
  1840. Plane.prototype.clone = function () {
  1841. return new Plane(this.normal.x, this.normal.y, this.normal.z, this.d);
  1842. };
  1843. Plane.prototype.normalize = function () {
  1844. var norm = (Math.sqrt((this.normal.x * this.normal.x) + (this.normal.y * this.normal.y) + (this.normal.z * this.normal.z)));
  1845. var magnitude = 0;
  1846. if (norm !== 0) {
  1847. magnitude = 1.0 / norm;
  1848. }
  1849. this.normal.x *= magnitude;
  1850. this.normal.y *= magnitude;
  1851. this.normal.z *= magnitude;
  1852. this.d *= magnitude;
  1853. return this;
  1854. };
  1855. Plane.prototype.transform = function (transformation) {
  1856. var transposedMatrix = Matrix.Transpose(transformation);
  1857. var x = this.normal.x;
  1858. var y = this.normal.y;
  1859. var z = this.normal.z;
  1860. var d = this.d;
  1861. var normalX = (((x * transposedMatrix.m[0]) + (y * transposedMatrix.m[1])) + (z * transposedMatrix.m[2])) + (d * transposedMatrix.m[3]);
  1862. var normalY = (((x * transposedMatrix.m[4]) + (y * transposedMatrix.m[5])) + (z * transposedMatrix.m[6])) + (d * transposedMatrix.m[7]);
  1863. var normalZ = (((x * transposedMatrix.m[8]) + (y * transposedMatrix.m[9])) + (z * transposedMatrix.m[10])) + (d * transposedMatrix.m[11]);
  1864. var finalD = (((x * transposedMatrix.m[12]) + (y * transposedMatrix.m[13])) + (z * transposedMatrix.m[14])) + (d * transposedMatrix.m[15]);
  1865. return new Plane(normalX, normalY, normalZ, finalD);
  1866. };
  1867. Plane.prototype.dotCoordinate = function (point) {
  1868. return ((((this.normal.x * point.x) + (this.normal.y * point.y)) + (this.normal.z * point.z)) + this.d);
  1869. };
  1870. Plane.prototype.copyFromPoints = function (point1, point2, point3) {
  1871. var x1 = point2.x - point1.x;
  1872. var y1 = point2.y - point1.y;
  1873. var z1 = point2.z - point1.z;
  1874. var x2 = point3.x - point1.x;
  1875. var y2 = point3.y - point1.y;
  1876. var z2 = point3.z - point1.z;
  1877. var yz = (y1 * z2) - (z1 * y2);
  1878. var xz = (z1 * x2) - (x1 * z2);
  1879. var xy = (x1 * y2) - (y1 * x2);
  1880. var pyth = (Math.sqrt((yz * yz) + (xz * xz) + (xy * xy)));
  1881. var invPyth;
  1882. if (pyth !== 0) {
  1883. invPyth = 1.0 / pyth;
  1884. }
  1885. else {
  1886. invPyth = 0;
  1887. }
  1888. this.normal.x = yz * invPyth;
  1889. this.normal.y = xz * invPyth;
  1890. this.normal.z = xy * invPyth;
  1891. this.d = -((this.normal.x * point1.x) + (this.normal.y * point1.y) + (this.normal.z * point1.z));
  1892. return this;
  1893. };
  1894. Plane.prototype.isFrontFacingTo = function (direction, epsilon) {
  1895. var dot = Vector3.Dot(this.normal, direction);
  1896. return (dot <= epsilon);
  1897. };
  1898. Plane.prototype.signedDistanceTo = function (point) {
  1899. return Vector3.Dot(point, this.normal) + this.d;
  1900. };
  1901. // Statics
  1902. Plane.FromArray = function (array) {
  1903. return new Plane(array[0], array[1], array[2], array[3]);
  1904. };
  1905. Plane.FromPoints = function (point1, point2, point3) {
  1906. var result = new Plane(0, 0, 0, 0);
  1907. result.copyFromPoints(point1, point2, point3);
  1908. return result;
  1909. };
  1910. Plane.FromPositionAndNormal = function (origin, normal) {
  1911. var result = new Plane(0, 0, 0, 0);
  1912. normal.normalize();
  1913. result.normal = normal;
  1914. result.d = -(normal.x * origin.x + normal.y * origin.y + normal.z * origin.z);
  1915. return result;
  1916. };
  1917. Plane.SignedDistanceToPlaneFromPositionAndNormal = function (origin, normal, point) {
  1918. var d = -(normal.x * origin.x + normal.y * origin.y + normal.z * origin.z);
  1919. return Vector3.Dot(point, normal) + d;
  1920. };
  1921. return Plane;
  1922. })();
  1923. BABYLON.Plane = Plane;
  1924. var Viewport = (function () {
  1925. function Viewport(x, y, width, height) {
  1926. this.x = x;
  1927. this.y = y;
  1928. this.width = width;
  1929. this.height = height;
  1930. }
  1931. Viewport.prototype.toGlobal = function (engine) {
  1932. var width = engine.getRenderWidth();
  1933. var height = engine.getRenderHeight();
  1934. return new Viewport(this.x * width, this.y * height, this.width * width, this.height * height);
  1935. };
  1936. return Viewport;
  1937. })();
  1938. BABYLON.Viewport = Viewport;
  1939. var Frustum = (function () {
  1940. function Frustum() {
  1941. }
  1942. Frustum.GetPlanes = function (transform) {
  1943. var frustumPlanes = [];
  1944. for (var index = 0; index < 6; index++) {
  1945. frustumPlanes.push(new Plane(0, 0, 0, 0));
  1946. }
  1947. Frustum.GetPlanesToRef(transform, frustumPlanes);
  1948. return frustumPlanes;
  1949. };
  1950. Frustum.GetPlanesToRef = function (transform, frustumPlanes) {
  1951. // Near
  1952. frustumPlanes[0].normal.x = transform.m[3] + transform.m[2];
  1953. frustumPlanes[0].normal.y = transform.m[7] + transform.m[6];
  1954. frustumPlanes[0].normal.z = transform.m[10] + transform.m[10];
  1955. frustumPlanes[0].d = transform.m[15] + transform.m[14];
  1956. frustumPlanes[0].normalize();
  1957. // Far
  1958. frustumPlanes[1].normal.x = transform.m[3] - transform.m[2];
  1959. frustumPlanes[1].normal.y = transform.m[7] - transform.m[6];
  1960. frustumPlanes[1].normal.z = transform.m[11] - transform.m[10];
  1961. frustumPlanes[1].d = transform.m[15] - transform.m[14];
  1962. frustumPlanes[1].normalize();
  1963. // Left
  1964. frustumPlanes[2].normal.x = transform.m[3] + transform.m[0];
  1965. frustumPlanes[2].normal.y = transform.m[7] + transform.m[4];
  1966. frustumPlanes[2].normal.z = transform.m[11] + transform.m[8];
  1967. frustumPlanes[2].d = transform.m[15] + transform.m[12];
  1968. frustumPlanes[2].normalize();
  1969. // Right
  1970. frustumPlanes[3].normal.x = transform.m[3] - transform.m[0];
  1971. frustumPlanes[3].normal.y = transform.m[7] - transform.m[4];
  1972. frustumPlanes[3].normal.z = transform.m[11] - transform.m[8];
  1973. frustumPlanes[3].d = transform.m[15] - transform.m[12];
  1974. frustumPlanes[3].normalize();
  1975. // Top
  1976. frustumPlanes[4].normal.x = transform.m[3] - transform.m[1];
  1977. frustumPlanes[4].normal.y = transform.m[7] - transform.m[5];
  1978. frustumPlanes[4].normal.z = transform.m[11] - transform.m[9];
  1979. frustumPlanes[4].d = transform.m[15] - transform.m[13];
  1980. frustumPlanes[4].normalize();
  1981. // Bottom
  1982. frustumPlanes[5].normal.x = transform.m[3] + transform.m[1];
  1983. frustumPlanes[5].normal.y = transform.m[7] + transform.m[5];
  1984. frustumPlanes[5].normal.z = transform.m[11] + transform.m[9];
  1985. frustumPlanes[5].d = transform.m[15] + transform.m[13];
  1986. frustumPlanes[5].normalize();
  1987. };
  1988. return Frustum;
  1989. })();
  1990. BABYLON.Frustum = Frustum;
  1991. var Ray = (function () {
  1992. function Ray(origin, direction, length) {
  1993. if (length === void 0) { length = Number.MAX_VALUE; }
  1994. this.origin = origin;
  1995. this.direction = direction;
  1996. this.length = length;
  1997. }
  1998. // Methods
  1999. Ray.prototype.intersectsBoxMinMax = function (minimum, maximum) {
  2000. var d = 0.0;
  2001. var maxValue = Number.MAX_VALUE;
  2002. if (Math.abs(this.direction.x) < 0.0000001) {
  2003. if (this.origin.x < minimum.x || this.origin.x > maximum.x) {
  2004. return false;
  2005. }
  2006. }
  2007. else {
  2008. var inv = 1.0 / this.direction.x;
  2009. var min = (minimum.x - this.origin.x) * inv;
  2010. var max = (maximum.x - this.origin.x) * inv;
  2011. if (max === -Infinity) {
  2012. max = Infinity;
  2013. }
  2014. if (min > max) {
  2015. var temp = min;
  2016. min = max;
  2017. max = temp;
  2018. }
  2019. d = Math.max(min, d);
  2020. maxValue = Math.min(max, maxValue);
  2021. if (d > maxValue) {
  2022. return false;
  2023. }
  2024. }
  2025. if (Math.abs(this.direction.y) < 0.0000001) {
  2026. if (this.origin.y < minimum.y || this.origin.y > maximum.y) {
  2027. return false;
  2028. }
  2029. }
  2030. else {
  2031. inv = 1.0 / this.direction.y;
  2032. min = (minimum.y - this.origin.y) * inv;
  2033. max = (maximum.y - this.origin.y) * inv;
  2034. if (max === -Infinity) {
  2035. max = Infinity;
  2036. }
  2037. if (min > max) {
  2038. temp = min;
  2039. min = max;
  2040. max = temp;
  2041. }
  2042. d = Math.max(min, d);
  2043. maxValue = Math.min(max, maxValue);
  2044. if (d > maxValue) {
  2045. return false;
  2046. }
  2047. }
  2048. if (Math.abs(this.direction.z) < 0.0000001) {
  2049. if (this.origin.z < minimum.z || this.origin.z > maximum.z) {
  2050. return false;
  2051. }
  2052. }
  2053. else {
  2054. inv = 1.0 / this.direction.z;
  2055. min = (minimum.z - this.origin.z) * inv;
  2056. max = (maximum.z - this.origin.z) * inv;
  2057. if (max === -Infinity) {
  2058. max = Infinity;
  2059. }
  2060. if (min > max) {
  2061. temp = min;
  2062. min = max;
  2063. max = temp;
  2064. }
  2065. d = Math.max(min, d);
  2066. maxValue = Math.min(max, maxValue);
  2067. if (d > maxValue) {
  2068. return false;
  2069. }
  2070. }
  2071. return true;
  2072. };
  2073. Ray.prototype.intersectsBox = function (box) {
  2074. return this.intersectsBoxMinMax(box.minimum, box.maximum);
  2075. };
  2076. Ray.prototype.intersectsSphere = function (sphere) {
  2077. var x = sphere.center.x - this.origin.x;
  2078. var y = sphere.center.y - this.origin.y;
  2079. var z = sphere.center.z - this.origin.z;
  2080. var pyth = (x * x) + (y * y) + (z * z);
  2081. var rr = sphere.radius * sphere.radius;
  2082. if (pyth <= rr) {
  2083. return true;
  2084. }
  2085. var dot = (x * this.direction.x) + (y * this.direction.y) + (z * this.direction.z);
  2086. if (dot < 0.0) {
  2087. return false;
  2088. }
  2089. var temp = pyth - (dot * dot);
  2090. return temp <= rr;
  2091. };
  2092. Ray.prototype.intersectsTriangle = function (vertex0, vertex1, vertex2) {
  2093. if (!this._edge1) {
  2094. this._edge1 = Vector3.Zero();
  2095. this._edge2 = Vector3.Zero();
  2096. this._pvec = Vector3.Zero();
  2097. this._tvec = Vector3.Zero();
  2098. this._qvec = Vector3.Zero();
  2099. }
  2100. vertex1.subtractToRef(vertex0, this._edge1);
  2101. vertex2.subtractToRef(vertex0, this._edge2);
  2102. Vector3.CrossToRef(this.direction, this._edge2, this._pvec);
  2103. var det = Vector3.Dot(this._edge1, this._pvec);
  2104. if (det === 0) {
  2105. return null;
  2106. }
  2107. var invdet = 1 / det;
  2108. this.origin.subtractToRef(vertex0, this._tvec);
  2109. var bu = Vector3.Dot(this._tvec, this._pvec) * invdet;
  2110. if (bu < 0 || bu > 1.0) {
  2111. return null;
  2112. }
  2113. Vector3.CrossToRef(this._tvec, this._edge1, this._qvec);
  2114. var bv = Vector3.Dot(this.direction, this._qvec) * invdet;
  2115. if (bv < 0 || bu + bv > 1.0) {
  2116. return null;
  2117. }
  2118. //check if the distance is longer than the predefined length.
  2119. var distance = Vector3.Dot(this._edge2, this._qvec) * invdet;
  2120. if (distance > this.length) {
  2121. return null;
  2122. }
  2123. return new BABYLON.IntersectionInfo(bu, bv, distance);
  2124. };
  2125. // Statics
  2126. Ray.CreateNew = function (x, y, viewportWidth, viewportHeight, world, view, projection) {
  2127. var start = Vector3.Unproject(new Vector3(x, y, 0), viewportWidth, viewportHeight, world, view, projection);
  2128. var end = Vector3.Unproject(new Vector3(x, y, 1), viewportWidth, viewportHeight, world, view, projection);
  2129. var direction = end.subtract(start);
  2130. direction.normalize();
  2131. return new Ray(start, direction);
  2132. };
  2133. /**
  2134. * Function will create a new transformed ray starting from origin and ending at the end point. Ray's length will be set, and ray will be
  2135. * transformed to the given world matrix.
  2136. * @param origin The origin point
  2137. * @param end The end point
  2138. * @param world a matrix to transform the ray to. Default is the identity matrix.
  2139. */
  2140. Ray.CreateNewFromTo = function (origin, end, world) {
  2141. if (world === void 0) { world = Matrix.Identity(); }
  2142. var direction = end.subtract(origin);
  2143. var length = Math.sqrt((direction.x * direction.x) + (direction.y * direction.y) + (direction.z * direction.z));
  2144. direction.normalize();
  2145. return Ray.Transform(new Ray(origin, direction, length), world);
  2146. };
  2147. Ray.Transform = function (ray, matrix) {
  2148. var newOrigin = Vector3.TransformCoordinates(ray.origin, matrix);
  2149. var newDirection = Vector3.TransformNormal(ray.direction, matrix);
  2150. return new Ray(newOrigin, newDirection, ray.length);
  2151. };
  2152. return Ray;
  2153. })();
  2154. BABYLON.Ray = Ray;
  2155. (function (Space) {
  2156. Space[Space["LOCAL"] = 0] = "LOCAL";
  2157. Space[Space["WORLD"] = 1] = "WORLD";
  2158. })(BABYLON.Space || (BABYLON.Space = {}));
  2159. var Space = BABYLON.Space;
  2160. var Axis = (function () {
  2161. function Axis() {
  2162. }
  2163. Axis.X = new Vector3(1, 0, 0);
  2164. Axis.Y = new Vector3(0, 1, 0);
  2165. Axis.Z = new Vector3(0, 0, 1);
  2166. return Axis;
  2167. })();
  2168. BABYLON.Axis = Axis;
  2169. ;
  2170. var BezierCurve = (function () {
  2171. function BezierCurve() {
  2172. }
  2173. BezierCurve.interpolate = function (t, x1, y1, x2, y2) {
  2174. // Extract X (which is equal to time here)
  2175. var f0 = 1 - 3 * x2 + 3 * x1;
  2176. var f1 = 3 * x2 - 6 * x1;
  2177. var f2 = 3 * x1;
  2178. var refinedT = t;
  2179. for (var i = 0; i < 5; i++) {
  2180. var refinedT2 = refinedT * refinedT;
  2181. var refinedT3 = refinedT2 * refinedT;
  2182. var x = f0 * refinedT3 + f1 * refinedT2 + f2 * refinedT;
  2183. var slope = 1.0 / (3.0 * f0 * refinedT2 + 2.0 * f1 * refinedT + f2);
  2184. refinedT -= (x - t) * slope;
  2185. refinedT = Math.min(1, Math.max(0, refinedT));
  2186. }
  2187. // Resolve cubic bezier for the given x
  2188. return 3 * Math.pow(1 - refinedT, 2) * refinedT * y1 + 3 * (1 - refinedT) * Math.pow(refinedT, 2) * y2 + Math.pow(refinedT, 3);
  2189. };
  2190. return BezierCurve;
  2191. })();
  2192. BABYLON.BezierCurve = BezierCurve;
  2193. (function (Orientation) {
  2194. Orientation[Orientation["CW"] = 0] = "CW";
  2195. Orientation[Orientation["CCW"] = 1] = "CCW";
  2196. })(BABYLON.Orientation || (BABYLON.Orientation = {}));
  2197. var Orientation = BABYLON.Orientation;
  2198. var Angle = (function () {
  2199. function Angle(radians) {
  2200. var _this = this;
  2201. this.degrees = function () { return _this._radians * 180 / Math.PI; };
  2202. this.radians = function () { return _this._radians; };
  2203. this._radians = radians;
  2204. if (this._radians < 0)
  2205. this._radians += (2 * Math.PI);
  2206. }
  2207. Angle.BetweenTwoPoints = function (a, b) {
  2208. var delta = b.subtract(a);
  2209. var theta = Math.atan2(delta.y, delta.x);
  2210. return new Angle(theta);
  2211. };
  2212. Angle.FromRadians = function (radians) {
  2213. return new Angle(radians);
  2214. };
  2215. Angle.FromDegrees = function (degrees) {
  2216. return new Angle(degrees * Math.PI / 180);
  2217. };
  2218. return Angle;
  2219. })();
  2220. BABYLON.Angle = Angle;
  2221. var Arc2 = (function () {
  2222. function Arc2(startPoint, midPoint, endPoint) {
  2223. this.startPoint = startPoint;
  2224. this.midPoint = midPoint;
  2225. this.endPoint = endPoint;
  2226. var temp = Math.pow(midPoint.x, 2) + Math.pow(midPoint.y, 2);
  2227. var startToMid = (Math.pow(startPoint.x, 2) + Math.pow(startPoint.y, 2) - temp) / 2.;
  2228. var midToEnd = (temp - Math.pow(endPoint.x, 2) - Math.pow(endPoint.y, 2)) / 2.;
  2229. var det = (startPoint.x - midPoint.x) * (midPoint.y - endPoint.y) - (midPoint.x - endPoint.x) * (startPoint.y - midPoint.y);
  2230. this.centerPoint = new Vector2((startToMid * (midPoint.y - endPoint.y) - midToEnd * (startPoint.y - midPoint.y)) / det, ((startPoint.x - midPoint.x) * midToEnd - (midPoint.x - endPoint.x) * startToMid) / det);
  2231. this.radius = this.centerPoint.subtract(this.startPoint).length();
  2232. this.startAngle = Angle.BetweenTwoPoints(this.centerPoint, this.startPoint);
  2233. var a1 = this.startAngle.degrees();
  2234. var a2 = Angle.BetweenTwoPoints(this.centerPoint, this.midPoint).degrees();
  2235. var a3 = Angle.BetweenTwoPoints(this.centerPoint, this.endPoint).degrees();
  2236. // angles correction
  2237. if (a2 - a1 > +180.0)
  2238. a2 -= 360.0;
  2239. if (a2 - a1 < -180.0)
  2240. a2 += 360.0;
  2241. if (a3 - a2 > +180.0)
  2242. a3 -= 360.0;
  2243. if (a3 - a2 < -180.0)
  2244. a3 += 360.0;
  2245. this.orientation = (a2 - a1) < 0 ? 0 /* CW */ : 1 /* CCW */;
  2246. this.angle = Angle.FromDegrees(this.orientation === 0 /* CW */ ? a1 - a3 : a3 - a1);
  2247. }
  2248. return Arc2;
  2249. })();
  2250. BABYLON.Arc2 = Arc2;
  2251. var PathCursor = (function () {
  2252. function PathCursor(path) {
  2253. this.path = path;
  2254. this._onchange = new Array();
  2255. this.value = 0;
  2256. this.animations = new Array();
  2257. }
  2258. PathCursor.prototype.getPoint = function () {
  2259. var point = this.path.getPointAtLengthPosition(this.value);
  2260. return new Vector3(point.x, 0, point.y);
  2261. };
  2262. PathCursor.prototype.moveAhead = function (step) {
  2263. if (step === void 0) { step = 0.002; }
  2264. this.move(step);
  2265. return this;
  2266. };
  2267. PathCursor.prototype.moveBack = function (step) {
  2268. if (step === void 0) { step = 0.002; }
  2269. this.move(-step);
  2270. return this;
  2271. };
  2272. PathCursor.prototype.move = function (step) {
  2273. if (Math.abs(step) > 1) {
  2274. throw "step size should be less than 1.";
  2275. }
  2276. this.value += step;
  2277. this.ensureLimits();
  2278. this.raiseOnChange();
  2279. return this;
  2280. };
  2281. PathCursor.prototype.ensureLimits = function () {
  2282. while (this.value > 1) {
  2283. this.value -= 1;
  2284. }
  2285. while (this.value < 0) {
  2286. this.value += 1;
  2287. }
  2288. return this;
  2289. };
  2290. // used by animation engine
  2291. PathCursor.prototype.markAsDirty = function (propertyName) {
  2292. this.ensureLimits();
  2293. this.raiseOnChange();
  2294. return this;
  2295. };
  2296. PathCursor.prototype.raiseOnChange = function () {
  2297. var _this = this;
  2298. this._onchange.forEach(function (f) { return f(_this); });
  2299. return this;
  2300. };
  2301. PathCursor.prototype.onchange = function (f) {
  2302. this._onchange.push(f);
  2303. return this;
  2304. };
  2305. return PathCursor;
  2306. })();
  2307. BABYLON.PathCursor = PathCursor;
  2308. var Path2 = (function () {
  2309. function Path2(x, y) {
  2310. this._points = [];
  2311. this._length = 0;
  2312. this.closed = false;
  2313. this._points.push(new Vector2(x, y));
  2314. }
  2315. Path2.prototype.addLineTo = function (x, y) {
  2316. if (closed) {
  2317. BABYLON.Tools.Error("cannot add lines to closed paths");
  2318. return this;
  2319. }
  2320. var newPoint = new Vector2(x, y);
  2321. var previousPoint = this._points[this._points.length - 1];
  2322. this._points.push(newPoint);
  2323. this._length += newPoint.subtract(previousPoint).length();
  2324. return this;
  2325. };
  2326. Path2.prototype.addArcTo = function (midX, midY, endX, endY, numberOfSegments) {
  2327. if (numberOfSegments === void 0) { numberOfSegments = 36; }
  2328. if (closed) {
  2329. BABYLON.Tools.Error("cannot add arcs to closed paths");
  2330. return this;
  2331. }
  2332. var startPoint = this._points[this._points.length - 1];
  2333. var midPoint = new Vector2(midX, midY);
  2334. var endPoint = new Vector2(endX, endY);
  2335. var arc = new Arc2(startPoint, midPoint, endPoint);
  2336. var increment = arc.angle.radians() / numberOfSegments;
  2337. if (arc.orientation === 0 /* CW */)
  2338. increment *= -1;
  2339. var currentAngle = arc.startAngle.radians() + increment;
  2340. for (var i = 0; i < numberOfSegments; i++) {
  2341. var x = Math.cos(currentAngle) * arc.radius + arc.centerPoint.x;
  2342. var y = Math.sin(currentAngle) * arc.radius + arc.centerPoint.y;
  2343. this.addLineTo(x, y);
  2344. currentAngle += increment;
  2345. }
  2346. return this;
  2347. };
  2348. Path2.prototype.close = function () {
  2349. this.closed = true;
  2350. return this;
  2351. };
  2352. Path2.prototype.length = function () {
  2353. var result = this._length;
  2354. if (!this.closed) {
  2355. var lastPoint = this._points[this._points.length - 1];
  2356. var firstPoint = this._points[0];
  2357. result += (firstPoint.subtract(lastPoint).length());
  2358. }
  2359. return result;
  2360. };
  2361. Path2.prototype.getPoints = function () {
  2362. return this._points;
  2363. };
  2364. Path2.prototype.getPointAtLengthPosition = function (normalizedLengthPosition) {
  2365. if (normalizedLengthPosition < 0 || normalizedLengthPosition > 1) {
  2366. BABYLON.Tools.Error("normalized length position should be between 0 and 1.");
  2367. return Vector2.Zero();
  2368. }
  2369. var lengthPosition = normalizedLengthPosition * this.length();
  2370. var previousOffset = 0;
  2371. for (var i = 0; i < this._points.length; i++) {
  2372. var j = (i + 1) % this._points.length;
  2373. var a = this._points[i];
  2374. var b = this._points[j];
  2375. var bToA = b.subtract(a);
  2376. var nextOffset = (bToA.length() + previousOffset);
  2377. if (lengthPosition >= previousOffset && lengthPosition <= nextOffset) {
  2378. var dir = bToA.normalize();
  2379. var localOffset = lengthPosition - previousOffset;
  2380. return new Vector2(a.x + (dir.x * localOffset), a.y + (dir.y * localOffset));
  2381. }
  2382. previousOffset = nextOffset;
  2383. }
  2384. BABYLON.Tools.Error("internal error");
  2385. return Vector2.Zero();
  2386. };
  2387. Path2.StartingAt = function (x, y) {
  2388. return new Path2(x, y);
  2389. };
  2390. return Path2;
  2391. })();
  2392. BABYLON.Path2 = Path2;
  2393. })(BABYLON || (BABYLON = {}));
  2394. //# sourceMappingURL=babylon.math.js.mapvar BABYLON;
  2395. (function (BABYLON) {
  2396. // Screenshots
  2397. var screenshotCanvas;
  2398. var cloneValue = function (source, destinationObject) {
  2399. if (!source)
  2400. return null;
  2401. if (source instanceof BABYLON.Mesh) {
  2402. return null;
  2403. }
  2404. if (source instanceof BABYLON.SubMesh) {
  2405. return source.clone(destinationObject);
  2406. }
  2407. else if (source.clone) {
  2408. return source.clone();
  2409. }
  2410. return null;
  2411. };
  2412. var Tools = (function () {
  2413. function Tools() {
  2414. }
  2415. Tools.GetFilename = function (path) {
  2416. var index = path.lastIndexOf("/");
  2417. if (index < 0)
  2418. return path;
  2419. return path.substring(index + 1);
  2420. };
  2421. Tools.GetDOMTextContent = function (element) {
  2422. var result = "";
  2423. var child = element.firstChild;
  2424. while (child) {
  2425. if (child.nodeType === 3) {
  2426. result += child.textContent;
  2427. }
  2428. child = child.nextSibling;
  2429. }
  2430. return result;
  2431. };
  2432. Tools.ToDegrees = function (angle) {
  2433. return angle * 180 / Math.PI;
  2434. };
  2435. Tools.ToRadians = function (angle) {
  2436. return angle * Math.PI / 180;
  2437. };
  2438. Tools.ExtractMinAndMaxIndexed = function (positions, indices, indexStart, indexCount) {
  2439. var minimum = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  2440. var maximum = new BABYLON.Vector3(-Number.MAX_VALUE, -Number.MAX_VALUE, -Number.MAX_VALUE);
  2441. for (var index = indexStart; index < indexStart + indexCount; index++) {
  2442. var current = new BABYLON.Vector3(positions[indices[index] * 3], positions[indices[index] * 3 + 1], positions[indices[index] * 3 + 2]);
  2443. minimum = BABYLON.Vector3.Minimize(current, minimum);
  2444. maximum = BABYLON.Vector3.Maximize(current, maximum);
  2445. }
  2446. return {
  2447. minimum: minimum,
  2448. maximum: maximum
  2449. };
  2450. };
  2451. Tools.ExtractMinAndMax = function (positions, start, count) {
  2452. var minimum = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  2453. var maximum = new BABYLON.Vector3(-Number.MAX_VALUE, -Number.MAX_VALUE, -Number.MAX_VALUE);
  2454. for (var index = start; index < start + count; index++) {
  2455. var current = new BABYLON.Vector3(positions[index * 3], positions[index * 3 + 1], positions[index * 3 + 2]);
  2456. minimum = BABYLON.Vector3.Minimize(current, minimum);
  2457. maximum = BABYLON.Vector3.Maximize(current, maximum);
  2458. }
  2459. return {
  2460. minimum: minimum,
  2461. maximum: maximum
  2462. };
  2463. };
  2464. Tools.MakeArray = function (obj, allowsNullUndefined) {
  2465. if (allowsNullUndefined !== true && (obj === undefined || obj == null))
  2466. return undefined;
  2467. return Array.isArray(obj) ? obj : [obj];
  2468. };
  2469. // Misc.
  2470. Tools.GetPointerPrefix = function () {
  2471. var eventPrefix = "pointer";
  2472. // Check if hand.js is referenced or if the browser natively supports pointer events
  2473. if (!navigator.pointerEnabled) {
  2474. eventPrefix = "mouse";
  2475. }
  2476. return eventPrefix;
  2477. };
  2478. Tools.QueueNewFrame = function (func) {
  2479. if (window.requestAnimationFrame)
  2480. window.requestAnimationFrame(func);
  2481. else if (window.msRequestAnimationFrame)
  2482. window.msRequestAnimationFrame(func);
  2483. else if (window.webkitRequestAnimationFrame)
  2484. window.webkitRequestAnimationFrame(func);
  2485. else if (window.mozRequestAnimationFrame)
  2486. window.mozRequestAnimationFrame(func);
  2487. else if (window.oRequestAnimationFrame)
  2488. window.oRequestAnimationFrame(func);
  2489. else {
  2490. window.setTimeout(func, 16);
  2491. }
  2492. };
  2493. Tools.RequestFullscreen = function (element) {
  2494. if (element.requestFullscreen)
  2495. element.requestFullscreen();
  2496. else if (element.msRequestFullscreen)
  2497. element.msRequestFullscreen();
  2498. else if (element.webkitRequestFullscreen)
  2499. element.webkitRequestFullscreen();
  2500. else if (element.mozRequestFullScreen)
  2501. element.mozRequestFullScreen();
  2502. };
  2503. Tools.ExitFullscreen = function () {
  2504. if (document.exitFullscreen) {
  2505. document.exitFullscreen();
  2506. }
  2507. else if (document.mozCancelFullScreen) {
  2508. document.mozCancelFullScreen();
  2509. }
  2510. else if (document.webkitCancelFullScreen) {
  2511. document.webkitCancelFullScreen();
  2512. }
  2513. else if (document.msCancelFullScreen) {
  2514. document.msCancelFullScreen();
  2515. }
  2516. };
  2517. // External files
  2518. Tools.CleanUrl = function (url) {
  2519. url = url.replace(/#/mg, "%23");
  2520. return url;
  2521. };
  2522. Tools.LoadImage = function (url, onload, onerror, database) {
  2523. url = Tools.CleanUrl(url);
  2524. var img = new Image();
  2525. if (url.substr(0, 5) !== "data:")
  2526. img.crossOrigin = 'anonymous';
  2527. img.onload = function () {
  2528. onload(img);
  2529. };
  2530. img.onerror = function (err) {
  2531. onerror(img, err);
  2532. };
  2533. var noIndexedDB = function () {
  2534. img.src = url;
  2535. };
  2536. var loadFromIndexedDB = function () {
  2537. database.loadImageFromDB(url, img);
  2538. };
  2539. //ANY database to do!
  2540. if (database && database.enableTexturesOffline && BABYLON.Database.isUASupportingBlobStorage) {
  2541. database.openAsync(loadFromIndexedDB, noIndexedDB);
  2542. }
  2543. else {
  2544. if (url.indexOf("file:") === -1) {
  2545. noIndexedDB();
  2546. }
  2547. else {
  2548. try {
  2549. var textureName = url.substring(5);
  2550. var blobURL;
  2551. try {
  2552. blobURL = URL.createObjectURL(BABYLON.FilesInput.FilesTextures[textureName], { oneTimeOnly: true });
  2553. }
  2554. catch (ex) {
  2555. // Chrome doesn't support oneTimeOnly parameter
  2556. blobURL = URL.createObjectURL(BABYLON.FilesInput.FilesTextures[textureName]);
  2557. }
  2558. img.src = blobURL;
  2559. }
  2560. catch (e) {
  2561. Tools.Log("Error while trying to load texture: " + textureName);
  2562. img.src = null;
  2563. }
  2564. }
  2565. }
  2566. return img;
  2567. };
  2568. //ANY
  2569. Tools.LoadFile = function (url, callback, progressCallBack, database, useArrayBuffer, onError) {
  2570. url = Tools.CleanUrl(url);
  2571. var noIndexedDB = function () {
  2572. var request = new XMLHttpRequest();
  2573. var loadUrl = Tools.BaseUrl + url;
  2574. request.open('GET', loadUrl, true);
  2575. if (useArrayBuffer) {
  2576. request.responseType = "arraybuffer";
  2577. }
  2578. request.onprogress = progressCallBack;
  2579. request.onreadystatechange = function () {
  2580. if (request.readyState === 4) {
  2581. if (request.status === 200 || Tools.ValidateXHRData(request, !useArrayBuffer ? 1 : 6)) {
  2582. callback(!useArrayBuffer ? request.responseText : request.response);
  2583. }
  2584. else {
  2585. if (onError) {
  2586. onError();
  2587. }
  2588. else {
  2589. throw new Error("Error status: " + request.status + " - Unable to load " + loadUrl);
  2590. }
  2591. }
  2592. }
  2593. };
  2594. request.send(null);
  2595. };
  2596. var loadFromIndexedDB = function () {
  2597. database.loadFileFromDB(url, callback, progressCallBack, noIndexedDB, useArrayBuffer);
  2598. };
  2599. if (url.indexOf("file:") !== -1) {
  2600. var fileName = url.substring(5);
  2601. Tools.ReadFile(BABYLON.FilesInput.FilesToLoad[fileName], callback, progressCallBack, true);
  2602. }
  2603. else {
  2604. // Caching all files
  2605. if (database && database.enableSceneOffline) {
  2606. database.openAsync(loadFromIndexedDB, noIndexedDB);
  2607. }
  2608. else {
  2609. noIndexedDB();
  2610. }
  2611. }
  2612. };
  2613. Tools.ReadFileAsDataURL = function (fileToLoad, callback, progressCallback) {
  2614. var reader = new FileReader();
  2615. reader.onload = function (e) {
  2616. callback(e.target.result);
  2617. };
  2618. reader.onprogress = progressCallback;
  2619. reader.readAsDataURL(fileToLoad);
  2620. };
  2621. Tools.ReadFile = function (fileToLoad, callback, progressCallBack, useArrayBuffer) {
  2622. var reader = new FileReader();
  2623. reader.onload = function (e) {
  2624. callback(e.target.result);
  2625. };
  2626. reader.onprogress = progressCallBack;
  2627. if (!useArrayBuffer) {
  2628. // Asynchronous read
  2629. reader.readAsText(fileToLoad);
  2630. }
  2631. else {
  2632. reader.readAsArrayBuffer(fileToLoad);
  2633. }
  2634. };
  2635. // Misc.
  2636. Tools.Clamp = function (value, min, max) {
  2637. if (min === void 0) { min = 0; }
  2638. if (max === void 0) { max = 1; }
  2639. return Math.min(max, Math.max(min, value));
  2640. };
  2641. // Returns -1 when value is a negative number and
  2642. // +1 when value is a positive number.
  2643. Tools.Sign = function (value) {
  2644. value = +value; // convert to a number
  2645. if (value === 0 || isNaN(value))
  2646. return value;
  2647. return value > 0 ? 1 : -1;
  2648. };
  2649. Tools.Format = function (value, decimals) {
  2650. if (decimals === void 0) { decimals = 2; }
  2651. return value.toFixed(decimals);
  2652. };
  2653. Tools.CheckExtends = function (v, min, max) {
  2654. if (v.x < min.x)
  2655. min.x = v.x;
  2656. if (v.y < min.y)
  2657. min.y = v.y;
  2658. if (v.z < min.z)
  2659. min.z = v.z;
  2660. if (v.x > max.x)
  2661. max.x = v.x;
  2662. if (v.y > max.y)
  2663. max.y = v.y;
  2664. if (v.z > max.z)
  2665. max.z = v.z;
  2666. };
  2667. Tools.WithinEpsilon = function (a, b, epsilon) {
  2668. if (epsilon === void 0) { epsilon = 1.401298E-45; }
  2669. var num = a - b;
  2670. return -epsilon <= num && num <= epsilon;
  2671. };
  2672. Tools.DeepCopy = function (source, destination, doNotCopyList, mustCopyList) {
  2673. for (var prop in source) {
  2674. if (prop[0] === "_" && (!mustCopyList || mustCopyList.indexOf(prop) === -1)) {
  2675. continue;
  2676. }
  2677. if (doNotCopyList && doNotCopyList.indexOf(prop) !== -1) {
  2678. continue;
  2679. }
  2680. var sourceValue = source[prop];
  2681. var typeOfSourceValue = typeof sourceValue;
  2682. if (typeOfSourceValue === "function") {
  2683. continue;
  2684. }
  2685. if (typeOfSourceValue === "object") {
  2686. if (sourceValue instanceof Array) {
  2687. destination[prop] = [];
  2688. if (sourceValue.length > 0) {
  2689. if (typeof sourceValue[0] == "object") {
  2690. for (var index = 0; index < sourceValue.length; index++) {
  2691. var clonedValue = cloneValue(sourceValue[index], destination);
  2692. if (destination[prop].indexOf(clonedValue) === -1) {
  2693. destination[prop].push(clonedValue);
  2694. }
  2695. }
  2696. }
  2697. else {
  2698. destination[prop] = sourceValue.slice(0);
  2699. }
  2700. }
  2701. }
  2702. else {
  2703. destination[prop] = cloneValue(sourceValue, destination);
  2704. }
  2705. }
  2706. else {
  2707. destination[prop] = sourceValue;
  2708. }
  2709. }
  2710. };
  2711. Tools.IsEmpty = function (obj) {
  2712. for (var i in obj) {
  2713. return false;
  2714. }
  2715. return true;
  2716. };
  2717. Tools.RegisterTopRootEvents = function (events) {
  2718. for (var index = 0; index < events.length; index++) {
  2719. var event = events[index];
  2720. window.addEventListener(event.name, event.handler, false);
  2721. try {
  2722. if (window.parent) {
  2723. window.parent.addEventListener(event.name, event.handler, false);
  2724. }
  2725. }
  2726. catch (e) {
  2727. }
  2728. }
  2729. };
  2730. Tools.UnregisterTopRootEvents = function (events) {
  2731. for (var index = 0; index < events.length; index++) {
  2732. var event = events[index];
  2733. window.removeEventListener(event.name, event.handler);
  2734. try {
  2735. if (window.parent) {
  2736. window.parent.removeEventListener(event.name, event.handler);
  2737. }
  2738. }
  2739. catch (e) {
  2740. }
  2741. }
  2742. };
  2743. Tools.CreateScreenshot = function (engine, camera, size) {
  2744. var width;
  2745. var height;
  2746. var scene = camera.getScene();
  2747. var previousCamera = null;
  2748. if (scene.activeCamera !== camera) {
  2749. previousCamera = scene.activeCamera;
  2750. scene.activeCamera = camera;
  2751. }
  2752. //If a precision value is specified
  2753. if (size.precision) {
  2754. width = Math.round(engine.getRenderWidth() * size.precision);
  2755. height = Math.round(width / engine.getAspectRatio(camera));
  2756. size = { width: width, height: height };
  2757. }
  2758. else if (size.width && size.height) {
  2759. width = size.width;
  2760. height = size.height;
  2761. }
  2762. else if (size.width && !size.height) {
  2763. width = size.width;
  2764. height = Math.round(width / engine.getAspectRatio(camera));
  2765. size = { width: width, height: height };
  2766. }
  2767. else if (size.height && !size.width) {
  2768. height = size.height;
  2769. width = Math.round(height * engine.getAspectRatio(camera));
  2770. size = { width: width, height: height };
  2771. }
  2772. else if (!isNaN(size)) {
  2773. height = size;
  2774. width = size;
  2775. }
  2776. else {
  2777. Tools.Error("Invalid 'size' parameter !");
  2778. return;
  2779. }
  2780. //At this point size can be a number, or an object (according to engine.prototype.createRenderTargetTexture method)
  2781. var texture = new BABYLON.RenderTargetTexture("screenShot", size, scene, false, false);
  2782. texture.renderList = scene.meshes;
  2783. texture.onAfterRender = function () {
  2784. // Read the contents of the framebuffer
  2785. var numberOfChannelsByLine = width * 4;
  2786. var halfHeight = height / 2;
  2787. //Reading datas from WebGL
  2788. var data = engine.readPixels(0, 0, width, height);
  2789. for (var i = 0; i < halfHeight; i++) {
  2790. for (var j = 0; j < numberOfChannelsByLine; j++) {
  2791. var currentCell = j + i * numberOfChannelsByLine;
  2792. var targetLine = height - i - 1;
  2793. var targetCell = j + targetLine * numberOfChannelsByLine;
  2794. var temp = data[currentCell];
  2795. data[currentCell] = data[targetCell];
  2796. data[targetCell] = temp;
  2797. }
  2798. }
  2799. // Create a 2D canvas to store the result
  2800. if (!screenshotCanvas) {
  2801. screenshotCanvas = document.createElement('canvas');
  2802. }
  2803. screenshotCanvas.width = width;
  2804. screenshotCanvas.height = height;
  2805. var context = screenshotCanvas.getContext('2d');
  2806. // Copy the pixels to a 2D canvas
  2807. var imageData = context.createImageData(width, height);
  2808. imageData.data.set(data);
  2809. context.putImageData(imageData, 0, 0);
  2810. var base64Image = screenshotCanvas.toDataURL();
  2811. //Creating a link if the browser have the download attribute on the a tag, to automatically start download generated image.
  2812. if (("download" in document.createElement("a"))) {
  2813. var a = window.document.createElement("a");
  2814. a.href = base64Image;
  2815. var date = new Date();
  2816. var stringDate = date.getFullYear() + "/" + date.getMonth() + "/" + date.getDate() + "-" + date.getHours() + ":" + date.getMinutes();
  2817. a.setAttribute("download", "screenshot-" + stringDate + ".png");
  2818. window.document.body.appendChild(a);
  2819. a.addEventListener("click", function () {
  2820. a.parentElement.removeChild(a);
  2821. });
  2822. a.click();
  2823. }
  2824. else {
  2825. var newWindow = window.open("");
  2826. var img = newWindow.document.createElement("img");
  2827. img.src = base64Image;
  2828. newWindow.document.body.appendChild(img);
  2829. }
  2830. };
  2831. scene.incrementRenderId();
  2832. texture.render(true);
  2833. texture.dispose();
  2834. if (previousCamera) {
  2835. scene.activeCamera = previousCamera;
  2836. }
  2837. };
  2838. // XHR response validator for local file scenario
  2839. Tools.ValidateXHRData = function (xhr, dataType) {
  2840. // 1 for text (.babylon, manifest and shaders), 2 for TGA, 4 for DDS, 7 for all
  2841. if (dataType === void 0) { dataType = 7; }
  2842. try {
  2843. if (dataType & 1) {
  2844. if (xhr.responseText && xhr.responseText.length > 0) {
  2845. return true;
  2846. }
  2847. else if (dataType === 1) {
  2848. return false;
  2849. }
  2850. }
  2851. if (dataType & 2) {
  2852. // Check header width and height since there is no "TGA" magic number
  2853. var tgaHeader = BABYLON.Internals.TGATools.GetTGAHeader(xhr.response);
  2854. if (tgaHeader.width && tgaHeader.height && tgaHeader.width > 0 && tgaHeader.height > 0) {
  2855. return true;
  2856. }
  2857. else if (dataType === 2) {
  2858. return false;
  2859. }
  2860. }
  2861. if (dataType & 4) {
  2862. // Check for the "DDS" magic number
  2863. var ddsHeader = new Uint8Array(xhr.response, 0, 3);
  2864. if (ddsHeader[0] === 68 && ddsHeader[1] === 68 && ddsHeader[2] === 83) {
  2865. return true;
  2866. }
  2867. else {
  2868. return false;
  2869. }
  2870. }
  2871. }
  2872. catch (e) {
  2873. }
  2874. return false;
  2875. };
  2876. Object.defineProperty(Tools, "NoneLogLevel", {
  2877. get: function () {
  2878. return Tools._NoneLogLevel;
  2879. },
  2880. enumerable: true,
  2881. configurable: true
  2882. });
  2883. Object.defineProperty(Tools, "MessageLogLevel", {
  2884. get: function () {
  2885. return Tools._MessageLogLevel;
  2886. },
  2887. enumerable: true,
  2888. configurable: true
  2889. });
  2890. Object.defineProperty(Tools, "WarningLogLevel", {
  2891. get: function () {
  2892. return Tools._WarningLogLevel;
  2893. },
  2894. enumerable: true,
  2895. configurable: true
  2896. });
  2897. Object.defineProperty(Tools, "ErrorLogLevel", {
  2898. get: function () {
  2899. return Tools._ErrorLogLevel;
  2900. },
  2901. enumerable: true,
  2902. configurable: true
  2903. });
  2904. Object.defineProperty(Tools, "AllLogLevel", {
  2905. get: function () {
  2906. return Tools._MessageLogLevel | Tools._WarningLogLevel | Tools._ErrorLogLevel;
  2907. },
  2908. enumerable: true,
  2909. configurable: true
  2910. });
  2911. Tools._AddLogEntry = function (entry) {
  2912. Tools._LogCache = entry + Tools._LogCache;
  2913. if (Tools.OnNewCacheEntry) {
  2914. Tools.OnNewCacheEntry(entry);
  2915. }
  2916. };
  2917. Tools._FormatMessage = function (message) {
  2918. var padStr = function (i) { return (i < 10) ? "0" + i : "" + i; };
  2919. var date = new Date();
  2920. return "[" + padStr(date.getHours()) + ":" + padStr(date.getMinutes()) + ":" + padStr(date.getSeconds()) + "]: " + message;
  2921. };
  2922. Tools._LogDisabled = function (message) {
  2923. // nothing to do
  2924. };
  2925. Tools._LogEnabled = function (message) {
  2926. var formattedMessage = Tools._FormatMessage(message);
  2927. console.log("BJS - " + formattedMessage);
  2928. var entry = "<div style='color:white'>" + formattedMessage + "</div><br>";
  2929. Tools._AddLogEntry(entry);
  2930. };
  2931. Tools._WarnDisabled = function (message) {
  2932. // nothing to do
  2933. };
  2934. Tools._WarnEnabled = function (message) {
  2935. var formattedMessage = Tools._FormatMessage(message);
  2936. console.warn("BJS - " + formattedMessage);
  2937. var entry = "<div style='color:orange'>" + formattedMessage + "</div><br>";
  2938. Tools._AddLogEntry(entry);
  2939. };
  2940. Tools._ErrorDisabled = function (message) {
  2941. // nothing to do
  2942. };
  2943. Tools._ErrorEnabled = function (message) {
  2944. var formattedMessage = Tools._FormatMessage(message);
  2945. console.error("BJS - " + formattedMessage);
  2946. var entry = "<div style='color:red'>" + formattedMessage + "</div><br>";
  2947. Tools._AddLogEntry(entry);
  2948. };
  2949. Object.defineProperty(Tools, "LogCache", {
  2950. get: function () {
  2951. return Tools._LogCache;
  2952. },
  2953. enumerable: true,
  2954. configurable: true
  2955. });
  2956. Object.defineProperty(Tools, "LogLevels", {
  2957. set: function (level) {
  2958. if ((level & Tools.MessageLogLevel) === Tools.MessageLogLevel) {
  2959. Tools.Log = Tools._LogEnabled;
  2960. }
  2961. else {
  2962. Tools.Log = Tools._LogDisabled;
  2963. }
  2964. if ((level & Tools.WarningLogLevel) === Tools.WarningLogLevel) {
  2965. Tools.Warn = Tools._WarnEnabled;
  2966. }
  2967. else {
  2968. Tools.Warn = Tools._WarnDisabled;
  2969. }
  2970. if ((level & Tools.ErrorLogLevel) === Tools.ErrorLogLevel) {
  2971. Tools.Error = Tools._ErrorEnabled;
  2972. }
  2973. else {
  2974. Tools.Error = Tools._ErrorDisabled;
  2975. }
  2976. },
  2977. enumerable: true,
  2978. configurable: true
  2979. });
  2980. Object.defineProperty(Tools, "PerformanceNoneLogLevel", {
  2981. get: function () {
  2982. return Tools._PerformanceNoneLogLevel;
  2983. },
  2984. enumerable: true,
  2985. configurable: true
  2986. });
  2987. Object.defineProperty(Tools, "PerformanceUserMarkLogLevel", {
  2988. get: function () {
  2989. return Tools._PerformanceUserMarkLogLevel;
  2990. },
  2991. enumerable: true,
  2992. configurable: true
  2993. });
  2994. Object.defineProperty(Tools, "PerformanceConsoleLogLevel", {
  2995. get: function () {
  2996. return Tools._PerformanceConsoleLogLevel;
  2997. },
  2998. enumerable: true,
  2999. configurable: true
  3000. });
  3001. Object.defineProperty(Tools, "PerformanceLogLevel", {
  3002. set: function (level) {
  3003. if ((level & Tools.PerformanceUserMarkLogLevel) === Tools.PerformanceUserMarkLogLevel) {
  3004. Tools.StartPerformanceCounter = Tools._StartUserMark;
  3005. Tools.EndPerformanceCounter = Tools._EndUserMark;
  3006. return;
  3007. }
  3008. if ((level & Tools.PerformanceConsoleLogLevel) === Tools.PerformanceConsoleLogLevel) {
  3009. Tools.StartPerformanceCounter = Tools._StartPerformanceConsole;
  3010. Tools.EndPerformanceCounter = Tools._EndPerformanceConsole;
  3011. return;
  3012. }
  3013. Tools.StartPerformanceCounter = Tools._StartPerformanceCounterDisabled;
  3014. Tools.EndPerformanceCounter = Tools._EndPerformanceCounterDisabled;
  3015. },
  3016. enumerable: true,
  3017. configurable: true
  3018. });
  3019. Tools._StartPerformanceCounterDisabled = function (counterName, condition) {
  3020. };
  3021. Tools._EndPerformanceCounterDisabled = function (counterName, condition) {
  3022. };
  3023. Tools._StartUserMark = function (counterName, condition) {
  3024. if (condition === void 0) { condition = true; }
  3025. if (!condition || !Tools._performance.mark) {
  3026. return;
  3027. }
  3028. Tools._performance.mark(counterName + "-Begin");
  3029. };
  3030. Tools._EndUserMark = function (counterName, condition) {
  3031. if (condition === void 0) { condition = true; }
  3032. if (!condition || !Tools._performance.mark) {
  3033. return;
  3034. }
  3035. Tools._performance.mark(counterName + "-End");
  3036. Tools._performance.measure(counterName, counterName + "-Begin", counterName + "-End");
  3037. };
  3038. Tools._StartPerformanceConsole = function (counterName, condition) {
  3039. if (condition === void 0) { condition = true; }
  3040. if (!condition) {
  3041. return;
  3042. }
  3043. Tools._StartUserMark(counterName, condition);
  3044. if (console.time) {
  3045. console.time(counterName);
  3046. }
  3047. };
  3048. Tools._EndPerformanceConsole = function (counterName, condition) {
  3049. if (condition === void 0) { condition = true; }
  3050. if (!condition) {
  3051. return;
  3052. }
  3053. Tools._EndUserMark(counterName, condition);
  3054. if (console.time) {
  3055. console.timeEnd(counterName);
  3056. }
  3057. };
  3058. Object.defineProperty(Tools, "Now", {
  3059. get: function () {
  3060. if (window.performance && window.performance.now) {
  3061. return window.performance.now();
  3062. }
  3063. return new Date().getTime();
  3064. },
  3065. enumerable: true,
  3066. configurable: true
  3067. });
  3068. // Deprecated
  3069. Tools.GetFps = function () {
  3070. Tools.Warn("Tools.GetFps() is deprecated. Please use engine.getFps() instead");
  3071. return 0;
  3072. };
  3073. Tools.BaseUrl = "";
  3074. Tools.GetExponantOfTwo = function (value, max) {
  3075. var count = 1;
  3076. do {
  3077. count *= 2;
  3078. } while (count < value);
  3079. if (count > max)
  3080. count = max;
  3081. return count;
  3082. };
  3083. // Logs
  3084. Tools._NoneLogLevel = 0;
  3085. Tools._MessageLogLevel = 1;
  3086. Tools._WarningLogLevel = 2;
  3087. Tools._ErrorLogLevel = 4;
  3088. Tools._LogCache = "";
  3089. Tools.Log = Tools._LogEnabled;
  3090. Tools.Warn = Tools._WarnEnabled;
  3091. Tools.Error = Tools._ErrorEnabled;
  3092. // Performances
  3093. Tools._PerformanceNoneLogLevel = 0;
  3094. Tools._PerformanceUserMarkLogLevel = 1;
  3095. Tools._PerformanceConsoleLogLevel = 2;
  3096. Tools._performance = window.performance;
  3097. Tools.StartPerformanceCounter = Tools._StartPerformanceCounterDisabled;
  3098. Tools.EndPerformanceCounter = Tools._EndPerformanceCounterDisabled;
  3099. return Tools;
  3100. })();
  3101. BABYLON.Tools = Tools;
  3102. /**
  3103. * An implementation of a loop for asynchronous functions.
  3104. */
  3105. var AsyncLoop = (function () {
  3106. /**
  3107. * Constroctor.
  3108. * @param iterations the number of iterations.
  3109. * @param _fn the function to run each iteration
  3110. * @param _successCallback the callback that will be called upon succesful execution
  3111. * @param offset starting offset.
  3112. */
  3113. function AsyncLoop(iterations, _fn, _successCallback, offset) {
  3114. if (offset === void 0) { offset = 0; }
  3115. this.iterations = iterations;
  3116. this._fn = _fn;
  3117. this._successCallback = _successCallback;
  3118. this.index = offset - 1;
  3119. this._done = false;
  3120. }
  3121. /**
  3122. * Execute the next iteration. Must be called after the last iteration was finished.
  3123. */
  3124. AsyncLoop.prototype.executeNext = function () {
  3125. if (!this._done) {
  3126. if (this.index + 1 < this.iterations) {
  3127. ++this.index;
  3128. this._fn(this);
  3129. }
  3130. else {
  3131. this.breakLoop();
  3132. }
  3133. }
  3134. };
  3135. /**
  3136. * Break the loop and run the success callback.
  3137. */
  3138. AsyncLoop.prototype.breakLoop = function () {
  3139. this._done = true;
  3140. this._successCallback();
  3141. };
  3142. /**
  3143. * Helper function
  3144. */
  3145. AsyncLoop.Run = function (iterations, _fn, _successCallback, offset) {
  3146. if (offset === void 0) { offset = 0; }
  3147. var loop = new AsyncLoop(iterations, _fn, _successCallback, offset);
  3148. loop.executeNext();
  3149. return loop;
  3150. };
  3151. /**
  3152. * A for-loop that will run a given number of iterations synchronous and the rest async.
  3153. * @param iterations total number of iterations
  3154. * @param syncedIterations number of synchronous iterations in each async iteration.
  3155. * @param fn the function to call each iteration.
  3156. * @param callback a success call back that will be called when iterating stops.
  3157. * @param breakFunction a break condition (optional)
  3158. * @param timeout timeout settings for the setTimeout function. default - 0.
  3159. * @constructor
  3160. */
  3161. AsyncLoop.SyncAsyncForLoop = function (iterations, syncedIterations, fn, callback, breakFunction, timeout) {
  3162. if (timeout === void 0) { timeout = 0; }
  3163. AsyncLoop.Run(Math.ceil(iterations / syncedIterations), function (loop) {
  3164. if (breakFunction && breakFunction())
  3165. loop.breakLoop();
  3166. else {
  3167. setTimeout(function () {
  3168. for (var i = 0; i < syncedIterations; ++i) {
  3169. var iteration = (loop.index * syncedIterations) + i;
  3170. if (iteration >= iterations)
  3171. break;
  3172. fn(iteration);
  3173. if (breakFunction && breakFunction()) {
  3174. loop.breakLoop();
  3175. break;
  3176. }
  3177. }
  3178. loop.executeNext();
  3179. }, timeout);
  3180. }
  3181. }, callback);
  3182. };
  3183. return AsyncLoop;
  3184. })();
  3185. BABYLON.AsyncLoop = AsyncLoop;
  3186. })(BABYLON || (BABYLON = {}));
  3187. //# sourceMappingURL=babylon.tools.js.mapvar BABYLON;
  3188. (function (BABYLON) {
  3189. var _DepthCullingState = (function () {
  3190. function _DepthCullingState() {
  3191. this._isDepthTestDirty = false;
  3192. this._isDepthMaskDirty = false;
  3193. this._isDepthFuncDirty = false;
  3194. this._isCullFaceDirty = false;
  3195. this._isCullDirty = false;
  3196. }
  3197. Object.defineProperty(_DepthCullingState.prototype, "isDirty", {
  3198. get: function () {
  3199. return this._isDepthFuncDirty || this._isDepthTestDirty || this._isDepthMaskDirty || this._isCullFaceDirty || this._isCullDirty;
  3200. },
  3201. enumerable: true,
  3202. configurable: true
  3203. });
  3204. Object.defineProperty(_DepthCullingState.prototype, "cullFace", {
  3205. get: function () {
  3206. return this._cullFace;
  3207. },
  3208. set: function (value) {
  3209. if (this._cullFace === value) {
  3210. return;
  3211. }
  3212. this._cullFace = value;
  3213. this._isCullFaceDirty = true;
  3214. },
  3215. enumerable: true,
  3216. configurable: true
  3217. });
  3218. Object.defineProperty(_DepthCullingState.prototype, "cull", {
  3219. get: function () {
  3220. return this._cull;
  3221. },
  3222. set: function (value) {
  3223. if (this._cull === value) {
  3224. return;
  3225. }
  3226. this._cull = value;
  3227. this._isCullDirty = true;
  3228. },
  3229. enumerable: true,
  3230. configurable: true
  3231. });
  3232. Object.defineProperty(_DepthCullingState.prototype, "depthFunc", {
  3233. get: function () {
  3234. return this._depthFunc;
  3235. },
  3236. set: function (value) {
  3237. if (this._depthFunc === value) {
  3238. return;
  3239. }
  3240. this._depthFunc = value;
  3241. this._isDepthFuncDirty = true;
  3242. },
  3243. enumerable: true,
  3244. configurable: true
  3245. });
  3246. Object.defineProperty(_DepthCullingState.prototype, "depthMask", {
  3247. get: function () {
  3248. return this._depthMask;
  3249. },
  3250. set: function (value) {
  3251. if (this._depthMask === value) {
  3252. return;
  3253. }
  3254. this._depthMask = value;
  3255. this._isDepthMaskDirty = true;
  3256. },
  3257. enumerable: true,
  3258. configurable: true
  3259. });
  3260. Object.defineProperty(_DepthCullingState.prototype, "depthTest", {
  3261. get: function () {
  3262. return this._depthTest;
  3263. },
  3264. set: function (value) {
  3265. if (this._depthTest === value) {
  3266. return;
  3267. }
  3268. this._depthTest = value;
  3269. this._isDepthTestDirty = true;
  3270. },
  3271. enumerable: true,
  3272. configurable: true
  3273. });
  3274. _DepthCullingState.prototype.reset = function () {
  3275. this._depthMask = true;
  3276. this._depthTest = true;
  3277. this._depthFunc = null;
  3278. this._cull = null;
  3279. this._cullFace = null;
  3280. this._isDepthTestDirty = true;
  3281. this._isDepthMaskDirty = true;
  3282. this._isDepthFuncDirty = false;
  3283. this._isCullFaceDirty = false;
  3284. this._isCullDirty = false;
  3285. };
  3286. _DepthCullingState.prototype.apply = function (gl) {
  3287. if (!this.isDirty) {
  3288. return;
  3289. }
  3290. // Cull
  3291. if (this._isCullDirty) {
  3292. if (this.cull) {
  3293. gl.enable(gl.CULL_FACE);
  3294. }
  3295. else {
  3296. gl.disable(gl.CULL_FACE);
  3297. }
  3298. this._isCullDirty = false;
  3299. }
  3300. // Cull face
  3301. if (this._isCullFaceDirty) {
  3302. gl.cullFace(this.cullFace);
  3303. this._isCullFaceDirty = false;
  3304. }
  3305. // Depth mask
  3306. if (this._isDepthMaskDirty) {
  3307. gl.depthMask(this.depthMask);
  3308. this._isDepthMaskDirty = false;
  3309. }
  3310. // Depth test
  3311. if (this._isDepthTestDirty) {
  3312. if (this.depthTest) {
  3313. gl.enable(gl.DEPTH_TEST);
  3314. }
  3315. else {
  3316. gl.disable(gl.DEPTH_TEST);
  3317. }
  3318. this._isDepthTestDirty = false;
  3319. }
  3320. // Depth func
  3321. if (this._isDepthFuncDirty) {
  3322. gl.depthFunc(this.depthFunc);
  3323. this._isDepthFuncDirty = false;
  3324. }
  3325. };
  3326. return _DepthCullingState;
  3327. })();
  3328. BABYLON._DepthCullingState = _DepthCullingState;
  3329. var _AlphaState = (function () {
  3330. function _AlphaState() {
  3331. this._isAlphaBlendDirty = false;
  3332. this._isBlendFunctionParametersDirty = false;
  3333. this._alphaBlend = false;
  3334. this._blendFunctionParameters = new Array(4);
  3335. }
  3336. Object.defineProperty(_AlphaState.prototype, "isDirty", {
  3337. get: function () {
  3338. return this._isAlphaBlendDirty || this._isBlendFunctionParametersDirty;
  3339. },
  3340. enumerable: true,
  3341. configurable: true
  3342. });
  3343. Object.defineProperty(_AlphaState.prototype, "alphaBlend", {
  3344. get: function () {
  3345. return this._alphaBlend;
  3346. },
  3347. set: function (value) {
  3348. if (this._alphaBlend === value) {
  3349. return;
  3350. }
  3351. this._alphaBlend = value;
  3352. this._isAlphaBlendDirty = true;
  3353. },
  3354. enumerable: true,
  3355. configurable: true
  3356. });
  3357. _AlphaState.prototype.setAlphaBlendFunctionParameters = function (value0, value1, value2, value3) {
  3358. if (this._blendFunctionParameters[0] === value0 && this._blendFunctionParameters[1] === value1 && this._blendFunctionParameters[2] === value2 && this._blendFunctionParameters[3] === value3) {
  3359. return;
  3360. }
  3361. this._blendFunctionParameters[0] = value0;
  3362. this._blendFunctionParameters[1] = value1;
  3363. this._blendFunctionParameters[2] = value2;
  3364. this._blendFunctionParameters[3] = value3;
  3365. this._isBlendFunctionParametersDirty = true;
  3366. };
  3367. _AlphaState.prototype.reset = function () {
  3368. this._alphaBlend = false;
  3369. this._blendFunctionParameters[0] = null;
  3370. this._blendFunctionParameters[1] = null;
  3371. this._blendFunctionParameters[2] = null;
  3372. this._blendFunctionParameters[3] = null;
  3373. this._isAlphaBlendDirty = true;
  3374. this._isBlendFunctionParametersDirty = false;
  3375. };
  3376. _AlphaState.prototype.apply = function (gl) {
  3377. if (!this.isDirty) {
  3378. return;
  3379. }
  3380. // Alpha blend
  3381. if (this._isAlphaBlendDirty) {
  3382. if (this._alphaBlend) {
  3383. gl.enable(gl.BLEND);
  3384. }
  3385. else {
  3386. gl.disable(gl.BLEND);
  3387. }
  3388. this._isAlphaBlendDirty = false;
  3389. }
  3390. // Alpha function
  3391. if (this._isBlendFunctionParametersDirty) {
  3392. gl.blendFuncSeparate(this._blendFunctionParameters[0], this._blendFunctionParameters[1], this._blendFunctionParameters[2], this._blendFunctionParameters[3]);
  3393. this._isBlendFunctionParametersDirty = false;
  3394. }
  3395. };
  3396. return _AlphaState;
  3397. })();
  3398. BABYLON._AlphaState = _AlphaState;
  3399. var compileShader = function (gl, source, type, defines) {
  3400. var shader = gl.createShader(type === "vertex" ? gl.VERTEX_SHADER : gl.FRAGMENT_SHADER);
  3401. gl.shaderSource(shader, (defines ? defines + "\n" : "") + source);
  3402. gl.compileShader(shader);
  3403. if (!gl.getShaderParameter(shader, gl.COMPILE_STATUS)) {
  3404. throw new Error(gl.getShaderInfoLog(shader));
  3405. }
  3406. return shader;
  3407. };
  3408. var getWebGLTextureType = function (gl, type) {
  3409. var textureType = gl.UNSIGNED_BYTE;
  3410. if (type === Engine.TEXTURETYPE_FLOAT)
  3411. textureType = gl.FLOAT;
  3412. return textureType;
  3413. };
  3414. var getSamplingParameters = function (samplingMode, generateMipMaps, gl) {
  3415. var magFilter = gl.NEAREST;
  3416. var minFilter = gl.NEAREST;
  3417. if (samplingMode === BABYLON.Texture.BILINEAR_SAMPLINGMODE) {
  3418. magFilter = gl.LINEAR;
  3419. if (generateMipMaps) {
  3420. minFilter = gl.LINEAR_MIPMAP_NEAREST;
  3421. }
  3422. else {
  3423. minFilter = gl.LINEAR;
  3424. }
  3425. }
  3426. else if (samplingMode === BABYLON.Texture.TRILINEAR_SAMPLINGMODE) {
  3427. magFilter = gl.LINEAR;
  3428. if (generateMipMaps) {
  3429. minFilter = gl.LINEAR_MIPMAP_LINEAR;
  3430. }
  3431. else {
  3432. minFilter = gl.LINEAR;
  3433. }
  3434. }
  3435. else if (samplingMode === BABYLON.Texture.NEAREST_SAMPLINGMODE) {
  3436. magFilter = gl.NEAREST;
  3437. if (generateMipMaps) {
  3438. minFilter = gl.NEAREST_MIPMAP_LINEAR;
  3439. }
  3440. else {
  3441. minFilter = gl.NEAREST;
  3442. }
  3443. }
  3444. return {
  3445. min: minFilter,
  3446. mag: magFilter
  3447. };
  3448. };
  3449. var prepareWebGLTexture = function (texture, gl, scene, width, height, invertY, noMipmap, isCompressed, processFunction, samplingMode) {
  3450. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  3451. var engine = scene.getEngine();
  3452. var potWidth = BABYLON.Tools.GetExponantOfTwo(width, engine.getCaps().maxTextureSize);
  3453. var potHeight = BABYLON.Tools.GetExponantOfTwo(height, engine.getCaps().maxTextureSize);
  3454. gl.bindTexture(gl.TEXTURE_2D, texture);
  3455. gl.pixelStorei(gl.UNPACK_FLIP_Y_WEBGL, invertY === undefined ? 1 : (invertY ? 1 : 0));
  3456. processFunction(potWidth, potHeight);
  3457. var filters = getSamplingParameters(samplingMode, !noMipmap, gl);
  3458. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MAG_FILTER, filters.mag);
  3459. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MIN_FILTER, filters.min);
  3460. if (!noMipmap && !isCompressed) {
  3461. gl.generateMipmap(gl.TEXTURE_2D);
  3462. }
  3463. gl.bindTexture(gl.TEXTURE_2D, null);
  3464. engine._activeTexturesCache = [];
  3465. texture._baseWidth = width;
  3466. texture._baseHeight = height;
  3467. texture._width = potWidth;
  3468. texture._height = potHeight;
  3469. texture.isReady = true;
  3470. texture.samplingMode = samplingMode;
  3471. scene._removePendingData(texture);
  3472. };
  3473. var partialLoad = function (url, index, loadedImages, scene, onfinish) {
  3474. var onload = function () {
  3475. loadedImages[index] = img;
  3476. loadedImages._internalCount++;
  3477. scene._removePendingData(img);
  3478. if (loadedImages._internalCount === 6) {
  3479. onfinish(loadedImages);
  3480. }
  3481. };
  3482. var onerror = function () {
  3483. scene._removePendingData(img);
  3484. };
  3485. var img = BABYLON.Tools.LoadImage(url, onload, onerror, scene.database);
  3486. scene._addPendingData(img);
  3487. };
  3488. var cascadeLoad = function (rootUrl, scene, onfinish, extensions) {
  3489. var loadedImages = [];
  3490. loadedImages._internalCount = 0;
  3491. for (var index = 0; index < 6; index++) {
  3492. partialLoad(rootUrl + extensions[index], index, loadedImages, scene, onfinish);
  3493. }
  3494. };
  3495. var EngineCapabilities = (function () {
  3496. function EngineCapabilities() {
  3497. }
  3498. return EngineCapabilities;
  3499. })();
  3500. BABYLON.EngineCapabilities = EngineCapabilities;
  3501. /**
  3502. * The engine class is responsible for interfacing with all lower-level APIs such as WebGL and Audio.
  3503. */
  3504. var Engine = (function () {
  3505. /**
  3506. * @constructor
  3507. * @param {HTMLCanvasElement} canvas - the canvas to be used for rendering
  3508. * @param {boolean} [antialias] - enable antialias
  3509. * @param options - further options to be sent to the getContext function
  3510. */
  3511. function Engine(canvas, antialias, options) {
  3512. var _this = this;
  3513. // Public members
  3514. this.isFullscreen = false;
  3515. this.isPointerLock = false;
  3516. this.cullBackFaces = true;
  3517. this.renderEvenInBackground = true;
  3518. this.scenes = new Array();
  3519. this._windowIsBackground = false;
  3520. this._loadingDivBackgroundColor = "black";
  3521. this._drawCalls = 0;
  3522. this._renderingQueueLaunched = false;
  3523. this._activeRenderLoops = [];
  3524. // FPS
  3525. this.fpsRange = 60;
  3526. this.previousFramesDuration = [];
  3527. this.fps = 60;
  3528. this.deltaTime = 0;
  3529. // States
  3530. this._depthCullingState = new _DepthCullingState();
  3531. this._alphaState = new _AlphaState();
  3532. this._alphaMode = Engine.ALPHA_DISABLE;
  3533. // Cache
  3534. this._loadedTexturesCache = new Array();
  3535. this._activeTexturesCache = new Array();
  3536. this._compiledEffects = {};
  3537. this._uintIndicesCurrentlySet = false;
  3538. this._renderingCanvas = canvas;
  3539. this._canvasClientRect = this._renderingCanvas.getBoundingClientRect();
  3540. options = options || {};
  3541. options.antialias = antialias;
  3542. try {
  3543. this._gl = canvas.getContext("webgl", options) || canvas.getContext("experimental-webgl", options);
  3544. }
  3545. catch (e) {
  3546. throw new Error("WebGL not supported");
  3547. }
  3548. if (!this._gl) {
  3549. throw new Error("WebGL not supported");
  3550. }
  3551. this._onBlur = function () {
  3552. _this._windowIsBackground = true;
  3553. };
  3554. this._onFocus = function () {
  3555. _this._windowIsBackground = false;
  3556. };
  3557. window.addEventListener("blur", this._onBlur);
  3558. window.addEventListener("focus", this._onFocus);
  3559. // Textures
  3560. this._workingCanvas = document.createElement("canvas");
  3561. this._workingContext = this._workingCanvas.getContext("2d");
  3562. // Viewport
  3563. this._hardwareScalingLevel = 1.0 / (window.devicePixelRatio || 1.0);
  3564. this.resize();
  3565. // Caps
  3566. this._caps = new EngineCapabilities();
  3567. this._caps.maxTexturesImageUnits = this._gl.getParameter(this._gl.MAX_TEXTURE_IMAGE_UNITS);
  3568. this._caps.maxTextureSize = this._gl.getParameter(this._gl.MAX_TEXTURE_SIZE);
  3569. this._caps.maxCubemapTextureSize = this._gl.getParameter(this._gl.MAX_CUBE_MAP_TEXTURE_SIZE);
  3570. this._caps.maxRenderTextureSize = this._gl.getParameter(this._gl.MAX_RENDERBUFFER_SIZE);
  3571. // Infos
  3572. this._glVersion = this._gl.getParameter(this._gl.VERSION);
  3573. var rendererInfo = this._gl.getExtension("WEBGL_debug_renderer_info");
  3574. if (rendererInfo != null) {
  3575. this._glRenderer = this._gl.getParameter(rendererInfo.UNMASKED_RENDERER_WEBGL);
  3576. this._glVendor = this._gl.getParameter(rendererInfo.UNMASKED_VENDOR_WEBGL);
  3577. }
  3578. if (!this._glVendor) {
  3579. this._glVendor = "Unknown vendor";
  3580. }
  3581. if (!this._glRenderer) {
  3582. this._glRenderer = "Unknown renderer";
  3583. }
  3584. // Extensions
  3585. this._caps.standardDerivatives = (this._gl.getExtension('OES_standard_derivatives') !== null);
  3586. this._caps.s3tc = this._gl.getExtension('WEBGL_compressed_texture_s3tc');
  3587. this._caps.textureFloat = (this._gl.getExtension('OES_texture_float') !== null);
  3588. this._caps.textureAnisotropicFilterExtension = this._gl.getExtension('EXT_texture_filter_anisotropic') || this._gl.getExtension('WEBKIT_EXT_texture_filter_anisotropic') || this._gl.getExtension('MOZ_EXT_texture_filter_anisotropic');
  3589. this._caps.maxAnisotropy = this._caps.textureAnisotropicFilterExtension ? this._gl.getParameter(this._caps.textureAnisotropicFilterExtension.MAX_TEXTURE_MAX_ANISOTROPY_EXT) : 0;
  3590. this._caps.instancedArrays = this._gl.getExtension('ANGLE_instanced_arrays');
  3591. this._caps.uintIndices = this._gl.getExtension('OES_element_index_uint') !== null;
  3592. // Depth buffer
  3593. this.setDepthBuffer(true);
  3594. this.setDepthFunctionToLessOrEqual();
  3595. this.setDepthWrite(true);
  3596. // Fullscreen
  3597. this._onFullscreenChange = function () {
  3598. if (document.fullscreen !== undefined) {
  3599. _this.isFullscreen = document.fullscreen;
  3600. }
  3601. else if (document.mozFullScreen !== undefined) {
  3602. _this.isFullscreen = document.mozFullScreen;
  3603. }
  3604. else if (document.webkitIsFullScreen !== undefined) {
  3605. _this.isFullscreen = document.webkitIsFullScreen;
  3606. }
  3607. else if (document.msIsFullScreen !== undefined) {
  3608. _this.isFullscreen = document.msIsFullScreen;
  3609. }
  3610. // Pointer lock
  3611. if (_this.isFullscreen && _this._pointerLockRequested) {
  3612. canvas.requestPointerLock = canvas.requestPointerLock || canvas.msRequestPointerLock || canvas.mozRequestPointerLock || canvas.webkitRequestPointerLock;
  3613. if (canvas.requestPointerLock) {
  3614. canvas.requestPointerLock();
  3615. }
  3616. }
  3617. };
  3618. document.addEventListener("fullscreenchange", this._onFullscreenChange, false);
  3619. document.addEventListener("mozfullscreenchange", this._onFullscreenChange, false);
  3620. document.addEventListener("webkitfullscreenchange", this._onFullscreenChange, false);
  3621. document.addEventListener("msfullscreenchange", this._onFullscreenChange, false);
  3622. // Pointer lock
  3623. this._onPointerLockChange = function () {
  3624. _this.isPointerLock = (document.mozPointerLockElement === canvas || document.webkitPointerLockElement === canvas || document.msPointerLockElement === canvas || document.pointerLockElement === canvas);
  3625. };
  3626. document.addEventListener("pointerlockchange", this._onPointerLockChange, false);
  3627. document.addEventListener("mspointerlockchange", this._onPointerLockChange, false);
  3628. document.addEventListener("mozpointerlockchange", this._onPointerLockChange, false);
  3629. document.addEventListener("webkitpointerlockchange", this._onPointerLockChange, false);
  3630. if (!Engine.audioEngine) {
  3631. Engine.audioEngine = new BABYLON.AudioEngine();
  3632. }
  3633. BABYLON.Tools.Log("Babylon.js engine (v" + Engine.Version + ") launched");
  3634. }
  3635. Object.defineProperty(Engine, "ALPHA_DISABLE", {
  3636. get: function () {
  3637. return Engine._ALPHA_DISABLE;
  3638. },
  3639. enumerable: true,
  3640. configurable: true
  3641. });
  3642. Object.defineProperty(Engine, "ALPHA_ADD", {
  3643. get: function () {
  3644. return Engine._ALPHA_ADD;
  3645. },
  3646. enumerable: true,
  3647. configurable: true
  3648. });
  3649. Object.defineProperty(Engine, "ALPHA_COMBINE", {
  3650. get: function () {
  3651. return Engine._ALPHA_COMBINE;
  3652. },
  3653. enumerable: true,
  3654. configurable: true
  3655. });
  3656. Object.defineProperty(Engine, "DELAYLOADSTATE_NONE", {
  3657. get: function () {
  3658. return Engine._DELAYLOADSTATE_NONE;
  3659. },
  3660. enumerable: true,
  3661. configurable: true
  3662. });
  3663. Object.defineProperty(Engine, "DELAYLOADSTATE_LOADED", {
  3664. get: function () {
  3665. return Engine._DELAYLOADSTATE_LOADED;
  3666. },
  3667. enumerable: true,
  3668. configurable: true
  3669. });
  3670. Object.defineProperty(Engine, "DELAYLOADSTATE_LOADING", {
  3671. get: function () {
  3672. return Engine._DELAYLOADSTATE_LOADING;
  3673. },
  3674. enumerable: true,
  3675. configurable: true
  3676. });
  3677. Object.defineProperty(Engine, "DELAYLOADSTATE_NOTLOADED", {
  3678. get: function () {
  3679. return Engine._DELAYLOADSTATE_NOTLOADED;
  3680. },
  3681. enumerable: true,
  3682. configurable: true
  3683. });
  3684. Object.defineProperty(Engine, "TEXTUREFORMAT_ALPHA", {
  3685. get: function () {
  3686. return Engine._TEXTUREFORMAT_ALPHA;
  3687. },
  3688. enumerable: true,
  3689. configurable: true
  3690. });
  3691. Object.defineProperty(Engine, "TEXTUREFORMAT_LUMINANCE", {
  3692. get: function () {
  3693. return Engine._TEXTUREFORMAT_LUMINANCE;
  3694. },
  3695. enumerable: true,
  3696. configurable: true
  3697. });
  3698. Object.defineProperty(Engine, "TEXTUREFORMAT_LUMINANCE_ALPHA", {
  3699. get: function () {
  3700. return Engine._TEXTUREFORMAT_LUMINANCE_ALPHA;
  3701. },
  3702. enumerable: true,
  3703. configurable: true
  3704. });
  3705. Object.defineProperty(Engine, "TEXTUREFORMAT_RGB", {
  3706. get: function () {
  3707. return Engine._TEXTUREFORMAT_RGB;
  3708. },
  3709. enumerable: true,
  3710. configurable: true
  3711. });
  3712. Object.defineProperty(Engine, "TEXTUREFORMAT_RGBA", {
  3713. get: function () {
  3714. return Engine._TEXTUREFORMAT_RGBA;
  3715. },
  3716. enumerable: true,
  3717. configurable: true
  3718. });
  3719. Object.defineProperty(Engine, "TEXTURETYPE_UNSIGNED_INT", {
  3720. get: function () {
  3721. return Engine._TEXTURETYPE_UNSIGNED_INT;
  3722. },
  3723. enumerable: true,
  3724. configurable: true
  3725. });
  3726. Object.defineProperty(Engine, "TEXTURETYPE_FLOAT", {
  3727. get: function () {
  3728. return Engine._TEXTURETYPE_FLOAT;
  3729. },
  3730. enumerable: true,
  3731. configurable: true
  3732. });
  3733. Object.defineProperty(Engine, "Version", {
  3734. get: function () {
  3735. return "2.0.0";
  3736. },
  3737. enumerable: true,
  3738. configurable: true
  3739. });
  3740. Engine.prototype.getGlInfo = function () {
  3741. return {
  3742. vendor: this._glVendor,
  3743. renderer: this._glRenderer,
  3744. version: this._glVersion
  3745. };
  3746. };
  3747. Engine.prototype.getAspectRatio = function (camera) {
  3748. var viewport = camera.viewport;
  3749. return (this.getRenderWidth() * viewport.width) / (this.getRenderHeight() * viewport.height);
  3750. };
  3751. Engine.prototype.getRenderWidth = function () {
  3752. if (this._currentRenderTarget) {
  3753. return this._currentRenderTarget._width;
  3754. }
  3755. return this._renderingCanvas.width;
  3756. };
  3757. Engine.prototype.getRenderHeight = function () {
  3758. if (this._currentRenderTarget) {
  3759. return this._currentRenderTarget._height;
  3760. }
  3761. return this._renderingCanvas.height;
  3762. };
  3763. Engine.prototype.getRenderingCanvas = function () {
  3764. return this._renderingCanvas;
  3765. };
  3766. Engine.prototype.getRenderingCanvasClientRect = function () {
  3767. return this._renderingCanvas.getBoundingClientRect();
  3768. };
  3769. Engine.prototype.setHardwareScalingLevel = function (level) {
  3770. this._hardwareScalingLevel = level;
  3771. this.resize();
  3772. };
  3773. Engine.prototype.getHardwareScalingLevel = function () {
  3774. return this._hardwareScalingLevel;
  3775. };
  3776. Engine.prototype.getLoadedTexturesCache = function () {
  3777. return this._loadedTexturesCache;
  3778. };
  3779. Engine.prototype.getCaps = function () {
  3780. return this._caps;
  3781. };
  3782. Object.defineProperty(Engine.prototype, "drawCalls", {
  3783. get: function () {
  3784. return this._drawCalls;
  3785. },
  3786. enumerable: true,
  3787. configurable: true
  3788. });
  3789. // Methods
  3790. Engine.prototype.resetDrawCalls = function () {
  3791. this._drawCalls = 0;
  3792. };
  3793. Engine.prototype.setDepthFunctionToGreater = function () {
  3794. this._depthCullingState.depthFunc = this._gl.GREATER;
  3795. };
  3796. Engine.prototype.setDepthFunctionToGreaterOrEqual = function () {
  3797. this._depthCullingState.depthFunc = this._gl.GEQUAL;
  3798. };
  3799. Engine.prototype.setDepthFunctionToLess = function () {
  3800. this._depthCullingState.depthFunc = this._gl.LESS;
  3801. };
  3802. Engine.prototype.setDepthFunctionToLessOrEqual = function () {
  3803. this._depthCullingState.depthFunc = this._gl.LEQUAL;
  3804. };
  3805. /**
  3806. * stop executing a render loop function and remove it from the execution array
  3807. * @param {Function} [renderFunction] the function to be removed. If not provided all functions will be removed.
  3808. */
  3809. Engine.prototype.stopRenderLoop = function (renderFunction) {
  3810. if (!renderFunction) {
  3811. this._activeRenderLoops = [];
  3812. return;
  3813. }
  3814. var index = this._activeRenderLoops.indexOf(renderFunction);
  3815. if (index >= 0) {
  3816. this._activeRenderLoops.splice(index, 1);
  3817. }
  3818. };
  3819. Engine.prototype._renderLoop = function () {
  3820. var _this = this;
  3821. var shouldRender = true;
  3822. if (!this.renderEvenInBackground && this._windowIsBackground) {
  3823. shouldRender = false;
  3824. }
  3825. if (shouldRender) {
  3826. // Start new frame
  3827. this.beginFrame();
  3828. for (var index = 0; index < this._activeRenderLoops.length; index++) {
  3829. var renderFunction = this._activeRenderLoops[index];
  3830. renderFunction();
  3831. }
  3832. // Present
  3833. this.endFrame();
  3834. }
  3835. if (this._activeRenderLoops.length > 0) {
  3836. // Register new frame
  3837. BABYLON.Tools.QueueNewFrame(function () {
  3838. _this._renderLoop();
  3839. });
  3840. }
  3841. else {
  3842. this._renderingQueueLaunched = false;
  3843. }
  3844. };
  3845. /**
  3846. * Register and execute a render loop. The engine can have more than one render function.
  3847. * @param {Function} renderFunction - the function to continuesly execute starting the next render loop.
  3848. * @example
  3849. * engine.runRenderLoop(function () {
  3850. * scene.render()
  3851. * })
  3852. */
  3853. Engine.prototype.runRenderLoop = function (renderFunction) {
  3854. var _this = this;
  3855. if (this._activeRenderLoops.indexOf(renderFunction) !== -1) {
  3856. return;
  3857. }
  3858. this._activeRenderLoops.push(renderFunction);
  3859. if (!this._renderingQueueLaunched) {
  3860. this._renderingQueueLaunched = true;
  3861. BABYLON.Tools.QueueNewFrame(function () {
  3862. _this._renderLoop();
  3863. });
  3864. }
  3865. };
  3866. /**
  3867. * Toggle full screen mode.
  3868. * @param {boolean} requestPointerLock - should a pointer lock be requested from the user
  3869. */
  3870. Engine.prototype.switchFullscreen = function (requestPointerLock) {
  3871. if (this.isFullscreen) {
  3872. BABYLON.Tools.ExitFullscreen();
  3873. }
  3874. else {
  3875. this._pointerLockRequested = requestPointerLock;
  3876. BABYLON.Tools.RequestFullscreen(this._renderingCanvas);
  3877. }
  3878. };
  3879. Engine.prototype.clear = function (color, backBuffer, depthStencil) {
  3880. this.applyStates();
  3881. this._gl.clearColor(color.r, color.g, color.b, color.a !== undefined ? color.a : 1.0);
  3882. if (this._depthCullingState.depthMask) {
  3883. this._gl.clearDepth(1.0);
  3884. }
  3885. var mode = 0;
  3886. if (backBuffer)
  3887. mode |= this._gl.COLOR_BUFFER_BIT;
  3888. if (depthStencil && this._depthCullingState.depthMask)
  3889. mode |= this._gl.DEPTH_BUFFER_BIT;
  3890. this._gl.clear(mode);
  3891. };
  3892. /**
  3893. * Set the WebGL's viewport
  3894. * @param {BABYLON.Viewport} viewport - the viewport element to be used.
  3895. * @param {number} [requiredWidth] - the width required for rendering. If not provided the rendering canvas' width is used.
  3896. * @param {number} [requiredHeight] - the height required for rendering. If not provided the rendering canvas' height is used.
  3897. */
  3898. Engine.prototype.setViewport = function (viewport, requiredWidth, requiredHeight) {
  3899. var width = requiredWidth || this._renderingCanvas.width;
  3900. var height = requiredHeight || this._renderingCanvas.height;
  3901. var x = viewport.x || 0;
  3902. var y = viewport.y || 0;
  3903. this._cachedViewport = viewport;
  3904. this._gl.viewport(x * width, y * height, width * viewport.width, height * viewport.height);
  3905. };
  3906. Engine.prototype.setDirectViewport = function (x, y, width, height) {
  3907. this._cachedViewport = null;
  3908. this._gl.viewport(x, y, width, height);
  3909. };
  3910. Engine.prototype.beginFrame = function () {
  3911. this._measureFps();
  3912. };
  3913. Engine.prototype.endFrame = function () {
  3914. //this.flushFramebuffer();
  3915. };
  3916. /**
  3917. * resize the view according to the canvas' size.
  3918. * @example
  3919. * window.addEventListener("resize", function () {
  3920. * engine.resize();
  3921. * });
  3922. */
  3923. Engine.prototype.resize = function () {
  3924. this.setSize(this._renderingCanvas.clientWidth / this._hardwareScalingLevel, this._renderingCanvas.clientHeight / this._hardwareScalingLevel);
  3925. };
  3926. /**
  3927. * force a specific size of the canvas
  3928. * @param {number} width - the new canvas' width
  3929. * @param {number} height - the new canvas' height
  3930. */
  3931. Engine.prototype.setSize = function (width, height) {
  3932. this._renderingCanvas.width = width;
  3933. this._renderingCanvas.height = height;
  3934. this._canvasClientRect = this._renderingCanvas.getBoundingClientRect();
  3935. };
  3936. Engine.prototype.bindFramebuffer = function (texture) {
  3937. this._currentRenderTarget = texture;
  3938. var gl = this._gl;
  3939. gl.bindFramebuffer(gl.FRAMEBUFFER, texture._framebuffer);
  3940. this._gl.viewport(0, 0, texture._width, texture._height);
  3941. this.wipeCaches();
  3942. };
  3943. Engine.prototype.unBindFramebuffer = function (texture) {
  3944. this._currentRenderTarget = null;
  3945. if (texture.generateMipMaps) {
  3946. var gl = this._gl;
  3947. gl.bindTexture(gl.TEXTURE_2D, texture);
  3948. gl.generateMipmap(gl.TEXTURE_2D);
  3949. gl.bindTexture(gl.TEXTURE_2D, null);
  3950. }
  3951. this._gl.bindFramebuffer(this._gl.FRAMEBUFFER, null);
  3952. };
  3953. Engine.prototype.flushFramebuffer = function () {
  3954. this._gl.flush();
  3955. };
  3956. Engine.prototype.restoreDefaultFramebuffer = function () {
  3957. this._currentRenderTarget = null;
  3958. this._gl.bindFramebuffer(this._gl.FRAMEBUFFER, null);
  3959. this.setViewport(this._cachedViewport);
  3960. this.wipeCaches();
  3961. };
  3962. // VBOs
  3963. Engine.prototype._resetVertexBufferBinding = function () {
  3964. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, null);
  3965. this._cachedVertexBuffers = null;
  3966. };
  3967. Engine.prototype.createVertexBuffer = function (vertices) {
  3968. var vbo = this._gl.createBuffer();
  3969. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vbo);
  3970. this._gl.bufferData(this._gl.ARRAY_BUFFER, new Float32Array(vertices), this._gl.STATIC_DRAW);
  3971. this._resetVertexBufferBinding();
  3972. vbo.references = 1;
  3973. return vbo;
  3974. };
  3975. Engine.prototype.createDynamicVertexBuffer = function (capacity) {
  3976. var vbo = this._gl.createBuffer();
  3977. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vbo);
  3978. this._gl.bufferData(this._gl.ARRAY_BUFFER, capacity, this._gl.DYNAMIC_DRAW);
  3979. this._resetVertexBufferBinding();
  3980. vbo.references = 1;
  3981. return vbo;
  3982. };
  3983. Engine.prototype.updateDynamicVertexBuffer = function (vertexBuffer, vertices, offset) {
  3984. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vertexBuffer);
  3985. if (offset === undefined) {
  3986. offset = 0;
  3987. }
  3988. if (vertices instanceof Float32Array) {
  3989. this._gl.bufferSubData(this._gl.ARRAY_BUFFER, offset, vertices);
  3990. }
  3991. else {
  3992. this._gl.bufferSubData(this._gl.ARRAY_BUFFER, offset, new Float32Array(vertices));
  3993. }
  3994. this._resetVertexBufferBinding();
  3995. };
  3996. Engine.prototype._resetIndexBufferBinding = function () {
  3997. this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, null);
  3998. this._cachedIndexBuffer = null;
  3999. };
  4000. Engine.prototype.createIndexBuffer = function (indices) {
  4001. var vbo = this._gl.createBuffer();
  4002. this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, vbo);
  4003. // Check for 32 bits indices
  4004. var arrayBuffer;
  4005. var need32Bits = false;
  4006. if (this._caps.uintIndices) {
  4007. for (var index = 0; index < indices.length; index++) {
  4008. if (indices[index] > 65535) {
  4009. need32Bits = true;
  4010. break;
  4011. }
  4012. }
  4013. arrayBuffer = need32Bits ? new Uint32Array(indices) : new Uint16Array(indices);
  4014. }
  4015. else {
  4016. arrayBuffer = new Uint16Array(indices);
  4017. }
  4018. this._gl.bufferData(this._gl.ELEMENT_ARRAY_BUFFER, arrayBuffer, this._gl.STATIC_DRAW);
  4019. this._resetIndexBufferBinding();
  4020. vbo.references = 1;
  4021. vbo.is32Bits = need32Bits;
  4022. return vbo;
  4023. };
  4024. Engine.prototype.bindBuffers = function (vertexBuffer, indexBuffer, vertexDeclaration, vertexStrideSize, effect) {
  4025. if (this._cachedVertexBuffers !== vertexBuffer || this._cachedEffectForVertexBuffers !== effect) {
  4026. this._cachedVertexBuffers = vertexBuffer;
  4027. this._cachedEffectForVertexBuffers = effect;
  4028. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vertexBuffer);
  4029. var offset = 0;
  4030. for (var index = 0; index < vertexDeclaration.length; index++) {
  4031. var order = effect.getAttributeLocation(index);
  4032. if (order >= 0) {
  4033. this._gl.vertexAttribPointer(order, vertexDeclaration[index], this._gl.FLOAT, false, vertexStrideSize, offset);
  4034. }
  4035. offset += vertexDeclaration[index] * 4;
  4036. }
  4037. }
  4038. if (this._cachedIndexBuffer !== indexBuffer) {
  4039. this._cachedIndexBuffer = indexBuffer;
  4040. this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, indexBuffer);
  4041. this._uintIndicesCurrentlySet = indexBuffer.is32Bits;
  4042. }
  4043. };
  4044. Engine.prototype.bindMultiBuffers = function (vertexBuffers, indexBuffer, effect) {
  4045. if (this._cachedVertexBuffers !== vertexBuffers || this._cachedEffectForVertexBuffers !== effect) {
  4046. this._cachedVertexBuffers = vertexBuffers;
  4047. this._cachedEffectForVertexBuffers = effect;
  4048. var attributes = effect.getAttributesNames();
  4049. for (var index = 0; index < attributes.length; index++) {
  4050. var order = effect.getAttributeLocation(index);
  4051. if (order >= 0) {
  4052. var vertexBuffer = vertexBuffers[attributes[index]];
  4053. if (!vertexBuffer) {
  4054. continue;
  4055. }
  4056. var stride = vertexBuffer.getStrideSize();
  4057. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vertexBuffer.getBuffer());
  4058. this._gl.vertexAttribPointer(order, stride, this._gl.FLOAT, false, stride * 4, 0);
  4059. }
  4060. }
  4061. }
  4062. if (indexBuffer != null && this._cachedIndexBuffer !== indexBuffer) {
  4063. this._cachedIndexBuffer = indexBuffer;
  4064. this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, indexBuffer);
  4065. this._uintIndicesCurrentlySet = indexBuffer.is32Bits;
  4066. }
  4067. };
  4068. Engine.prototype._releaseBuffer = function (buffer) {
  4069. buffer.references--;
  4070. if (buffer.references === 0) {
  4071. this._gl.deleteBuffer(buffer);
  4072. return true;
  4073. }
  4074. return false;
  4075. };
  4076. Engine.prototype.createInstancesBuffer = function (capacity) {
  4077. var buffer = this._gl.createBuffer();
  4078. buffer.capacity = capacity;
  4079. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, buffer);
  4080. this._gl.bufferData(this._gl.ARRAY_BUFFER, capacity, this._gl.DYNAMIC_DRAW);
  4081. return buffer;
  4082. };
  4083. Engine.prototype.deleteInstancesBuffer = function (buffer) {
  4084. this._gl.deleteBuffer(buffer);
  4085. };
  4086. Engine.prototype.updateAndBindInstancesBuffer = function (instancesBuffer, data, offsetLocations) {
  4087. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, instancesBuffer);
  4088. this._gl.bufferSubData(this._gl.ARRAY_BUFFER, 0, data);
  4089. for (var index = 0; index < 4; index++) {
  4090. var offsetLocation = offsetLocations[index];
  4091. this._gl.enableVertexAttribArray(offsetLocation);
  4092. this._gl.vertexAttribPointer(offsetLocation, 4, this._gl.FLOAT, false, 64, index * 16);
  4093. this._caps.instancedArrays.vertexAttribDivisorANGLE(offsetLocation, 1);
  4094. }
  4095. };
  4096. Engine.prototype.unBindInstancesBuffer = function (instancesBuffer, offsetLocations) {
  4097. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, instancesBuffer);
  4098. for (var index = 0; index < 4; index++) {
  4099. var offsetLocation = offsetLocations[index];
  4100. this._gl.disableVertexAttribArray(offsetLocation);
  4101. this._caps.instancedArrays.vertexAttribDivisorANGLE(offsetLocation, 0);
  4102. }
  4103. };
  4104. Engine.prototype.applyStates = function () {
  4105. this._depthCullingState.apply(this._gl);
  4106. this._alphaState.apply(this._gl);
  4107. };
  4108. Engine.prototype.draw = function (useTriangles, indexStart, indexCount, instancesCount) {
  4109. // Apply states
  4110. this.applyStates();
  4111. this._drawCalls++;
  4112. // Render
  4113. var indexFormat = this._uintIndicesCurrentlySet ? this._gl.UNSIGNED_INT : this._gl.UNSIGNED_SHORT;
  4114. if (instancesCount) {
  4115. this._caps.instancedArrays.drawElementsInstancedANGLE(useTriangles ? this._gl.TRIANGLES : this._gl.LINES, indexCount, indexFormat, indexStart * 2, instancesCount);
  4116. return;
  4117. }
  4118. this._gl.drawElements(useTriangles ? this._gl.TRIANGLES : this._gl.LINES, indexCount, indexFormat, indexStart * 2);
  4119. };
  4120. Engine.prototype.drawPointClouds = function (verticesStart, verticesCount, instancesCount) {
  4121. // Apply states
  4122. this.applyStates();
  4123. this._drawCalls++;
  4124. if (instancesCount) {
  4125. this._caps.instancedArrays.drawArraysInstancedANGLE(this._gl.POINTS, verticesStart, verticesCount, instancesCount);
  4126. return;
  4127. }
  4128. this._gl.drawArrays(this._gl.POINTS, verticesStart, verticesCount);
  4129. };
  4130. // Shaders
  4131. Engine.prototype._releaseEffect = function (effect) {
  4132. if (this._compiledEffects[effect._key]) {
  4133. delete this._compiledEffects[effect._key];
  4134. if (effect.getProgram()) {
  4135. this._gl.deleteProgram(effect.getProgram());
  4136. }
  4137. }
  4138. };
  4139. Engine.prototype.createEffect = function (baseName, attributesNames, uniformsNames, samplers, defines, fallbacks, onCompiled, onError) {
  4140. var vertex = baseName.vertexElement || baseName.vertex || baseName;
  4141. var fragment = baseName.fragmentElement || baseName.fragment || baseName;
  4142. var name = vertex + "+" + fragment + "@" + defines;
  4143. if (this._compiledEffects[name]) {
  4144. return this._compiledEffects[name];
  4145. }
  4146. var effect = new BABYLON.Effect(baseName, attributesNames, uniformsNames, samplers, this, defines, fallbacks, onCompiled, onError);
  4147. effect._key = name;
  4148. this._compiledEffects[name] = effect;
  4149. return effect;
  4150. };
  4151. Engine.prototype.createEffectForParticles = function (fragmentName, uniformsNames, samplers, defines, fallbacks, onCompiled, onError) {
  4152. if (uniformsNames === void 0) { uniformsNames = []; }
  4153. if (samplers === void 0) { samplers = []; }
  4154. if (defines === void 0) { defines = ""; }
  4155. return this.createEffect({
  4156. vertex: "particles",
  4157. fragmentElement: fragmentName
  4158. }, ["position", "color", "options"], ["view", "projection"].concat(uniformsNames), ["diffuseSampler"].concat(samplers), defines, fallbacks, onCompiled, onError);
  4159. };
  4160. Engine.prototype.createShaderProgram = function (vertexCode, fragmentCode, defines) {
  4161. var vertexShader = compileShader(this._gl, vertexCode, "vertex", defines);
  4162. var fragmentShader = compileShader(this._gl, fragmentCode, "fragment", defines);
  4163. var shaderProgram = this._gl.createProgram();
  4164. this._gl.attachShader(shaderProgram, vertexShader);
  4165. this._gl.attachShader(shaderProgram, fragmentShader);
  4166. this._gl.linkProgram(shaderProgram);
  4167. var linked = this._gl.getProgramParameter(shaderProgram, this._gl.LINK_STATUS);
  4168. if (!linked) {
  4169. var error = this._gl.getProgramInfoLog(shaderProgram);
  4170. if (error) {
  4171. throw new Error(error);
  4172. }
  4173. }
  4174. this._gl.deleteShader(vertexShader);
  4175. this._gl.deleteShader(fragmentShader);
  4176. return shaderProgram;
  4177. };
  4178. Engine.prototype.getUniforms = function (shaderProgram, uniformsNames) {
  4179. var results = [];
  4180. for (var index = 0; index < uniformsNames.length; index++) {
  4181. results.push(this._gl.getUniformLocation(shaderProgram, uniformsNames[index]));
  4182. }
  4183. return results;
  4184. };
  4185. Engine.prototype.getAttributes = function (shaderProgram, attributesNames) {
  4186. var results = [];
  4187. for (var index = 0; index < attributesNames.length; index++) {
  4188. try {
  4189. results.push(this._gl.getAttribLocation(shaderProgram, attributesNames[index]));
  4190. }
  4191. catch (e) {
  4192. results.push(-1);
  4193. }
  4194. }
  4195. return results;
  4196. };
  4197. Engine.prototype.enableEffect = function (effect) {
  4198. if (!effect || !effect.getAttributesCount() || this._currentEffect === effect) {
  4199. if (effect && effect.onBind) {
  4200. effect.onBind(effect);
  4201. }
  4202. return;
  4203. }
  4204. this._vertexAttribArrays = this._vertexAttribArrays || [];
  4205. // Use program
  4206. this._gl.useProgram(effect.getProgram());
  4207. for (var i in this._vertexAttribArrays) {
  4208. if (i > this._gl.VERTEX_ATTRIB_ARRAY_ENABLED || !this._vertexAttribArrays[i]) {
  4209. continue;
  4210. }
  4211. this._vertexAttribArrays[i] = false;
  4212. this._gl.disableVertexAttribArray(i);
  4213. }
  4214. var attributesCount = effect.getAttributesCount();
  4215. for (var index = 0; index < attributesCount; index++) {
  4216. // Attributes
  4217. var order = effect.getAttributeLocation(index);
  4218. if (order >= 0) {
  4219. this._vertexAttribArrays[order] = true;
  4220. this._gl.enableVertexAttribArray(order);
  4221. }
  4222. }
  4223. this._currentEffect = effect;
  4224. if (effect.onBind) {
  4225. effect.onBind(effect);
  4226. }
  4227. };
  4228. Engine.prototype.setArray = function (uniform, array) {
  4229. if (!uniform)
  4230. return;
  4231. this._gl.uniform1fv(uniform, array);
  4232. };
  4233. Engine.prototype.setArray2 = function (uniform, array) {
  4234. if (!uniform || array.length % 2 !== 0)
  4235. return;
  4236. this._gl.uniform2fv(uniform, array);
  4237. };
  4238. Engine.prototype.setArray3 = function (uniform, array) {
  4239. if (!uniform || array.length % 3 !== 0)
  4240. return;
  4241. this._gl.uniform3fv(uniform, array);
  4242. };
  4243. Engine.prototype.setArray4 = function (uniform, array) {
  4244. if (!uniform || array.length % 4 !== 0)
  4245. return;
  4246. this._gl.uniform4fv(uniform, array);
  4247. };
  4248. Engine.prototype.setMatrices = function (uniform, matrices) {
  4249. if (!uniform)
  4250. return;
  4251. this._gl.uniformMatrix4fv(uniform, false, matrices);
  4252. };
  4253. Engine.prototype.setMatrix = function (uniform, matrix) {
  4254. if (!uniform)
  4255. return;
  4256. this._gl.uniformMatrix4fv(uniform, false, matrix.toArray());
  4257. };
  4258. Engine.prototype.setFloat = function (uniform, value) {
  4259. if (!uniform)
  4260. return;
  4261. this._gl.uniform1f(uniform, value);
  4262. };
  4263. Engine.prototype.setFloat2 = function (uniform, x, y) {
  4264. if (!uniform)
  4265. return;
  4266. this._gl.uniform2f(uniform, x, y);
  4267. };
  4268. Engine.prototype.setFloat3 = function (uniform, x, y, z) {
  4269. if (!uniform)
  4270. return;
  4271. this._gl.uniform3f(uniform, x, y, z);
  4272. };
  4273. Engine.prototype.setBool = function (uniform, bool) {
  4274. if (!uniform)
  4275. return;
  4276. this._gl.uniform1i(uniform, bool);
  4277. };
  4278. Engine.prototype.setFloat4 = function (uniform, x, y, z, w) {
  4279. if (!uniform)
  4280. return;
  4281. this._gl.uniform4f(uniform, x, y, z, w);
  4282. };
  4283. Engine.prototype.setColor3 = function (uniform, color3) {
  4284. if (!uniform)
  4285. return;
  4286. this._gl.uniform3f(uniform, color3.r, color3.g, color3.b);
  4287. };
  4288. Engine.prototype.setColor4 = function (uniform, color3, alpha) {
  4289. if (!uniform)
  4290. return;
  4291. this._gl.uniform4f(uniform, color3.r, color3.g, color3.b, alpha);
  4292. };
  4293. // States
  4294. Engine.prototype.setState = function (culling, force) {
  4295. // Culling
  4296. if (this._depthCullingState.cull !== culling || force) {
  4297. if (culling) {
  4298. this._depthCullingState.cullFace = this.cullBackFaces ? this._gl.BACK : this._gl.FRONT;
  4299. this._depthCullingState.cull = true;
  4300. }
  4301. else {
  4302. this._depthCullingState.cull = false;
  4303. }
  4304. }
  4305. };
  4306. Engine.prototype.setDepthBuffer = function (enable) {
  4307. this._depthCullingState.depthTest = enable;
  4308. };
  4309. Engine.prototype.getDepthWrite = function () {
  4310. return this._depthCullingState.depthMask;
  4311. };
  4312. Engine.prototype.setDepthWrite = function (enable) {
  4313. this._depthCullingState.depthMask = enable;
  4314. };
  4315. Engine.prototype.setColorWrite = function (enable) {
  4316. this._gl.colorMask(enable, enable, enable, enable);
  4317. };
  4318. Engine.prototype.setAlphaMode = function (mode) {
  4319. switch (mode) {
  4320. case Engine.ALPHA_DISABLE:
  4321. this.setDepthWrite(true);
  4322. this._alphaState.alphaBlend = false;
  4323. break;
  4324. case Engine.ALPHA_COMBINE:
  4325. this.setDepthWrite(false);
  4326. this._alphaState.setAlphaBlendFunctionParameters(this._gl.SRC_ALPHA, this._gl.ONE_MINUS_SRC_ALPHA, this._gl.ONE, this._gl.ONE);
  4327. this._alphaState.alphaBlend = true;
  4328. break;
  4329. case Engine.ALPHA_ADD:
  4330. this.setDepthWrite(false);
  4331. this._alphaState.setAlphaBlendFunctionParameters(this._gl.ONE, this._gl.ONE, this._gl.ZERO, this._gl.ONE);
  4332. this._alphaState.alphaBlend = true;
  4333. break;
  4334. }
  4335. this._alphaMode = mode;
  4336. };
  4337. Engine.prototype.getAlphaMode = function () {
  4338. return this._alphaMode;
  4339. };
  4340. Engine.prototype.setAlphaTesting = function (enable) {
  4341. this._alphaTest = enable;
  4342. };
  4343. Engine.prototype.getAlphaTesting = function () {
  4344. return this._alphaTest;
  4345. };
  4346. // Textures
  4347. Engine.prototype.wipeCaches = function () {
  4348. this._activeTexturesCache = [];
  4349. this._currentEffect = null;
  4350. this._depthCullingState.reset();
  4351. this._alphaState.reset();
  4352. this._cachedVertexBuffers = null;
  4353. this._cachedIndexBuffer = null;
  4354. this._cachedEffectForVertexBuffers = null;
  4355. };
  4356. Engine.prototype.setSamplingMode = function (texture, samplingMode) {
  4357. var gl = this._gl;
  4358. gl.bindTexture(gl.TEXTURE_2D, texture);
  4359. var magFilter = gl.NEAREST;
  4360. var minFilter = gl.NEAREST;
  4361. if (samplingMode === BABYLON.Texture.BILINEAR_SAMPLINGMODE) {
  4362. magFilter = gl.LINEAR;
  4363. minFilter = gl.LINEAR;
  4364. }
  4365. else if (samplingMode === BABYLON.Texture.TRILINEAR_SAMPLINGMODE) {
  4366. magFilter = gl.LINEAR;
  4367. minFilter = gl.LINEAR_MIPMAP_LINEAR;
  4368. }
  4369. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MAG_FILTER, magFilter);
  4370. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MIN_FILTER, minFilter);
  4371. gl.bindTexture(gl.TEXTURE_2D, null);
  4372. texture.samplingMode = samplingMode;
  4373. };
  4374. Engine.prototype.createTexture = function (url, noMipmap, invertY, scene, samplingMode, onLoad, onError, buffer) {
  4375. var _this = this;
  4376. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  4377. if (onLoad === void 0) { onLoad = null; }
  4378. if (onError === void 0) { onError = null; }
  4379. if (buffer === void 0) { buffer = null; }
  4380. var texture = this._gl.createTexture();
  4381. var extension;
  4382. var fromData = false;
  4383. if (url.substr(0, 5) === "data:") {
  4384. fromData = true;
  4385. }
  4386. if (!fromData)
  4387. extension = url.substr(url.length - 4, 4).toLowerCase();
  4388. else {
  4389. var oldUrl = url;
  4390. fromData = oldUrl.split(':');
  4391. url = oldUrl;
  4392. extension = fromData[1].substr(fromData[1].length - 4, 4).toLowerCase();
  4393. }
  4394. var isDDS = this.getCaps().s3tc && (extension === ".dds");
  4395. var isTGA = (extension === ".tga");
  4396. scene._addPendingData(texture);
  4397. texture.url = url;
  4398. texture.noMipmap = noMipmap;
  4399. texture.references = 1;
  4400. this._loadedTexturesCache.push(texture);
  4401. var onerror = function () {
  4402. scene._removePendingData(texture);
  4403. if (onError) {
  4404. onError();
  4405. }
  4406. };
  4407. if (isTGA) {
  4408. var callback = function (arrayBuffer) {
  4409. var data = new Uint8Array(arrayBuffer);
  4410. var header = BABYLON.Internals.TGATools.GetTGAHeader(data);
  4411. prepareWebGLTexture(texture, _this._gl, scene, header.width, header.height, invertY, noMipmap, false, function () {
  4412. BABYLON.Internals.TGATools.UploadContent(_this._gl, data);
  4413. if (onLoad) {
  4414. onLoad();
  4415. }
  4416. }, samplingMode);
  4417. };
  4418. if (!(fromData instanceof Array))
  4419. BABYLON.Tools.LoadFile(url, function (arrayBuffer) {
  4420. callback(arrayBuffer);
  4421. }, onerror, scene.database, true);
  4422. else
  4423. callback(buffer);
  4424. }
  4425. else if (isDDS) {
  4426. callback = function (data) {
  4427. var info = BABYLON.Internals.DDSTools.GetDDSInfo(data);
  4428. var loadMipmap = (info.isRGB || info.isLuminance || info.mipmapCount > 1) && !noMipmap && ((info.width >> (info.mipmapCount - 1)) === 1);
  4429. prepareWebGLTexture(texture, _this._gl, scene, info.width, info.height, invertY, !loadMipmap, info.isFourCC, function () {
  4430. BABYLON.Internals.DDSTools.UploadDDSLevels(_this._gl, _this.getCaps().s3tc, data, info, loadMipmap, 1);
  4431. if (onLoad) {
  4432. onLoad();
  4433. }
  4434. }, samplingMode);
  4435. };
  4436. if (!(fromData instanceof Array))
  4437. BABYLON.Tools.LoadFile(url, function (data) {
  4438. callback(data);
  4439. }, onerror, scene.database, true);
  4440. else
  4441. callback(buffer);
  4442. }
  4443. else {
  4444. var onload = function (img) {
  4445. prepareWebGLTexture(texture, _this._gl, scene, img.width, img.height, invertY, noMipmap, false, function (potWidth, potHeight) {
  4446. var isPot = (img.width === potWidth && img.height === potHeight);
  4447. if (!isPot) {
  4448. _this._workingCanvas.width = potWidth;
  4449. _this._workingCanvas.height = potHeight;
  4450. if (samplingMode === BABYLON.Texture.NEAREST_SAMPLINGMODE) {
  4451. _this._workingContext.imageSmoothingEnabled = false;
  4452. _this._workingContext.mozImageSmoothingEnabled = false;
  4453. _this._workingContext.oImageSmoothingEnabled = false;
  4454. _this._workingContext.webkitImageSmoothingEnabled = false;
  4455. _this._workingContext.msImageSmoothingEnabled = false;
  4456. }
  4457. _this._workingContext.drawImage(img, 0, 0, img.width, img.height, 0, 0, potWidth, potHeight);
  4458. if (samplingMode === BABYLON.Texture.NEAREST_SAMPLINGMODE) {
  4459. _this._workingContext.imageSmoothingEnabled = true;
  4460. _this._workingContext.mozImageSmoothingEnabled = true;
  4461. _this._workingContext.oImageSmoothingEnabled = true;
  4462. _this._workingContext.webkitImageSmoothingEnabled = true;
  4463. _this._workingContext.msImageSmoothingEnabled = true;
  4464. }
  4465. }
  4466. _this._gl.texImage2D(_this._gl.TEXTURE_2D, 0, _this._gl.RGBA, _this._gl.RGBA, _this._gl.UNSIGNED_BYTE, isPot ? img : _this._workingCanvas);
  4467. if (onLoad) {
  4468. onLoad();
  4469. }
  4470. }, samplingMode);
  4471. };
  4472. if (!(fromData instanceof Array))
  4473. BABYLON.Tools.LoadImage(url, onload, onerror, scene.database);
  4474. else
  4475. BABYLON.Tools.LoadImage(buffer, onload, onerror, scene.database);
  4476. }
  4477. return texture;
  4478. };
  4479. Engine.prototype.createRawTexture = function (data, width, height, format, generateMipMaps, invertY, samplingMode) {
  4480. var texture = this._gl.createTexture();
  4481. this._gl.bindTexture(this._gl.TEXTURE_2D, texture);
  4482. this._gl.pixelStorei(this._gl.UNPACK_FLIP_Y_WEBGL, invertY === undefined ? 1 : (invertY ? 1 : 0));
  4483. // Format
  4484. var internalFormat = this._gl.RGBA;
  4485. switch (format) {
  4486. case Engine.TEXTUREFORMAT_ALPHA:
  4487. internalFormat = this._gl.ALPHA;
  4488. break;
  4489. case Engine.TEXTUREFORMAT_LUMINANCE:
  4490. internalFormat = this._gl.LUMINANCE;
  4491. break;
  4492. case Engine.TEXTUREFORMAT_LUMINANCE_ALPHA:
  4493. internalFormat = this._gl.LUMINANCE_ALPHA;
  4494. break;
  4495. case Engine.TEXTUREFORMAT_RGB:
  4496. internalFormat = this._gl.RGB;
  4497. break;
  4498. case Engine.TEXTUREFORMAT_RGBA:
  4499. internalFormat = this._gl.RGBA;
  4500. break;
  4501. }
  4502. this._gl.texImage2D(this._gl.TEXTURE_2D, 0, internalFormat, width, height, 0, internalFormat, this._gl.UNSIGNED_BYTE, data);
  4503. if (generateMipMaps) {
  4504. this._gl.generateMipmap(this._gl.TEXTURE_2D);
  4505. }
  4506. // Filters
  4507. var filters = getSamplingParameters(samplingMode, generateMipMaps, this._gl);
  4508. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, filters.mag);
  4509. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, filters.min);
  4510. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  4511. this._activeTexturesCache = [];
  4512. texture._baseWidth = width;
  4513. texture._baseHeight = height;
  4514. texture._width = width;
  4515. texture._height = height;
  4516. texture.isReady = true;
  4517. texture.references = 1;
  4518. texture.samplingMode = samplingMode;
  4519. this._loadedTexturesCache.push(texture);
  4520. return texture;
  4521. };
  4522. Engine.prototype.createDynamicTexture = function (width, height, generateMipMaps, samplingMode) {
  4523. var texture = this._gl.createTexture();
  4524. width = BABYLON.Tools.GetExponantOfTwo(width, this._caps.maxTextureSize);
  4525. height = BABYLON.Tools.GetExponantOfTwo(height, this._caps.maxTextureSize);
  4526. this._gl.bindTexture(this._gl.TEXTURE_2D, texture);
  4527. var filters = getSamplingParameters(samplingMode, generateMipMaps, this._gl);
  4528. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, filters.mag);
  4529. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, filters.min);
  4530. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  4531. this._activeTexturesCache = [];
  4532. texture._baseWidth = width;
  4533. texture._baseHeight = height;
  4534. texture._width = width;
  4535. texture._height = height;
  4536. texture.isReady = false;
  4537. texture.generateMipMaps = generateMipMaps;
  4538. texture.references = 1;
  4539. texture.samplingMode = samplingMode;
  4540. this._loadedTexturesCache.push(texture);
  4541. return texture;
  4542. };
  4543. Engine.prototype.updateDynamicTexture = function (texture, canvas, invertY) {
  4544. this._gl.bindTexture(this._gl.TEXTURE_2D, texture);
  4545. this._gl.pixelStorei(this._gl.UNPACK_FLIP_Y_WEBGL, invertY ? 1 : 0);
  4546. this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.RGBA, this._gl.RGBA, this._gl.UNSIGNED_BYTE, canvas);
  4547. if (texture.generateMipMaps) {
  4548. this._gl.generateMipmap(this._gl.TEXTURE_2D);
  4549. }
  4550. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  4551. this._activeTexturesCache = [];
  4552. texture.isReady = true;
  4553. };
  4554. Engine.prototype.updateVideoTexture = function (texture, video, invertY) {
  4555. this._gl.bindTexture(this._gl.TEXTURE_2D, texture);
  4556. this._gl.pixelStorei(this._gl.UNPACK_FLIP_Y_WEBGL, invertY ? 0 : 1); // Video are upside down by default
  4557. // Scale the video if it is a NPOT using the current working canvas
  4558. if (video.videoWidth !== texture._width || video.videoHeight !== texture._height) {
  4559. if (!texture._workingCanvas) {
  4560. texture._workingCanvas = document.createElement("canvas");
  4561. texture._workingContext = texture._workingCanvas.getContext("2d");
  4562. texture._workingCanvas.width = texture._width;
  4563. texture._workingCanvas.height = texture._height;
  4564. }
  4565. texture._workingContext.drawImage(video, 0, 0, video.videoWidth, video.videoHeight, 0, 0, texture._width, texture._height);
  4566. this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.RGBA, this._gl.RGBA, this._gl.UNSIGNED_BYTE, texture._workingCanvas);
  4567. }
  4568. else {
  4569. this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.RGBA, this._gl.RGBA, this._gl.UNSIGNED_BYTE, video);
  4570. }
  4571. if (texture.generateMipMaps) {
  4572. this._gl.generateMipmap(this._gl.TEXTURE_2D);
  4573. }
  4574. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  4575. this._activeTexturesCache = [];
  4576. texture.isReady = true;
  4577. };
  4578. Engine.prototype.createRenderTargetTexture = function (size, options) {
  4579. // old version had a "generateMipMaps" arg instead of options.
  4580. // if options.generateMipMaps is undefined, consider that options itself if the generateMipmaps value
  4581. // in the same way, generateDepthBuffer is defaulted to true
  4582. var generateMipMaps = false;
  4583. var generateDepthBuffer = true;
  4584. var type = Engine.TEXTURETYPE_UNSIGNED_INT;
  4585. var samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE;
  4586. if (options !== undefined) {
  4587. generateMipMaps = options.generateMipMaps === undefined ? options : options.generateMipmaps;
  4588. generateDepthBuffer = options.generateDepthBuffer === undefined ? true : options.generateDepthBuffer;
  4589. type = options.type === undefined ? type : options.type;
  4590. if (options.samplingMode !== undefined) {
  4591. samplingMode = options.samplingMode;
  4592. }
  4593. if (type === Engine.TEXTURETYPE_FLOAT) {
  4594. // if floating point (gl.FLOAT) then force to NEAREST_SAMPLINGMODE
  4595. samplingMode = BABYLON.Texture.NEAREST_SAMPLINGMODE;
  4596. }
  4597. }
  4598. var gl = this._gl;
  4599. var texture = gl.createTexture();
  4600. gl.bindTexture(gl.TEXTURE_2D, texture);
  4601. var width = size.width || size;
  4602. var height = size.height || size;
  4603. var filters = getSamplingParameters(samplingMode, generateMipMaps, gl);
  4604. if (type === Engine.TEXTURETYPE_FLOAT && !this._caps.textureFloat) {
  4605. type = Engine.TEXTURETYPE_UNSIGNED_INT;
  4606. BABYLON.Tools.Warn("Float textures are not supported. Render target forced to TEXTURETYPE_UNSIGNED_BYTE type");
  4607. }
  4608. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MAG_FILTER, filters.mag);
  4609. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MIN_FILTER, filters.min);
  4610. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_WRAP_S, gl.CLAMP_TO_EDGE);
  4611. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_WRAP_T, gl.CLAMP_TO_EDGE);
  4612. gl.texImage2D(gl.TEXTURE_2D, 0, gl.RGBA, width, height, 0, gl.RGBA, getWebGLTextureType(gl, type), null);
  4613. var depthBuffer;
  4614. // Create the depth buffer
  4615. if (generateDepthBuffer) {
  4616. depthBuffer = gl.createRenderbuffer();
  4617. gl.bindRenderbuffer(gl.RENDERBUFFER, depthBuffer);
  4618. gl.renderbufferStorage(gl.RENDERBUFFER, gl.DEPTH_COMPONENT16, width, height);
  4619. }
  4620. // Create the framebuffer
  4621. var framebuffer = gl.createFramebuffer();
  4622. gl.bindFramebuffer(gl.FRAMEBUFFER, framebuffer);
  4623. gl.framebufferTexture2D(gl.FRAMEBUFFER, gl.COLOR_ATTACHMENT0, gl.TEXTURE_2D, texture, 0);
  4624. if (generateDepthBuffer) {
  4625. gl.framebufferRenderbuffer(gl.FRAMEBUFFER, gl.DEPTH_ATTACHMENT, gl.RENDERBUFFER, depthBuffer);
  4626. }
  4627. // Unbind
  4628. gl.bindTexture(gl.TEXTURE_2D, null);
  4629. gl.bindRenderbuffer(gl.RENDERBUFFER, null);
  4630. gl.bindFramebuffer(gl.FRAMEBUFFER, null);
  4631. texture._framebuffer = framebuffer;
  4632. if (generateDepthBuffer) {
  4633. texture._depthBuffer = depthBuffer;
  4634. }
  4635. texture._width = width;
  4636. texture._height = height;
  4637. texture.isReady = true;
  4638. texture.generateMipMaps = generateMipMaps;
  4639. texture.references = 1;
  4640. texture.samplingMode = samplingMode;
  4641. this._activeTexturesCache = [];
  4642. this._loadedTexturesCache.push(texture);
  4643. return texture;
  4644. };
  4645. Engine.prototype.createCubeTexture = function (rootUrl, scene, extensions, noMipmap) {
  4646. var _this = this;
  4647. var gl = this._gl;
  4648. var texture = gl.createTexture();
  4649. texture.isCube = true;
  4650. texture.url = rootUrl;
  4651. texture.references = 1;
  4652. this._loadedTexturesCache.push(texture);
  4653. var extension = rootUrl.substr(rootUrl.length - 4, 4).toLowerCase();
  4654. var isDDS = this.getCaps().s3tc && (extension === ".dds");
  4655. if (isDDS) {
  4656. BABYLON.Tools.LoadFile(rootUrl, function (data) {
  4657. var info = BABYLON.Internals.DDSTools.GetDDSInfo(data);
  4658. var loadMipmap = (info.isRGB || info.isLuminance || info.mipmapCount > 1) && !noMipmap;
  4659. gl.bindTexture(gl.TEXTURE_CUBE_MAP, texture);
  4660. gl.pixelStorei(gl.UNPACK_FLIP_Y_WEBGL, 1);
  4661. BABYLON.Internals.DDSTools.UploadDDSLevels(_this._gl, _this.getCaps().s3tc, data, info, loadMipmap, 6);
  4662. if (!noMipmap && !info.isFourCC && info.mipmapCount === 1) {
  4663. gl.generateMipmap(gl.TEXTURE_CUBE_MAP);
  4664. }
  4665. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MAG_FILTER, gl.LINEAR);
  4666. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MIN_FILTER, loadMipmap ? gl.LINEAR_MIPMAP_LINEAR : gl.LINEAR);
  4667. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_S, gl.CLAMP_TO_EDGE);
  4668. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_T, gl.CLAMP_TO_EDGE);
  4669. gl.bindTexture(gl.TEXTURE_CUBE_MAP, null);
  4670. _this._activeTexturesCache = [];
  4671. texture._width = info.width;
  4672. texture._height = info.height;
  4673. texture.isReady = true;
  4674. }, null, null, true);
  4675. }
  4676. else {
  4677. cascadeLoad(rootUrl, scene, function (imgs) {
  4678. var width = BABYLON.Tools.GetExponantOfTwo(imgs[0].width, _this._caps.maxCubemapTextureSize);
  4679. var height = width;
  4680. _this._workingCanvas.width = width;
  4681. _this._workingCanvas.height = height;
  4682. var faces = [
  4683. gl.TEXTURE_CUBE_MAP_POSITIVE_X,
  4684. gl.TEXTURE_CUBE_MAP_POSITIVE_Y,
  4685. gl.TEXTURE_CUBE_MAP_POSITIVE_Z,
  4686. gl.TEXTURE_CUBE_MAP_NEGATIVE_X,
  4687. gl.TEXTURE_CUBE_MAP_NEGATIVE_Y,
  4688. gl.TEXTURE_CUBE_MAP_NEGATIVE_Z
  4689. ];
  4690. gl.bindTexture(gl.TEXTURE_CUBE_MAP, texture);
  4691. gl.pixelStorei(gl.UNPACK_FLIP_Y_WEBGL, 0);
  4692. for (var index = 0; index < faces.length; index++) {
  4693. _this._workingContext.drawImage(imgs[index], 0, 0, imgs[index].width, imgs[index].height, 0, 0, width, height);
  4694. gl.texImage2D(faces[index], 0, gl.RGBA, gl.RGBA, gl.UNSIGNED_BYTE, _this._workingCanvas);
  4695. }
  4696. if (!noMipmap) {
  4697. gl.generateMipmap(gl.TEXTURE_CUBE_MAP);
  4698. }
  4699. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MAG_FILTER, gl.LINEAR);
  4700. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MIN_FILTER, noMipmap ? gl.LINEAR : gl.LINEAR_MIPMAP_LINEAR);
  4701. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_S, gl.CLAMP_TO_EDGE);
  4702. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_T, gl.CLAMP_TO_EDGE);
  4703. gl.bindTexture(gl.TEXTURE_CUBE_MAP, null);
  4704. _this._activeTexturesCache = [];
  4705. texture._width = width;
  4706. texture._height = height;
  4707. texture.isReady = true;
  4708. }, extensions);
  4709. }
  4710. return texture;
  4711. };
  4712. Engine.prototype._releaseTexture = function (texture) {
  4713. var gl = this._gl;
  4714. if (texture._framebuffer) {
  4715. gl.deleteFramebuffer(texture._framebuffer);
  4716. }
  4717. if (texture._depthBuffer) {
  4718. gl.deleteRenderbuffer(texture._depthBuffer);
  4719. }
  4720. gl.deleteTexture(texture);
  4721. for (var channel = 0; channel < this._caps.maxTexturesImageUnits; channel++) {
  4722. this._gl.activeTexture(this._gl["TEXTURE" + channel]);
  4723. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  4724. this._gl.bindTexture(this._gl.TEXTURE_CUBE_MAP, null);
  4725. this._activeTexturesCache[channel] = null;
  4726. }
  4727. var index = this._loadedTexturesCache.indexOf(texture);
  4728. if (index !== -1) {
  4729. this._loadedTexturesCache.splice(index, 1);
  4730. }
  4731. };
  4732. Engine.prototype.bindSamplers = function (effect) {
  4733. this._gl.useProgram(effect.getProgram());
  4734. var samplers = effect.getSamplers();
  4735. for (var index = 0; index < samplers.length; index++) {
  4736. var uniform = effect.getUniform(samplers[index]);
  4737. this._gl.uniform1i(uniform, index);
  4738. }
  4739. this._currentEffect = null;
  4740. };
  4741. Engine.prototype._bindTexture = function (channel, texture) {
  4742. this._gl.activeTexture(this._gl["TEXTURE" + channel]);
  4743. this._gl.bindTexture(this._gl.TEXTURE_2D, texture);
  4744. this._activeTexturesCache[channel] = null;
  4745. };
  4746. Engine.prototype.setTextureFromPostProcess = function (channel, postProcess) {
  4747. this._bindTexture(channel, postProcess._textures.data[postProcess._currentRenderTextureInd]);
  4748. };
  4749. Engine.prototype.setTexture = function (channel, texture) {
  4750. if (channel < 0) {
  4751. return;
  4752. }
  4753. // Not ready?
  4754. if (!texture || !texture.isReady()) {
  4755. if (this._activeTexturesCache[channel] != null) {
  4756. this._gl.activeTexture(this._gl["TEXTURE" + channel]);
  4757. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  4758. this._gl.bindTexture(this._gl.TEXTURE_CUBE_MAP, null);
  4759. this._activeTexturesCache[channel] = null;
  4760. }
  4761. return;
  4762. }
  4763. // Video
  4764. if (texture instanceof BABYLON.VideoTexture) {
  4765. if (texture.update()) {
  4766. this._activeTexturesCache[channel] = null;
  4767. }
  4768. }
  4769. else if (texture.delayLoadState === Engine.DELAYLOADSTATE_NOTLOADED) {
  4770. texture.delayLoad();
  4771. return;
  4772. }
  4773. if (this._activeTexturesCache[channel] === texture) {
  4774. return;
  4775. }
  4776. this._activeTexturesCache[channel] = texture;
  4777. var internalTexture = texture.getInternalTexture();
  4778. this._gl.activeTexture(this._gl["TEXTURE" + channel]);
  4779. if (internalTexture.isCube) {
  4780. this._gl.bindTexture(this._gl.TEXTURE_CUBE_MAP, internalTexture);
  4781. if (internalTexture._cachedCoordinatesMode !== texture.coordinatesMode) {
  4782. internalTexture._cachedCoordinatesMode = texture.coordinatesMode;
  4783. // CUBIC_MODE and SKYBOX_MODE both require CLAMP_TO_EDGE. All other modes use REPEAT.
  4784. var textureWrapMode = (texture.coordinatesMode !== BABYLON.Texture.CUBIC_MODE && texture.coordinatesMode !== BABYLON.Texture.SKYBOX_MODE) ? this._gl.REPEAT : this._gl.CLAMP_TO_EDGE;
  4785. this._gl.texParameteri(this._gl.TEXTURE_CUBE_MAP, this._gl.TEXTURE_WRAP_S, textureWrapMode);
  4786. this._gl.texParameteri(this._gl.TEXTURE_CUBE_MAP, this._gl.TEXTURE_WRAP_T, textureWrapMode);
  4787. }
  4788. this._setAnisotropicLevel(this._gl.TEXTURE_CUBE_MAP, texture);
  4789. }
  4790. else {
  4791. this._gl.bindTexture(this._gl.TEXTURE_2D, internalTexture);
  4792. if (internalTexture._cachedWrapU !== texture.wrapU) {
  4793. internalTexture._cachedWrapU = texture.wrapU;
  4794. switch (texture.wrapU) {
  4795. case BABYLON.Texture.WRAP_ADDRESSMODE:
  4796. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.REPEAT);
  4797. break;
  4798. case BABYLON.Texture.CLAMP_ADDRESSMODE:
  4799. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE);
  4800. break;
  4801. case BABYLON.Texture.MIRROR_ADDRESSMODE:
  4802. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.MIRRORED_REPEAT);
  4803. break;
  4804. }
  4805. }
  4806. if (internalTexture._cachedWrapV !== texture.wrapV) {
  4807. internalTexture._cachedWrapV = texture.wrapV;
  4808. switch (texture.wrapV) {
  4809. case BABYLON.Texture.WRAP_ADDRESSMODE:
  4810. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.REPEAT);
  4811. break;
  4812. case BABYLON.Texture.CLAMP_ADDRESSMODE:
  4813. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE);
  4814. break;
  4815. case BABYLON.Texture.MIRROR_ADDRESSMODE:
  4816. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.MIRRORED_REPEAT);
  4817. break;
  4818. }
  4819. }
  4820. this._setAnisotropicLevel(this._gl.TEXTURE_2D, texture);
  4821. }
  4822. };
  4823. Engine.prototype._setAnisotropicLevel = function (key, texture) {
  4824. var anisotropicFilterExtension = this._caps.textureAnisotropicFilterExtension;
  4825. if (anisotropicFilterExtension && texture._cachedAnisotropicFilteringLevel !== texture.anisotropicFilteringLevel) {
  4826. this._gl.texParameterf(key, anisotropicFilterExtension.TEXTURE_MAX_ANISOTROPY_EXT, Math.min(texture.anisotropicFilteringLevel, this._caps.maxAnisotropy));
  4827. texture._cachedAnisotropicFilteringLevel = texture.anisotropicFilteringLevel;
  4828. }
  4829. };
  4830. Engine.prototype.readPixels = function (x, y, width, height) {
  4831. var data = new Uint8Array(height * width * 4);
  4832. this._gl.readPixels(0, 0, width, height, this._gl.RGBA, this._gl.UNSIGNED_BYTE, data);
  4833. return data;
  4834. };
  4835. // Dispose
  4836. Engine.prototype.dispose = function () {
  4837. this.hideLoadingUI();
  4838. this.stopRenderLoop();
  4839. while (this.scenes.length) {
  4840. this.scenes[0].dispose();
  4841. }
  4842. // Release audio engine
  4843. Engine.audioEngine.dispose();
  4844. for (var name in this._compiledEffects) {
  4845. this._gl.deleteProgram(this._compiledEffects[name]._program);
  4846. }
  4847. for (var i in this._vertexAttribArrays) {
  4848. if (i > this._gl.VERTEX_ATTRIB_ARRAY_ENABLED || !this._vertexAttribArrays[i]) {
  4849. continue;
  4850. }
  4851. this._gl.disableVertexAttribArray(i);
  4852. }
  4853. // Events
  4854. window.removeEventListener("blur", this._onBlur);
  4855. window.removeEventListener("focus", this._onFocus);
  4856. document.removeEventListener("fullscreenchange", this._onFullscreenChange);
  4857. document.removeEventListener("mozfullscreenchange", this._onFullscreenChange);
  4858. document.removeEventListener("webkitfullscreenchange", this._onFullscreenChange);
  4859. document.removeEventListener("msfullscreenchange", this._onFullscreenChange);
  4860. document.removeEventListener("pointerlockchange", this._onPointerLockChange);
  4861. document.removeEventListener("mspointerlockchange", this._onPointerLockChange);
  4862. document.removeEventListener("mozpointerlockchange", this._onPointerLockChange);
  4863. document.removeEventListener("webkitpointerlockchange", this._onPointerLockChange);
  4864. };
  4865. // Loading screen
  4866. Engine.prototype.displayLoadingUI = function () {
  4867. var _this = this;
  4868. this._loadingDiv = document.createElement("div");
  4869. this._loadingDiv.style.opacity = "0";
  4870. this._loadingDiv.style.transition = "opacity 1.5s ease";
  4871. // Loading text
  4872. this._loadingTextDiv = document.createElement("div");
  4873. this._loadingTextDiv.style.position = "absolute";
  4874. this._loadingTextDiv.style.left = "0";
  4875. this._loadingTextDiv.style.top = "50%";
  4876. this._loadingTextDiv.style.marginTop = "80px";
  4877. this._loadingTextDiv.style.width = "100%";
  4878. this._loadingTextDiv.style.height = "20px";
  4879. this._loadingTextDiv.style.fontFamily = "Arial";
  4880. this._loadingTextDiv.style.fontSize = "14px";
  4881. this._loadingTextDiv.style.color = "white";
  4882. this._loadingTextDiv.style.textAlign = "center";
  4883. this._loadingTextDiv.innerHTML = "Loading";
  4884. this._loadingDiv.appendChild(this._loadingTextDiv);
  4885. // Loading img
  4886. var imgBack = new Image();
  4887. imgBack.src = "data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAGQAAABkCAYAAABw4pVUAAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAJcEhZcwAADsMAAA7DAcdvqGQAAAAYdEVYdFNvZnR3YXJlAHBhaW50Lm5ldCA0LjAuM4zml1AAAARbSURBVHhe7Z09aFNRFMc716kuLrq4FdyLq4Wi4CAoRQcR0UJBUBdRiuLSIYMo6CA4FF2sgw6CFAdFUOpSQYcWO4hD26UQCfXrIQrx/JJzw1OSWq3NPeL/B4Fy+0jg/HO+7j3vpUcI8b/Q39+/49ihfWdPHT94Yf/e3Se3bd263f8lus218TPn6vV6Ya8Wi/MzNRNmj18iusX9W1evmP1/EKNEIVG6CMbG6E3bt+fT++pHha8NoHdT72bLE8NDg7tGU64gLLndV4Wc4m8j/pS+vr4tGB/DT16v3Fyr8dvBe/jbit8BL0AES9LX1iPAz+BR/hFiLVCynj95dPzNy6fv3IZ/k4L3948Sq7FzYGBg4vLFGxitabuOFCbWNKGrMnbiUuo18KaV6tIHv6YtvL9/nOgE31jCktmrY7k6+/zhE4yP4Vf7hiNqh/BWWEl8mzDol4p22Lf7cIdvdUMEvv0Y2S9fE5S1hLzpqTsPkiep//gFGPnR3Yl7GL5p/xYFBrTwM+iXio3GqpwDGL5p/xYNIX7XG8Q6IJRgdIzf1KBBgafII7oMidhyQtVFaMA2Bt7il4huQRhaXphbcR2g4RXqBzKAGHiCCwGFVUAj/m/RTRDj29cvn10I0PZ3LghH5f4CL1EFlQmqqXK3jDDKFxmhQ3Yt6oQseUZGKmMnTpsOqc8o1F9kBOMjQlOLeqEeIyOc6JV6jYLJD/+XyIFvnzdgl9aXRQ5I2qZDK1SpospMqaoqON/wZZGDciLnMMiXRS7IF4hhqMTNTdk7CFu+LHLhR7BQqBvPDJUUQqCGvCMATHUgBmhWNgApmdOda9YpM+VwRYfuyyIXDK8hBlilNerLIheMZCKGwlUAyru6GlwOgPUbRxADdJ9FAChxXY864viyyEXqPxhc0M2TAfAbatSdRyHtXymhByEdRnE3ky+JnHAIhSA0h74kckETmHoQbSgGwJrCIRMEPSRIBCRIMAhZaYhaggQhJXUJEoRU9mofKwh+F22dLRRfEjlJM7w6KQwCoQpBOKTyJZETjmwRxKqtGV8SOSkNOGjKPQppBEgDDkFgpxdBVGkFgaYQQXRIFQSObk0P5ZFIpAZRHXsQ0r0hCluBWKkuvVbYCkQaCdL5ehBScudJP4yY+rLISdps1NBDEJKXMMmoSfggWC4ZQRR17oFYXph7hSiquIKQ+hJGTX1J5MYSPD/GVdNzsgLBwZVCVyAQAkF0ohiI/c1fS6tNXq9UfEnkhudmIQolsS+J3Hh/UtNDzQLhj42VKJFInqLwFYiUU5ToA+HdfI0JevUpQUAIn+vSz2lHIuUV/dJOIHhOY/IWVWGBIHQtzs88s9zyWBuTgcBLzGOmeNnfF/QslSDgMeQW85i3DOQxuipxAkCyZ8SIm4Omp+7MMlCB59j6sKZcMoM4iIEoeI2J9AKxrFobZx0v4vYInuHFS4J1GQRCAGaLEYQXfyMML5XSQgghhBBCCCH+cXp6vgNhKpSKX/XdOAAAAABJRU5ErkJggg==";
  4888. imgBack.style.position = "absolute";
  4889. imgBack.style.left = "50%";
  4890. imgBack.style.top = "50%";
  4891. imgBack.style.marginLeft = "-50px";
  4892. imgBack.style.marginTop = "-50px";
  4893. imgBack.style.transition = "transform 1.0s ease";
  4894. imgBack.style.webkitTransition = "-webkit-transform 1.0s ease";
  4895. var deg = 360;
  4896. var onTransitionEnd = function () {
  4897. deg += 360;
  4898. imgBack.style.transform = "rotateZ(" + deg + "deg)";
  4899. imgBack.style.webkitTransform = "rotateZ(" + deg + "deg)";
  4900. };
  4901. imgBack.addEventListener("transitionend", onTransitionEnd);
  4902. imgBack.addEventListener("webkitTransitionEnd", onTransitionEnd);
  4903. this._loadingDiv.appendChild(imgBack);
  4904. // front image
  4905. var imgFront = new Image();
  4906. imgFront.src = "data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAGQAAABkCAYAAABw4pVUAAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAJcEhZcwAADsMAAA7DAcdvqGQAAAAYdEVYdFNvZnR3YXJlAHBhaW50Lm5ldCA0LjAuM4zml1AAAAYJSURBVHhe7Zy/qx1FFMff/2Av2Nvbi4WFiiAEY/OQ2IgQsbCJQoqkCAgpFLXyoZURLfwBIiIpgqZJoYQYlWelNsIrNOxDJcrzfHe+G97dnTl75u7euzv7zgcWHrlnZmfOmXPmzI/NjuM4juM4juM4juM4juM4juM4juM4juM45fPic08/uHf5/CvffH7lnT8PfrtxdHS0n3p+/fHGl5+89/prr5599iEWd8bg0rkXHoFyqehKnlxQpjYSDHTm9JMPsGrHylOPPXofvICKXMcIGtXdf/76AYbm6xyNW9e/eAtKC7rbKLXnvHHx5Sf4auc4Ek7OQkFU1Dap/vv37k/wSjblZANFiFIGzw98hhizwqBgs04mCBdQRNCHidoAEtY+lLIvtSdoGFeyql2ZH57HBH4sE7O+o/r9l+8/ZXUni68+2jsHBQQ9qNRGeP/tSxdSYQX/roUcpL4/f3vtM9TD+jTq92n1LQ7jxF1hhGPtwWL3gGccy8JuS1r8sVWBGXNVdSKMYjBGPUJjCzooiGuSpnwlnnOGP2dhHRSLNgpHp2oMKIriK8TmG4Qh/rwW8D6pps9b9im+LDDipXOqMVJrAngBfg9i98gevWKA+/nnCod3Dr5GfaHaDgidVym6HKRjGIkpqthcAVKGxNqBImbEo66kjCih8AOpNmkUmbMuUrR8kEqiU6FvHZLGAPJ71JCYSyhiBqmwFE2GoD6jLGIfDHtG6EzoU4dK21PCqIRMEF0FGRjFzGDtIkXVAdATvsqfT9CJ0JcOFdYiFIsiMlqYy1YOFpQo2OddqBtyEaq9y+efoVh5oPHoROjLKn0j3JIE5Ka8UqZRtGrMnneX6yVofOhDh94MSbznTcpqmDOt1vyQzOgaJAF4F3JBfIXesrNEGWWmjIX7UBZ6jRJbBMLg/DmJiKUGVHleIpnVNTa+jakzkAviJqLhi4MC9XQGBrZeKJZESSrKy7ik0VGFWhQBRDTHIACKQ5l9nAjy75gya4a2w+Jhs0FJdc0xX/GwUbAqFBkZi7QpJ2w16WUbjFyK9MJF3KaoEM74KhVtLrQOrsmRxkbdHEqmSC/c+EuGnIFkjW7Ih2Kr4CCMIvNG2hrrgLpCjiFloooYCjyYrzCRyvhyBthkIPuQtsZGdnbMTezyDiU71KTC5zr7aVsHbsz2tllrEkS5UHwU1tq1HbtPW4UbeB0O7xx8R5EsMJql+BheUmHjkNVmIRP7LutoM3+D4O4tG7vCkNO9ESZ4lL3J6rKRMPx4qKbD/A0icf8CG7tC7kTahnMTwleuYSrsS7GatRAvfZh1tTm5BmmQCdZ8a0Sefe28xUrRBkmFLKy8KTIKUDRX0Y1xagPgwbaIdeFnQULmKak3xvwNMkVGgok/N5XNoehJvejRlCDl9escI28dJU0tZ++nBTJE9mEF647x5Ehbo4s5hDOKFIU0PdofeA5F5k1q63zIWmQqNI/P3ZubjFTqKxQ3jyjHAOX0RdlgVO9hzRFpczRcjZ3Gbxxpc7Qj6+5pTYF2OFXawNI+yDGf1k2NcvOlzBQeDQ/t7zD7DsEDpJ2xATXaNtDWUS4IzP4DS2ljajAVu57SUkYw245ptxZxA5JiZaJ0DswudGn3kYUy54426EjoT4dZfYbccxC2nI92cDkZHQr96jD4AGkMDKeSy/COBsRe6VTSKFN6irLeaCh3IteQjt1E5+oudsG/b/2DfZ5AqsYo8vMDK9LB1HzSsLWvlGThdxXvC6+NsqyPPWP0pMINtbdsajfVeC6f/GZ+cdAofQoB1d+Hf9waY98I7+RXWab3Lt4zYkjHtTnlOLXHYMsCh1zWeQYehu1zfNPOOiys/d91LAKEBSgh6MJMbSA82AaHofDgAIwbgvVvlLNS11nModMm4UZergLHZBZrodmBuA3lBB1thdorSjkOmATMDwg/UBQVtglqQyx6fbEJ+H3IWIapjYAjAfeIgeCMHldueJvFaqDaAHhwf8qNsEEQ1iQbOoUUGIbCLRc8+Bvfp4jyd2FEijuO4ziO4ziO4ziO4ziO4ziO4ziO4ziOUzw7O/8D0P7rcZ/GEboAAAAASUVORK5CYII=";
  4907. imgFront.style.position = "absolute";
  4908. imgFront.style.left = "50%";
  4909. imgFront.style.top = "50%";
  4910. imgFront.style.marginLeft = "-50px";
  4911. imgFront.style.marginTop = "-50px";
  4912. this._loadingDiv.appendChild(imgFront);
  4913. // Resize
  4914. this._resizeLoadingUI = function () {
  4915. var canvasRect = _this.getRenderingCanvasClientRect();
  4916. _this._loadingDiv.style.position = "absolute";
  4917. _this._loadingDiv.style.left = canvasRect.left + "px";
  4918. _this._loadingDiv.style.top = canvasRect.top + "px";
  4919. _this._loadingDiv.style.width = canvasRect.width + "px";
  4920. _this._loadingDiv.style.height = canvasRect.height + "px";
  4921. };
  4922. this._resizeLoadingUI();
  4923. window.addEventListener("resize", this._resizeLoadingUI);
  4924. this._loadingDiv.style.backgroundColor = this._loadingDivBackgroundColor;
  4925. document.body.appendChild(this._loadingDiv);
  4926. setTimeout(function () {
  4927. _this._loadingDiv.style.opacity = "1";
  4928. imgBack.style.transform = "rotateZ(360deg)";
  4929. imgBack.style.webkitTransform = "rotateZ(360deg)";
  4930. }, 0);
  4931. };
  4932. Object.defineProperty(Engine.prototype, "loadingUIText", {
  4933. set: function (text) {
  4934. if (!this._loadingDiv) {
  4935. return;
  4936. }
  4937. this._loadingTextDiv.innerHTML = text;
  4938. },
  4939. enumerable: true,
  4940. configurable: true
  4941. });
  4942. Object.defineProperty(Engine.prototype, "loadingUIBackgroundColor", {
  4943. get: function () {
  4944. return this._loadingDivBackgroundColor;
  4945. },
  4946. set: function (color) {
  4947. this._loadingDivBackgroundColor = color;
  4948. if (!this._loadingDiv) {
  4949. return;
  4950. }
  4951. this._loadingDiv.style.backgroundColor = this._loadingDivBackgroundColor;
  4952. },
  4953. enumerable: true,
  4954. configurable: true
  4955. });
  4956. Engine.prototype.hideLoadingUI = function () {
  4957. var _this = this;
  4958. if (!this._loadingDiv) {
  4959. return;
  4960. }
  4961. var onTransitionEnd = function () {
  4962. if (!_this._loadingDiv) {
  4963. return;
  4964. }
  4965. document.body.removeChild(_this._loadingDiv);
  4966. window.removeEventListener("resize", _this._resizeLoadingUI);
  4967. _this._loadingDiv = null;
  4968. };
  4969. this._loadingDiv.style.opacity = "0";
  4970. this._loadingDiv.addEventListener("transitionend", onTransitionEnd);
  4971. };
  4972. // FPS
  4973. Engine.prototype.getFps = function () {
  4974. return this.fps;
  4975. };
  4976. Engine.prototype.getDeltaTime = function () {
  4977. return this.deltaTime;
  4978. };
  4979. Engine.prototype._measureFps = function () {
  4980. this.previousFramesDuration.push(BABYLON.Tools.Now);
  4981. var length = this.previousFramesDuration.length;
  4982. if (length >= 2) {
  4983. this.deltaTime = this.previousFramesDuration[length - 1] - this.previousFramesDuration[length - 2];
  4984. }
  4985. if (length >= this.fpsRange) {
  4986. if (length > this.fpsRange) {
  4987. this.previousFramesDuration.splice(0, 1);
  4988. length = this.previousFramesDuration.length;
  4989. }
  4990. var sum = 0;
  4991. for (var id = 0; id < length - 1; id++) {
  4992. sum += this.previousFramesDuration[id + 1] - this.previousFramesDuration[id];
  4993. }
  4994. this.fps = 1000.0 / (sum / (length - 1));
  4995. }
  4996. };
  4997. // Statics
  4998. Engine.isSupported = function () {
  4999. try {
  5000. // Avoid creating an unsized context for CocoonJS, since size determined on first creation. Is not resizable
  5001. if (navigator.isCocoonJS) {
  5002. return true;
  5003. }
  5004. var tempcanvas = document.createElement("canvas");
  5005. var gl = tempcanvas.getContext("webgl") || tempcanvas.getContext("experimental-webgl");
  5006. return gl != null && !!window.WebGLRenderingContext;
  5007. }
  5008. catch (e) {
  5009. return false;
  5010. }
  5011. };
  5012. // Const statics
  5013. Engine._ALPHA_DISABLE = 0;
  5014. Engine._ALPHA_ADD = 1;
  5015. Engine._ALPHA_COMBINE = 2;
  5016. Engine._DELAYLOADSTATE_NONE = 0;
  5017. Engine._DELAYLOADSTATE_LOADED = 1;
  5018. Engine._DELAYLOADSTATE_LOADING = 2;
  5019. Engine._DELAYLOADSTATE_NOTLOADED = 4;
  5020. Engine._TEXTUREFORMAT_ALPHA = 0;
  5021. Engine._TEXTUREFORMAT_LUMINANCE = 1;
  5022. Engine._TEXTUREFORMAT_LUMINANCE_ALPHA = 2;
  5023. Engine._TEXTUREFORMAT_RGB = 4;
  5024. Engine._TEXTUREFORMAT_RGBA = 4;
  5025. Engine._TEXTURETYPE_UNSIGNED_INT = 0;
  5026. Engine._TEXTURETYPE_FLOAT = 1;
  5027. // Updatable statics so stick with vars here
  5028. Engine.Epsilon = 0.001;
  5029. Engine.CollisionsEpsilon = 0.001;
  5030. Engine.ShadersRepository = "Babylon/Shaders/";
  5031. return Engine;
  5032. })();
  5033. BABYLON.Engine = Engine;
  5034. })(BABYLON || (BABYLON = {}));
  5035. //# sourceMappingURL=babylon.engine.js.mapvar BABYLON;
  5036. (function (BABYLON) {
  5037. /**
  5038. * Node is the basic class for all scene objects (Mesh, Light Camera).
  5039. */
  5040. var Node = (function () {
  5041. /**
  5042. * @constructor
  5043. * @param {string} name - the name and id to be given to this node
  5044. * @param {BABYLON.Scene} the scene this node will be added to
  5045. */
  5046. function Node(name, scene) {
  5047. this.state = "";
  5048. this.animations = new Array();
  5049. this._childrenFlag = -1;
  5050. this._isEnabled = true;
  5051. this._isReady = true;
  5052. this._currentRenderId = -1;
  5053. this.name = name;
  5054. this.id = name;
  5055. this._scene = scene;
  5056. this._initCache();
  5057. }
  5058. Node.prototype.getScene = function () {
  5059. return this._scene;
  5060. };
  5061. Node.prototype.getEngine = function () {
  5062. return this._scene.getEngine();
  5063. };
  5064. // override it in derived class
  5065. Node.prototype.getWorldMatrix = function () {
  5066. return BABYLON.Matrix.Identity();
  5067. };
  5068. // override it in derived class if you add new variables to the cache
  5069. // and call the parent class method
  5070. Node.prototype._initCache = function () {
  5071. this._cache = {};
  5072. this._cache.parent = undefined;
  5073. };
  5074. Node.prototype.updateCache = function (force) {
  5075. if (!force && this.isSynchronized())
  5076. return;
  5077. this._cache.parent = this.parent;
  5078. this._updateCache();
  5079. };
  5080. // override it in derived class if you add new variables to the cache
  5081. // and call the parent class method if !ignoreParentClass
  5082. Node.prototype._updateCache = function (ignoreParentClass) {
  5083. };
  5084. // override it in derived class if you add new variables to the cache
  5085. Node.prototype._isSynchronized = function () {
  5086. return true;
  5087. };
  5088. Node.prototype.isSynchronizedWithParent = function () {
  5089. return this.parent ? this.parent._currentRenderId <= this._currentRenderId : true;
  5090. };
  5091. Node.prototype.isSynchronized = function (updateCache) {
  5092. var check = this.hasNewParent();
  5093. check = check || !this.isSynchronizedWithParent();
  5094. check = check || !this._isSynchronized();
  5095. if (updateCache)
  5096. this.updateCache(true);
  5097. return !check;
  5098. };
  5099. Node.prototype.hasNewParent = function (update) {
  5100. if (this._cache.parent === this.parent)
  5101. return false;
  5102. if (update)
  5103. this._cache.parent = this.parent;
  5104. return true;
  5105. };
  5106. /**
  5107. * Is this node ready to be used/rendered
  5108. * @return {boolean} is it ready
  5109. */
  5110. Node.prototype.isReady = function () {
  5111. return this._isReady;
  5112. };
  5113. /**
  5114. * Is this node enabled.
  5115. * If the node has a parent and is enabled, the parent will be inspected as well.
  5116. * @return {boolean} whether this node (and its parent) is enabled.
  5117. * @see setEnabled
  5118. */
  5119. Node.prototype.isEnabled = function () {
  5120. if (!this._isEnabled) {
  5121. return false;
  5122. }
  5123. if (this.parent) {
  5124. return this.parent.isEnabled();
  5125. }
  5126. return true;
  5127. };
  5128. /**
  5129. * Set the enabled state of this node.
  5130. * @param {boolean} value - the new enabled state
  5131. * @see isEnabled
  5132. */
  5133. Node.prototype.setEnabled = function (value) {
  5134. this._isEnabled = value;
  5135. };
  5136. /**
  5137. * Is this node a descendant of the given node.
  5138. * The function will iterate up the hierarchy until the ancestor was found or no more parents defined.
  5139. * @param {BABYLON.Node} ancestor - The parent node to inspect
  5140. * @see parent
  5141. */
  5142. Node.prototype.isDescendantOf = function (ancestor) {
  5143. if (this.parent) {
  5144. if (this.parent === ancestor) {
  5145. return true;
  5146. }
  5147. return this.parent.isDescendantOf(ancestor);
  5148. }
  5149. return false;
  5150. };
  5151. Node.prototype._getDescendants = function (list, results) {
  5152. for (var index = 0; index < list.length; index++) {
  5153. var item = list[index];
  5154. if (item.isDescendantOf(this)) {
  5155. results.push(item);
  5156. }
  5157. }
  5158. };
  5159. /**
  5160. * Will return all nodes that have this node as parent.
  5161. * @return {BABYLON.Node[]} all children nodes of all types.
  5162. */
  5163. Node.prototype.getDescendants = function () {
  5164. var results = [];
  5165. this._getDescendants(this._scene.meshes, results);
  5166. this._getDescendants(this._scene.lights, results);
  5167. this._getDescendants(this._scene.cameras, results);
  5168. return results;
  5169. };
  5170. Node.prototype._setReady = function (state) {
  5171. if (state == this._isReady) {
  5172. return;
  5173. }
  5174. if (!state) {
  5175. this._isReady = false;
  5176. return;
  5177. }
  5178. this._isReady = true;
  5179. if (this.onReady) {
  5180. this.onReady(this);
  5181. }
  5182. };
  5183. return Node;
  5184. })();
  5185. BABYLON.Node = Node;
  5186. })(BABYLON || (BABYLON = {}));
  5187. //# sourceMappingURL=babylon.node.js.mapvar BABYLON;
  5188. (function (BABYLON) {
  5189. var BoundingSphere = (function () {
  5190. function BoundingSphere(minimum, maximum) {
  5191. this.minimum = minimum;
  5192. this.maximum = maximum;
  5193. this._tempRadiusVector = BABYLON.Vector3.Zero();
  5194. var distance = BABYLON.Vector3.Distance(minimum, maximum);
  5195. this.center = BABYLON.Vector3.Lerp(minimum, maximum, 0.5);
  5196. this.radius = distance * 0.5;
  5197. this.centerWorld = BABYLON.Vector3.Zero();
  5198. this._update(BABYLON.Matrix.Identity());
  5199. }
  5200. // Methods
  5201. BoundingSphere.prototype._update = function (world) {
  5202. BABYLON.Vector3.TransformCoordinatesToRef(this.center, world, this.centerWorld);
  5203. BABYLON.Vector3.TransformNormalFromFloatsToRef(1.0, 1.0, 1.0, world, this._tempRadiusVector);
  5204. this.radiusWorld = Math.max(Math.abs(this._tempRadiusVector.x), Math.abs(this._tempRadiusVector.y), Math.abs(this._tempRadiusVector.z)) * this.radius;
  5205. };
  5206. BoundingSphere.prototype.isInFrustum = function (frustumPlanes) {
  5207. for (var i = 0; i < 6; i++) {
  5208. if (frustumPlanes[i].dotCoordinate(this.centerWorld) <= -this.radiusWorld)
  5209. return false;
  5210. }
  5211. return true;
  5212. };
  5213. BoundingSphere.prototype.intersectsPoint = function (point) {
  5214. var x = this.centerWorld.x - point.x;
  5215. var y = this.centerWorld.y - point.y;
  5216. var z = this.centerWorld.z - point.z;
  5217. var distance = Math.sqrt((x * x) + (y * y) + (z * z));
  5218. if (Math.abs(this.radiusWorld - distance) < BABYLON.Engine.Epsilon)
  5219. return false;
  5220. return true;
  5221. };
  5222. // Statics
  5223. BoundingSphere.Intersects = function (sphere0, sphere1) {
  5224. var x = sphere0.centerWorld.x - sphere1.centerWorld.x;
  5225. var y = sphere0.centerWorld.y - sphere1.centerWorld.y;
  5226. var z = sphere0.centerWorld.z - sphere1.centerWorld.z;
  5227. var distance = Math.sqrt((x * x) + (y * y) + (z * z));
  5228. if (sphere0.radiusWorld + sphere1.radiusWorld < distance)
  5229. return false;
  5230. return true;
  5231. };
  5232. return BoundingSphere;
  5233. })();
  5234. BABYLON.BoundingSphere = BoundingSphere;
  5235. })(BABYLON || (BABYLON = {}));
  5236. //# sourceMappingURL=babylon.boundingSphere.js.mapvar BABYLON;
  5237. (function (BABYLON) {
  5238. var BoundingBox = (function () {
  5239. function BoundingBox(minimum, maximum) {
  5240. this.minimum = minimum;
  5241. this.maximum = maximum;
  5242. this.vectors = new Array();
  5243. this.vectorsWorld = new Array();
  5244. // Bounding vectors
  5245. this.vectors.push(this.minimum.clone());
  5246. this.vectors.push(this.maximum.clone());
  5247. this.vectors.push(this.minimum.clone());
  5248. this.vectors[2].x = this.maximum.x;
  5249. this.vectors.push(this.minimum.clone());
  5250. this.vectors[3].y = this.maximum.y;
  5251. this.vectors.push(this.minimum.clone());
  5252. this.vectors[4].z = this.maximum.z;
  5253. this.vectors.push(this.maximum.clone());
  5254. this.vectors[5].z = this.minimum.z;
  5255. this.vectors.push(this.maximum.clone());
  5256. this.vectors[6].x = this.minimum.x;
  5257. this.vectors.push(this.maximum.clone());
  5258. this.vectors[7].y = this.minimum.y;
  5259. // OBB
  5260. this.center = this.maximum.add(this.minimum).scale(0.5);
  5261. this.extendSize = this.maximum.subtract(this.minimum).scale(0.5);
  5262. this.directions = [BABYLON.Vector3.Zero(), BABYLON.Vector3.Zero(), BABYLON.Vector3.Zero()];
  5263. for (var index = 0; index < this.vectors.length; index++) {
  5264. this.vectorsWorld[index] = BABYLON.Vector3.Zero();
  5265. }
  5266. this.minimumWorld = BABYLON.Vector3.Zero();
  5267. this.maximumWorld = BABYLON.Vector3.Zero();
  5268. this._update(BABYLON.Matrix.Identity());
  5269. }
  5270. // Methods
  5271. BoundingBox.prototype.getWorldMatrix = function () {
  5272. return this._worldMatrix;
  5273. };
  5274. BoundingBox.prototype._update = function (world) {
  5275. BABYLON.Vector3.FromFloatsToRef(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE, this.minimumWorld);
  5276. BABYLON.Vector3.FromFloatsToRef(-Number.MAX_VALUE, -Number.MAX_VALUE, -Number.MAX_VALUE, this.maximumWorld);
  5277. for (var index = 0; index < this.vectors.length; index++) {
  5278. var v = this.vectorsWorld[index];
  5279. BABYLON.Vector3.TransformCoordinatesToRef(this.vectors[index], world, v);
  5280. if (v.x < this.minimumWorld.x)
  5281. this.minimumWorld.x = v.x;
  5282. if (v.y < this.minimumWorld.y)
  5283. this.minimumWorld.y = v.y;
  5284. if (v.z < this.minimumWorld.z)
  5285. this.minimumWorld.z = v.z;
  5286. if (v.x > this.maximumWorld.x)
  5287. this.maximumWorld.x = v.x;
  5288. if (v.y > this.maximumWorld.y)
  5289. this.maximumWorld.y = v.y;
  5290. if (v.z > this.maximumWorld.z)
  5291. this.maximumWorld.z = v.z;
  5292. }
  5293. // OBB
  5294. this.maximumWorld.addToRef(this.minimumWorld, this.center);
  5295. this.center.scaleInPlace(0.5);
  5296. BABYLON.Vector3.FromFloatArrayToRef(world.m, 0, this.directions[0]);
  5297. BABYLON.Vector3.FromFloatArrayToRef(world.m, 4, this.directions[1]);
  5298. BABYLON.Vector3.FromFloatArrayToRef(world.m, 8, this.directions[2]);
  5299. this._worldMatrix = world;
  5300. };
  5301. BoundingBox.prototype.isInFrustum = function (frustumPlanes) {
  5302. return BoundingBox.IsInFrustum(this.vectorsWorld, frustumPlanes);
  5303. };
  5304. BoundingBox.prototype.isCompletelyInFrustum = function (frustumPlanes) {
  5305. return BoundingBox.IsCompletelyInFrustum(this.vectorsWorld, frustumPlanes);
  5306. };
  5307. BoundingBox.prototype.intersectsPoint = function (point) {
  5308. var delta = BABYLON.Engine.Epsilon;
  5309. if (this.maximumWorld.x - point.x < delta || delta > point.x - this.minimumWorld.x)
  5310. return false;
  5311. if (this.maximumWorld.y - point.y < delta || delta > point.y - this.minimumWorld.y)
  5312. return false;
  5313. if (this.maximumWorld.z - point.z < delta || delta > point.z - this.minimumWorld.z)
  5314. return false;
  5315. return true;
  5316. };
  5317. BoundingBox.prototype.intersectsSphere = function (sphere) {
  5318. return BoundingBox.IntersectsSphere(this.minimumWorld, this.maximumWorld, sphere.centerWorld, sphere.radiusWorld);
  5319. };
  5320. BoundingBox.prototype.intersectsMinMax = function (min, max) {
  5321. if (this.maximumWorld.x < min.x || this.minimumWorld.x > max.x)
  5322. return false;
  5323. if (this.maximumWorld.y < min.y || this.minimumWorld.y > max.y)
  5324. return false;
  5325. if (this.maximumWorld.z < min.z || this.minimumWorld.z > max.z)
  5326. return false;
  5327. return true;
  5328. };
  5329. // Statics
  5330. BoundingBox.Intersects = function (box0, box1) {
  5331. if (box0.maximumWorld.x < box1.minimumWorld.x || box0.minimumWorld.x > box1.maximumWorld.x)
  5332. return false;
  5333. if (box0.maximumWorld.y < box1.minimumWorld.y || box0.minimumWorld.y > box1.maximumWorld.y)
  5334. return false;
  5335. if (box0.maximumWorld.z < box1.minimumWorld.z || box0.minimumWorld.z > box1.maximumWorld.z)
  5336. return false;
  5337. return true;
  5338. };
  5339. BoundingBox.IntersectsSphere = function (minPoint, maxPoint, sphereCenter, sphereRadius) {
  5340. var vector = BABYLON.Vector3.Clamp(sphereCenter, minPoint, maxPoint);
  5341. var num = BABYLON.Vector3.DistanceSquared(sphereCenter, vector);
  5342. return (num <= (sphereRadius * sphereRadius));
  5343. };
  5344. BoundingBox.IsCompletelyInFrustum = function (boundingVectors, frustumPlanes) {
  5345. for (var p = 0; p < 6; p++) {
  5346. for (var i = 0; i < 8; i++) {
  5347. if (frustumPlanes[p].dotCoordinate(boundingVectors[i]) < 0) {
  5348. return false;
  5349. }
  5350. }
  5351. }
  5352. return true;
  5353. };
  5354. BoundingBox.IsInFrustum = function (boundingVectors, frustumPlanes) {
  5355. for (var p = 0; p < 6; p++) {
  5356. var inCount = 8;
  5357. for (var i = 0; i < 8; i++) {
  5358. if (frustumPlanes[p].dotCoordinate(boundingVectors[i]) < 0) {
  5359. --inCount;
  5360. }
  5361. else {
  5362. break;
  5363. }
  5364. }
  5365. if (inCount === 0)
  5366. return false;
  5367. }
  5368. return true;
  5369. };
  5370. return BoundingBox;
  5371. })();
  5372. BABYLON.BoundingBox = BoundingBox;
  5373. })(BABYLON || (BABYLON = {}));
  5374. //# sourceMappingURL=babylon.boundingBox.js.mapvar BABYLON;
  5375. (function (BABYLON) {
  5376. var computeBoxExtents = function (axis, box) {
  5377. var p = BABYLON.Vector3.Dot(box.center, axis);
  5378. var r0 = Math.abs(BABYLON.Vector3.Dot(box.directions[0], axis)) * box.extendSize.x;
  5379. var r1 = Math.abs(BABYLON.Vector3.Dot(box.directions[1], axis)) * box.extendSize.y;
  5380. var r2 = Math.abs(BABYLON.Vector3.Dot(box.directions[2], axis)) * box.extendSize.z;
  5381. var r = r0 + r1 + r2;
  5382. return {
  5383. min: p - r,
  5384. max: p + r
  5385. };
  5386. };
  5387. var extentsOverlap = function (min0, max0, min1, max1) { return !(min0 > max1 || min1 > max0); };
  5388. var axisOverlap = function (axis, box0, box1) {
  5389. var result0 = computeBoxExtents(axis, box0);
  5390. var result1 = computeBoxExtents(axis, box1);
  5391. return extentsOverlap(result0.min, result0.max, result1.min, result1.max);
  5392. };
  5393. var BoundingInfo = (function () {
  5394. function BoundingInfo(minimum, maximum) {
  5395. this.minimum = minimum;
  5396. this.maximum = maximum;
  5397. this.boundingBox = new BABYLON.BoundingBox(minimum, maximum);
  5398. this.boundingSphere = new BABYLON.BoundingSphere(minimum, maximum);
  5399. }
  5400. // Methods
  5401. BoundingInfo.prototype._update = function (world) {
  5402. this.boundingBox._update(world);
  5403. this.boundingSphere._update(world);
  5404. };
  5405. BoundingInfo.prototype.isInFrustum = function (frustumPlanes) {
  5406. if (!this.boundingSphere.isInFrustum(frustumPlanes))
  5407. return false;
  5408. return this.boundingBox.isInFrustum(frustumPlanes);
  5409. };
  5410. BoundingInfo.prototype.isCompletelyInFrustum = function (frustumPlanes) {
  5411. return this.boundingBox.isCompletelyInFrustum(frustumPlanes);
  5412. };
  5413. BoundingInfo.prototype._checkCollision = function (collider) {
  5414. return collider._canDoCollision(this.boundingSphere.centerWorld, this.boundingSphere.radiusWorld, this.boundingBox.minimumWorld, this.boundingBox.maximumWorld);
  5415. };
  5416. BoundingInfo.prototype.intersectsPoint = function (point) {
  5417. if (!this.boundingSphere.centerWorld) {
  5418. return false;
  5419. }
  5420. if (!this.boundingSphere.intersectsPoint(point)) {
  5421. return false;
  5422. }
  5423. if (!this.boundingBox.intersectsPoint(point)) {
  5424. return false;
  5425. }
  5426. return true;
  5427. };
  5428. BoundingInfo.prototype.intersects = function (boundingInfo, precise) {
  5429. if (!this.boundingSphere.centerWorld || !boundingInfo.boundingSphere.centerWorld) {
  5430. return false;
  5431. }
  5432. if (!BABYLON.BoundingSphere.Intersects(this.boundingSphere, boundingInfo.boundingSphere)) {
  5433. return false;
  5434. }
  5435. if (!BABYLON.BoundingBox.Intersects(this.boundingBox, boundingInfo.boundingBox)) {
  5436. return false;
  5437. }
  5438. if (!precise) {
  5439. return true;
  5440. }
  5441. var box0 = this.boundingBox;
  5442. var box1 = boundingInfo.boundingBox;
  5443. if (!axisOverlap(box0.directions[0], box0, box1))
  5444. return false;
  5445. if (!axisOverlap(box0.directions[1], box0, box1))
  5446. return false;
  5447. if (!axisOverlap(box0.directions[2], box0, box1))
  5448. return false;
  5449. if (!axisOverlap(box1.directions[0], box0, box1))
  5450. return false;
  5451. if (!axisOverlap(box1.directions[1], box0, box1))
  5452. return false;
  5453. if (!axisOverlap(box1.directions[2], box0, box1))
  5454. return false;
  5455. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[0], box1.directions[0]), box0, box1))
  5456. return false;
  5457. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[0], box1.directions[1]), box0, box1))
  5458. return false;
  5459. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[0], box1.directions[2]), box0, box1))
  5460. return false;
  5461. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[1], box1.directions[0]), box0, box1))
  5462. return false;
  5463. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[1], box1.directions[1]), box0, box1))
  5464. return false;
  5465. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[1], box1.directions[2]), box0, box1))
  5466. return false;
  5467. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[2], box1.directions[0]), box0, box1))
  5468. return false;
  5469. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[2], box1.directions[1]), box0, box1))
  5470. return false;
  5471. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[2], box1.directions[2]), box0, box1))
  5472. return false;
  5473. return true;
  5474. };
  5475. return BoundingInfo;
  5476. })();
  5477. BABYLON.BoundingInfo = BoundingInfo;
  5478. })(BABYLON || (BABYLON = {}));
  5479. //# sourceMappingURL=babylon.boundingInfo.js.map
  5480. var BABYLON;
  5481. (function (BABYLON) {
  5482. var Light = (function (_super) {
  5483. __extends(Light, _super);
  5484. function Light(name, scene) {
  5485. _super.call(this, name, scene);
  5486. this.diffuse = new BABYLON.Color3(1.0, 1.0, 1.0);
  5487. this.specular = new BABYLON.Color3(1.0, 1.0, 1.0);
  5488. this.intensity = 1.0;
  5489. this.range = Number.MAX_VALUE;
  5490. this.includedOnlyMeshes = new Array();
  5491. this.excludedMeshes = new Array();
  5492. this._excludedMeshesIds = new Array();
  5493. this._includedOnlyMeshesIds = new Array();
  5494. scene.lights.push(this);
  5495. }
  5496. Light.prototype.getShadowGenerator = function () {
  5497. return this._shadowGenerator;
  5498. };
  5499. Light.prototype.getAbsolutePosition = function () {
  5500. return BABYLON.Vector3.Zero();
  5501. };
  5502. Light.prototype.transferToEffect = function (effect, uniformName0, uniformName1) {
  5503. };
  5504. Light.prototype._getWorldMatrix = function () {
  5505. return BABYLON.Matrix.Identity();
  5506. };
  5507. Light.prototype.canAffectMesh = function (mesh) {
  5508. if (!mesh) {
  5509. return true;
  5510. }
  5511. if (this.includedOnlyMeshes.length > 0 && this.includedOnlyMeshes.indexOf(mesh) === -1) {
  5512. return false;
  5513. }
  5514. if (this.excludedMeshes.length > 0 && this.excludedMeshes.indexOf(mesh) !== -1) {
  5515. return false;
  5516. }
  5517. return true;
  5518. };
  5519. Light.prototype.getWorldMatrix = function () {
  5520. this._currentRenderId = this.getScene().getRenderId();
  5521. var worldMatrix = this._getWorldMatrix();
  5522. if (this.parent && this.parent.getWorldMatrix) {
  5523. if (!this._parentedWorldMatrix) {
  5524. this._parentedWorldMatrix = BABYLON.Matrix.Identity();
  5525. }
  5526. worldMatrix.multiplyToRef(this.parent.getWorldMatrix(), this._parentedWorldMatrix);
  5527. return this._parentedWorldMatrix;
  5528. }
  5529. return worldMatrix;
  5530. };
  5531. Light.prototype.dispose = function () {
  5532. if (this._shadowGenerator) {
  5533. this._shadowGenerator.dispose();
  5534. this._shadowGenerator = null;
  5535. }
  5536. // Remove from scene
  5537. var index = this.getScene().lights.indexOf(this);
  5538. this.getScene().lights.splice(index, 1);
  5539. };
  5540. return Light;
  5541. })(BABYLON.Node);
  5542. BABYLON.Light = Light;
  5543. })(BABYLON || (BABYLON = {}));
  5544. //# sourceMappingURL=babylon.light.js.map
  5545. var BABYLON;
  5546. (function (BABYLON) {
  5547. var PointLight = (function (_super) {
  5548. __extends(PointLight, _super);
  5549. function PointLight(name, position, scene) {
  5550. _super.call(this, name, scene);
  5551. this.position = position;
  5552. }
  5553. PointLight.prototype.getAbsolutePosition = function () {
  5554. return this._transformedPosition ? this._transformedPosition : this.position;
  5555. };
  5556. PointLight.prototype.transferToEffect = function (effect, positionUniformName) {
  5557. if (this.parent && this.parent.getWorldMatrix) {
  5558. if (!this._transformedPosition) {
  5559. this._transformedPosition = BABYLON.Vector3.Zero();
  5560. }
  5561. BABYLON.Vector3.TransformCoordinatesToRef(this.position, this.parent.getWorldMatrix(), this._transformedPosition);
  5562. effect.setFloat4(positionUniformName, this._transformedPosition.x, this._transformedPosition.y, this._transformedPosition.z, 0);
  5563. return;
  5564. }
  5565. effect.setFloat4(positionUniformName, this.position.x, this.position.y, this.position.z, 0);
  5566. };
  5567. PointLight.prototype.getShadowGenerator = function () {
  5568. return null;
  5569. };
  5570. PointLight.prototype._getWorldMatrix = function () {
  5571. if (!this._worldMatrix) {
  5572. this._worldMatrix = BABYLON.Matrix.Identity();
  5573. }
  5574. BABYLON.Matrix.TranslationToRef(this.position.x, this.position.y, this.position.z, this._worldMatrix);
  5575. return this._worldMatrix;
  5576. };
  5577. return PointLight;
  5578. })(BABYLON.Light);
  5579. BABYLON.PointLight = PointLight;
  5580. })(BABYLON || (BABYLON = {}));
  5581. //# sourceMappingURL=babylon.pointLight.js.map
  5582. var BABYLON;
  5583. (function (BABYLON) {
  5584. var SpotLight = (function (_super) {
  5585. __extends(SpotLight, _super);
  5586. function SpotLight(name, position, direction, angle, exponent, scene) {
  5587. _super.call(this, name, scene);
  5588. this.position = position;
  5589. this.direction = direction;
  5590. this.angle = angle;
  5591. this.exponent = exponent;
  5592. }
  5593. SpotLight.prototype.getAbsolutePosition = function () {
  5594. return this.transformedPosition ? this.transformedPosition : this.position;
  5595. };
  5596. SpotLight.prototype.setDirectionToTarget = function (target) {
  5597. this.direction = BABYLON.Vector3.Normalize(target.subtract(this.position));
  5598. return this.direction;
  5599. };
  5600. SpotLight.prototype.computeTransformedPosition = function () {
  5601. if (this.parent && this.parent.getWorldMatrix) {
  5602. if (!this.transformedPosition) {
  5603. this.transformedPosition = BABYLON.Vector3.Zero();
  5604. }
  5605. BABYLON.Vector3.TransformCoordinatesToRef(this.position, this.parent.getWorldMatrix(), this.transformedPosition);
  5606. return true;
  5607. }
  5608. return false;
  5609. };
  5610. SpotLight.prototype.transferToEffect = function (effect, positionUniformName, directionUniformName) {
  5611. var normalizeDirection;
  5612. if (this.parent && this.parent.getWorldMatrix) {
  5613. if (!this._transformedDirection) {
  5614. this._transformedDirection = BABYLON.Vector3.Zero();
  5615. }
  5616. this.computeTransformedPosition();
  5617. BABYLON.Vector3.TransformNormalToRef(this.direction, this.parent.getWorldMatrix(), this._transformedDirection);
  5618. effect.setFloat4(positionUniformName, this.transformedPosition.x, this.transformedPosition.y, this.transformedPosition.z, this.exponent);
  5619. normalizeDirection = BABYLON.Vector3.Normalize(this._transformedDirection);
  5620. }
  5621. else {
  5622. effect.setFloat4(positionUniformName, this.position.x, this.position.y, this.position.z, this.exponent);
  5623. normalizeDirection = BABYLON.Vector3.Normalize(this.direction);
  5624. }
  5625. effect.setFloat4(directionUniformName, normalizeDirection.x, normalizeDirection.y, normalizeDirection.z, Math.cos(this.angle * 0.5));
  5626. };
  5627. SpotLight.prototype._getWorldMatrix = function () {
  5628. if (!this._worldMatrix) {
  5629. this._worldMatrix = BABYLON.Matrix.Identity();
  5630. }
  5631. BABYLON.Matrix.TranslationToRef(this.position.x, this.position.y, this.position.z, this._worldMatrix);
  5632. return this._worldMatrix;
  5633. };
  5634. return SpotLight;
  5635. })(BABYLON.Light);
  5636. BABYLON.SpotLight = SpotLight;
  5637. })(BABYLON || (BABYLON = {}));
  5638. //# sourceMappingURL=babylon.spotLight.js.map
  5639. var BABYLON;
  5640. (function (BABYLON) {
  5641. var DirectionalLight = (function (_super) {
  5642. __extends(DirectionalLight, _super);
  5643. function DirectionalLight(name, direction, scene) {
  5644. _super.call(this, name, scene);
  5645. this.direction = direction;
  5646. this.position = direction.scale(-1);
  5647. }
  5648. DirectionalLight.prototype.getAbsolutePosition = function () {
  5649. return this.transformedPosition ? this.transformedPosition : this.position;
  5650. };
  5651. DirectionalLight.prototype.setDirectionToTarget = function (target) {
  5652. this.direction = BABYLON.Vector3.Normalize(target.subtract(this.position));
  5653. return this.direction;
  5654. };
  5655. DirectionalLight.prototype.computeTransformedPosition = function () {
  5656. if (this.parent && this.parent.getWorldMatrix) {
  5657. if (!this.transformedPosition) {
  5658. this.transformedPosition = BABYLON.Vector3.Zero();
  5659. }
  5660. BABYLON.Vector3.TransformCoordinatesToRef(this.position, this.parent.getWorldMatrix(), this.transformedPosition);
  5661. return true;
  5662. }
  5663. return false;
  5664. };
  5665. DirectionalLight.prototype.transferToEffect = function (effect, directionUniformName) {
  5666. if (this.parent && this.parent.getWorldMatrix) {
  5667. if (!this._transformedDirection) {
  5668. this._transformedDirection = BABYLON.Vector3.Zero();
  5669. }
  5670. BABYLON.Vector3.TransformNormalToRef(this.direction, this.parent.getWorldMatrix(), this._transformedDirection);
  5671. effect.setFloat4(directionUniformName, this._transformedDirection.x, this._transformedDirection.y, this._transformedDirection.z, 1);
  5672. return;
  5673. }
  5674. effect.setFloat4(directionUniformName, this.direction.x, this.direction.y, this.direction.z, 1);
  5675. };
  5676. DirectionalLight.prototype._getWorldMatrix = function () {
  5677. if (!this._worldMatrix) {
  5678. this._worldMatrix = BABYLON.Matrix.Identity();
  5679. }
  5680. BABYLON.Matrix.TranslationToRef(this.position.x, this.position.y, this.position.z, this._worldMatrix);
  5681. return this._worldMatrix;
  5682. };
  5683. return DirectionalLight;
  5684. })(BABYLON.Light);
  5685. BABYLON.DirectionalLight = DirectionalLight;
  5686. })(BABYLON || (BABYLON = {}));
  5687. //# sourceMappingURL=babylon.directionalLight.js.mapvar BABYLON;
  5688. (function (BABYLON) {
  5689. var ShadowGenerator = (function () {
  5690. function ShadowGenerator(mapSize, light) {
  5691. var _this = this;
  5692. // Members
  5693. this.filter = ShadowGenerator.FILTER_NONE;
  5694. this._darkness = 0;
  5695. this._transparencyShadow = false;
  5696. this._viewMatrix = BABYLON.Matrix.Zero();
  5697. this._projectionMatrix = BABYLON.Matrix.Zero();
  5698. this._transformMatrix = BABYLON.Matrix.Zero();
  5699. this._worldViewProjection = BABYLON.Matrix.Zero();
  5700. this._light = light;
  5701. this._scene = light.getScene();
  5702. light._shadowGenerator = this;
  5703. // Render target
  5704. this._shadowMap = new BABYLON.RenderTargetTexture(light.name + "_shadowMap", mapSize, this._scene, false);
  5705. this._shadowMap.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  5706. this._shadowMap.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  5707. this._shadowMap.renderParticles = false;
  5708. // Custom render function
  5709. var renderSubMesh = function (subMesh) {
  5710. var mesh = subMesh.getRenderingMesh();
  5711. var scene = _this._scene;
  5712. var engine = scene.getEngine();
  5713. // Culling
  5714. engine.setState(subMesh.getMaterial().backFaceCulling);
  5715. // Managing instances
  5716. var batch = mesh._getInstancesRenderList(subMesh._id);
  5717. if (batch.mustReturn) {
  5718. return;
  5719. }
  5720. var hardwareInstancedRendering = (engine.getCaps().instancedArrays !== null) && (batch.visibleInstances[subMesh._id] !== null);
  5721. if (_this.isReady(subMesh, hardwareInstancedRendering)) {
  5722. engine.enableEffect(_this._effect);
  5723. mesh._bind(subMesh, _this._effect, BABYLON.Material.TriangleFillMode);
  5724. var material = subMesh.getMaterial();
  5725. _this._effect.setMatrix("viewProjection", _this.getTransformMatrix());
  5726. // Alpha test
  5727. if (material && material.needAlphaTesting()) {
  5728. var alphaTexture = material.getAlphaTestTexture();
  5729. _this._effect.setTexture("diffuseSampler", alphaTexture);
  5730. _this._effect.setMatrix("diffuseMatrix", alphaTexture.getTextureMatrix());
  5731. }
  5732. // Bones
  5733. if (mesh.useBones) {
  5734. _this._effect.setMatrices("mBones", mesh.skeleton.getTransformMatrices());
  5735. }
  5736. // Draw
  5737. mesh._processRendering(subMesh, _this._effect, BABYLON.Material.TriangleFillMode, batch, hardwareInstancedRendering, function (isInstance, world) { return _this._effect.setMatrix("world", world); });
  5738. }
  5739. else {
  5740. // Need to reset refresh rate of the shadowMap
  5741. _this._shadowMap.resetRefreshCounter();
  5742. }
  5743. };
  5744. this._shadowMap.customRenderFunction = function (opaqueSubMeshes, alphaTestSubMeshes, transparentSubMeshes) {
  5745. var index;
  5746. for (index = 0; index < opaqueSubMeshes.length; index++) {
  5747. renderSubMesh(opaqueSubMeshes.data[index]);
  5748. }
  5749. for (index = 0; index < alphaTestSubMeshes.length; index++) {
  5750. renderSubMesh(alphaTestSubMeshes.data[index]);
  5751. }
  5752. if (_this._transparencyShadow) {
  5753. for (index = 0; index < transparentSubMeshes.length; index++) {
  5754. renderSubMesh(transparentSubMeshes.data[index]);
  5755. }
  5756. }
  5757. };
  5758. }
  5759. Object.defineProperty(ShadowGenerator, "FILTER_NONE", {
  5760. // Static
  5761. get: function () {
  5762. return ShadowGenerator._FILTER_NONE;
  5763. },
  5764. enumerable: true,
  5765. configurable: true
  5766. });
  5767. Object.defineProperty(ShadowGenerator, "FILTER_VARIANCESHADOWMAP", {
  5768. get: function () {
  5769. return ShadowGenerator._FILTER_VARIANCESHADOWMAP;
  5770. },
  5771. enumerable: true,
  5772. configurable: true
  5773. });
  5774. Object.defineProperty(ShadowGenerator, "FILTER_POISSONSAMPLING", {
  5775. get: function () {
  5776. return ShadowGenerator._FILTER_POISSONSAMPLING;
  5777. },
  5778. enumerable: true,
  5779. configurable: true
  5780. });
  5781. Object.defineProperty(ShadowGenerator.prototype, "useVarianceShadowMap", {
  5782. get: function () {
  5783. return this.filter === ShadowGenerator.FILTER_VARIANCESHADOWMAP;
  5784. },
  5785. set: function (value) {
  5786. this.filter = (value ? ShadowGenerator.FILTER_VARIANCESHADOWMAP : ShadowGenerator.FILTER_NONE);
  5787. },
  5788. enumerable: true,
  5789. configurable: true
  5790. });
  5791. Object.defineProperty(ShadowGenerator.prototype, "usePoissonSampling", {
  5792. get: function () {
  5793. return this.filter === ShadowGenerator.FILTER_POISSONSAMPLING;
  5794. },
  5795. set: function (value) {
  5796. this.filter = (value ? ShadowGenerator.FILTER_POISSONSAMPLING : ShadowGenerator.FILTER_NONE);
  5797. },
  5798. enumerable: true,
  5799. configurable: true
  5800. });
  5801. ShadowGenerator.prototype.isReady = function (subMesh, useInstances) {
  5802. var defines = [];
  5803. if (this.useVarianceShadowMap) {
  5804. defines.push("#define VSM");
  5805. }
  5806. var attribs = [BABYLON.VertexBuffer.PositionKind];
  5807. var mesh = subMesh.getMesh();
  5808. var material = subMesh.getMaterial();
  5809. // Alpha test
  5810. if (material && material.needAlphaTesting()) {
  5811. defines.push("#define ALPHATEST");
  5812. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  5813. attribs.push(BABYLON.VertexBuffer.UVKind);
  5814. defines.push("#define UV1");
  5815. }
  5816. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  5817. attribs.push(BABYLON.VertexBuffer.UV2Kind);
  5818. defines.push("#define UV2");
  5819. }
  5820. }
  5821. // Bones
  5822. if (mesh.useBones) {
  5823. attribs.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  5824. attribs.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  5825. defines.push("#define BONES");
  5826. defines.push("#define BonesPerMesh " + (mesh.skeleton.bones.length + 1));
  5827. }
  5828. // Instances
  5829. if (useInstances) {
  5830. defines.push("#define INSTANCES");
  5831. attribs.push("world0");
  5832. attribs.push("world1");
  5833. attribs.push("world2");
  5834. attribs.push("world3");
  5835. }
  5836. // Get correct effect
  5837. var join = defines.join("\n");
  5838. if (this._cachedDefines !== join) {
  5839. this._cachedDefines = join;
  5840. this._effect = this._scene.getEngine().createEffect("shadowMap", attribs, ["world", "mBones", "viewProjection", "diffuseMatrix"], ["diffuseSampler"], join);
  5841. }
  5842. return this._effect.isReady();
  5843. };
  5844. ShadowGenerator.prototype.getShadowMap = function () {
  5845. return this._shadowMap;
  5846. };
  5847. ShadowGenerator.prototype.getLight = function () {
  5848. return this._light;
  5849. };
  5850. // Methods
  5851. ShadowGenerator.prototype.getTransformMatrix = function () {
  5852. var lightPosition = this._light.position;
  5853. var lightDirection = this._light.direction;
  5854. if (this._light.computeTransformedPosition()) {
  5855. lightPosition = this._light.transformedPosition;
  5856. }
  5857. if (!this._cachedPosition || !this._cachedDirection || !lightPosition.equals(this._cachedPosition) || !lightDirection.equals(this._cachedDirection)) {
  5858. this._cachedPosition = lightPosition.clone();
  5859. this._cachedDirection = lightDirection.clone();
  5860. var activeCamera = this._scene.activeCamera;
  5861. BABYLON.Matrix.LookAtLHToRef(lightPosition, this._light.position.add(lightDirection), BABYLON.Vector3.Up(), this._viewMatrix);
  5862. BABYLON.Matrix.PerspectiveFovLHToRef(Math.PI / 2.0, 1.0, activeCamera.minZ, activeCamera.maxZ, this._projectionMatrix);
  5863. this._viewMatrix.multiplyToRef(this._projectionMatrix, this._transformMatrix);
  5864. }
  5865. return this._transformMatrix;
  5866. };
  5867. ShadowGenerator.prototype.getDarkness = function () {
  5868. return this._darkness;
  5869. };
  5870. ShadowGenerator.prototype.setDarkness = function (darkness) {
  5871. if (darkness >= 1.0)
  5872. this._darkness = 1.0;
  5873. else if (darkness <= 0.0)
  5874. this._darkness = 0.0;
  5875. else
  5876. this._darkness = darkness;
  5877. };
  5878. ShadowGenerator.prototype.setTransparencyShadow = function (hasShadow) {
  5879. this._transparencyShadow = hasShadow;
  5880. };
  5881. ShadowGenerator.prototype.dispose = function () {
  5882. this._shadowMap.dispose();
  5883. };
  5884. ShadowGenerator._FILTER_NONE = 0;
  5885. ShadowGenerator._FILTER_VARIANCESHADOWMAP = 1;
  5886. ShadowGenerator._FILTER_POISSONSAMPLING = 2;
  5887. return ShadowGenerator;
  5888. })();
  5889. BABYLON.ShadowGenerator = ShadowGenerator;
  5890. })(BABYLON || (BABYLON = {}));
  5891. //# sourceMappingURL=babylon.shadowGenerator.js.map
  5892. var BABYLON;
  5893. (function (BABYLON) {
  5894. var HemisphericLight = (function (_super) {
  5895. __extends(HemisphericLight, _super);
  5896. function HemisphericLight(name, direction, scene) {
  5897. _super.call(this, name, scene);
  5898. this.direction = direction;
  5899. this.groundColor = new BABYLON.Color3(0.0, 0.0, 0.0);
  5900. }
  5901. HemisphericLight.prototype.setDirectionToTarget = function (target) {
  5902. this.direction = BABYLON.Vector3.Normalize(target.subtract(BABYLON.Vector3.Zero()));
  5903. return this.direction;
  5904. };
  5905. HemisphericLight.prototype.getShadowGenerator = function () {
  5906. return null;
  5907. };
  5908. HemisphericLight.prototype.transferToEffect = function (effect, directionUniformName, groundColorUniformName) {
  5909. var normalizeDirection = BABYLON.Vector3.Normalize(this.direction);
  5910. effect.setFloat4(directionUniformName, normalizeDirection.x, normalizeDirection.y, normalizeDirection.z, 0);
  5911. effect.setColor3(groundColorUniformName, this.groundColor.scale(this.intensity));
  5912. };
  5913. HemisphericLight.prototype._getWorldMatrix = function () {
  5914. if (!this._worldMatrix) {
  5915. this._worldMatrix = BABYLON.Matrix.Identity();
  5916. }
  5917. return this._worldMatrix;
  5918. };
  5919. return HemisphericLight;
  5920. })(BABYLON.Light);
  5921. BABYLON.HemisphericLight = HemisphericLight;
  5922. })(BABYLON || (BABYLON = {}));
  5923. //# sourceMappingURL=babylon.hemisphericLight.js.mapvar BABYLON;
  5924. (function (BABYLON) {
  5925. var intersectBoxAASphere = function (boxMin, boxMax, sphereCenter, sphereRadius) {
  5926. if (boxMin.x > sphereCenter.x + sphereRadius)
  5927. return false;
  5928. if (sphereCenter.x - sphereRadius > boxMax.x)
  5929. return false;
  5930. if (boxMin.y > sphereCenter.y + sphereRadius)
  5931. return false;
  5932. if (sphereCenter.y - sphereRadius > boxMax.y)
  5933. return false;
  5934. if (boxMin.z > sphereCenter.z + sphereRadius)
  5935. return false;
  5936. if (sphereCenter.z - sphereRadius > boxMax.z)
  5937. return false;
  5938. return true;
  5939. };
  5940. var getLowestRoot = function (a, b, c, maxR) {
  5941. var determinant = b * b - 4.0 * a * c;
  5942. var result = { root: 0, found: false };
  5943. if (determinant < 0)
  5944. return result;
  5945. var sqrtD = Math.sqrt(determinant);
  5946. var r1 = (-b - sqrtD) / (2.0 * a);
  5947. var r2 = (-b + sqrtD) / (2.0 * a);
  5948. if (r1 > r2) {
  5949. var temp = r2;
  5950. r2 = r1;
  5951. r1 = temp;
  5952. }
  5953. if (r1 > 0 && r1 < maxR) {
  5954. result.root = r1;
  5955. result.found = true;
  5956. return result;
  5957. }
  5958. if (r2 > 0 && r2 < maxR) {
  5959. result.root = r2;
  5960. result.found = true;
  5961. return result;
  5962. }
  5963. return result;
  5964. };
  5965. var Collider = (function () {
  5966. function Collider() {
  5967. this.radius = new BABYLON.Vector3(1, 1, 1);
  5968. this.retry = 0;
  5969. this.basePointWorld = BABYLON.Vector3.Zero();
  5970. this.velocityWorld = BABYLON.Vector3.Zero();
  5971. this.normalizedVelocity = BABYLON.Vector3.Zero();
  5972. this._collisionPoint = BABYLON.Vector3.Zero();
  5973. this._planeIntersectionPoint = BABYLON.Vector3.Zero();
  5974. this._tempVector = BABYLON.Vector3.Zero();
  5975. this._tempVector2 = BABYLON.Vector3.Zero();
  5976. this._tempVector3 = BABYLON.Vector3.Zero();
  5977. this._tempVector4 = BABYLON.Vector3.Zero();
  5978. this._edge = BABYLON.Vector3.Zero();
  5979. this._baseToVertex = BABYLON.Vector3.Zero();
  5980. this._destinationPoint = BABYLON.Vector3.Zero();
  5981. this._slidePlaneNormal = BABYLON.Vector3.Zero();
  5982. this._displacementVector = BABYLON.Vector3.Zero();
  5983. }
  5984. // Methods
  5985. Collider.prototype._initialize = function (source, dir, e) {
  5986. this.velocity = dir;
  5987. BABYLON.Vector3.NormalizeToRef(dir, this.normalizedVelocity);
  5988. this.basePoint = source;
  5989. source.multiplyToRef(this.radius, this.basePointWorld);
  5990. dir.multiplyToRef(this.radius, this.velocityWorld);
  5991. this.velocityWorldLength = this.velocityWorld.length();
  5992. this.epsilon = e;
  5993. this.collisionFound = false;
  5994. };
  5995. Collider.prototype._checkPointInTriangle = function (point, pa, pb, pc, n) {
  5996. pa.subtractToRef(point, this._tempVector);
  5997. pb.subtractToRef(point, this._tempVector2);
  5998. BABYLON.Vector3.CrossToRef(this._tempVector, this._tempVector2, this._tempVector4);
  5999. var d = BABYLON.Vector3.Dot(this._tempVector4, n);
  6000. if (d < 0)
  6001. return false;
  6002. pc.subtractToRef(point, this._tempVector3);
  6003. BABYLON.Vector3.CrossToRef(this._tempVector2, this._tempVector3, this._tempVector4);
  6004. d = BABYLON.Vector3.Dot(this._tempVector4, n);
  6005. if (d < 0)
  6006. return false;
  6007. BABYLON.Vector3.CrossToRef(this._tempVector3, this._tempVector, this._tempVector4);
  6008. d = BABYLON.Vector3.Dot(this._tempVector4, n);
  6009. return d >= 0;
  6010. };
  6011. Collider.prototype._canDoCollision = function (sphereCenter, sphereRadius, vecMin, vecMax) {
  6012. var distance = BABYLON.Vector3.Distance(this.basePointWorld, sphereCenter);
  6013. var max = Math.max(this.radius.x, this.radius.y, this.radius.z);
  6014. if (distance > this.velocityWorldLength + max + sphereRadius) {
  6015. return false;
  6016. }
  6017. if (!intersectBoxAASphere(vecMin, vecMax, this.basePointWorld, this.velocityWorldLength + max))
  6018. return false;
  6019. return true;
  6020. };
  6021. Collider.prototype._testTriangle = function (faceIndex, subMesh, p1, p2, p3) {
  6022. var t0;
  6023. var embeddedInPlane = false;
  6024. if (!subMesh._trianglePlanes) {
  6025. subMesh._trianglePlanes = [];
  6026. }
  6027. if (!subMesh._trianglePlanes[faceIndex]) {
  6028. subMesh._trianglePlanes[faceIndex] = new BABYLON.Plane(0, 0, 0, 0);
  6029. subMesh._trianglePlanes[faceIndex].copyFromPoints(p1, p2, p3);
  6030. }
  6031. var trianglePlane = subMesh._trianglePlanes[faceIndex];
  6032. if ((!subMesh.getMaterial()) && !trianglePlane.isFrontFacingTo(this.normalizedVelocity, 0))
  6033. return;
  6034. var signedDistToTrianglePlane = trianglePlane.signedDistanceTo(this.basePoint);
  6035. var normalDotVelocity = BABYLON.Vector3.Dot(trianglePlane.normal, this.velocity);
  6036. if (normalDotVelocity == 0) {
  6037. if (Math.abs(signedDistToTrianglePlane) >= 1.0)
  6038. return;
  6039. embeddedInPlane = true;
  6040. t0 = 0;
  6041. }
  6042. else {
  6043. t0 = (-1.0 - signedDistToTrianglePlane) / normalDotVelocity;
  6044. var t1 = (1.0 - signedDistToTrianglePlane) / normalDotVelocity;
  6045. if (t0 > t1) {
  6046. var temp = t1;
  6047. t1 = t0;
  6048. t0 = temp;
  6049. }
  6050. if (t0 > 1.0 || t1 < 0.0)
  6051. return;
  6052. if (t0 < 0)
  6053. t0 = 0;
  6054. if (t0 > 1.0)
  6055. t0 = 1.0;
  6056. }
  6057. this._collisionPoint.copyFromFloats(0, 0, 0);
  6058. var found = false;
  6059. var t = 1.0;
  6060. if (!embeddedInPlane) {
  6061. this.basePoint.subtractToRef(trianglePlane.normal, this._planeIntersectionPoint);
  6062. this.velocity.scaleToRef(t0, this._tempVector);
  6063. this._planeIntersectionPoint.addInPlace(this._tempVector);
  6064. if (this._checkPointInTriangle(this._planeIntersectionPoint, p1, p2, p3, trianglePlane.normal)) {
  6065. found = true;
  6066. t = t0;
  6067. this._collisionPoint.copyFrom(this._planeIntersectionPoint);
  6068. }
  6069. }
  6070. if (!found) {
  6071. var velocitySquaredLength = this.velocity.lengthSquared();
  6072. var a = velocitySquaredLength;
  6073. this.basePoint.subtractToRef(p1, this._tempVector);
  6074. var b = 2.0 * (BABYLON.Vector3.Dot(this.velocity, this._tempVector));
  6075. var c = this._tempVector.lengthSquared() - 1.0;
  6076. var lowestRoot = getLowestRoot(a, b, c, t);
  6077. if (lowestRoot.found) {
  6078. t = lowestRoot.root;
  6079. found = true;
  6080. this._collisionPoint.copyFrom(p1);
  6081. }
  6082. this.basePoint.subtractToRef(p2, this._tempVector);
  6083. b = 2.0 * (BABYLON.Vector3.Dot(this.velocity, this._tempVector));
  6084. c = this._tempVector.lengthSquared() - 1.0;
  6085. lowestRoot = getLowestRoot(a, b, c, t);
  6086. if (lowestRoot.found) {
  6087. t = lowestRoot.root;
  6088. found = true;
  6089. this._collisionPoint.copyFrom(p2);
  6090. }
  6091. this.basePoint.subtractToRef(p3, this._tempVector);
  6092. b = 2.0 * (BABYLON.Vector3.Dot(this.velocity, this._tempVector));
  6093. c = this._tempVector.lengthSquared() - 1.0;
  6094. lowestRoot = getLowestRoot(a, b, c, t);
  6095. if (lowestRoot.found) {
  6096. t = lowestRoot.root;
  6097. found = true;
  6098. this._collisionPoint.copyFrom(p3);
  6099. }
  6100. p2.subtractToRef(p1, this._edge);
  6101. p1.subtractToRef(this.basePoint, this._baseToVertex);
  6102. var edgeSquaredLength = this._edge.lengthSquared();
  6103. var edgeDotVelocity = BABYLON.Vector3.Dot(this._edge, this.velocity);
  6104. var edgeDotBaseToVertex = BABYLON.Vector3.Dot(this._edge, this._baseToVertex);
  6105. a = edgeSquaredLength * (-velocitySquaredLength) + edgeDotVelocity * edgeDotVelocity;
  6106. b = edgeSquaredLength * (2.0 * BABYLON.Vector3.Dot(this.velocity, this._baseToVertex)) - 2.0 * edgeDotVelocity * edgeDotBaseToVertex;
  6107. c = edgeSquaredLength * (1.0 - this._baseToVertex.lengthSquared()) + edgeDotBaseToVertex * edgeDotBaseToVertex;
  6108. lowestRoot = getLowestRoot(a, b, c, t);
  6109. if (lowestRoot.found) {
  6110. var f = (edgeDotVelocity * lowestRoot.root - edgeDotBaseToVertex) / edgeSquaredLength;
  6111. if (f >= 0.0 && f <= 1.0) {
  6112. t = lowestRoot.root;
  6113. found = true;
  6114. this._edge.scaleInPlace(f);
  6115. p1.addToRef(this._edge, this._collisionPoint);
  6116. }
  6117. }
  6118. p3.subtractToRef(p2, this._edge);
  6119. p2.subtractToRef(this.basePoint, this._baseToVertex);
  6120. edgeSquaredLength = this._edge.lengthSquared();
  6121. edgeDotVelocity = BABYLON.Vector3.Dot(this._edge, this.velocity);
  6122. edgeDotBaseToVertex = BABYLON.Vector3.Dot(this._edge, this._baseToVertex);
  6123. a = edgeSquaredLength * (-velocitySquaredLength) + edgeDotVelocity * edgeDotVelocity;
  6124. b = edgeSquaredLength * (2.0 * BABYLON.Vector3.Dot(this.velocity, this._baseToVertex)) - 2.0 * edgeDotVelocity * edgeDotBaseToVertex;
  6125. c = edgeSquaredLength * (1.0 - this._baseToVertex.lengthSquared()) + edgeDotBaseToVertex * edgeDotBaseToVertex;
  6126. lowestRoot = getLowestRoot(a, b, c, t);
  6127. if (lowestRoot.found) {
  6128. f = (edgeDotVelocity * lowestRoot.root - edgeDotBaseToVertex) / edgeSquaredLength;
  6129. if (f >= 0.0 && f <= 1.0) {
  6130. t = lowestRoot.root;
  6131. found = true;
  6132. this._edge.scaleInPlace(f);
  6133. p2.addToRef(this._edge, this._collisionPoint);
  6134. }
  6135. }
  6136. p1.subtractToRef(p3, this._edge);
  6137. p3.subtractToRef(this.basePoint, this._baseToVertex);
  6138. edgeSquaredLength = this._edge.lengthSquared();
  6139. edgeDotVelocity = BABYLON.Vector3.Dot(this._edge, this.velocity);
  6140. edgeDotBaseToVertex = BABYLON.Vector3.Dot(this._edge, this._baseToVertex);
  6141. a = edgeSquaredLength * (-velocitySquaredLength) + edgeDotVelocity * edgeDotVelocity;
  6142. b = edgeSquaredLength * (2.0 * BABYLON.Vector3.Dot(this.velocity, this._baseToVertex)) - 2.0 * edgeDotVelocity * edgeDotBaseToVertex;
  6143. c = edgeSquaredLength * (1.0 - this._baseToVertex.lengthSquared()) + edgeDotBaseToVertex * edgeDotBaseToVertex;
  6144. lowestRoot = getLowestRoot(a, b, c, t);
  6145. if (lowestRoot.found) {
  6146. f = (edgeDotVelocity * lowestRoot.root - edgeDotBaseToVertex) / edgeSquaredLength;
  6147. if (f >= 0.0 && f <= 1.0) {
  6148. t = lowestRoot.root;
  6149. found = true;
  6150. this._edge.scaleInPlace(f);
  6151. p3.addToRef(this._edge, this._collisionPoint);
  6152. }
  6153. }
  6154. }
  6155. if (found) {
  6156. var distToCollision = t * this.velocity.length();
  6157. if (!this.collisionFound || distToCollision < this.nearestDistance) {
  6158. if (!this.intersectionPoint) {
  6159. this.intersectionPoint = this._collisionPoint.clone();
  6160. }
  6161. else {
  6162. this.intersectionPoint.copyFrom(this._collisionPoint);
  6163. }
  6164. this.nearestDistance = distToCollision;
  6165. this.collisionFound = true;
  6166. this.collidedMesh = subMesh.getMesh();
  6167. }
  6168. }
  6169. };
  6170. Collider.prototype._collide = function (subMesh, pts, indices, indexStart, indexEnd, decal) {
  6171. for (var i = indexStart; i < indexEnd; i += 3) {
  6172. var p1 = pts[indices[i] - decal];
  6173. var p2 = pts[indices[i + 1] - decal];
  6174. var p3 = pts[indices[i + 2] - decal];
  6175. this._testTriangle(i, subMesh, p3, p2, p1);
  6176. }
  6177. };
  6178. Collider.prototype._getResponse = function (pos, vel) {
  6179. pos.addToRef(vel, this._destinationPoint);
  6180. vel.scaleInPlace((this.nearestDistance / vel.length()));
  6181. this.basePoint.addToRef(vel, pos);
  6182. pos.subtractToRef(this.intersectionPoint, this._slidePlaneNormal);
  6183. this._slidePlaneNormal.normalize();
  6184. this._slidePlaneNormal.scaleToRef(this.epsilon, this._displacementVector);
  6185. pos.addInPlace(this._displacementVector);
  6186. this.intersectionPoint.addInPlace(this._displacementVector);
  6187. this._slidePlaneNormal.scaleInPlace(BABYLON.Plane.SignedDistanceToPlaneFromPositionAndNormal(this.intersectionPoint, this._slidePlaneNormal, this._destinationPoint));
  6188. this._destinationPoint.subtractInPlace(this._slidePlaneNormal);
  6189. this._destinationPoint.subtractToRef(this.intersectionPoint, vel);
  6190. };
  6191. return Collider;
  6192. })();
  6193. BABYLON.Collider = Collider;
  6194. })(BABYLON || (BABYLON = {}));
  6195. //# sourceMappingURL=babylon.collider.js.map
  6196. var BABYLON;
  6197. (function (BABYLON) {
  6198. var Camera = (function (_super) {
  6199. __extends(Camera, _super);
  6200. function Camera(name, position, scene) {
  6201. _super.call(this, name, scene);
  6202. this.position = position;
  6203. // Members
  6204. this.upVector = BABYLON.Vector3.Up();
  6205. this.orthoLeft = null;
  6206. this.orthoRight = null;
  6207. this.orthoBottom = null;
  6208. this.orthoTop = null;
  6209. this.fov = 0.8;
  6210. this.minZ = 1.0;
  6211. this.maxZ = 10000.0;
  6212. this.inertia = 0.9;
  6213. this.mode = Camera.PERSPECTIVE_CAMERA;
  6214. this.isIntermediate = false;
  6215. this.viewport = new BABYLON.Viewport(0, 0, 1.0, 1.0);
  6216. this.subCameras = [];
  6217. this.layerMask = 0xFFFFFFFF;
  6218. this.fovMode = Camera.FOVMODE_VERTICAL_FIXED;
  6219. this._computedViewMatrix = BABYLON.Matrix.Identity();
  6220. this._projectionMatrix = new BABYLON.Matrix();
  6221. this._postProcesses = new Array();
  6222. this._postProcessesTakenIndices = [];
  6223. scene.cameras.push(this);
  6224. if (!scene.activeCamera) {
  6225. scene.activeCamera = this;
  6226. }
  6227. }
  6228. Object.defineProperty(Camera, "PERSPECTIVE_CAMERA", {
  6229. get: function () {
  6230. return Camera._PERSPECTIVE_CAMERA;
  6231. },
  6232. enumerable: true,
  6233. configurable: true
  6234. });
  6235. Object.defineProperty(Camera, "ORTHOGRAPHIC_CAMERA", {
  6236. get: function () {
  6237. return Camera._ORTHOGRAPHIC_CAMERA;
  6238. },
  6239. enumerable: true,
  6240. configurable: true
  6241. });
  6242. Object.defineProperty(Camera, "FOVMODE_VERTICAL_FIXED", {
  6243. get: function () {
  6244. return Camera._FOVMODE_VERTICAL_FIXED;
  6245. },
  6246. enumerable: true,
  6247. configurable: true
  6248. });
  6249. Object.defineProperty(Camera, "FOVMODE_HORIZONTAL_FIXED", {
  6250. get: function () {
  6251. return Camera._FOVMODE_HORIZONTAL_FIXED;
  6252. },
  6253. enumerable: true,
  6254. configurable: true
  6255. });
  6256. //Cache
  6257. Camera.prototype._initCache = function () {
  6258. _super.prototype._initCache.call(this);
  6259. this._cache.position = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  6260. this._cache.upVector = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  6261. this._cache.mode = undefined;
  6262. this._cache.minZ = undefined;
  6263. this._cache.maxZ = undefined;
  6264. this._cache.fov = undefined;
  6265. this._cache.aspectRatio = undefined;
  6266. this._cache.orthoLeft = undefined;
  6267. this._cache.orthoRight = undefined;
  6268. this._cache.orthoBottom = undefined;
  6269. this._cache.orthoTop = undefined;
  6270. this._cache.renderWidth = undefined;
  6271. this._cache.renderHeight = undefined;
  6272. };
  6273. Camera.prototype._updateCache = function (ignoreParentClass) {
  6274. if (!ignoreParentClass) {
  6275. _super.prototype._updateCache.call(this);
  6276. }
  6277. var engine = this.getEngine();
  6278. this._cache.position.copyFrom(this.position);
  6279. this._cache.upVector.copyFrom(this.upVector);
  6280. this._cache.mode = this.mode;
  6281. this._cache.minZ = this.minZ;
  6282. this._cache.maxZ = this.maxZ;
  6283. this._cache.fov = this.fov;
  6284. this._cache.aspectRatio = engine.getAspectRatio(this);
  6285. this._cache.orthoLeft = this.orthoLeft;
  6286. this._cache.orthoRight = this.orthoRight;
  6287. this._cache.orthoBottom = this.orthoBottom;
  6288. this._cache.orthoTop = this.orthoTop;
  6289. this._cache.renderWidth = engine.getRenderWidth();
  6290. this._cache.renderHeight = engine.getRenderHeight();
  6291. };
  6292. Camera.prototype._updateFromScene = function () {
  6293. this.updateCache();
  6294. this._update();
  6295. };
  6296. // Synchronized
  6297. Camera.prototype._isSynchronized = function () {
  6298. return this._isSynchronizedViewMatrix() && this._isSynchronizedProjectionMatrix();
  6299. };
  6300. Camera.prototype._isSynchronizedViewMatrix = function () {
  6301. if (!_super.prototype._isSynchronized.call(this))
  6302. return false;
  6303. return this._cache.position.equals(this.position) && this._cache.upVector.equals(this.upVector) && this.isSynchronizedWithParent();
  6304. };
  6305. Camera.prototype._isSynchronizedProjectionMatrix = function () {
  6306. var check = this._cache.mode === this.mode && this._cache.minZ === this.minZ && this._cache.maxZ === this.maxZ;
  6307. if (!check) {
  6308. return false;
  6309. }
  6310. var engine = this.getEngine();
  6311. if (this.mode === Camera.PERSPECTIVE_CAMERA) {
  6312. check = this._cache.fov === this.fov && this._cache.aspectRatio === engine.getAspectRatio(this);
  6313. }
  6314. else {
  6315. check = this._cache.orthoLeft === this.orthoLeft && this._cache.orthoRight === this.orthoRight && this._cache.orthoBottom === this.orthoBottom && this._cache.orthoTop === this.orthoTop && this._cache.renderWidth === engine.getRenderWidth() && this._cache.renderHeight === engine.getRenderHeight();
  6316. }
  6317. return check;
  6318. };
  6319. // Controls
  6320. Camera.prototype.attachControl = function (element) {
  6321. };
  6322. Camera.prototype.detachControl = function (element) {
  6323. };
  6324. Camera.prototype._update = function () {
  6325. };
  6326. Camera.prototype.attachPostProcess = function (postProcess, insertAt) {
  6327. if (insertAt === void 0) { insertAt = null; }
  6328. if (!postProcess.isReusable() && this._postProcesses.indexOf(postProcess) > -1) {
  6329. BABYLON.Tools.Error("You're trying to reuse a post process not defined as reusable.");
  6330. return 0;
  6331. }
  6332. if (insertAt == null || insertAt < 0) {
  6333. this._postProcesses.push(postProcess);
  6334. this._postProcessesTakenIndices.push(this._postProcesses.length - 1);
  6335. return this._postProcesses.length - 1;
  6336. }
  6337. var add = 0;
  6338. if (this._postProcesses[insertAt]) {
  6339. var start = this._postProcesses.length - 1;
  6340. for (var i = start; i >= insertAt + 1; --i) {
  6341. this._postProcesses[i + 1] = this._postProcesses[i];
  6342. }
  6343. add = 1;
  6344. }
  6345. for (i = 0; i < this._postProcessesTakenIndices.length; ++i) {
  6346. if (this._postProcessesTakenIndices[i] < insertAt) {
  6347. continue;
  6348. }
  6349. start = this._postProcessesTakenIndices.length - 1;
  6350. for (var j = start; j >= i; --j) {
  6351. this._postProcessesTakenIndices[j + 1] = this._postProcessesTakenIndices[j] + add;
  6352. }
  6353. this._postProcessesTakenIndices[i] = insertAt;
  6354. break;
  6355. }
  6356. if (!add && this._postProcessesTakenIndices.indexOf(insertAt) == -1) {
  6357. this._postProcessesTakenIndices.push(insertAt);
  6358. }
  6359. var result = insertAt + add;
  6360. this._postProcesses[result] = postProcess;
  6361. return result;
  6362. };
  6363. Camera.prototype.detachPostProcess = function (postProcess, atIndices) {
  6364. if (atIndices === void 0) { atIndices = null; }
  6365. var result = [];
  6366. if (!atIndices) {
  6367. var length = this._postProcesses.length;
  6368. for (var i = 0; i < length; i++) {
  6369. if (this._postProcesses[i] !== postProcess) {
  6370. continue;
  6371. }
  6372. delete this._postProcesses[i];
  6373. var index = this._postProcessesTakenIndices.indexOf(i);
  6374. this._postProcessesTakenIndices.splice(index, 1);
  6375. }
  6376. }
  6377. else {
  6378. atIndices = (atIndices instanceof Array) ? atIndices : [atIndices];
  6379. for (i = 0; i < atIndices.length; i++) {
  6380. var foundPostProcess = this._postProcesses[atIndices[i]];
  6381. if (foundPostProcess !== postProcess) {
  6382. result.push(i);
  6383. continue;
  6384. }
  6385. delete this._postProcesses[atIndices[i]];
  6386. index = this._postProcessesTakenIndices.indexOf(atIndices[i]);
  6387. this._postProcessesTakenIndices.splice(index, 1);
  6388. }
  6389. }
  6390. return result;
  6391. };
  6392. Camera.prototype.getWorldMatrix = function () {
  6393. if (!this._worldMatrix) {
  6394. this._worldMatrix = BABYLON.Matrix.Identity();
  6395. }
  6396. var viewMatrix = this.getViewMatrix();
  6397. viewMatrix.invertToRef(this._worldMatrix);
  6398. return this._worldMatrix;
  6399. };
  6400. Camera.prototype._getViewMatrix = function () {
  6401. return BABYLON.Matrix.Identity();
  6402. };
  6403. Camera.prototype.getViewMatrix = function () {
  6404. this._computedViewMatrix = this._computeViewMatrix();
  6405. if (!this.parent || !this.parent.getWorldMatrix || this.isSynchronized()) {
  6406. return this._computedViewMatrix;
  6407. }
  6408. if (!this._worldMatrix) {
  6409. this._worldMatrix = BABYLON.Matrix.Identity();
  6410. }
  6411. this._computedViewMatrix.invertToRef(this._worldMatrix);
  6412. this._worldMatrix.multiplyToRef(this.parent.getWorldMatrix(), this._computedViewMatrix);
  6413. this._computedViewMatrix.invert();
  6414. this._currentRenderId = this.getScene().getRenderId();
  6415. return this._computedViewMatrix;
  6416. };
  6417. Camera.prototype._computeViewMatrix = function (force) {
  6418. if (!force && this._isSynchronizedViewMatrix()) {
  6419. return this._computedViewMatrix;
  6420. }
  6421. this._computedViewMatrix = this._getViewMatrix();
  6422. if (!this.parent || !this.parent.getWorldMatrix) {
  6423. this._currentRenderId = this.getScene().getRenderId();
  6424. }
  6425. return this._computedViewMatrix;
  6426. };
  6427. Camera.prototype.getProjectionMatrix = function (force) {
  6428. if (!force && this._isSynchronizedProjectionMatrix()) {
  6429. return this._projectionMatrix;
  6430. }
  6431. var engine = this.getEngine();
  6432. if (this.mode === Camera.PERSPECTIVE_CAMERA) {
  6433. if (this.minZ <= 0) {
  6434. this.minZ = 0.1;
  6435. }
  6436. BABYLON.Matrix.PerspectiveFovLHToRef(this.fov, engine.getAspectRatio(this), this.minZ, this.maxZ, this._projectionMatrix, this.fovMode);
  6437. return this._projectionMatrix;
  6438. }
  6439. var halfWidth = engine.getRenderWidth() / 2.0;
  6440. var halfHeight = engine.getRenderHeight() / 2.0;
  6441. BABYLON.Matrix.OrthoOffCenterLHToRef(this.orthoLeft || -halfWidth, this.orthoRight || halfWidth, this.orthoBottom || -halfHeight, this.orthoTop || halfHeight, this.minZ, this.maxZ, this._projectionMatrix);
  6442. return this._projectionMatrix;
  6443. };
  6444. Camera.prototype.dispose = function () {
  6445. // Remove from scene
  6446. var index = this.getScene().cameras.indexOf(this);
  6447. this.getScene().cameras.splice(index, 1);
  6448. for (var i = 0; i < this._postProcessesTakenIndices.length; ++i) {
  6449. this._postProcesses[this._postProcessesTakenIndices[i]].dispose(this);
  6450. }
  6451. };
  6452. // Statics
  6453. Camera._PERSPECTIVE_CAMERA = 0;
  6454. Camera._ORTHOGRAPHIC_CAMERA = 1;
  6455. Camera._FOVMODE_VERTICAL_FIXED = 0;
  6456. Camera._FOVMODE_HORIZONTAL_FIXED = 1;
  6457. return Camera;
  6458. })(BABYLON.Node);
  6459. BABYLON.Camera = Camera;
  6460. })(BABYLON || (BABYLON = {}));
  6461. //# sourceMappingURL=babylon.camera.js.map
  6462. var BABYLON;
  6463. (function (BABYLON) {
  6464. var TargetCamera = (function (_super) {
  6465. __extends(TargetCamera, _super);
  6466. function TargetCamera(name, position, scene) {
  6467. _super.call(this, name, position, scene);
  6468. this.cameraDirection = new BABYLON.Vector3(0, 0, 0);
  6469. this.cameraRotation = new BABYLON.Vector2(0, 0);
  6470. this.rotation = new BABYLON.Vector3(0, 0, 0);
  6471. this.speed = 2.0;
  6472. this.noRotationConstraint = false;
  6473. this.lockedTarget = null;
  6474. this._currentTarget = BABYLON.Vector3.Zero();
  6475. this._viewMatrix = BABYLON.Matrix.Zero();
  6476. this._camMatrix = BABYLON.Matrix.Zero();
  6477. this._cameraTransformMatrix = BABYLON.Matrix.Zero();
  6478. this._cameraRotationMatrix = BABYLON.Matrix.Zero();
  6479. this._referencePoint = new BABYLON.Vector3(0, 0, 1);
  6480. this._transformedReferencePoint = BABYLON.Vector3.Zero();
  6481. this._lookAtTemp = BABYLON.Matrix.Zero();
  6482. this._tempMatrix = BABYLON.Matrix.Zero();
  6483. }
  6484. TargetCamera.prototype._getLockedTargetPosition = function () {
  6485. if (!this.lockedTarget) {
  6486. return null;
  6487. }
  6488. return this.lockedTarget.position || this.lockedTarget;
  6489. };
  6490. // Cache
  6491. TargetCamera.prototype._initCache = function () {
  6492. _super.prototype._initCache.call(this);
  6493. this._cache.lockedTarget = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  6494. this._cache.rotation = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  6495. };
  6496. TargetCamera.prototype._updateCache = function (ignoreParentClass) {
  6497. if (!ignoreParentClass) {
  6498. _super.prototype._updateCache.call(this);
  6499. }
  6500. var lockedTargetPosition = this._getLockedTargetPosition();
  6501. if (!lockedTargetPosition) {
  6502. this._cache.lockedTarget = null;
  6503. }
  6504. else {
  6505. if (!this._cache.lockedTarget) {
  6506. this._cache.lockedTarget = lockedTargetPosition.clone();
  6507. }
  6508. else {
  6509. this._cache.lockedTarget.copyFrom(lockedTargetPosition);
  6510. }
  6511. }
  6512. this._cache.rotation.copyFrom(this.rotation);
  6513. };
  6514. // Synchronized
  6515. TargetCamera.prototype._isSynchronizedViewMatrix = function () {
  6516. if (!_super.prototype._isSynchronizedViewMatrix.call(this)) {
  6517. return false;
  6518. }
  6519. var lockedTargetPosition = this._getLockedTargetPosition();
  6520. return (this._cache.lockedTarget ? this._cache.lockedTarget.equals(lockedTargetPosition) : !lockedTargetPosition) && this._cache.rotation.equals(this.rotation);
  6521. };
  6522. // Methods
  6523. TargetCamera.prototype._computeLocalCameraSpeed = function () {
  6524. var engine = this.getEngine();
  6525. return this.speed * ((engine.getDeltaTime() / (engine.getFps() * 10.0)));
  6526. };
  6527. // Target
  6528. TargetCamera.prototype.setTarget = function (target) {
  6529. this.upVector.normalize();
  6530. BABYLON.Matrix.LookAtLHToRef(this.position, target, this.upVector, this._camMatrix);
  6531. this._camMatrix.invert();
  6532. this.rotation.x = Math.atan(this._camMatrix.m[6] / this._camMatrix.m[10]);
  6533. var vDir = target.subtract(this.position);
  6534. if (vDir.x >= 0.0) {
  6535. this.rotation.y = (-Math.atan(vDir.z / vDir.x) + Math.PI / 2.0);
  6536. }
  6537. else {
  6538. this.rotation.y = (-Math.atan(vDir.z / vDir.x) - Math.PI / 2.0);
  6539. }
  6540. this.rotation.z = -Math.acos(BABYLON.Vector3.Dot(new BABYLON.Vector3(0, 1.0, 0), this.upVector));
  6541. if (isNaN(this.rotation.x)) {
  6542. this.rotation.x = 0;
  6543. }
  6544. if (isNaN(this.rotation.y)) {
  6545. this.rotation.y = 0;
  6546. }
  6547. if (isNaN(this.rotation.z)) {
  6548. this.rotation.z = 0;
  6549. }
  6550. };
  6551. TargetCamera.prototype.getTarget = function () {
  6552. return this._currentTarget;
  6553. };
  6554. TargetCamera.prototype._decideIfNeedsToMove = function () {
  6555. return Math.abs(this.cameraDirection.x) > 0 || Math.abs(this.cameraDirection.y) > 0 || Math.abs(this.cameraDirection.z) > 0;
  6556. };
  6557. TargetCamera.prototype._updatePosition = function () {
  6558. this.position.addInPlace(this.cameraDirection);
  6559. };
  6560. TargetCamera.prototype._update = function () {
  6561. var needToMove = this._decideIfNeedsToMove();
  6562. var needToRotate = Math.abs(this.cameraRotation.x) > 0 || Math.abs(this.cameraRotation.y) > 0;
  6563. // Move
  6564. if (needToMove) {
  6565. this._updatePosition();
  6566. }
  6567. // Rotate
  6568. if (needToRotate) {
  6569. this.rotation.x += this.cameraRotation.x;
  6570. this.rotation.y += this.cameraRotation.y;
  6571. if (!this.noRotationConstraint) {
  6572. var limit = (Math.PI / 2) * 0.95;
  6573. if (this.rotation.x > limit)
  6574. this.rotation.x = limit;
  6575. if (this.rotation.x < -limit)
  6576. this.rotation.x = -limit;
  6577. }
  6578. }
  6579. // Inertia
  6580. if (needToMove) {
  6581. if (Math.abs(this.cameraDirection.x) < BABYLON.Engine.Epsilon) {
  6582. this.cameraDirection.x = 0;
  6583. }
  6584. if (Math.abs(this.cameraDirection.y) < BABYLON.Engine.Epsilon) {
  6585. this.cameraDirection.y = 0;
  6586. }
  6587. if (Math.abs(this.cameraDirection.z) < BABYLON.Engine.Epsilon) {
  6588. this.cameraDirection.z = 0;
  6589. }
  6590. this.cameraDirection.scaleInPlace(this.inertia);
  6591. }
  6592. if (needToRotate) {
  6593. if (Math.abs(this.cameraRotation.x) < BABYLON.Engine.Epsilon) {
  6594. this.cameraRotation.x = 0;
  6595. }
  6596. if (Math.abs(this.cameraRotation.y) < BABYLON.Engine.Epsilon) {
  6597. this.cameraRotation.y = 0;
  6598. }
  6599. this.cameraRotation.scaleInPlace(this.inertia);
  6600. }
  6601. };
  6602. TargetCamera.prototype._getViewMatrix = function () {
  6603. if (!this.lockedTarget) {
  6604. // Compute
  6605. if (this.upVector.x != 0 || this.upVector.y != 1.0 || this.upVector.z != 0) {
  6606. BABYLON.Matrix.LookAtLHToRef(BABYLON.Vector3.Zero(), this._referencePoint, this.upVector, this._lookAtTemp);
  6607. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._cameraRotationMatrix);
  6608. this._lookAtTemp.multiplyToRef(this._cameraRotationMatrix, this._tempMatrix);
  6609. this._lookAtTemp.invert();
  6610. this._tempMatrix.multiplyToRef(this._lookAtTemp, this._cameraRotationMatrix);
  6611. }
  6612. else {
  6613. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._cameraRotationMatrix);
  6614. }
  6615. BABYLON.Vector3.TransformCoordinatesToRef(this._referencePoint, this._cameraRotationMatrix, this._transformedReferencePoint);
  6616. // Computing target and final matrix
  6617. this.position.addToRef(this._transformedReferencePoint, this._currentTarget);
  6618. }
  6619. else {
  6620. this._currentTarget.copyFrom(this._getLockedTargetPosition());
  6621. }
  6622. BABYLON.Matrix.LookAtLHToRef(this.position, this._currentTarget, this.upVector, this._viewMatrix);
  6623. return this._viewMatrix;
  6624. };
  6625. return TargetCamera;
  6626. })(BABYLON.Camera);
  6627. BABYLON.TargetCamera = TargetCamera;
  6628. })(BABYLON || (BABYLON = {}));
  6629. //# sourceMappingURL=babylon.targetCamera.js.map
  6630. var BABYLON;
  6631. (function (BABYLON) {
  6632. var FollowCamera = (function (_super) {
  6633. __extends(FollowCamera, _super);
  6634. function FollowCamera(name, position, scene) {
  6635. _super.call(this, name, position, scene);
  6636. this.radius = 12;
  6637. this.rotationOffset = 0;
  6638. this.heightOffset = 4;
  6639. this.cameraAcceleration = 0.05;
  6640. this.maxCameraSpeed = 20;
  6641. }
  6642. FollowCamera.prototype.getRadians = function (degrees) {
  6643. return degrees * Math.PI / 180;
  6644. };
  6645. FollowCamera.prototype.follow = function (cameraTarget) {
  6646. if (!cameraTarget)
  6647. return;
  6648. var radians = this.getRadians(this.rotationOffset) + cameraTarget.rotation.y;
  6649. var targetX = cameraTarget.position.x + Math.sin(radians) * this.radius;
  6650. var targetZ = cameraTarget.position.z + Math.cos(radians) * this.radius;
  6651. var dx = targetX - this.position.x;
  6652. var dy = (cameraTarget.position.y + this.heightOffset) - this.position.y;
  6653. var dz = (targetZ) - this.position.z;
  6654. var vx = dx * this.cameraAcceleration * 2; //this is set to .05
  6655. var vy = dy * this.cameraAcceleration;
  6656. var vz = dz * this.cameraAcceleration * 2;
  6657. if (vx > this.maxCameraSpeed || vx < -this.maxCameraSpeed) {
  6658. vx = vx < 1 ? -this.maxCameraSpeed : this.maxCameraSpeed;
  6659. }
  6660. if (vy > this.maxCameraSpeed || vy < -this.maxCameraSpeed) {
  6661. vy = vy < 1 ? -this.maxCameraSpeed : this.maxCameraSpeed;
  6662. }
  6663. if (vz > this.maxCameraSpeed || vz < -this.maxCameraSpeed) {
  6664. vz = vz < 1 ? -this.maxCameraSpeed : this.maxCameraSpeed;
  6665. }
  6666. this.position = new BABYLON.Vector3(this.position.x + vx, this.position.y + vy, this.position.z + vz);
  6667. this.setTarget(cameraTarget.position);
  6668. };
  6669. FollowCamera.prototype._update = function () {
  6670. _super.prototype._update.call(this);
  6671. this.follow(this.target);
  6672. };
  6673. return FollowCamera;
  6674. })(BABYLON.TargetCamera);
  6675. BABYLON.FollowCamera = FollowCamera;
  6676. })(BABYLON || (BABYLON = {}));
  6677. //# sourceMappingURL=babylon.followCamera.js.map
  6678. var BABYLON;
  6679. (function (BABYLON) {
  6680. var FreeCamera = (function (_super) {
  6681. __extends(FreeCamera, _super);
  6682. function FreeCamera(name, position, scene) {
  6683. _super.call(this, name, position, scene);
  6684. this.ellipsoid = new BABYLON.Vector3(0.5, 1, 0.5);
  6685. this.keysUp = [38];
  6686. this.keysDown = [40];
  6687. this.keysLeft = [37];
  6688. this.keysRight = [39];
  6689. this.checkCollisions = false;
  6690. this.applyGravity = false;
  6691. this.angularSensibility = 2000.0;
  6692. this._keys = [];
  6693. this._collider = new BABYLON.Collider();
  6694. this._needMoveForGravity = true;
  6695. this._oldPosition = BABYLON.Vector3.Zero();
  6696. this._diffPosition = BABYLON.Vector3.Zero();
  6697. this._newPosition = BABYLON.Vector3.Zero();
  6698. }
  6699. // Controls
  6700. FreeCamera.prototype.attachControl = function (element, noPreventDefault) {
  6701. var _this = this;
  6702. var previousPosition;
  6703. var engine = this.getEngine();
  6704. if (this._attachedElement) {
  6705. return;
  6706. }
  6707. this._attachedElement = element;
  6708. if (this._onMouseDown === undefined) {
  6709. this._onMouseDown = function (evt) {
  6710. previousPosition = {
  6711. x: evt.clientX,
  6712. y: evt.clientY
  6713. };
  6714. if (!noPreventDefault) {
  6715. evt.preventDefault();
  6716. }
  6717. };
  6718. this._onMouseUp = function (evt) {
  6719. previousPosition = null;
  6720. if (!noPreventDefault) {
  6721. evt.preventDefault();
  6722. }
  6723. };
  6724. this._onMouseOut = function (evt) {
  6725. previousPosition = null;
  6726. _this._keys = [];
  6727. if (!noPreventDefault) {
  6728. evt.preventDefault();
  6729. }
  6730. };
  6731. this._onMouseMove = function (evt) {
  6732. if (!previousPosition && !engine.isPointerLock) {
  6733. return;
  6734. }
  6735. var offsetX;
  6736. var offsetY;
  6737. if (!engine.isPointerLock) {
  6738. offsetX = evt.clientX - previousPosition.x;
  6739. offsetY = evt.clientY - previousPosition.y;
  6740. }
  6741. else {
  6742. offsetX = evt.movementX || evt.mozMovementX || evt.webkitMovementX || evt.msMovementX || 0;
  6743. offsetY = evt.movementY || evt.mozMovementY || evt.webkitMovementY || evt.msMovementY || 0;
  6744. }
  6745. _this.cameraRotation.y += offsetX / _this.angularSensibility;
  6746. _this.cameraRotation.x += offsetY / _this.angularSensibility;
  6747. previousPosition = {
  6748. x: evt.clientX,
  6749. y: evt.clientY
  6750. };
  6751. if (!noPreventDefault) {
  6752. evt.preventDefault();
  6753. }
  6754. };
  6755. this._onKeyDown = function (evt) {
  6756. if (_this.keysUp.indexOf(evt.keyCode) !== -1 || _this.keysDown.indexOf(evt.keyCode) !== -1 || _this.keysLeft.indexOf(evt.keyCode) !== -1 || _this.keysRight.indexOf(evt.keyCode) !== -1) {
  6757. var index = _this._keys.indexOf(evt.keyCode);
  6758. if (index === -1) {
  6759. _this._keys.push(evt.keyCode);
  6760. }
  6761. if (!noPreventDefault) {
  6762. evt.preventDefault();
  6763. }
  6764. }
  6765. };
  6766. this._onKeyUp = function (evt) {
  6767. if (_this.keysUp.indexOf(evt.keyCode) !== -1 || _this.keysDown.indexOf(evt.keyCode) !== -1 || _this.keysLeft.indexOf(evt.keyCode) !== -1 || _this.keysRight.indexOf(evt.keyCode) !== -1) {
  6768. var index = _this._keys.indexOf(evt.keyCode);
  6769. if (index >= 0) {
  6770. _this._keys.splice(index, 1);
  6771. }
  6772. if (!noPreventDefault) {
  6773. evt.preventDefault();
  6774. }
  6775. }
  6776. };
  6777. this._onLostFocus = function () {
  6778. _this._keys = [];
  6779. };
  6780. this._reset = function () {
  6781. _this._keys = [];
  6782. previousPosition = null;
  6783. _this.cameraDirection = new BABYLON.Vector3(0, 0, 0);
  6784. _this.cameraRotation = new BABYLON.Vector2(0, 0);
  6785. };
  6786. }
  6787. element.addEventListener("mousedown", this._onMouseDown, false);
  6788. element.addEventListener("mouseup", this._onMouseUp, false);
  6789. element.addEventListener("mouseout", this._onMouseOut, false);
  6790. element.addEventListener("mousemove", this._onMouseMove, false);
  6791. BABYLON.Tools.RegisterTopRootEvents([
  6792. { name: "keydown", handler: this._onKeyDown },
  6793. { name: "keyup", handler: this._onKeyUp },
  6794. { name: "blur", handler: this._onLostFocus }
  6795. ]);
  6796. };
  6797. FreeCamera.prototype.detachControl = function (element) {
  6798. if (this._attachedElement != element) {
  6799. return;
  6800. }
  6801. element.removeEventListener("mousedown", this._onMouseDown);
  6802. element.removeEventListener("mouseup", this._onMouseUp);
  6803. element.removeEventListener("mouseout", this._onMouseOut);
  6804. element.removeEventListener("mousemove", this._onMouseMove);
  6805. BABYLON.Tools.UnregisterTopRootEvents([
  6806. { name: "keydown", handler: this._onKeyDown },
  6807. { name: "keyup", handler: this._onKeyUp },
  6808. { name: "blur", handler: this._onLostFocus }
  6809. ]);
  6810. this._attachedElement = null;
  6811. if (this._reset) {
  6812. this._reset();
  6813. }
  6814. };
  6815. FreeCamera.prototype._collideWithWorld = function (velocity) {
  6816. var globalPosition;
  6817. if (this.parent) {
  6818. globalPosition = BABYLON.Vector3.TransformCoordinates(this.position, this.parent.getWorldMatrix());
  6819. }
  6820. else {
  6821. globalPosition = this.position;
  6822. }
  6823. globalPosition.subtractFromFloatsToRef(0, this.ellipsoid.y, 0, this._oldPosition);
  6824. this._collider.radius = this.ellipsoid;
  6825. this.getScene()._getNewPosition(this._oldPosition, velocity, this._collider, 3, this._newPosition);
  6826. this._newPosition.subtractToRef(this._oldPosition, this._diffPosition);
  6827. if (this._diffPosition.length() > BABYLON.Engine.CollisionsEpsilon) {
  6828. this.position.addInPlace(this._diffPosition);
  6829. if (this.onCollide) {
  6830. this.onCollide(this._collider.collidedMesh);
  6831. }
  6832. }
  6833. };
  6834. FreeCamera.prototype._checkInputs = function () {
  6835. if (!this._localDirection) {
  6836. this._localDirection = BABYLON.Vector3.Zero();
  6837. this._transformedDirection = BABYLON.Vector3.Zero();
  6838. }
  6839. for (var index = 0; index < this._keys.length; index++) {
  6840. var keyCode = this._keys[index];
  6841. var speed = this._computeLocalCameraSpeed();
  6842. if (this.keysLeft.indexOf(keyCode) !== -1) {
  6843. this._localDirection.copyFromFloats(-speed, 0, 0);
  6844. }
  6845. else if (this.keysUp.indexOf(keyCode) !== -1) {
  6846. this._localDirection.copyFromFloats(0, 0, speed);
  6847. }
  6848. else if (this.keysRight.indexOf(keyCode) !== -1) {
  6849. this._localDirection.copyFromFloats(speed, 0, 0);
  6850. }
  6851. else if (this.keysDown.indexOf(keyCode) !== -1) {
  6852. this._localDirection.copyFromFloats(0, 0, -speed);
  6853. }
  6854. this.getViewMatrix().invertToRef(this._cameraTransformMatrix);
  6855. BABYLON.Vector3.TransformNormalToRef(this._localDirection, this._cameraTransformMatrix, this._transformedDirection);
  6856. this.cameraDirection.addInPlace(this._transformedDirection);
  6857. }
  6858. };
  6859. FreeCamera.prototype._decideIfNeedsToMove = function () {
  6860. return this._needMoveForGravity || Math.abs(this.cameraDirection.x) > 0 || Math.abs(this.cameraDirection.y) > 0 || Math.abs(this.cameraDirection.z) > 0;
  6861. };
  6862. FreeCamera.prototype._updatePosition = function () {
  6863. if (this.checkCollisions && this.getScene().collisionsEnabled) {
  6864. this._collideWithWorld(this.cameraDirection);
  6865. if (this.applyGravity) {
  6866. var oldPosition = this.position;
  6867. this._collideWithWorld(this.getScene().gravity);
  6868. this._needMoveForGravity = (BABYLON.Vector3.DistanceSquared(oldPosition, this.position) != 0);
  6869. }
  6870. }
  6871. else {
  6872. this.position.addInPlace(this.cameraDirection);
  6873. }
  6874. };
  6875. FreeCamera.prototype._update = function () {
  6876. this._checkInputs();
  6877. _super.prototype._update.call(this);
  6878. };
  6879. return FreeCamera;
  6880. })(BABYLON.TargetCamera);
  6881. BABYLON.FreeCamera = FreeCamera;
  6882. })(BABYLON || (BABYLON = {}));
  6883. //# sourceMappingURL=babylon.freeCamera.js.map
  6884. var BABYLON;
  6885. (function (BABYLON) {
  6886. // We're mainly based on the logic defined into the FreeCamera code
  6887. var TouchCamera = (function (_super) {
  6888. __extends(TouchCamera, _super);
  6889. function TouchCamera(name, position, scene) {
  6890. _super.call(this, name, position, scene);
  6891. this._offsetX = null;
  6892. this._offsetY = null;
  6893. this._pointerCount = 0;
  6894. this._pointerPressed = [];
  6895. this.angularSensibility = 200000.0;
  6896. this.moveSensibility = 500.0;
  6897. }
  6898. TouchCamera.prototype.attachControl = function (canvas, noPreventDefault) {
  6899. var _this = this;
  6900. var previousPosition;
  6901. if (this._attachedCanvas) {
  6902. return;
  6903. }
  6904. this._attachedCanvas = canvas;
  6905. if (this._onPointerDown === undefined) {
  6906. this._onPointerDown = function (evt) {
  6907. if (!noPreventDefault) {
  6908. evt.preventDefault();
  6909. }
  6910. _this._pointerPressed.push(evt.pointerId);
  6911. if (_this._pointerPressed.length !== 1) {
  6912. return;
  6913. }
  6914. previousPosition = {
  6915. x: evt.clientX,
  6916. y: evt.clientY
  6917. };
  6918. };
  6919. this._onPointerUp = function (evt) {
  6920. if (!noPreventDefault) {
  6921. evt.preventDefault();
  6922. }
  6923. var index = _this._pointerPressed.indexOf(evt.pointerId);
  6924. if (index === -1) {
  6925. return;
  6926. }
  6927. _this._pointerPressed.splice(index, 1);
  6928. if (index != 0) {
  6929. return;
  6930. }
  6931. previousPosition = null;
  6932. _this._offsetX = null;
  6933. _this._offsetY = null;
  6934. };
  6935. this._onPointerMove = function (evt) {
  6936. if (!noPreventDefault) {
  6937. evt.preventDefault();
  6938. }
  6939. if (!previousPosition) {
  6940. return;
  6941. }
  6942. var index = _this._pointerPressed.indexOf(evt.pointerId);
  6943. if (index != 0) {
  6944. return;
  6945. }
  6946. _this._offsetX = evt.clientX - previousPosition.x;
  6947. _this._offsetY = -(evt.clientY - previousPosition.y);
  6948. };
  6949. this._onLostFocus = function () {
  6950. _this._offsetX = null;
  6951. _this._offsetY = null;
  6952. };
  6953. }
  6954. canvas.addEventListener("pointerdown", this._onPointerDown);
  6955. canvas.addEventListener("pointerup", this._onPointerUp);
  6956. canvas.addEventListener("pointerout", this._onPointerUp);
  6957. canvas.addEventListener("pointermove", this._onPointerMove);
  6958. BABYLON.Tools.RegisterTopRootEvents([
  6959. { name: "blur", handler: this._onLostFocus }
  6960. ]);
  6961. };
  6962. TouchCamera.prototype.detachControl = function (canvas) {
  6963. if (this._attachedCanvas != canvas) {
  6964. return;
  6965. }
  6966. canvas.removeEventListener("pointerdown", this._onPointerDown);
  6967. canvas.removeEventListener("pointerup", this._onPointerUp);
  6968. canvas.removeEventListener("pointerout", this._onPointerUp);
  6969. canvas.removeEventListener("pointermove", this._onPointerMove);
  6970. BABYLON.Tools.UnregisterTopRootEvents([
  6971. { name: "blur", handler: this._onLostFocus }
  6972. ]);
  6973. this._attachedCanvas = null;
  6974. };
  6975. TouchCamera.prototype._checkInputs = function () {
  6976. if (!this._offsetX) {
  6977. return;
  6978. }
  6979. this.cameraRotation.y += this._offsetX / this.angularSensibility;
  6980. if (this._pointerPressed.length > 1) {
  6981. this.cameraRotation.x += -this._offsetY / this.angularSensibility;
  6982. }
  6983. else {
  6984. var speed = this._computeLocalCameraSpeed();
  6985. var direction = new BABYLON.Vector3(0, 0, speed * this._offsetY / this.moveSensibility);
  6986. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, 0, this._cameraRotationMatrix);
  6987. this.cameraDirection.addInPlace(BABYLON.Vector3.TransformCoordinates(direction, this._cameraRotationMatrix));
  6988. }
  6989. };
  6990. return TouchCamera;
  6991. })(BABYLON.FreeCamera);
  6992. BABYLON.TouchCamera = TouchCamera;
  6993. })(BABYLON || (BABYLON = {}));
  6994. //# sourceMappingURL=babylon.touchCamera.js.map
  6995. var BABYLON;
  6996. (function (BABYLON) {
  6997. // We're mainly based on the logic defined into the FreeCamera code
  6998. var DeviceOrientationCamera = (function (_super) {
  6999. __extends(DeviceOrientationCamera, _super);
  7000. function DeviceOrientationCamera(name, position, scene) {
  7001. var _this = this;
  7002. _super.call(this, name, position, scene);
  7003. this._offsetX = null;
  7004. this._offsetY = null;
  7005. this._orientationGamma = 0;
  7006. this._orientationBeta = 0;
  7007. this._initialOrientationGamma = 0;
  7008. this._initialOrientationBeta = 0;
  7009. this.angularSensibility = 10000.0;
  7010. this.moveSensibility = 50.0;
  7011. window.addEventListener("resize", function () {
  7012. _this._initialOrientationGamma = null;
  7013. }, false);
  7014. }
  7015. DeviceOrientationCamera.prototype.attachControl = function (canvas, noPreventDefault) {
  7016. var _this = this;
  7017. if (this._attachedCanvas) {
  7018. return;
  7019. }
  7020. this._attachedCanvas = canvas;
  7021. if (!this._orientationChanged) {
  7022. this._orientationChanged = function (evt) {
  7023. if (!_this._initialOrientationGamma) {
  7024. _this._initialOrientationGamma = evt.gamma;
  7025. _this._initialOrientationBeta = evt.beta;
  7026. }
  7027. _this._orientationGamma = evt.gamma;
  7028. _this._orientationBeta = evt.beta;
  7029. _this._offsetY = (_this._initialOrientationBeta - _this._orientationBeta);
  7030. _this._offsetX = (_this._initialOrientationGamma - _this._orientationGamma);
  7031. };
  7032. }
  7033. window.addEventListener("deviceorientation", this._orientationChanged);
  7034. };
  7035. DeviceOrientationCamera.prototype.detachControl = function (canvas) {
  7036. if (this._attachedCanvas != canvas) {
  7037. return;
  7038. }
  7039. window.removeEventListener("deviceorientation", this._orientationChanged);
  7040. this._attachedCanvas = null;
  7041. this._orientationGamma = 0;
  7042. this._orientationBeta = 0;
  7043. this._initialOrientationGamma = 0;
  7044. this._initialOrientationBeta = 0;
  7045. };
  7046. DeviceOrientationCamera.prototype._checkInputs = function () {
  7047. if (!this._offsetX) {
  7048. return;
  7049. }
  7050. this.cameraRotation.y -= this._offsetX / this.angularSensibility;
  7051. var speed = this._computeLocalCameraSpeed();
  7052. var direction = new BABYLON.Vector3(0, 0, speed * this._offsetY / this.moveSensibility);
  7053. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, 0, this._cameraRotationMatrix);
  7054. this.cameraDirection.addInPlace(BABYLON.Vector3.TransformCoordinates(direction, this._cameraRotationMatrix));
  7055. };
  7056. return DeviceOrientationCamera;
  7057. })(BABYLON.FreeCamera);
  7058. BABYLON.DeviceOrientationCamera = DeviceOrientationCamera;
  7059. })(BABYLON || (BABYLON = {}));
  7060. //# sourceMappingURL=babylon.deviceOrientationCamera.js.map
  7061. var BABYLON;
  7062. (function (BABYLON) {
  7063. var eventPrefix = BABYLON.Tools.GetPointerPrefix();
  7064. var ArcRotateCamera = (function (_super) {
  7065. __extends(ArcRotateCamera, _super);
  7066. function ArcRotateCamera(name, alpha, beta, radius, target, scene) {
  7067. _super.call(this, name, BABYLON.Vector3.Zero(), scene);
  7068. this.alpha = alpha;
  7069. this.beta = beta;
  7070. this.radius = radius;
  7071. this.target = target;
  7072. this.inertialAlphaOffset = 0;
  7073. this.inertialBetaOffset = 0;
  7074. this.inertialRadiusOffset = 0;
  7075. this.lowerAlphaLimit = null;
  7076. this.upperAlphaLimit = null;
  7077. this.lowerBetaLimit = 0.01;
  7078. this.upperBetaLimit = Math.PI;
  7079. this.lowerRadiusLimit = null;
  7080. this.upperRadiusLimit = null;
  7081. this.angularSensibility = 1000.0;
  7082. this.wheelPrecision = 3.0;
  7083. this.keysUp = [38];
  7084. this.keysDown = [40];
  7085. this.keysLeft = [37];
  7086. this.keysRight = [39];
  7087. this.zoomOnFactor = 1;
  7088. this.targetScreenOffset = BABYLON.Vector2.Zero();
  7089. this._keys = [];
  7090. this._viewMatrix = new BABYLON.Matrix();
  7091. this.checkCollisions = false;
  7092. this.collisionRadius = new BABYLON.Vector3(0.5, 0.5, 0.5);
  7093. this._collider = new BABYLON.Collider();
  7094. this._previousPosition = BABYLON.Vector3.Zero();
  7095. this._collisionVelocity = BABYLON.Vector3.Zero();
  7096. this._newPosition = BABYLON.Vector3.Zero();
  7097. // Pinch
  7098. // value for pinch step scaling
  7099. // set to 20 by default
  7100. this.pinchPrecision = 20;
  7101. this.getViewMatrix();
  7102. }
  7103. ArcRotateCamera.prototype._getTargetPosition = function () {
  7104. return this.target.position || this.target;
  7105. };
  7106. // Cache
  7107. ArcRotateCamera.prototype._initCache = function () {
  7108. _super.prototype._initCache.call(this);
  7109. this._cache.target = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  7110. this._cache.alpha = undefined;
  7111. this._cache.beta = undefined;
  7112. this._cache.radius = undefined;
  7113. this._cache.targetScreenOffset = undefined;
  7114. };
  7115. ArcRotateCamera.prototype._updateCache = function (ignoreParentClass) {
  7116. if (!ignoreParentClass) {
  7117. _super.prototype._updateCache.call(this);
  7118. }
  7119. this._cache.target.copyFrom(this._getTargetPosition());
  7120. this._cache.alpha = this.alpha;
  7121. this._cache.beta = this.beta;
  7122. this._cache.radius = this.radius;
  7123. this._cache.targetScreenOffset = this.targetScreenOffset.clone();
  7124. };
  7125. // Synchronized
  7126. ArcRotateCamera.prototype._isSynchronizedViewMatrix = function () {
  7127. if (!_super.prototype._isSynchronizedViewMatrix.call(this))
  7128. return false;
  7129. return this._cache.target.equals(this._getTargetPosition()) && this._cache.alpha === this.alpha && this._cache.beta === this.beta && this._cache.radius === this.radius && this._cache.targetScreenOffset.equals(this.targetScreenOffset);
  7130. };
  7131. // Methods
  7132. ArcRotateCamera.prototype.attachControl = function (element, noPreventDefault) {
  7133. var _this = this;
  7134. var previousPosition;
  7135. var pointerId;
  7136. // to know if pinch started
  7137. var pinchStarted = false;
  7138. // two pinch point on X
  7139. // that will use for find if user action is pinch open or pinch close
  7140. var pinchPointX1, pinchPointX2;
  7141. if (this._attachedElement) {
  7142. return;
  7143. }
  7144. this._attachedElement = element;
  7145. var engine = this.getEngine();
  7146. if (this._onPointerDown === undefined) {
  7147. this._onPointerDown = function (evt) {
  7148. if (pointerId) {
  7149. return;
  7150. }
  7151. pointerId = evt.pointerId;
  7152. previousPosition = {
  7153. x: evt.clientX,
  7154. y: evt.clientY
  7155. };
  7156. if (!noPreventDefault) {
  7157. evt.preventDefault();
  7158. }
  7159. };
  7160. this._onPointerUp = function (evt) {
  7161. previousPosition = null;
  7162. pointerId = null;
  7163. if (!noPreventDefault) {
  7164. evt.preventDefault();
  7165. }
  7166. };
  7167. this._onPointerMove = function (evt) {
  7168. if (!previousPosition) {
  7169. return;
  7170. }
  7171. if (pointerId !== evt.pointerId) {
  7172. return;
  7173. }
  7174. // return pinch is started
  7175. if (pinchStarted) {
  7176. return;
  7177. }
  7178. var offsetX = evt.clientX - previousPosition.x;
  7179. var offsetY = evt.clientY - previousPosition.y;
  7180. _this.inertialAlphaOffset -= offsetX / _this.angularSensibility;
  7181. _this.inertialBetaOffset -= offsetY / _this.angularSensibility;
  7182. previousPosition = {
  7183. x: evt.clientX,
  7184. y: evt.clientY
  7185. };
  7186. if (!noPreventDefault) {
  7187. evt.preventDefault();
  7188. }
  7189. };
  7190. this._onMouseMove = function (evt) {
  7191. if (!engine.isPointerLock) {
  7192. return;
  7193. }
  7194. // return pinch is started
  7195. if (pinchStarted) {
  7196. return;
  7197. }
  7198. var offsetX = evt.movementX || evt.mozMovementX || evt.webkitMovementX || evt.msMovementX || 0;
  7199. var offsetY = evt.movementY || evt.mozMovementY || evt.webkitMovementY || evt.msMovementY || 0;
  7200. _this.inertialAlphaOffset -= offsetX / _this.angularSensibility;
  7201. _this.inertialBetaOffset -= offsetY / _this.angularSensibility;
  7202. if (!noPreventDefault) {
  7203. evt.preventDefault();
  7204. }
  7205. };
  7206. this._wheel = function (event) {
  7207. var delta = 0;
  7208. if (event.wheelDelta) {
  7209. delta = event.wheelDelta / (_this.wheelPrecision * 40);
  7210. }
  7211. else if (event.detail) {
  7212. delta = -event.detail / _this.wheelPrecision;
  7213. }
  7214. if (delta)
  7215. _this.inertialRadiusOffset += delta;
  7216. if (event.preventDefault) {
  7217. if (!noPreventDefault) {
  7218. event.preventDefault();
  7219. }
  7220. }
  7221. };
  7222. this._onKeyDown = function (evt) {
  7223. if (_this.keysUp.indexOf(evt.keyCode) !== -1 || _this.keysDown.indexOf(evt.keyCode) !== -1 || _this.keysLeft.indexOf(evt.keyCode) !== -1 || _this.keysRight.indexOf(evt.keyCode) !== -1) {
  7224. var index = _this._keys.indexOf(evt.keyCode);
  7225. if (index === -1) {
  7226. _this._keys.push(evt.keyCode);
  7227. }
  7228. if (evt.preventDefault) {
  7229. if (!noPreventDefault) {
  7230. evt.preventDefault();
  7231. }
  7232. }
  7233. }
  7234. };
  7235. this._onKeyUp = function (evt) {
  7236. if (_this.keysUp.indexOf(evt.keyCode) !== -1 || _this.keysDown.indexOf(evt.keyCode) !== -1 || _this.keysLeft.indexOf(evt.keyCode) !== -1 || _this.keysRight.indexOf(evt.keyCode) !== -1) {
  7237. var index = _this._keys.indexOf(evt.keyCode);
  7238. if (index >= 0) {
  7239. _this._keys.splice(index, 1);
  7240. }
  7241. if (evt.preventDefault) {
  7242. if (!noPreventDefault) {
  7243. evt.preventDefault();
  7244. }
  7245. }
  7246. }
  7247. };
  7248. this._onLostFocus = function () {
  7249. _this._keys = [];
  7250. pointerId = null;
  7251. };
  7252. this._onGestureStart = function (e) {
  7253. if (window.MSGesture === undefined) {
  7254. return;
  7255. }
  7256. if (!_this._MSGestureHandler) {
  7257. _this._MSGestureHandler = new MSGesture();
  7258. _this._MSGestureHandler.target = element;
  7259. }
  7260. _this._MSGestureHandler.addPointer(e.pointerId);
  7261. };
  7262. this._onGesture = function (e) {
  7263. _this.radius *= e.scale;
  7264. if (e.preventDefault) {
  7265. if (!noPreventDefault) {
  7266. e.stopPropagation();
  7267. e.preventDefault();
  7268. }
  7269. }
  7270. };
  7271. this._reset = function () {
  7272. _this._keys = [];
  7273. _this.inertialAlphaOffset = 0;
  7274. _this.inertialBetaOffset = 0;
  7275. _this.inertialRadiusOffset = 0;
  7276. previousPosition = null;
  7277. pointerId = null;
  7278. };
  7279. this._touchStart = function (event) {
  7280. if (event.touches.length === 2) {
  7281. //-- start pinch if two fingers on the screen
  7282. pinchStarted = true;
  7283. _this._pinchStart(event);
  7284. }
  7285. };
  7286. this._touchMove = function (event) {
  7287. if (pinchStarted) {
  7288. //-- make scaling
  7289. _this._pinchMove(event);
  7290. }
  7291. };
  7292. this._touchEnd = function (event) {
  7293. if (pinchStarted) {
  7294. //-- end of pinch
  7295. _this._pinchEnd(event);
  7296. }
  7297. };
  7298. this._pinchStart = function (event) {
  7299. // save origin touch point
  7300. pinchPointX1 = event.touches[0].clientX;
  7301. pinchPointX2 = event.touches[1].clientX;
  7302. // block the camera
  7303. // if not it rotate around target during pinch
  7304. pinchStarted = true;
  7305. };
  7306. this._pinchMove = function (event) {
  7307. // variable for new camera's radius
  7308. var delta = 0;
  7309. // variables to know if pinch open or pinch close
  7310. var direction = 1;
  7311. var distanceXOrigine, distanceXNow;
  7312. if (event.touches.length !== 2)
  7313. return;
  7314. // calculate absolute distances of the two fingers
  7315. distanceXOrigine = Math.abs(pinchPointX1 - pinchPointX2);
  7316. distanceXNow = Math.abs(event.touches[0].clientX - event.touches[1].clientX);
  7317. // if distanceXNow < distanceXOrigine -> pinch close so direction = -1
  7318. if (distanceXNow < distanceXOrigine) {
  7319. direction = -1;
  7320. }
  7321. // calculate new radius
  7322. delta = (_this.pinchPrecision / (_this.wheelPrecision * 40)) * direction;
  7323. // set new radius
  7324. _this.inertialRadiusOffset -= delta;
  7325. // save origin touch point
  7326. pinchPointX1 = event.touches[0].clientX;
  7327. pinchPointX2 = event.touches[1].clientX;
  7328. };
  7329. this._pinchEnd = function (event) {
  7330. // cancel pinch and deblock camera rotation
  7331. pinchStarted = false;
  7332. };
  7333. }
  7334. element.addEventListener(eventPrefix + "down", this._onPointerDown, false);
  7335. element.addEventListener(eventPrefix + "up", this._onPointerUp, false);
  7336. element.addEventListener(eventPrefix + "out", this._onPointerUp, false);
  7337. element.addEventListener(eventPrefix + "move", this._onPointerMove, false);
  7338. element.addEventListener("mousemove", this._onMouseMove, false);
  7339. element.addEventListener("MSPointerDown", this._onGestureStart, false);
  7340. element.addEventListener("MSGestureChange", this._onGesture, false);
  7341. element.addEventListener('mousewheel', this._wheel, false);
  7342. element.addEventListener('DOMMouseScroll', this._wheel, false);
  7343. // pinch
  7344. element.addEventListener('touchstart', this._touchStart, false);
  7345. element.addEventListener('touchmove', this._touchMove, false);
  7346. element.addEventListener('touchend', this._touchEnd, false);
  7347. BABYLON.Tools.RegisterTopRootEvents([
  7348. { name: "keydown", handler: this._onKeyDown },
  7349. { name: "keyup", handler: this._onKeyUp },
  7350. { name: "blur", handler: this._onLostFocus }
  7351. ]);
  7352. };
  7353. ArcRotateCamera.prototype.detachControl = function (element) {
  7354. if (this._attachedElement != element) {
  7355. return;
  7356. }
  7357. element.removeEventListener(eventPrefix + "down", this._onPointerDown);
  7358. element.removeEventListener(eventPrefix + "up", this._onPointerUp);
  7359. element.removeEventListener(eventPrefix + "out", this._onPointerUp);
  7360. element.removeEventListener(eventPrefix + "move", this._onPointerMove);
  7361. element.removeEventListener("mousemove", this._onMouseMove);
  7362. element.removeEventListener("MSPointerDown", this._onGestureStart);
  7363. element.removeEventListener("MSGestureChange", this._onGesture);
  7364. element.removeEventListener('mousewheel', this._wheel);
  7365. element.removeEventListener('DOMMouseScroll', this._wheel);
  7366. // pinch
  7367. element.removeEventListener('touchstart', this._touchStart);
  7368. element.removeEventListener('touchmove', this._touchMove);
  7369. element.removeEventListener('touchend', this._touchEnd);
  7370. BABYLON.Tools.UnregisterTopRootEvents([
  7371. { name: "keydown", handler: this._onKeyDown },
  7372. { name: "keyup", handler: this._onKeyUp },
  7373. { name: "blur", handler: this._onLostFocus }
  7374. ]);
  7375. this._MSGestureHandler = null;
  7376. this._attachedElement = null;
  7377. if (this._reset) {
  7378. this._reset();
  7379. }
  7380. };
  7381. ArcRotateCamera.prototype._update = function () {
  7382. for (var index = 0; index < this._keys.length; index++) {
  7383. var keyCode = this._keys[index];
  7384. if (this.keysLeft.indexOf(keyCode) !== -1) {
  7385. this.inertialAlphaOffset -= 0.01;
  7386. }
  7387. else if (this.keysUp.indexOf(keyCode) !== -1) {
  7388. this.inertialBetaOffset -= 0.01;
  7389. }
  7390. else if (this.keysRight.indexOf(keyCode) !== -1) {
  7391. this.inertialAlphaOffset += 0.01;
  7392. }
  7393. else if (this.keysDown.indexOf(keyCode) !== -1) {
  7394. this.inertialBetaOffset += 0.01;
  7395. }
  7396. }
  7397. // Inertia
  7398. if (this.inertialAlphaOffset != 0 || this.inertialBetaOffset != 0 || this.inertialRadiusOffset != 0) {
  7399. this.alpha += this.inertialAlphaOffset;
  7400. this.beta += this.inertialBetaOffset;
  7401. this.radius -= this.inertialRadiusOffset;
  7402. this.inertialAlphaOffset *= this.inertia;
  7403. this.inertialBetaOffset *= this.inertia;
  7404. this.inertialRadiusOffset *= this.inertia;
  7405. if (Math.abs(this.inertialAlphaOffset) < BABYLON.Engine.Epsilon)
  7406. this.inertialAlphaOffset = 0;
  7407. if (Math.abs(this.inertialBetaOffset) < BABYLON.Engine.Epsilon)
  7408. this.inertialBetaOffset = 0;
  7409. if (Math.abs(this.inertialRadiusOffset) < BABYLON.Engine.Epsilon)
  7410. this.inertialRadiusOffset = 0;
  7411. }
  7412. // Limits
  7413. if (this.lowerAlphaLimit && this.alpha < this.lowerAlphaLimit) {
  7414. this.alpha = this.lowerAlphaLimit;
  7415. }
  7416. if (this.upperAlphaLimit && this.alpha > this.upperAlphaLimit) {
  7417. this.alpha = this.upperAlphaLimit;
  7418. }
  7419. if (this.lowerBetaLimit && this.beta < this.lowerBetaLimit) {
  7420. this.beta = this.lowerBetaLimit;
  7421. }
  7422. if (this.upperBetaLimit && this.beta > this.upperBetaLimit) {
  7423. this.beta = this.upperBetaLimit;
  7424. }
  7425. if (this.lowerRadiusLimit && this.radius < this.lowerRadiusLimit) {
  7426. this.radius = this.lowerRadiusLimit;
  7427. }
  7428. if (this.upperRadiusLimit && this.radius > this.upperRadiusLimit) {
  7429. this.radius = this.upperRadiusLimit;
  7430. }
  7431. };
  7432. ArcRotateCamera.prototype.setPosition = function (position) {
  7433. var radiusv3 = position.subtract(this._getTargetPosition());
  7434. this.radius = radiusv3.length();
  7435. // Alpha
  7436. this.alpha = Math.acos(radiusv3.x / Math.sqrt(Math.pow(radiusv3.x, 2) + Math.pow(radiusv3.z, 2)));
  7437. if (radiusv3.z < 0) {
  7438. this.alpha = 2 * Math.PI - this.alpha;
  7439. }
  7440. // Beta
  7441. this.beta = Math.acos(radiusv3.y / this.radius);
  7442. };
  7443. ArcRotateCamera.prototype._getViewMatrix = function () {
  7444. // Compute
  7445. var cosa = Math.cos(this.alpha);
  7446. var sina = Math.sin(this.alpha);
  7447. var cosb = Math.cos(this.beta);
  7448. var sinb = Math.sin(this.beta);
  7449. var target = this._getTargetPosition();
  7450. target.addToRef(new BABYLON.Vector3(this.radius * cosa * sinb, this.radius * cosb, this.radius * sina * sinb), this.position);
  7451. if (this.checkCollisions) {
  7452. this._collider.radius = this.collisionRadius;
  7453. this.position.subtractToRef(this._previousPosition, this._collisionVelocity);
  7454. this.getScene()._getNewPosition(this._previousPosition, this._collisionVelocity, this._collider, 3, this._newPosition);
  7455. if (!this._newPosition.equalsWithEpsilon(this.position)) {
  7456. this.position.copyFrom(this._previousPosition);
  7457. this.alpha = this._previousAlpha;
  7458. this.beta = this._previousBeta;
  7459. this.radius = this._previousRadius;
  7460. if (this.onCollide) {
  7461. this.onCollide(this._collider.collidedMesh);
  7462. }
  7463. }
  7464. }
  7465. BABYLON.Matrix.LookAtLHToRef(this.position, target, this.upVector, this._viewMatrix);
  7466. this._previousAlpha = this.alpha;
  7467. this._previousBeta = this.beta;
  7468. this._previousRadius = this.radius;
  7469. this._previousPosition.copyFrom(this.position);
  7470. this._viewMatrix.m[12] += this.targetScreenOffset.x;
  7471. this._viewMatrix.m[13] += this.targetScreenOffset.y;
  7472. return this._viewMatrix;
  7473. };
  7474. ArcRotateCamera.prototype.zoomOn = function (meshes) {
  7475. meshes = meshes || this.getScene().meshes;
  7476. var minMaxVector = BABYLON.Mesh.MinMax(meshes);
  7477. var distance = BABYLON.Vector3.Distance(minMaxVector.min, minMaxVector.max);
  7478. this.radius = distance * this.zoomOnFactor;
  7479. this.focusOn({ min: minMaxVector.min, max: minMaxVector.max, distance: distance });
  7480. };
  7481. ArcRotateCamera.prototype.focusOn = function (meshesOrMinMaxVectorAndDistance) {
  7482. var meshesOrMinMaxVector;
  7483. var distance;
  7484. if (meshesOrMinMaxVectorAndDistance.min === undefined) {
  7485. meshesOrMinMaxVector = meshesOrMinMaxVectorAndDistance || this.getScene().meshes;
  7486. meshesOrMinMaxVector = BABYLON.Mesh.MinMax(meshesOrMinMaxVector);
  7487. distance = BABYLON.Vector3.Distance(meshesOrMinMaxVector.min, meshesOrMinMaxVector.max);
  7488. }
  7489. else {
  7490. meshesOrMinMaxVector = meshesOrMinMaxVectorAndDistance;
  7491. distance = meshesOrMinMaxVectorAndDistance.distance;
  7492. }
  7493. this.target = BABYLON.Mesh.Center(meshesOrMinMaxVector);
  7494. this.maxZ = distance * 2;
  7495. };
  7496. return ArcRotateCamera;
  7497. })(BABYLON.Camera);
  7498. BABYLON.ArcRotateCamera = ArcRotateCamera;
  7499. })(BABYLON || (BABYLON = {}));
  7500. //# sourceMappingURL=babylon.arcRotateCamera.js.mapvar BABYLON;
  7501. (function (BABYLON) {
  7502. /**
  7503. * Represents a scene to be rendered by the engine.
  7504. * @see http://doc.babylonjs.com/page.php?p=21911
  7505. */
  7506. var Scene = (function () {
  7507. /**
  7508. * @constructor
  7509. * @param {BABYLON.Engine} engine - the engine to be used to render this scene.
  7510. */
  7511. function Scene(engine) {
  7512. // Members
  7513. this.autoClear = true;
  7514. this.clearColor = new BABYLON.Color3(0.2, 0.2, 0.3);
  7515. this.ambientColor = new BABYLON.Color3(0, 0, 0);
  7516. this.forceWireframe = false;
  7517. this.forcePointsCloud = false;
  7518. this.forceShowBoundingBoxes = false;
  7519. this.animationsEnabled = true;
  7520. this.cameraToUseForPointers = null; // Define this parameter if you are using multiple cameras and you want to specify which one should be used for pointer position
  7521. // Fog
  7522. /**
  7523. * is fog enabled on this scene.
  7524. * @type {boolean}
  7525. */
  7526. this.fogEnabled = true;
  7527. this.fogMode = Scene.FOGMODE_NONE;
  7528. this.fogColor = new BABYLON.Color3(0.2, 0.2, 0.3);
  7529. this.fogDensity = 0.1;
  7530. this.fogStart = 0;
  7531. this.fogEnd = 1000.0;
  7532. // Lights
  7533. /**
  7534. * is shadow enabled on this scene.
  7535. * @type {boolean}
  7536. */
  7537. this.shadowsEnabled = true;
  7538. /**
  7539. * is light enabled on this scene.
  7540. * @type {boolean}
  7541. */
  7542. this.lightsEnabled = true;
  7543. /**
  7544. * All of the lights added to this scene.
  7545. * @see BABYLON.Light
  7546. * @type {BABYLON.Light[]}
  7547. */
  7548. this.lights = new Array();
  7549. // Cameras
  7550. /**
  7551. * All of the cameras added to this scene.
  7552. * @see BABYLON.Camera
  7553. * @type {BABYLON.Camera[]}
  7554. */
  7555. this.cameras = new Array();
  7556. this.activeCameras = new Array();
  7557. // Meshes
  7558. /**
  7559. * All of the (abstract) meshes added to this scene.
  7560. * @see BABYLON.AbstractMesh
  7561. * @type {BABYLON.AbstractMesh[]}
  7562. */
  7563. this.meshes = new Array();
  7564. // Geometries
  7565. this._geometries = new Array();
  7566. this.materials = new Array();
  7567. this.multiMaterials = new Array();
  7568. this.defaultMaterial = new BABYLON.StandardMaterial("default material", this);
  7569. // Textures
  7570. this.texturesEnabled = true;
  7571. this.textures = new Array();
  7572. // Particles
  7573. this.particlesEnabled = true;
  7574. this.particleSystems = new Array();
  7575. // Sprites
  7576. this.spriteManagers = new Array();
  7577. // Layers
  7578. this.layers = new Array();
  7579. // Skeletons
  7580. this.skeletonsEnabled = true;
  7581. this.skeletons = new Array();
  7582. // Lens flares
  7583. this.lensFlaresEnabled = true;
  7584. this.lensFlareSystems = new Array();
  7585. // Collisions
  7586. this.collisionsEnabled = true;
  7587. this.gravity = new BABYLON.Vector3(0, -9.0, 0);
  7588. // Postprocesses
  7589. this.postProcessesEnabled = true;
  7590. // Customs render targets
  7591. this.renderTargetsEnabled = true;
  7592. this.customRenderTargets = new Array();
  7593. // Imported meshes
  7594. this.importedMeshesFiles = new Array();
  7595. this._actionManagers = new Array();
  7596. this._meshesForIntersections = new BABYLON.SmartArray(256);
  7597. // Procedural textures
  7598. this.proceduralTexturesEnabled = true;
  7599. this._proceduralTextures = new Array();
  7600. this.soundTracks = new Array();
  7601. this._totalVertices = 0;
  7602. this._activeVertices = 0;
  7603. this._activeParticles = 0;
  7604. this._lastFrameDuration = 0;
  7605. this._evaluateActiveMeshesDuration = 0;
  7606. this._renderTargetsDuration = 0;
  7607. this._particlesDuration = 0;
  7608. this._renderDuration = 0;
  7609. this._spritesDuration = 0;
  7610. this._animationRatio = 0;
  7611. this._renderId = 0;
  7612. this._executeWhenReadyTimeoutId = -1;
  7613. this._toBeDisposed = new BABYLON.SmartArray(256);
  7614. this._onReadyCallbacks = new Array();
  7615. this._pendingData = []; //ANY
  7616. this._onBeforeRenderCallbacks = new Array();
  7617. this._onAfterRenderCallbacks = new Array();
  7618. this._activeMeshes = new BABYLON.SmartArray(256);
  7619. this._processedMaterials = new BABYLON.SmartArray(256);
  7620. this._renderTargets = new BABYLON.SmartArray(256);
  7621. this._activeParticleSystems = new BABYLON.SmartArray(256);
  7622. this._activeSkeletons = new BABYLON.SmartArray(32);
  7623. this._activeBones = 0;
  7624. this._activeAnimatables = new Array();
  7625. this._transformMatrix = BABYLON.Matrix.Zero();
  7626. this._scaledPosition = BABYLON.Vector3.Zero();
  7627. this._scaledVelocity = BABYLON.Vector3.Zero();
  7628. this._engine = engine;
  7629. engine.scenes.push(this);
  7630. this._renderingManager = new BABYLON.RenderingManager(this);
  7631. this.postProcessManager = new BABYLON.PostProcessManager(this);
  7632. this.postProcessRenderPipelineManager = new BABYLON.PostProcessRenderPipelineManager();
  7633. this._boundingBoxRenderer = new BABYLON.BoundingBoxRenderer(this);
  7634. this._outlineRenderer = new BABYLON.OutlineRenderer(this);
  7635. this.attachControl();
  7636. this._debugLayer = new BABYLON.DebugLayer(this);
  7637. this.mainSoundTrack = new BABYLON.SoundTrack(this, { mainTrack: true });
  7638. }
  7639. Object.defineProperty(Scene, "FOGMODE_NONE", {
  7640. get: function () {
  7641. return Scene._FOGMODE_NONE;
  7642. },
  7643. enumerable: true,
  7644. configurable: true
  7645. });
  7646. Object.defineProperty(Scene, "FOGMODE_EXP", {
  7647. get: function () {
  7648. return Scene._FOGMODE_EXP;
  7649. },
  7650. enumerable: true,
  7651. configurable: true
  7652. });
  7653. Object.defineProperty(Scene, "FOGMODE_EXP2", {
  7654. get: function () {
  7655. return Scene._FOGMODE_EXP2;
  7656. },
  7657. enumerable: true,
  7658. configurable: true
  7659. });
  7660. Object.defineProperty(Scene, "FOGMODE_LINEAR", {
  7661. get: function () {
  7662. return Scene._FOGMODE_LINEAR;
  7663. },
  7664. enumerable: true,
  7665. configurable: true
  7666. });
  7667. Object.defineProperty(Scene.prototype, "debugLayer", {
  7668. // Properties
  7669. get: function () {
  7670. return this._debugLayer;
  7671. },
  7672. enumerable: true,
  7673. configurable: true
  7674. });
  7675. Object.defineProperty(Scene.prototype, "meshUnderPointer", {
  7676. /**
  7677. * The mesh that is currently under the pointer.
  7678. * @return {BABYLON.AbstractMesh} mesh under the pointer/mouse cursor or null if none.
  7679. */
  7680. get: function () {
  7681. return this._meshUnderPointer;
  7682. },
  7683. enumerable: true,
  7684. configurable: true
  7685. });
  7686. Object.defineProperty(Scene.prototype, "pointerX", {
  7687. /**
  7688. * Current on-screen X position of the pointer
  7689. * @return {number} X position of the pointer
  7690. */
  7691. get: function () {
  7692. return this._pointerX;
  7693. },
  7694. enumerable: true,
  7695. configurable: true
  7696. });
  7697. Object.defineProperty(Scene.prototype, "pointerY", {
  7698. /**
  7699. * Current on-screen Y position of the pointer
  7700. * @return {number} Y position of the pointer
  7701. */
  7702. get: function () {
  7703. return this._pointerY;
  7704. },
  7705. enumerable: true,
  7706. configurable: true
  7707. });
  7708. Scene.prototype.getCachedMaterial = function () {
  7709. return this._cachedMaterial;
  7710. };
  7711. Scene.prototype.getBoundingBoxRenderer = function () {
  7712. return this._boundingBoxRenderer;
  7713. };
  7714. Scene.prototype.getOutlineRenderer = function () {
  7715. return this._outlineRenderer;
  7716. };
  7717. Scene.prototype.getEngine = function () {
  7718. return this._engine;
  7719. };
  7720. Scene.prototype.getTotalVertices = function () {
  7721. return this._totalVertices;
  7722. };
  7723. Scene.prototype.getActiveVertices = function () {
  7724. return this._activeVertices;
  7725. };
  7726. Scene.prototype.getActiveParticles = function () {
  7727. return this._activeParticles;
  7728. };
  7729. Scene.prototype.getActiveBones = function () {
  7730. return this._activeBones;
  7731. };
  7732. // Stats
  7733. Scene.prototype.getLastFrameDuration = function () {
  7734. return this._lastFrameDuration;
  7735. };
  7736. Scene.prototype.getEvaluateActiveMeshesDuration = function () {
  7737. return this._evaluateActiveMeshesDuration;
  7738. };
  7739. Scene.prototype.getActiveMeshes = function () {
  7740. return this._activeMeshes;
  7741. };
  7742. Scene.prototype.getRenderTargetsDuration = function () {
  7743. return this._renderTargetsDuration;
  7744. };
  7745. Scene.prototype.getRenderDuration = function () {
  7746. return this._renderDuration;
  7747. };
  7748. Scene.prototype.getParticlesDuration = function () {
  7749. return this._particlesDuration;
  7750. };
  7751. Scene.prototype.getSpritesDuration = function () {
  7752. return this._spritesDuration;
  7753. };
  7754. Scene.prototype.getAnimationRatio = function () {
  7755. return this._animationRatio;
  7756. };
  7757. Scene.prototype.getRenderId = function () {
  7758. return this._renderId;
  7759. };
  7760. Scene.prototype.incrementRenderId = function () {
  7761. this._renderId++;
  7762. };
  7763. Scene.prototype._updatePointerPosition = function (evt) {
  7764. var canvasRect = this._engine.getRenderingCanvasClientRect();
  7765. this._pointerX = evt.clientX - canvasRect.left;
  7766. this._pointerY = evt.clientY - canvasRect.top;
  7767. if (this.cameraToUseForPointers) {
  7768. this._pointerX = this._pointerX - this.cameraToUseForPointers.viewport.x * this._engine.getRenderWidth();
  7769. this._pointerY = this._pointerY - this.cameraToUseForPointers.viewport.y * this._engine.getRenderHeight();
  7770. }
  7771. };
  7772. // Pointers handling
  7773. Scene.prototype.attachControl = function () {
  7774. var _this = this;
  7775. this._onPointerMove = function (evt) {
  7776. var canvas = _this._engine.getRenderingCanvas();
  7777. _this._updatePointerPosition(evt);
  7778. var pickResult = _this.pick(_this._pointerX, _this._pointerY, function (mesh) { return mesh.isPickable && mesh.isVisible && mesh.isReady() && mesh.actionManager && mesh.actionManager.hasPointerTriggers; }, false, _this.cameraToUseForPointers);
  7779. if (pickResult.hit) {
  7780. _this._meshUnderPointer = pickResult.pickedMesh;
  7781. _this.setPointerOverMesh(pickResult.pickedMesh);
  7782. canvas.style.cursor = "pointer";
  7783. }
  7784. else {
  7785. _this.setPointerOverMesh(null);
  7786. canvas.style.cursor = "";
  7787. _this._meshUnderPointer = null;
  7788. }
  7789. };
  7790. this._onPointerDown = function (evt) {
  7791. var predicate = null;
  7792. if (!_this.onPointerDown) {
  7793. predicate = function (mesh) {
  7794. return mesh.isPickable && mesh.isVisible && mesh.isReady() && mesh.actionManager && mesh.actionManager.hasPickTriggers;
  7795. };
  7796. }
  7797. _this._updatePointerPosition(evt);
  7798. var pickResult = _this.pick(_this._pointerX, _this._pointerY, predicate, false, _this.cameraToUseForPointers);
  7799. if (pickResult.hit) {
  7800. if (pickResult.pickedMesh.actionManager) {
  7801. switch (evt.button) {
  7802. case 0:
  7803. pickResult.pickedMesh.actionManager.processTrigger(BABYLON.ActionManager.OnLeftPickTrigger, BABYLON.ActionEvent.CreateNew(pickResult.pickedMesh, evt));
  7804. break;
  7805. case 1:
  7806. pickResult.pickedMesh.actionManager.processTrigger(BABYLON.ActionManager.OnCenterPickTrigger, BABYLON.ActionEvent.CreateNew(pickResult.pickedMesh, evt));
  7807. break;
  7808. case 2:
  7809. pickResult.pickedMesh.actionManager.processTrigger(BABYLON.ActionManager.OnRightPickTrigger, BABYLON.ActionEvent.CreateNew(pickResult.pickedMesh, evt));
  7810. break;
  7811. }
  7812. pickResult.pickedMesh.actionManager.processTrigger(BABYLON.ActionManager.OnPickTrigger, BABYLON.ActionEvent.CreateNew(pickResult.pickedMesh, evt));
  7813. }
  7814. }
  7815. if (_this.onPointerDown) {
  7816. _this.onPointerDown(evt, pickResult);
  7817. }
  7818. };
  7819. this._onKeyDown = function (evt) {
  7820. if (_this.actionManager) {
  7821. _this.actionManager.processTrigger(BABYLON.ActionManager.OnKeyDownTrigger, BABYLON.ActionEvent.CreateNewFromScene(_this, evt));
  7822. }
  7823. };
  7824. this._onKeyUp = function (evt) {
  7825. if (_this.actionManager) {
  7826. _this.actionManager.processTrigger(BABYLON.ActionManager.OnKeyUpTrigger, BABYLON.ActionEvent.CreateNewFromScene(_this, evt));
  7827. }
  7828. };
  7829. var eventPrefix = BABYLON.Tools.GetPointerPrefix();
  7830. this._engine.getRenderingCanvas().addEventListener(eventPrefix + "move", this._onPointerMove, false);
  7831. this._engine.getRenderingCanvas().addEventListener(eventPrefix + "down", this._onPointerDown, false);
  7832. BABYLON.Tools.RegisterTopRootEvents([
  7833. { name: "keydown", handler: this._onKeyDown },
  7834. { name: "keyup", handler: this._onKeyUp }
  7835. ]);
  7836. };
  7837. Scene.prototype.detachControl = function () {
  7838. var eventPrefix = BABYLON.Tools.GetPointerPrefix();
  7839. this._engine.getRenderingCanvas().removeEventListener(eventPrefix + "move", this._onPointerMove);
  7840. this._engine.getRenderingCanvas().removeEventListener(eventPrefix + "down", this._onPointerDown);
  7841. BABYLON.Tools.UnregisterTopRootEvents([
  7842. { name: "keydown", handler: this._onKeyDown },
  7843. { name: "keyup", handler: this._onKeyUp }
  7844. ]);
  7845. };
  7846. // Ready
  7847. Scene.prototype.isReady = function () {
  7848. if (this._pendingData.length > 0) {
  7849. return false;
  7850. }
  7851. for (var index = 0; index < this._geometries.length; index++) {
  7852. var geometry = this._geometries[index];
  7853. if (geometry.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADING) {
  7854. return false;
  7855. }
  7856. }
  7857. for (index = 0; index < this.meshes.length; index++) {
  7858. var mesh = this.meshes[index];
  7859. if (!mesh.isReady()) {
  7860. return false;
  7861. }
  7862. var mat = mesh.material;
  7863. if (mat) {
  7864. if (!mat.isReady(mesh)) {
  7865. return false;
  7866. }
  7867. }
  7868. }
  7869. return true;
  7870. };
  7871. Scene.prototype.resetCachedMaterial = function () {
  7872. this._cachedMaterial = null;
  7873. };
  7874. Scene.prototype.registerBeforeRender = function (func) {
  7875. this._onBeforeRenderCallbacks.push(func);
  7876. };
  7877. Scene.prototype.unregisterBeforeRender = function (func) {
  7878. var index = this._onBeforeRenderCallbacks.indexOf(func);
  7879. if (index > -1) {
  7880. this._onBeforeRenderCallbacks.splice(index, 1);
  7881. }
  7882. };
  7883. Scene.prototype.registerAfterRender = function (func) {
  7884. this._onAfterRenderCallbacks.push(func);
  7885. };
  7886. Scene.prototype.unregisterAfterRender = function (func) {
  7887. var index = this._onAfterRenderCallbacks.indexOf(func);
  7888. if (index > -1) {
  7889. this._onAfterRenderCallbacks.splice(index, 1);
  7890. }
  7891. };
  7892. Scene.prototype._addPendingData = function (data) {
  7893. this._pendingData.push(data);
  7894. };
  7895. Scene.prototype._removePendingData = function (data) {
  7896. var index = this._pendingData.indexOf(data);
  7897. if (index !== -1) {
  7898. this._pendingData.splice(index, 1);
  7899. }
  7900. };
  7901. Scene.prototype.getWaitingItemsCount = function () {
  7902. return this._pendingData.length;
  7903. };
  7904. /**
  7905. * Registers a function to be executed when the scene is ready.
  7906. * @param {Function} func - the function to be executed.
  7907. */
  7908. Scene.prototype.executeWhenReady = function (func) {
  7909. var _this = this;
  7910. this._onReadyCallbacks.push(func);
  7911. if (this._executeWhenReadyTimeoutId !== -1) {
  7912. return;
  7913. }
  7914. this._executeWhenReadyTimeoutId = setTimeout(function () {
  7915. _this._checkIsReady();
  7916. }, 150);
  7917. };
  7918. Scene.prototype._checkIsReady = function () {
  7919. var _this = this;
  7920. if (this.isReady()) {
  7921. this._onReadyCallbacks.forEach(function (func) {
  7922. func();
  7923. });
  7924. this._onReadyCallbacks = [];
  7925. this._executeWhenReadyTimeoutId = -1;
  7926. return;
  7927. }
  7928. this._executeWhenReadyTimeoutId = setTimeout(function () {
  7929. _this._checkIsReady();
  7930. }, 150);
  7931. };
  7932. // Animations
  7933. /**
  7934. * Will start the animation sequence of a given target
  7935. * @param target - the target
  7936. * @param {number} from - from which frame should animation start
  7937. * @param {number} to - till which frame should animation run.
  7938. * @param {boolean} [loop] - should the animation loop
  7939. * @param {number} [speedRatio] - the speed in which to run the animation
  7940. * @param {Function} [onAnimationEnd] function to be executed when the animation ended.
  7941. * @param {BABYLON.Animatable} [animatable] an animatable object. If not provided a new one will be created from the given params.
  7942. * @return {BABYLON.Animatable} the animatable object created for this animation
  7943. * @see BABYLON.Animatable
  7944. * @see http://doc.babylonjs.com/page.php?p=22081
  7945. */
  7946. Scene.prototype.beginAnimation = function (target, from, to, loop, speedRatio, onAnimationEnd, animatable) {
  7947. if (speedRatio === undefined) {
  7948. speedRatio = 1.0;
  7949. }
  7950. this.stopAnimation(target);
  7951. if (!animatable) {
  7952. animatable = new BABYLON.Animatable(this, target, from, to, loop, speedRatio, onAnimationEnd);
  7953. }
  7954. // Local animations
  7955. if (target.animations) {
  7956. animatable.appendAnimations(target, target.animations);
  7957. }
  7958. // Children animations
  7959. if (target.getAnimatables) {
  7960. var animatables = target.getAnimatables();
  7961. for (var index = 0; index < animatables.length; index++) {
  7962. this.beginAnimation(animatables[index], from, to, loop, speedRatio, onAnimationEnd, animatable);
  7963. }
  7964. }
  7965. return animatable;
  7966. };
  7967. Scene.prototype.beginDirectAnimation = function (target, animations, from, to, loop, speedRatio, onAnimationEnd) {
  7968. if (speedRatio === undefined) {
  7969. speedRatio = 1.0;
  7970. }
  7971. var animatable = new BABYLON.Animatable(this, target, from, to, loop, speedRatio, onAnimationEnd, animations);
  7972. return animatable;
  7973. };
  7974. Scene.prototype.getAnimatableByTarget = function (target) {
  7975. for (var index = 0; index < this._activeAnimatables.length; index++) {
  7976. if (this._activeAnimatables[index].target === target) {
  7977. return this._activeAnimatables[index];
  7978. }
  7979. }
  7980. return null;
  7981. };
  7982. /**
  7983. * Will stop the animation of the given target
  7984. * @param target - the target
  7985. * @see beginAnimation
  7986. */
  7987. Scene.prototype.stopAnimation = function (target) {
  7988. var animatable = this.getAnimatableByTarget(target);
  7989. if (animatable) {
  7990. animatable.stop();
  7991. }
  7992. };
  7993. Scene.prototype._animate = function () {
  7994. if (!this.animationsEnabled) {
  7995. return;
  7996. }
  7997. if (!this._animationStartDate) {
  7998. this._animationStartDate = BABYLON.Tools.Now;
  7999. }
  8000. // Getting time
  8001. var now = BABYLON.Tools.Now;
  8002. var delay = now - this._animationStartDate;
  8003. for (var index = 0; index < this._activeAnimatables.length; index++) {
  8004. if (!this._activeAnimatables[index]._animate(delay)) {
  8005. this._activeAnimatables.splice(index, 1);
  8006. index--;
  8007. }
  8008. }
  8009. };
  8010. // Matrix
  8011. Scene.prototype.getViewMatrix = function () {
  8012. return this._viewMatrix;
  8013. };
  8014. Scene.prototype.getProjectionMatrix = function () {
  8015. return this._projectionMatrix;
  8016. };
  8017. Scene.prototype.getTransformMatrix = function () {
  8018. return this._transformMatrix;
  8019. };
  8020. Scene.prototype.setTransformMatrix = function (view, projection) {
  8021. this._viewMatrix = view;
  8022. this._projectionMatrix = projection;
  8023. this._viewMatrix.multiplyToRef(this._projectionMatrix, this._transformMatrix);
  8024. };
  8025. // Methods
  8026. /**
  8027. * sets the active camera of the scene using its ID
  8028. * @param {string} id - the camera's ID
  8029. * @return {BABYLON.Camera|null} the new active camera or null if none found.
  8030. * @see activeCamera
  8031. */
  8032. Scene.prototype.setActiveCameraByID = function (id) {
  8033. var camera = this.getCameraByID(id);
  8034. if (camera) {
  8035. this.activeCamera = camera;
  8036. return camera;
  8037. }
  8038. return null;
  8039. };
  8040. /**
  8041. * sets the active camera of the scene using its name
  8042. * @param {string} name - the camera's name
  8043. * @return {BABYLON.Camera|null} the new active camera or null if none found.
  8044. * @see activeCamera
  8045. */
  8046. Scene.prototype.setActiveCameraByName = function (name) {
  8047. var camera = this.getCameraByName(name);
  8048. if (camera) {
  8049. this.activeCamera = camera;
  8050. return camera;
  8051. }
  8052. return null;
  8053. };
  8054. /**
  8055. * get a material using its id
  8056. * @param {string} the material's ID
  8057. * @return {BABYLON.Material|null} the material or null if none found.
  8058. */
  8059. Scene.prototype.getMaterialByID = function (id) {
  8060. for (var index = 0; index < this.materials.length; index++) {
  8061. if (this.materials[index].id === id) {
  8062. return this.materials[index];
  8063. }
  8064. }
  8065. return null;
  8066. };
  8067. /**
  8068. * get a material using its name
  8069. * @param {string} the material's name
  8070. * @return {BABYLON.Material|null} the material or null if none found.
  8071. */
  8072. Scene.prototype.getMaterialByName = function (name) {
  8073. for (var index = 0; index < this.materials.length; index++) {
  8074. if (this.materials[index].name === name) {
  8075. return this.materials[index];
  8076. }
  8077. }
  8078. return null;
  8079. };
  8080. Scene.prototype.getCameraByID = function (id) {
  8081. for (var index = 0; index < this.cameras.length; index++) {
  8082. if (this.cameras[index].id === id) {
  8083. return this.cameras[index];
  8084. }
  8085. }
  8086. return null;
  8087. };
  8088. /**
  8089. * get a camera using its name
  8090. * @param {string} the camera's name
  8091. * @return {BABYLON.Camera|null} the camera or null if none found.
  8092. */
  8093. Scene.prototype.getCameraByName = function (name) {
  8094. for (var index = 0; index < this.cameras.length; index++) {
  8095. if (this.cameras[index].name === name) {
  8096. return this.cameras[index];
  8097. }
  8098. }
  8099. return null;
  8100. };
  8101. /**
  8102. * get a light node using its name
  8103. * @param {string} the light's name
  8104. * @return {BABYLON.Light|null} the light or null if none found.
  8105. */
  8106. Scene.prototype.getLightByName = function (name) {
  8107. for (var index = 0; index < this.lights.length; index++) {
  8108. if (this.lights[index].name === name) {
  8109. return this.lights[index];
  8110. }
  8111. }
  8112. return null;
  8113. };
  8114. /**
  8115. * get a light node using its ID
  8116. * @param {string} the light's id
  8117. * @return {BABYLON.Light|null} the light or null if none found.
  8118. */
  8119. Scene.prototype.getLightByID = function (id) {
  8120. for (var index = 0; index < this.lights.length; index++) {
  8121. if (this.lights[index].id === id) {
  8122. return this.lights[index];
  8123. }
  8124. }
  8125. return null;
  8126. };
  8127. /**
  8128. * get a geometry using its ID
  8129. * @param {string} the geometry's id
  8130. * @return {BABYLON.Geometry|null} the geometry or null if none found.
  8131. */
  8132. Scene.prototype.getGeometryByID = function (id) {
  8133. for (var index = 0; index < this._geometries.length; index++) {
  8134. if (this._geometries[index].id === id) {
  8135. return this._geometries[index];
  8136. }
  8137. }
  8138. return null;
  8139. };
  8140. /**
  8141. * add a new geometry to this scene.
  8142. * @param {BABYLON.Geometry} geometry - the geometry to be added to the scene.
  8143. * @param {boolean} [force] - force addition, even if a geometry with this ID already exists
  8144. * @return {boolean} was the geometry added or not
  8145. */
  8146. Scene.prototype.pushGeometry = function (geometry, force) {
  8147. if (!force && this.getGeometryByID(geometry.id)) {
  8148. return false;
  8149. }
  8150. this._geometries.push(geometry);
  8151. return true;
  8152. };
  8153. Scene.prototype.getGeometries = function () {
  8154. return this._geometries;
  8155. };
  8156. /**
  8157. * Get a the first added mesh found of a given ID
  8158. * @param {string} id - the id to search for
  8159. * @return {BABYLON.AbstractMesh|null} the mesh found or null if not found at all.
  8160. */
  8161. Scene.prototype.getMeshByID = function (id) {
  8162. for (var index = 0; index < this.meshes.length; index++) {
  8163. if (this.meshes[index].id === id) {
  8164. return this.meshes[index];
  8165. }
  8166. }
  8167. return null;
  8168. };
  8169. /**
  8170. * Get a the last added mesh found of a given ID
  8171. * @param {string} id - the id to search for
  8172. * @return {BABYLON.AbstractMesh|null} the mesh found or null if not found at all.
  8173. */
  8174. Scene.prototype.getLastMeshByID = function (id) {
  8175. for (var index = this.meshes.length - 1; index >= 0; index--) {
  8176. if (this.meshes[index].id === id) {
  8177. return this.meshes[index];
  8178. }
  8179. }
  8180. return null;
  8181. };
  8182. /**
  8183. * Get a the last added node (Mesh, Camera, Light) found of a given ID
  8184. * @param {string} id - the id to search for
  8185. * @return {BABYLON.Node|null} the node found or null if not found at all.
  8186. */
  8187. Scene.prototype.getLastEntryByID = function (id) {
  8188. for (var index = this.meshes.length - 1; index >= 0; index--) {
  8189. if (this.meshes[index].id === id) {
  8190. return this.meshes[index];
  8191. }
  8192. }
  8193. for (index = this.cameras.length - 1; index >= 0; index--) {
  8194. if (this.cameras[index].id === id) {
  8195. return this.cameras[index];
  8196. }
  8197. }
  8198. for (index = this.lights.length - 1; index >= 0; index--) {
  8199. if (this.lights[index].id === id) {
  8200. return this.lights[index];
  8201. }
  8202. }
  8203. return null;
  8204. };
  8205. Scene.prototype.getNodeByName = function (name) {
  8206. var mesh = this.getMeshByName(name);
  8207. if (mesh) {
  8208. return mesh;
  8209. }
  8210. var light = this.getLightByName(name);
  8211. if (light) {
  8212. return light;
  8213. }
  8214. return this.getCameraByName(name);
  8215. };
  8216. Scene.prototype.getMeshByName = function (name) {
  8217. for (var index = 0; index < this.meshes.length; index++) {
  8218. if (this.meshes[index].name === name) {
  8219. return this.meshes[index];
  8220. }
  8221. }
  8222. return null;
  8223. };
  8224. Scene.prototype.getSoundByName = function (name) {
  8225. for (var index = 0; index < this.mainSoundTrack.soundCollection.length; index++) {
  8226. if (this.mainSoundTrack.soundCollection[index].name === name) {
  8227. return this.mainSoundTrack.soundCollection[index];
  8228. }
  8229. }
  8230. for (var sdIndex = 0; sdIndex < this.soundTracks.length; sdIndex++) {
  8231. for (index = 0; index < this.soundTracks[sdIndex].soundCollection.length; index++) {
  8232. if (this.soundTracks[sdIndex].soundCollection[index].name === name) {
  8233. return this.soundTracks[sdIndex].soundCollection[index];
  8234. }
  8235. }
  8236. }
  8237. return null;
  8238. };
  8239. Scene.prototype.getLastSkeletonByID = function (id) {
  8240. for (var index = this.skeletons.length - 1; index >= 0; index--) {
  8241. if (this.skeletons[index].id === id) {
  8242. return this.skeletons[index];
  8243. }
  8244. }
  8245. return null;
  8246. };
  8247. Scene.prototype.getSkeletonById = function (id) {
  8248. for (var index = 0; index < this.skeletons.length; index++) {
  8249. if (this.skeletons[index].id === id) {
  8250. return this.skeletons[index];
  8251. }
  8252. }
  8253. return null;
  8254. };
  8255. Scene.prototype.getSkeletonByName = function (name) {
  8256. for (var index = 0; index < this.skeletons.length; index++) {
  8257. if (this.skeletons[index].name === name) {
  8258. return this.skeletons[index];
  8259. }
  8260. }
  8261. return null;
  8262. };
  8263. Scene.prototype.isActiveMesh = function (mesh) {
  8264. return (this._activeMeshes.indexOf(mesh) !== -1);
  8265. };
  8266. Scene.prototype._evaluateSubMesh = function (subMesh, mesh) {
  8267. if (mesh.subMeshes.length === 1 || subMesh.isInFrustum(this._frustumPlanes)) {
  8268. var material = subMesh.getMaterial();
  8269. if (mesh.showSubMeshesBoundingBox) {
  8270. this._boundingBoxRenderer.renderList.push(subMesh.getBoundingInfo().boundingBox);
  8271. }
  8272. if (material) {
  8273. // Render targets
  8274. if (material.getRenderTargetTextures) {
  8275. if (this._processedMaterials.indexOf(material) === -1) {
  8276. this._processedMaterials.push(material);
  8277. this._renderTargets.concat(material.getRenderTargetTextures());
  8278. }
  8279. }
  8280. // Dispatch
  8281. this._activeVertices += subMesh.indexCount;
  8282. this._renderingManager.dispatch(subMesh);
  8283. }
  8284. }
  8285. };
  8286. Scene.prototype._evaluateActiveMeshes = function () {
  8287. this._activeMeshes.reset();
  8288. this._renderingManager.reset();
  8289. this._processedMaterials.reset();
  8290. this._activeParticleSystems.reset();
  8291. this._activeSkeletons.reset();
  8292. this._boundingBoxRenderer.reset();
  8293. if (!this._frustumPlanes) {
  8294. this._frustumPlanes = BABYLON.Frustum.GetPlanes(this._transformMatrix);
  8295. }
  8296. else {
  8297. BABYLON.Frustum.GetPlanesToRef(this._transformMatrix, this._frustumPlanes);
  8298. }
  8299. // Meshes
  8300. var meshes;
  8301. var len;
  8302. if (this._selectionOctree) {
  8303. var selection = this._selectionOctree.select(this._frustumPlanes);
  8304. meshes = selection.data;
  8305. len = selection.length;
  8306. }
  8307. else {
  8308. len = this.meshes.length;
  8309. meshes = this.meshes;
  8310. }
  8311. for (var meshIndex = 0; meshIndex < len; meshIndex++) {
  8312. var mesh = meshes[meshIndex];
  8313. if (mesh.isBlocked) {
  8314. continue;
  8315. }
  8316. this._totalVertices += mesh.getTotalVertices();
  8317. if (!mesh.isReady()) {
  8318. continue;
  8319. }
  8320. mesh.computeWorldMatrix();
  8321. // Intersections
  8322. if (mesh.actionManager && mesh.actionManager.hasSpecificTriggers([BABYLON.ActionManager.OnIntersectionEnterTrigger, BABYLON.ActionManager.OnIntersectionExitTrigger])) {
  8323. this._meshesForIntersections.pushNoDuplicate(mesh);
  8324. }
  8325. // Switch to current LOD
  8326. var meshLOD = mesh.getLOD(this.activeCamera);
  8327. if (!meshLOD) {
  8328. continue;
  8329. }
  8330. mesh._preActivate();
  8331. if (mesh.isEnabled() && mesh.isVisible && mesh.visibility > 0 && ((mesh.layerMask & this.activeCamera.layerMask) !== 0) && mesh.isInFrustum(this._frustumPlanes)) {
  8332. this._activeMeshes.push(mesh);
  8333. mesh._activate(this._renderId);
  8334. this._activeMesh(meshLOD);
  8335. }
  8336. }
  8337. // Particle systems
  8338. var beforeParticlesDate = BABYLON.Tools.Now;
  8339. if (this.particlesEnabled) {
  8340. BABYLON.Tools.StartPerformanceCounter("Particles", this.particleSystems.length > 0);
  8341. for (var particleIndex = 0; particleIndex < this.particleSystems.length; particleIndex++) {
  8342. var particleSystem = this.particleSystems[particleIndex];
  8343. if (!particleSystem.isStarted()) {
  8344. continue;
  8345. }
  8346. if (!particleSystem.emitter.position || (particleSystem.emitter && particleSystem.emitter.isEnabled())) {
  8347. this._activeParticleSystems.push(particleSystem);
  8348. particleSystem.animate();
  8349. }
  8350. }
  8351. BABYLON.Tools.EndPerformanceCounter("Particles", this.particleSystems.length > 0);
  8352. }
  8353. this._particlesDuration += BABYLON.Tools.Now - beforeParticlesDate;
  8354. };
  8355. Scene.prototype._activeMesh = function (mesh) {
  8356. if (mesh.skeleton && this.skeletonsEnabled) {
  8357. this._activeSkeletons.pushNoDuplicate(mesh.skeleton);
  8358. }
  8359. if (mesh.showBoundingBox || this.forceShowBoundingBoxes) {
  8360. this._boundingBoxRenderer.renderList.push(mesh.getBoundingInfo().boundingBox);
  8361. }
  8362. if (mesh && mesh.subMeshes) {
  8363. // Submeshes Octrees
  8364. var len;
  8365. var subMeshes;
  8366. if (mesh._submeshesOctree && mesh.useOctreeForRenderingSelection) {
  8367. var intersections = mesh._submeshesOctree.select(this._frustumPlanes);
  8368. len = intersections.length;
  8369. subMeshes = intersections.data;
  8370. }
  8371. else {
  8372. subMeshes = mesh.subMeshes;
  8373. len = subMeshes.length;
  8374. }
  8375. for (var subIndex = 0; subIndex < len; subIndex++) {
  8376. var subMesh = subMeshes[subIndex];
  8377. this._evaluateSubMesh(subMesh, mesh);
  8378. }
  8379. }
  8380. };
  8381. Scene.prototype.updateTransformMatrix = function (force) {
  8382. this.setTransformMatrix(this.activeCamera.getViewMatrix(), this.activeCamera.getProjectionMatrix(force));
  8383. };
  8384. Scene.prototype._renderForCamera = function (camera) {
  8385. var engine = this._engine;
  8386. this.activeCamera = camera;
  8387. if (!this.activeCamera)
  8388. throw new Error("Active camera not set");
  8389. BABYLON.Tools.StartPerformanceCounter("Rendering camera " + this.activeCamera.name);
  8390. // Viewport
  8391. engine.setViewport(this.activeCamera.viewport);
  8392. // Camera
  8393. this._renderId++;
  8394. this.updateTransformMatrix();
  8395. if (this.beforeCameraRender) {
  8396. this.beforeCameraRender(this.activeCamera);
  8397. }
  8398. // Meshes
  8399. var beforeEvaluateActiveMeshesDate = BABYLON.Tools.Now;
  8400. BABYLON.Tools.StartPerformanceCounter("Active meshes evaluation");
  8401. this._evaluateActiveMeshes();
  8402. this._evaluateActiveMeshesDuration += BABYLON.Tools.Now - beforeEvaluateActiveMeshesDate;
  8403. BABYLON.Tools.EndPerformanceCounter("Active meshes evaluation");
  8404. for (var skeletonIndex = 0; skeletonIndex < this._activeSkeletons.length; skeletonIndex++) {
  8405. var skeleton = this._activeSkeletons.data[skeletonIndex];
  8406. skeleton.prepare();
  8407. this._activeBones += skeleton.bones.length;
  8408. }
  8409. // Render targets
  8410. var beforeRenderTargetDate = BABYLON.Tools.Now;
  8411. if (this.renderTargetsEnabled) {
  8412. BABYLON.Tools.StartPerformanceCounter("Render targets", this._renderTargets.length > 0);
  8413. for (var renderIndex = 0; renderIndex < this._renderTargets.length; renderIndex++) {
  8414. var renderTarget = this._renderTargets.data[renderIndex];
  8415. if (renderTarget._shouldRender()) {
  8416. this._renderId++;
  8417. renderTarget.render();
  8418. }
  8419. }
  8420. BABYLON.Tools.EndPerformanceCounter("Render targets", this._renderTargets.length > 0);
  8421. this._renderId++;
  8422. }
  8423. if (this._renderTargets.length > 0) {
  8424. engine.restoreDefaultFramebuffer();
  8425. }
  8426. this._renderTargetsDuration += BABYLON.Tools.Now - beforeRenderTargetDate;
  8427. // Prepare Frame
  8428. this.postProcessManager._prepareFrame();
  8429. var beforeRenderDate = BABYLON.Tools.Now;
  8430. // Backgrounds
  8431. if (this.layers.length) {
  8432. engine.setDepthBuffer(false);
  8433. var layerIndex;
  8434. var layer;
  8435. for (layerIndex = 0; layerIndex < this.layers.length; layerIndex++) {
  8436. layer = this.layers[layerIndex];
  8437. if (layer.isBackground) {
  8438. layer.render();
  8439. }
  8440. }
  8441. engine.setDepthBuffer(true);
  8442. }
  8443. // Render
  8444. BABYLON.Tools.StartPerformanceCounter("Main render");
  8445. this._renderingManager.render(null, null, true, true);
  8446. BABYLON.Tools.EndPerformanceCounter("Main render");
  8447. // Bounding boxes
  8448. this._boundingBoxRenderer.render();
  8449. // Lens flares
  8450. if (this.lensFlaresEnabled) {
  8451. BABYLON.Tools.StartPerformanceCounter("Lens flares", this.lensFlareSystems.length > 0);
  8452. for (var lensFlareSystemIndex = 0; lensFlareSystemIndex < this.lensFlareSystems.length; lensFlareSystemIndex++) {
  8453. this.lensFlareSystems[lensFlareSystemIndex].render();
  8454. }
  8455. BABYLON.Tools.EndPerformanceCounter("Lens flares", this.lensFlareSystems.length > 0);
  8456. }
  8457. // Foregrounds
  8458. if (this.layers.length) {
  8459. engine.setDepthBuffer(false);
  8460. for (layerIndex = 0; layerIndex < this.layers.length; layerIndex++) {
  8461. layer = this.layers[layerIndex];
  8462. if (!layer.isBackground) {
  8463. layer.render();
  8464. }
  8465. }
  8466. engine.setDepthBuffer(true);
  8467. }
  8468. this._renderDuration += BABYLON.Tools.Now - beforeRenderDate;
  8469. // Finalize frame
  8470. this.postProcessManager._finalizeFrame(camera.isIntermediate);
  8471. // Update camera
  8472. this.activeCamera._updateFromScene();
  8473. // Reset some special arrays
  8474. this._renderTargets.reset();
  8475. if (this.afterCameraRender) {
  8476. this.afterCameraRender(this.activeCamera);
  8477. }
  8478. BABYLON.Tools.EndPerformanceCounter("Rendering camera " + this.activeCamera.name);
  8479. };
  8480. Scene.prototype._processSubCameras = function (camera) {
  8481. if (camera.subCameras.length === 0) {
  8482. this._renderForCamera(camera);
  8483. return;
  8484. }
  8485. for (var index = 0; index < camera.subCameras.length; index++) {
  8486. this._renderForCamera(camera.subCameras[index]);
  8487. }
  8488. this.activeCamera = camera;
  8489. this.setTransformMatrix(this.activeCamera.getViewMatrix(), this.activeCamera.getProjectionMatrix());
  8490. // Update camera
  8491. this.activeCamera._updateFromScene();
  8492. };
  8493. Scene.prototype._checkIntersections = function () {
  8494. for (var index = 0; index < this._meshesForIntersections.length; index++) {
  8495. var sourceMesh = this._meshesForIntersections.data[index];
  8496. for (var actionIndex = 0; actionIndex < sourceMesh.actionManager.actions.length; actionIndex++) {
  8497. var action = sourceMesh.actionManager.actions[actionIndex];
  8498. if (action.trigger === BABYLON.ActionManager.OnIntersectionEnterTrigger || action.trigger === BABYLON.ActionManager.OnIntersectionExitTrigger) {
  8499. var parameters = action.getTriggerParameter();
  8500. var otherMesh = parameters instanceof BABYLON.AbstractMesh ? parameters : parameters.mesh;
  8501. var areIntersecting = otherMesh.intersectsMesh(sourceMesh, parameters.usePreciseIntersection);
  8502. var currentIntersectionInProgress = sourceMesh._intersectionsInProgress.indexOf(otherMesh);
  8503. if (areIntersecting && currentIntersectionInProgress === -1) {
  8504. if (action.trigger === BABYLON.ActionManager.OnIntersectionEnterTrigger) {
  8505. action._executeCurrent(BABYLON.ActionEvent.CreateNew(sourceMesh));
  8506. sourceMesh._intersectionsInProgress.push(otherMesh);
  8507. }
  8508. else if (action.trigger === BABYLON.ActionManager.OnIntersectionExitTrigger) {
  8509. sourceMesh._intersectionsInProgress.push(otherMesh);
  8510. }
  8511. }
  8512. else if (!areIntersecting && currentIntersectionInProgress > -1 && action.trigger === BABYLON.ActionManager.OnIntersectionExitTrigger) {
  8513. action._executeCurrent(BABYLON.ActionEvent.CreateNew(sourceMesh));
  8514. var indexOfOther = sourceMesh._intersectionsInProgress.indexOf(otherMesh);
  8515. if (indexOfOther > -1) {
  8516. sourceMesh._intersectionsInProgress.splice(indexOfOther, 1);
  8517. }
  8518. }
  8519. }
  8520. }
  8521. }
  8522. };
  8523. Scene.prototype.render = function () {
  8524. var startDate = BABYLON.Tools.Now;
  8525. this._particlesDuration = 0;
  8526. this._spritesDuration = 0;
  8527. this._activeParticles = 0;
  8528. this._renderDuration = 0;
  8529. this._renderTargetsDuration = 0;
  8530. this._evaluateActiveMeshesDuration = 0;
  8531. this._totalVertices = 0;
  8532. this._activeVertices = 0;
  8533. this._activeBones = 0;
  8534. this.getEngine().resetDrawCalls();
  8535. this._meshesForIntersections.reset();
  8536. this.resetCachedMaterial();
  8537. BABYLON.Tools.StartPerformanceCounter("Scene rendering");
  8538. // Actions
  8539. if (this.actionManager) {
  8540. this.actionManager.processTrigger(BABYLON.ActionManager.OnEveryFrameTrigger, null);
  8541. }
  8542. // Before render
  8543. if (this.beforeRender) {
  8544. this.beforeRender();
  8545. }
  8546. for (var callbackIndex = 0; callbackIndex < this._onBeforeRenderCallbacks.length; callbackIndex++) {
  8547. this._onBeforeRenderCallbacks[callbackIndex]();
  8548. }
  8549. // Animations
  8550. var deltaTime = Math.max(Scene.MinDeltaTime, Math.min(this._engine.getDeltaTime(), Scene.MaxDeltaTime));
  8551. this._animationRatio = deltaTime * (60.0 / 1000.0);
  8552. this._animate();
  8553. // Physics
  8554. if (this._physicsEngine) {
  8555. BABYLON.Tools.StartPerformanceCounter("Physics");
  8556. this._physicsEngine._runOneStep(deltaTime / 1000.0);
  8557. BABYLON.Tools.EndPerformanceCounter("Physics");
  8558. }
  8559. // Customs render targets
  8560. var beforeRenderTargetDate = BABYLON.Tools.Now;
  8561. var engine = this.getEngine();
  8562. if (this.renderTargetsEnabled) {
  8563. BABYLON.Tools.StartPerformanceCounter("Custom render targets", this.customRenderTargets.length > 0);
  8564. for (var customIndex = 0; customIndex < this.customRenderTargets.length; customIndex++) {
  8565. var renderTarget = this.customRenderTargets[customIndex];
  8566. if (renderTarget._shouldRender()) {
  8567. this._renderId++;
  8568. this.activeCamera = renderTarget.activeCamera || this.activeCamera;
  8569. if (!this.activeCamera)
  8570. throw new Error("Active camera not set");
  8571. // Viewport
  8572. engine.setViewport(this.activeCamera.viewport);
  8573. // Camera
  8574. this.updateTransformMatrix();
  8575. renderTarget.render();
  8576. }
  8577. }
  8578. BABYLON.Tools.EndPerformanceCounter("Custom render targets", this.customRenderTargets.length > 0);
  8579. this._renderId++;
  8580. }
  8581. if (this.customRenderTargets.length > 0) {
  8582. engine.restoreDefaultFramebuffer();
  8583. }
  8584. this._renderTargetsDuration += BABYLON.Tools.Now - beforeRenderTargetDate;
  8585. // Procedural textures
  8586. if (this.proceduralTexturesEnabled) {
  8587. BABYLON.Tools.StartPerformanceCounter("Procedural textures", this._proceduralTextures.length > 0);
  8588. for (var proceduralIndex = 0; proceduralIndex < this._proceduralTextures.length; proceduralIndex++) {
  8589. var proceduralTexture = this._proceduralTextures[proceduralIndex];
  8590. if (proceduralTexture._shouldRender()) {
  8591. proceduralTexture.render();
  8592. }
  8593. }
  8594. BABYLON.Tools.EndPerformanceCounter("Procedural textures", this._proceduralTextures.length > 0);
  8595. }
  8596. // Clear
  8597. this._engine.clear(this.clearColor, this.autoClear || this.forceWireframe || this.forcePointsCloud, true);
  8598. // Shadows
  8599. if (this.shadowsEnabled) {
  8600. for (var lightIndex = 0; lightIndex < this.lights.length; lightIndex++) {
  8601. var light = this.lights[lightIndex];
  8602. var shadowGenerator = light.getShadowGenerator();
  8603. if (light.isEnabled() && shadowGenerator && shadowGenerator.getShadowMap().getScene().textures.indexOf(shadowGenerator.getShadowMap()) !== -1) {
  8604. this._renderTargets.push(shadowGenerator.getShadowMap());
  8605. }
  8606. }
  8607. }
  8608. // Depth renderer
  8609. if (this._depthRenderer) {
  8610. this._renderTargets.push(this._depthRenderer.getDepthMap());
  8611. }
  8612. // RenderPipeline
  8613. this.postProcessRenderPipelineManager.update();
  8614. // Multi-cameras?
  8615. if (this.activeCameras.length > 0) {
  8616. var currentRenderId = this._renderId;
  8617. for (var cameraIndex = 0; cameraIndex < this.activeCameras.length; cameraIndex++) {
  8618. this._renderId = currentRenderId;
  8619. this._processSubCameras(this.activeCameras[cameraIndex]);
  8620. }
  8621. }
  8622. else {
  8623. if (!this.activeCamera) {
  8624. throw new Error("No camera defined");
  8625. }
  8626. this._processSubCameras(this.activeCamera);
  8627. }
  8628. // Intersection checks
  8629. this._checkIntersections();
  8630. // Update the audio listener attached to the camera
  8631. this._updateAudioParameters();
  8632. // After render
  8633. if (this.afterRender) {
  8634. this.afterRender();
  8635. }
  8636. for (callbackIndex = 0; callbackIndex < this._onAfterRenderCallbacks.length; callbackIndex++) {
  8637. this._onAfterRenderCallbacks[callbackIndex]();
  8638. }
  8639. for (var index = 0; index < this._toBeDisposed.length; index++) {
  8640. this._toBeDisposed.data[index].dispose();
  8641. this._toBeDisposed[index] = null;
  8642. }
  8643. this._toBeDisposed.reset();
  8644. BABYLON.Tools.EndPerformanceCounter("Scene rendering");
  8645. this._lastFrameDuration = BABYLON.Tools.Now - startDate;
  8646. };
  8647. Scene.prototype._updateAudioParameters = function () {
  8648. var listeningCamera;
  8649. var audioEngine = BABYLON.Engine.audioEngine;
  8650. if (this.activeCameras.length > 0) {
  8651. listeningCamera = this.activeCameras[0];
  8652. }
  8653. else {
  8654. listeningCamera = this.activeCamera;
  8655. }
  8656. if (listeningCamera && audioEngine.canUseWebAudio) {
  8657. audioEngine.audioContext.listener.setPosition(listeningCamera.position.x, listeningCamera.position.y, listeningCamera.position.z);
  8658. var mat = BABYLON.Matrix.Invert(listeningCamera.getViewMatrix());
  8659. var cameraDirection = BABYLON.Vector3.TransformNormal(new BABYLON.Vector3(0, 0, -1), mat);
  8660. cameraDirection.normalize();
  8661. audioEngine.audioContext.listener.setOrientation(cameraDirection.x, cameraDirection.y, cameraDirection.z, 0, 1, 0);
  8662. for (var i = 0; i < this.mainSoundTrack.soundCollection.length; i++) {
  8663. var sound = this.mainSoundTrack.soundCollection[i];
  8664. if (sound.useCustomAttenuation) {
  8665. sound.updateDistanceFromListener();
  8666. }
  8667. }
  8668. for (i = 0; i < this.soundTracks.length; i++) {
  8669. for (var j = 0; j < this.soundTracks[i].soundCollection.length; j++) {
  8670. sound = this.soundTracks[i].soundCollection[j];
  8671. if (sound.useCustomAttenuation) {
  8672. sound.updateDistanceFromListener();
  8673. }
  8674. }
  8675. }
  8676. }
  8677. };
  8678. Scene.prototype.enableDepthRenderer = function () {
  8679. if (this._depthRenderer) {
  8680. return this._depthRenderer;
  8681. }
  8682. this._depthRenderer = new BABYLON.DepthRenderer(this);
  8683. return this._depthRenderer;
  8684. };
  8685. Scene.prototype.disableDepthRenderer = function () {
  8686. if (!this._depthRenderer) {
  8687. return;
  8688. }
  8689. this._depthRenderer.dispose();
  8690. this._depthRenderer = null;
  8691. };
  8692. Scene.prototype.dispose = function () {
  8693. this.beforeRender = null;
  8694. this.afterRender = null;
  8695. this.skeletons = [];
  8696. this._boundingBoxRenderer.dispose();
  8697. if (this._depthRenderer) {
  8698. this._depthRenderer.dispose();
  8699. }
  8700. // Debug layer
  8701. this.debugLayer.hide();
  8702. // Events
  8703. if (this.onDispose) {
  8704. this.onDispose();
  8705. }
  8706. this._onBeforeRenderCallbacks = [];
  8707. this._onAfterRenderCallbacks = [];
  8708. this.detachControl();
  8709. // Release sounds & sounds tracks
  8710. this.mainSoundTrack.dispose();
  8711. for (var scIndex = 0; scIndex < this.soundTracks.length; scIndex++) {
  8712. this.soundTracks[scIndex].dispose();
  8713. }
  8714. // Detach cameras
  8715. var canvas = this._engine.getRenderingCanvas();
  8716. var index;
  8717. for (index = 0; index < this.cameras.length; index++) {
  8718. this.cameras[index].detachControl(canvas);
  8719. }
  8720. while (this.lights.length) {
  8721. this.lights[0].dispose();
  8722. }
  8723. while (this.meshes.length) {
  8724. this.meshes[0].dispose(true);
  8725. }
  8726. while (this.cameras.length) {
  8727. this.cameras[0].dispose();
  8728. }
  8729. while (this.materials.length) {
  8730. this.materials[0].dispose();
  8731. }
  8732. while (this.particleSystems.length) {
  8733. this.particleSystems[0].dispose();
  8734. }
  8735. while (this.spriteManagers.length) {
  8736. this.spriteManagers[0].dispose();
  8737. }
  8738. while (this.layers.length) {
  8739. this.layers[0].dispose();
  8740. }
  8741. while (this.textures.length) {
  8742. this.textures[0].dispose();
  8743. }
  8744. // Post-processes
  8745. this.postProcessManager.dispose();
  8746. // Physics
  8747. if (this._physicsEngine) {
  8748. this.disablePhysicsEngine();
  8749. }
  8750. // Remove from engine
  8751. index = this._engine.scenes.indexOf(this);
  8752. if (index > -1) {
  8753. this._engine.scenes.splice(index, 1);
  8754. }
  8755. this._engine.wipeCaches();
  8756. };
  8757. // Collisions
  8758. Scene.prototype._getNewPosition = function (position, velocity, collider, maximumRetry, finalPosition, excludedMesh) {
  8759. if (excludedMesh === void 0) { excludedMesh = null; }
  8760. position.divideToRef(collider.radius, this._scaledPosition);
  8761. velocity.divideToRef(collider.radius, this._scaledVelocity);
  8762. collider.retry = 0;
  8763. collider.initialVelocity = this._scaledVelocity;
  8764. collider.initialPosition = this._scaledPosition;
  8765. this._collideWithWorld(this._scaledPosition, this._scaledVelocity, collider, maximumRetry, finalPosition, excludedMesh);
  8766. finalPosition.multiplyInPlace(collider.radius);
  8767. };
  8768. Scene.prototype._collideWithWorld = function (position, velocity, collider, maximumRetry, finalPosition, excludedMesh) {
  8769. if (excludedMesh === void 0) { excludedMesh = null; }
  8770. var closeDistance = BABYLON.Engine.CollisionsEpsilon * 10.0;
  8771. if (collider.retry >= maximumRetry) {
  8772. finalPosition.copyFrom(position);
  8773. return;
  8774. }
  8775. collider._initialize(position, velocity, closeDistance);
  8776. for (var index = 0; index < this.meshes.length; index++) {
  8777. var mesh = this.meshes[index];
  8778. if (mesh.isEnabled() && mesh.checkCollisions && mesh.subMeshes && mesh !== excludedMesh) {
  8779. mesh._checkCollision(collider);
  8780. }
  8781. }
  8782. if (!collider.collisionFound) {
  8783. position.addToRef(velocity, finalPosition);
  8784. return;
  8785. }
  8786. if (velocity.x !== 0 || velocity.y !== 0 || velocity.z !== 0) {
  8787. collider._getResponse(position, velocity);
  8788. }
  8789. if (velocity.length() <= closeDistance) {
  8790. finalPosition.copyFrom(position);
  8791. return;
  8792. }
  8793. collider.retry++;
  8794. this._collideWithWorld(position, velocity, collider, maximumRetry, finalPosition, excludedMesh);
  8795. };
  8796. // Octrees
  8797. Scene.prototype.getWorldExtends = function () {
  8798. var min = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  8799. var max = new BABYLON.Vector3(-Number.MAX_VALUE, -Number.MAX_VALUE, -Number.MAX_VALUE);
  8800. for (var index = 0; index < this.meshes.length; index++) {
  8801. var mesh = this.meshes[index];
  8802. mesh.computeWorldMatrix(true);
  8803. var minBox = mesh.getBoundingInfo().boundingBox.minimumWorld;
  8804. var maxBox = mesh.getBoundingInfo().boundingBox.maximumWorld;
  8805. BABYLON.Tools.CheckExtends(minBox, min, max);
  8806. BABYLON.Tools.CheckExtends(maxBox, min, max);
  8807. }
  8808. return {
  8809. min: min,
  8810. max: max
  8811. };
  8812. };
  8813. Scene.prototype.createOrUpdateSelectionOctree = function (maxCapacity, maxDepth) {
  8814. if (maxCapacity === void 0) { maxCapacity = 64; }
  8815. if (maxDepth === void 0) { maxDepth = 2; }
  8816. if (!this._selectionOctree) {
  8817. this._selectionOctree = new BABYLON.Octree(BABYLON.Octree.CreationFuncForMeshes, maxCapacity, maxDepth);
  8818. }
  8819. var worldExtends = this.getWorldExtends();
  8820. // Update octree
  8821. this._selectionOctree.update(worldExtends.min, worldExtends.max, this.meshes);
  8822. return this._selectionOctree;
  8823. };
  8824. // Picking
  8825. Scene.prototype.createPickingRay = function (x, y, world, camera) {
  8826. var engine = this._engine;
  8827. if (!camera) {
  8828. if (!this.activeCamera)
  8829. throw new Error("Active camera not set");
  8830. camera = this.activeCamera;
  8831. }
  8832. var cameraViewport = camera.viewport;
  8833. var viewport = cameraViewport.toGlobal(engine);
  8834. // Moving coordinates to local viewport world
  8835. x = x / this._engine.getHardwareScalingLevel() - viewport.x;
  8836. y = y / this._engine.getHardwareScalingLevel() - (this._engine.getRenderHeight() - viewport.y - viewport.height);
  8837. return BABYLON.Ray.CreateNew(x, y, viewport.width, viewport.height, world ? world : BABYLON.Matrix.Identity(), camera.getViewMatrix(), camera.getProjectionMatrix());
  8838. // return BABYLON.Ray.CreateNew(x / window.devicePixelRatio, y / window.devicePixelRatio, viewport.width, viewport.height, world ? world : BABYLON.Matrix.Identity(), camera.getViewMatrix(), camera.getProjectionMatrix());
  8839. };
  8840. Scene.prototype._internalPick = function (rayFunction, predicate, fastCheck) {
  8841. var pickingInfo = null;
  8842. for (var meshIndex = 0; meshIndex < this.meshes.length; meshIndex++) {
  8843. var mesh = this.meshes[meshIndex];
  8844. if (predicate) {
  8845. if (!predicate(mesh)) {
  8846. continue;
  8847. }
  8848. }
  8849. else if (!mesh.isEnabled() || !mesh.isVisible || !mesh.isPickable) {
  8850. continue;
  8851. }
  8852. var world = mesh.getWorldMatrix();
  8853. var ray = rayFunction(world);
  8854. var result = mesh.intersects(ray, fastCheck);
  8855. if (!result || !result.hit)
  8856. continue;
  8857. if (!fastCheck && pickingInfo != null && result.distance >= pickingInfo.distance)
  8858. continue;
  8859. pickingInfo = result;
  8860. if (fastCheck) {
  8861. break;
  8862. }
  8863. }
  8864. return pickingInfo || new BABYLON.PickingInfo();
  8865. };
  8866. Scene.prototype.pick = function (x, y, predicate, fastCheck, camera) {
  8867. var _this = this;
  8868. /// <summary>Launch a ray to try to pick a mesh in the scene</summary>
  8869. /// <param name="x">X position on screen</param>
  8870. /// <param name="y">Y position on screen</param>
  8871. /// <param name="predicate">Predicate function used to determine eligible meshes. Can be set to null. In this case, a mesh must be enabled, visible and with isPickable set to true</param>
  8872. /// <param name="fastCheck">Launch a fast check only using the bounding boxes. Can be set to null.</param>
  8873. /// <param name="camera">camera to use for computing the picking ray. Can be set to null. In this case, the scene.activeCamera will be used</param>
  8874. return this._internalPick(function (world) { return _this.createPickingRay(x, y, world, camera); }, predicate, fastCheck);
  8875. };
  8876. Scene.prototype.pickWithRay = function (ray, predicate, fastCheck) {
  8877. var _this = this;
  8878. return this._internalPick(function (world) {
  8879. if (!_this._pickWithRayInverseMatrix) {
  8880. _this._pickWithRayInverseMatrix = BABYLON.Matrix.Identity();
  8881. }
  8882. world.invertToRef(_this._pickWithRayInverseMatrix);
  8883. return BABYLON.Ray.Transform(ray, _this._pickWithRayInverseMatrix);
  8884. }, predicate, fastCheck);
  8885. };
  8886. Scene.prototype.setPointerOverMesh = function (mesh) {
  8887. if (this._pointerOverMesh === mesh) {
  8888. return;
  8889. }
  8890. if (this._pointerOverMesh && this._pointerOverMesh.actionManager) {
  8891. this._pointerOverMesh.actionManager.processTrigger(BABYLON.ActionManager.OnPointerOutTrigger, BABYLON.ActionEvent.CreateNew(this._pointerOverMesh));
  8892. }
  8893. this._pointerOverMesh = mesh;
  8894. if (this._pointerOverMesh && this._pointerOverMesh.actionManager) {
  8895. this._pointerOverMesh.actionManager.processTrigger(BABYLON.ActionManager.OnPointerOverTrigger, BABYLON.ActionEvent.CreateNew(this._pointerOverMesh));
  8896. }
  8897. };
  8898. Scene.prototype.getPointerOverMesh = function () {
  8899. return this._pointerOverMesh;
  8900. };
  8901. // Physics
  8902. Scene.prototype.getPhysicsEngine = function () {
  8903. return this._physicsEngine;
  8904. };
  8905. Scene.prototype.enablePhysics = function (gravity, plugin) {
  8906. if (this._physicsEngine) {
  8907. return true;
  8908. }
  8909. this._physicsEngine = new BABYLON.PhysicsEngine(plugin);
  8910. if (!this._physicsEngine.isSupported()) {
  8911. this._physicsEngine = null;
  8912. return false;
  8913. }
  8914. this._physicsEngine._initialize(gravity);
  8915. return true;
  8916. };
  8917. Scene.prototype.disablePhysicsEngine = function () {
  8918. if (!this._physicsEngine) {
  8919. return;
  8920. }
  8921. this._physicsEngine.dispose();
  8922. this._physicsEngine = undefined;
  8923. };
  8924. Scene.prototype.isPhysicsEnabled = function () {
  8925. return this._physicsEngine !== undefined;
  8926. };
  8927. Scene.prototype.setGravity = function (gravity) {
  8928. if (!this._physicsEngine) {
  8929. return;
  8930. }
  8931. this._physicsEngine._setGravity(gravity);
  8932. };
  8933. Scene.prototype.createCompoundImpostor = function (parts, options) {
  8934. if (parts.parts) {
  8935. options = parts;
  8936. parts = parts.parts;
  8937. }
  8938. if (!this._physicsEngine) {
  8939. return null;
  8940. }
  8941. for (var index = 0; index < parts.length; index++) {
  8942. var mesh = parts[index].mesh;
  8943. mesh._physicImpostor = parts[index].impostor;
  8944. mesh._physicsMass = options.mass / parts.length;
  8945. mesh._physicsFriction = options.friction;
  8946. mesh._physicRestitution = options.restitution;
  8947. }
  8948. return this._physicsEngine._registerMeshesAsCompound(parts, options);
  8949. };
  8950. Scene.prototype.deleteCompoundImpostor = function (compound) {
  8951. for (var index = 0; index < compound.parts.length; index++) {
  8952. var mesh = compound.parts[index].mesh;
  8953. mesh._physicImpostor = BABYLON.PhysicsEngine.NoImpostor;
  8954. this._physicsEngine._unregisterMesh(mesh);
  8955. }
  8956. };
  8957. // Misc.
  8958. Scene.prototype.createDefaultCameraOrLight = function () {
  8959. // Light
  8960. if (this.lights.length === 0) {
  8961. new BABYLON.HemisphericLight("default light", BABYLON.Vector3.Up(), this);
  8962. }
  8963. // Camera
  8964. if (!this.activeCamera) {
  8965. var camera = new BABYLON.FreeCamera("default camera", BABYLON.Vector3.Zero(), this);
  8966. // Compute position
  8967. var worldExtends = this.getWorldExtends();
  8968. var worldCenter = worldExtends.min.add(worldExtends.max.subtract(worldExtends.min).scale(0.5));
  8969. camera.position = new BABYLON.Vector3(worldCenter.x, worldCenter.y, worldExtends.min.z - (worldExtends.max.z - worldExtends.min.z));
  8970. camera.setTarget(worldCenter);
  8971. this.activeCamera = camera;
  8972. }
  8973. };
  8974. // Tags
  8975. Scene.prototype._getByTags = function (list, tagsQuery, forEach) {
  8976. if (tagsQuery === undefined) {
  8977. // returns the complete list (could be done with BABYLON.Tags.MatchesQuery but no need to have a for-loop here)
  8978. return list;
  8979. }
  8980. var listByTags = [];
  8981. forEach = forEach || (function (item) {
  8982. return;
  8983. });
  8984. for (var i in list) {
  8985. var item = list[i];
  8986. if (BABYLON.Tags.MatchesQuery(item, tagsQuery)) {
  8987. listByTags.push(item);
  8988. forEach(item);
  8989. }
  8990. }
  8991. return listByTags;
  8992. };
  8993. Scene.prototype.getMeshesByTags = function (tagsQuery, forEach) {
  8994. return this._getByTags(this.meshes, tagsQuery, forEach);
  8995. };
  8996. Scene.prototype.getCamerasByTags = function (tagsQuery, forEach) {
  8997. return this._getByTags(this.cameras, tagsQuery, forEach);
  8998. };
  8999. Scene.prototype.getLightsByTags = function (tagsQuery, forEach) {
  9000. return this._getByTags(this.lights, tagsQuery, forEach);
  9001. };
  9002. Scene.prototype.getMaterialByTags = function (tagsQuery, forEach) {
  9003. return this._getByTags(this.materials, tagsQuery, forEach).concat(this._getByTags(this.multiMaterials, tagsQuery, forEach));
  9004. };
  9005. // Statics
  9006. Scene._FOGMODE_NONE = 0;
  9007. Scene._FOGMODE_EXP = 1;
  9008. Scene._FOGMODE_EXP2 = 2;
  9009. Scene._FOGMODE_LINEAR = 3;
  9010. Scene.MinDeltaTime = 1.0;
  9011. Scene.MaxDeltaTime = 1000.0;
  9012. return Scene;
  9013. })();
  9014. BABYLON.Scene = Scene;
  9015. })(BABYLON || (BABYLON = {}));
  9016. //# sourceMappingURL=babylon.scene.js.mapvar BABYLON;
  9017. (function (BABYLON) {
  9018. var VertexBuffer = (function () {
  9019. function VertexBuffer(engine, data, kind, updatable, postponeInternalCreation, stride) {
  9020. if (engine instanceof BABYLON.Mesh) {
  9021. this._engine = engine.getScene().getEngine();
  9022. }
  9023. else {
  9024. this._engine = engine;
  9025. }
  9026. this._updatable = updatable;
  9027. this._data = data;
  9028. if (!postponeInternalCreation) {
  9029. this.create();
  9030. }
  9031. this._kind = kind;
  9032. if (stride) {
  9033. this._strideSize = stride;
  9034. return;
  9035. }
  9036. switch (kind) {
  9037. case VertexBuffer.PositionKind:
  9038. this._strideSize = 3;
  9039. break;
  9040. case VertexBuffer.NormalKind:
  9041. this._strideSize = 3;
  9042. break;
  9043. case VertexBuffer.UVKind:
  9044. this._strideSize = 2;
  9045. break;
  9046. case VertexBuffer.UV2Kind:
  9047. this._strideSize = 2;
  9048. break;
  9049. case VertexBuffer.ColorKind:
  9050. this._strideSize = 4;
  9051. break;
  9052. case VertexBuffer.MatricesIndicesKind:
  9053. this._strideSize = 4;
  9054. break;
  9055. case VertexBuffer.MatricesWeightsKind:
  9056. this._strideSize = 4;
  9057. break;
  9058. }
  9059. }
  9060. // Properties
  9061. VertexBuffer.prototype.isUpdatable = function () {
  9062. return this._updatable;
  9063. };
  9064. VertexBuffer.prototype.getData = function () {
  9065. return this._data;
  9066. };
  9067. VertexBuffer.prototype.getBuffer = function () {
  9068. return this._buffer;
  9069. };
  9070. VertexBuffer.prototype.getStrideSize = function () {
  9071. return this._strideSize;
  9072. };
  9073. // Methods
  9074. VertexBuffer.prototype.create = function (data) {
  9075. if (!data && this._buffer) {
  9076. return; // nothing to do
  9077. }
  9078. data = data || this._data;
  9079. if (!this._buffer) {
  9080. if (this._updatable) {
  9081. this._buffer = this._engine.createDynamicVertexBuffer(data.length * 4);
  9082. }
  9083. else {
  9084. this._buffer = this._engine.createVertexBuffer(data);
  9085. }
  9086. }
  9087. if (this._updatable) {
  9088. this._engine.updateDynamicVertexBuffer(this._buffer, data);
  9089. this._data = data;
  9090. }
  9091. };
  9092. VertexBuffer.prototype.update = function (data) {
  9093. this.create(data);
  9094. };
  9095. VertexBuffer.prototype.updateDirectly = function (data, offset) {
  9096. if (!this._buffer) {
  9097. return;
  9098. }
  9099. if (this._updatable) {
  9100. this._engine.updateDynamicVertexBuffer(this._buffer, data, offset);
  9101. this._data = null;
  9102. }
  9103. };
  9104. VertexBuffer.prototype.dispose = function () {
  9105. if (!this._buffer) {
  9106. return;
  9107. }
  9108. if (this._engine._releaseBuffer(this._buffer)) {
  9109. this._buffer = null;
  9110. }
  9111. };
  9112. Object.defineProperty(VertexBuffer, "PositionKind", {
  9113. get: function () {
  9114. return VertexBuffer._PositionKind;
  9115. },
  9116. enumerable: true,
  9117. configurable: true
  9118. });
  9119. Object.defineProperty(VertexBuffer, "NormalKind", {
  9120. get: function () {
  9121. return VertexBuffer._NormalKind;
  9122. },
  9123. enumerable: true,
  9124. configurable: true
  9125. });
  9126. Object.defineProperty(VertexBuffer, "UVKind", {
  9127. get: function () {
  9128. return VertexBuffer._UVKind;
  9129. },
  9130. enumerable: true,
  9131. configurable: true
  9132. });
  9133. Object.defineProperty(VertexBuffer, "UV2Kind", {
  9134. get: function () {
  9135. return VertexBuffer._UV2Kind;
  9136. },
  9137. enumerable: true,
  9138. configurable: true
  9139. });
  9140. Object.defineProperty(VertexBuffer, "ColorKind", {
  9141. get: function () {
  9142. return VertexBuffer._ColorKind;
  9143. },
  9144. enumerable: true,
  9145. configurable: true
  9146. });
  9147. Object.defineProperty(VertexBuffer, "MatricesIndicesKind", {
  9148. get: function () {
  9149. return VertexBuffer._MatricesIndicesKind;
  9150. },
  9151. enumerable: true,
  9152. configurable: true
  9153. });
  9154. Object.defineProperty(VertexBuffer, "MatricesWeightsKind", {
  9155. get: function () {
  9156. return VertexBuffer._MatricesWeightsKind;
  9157. },
  9158. enumerable: true,
  9159. configurable: true
  9160. });
  9161. // Enums
  9162. VertexBuffer._PositionKind = "position";
  9163. VertexBuffer._NormalKind = "normal";
  9164. VertexBuffer._UVKind = "uv";
  9165. VertexBuffer._UV2Kind = "uv2";
  9166. VertexBuffer._ColorKind = "color";
  9167. VertexBuffer._MatricesIndicesKind = "matricesIndices";
  9168. VertexBuffer._MatricesWeightsKind = "matricesWeights";
  9169. return VertexBuffer;
  9170. })();
  9171. BABYLON.VertexBuffer = VertexBuffer;
  9172. })(BABYLON || (BABYLON = {}));
  9173. //# sourceMappingURL=babylon.vertexBuffer.js.map
  9174. var BABYLON;
  9175. (function (BABYLON) {
  9176. var AbstractMesh = (function (_super) {
  9177. __extends(AbstractMesh, _super);
  9178. function AbstractMesh(name, scene) {
  9179. _super.call(this, name, scene);
  9180. // Properties
  9181. this.definedFacingForward = true; // orientation for POV movement & rotation
  9182. this.position = new BABYLON.Vector3(0, 0, 0);
  9183. this.rotation = new BABYLON.Vector3(0, 0, 0);
  9184. this.scaling = new BABYLON.Vector3(1, 1, 1);
  9185. this.billboardMode = AbstractMesh.BILLBOARDMODE_NONE;
  9186. this.visibility = 1.0;
  9187. this.alphaIndex = Number.MAX_VALUE;
  9188. this.infiniteDistance = false;
  9189. this.isVisible = true;
  9190. this.isPickable = true;
  9191. this.showBoundingBox = false;
  9192. this.showSubMeshesBoundingBox = false;
  9193. this.onDispose = null;
  9194. this.checkCollisions = false;
  9195. this.isBlocker = false;
  9196. this.renderingGroupId = 0;
  9197. this.receiveShadows = false;
  9198. this.renderOutline = false;
  9199. this.outlineColor = BABYLON.Color3.Red();
  9200. this.outlineWidth = 0.02;
  9201. this.renderOverlay = false;
  9202. this.overlayColor = BABYLON.Color3.Red();
  9203. this.overlayAlpha = 0.5;
  9204. this.hasVertexAlpha = false;
  9205. this.useVertexColors = true;
  9206. this.applyFog = true;
  9207. this.useOctreeForRenderingSelection = true;
  9208. this.useOctreeForPicking = true;
  9209. this.useOctreeForCollisions = true;
  9210. this.layerMask = 0xFFFFFFFF;
  9211. // Physics
  9212. this._physicImpostor = BABYLON.PhysicsEngine.NoImpostor;
  9213. // Collisions
  9214. this.ellipsoid = new BABYLON.Vector3(0.5, 1, 0.5);
  9215. this.ellipsoidOffset = new BABYLON.Vector3(0, 0, 0);
  9216. this._collider = new BABYLON.Collider();
  9217. this._oldPositionForCollisions = new BABYLON.Vector3(0, 0, 0);
  9218. this._diffPositionForCollisions = new BABYLON.Vector3(0, 0, 0);
  9219. this._newPositionForCollisions = new BABYLON.Vector3(0, 0, 0);
  9220. // Cache
  9221. this._localScaling = BABYLON.Matrix.Zero();
  9222. this._localRotation = BABYLON.Matrix.Zero();
  9223. this._localTranslation = BABYLON.Matrix.Zero();
  9224. this._localBillboard = BABYLON.Matrix.Zero();
  9225. this._localPivotScaling = BABYLON.Matrix.Zero();
  9226. this._localPivotScalingRotation = BABYLON.Matrix.Zero();
  9227. this._localWorld = BABYLON.Matrix.Zero();
  9228. this._worldMatrix = BABYLON.Matrix.Zero();
  9229. this._rotateYByPI = BABYLON.Matrix.RotationY(Math.PI);
  9230. this._absolutePosition = BABYLON.Vector3.Zero();
  9231. this._collisionsTransformMatrix = BABYLON.Matrix.Zero();
  9232. this._collisionsScalingMatrix = BABYLON.Matrix.Zero();
  9233. this._isDirty = false;
  9234. this._pivotMatrix = BABYLON.Matrix.Identity();
  9235. this._isDisposed = false;
  9236. this._renderId = 0;
  9237. this._intersectionsInProgress = new Array();
  9238. this._onAfterWorldMatrixUpdate = new Array();
  9239. scene.meshes.push(this);
  9240. }
  9241. Object.defineProperty(AbstractMesh, "BILLBOARDMODE_NONE", {
  9242. get: function () {
  9243. return AbstractMesh._BILLBOARDMODE_NONE;
  9244. },
  9245. enumerable: true,
  9246. configurable: true
  9247. });
  9248. Object.defineProperty(AbstractMesh, "BILLBOARDMODE_X", {
  9249. get: function () {
  9250. return AbstractMesh._BILLBOARDMODE_X;
  9251. },
  9252. enumerable: true,
  9253. configurable: true
  9254. });
  9255. Object.defineProperty(AbstractMesh, "BILLBOARDMODE_Y", {
  9256. get: function () {
  9257. return AbstractMesh._BILLBOARDMODE_Y;
  9258. },
  9259. enumerable: true,
  9260. configurable: true
  9261. });
  9262. Object.defineProperty(AbstractMesh, "BILLBOARDMODE_Z", {
  9263. get: function () {
  9264. return AbstractMesh._BILLBOARDMODE_Z;
  9265. },
  9266. enumerable: true,
  9267. configurable: true
  9268. });
  9269. Object.defineProperty(AbstractMesh, "BILLBOARDMODE_ALL", {
  9270. get: function () {
  9271. return AbstractMesh._BILLBOARDMODE_ALL;
  9272. },
  9273. enumerable: true,
  9274. configurable: true
  9275. });
  9276. Object.defineProperty(AbstractMesh.prototype, "isBlocked", {
  9277. // Methods
  9278. get: function () {
  9279. return false;
  9280. },
  9281. enumerable: true,
  9282. configurable: true
  9283. });
  9284. AbstractMesh.prototype.getLOD = function (camera) {
  9285. return this;
  9286. };
  9287. AbstractMesh.prototype.getTotalVertices = function () {
  9288. return 0;
  9289. };
  9290. AbstractMesh.prototype.getIndices = function () {
  9291. return null;
  9292. };
  9293. AbstractMesh.prototype.getVerticesData = function (kind) {
  9294. return null;
  9295. };
  9296. AbstractMesh.prototype.isVerticesDataPresent = function (kind) {
  9297. return false;
  9298. };
  9299. AbstractMesh.prototype.getBoundingInfo = function () {
  9300. if (this._masterMesh) {
  9301. return this._masterMesh.getBoundingInfo();
  9302. }
  9303. if (!this._boundingInfo) {
  9304. this._updateBoundingInfo();
  9305. }
  9306. return this._boundingInfo;
  9307. };
  9308. Object.defineProperty(AbstractMesh.prototype, "useBones", {
  9309. get: function () {
  9310. return this.skeleton && this.getScene().skeletonsEnabled && this.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind) && this.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind);
  9311. },
  9312. enumerable: true,
  9313. configurable: true
  9314. });
  9315. AbstractMesh.prototype._preActivate = function () {
  9316. };
  9317. AbstractMesh.prototype._activate = function (renderId) {
  9318. this._renderId = renderId;
  9319. };
  9320. AbstractMesh.prototype.getWorldMatrix = function () {
  9321. if (this._masterMesh) {
  9322. return this._masterMesh.getWorldMatrix();
  9323. }
  9324. if (this._currentRenderId !== this.getScene().getRenderId()) {
  9325. this.computeWorldMatrix();
  9326. }
  9327. return this._worldMatrix;
  9328. };
  9329. Object.defineProperty(AbstractMesh.prototype, "worldMatrixFromCache", {
  9330. get: function () {
  9331. return this._worldMatrix;
  9332. },
  9333. enumerable: true,
  9334. configurable: true
  9335. });
  9336. Object.defineProperty(AbstractMesh.prototype, "absolutePosition", {
  9337. get: function () {
  9338. return this._absolutePosition;
  9339. },
  9340. enumerable: true,
  9341. configurable: true
  9342. });
  9343. AbstractMesh.prototype.rotate = function (axis, amount, space) {
  9344. if (!this.rotationQuaternion) {
  9345. this.rotationQuaternion = BABYLON.Quaternion.RotationYawPitchRoll(this.rotation.y, this.rotation.x, this.rotation.z);
  9346. this.rotation = BABYLON.Vector3.Zero();
  9347. }
  9348. if (!space || space == 0 /* LOCAL */) {
  9349. var rotationQuaternion = BABYLON.Quaternion.RotationAxis(axis, amount);
  9350. this.rotationQuaternion = this.rotationQuaternion.multiply(rotationQuaternion);
  9351. }
  9352. else {
  9353. if (this.parent) {
  9354. var invertParentWorldMatrix = this.parent.getWorldMatrix().clone();
  9355. invertParentWorldMatrix.invert();
  9356. axis = BABYLON.Vector3.TransformNormal(axis, invertParentWorldMatrix);
  9357. }
  9358. rotationQuaternion = BABYLON.Quaternion.RotationAxis(axis, amount);
  9359. this.rotationQuaternion = rotationQuaternion.multiply(this.rotationQuaternion);
  9360. }
  9361. };
  9362. AbstractMesh.prototype.translate = function (axis, distance, space) {
  9363. var displacementVector = axis.scale(distance);
  9364. if (!space || space == 0 /* LOCAL */) {
  9365. var tempV3 = this.getPositionExpressedInLocalSpace().add(displacementVector);
  9366. this.setPositionWithLocalVector(tempV3);
  9367. }
  9368. else {
  9369. this.setAbsolutePosition(this.getAbsolutePosition().add(displacementVector));
  9370. }
  9371. };
  9372. AbstractMesh.prototype.getAbsolutePosition = function () {
  9373. this.computeWorldMatrix();
  9374. return this._absolutePosition;
  9375. };
  9376. AbstractMesh.prototype.setAbsolutePosition = function (absolutePosition) {
  9377. if (!absolutePosition) {
  9378. return;
  9379. }
  9380. var absolutePositionX;
  9381. var absolutePositionY;
  9382. var absolutePositionZ;
  9383. if (absolutePosition.x === undefined) {
  9384. if (arguments.length < 3) {
  9385. return;
  9386. }
  9387. absolutePositionX = arguments[0];
  9388. absolutePositionY = arguments[1];
  9389. absolutePositionZ = arguments[2];
  9390. }
  9391. else {
  9392. absolutePositionX = absolutePosition.x;
  9393. absolutePositionY = absolutePosition.y;
  9394. absolutePositionZ = absolutePosition.z;
  9395. }
  9396. if (this.parent) {
  9397. var invertParentWorldMatrix = this.parent.getWorldMatrix().clone();
  9398. invertParentWorldMatrix.invert();
  9399. var worldPosition = new BABYLON.Vector3(absolutePositionX, absolutePositionY, absolutePositionZ);
  9400. this.position = BABYLON.Vector3.TransformCoordinates(worldPosition, invertParentWorldMatrix);
  9401. }
  9402. else {
  9403. this.position.x = absolutePositionX;
  9404. this.position.y = absolutePositionY;
  9405. this.position.z = absolutePositionZ;
  9406. }
  9407. };
  9408. // ================================== Point of View Movement =================================
  9409. /**
  9410. * Perform relative position change from the point of view of behind the front of the mesh.
  9411. * This is performed taking into account the meshes current rotation, so you do not have to care.
  9412. * Supports definition of mesh facing forward or backward.
  9413. * @param {number} amountRight
  9414. * @param {number} amountUp
  9415. * @param {number} amountForward
  9416. */
  9417. AbstractMesh.prototype.movePOV = function (amountRight, amountUp, amountForward) {
  9418. this.position.addInPlace(this.calcMovePOV(amountRight, amountUp, amountForward));
  9419. };
  9420. /**
  9421. * Calculate relative position change from the point of view of behind the front of the mesh.
  9422. * This is performed taking into account the meshes current rotation, so you do not have to care.
  9423. * Supports definition of mesh facing forward or backward.
  9424. * @param {number} amountRight
  9425. * @param {number} amountUp
  9426. * @param {number} amountForward
  9427. */
  9428. AbstractMesh.prototype.calcMovePOV = function (amountRight, amountUp, amountForward) {
  9429. var rotMatrix = new BABYLON.Matrix();
  9430. var rotQuaternion = (this.rotationQuaternion) ? this.rotationQuaternion : BABYLON.Quaternion.RotationYawPitchRoll(this.rotation.y, this.rotation.x, this.rotation.z);
  9431. rotQuaternion.toRotationMatrix(rotMatrix);
  9432. var translationDelta = BABYLON.Vector3.Zero();
  9433. var defForwardMult = this.definedFacingForward ? -1 : 1;
  9434. BABYLON.Vector3.TransformCoordinatesFromFloatsToRef(amountRight * defForwardMult, amountUp, amountForward * defForwardMult, rotMatrix, translationDelta);
  9435. return translationDelta;
  9436. };
  9437. // ================================== Point of View Rotation =================================
  9438. /**
  9439. * Perform relative rotation change from the point of view of behind the front of the mesh.
  9440. * Supports definition of mesh facing forward or backward.
  9441. * @param {number} flipBack
  9442. * @param {number} twirlClockwise
  9443. * @param {number} tiltRight
  9444. */
  9445. AbstractMesh.prototype.rotatePOV = function (flipBack, twirlClockwise, tiltRight) {
  9446. this.rotation.addInPlace(this.calcRotatePOV(flipBack, twirlClockwise, tiltRight));
  9447. };
  9448. /**
  9449. * Calculate relative rotation change from the point of view of behind the front of the mesh.
  9450. * Supports definition of mesh facing forward or backward.
  9451. * @param {number} flipBack
  9452. * @param {number} twirlClockwise
  9453. * @param {number} tiltRight
  9454. */
  9455. AbstractMesh.prototype.calcRotatePOV = function (flipBack, twirlClockwise, tiltRight) {
  9456. var defForwardMult = this.definedFacingForward ? 1 : -1;
  9457. return new BABYLON.Vector3(flipBack * defForwardMult, twirlClockwise, tiltRight * defForwardMult);
  9458. };
  9459. AbstractMesh.prototype.setPivotMatrix = function (matrix) {
  9460. this._pivotMatrix = matrix;
  9461. this._cache.pivotMatrixUpdated = true;
  9462. };
  9463. AbstractMesh.prototype.getPivotMatrix = function () {
  9464. return this._pivotMatrix;
  9465. };
  9466. AbstractMesh.prototype._isSynchronized = function () {
  9467. if (this._isDirty) {
  9468. return false;
  9469. }
  9470. if (this.billboardMode !== AbstractMesh.BILLBOARDMODE_NONE)
  9471. return false;
  9472. if (this._cache.pivotMatrixUpdated) {
  9473. return false;
  9474. }
  9475. if (this.infiniteDistance) {
  9476. return false;
  9477. }
  9478. if (!this._cache.position.equals(this.position))
  9479. return false;
  9480. if (this.rotationQuaternion) {
  9481. if (!this._cache.rotationQuaternion.equals(this.rotationQuaternion))
  9482. return false;
  9483. }
  9484. else {
  9485. if (!this._cache.rotation.equals(this.rotation))
  9486. return false;
  9487. }
  9488. if (!this._cache.scaling.equals(this.scaling))
  9489. return false;
  9490. return true;
  9491. };
  9492. AbstractMesh.prototype._initCache = function () {
  9493. _super.prototype._initCache.call(this);
  9494. this._cache.localMatrixUpdated = false;
  9495. this._cache.position = BABYLON.Vector3.Zero();
  9496. this._cache.scaling = BABYLON.Vector3.Zero();
  9497. this._cache.rotation = BABYLON.Vector3.Zero();
  9498. this._cache.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 0);
  9499. };
  9500. AbstractMesh.prototype.markAsDirty = function (property) {
  9501. if (property === "rotation") {
  9502. this.rotationQuaternion = null;
  9503. }
  9504. this._currentRenderId = Number.MAX_VALUE;
  9505. this._isDirty = true;
  9506. };
  9507. AbstractMesh.prototype._updateBoundingInfo = function () {
  9508. this._boundingInfo = this._boundingInfo || new BABYLON.BoundingInfo(this.absolutePosition, this.absolutePosition);
  9509. this._boundingInfo._update(this.worldMatrixFromCache);
  9510. this._updateSubMeshesBoundingInfo(this.worldMatrixFromCache);
  9511. };
  9512. AbstractMesh.prototype._updateSubMeshesBoundingInfo = function (matrix) {
  9513. if (!this.subMeshes) {
  9514. return;
  9515. }
  9516. for (var subIndex = 0; subIndex < this.subMeshes.length; subIndex++) {
  9517. var subMesh = this.subMeshes[subIndex];
  9518. subMesh.updateBoundingInfo(matrix);
  9519. }
  9520. };
  9521. AbstractMesh.prototype.computeWorldMatrix = function (force) {
  9522. if (!force && (this._currentRenderId == this.getScene().getRenderId() || this.isSynchronized(true))) {
  9523. return this._worldMatrix;
  9524. }
  9525. this._cache.position.copyFrom(this.position);
  9526. this._cache.scaling.copyFrom(this.scaling);
  9527. this._cache.pivotMatrixUpdated = false;
  9528. this._currentRenderId = this.getScene().getRenderId();
  9529. this._isDirty = false;
  9530. // Scaling
  9531. BABYLON.Matrix.ScalingToRef(this.scaling.x, this.scaling.y, this.scaling.z, this._localScaling);
  9532. // Rotation
  9533. if (this.rotationQuaternion) {
  9534. this.rotationQuaternion.toRotationMatrix(this._localRotation);
  9535. this._cache.rotationQuaternion.copyFrom(this.rotationQuaternion);
  9536. }
  9537. else {
  9538. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._localRotation);
  9539. this._cache.rotation.copyFrom(this.rotation);
  9540. }
  9541. // Translation
  9542. if (this.infiniteDistance && !this.parent) {
  9543. var camera = this.getScene().activeCamera;
  9544. var cameraWorldMatrix = camera.getWorldMatrix();
  9545. var cameraGlobalPosition = new BABYLON.Vector3(cameraWorldMatrix.m[12], cameraWorldMatrix.m[13], cameraWorldMatrix.m[14]);
  9546. BABYLON.Matrix.TranslationToRef(this.position.x + cameraGlobalPosition.x, this.position.y + cameraGlobalPosition.y, this.position.z + cameraGlobalPosition.z, this._localTranslation);
  9547. }
  9548. else {
  9549. BABYLON.Matrix.TranslationToRef(this.position.x, this.position.y, this.position.z, this._localTranslation);
  9550. }
  9551. // Composing transformations
  9552. this._pivotMatrix.multiplyToRef(this._localScaling, this._localPivotScaling);
  9553. this._localPivotScaling.multiplyToRef(this._localRotation, this._localPivotScalingRotation);
  9554. // Billboarding
  9555. if (this.billboardMode !== AbstractMesh.BILLBOARDMODE_NONE && this.getScene().activeCamera) {
  9556. var localPosition = this.position.clone();
  9557. var zero = this.getScene().activeCamera.position.clone();
  9558. if (this.parent && this.parent.position) {
  9559. localPosition.addInPlace(this.parent.position);
  9560. BABYLON.Matrix.TranslationToRef(localPosition.x, localPosition.y, localPosition.z, this._localTranslation);
  9561. }
  9562. if ((this.billboardMode & AbstractMesh.BILLBOARDMODE_ALL) === AbstractMesh.BILLBOARDMODE_ALL) {
  9563. zero = this.getScene().activeCamera.position;
  9564. }
  9565. else {
  9566. if (this.billboardMode & BABYLON.AbstractMesh.BILLBOARDMODE_X)
  9567. zero.x = localPosition.x + BABYLON.Engine.Epsilon;
  9568. if (this.billboardMode & BABYLON.AbstractMesh.BILLBOARDMODE_Y)
  9569. zero.y = localPosition.y + 0.001;
  9570. if (this.billboardMode & BABYLON.AbstractMesh.BILLBOARDMODE_Z)
  9571. zero.z = localPosition.z + 0.001;
  9572. }
  9573. BABYLON.Matrix.LookAtLHToRef(localPosition, zero, BABYLON.Vector3.Up(), this._localBillboard);
  9574. this._localBillboard.m[12] = this._localBillboard.m[13] = this._localBillboard.m[14] = 0;
  9575. this._localBillboard.invert();
  9576. this._localPivotScalingRotation.multiplyToRef(this._localBillboard, this._localWorld);
  9577. this._rotateYByPI.multiplyToRef(this._localWorld, this._localPivotScalingRotation);
  9578. }
  9579. // Local world
  9580. this._localPivotScalingRotation.multiplyToRef(this._localTranslation, this._localWorld);
  9581. // Parent
  9582. if (this.parent && this.parent.getWorldMatrix && this.billboardMode === BABYLON.AbstractMesh.BILLBOARDMODE_NONE) {
  9583. this._localWorld.multiplyToRef(this.parent.getWorldMatrix(), this._worldMatrix);
  9584. }
  9585. else {
  9586. this._worldMatrix.copyFrom(this._localWorld);
  9587. }
  9588. // Bounding info
  9589. this._updateBoundingInfo();
  9590. // Absolute position
  9591. this._absolutePosition.copyFromFloats(this._worldMatrix.m[12], this._worldMatrix.m[13], this._worldMatrix.m[14]);
  9592. for (var callbackIndex = 0; callbackIndex < this._onAfterWorldMatrixUpdate.length; callbackIndex++) {
  9593. this._onAfterWorldMatrixUpdate[callbackIndex](this);
  9594. }
  9595. return this._worldMatrix;
  9596. };
  9597. /**
  9598. * If you'd like to be callbacked after the mesh position, rotation or scaling has been updated
  9599. * @param func: callback function to add
  9600. */
  9601. AbstractMesh.prototype.registerAfterWorldMatrixUpdate = function (func) {
  9602. this._onAfterWorldMatrixUpdate.push(func);
  9603. };
  9604. AbstractMesh.prototype.unregisterAfterWorldMatrixUpdate = function (func) {
  9605. var index = this._onAfterWorldMatrixUpdate.indexOf(func);
  9606. if (index > -1) {
  9607. this._onAfterWorldMatrixUpdate.splice(index, 1);
  9608. }
  9609. };
  9610. AbstractMesh.prototype.setPositionWithLocalVector = function (vector3) {
  9611. this.computeWorldMatrix();
  9612. this.position = BABYLON.Vector3.TransformNormal(vector3, this._localWorld);
  9613. };
  9614. AbstractMesh.prototype.getPositionExpressedInLocalSpace = function () {
  9615. this.computeWorldMatrix();
  9616. var invLocalWorldMatrix = this._localWorld.clone();
  9617. invLocalWorldMatrix.invert();
  9618. return BABYLON.Vector3.TransformNormal(this.position, invLocalWorldMatrix);
  9619. };
  9620. AbstractMesh.prototype.locallyTranslate = function (vector3) {
  9621. this.computeWorldMatrix();
  9622. this.position = BABYLON.Vector3.TransformCoordinates(vector3, this._localWorld);
  9623. };
  9624. AbstractMesh.prototype.lookAt = function (targetPoint, yawCor, pitchCor, rollCor) {
  9625. /// <summary>Orients a mesh towards a target point. Mesh must be drawn facing user.</summary>
  9626. /// <param name="targetPoint" type="BABYLON.Vector3">The position (must be in same space as current mesh) to look at</param>
  9627. /// <param name="yawCor" type="Number">optional yaw (y-axis) correction in radians</param>
  9628. /// <param name="pitchCor" type="Number">optional pitch (x-axis) correction in radians</param>
  9629. /// <param name="rollCor" type="Number">optional roll (z-axis) correction in radians</param>
  9630. /// <returns>Mesh oriented towards targetMesh</returns>
  9631. yawCor = yawCor || 0; // default to zero if undefined
  9632. pitchCor = pitchCor || 0;
  9633. rollCor = rollCor || 0;
  9634. var dv = targetPoint.subtract(this.position);
  9635. var yaw = -Math.atan2(dv.z, dv.x) - Math.PI / 2;
  9636. var len = Math.sqrt(dv.x * dv.x + dv.z * dv.z);
  9637. var pitch = Math.atan2(dv.y, len);
  9638. this.rotationQuaternion = BABYLON.Quaternion.RotationYawPitchRoll(yaw + yawCor, pitch + pitchCor, rollCor);
  9639. };
  9640. AbstractMesh.prototype.isInFrustum = function (frustumPlanes) {
  9641. if (!this._boundingInfo.isInFrustum(frustumPlanes)) {
  9642. return false;
  9643. }
  9644. return true;
  9645. };
  9646. AbstractMesh.prototype.isCompletelyInFrustum = function (camera) {
  9647. if (!camera) {
  9648. camera = this.getScene().activeCamera;
  9649. }
  9650. var transformMatrix = camera.getViewMatrix().multiply(camera.getProjectionMatrix());
  9651. if (!this._boundingInfo.isCompletelyInFrustum(BABYLON.Frustum.GetPlanes(transformMatrix))) {
  9652. return false;
  9653. }
  9654. return true;
  9655. };
  9656. AbstractMesh.prototype.intersectsMesh = function (mesh, precise) {
  9657. if (!this._boundingInfo || !mesh._boundingInfo) {
  9658. return false;
  9659. }
  9660. return this._boundingInfo.intersects(mesh._boundingInfo, precise);
  9661. };
  9662. AbstractMesh.prototype.intersectsPoint = function (point) {
  9663. if (!this._boundingInfo) {
  9664. return false;
  9665. }
  9666. return this._boundingInfo.intersectsPoint(point);
  9667. };
  9668. // Physics
  9669. AbstractMesh.prototype.setPhysicsState = function (impostor, options) {
  9670. var physicsEngine = this.getScene().getPhysicsEngine();
  9671. if (!physicsEngine) {
  9672. return;
  9673. }
  9674. if (impostor.impostor) {
  9675. // Old API
  9676. options = impostor;
  9677. impostor = impostor.impostor;
  9678. }
  9679. impostor = impostor || BABYLON.PhysicsEngine.NoImpostor;
  9680. if (impostor === BABYLON.PhysicsEngine.NoImpostor) {
  9681. physicsEngine._unregisterMesh(this);
  9682. return;
  9683. }
  9684. options.mass = options.mass || 0;
  9685. options.friction = options.friction || 0.2;
  9686. options.restitution = options.restitution || 0.2;
  9687. this._physicImpostor = impostor;
  9688. this._physicsMass = options.mass;
  9689. this._physicsFriction = options.friction;
  9690. this._physicRestitution = options.restitution;
  9691. return physicsEngine._registerMesh(this, impostor, options);
  9692. };
  9693. AbstractMesh.prototype.getPhysicsImpostor = function () {
  9694. if (!this._physicImpostor) {
  9695. return BABYLON.PhysicsEngine.NoImpostor;
  9696. }
  9697. return this._physicImpostor;
  9698. };
  9699. AbstractMesh.prototype.getPhysicsMass = function () {
  9700. if (!this._physicsMass) {
  9701. return 0;
  9702. }
  9703. return this._physicsMass;
  9704. };
  9705. AbstractMesh.prototype.getPhysicsFriction = function () {
  9706. if (!this._physicsFriction) {
  9707. return 0;
  9708. }
  9709. return this._physicsFriction;
  9710. };
  9711. AbstractMesh.prototype.getPhysicsRestitution = function () {
  9712. if (!this._physicRestitution) {
  9713. return 0;
  9714. }
  9715. return this._physicRestitution;
  9716. };
  9717. AbstractMesh.prototype.getPositionInCameraSpace = function (camera) {
  9718. if (!camera) {
  9719. camera = this.getScene().activeCamera;
  9720. }
  9721. return BABYLON.Vector3.TransformCoordinates(this.absolutePosition, camera.getViewMatrix());
  9722. };
  9723. AbstractMesh.prototype.getDistanceToCamera = function (camera) {
  9724. if (!camera) {
  9725. camera = this.getScene().activeCamera;
  9726. }
  9727. return this.absolutePosition.subtract(camera.position).length();
  9728. };
  9729. AbstractMesh.prototype.applyImpulse = function (force, contactPoint) {
  9730. if (!this._physicImpostor) {
  9731. return;
  9732. }
  9733. this.getScene().getPhysicsEngine()._applyImpulse(this, force, contactPoint);
  9734. };
  9735. AbstractMesh.prototype.setPhysicsLinkWith = function (otherMesh, pivot1, pivot2, options) {
  9736. if (!this._physicImpostor) {
  9737. return;
  9738. }
  9739. this.getScene().getPhysicsEngine()._createLink(this, otherMesh, pivot1, pivot2, options);
  9740. };
  9741. AbstractMesh.prototype.updatePhysicsBodyPosition = function () {
  9742. if (!this._physicImpostor) {
  9743. return;
  9744. }
  9745. this.getScene().getPhysicsEngine()._updateBodyPosition(this);
  9746. };
  9747. // Collisions
  9748. AbstractMesh.prototype.moveWithCollisions = function (velocity) {
  9749. var globalPosition = this.getAbsolutePosition();
  9750. globalPosition.subtractFromFloatsToRef(0, this.ellipsoid.y, 0, this._oldPositionForCollisions);
  9751. this._oldPositionForCollisions.addInPlace(this.ellipsoidOffset);
  9752. this._collider.radius = this.ellipsoid;
  9753. this.getScene()._getNewPosition(this._oldPositionForCollisions, velocity, this._collider, 3, this._newPositionForCollisions, this);
  9754. this._newPositionForCollisions.subtractToRef(this._oldPositionForCollisions, this._diffPositionForCollisions);
  9755. if (this._diffPositionForCollisions.length() > BABYLON.Engine.CollisionsEpsilon) {
  9756. this.position.addInPlace(this._diffPositionForCollisions);
  9757. }
  9758. };
  9759. // Submeshes octree
  9760. /**
  9761. * This function will create an octree to help select the right submeshes for rendering, picking and collisions
  9762. * Please note that you must have a decent number of submeshes to get performance improvements when using octree
  9763. */
  9764. AbstractMesh.prototype.createOrUpdateSubmeshesOctree = function (maxCapacity, maxDepth) {
  9765. if (maxCapacity === void 0) { maxCapacity = 64; }
  9766. if (maxDepth === void 0) { maxDepth = 2; }
  9767. if (!this._submeshesOctree) {
  9768. this._submeshesOctree = new BABYLON.Octree(BABYLON.Octree.CreationFuncForSubMeshes, maxCapacity, maxDepth);
  9769. }
  9770. this.computeWorldMatrix(true);
  9771. // Update octree
  9772. var bbox = this.getBoundingInfo().boundingBox;
  9773. this._submeshesOctree.update(bbox.minimumWorld, bbox.maximumWorld, this.subMeshes);
  9774. return this._submeshesOctree;
  9775. };
  9776. // Collisions
  9777. AbstractMesh.prototype._collideForSubMesh = function (subMesh, transformMatrix, collider) {
  9778. this._generatePointsArray();
  9779. // Transformation
  9780. if (!subMesh._lastColliderWorldVertices || !subMesh._lastColliderTransformMatrix.equals(transformMatrix)) {
  9781. subMesh._lastColliderTransformMatrix = transformMatrix.clone();
  9782. subMesh._lastColliderWorldVertices = [];
  9783. subMesh._trianglePlanes = [];
  9784. var start = subMesh.verticesStart;
  9785. var end = (subMesh.verticesStart + subMesh.verticesCount);
  9786. for (var i = start; i < end; i++) {
  9787. subMesh._lastColliderWorldVertices.push(BABYLON.Vector3.TransformCoordinates(this._positions[i], transformMatrix));
  9788. }
  9789. }
  9790. // Collide
  9791. collider._collide(subMesh, subMesh._lastColliderWorldVertices, this.getIndices(), subMesh.indexStart, subMesh.indexStart + subMesh.indexCount, subMesh.verticesStart);
  9792. };
  9793. AbstractMesh.prototype._processCollisionsForSubMeshes = function (collider, transformMatrix) {
  9794. var subMeshes;
  9795. var len;
  9796. // Octrees
  9797. if (this._submeshesOctree && this.useOctreeForCollisions) {
  9798. var radius = collider.velocityWorldLength + Math.max(collider.radius.x, collider.radius.y, collider.radius.z);
  9799. var intersections = this._submeshesOctree.intersects(collider.basePointWorld, radius);
  9800. len = intersections.length;
  9801. subMeshes = intersections.data;
  9802. }
  9803. else {
  9804. subMeshes = this.subMeshes;
  9805. len = subMeshes.length;
  9806. }
  9807. for (var index = 0; index < len; index++) {
  9808. var subMesh = subMeshes[index];
  9809. // Bounding test
  9810. if (len > 1 && !subMesh._checkCollision(collider))
  9811. continue;
  9812. this._collideForSubMesh(subMesh, transformMatrix, collider);
  9813. }
  9814. };
  9815. AbstractMesh.prototype._checkCollision = function (collider) {
  9816. // Bounding box test
  9817. if (!this._boundingInfo._checkCollision(collider))
  9818. return;
  9819. // Transformation matrix
  9820. BABYLON.Matrix.ScalingToRef(1.0 / collider.radius.x, 1.0 / collider.radius.y, 1.0 / collider.radius.z, this._collisionsScalingMatrix);
  9821. this.worldMatrixFromCache.multiplyToRef(this._collisionsScalingMatrix, this._collisionsTransformMatrix);
  9822. this._processCollisionsForSubMeshes(collider, this._collisionsTransformMatrix);
  9823. };
  9824. // Picking
  9825. AbstractMesh.prototype._generatePointsArray = function () {
  9826. return false;
  9827. };
  9828. AbstractMesh.prototype.intersects = function (ray, fastCheck) {
  9829. var pickingInfo = new BABYLON.PickingInfo();
  9830. if (!this.subMeshes || !this._boundingInfo || !ray.intersectsSphere(this._boundingInfo.boundingSphere) || !ray.intersectsBox(this._boundingInfo.boundingBox)) {
  9831. return pickingInfo;
  9832. }
  9833. if (!this._generatePointsArray()) {
  9834. return pickingInfo;
  9835. }
  9836. var intersectInfo = null;
  9837. // Octrees
  9838. var subMeshes;
  9839. var len;
  9840. if (this._submeshesOctree && this.useOctreeForPicking) {
  9841. var worldRay = BABYLON.Ray.Transform(ray, this.getWorldMatrix());
  9842. var intersections = this._submeshesOctree.intersectsRay(worldRay);
  9843. len = intersections.length;
  9844. subMeshes = intersections.data;
  9845. }
  9846. else {
  9847. subMeshes = this.subMeshes;
  9848. len = subMeshes.length;
  9849. }
  9850. for (var index = 0; index < len; index++) {
  9851. var subMesh = subMeshes[index];
  9852. // Bounding test
  9853. if (len > 1 && !subMesh.canIntersects(ray))
  9854. continue;
  9855. var currentIntersectInfo = subMesh.intersects(ray, this._positions, this.getIndices(), fastCheck);
  9856. if (currentIntersectInfo) {
  9857. if (fastCheck || !intersectInfo || currentIntersectInfo.distance < intersectInfo.distance) {
  9858. intersectInfo = currentIntersectInfo;
  9859. if (fastCheck) {
  9860. break;
  9861. }
  9862. }
  9863. }
  9864. }
  9865. if (intersectInfo) {
  9866. // Get picked point
  9867. var world = this.getWorldMatrix();
  9868. var worldOrigin = BABYLON.Vector3.TransformCoordinates(ray.origin, world);
  9869. var direction = ray.direction.clone();
  9870. direction = direction.scale(intersectInfo.distance);
  9871. var worldDirection = BABYLON.Vector3.TransformNormal(direction, world);
  9872. var pickedPoint = worldOrigin.add(worldDirection);
  9873. // Return result
  9874. pickingInfo.hit = true;
  9875. pickingInfo.distance = BABYLON.Vector3.Distance(worldOrigin, pickedPoint);
  9876. pickingInfo.pickedPoint = pickedPoint;
  9877. pickingInfo.pickedMesh = this;
  9878. pickingInfo.bu = intersectInfo.bu;
  9879. pickingInfo.bv = intersectInfo.bv;
  9880. pickingInfo.faceId = intersectInfo.faceId;
  9881. return pickingInfo;
  9882. }
  9883. return pickingInfo;
  9884. };
  9885. AbstractMesh.prototype.clone = function (name, newParent, doNotCloneChildren) {
  9886. return null;
  9887. };
  9888. AbstractMesh.prototype.releaseSubMeshes = function () {
  9889. if (this.subMeshes) {
  9890. while (this.subMeshes.length) {
  9891. this.subMeshes[0].dispose();
  9892. }
  9893. }
  9894. else {
  9895. this.subMeshes = new Array();
  9896. }
  9897. };
  9898. AbstractMesh.prototype.dispose = function (doNotRecurse) {
  9899. // Physics
  9900. if (this.getPhysicsImpostor() != BABYLON.PhysicsEngine.NoImpostor) {
  9901. this.setPhysicsState(BABYLON.PhysicsEngine.NoImpostor);
  9902. }
  9903. for (index = 0; index < this._intersectionsInProgress.length; index++) {
  9904. var other = this._intersectionsInProgress[index];
  9905. var pos = other._intersectionsInProgress.indexOf(this);
  9906. other._intersectionsInProgress.splice(pos, 1);
  9907. }
  9908. this._intersectionsInProgress = [];
  9909. // SubMeshes
  9910. this.releaseSubMeshes();
  9911. // Remove from scene
  9912. var index = this.getScene().meshes.indexOf(this);
  9913. if (index != -1) {
  9914. // Remove from the scene if mesh found
  9915. this.getScene().meshes.splice(index, 1);
  9916. }
  9917. if (!doNotRecurse) {
  9918. for (index = 0; index < this.getScene().particleSystems.length; index++) {
  9919. if (this.getScene().particleSystems[index].emitter == this) {
  9920. this.getScene().particleSystems[index].dispose();
  9921. index--;
  9922. }
  9923. }
  9924. // Children
  9925. var objects = this.getScene().meshes.slice(0);
  9926. for (index = 0; index < objects.length; index++) {
  9927. if (objects[index].parent == this) {
  9928. objects[index].dispose();
  9929. }
  9930. }
  9931. }
  9932. else {
  9933. for (index = 0; index < this.getScene().meshes.length; index++) {
  9934. var obj = this.getScene().meshes[index];
  9935. if (obj.parent === this) {
  9936. obj.parent = null;
  9937. obj.computeWorldMatrix(true);
  9938. }
  9939. }
  9940. }
  9941. this._onAfterWorldMatrixUpdate = [];
  9942. this._isDisposed = true;
  9943. // Callback
  9944. if (this.onDispose) {
  9945. this.onDispose();
  9946. }
  9947. };
  9948. // Statics
  9949. AbstractMesh._BILLBOARDMODE_NONE = 0;
  9950. AbstractMesh._BILLBOARDMODE_X = 1;
  9951. AbstractMesh._BILLBOARDMODE_Y = 2;
  9952. AbstractMesh._BILLBOARDMODE_Z = 4;
  9953. AbstractMesh._BILLBOARDMODE_ALL = 7;
  9954. return AbstractMesh;
  9955. })(BABYLON.Node);
  9956. BABYLON.AbstractMesh = AbstractMesh;
  9957. })(BABYLON || (BABYLON = {}));
  9958. //# sourceMappingURL=babylon.abstractMesh.js.map
  9959. var BABYLON;
  9960. (function (BABYLON) {
  9961. var _InstancesBatch = (function () {
  9962. function _InstancesBatch() {
  9963. this.mustReturn = false;
  9964. this.visibleInstances = new Array();
  9965. this.renderSelf = new Array();
  9966. }
  9967. return _InstancesBatch;
  9968. })();
  9969. BABYLON._InstancesBatch = _InstancesBatch;
  9970. var Mesh = (function (_super) {
  9971. __extends(Mesh, _super);
  9972. /**
  9973. * @constructor
  9974. * @param {string} name - The value used by scene.getMeshByName() to do a lookup.
  9975. * @param {Scene} scene - The scene to add this mesh to.
  9976. * @param {Node} parent - The parent of this mesh, if it has one
  9977. * @param {Mesh} source - An optional Mesh from which geometry is shared, cloned.
  9978. * @param {boolean} doNotCloneChildren - When cloning, skip cloning child meshes of source, default False.
  9979. * When false, achieved by calling a clone(), also passing False.
  9980. * This will make creation of children, recursive.
  9981. */
  9982. function Mesh(name, scene, parent, source, doNotCloneChildren) {
  9983. if (parent === void 0) { parent = null; }
  9984. _super.call(this, name, scene);
  9985. // Members
  9986. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NONE;
  9987. this.instances = new Array();
  9988. this._LODLevels = new Array();
  9989. this._onBeforeRenderCallbacks = new Array();
  9990. this._onAfterRenderCallbacks = new Array();
  9991. this._visibleInstances = {};
  9992. this._renderIdForInstances = new Array();
  9993. this._batchCache = new _InstancesBatch();
  9994. this._instancesBufferSize = 32 * 16 * 4; // let's start with a maximum of 32 instances
  9995. if (source) {
  9996. // Geometry
  9997. if (source._geometry) {
  9998. source._geometry.applyToMesh(this);
  9999. }
  10000. // Deep copy
  10001. BABYLON.Tools.DeepCopy(source, this, ["name", "material", "skeleton"], []);
  10002. // Material
  10003. this.material = source.material;
  10004. if (!doNotCloneChildren) {
  10005. for (var index = 0; index < scene.meshes.length; index++) {
  10006. var mesh = scene.meshes[index];
  10007. if (mesh.parent === source) {
  10008. // doNotCloneChildren is always going to be False
  10009. var newChild = mesh.clone(name + "." + mesh.name, this, doNotCloneChildren);
  10010. }
  10011. }
  10012. }
  10013. for (index = 0; index < scene.particleSystems.length; index++) {
  10014. var system = scene.particleSystems[index];
  10015. if (system.emitter === source) {
  10016. system.clone(system.name, this);
  10017. }
  10018. }
  10019. this.computeWorldMatrix(true);
  10020. }
  10021. // Parent
  10022. if (parent !== null) {
  10023. this.parent = parent;
  10024. }
  10025. }
  10026. Object.defineProperty(Mesh.prototype, "hasLODLevels", {
  10027. // Methods
  10028. get: function () {
  10029. return this._LODLevels.length > 0;
  10030. },
  10031. enumerable: true,
  10032. configurable: true
  10033. });
  10034. Mesh.prototype._sortLODLevels = function () {
  10035. this._LODLevels.sort(function (a, b) {
  10036. if (a.distance < b.distance) {
  10037. return 1;
  10038. }
  10039. if (a.distance > b.distance) {
  10040. return -1;
  10041. }
  10042. return 0;
  10043. });
  10044. };
  10045. /**
  10046. * Add a mesh as LOD level triggered at the given distance.
  10047. * @param {number} distance - the distance from the center of the object to show this level
  10048. * @param {BABYLON.Mesh} mesh - the mesh to be added as LOD level
  10049. * @return {BABYLON.Mesh} this mesh (for chaining)
  10050. */
  10051. Mesh.prototype.addLODLevel = function (distance, mesh) {
  10052. if (mesh && mesh._masterMesh) {
  10053. BABYLON.Tools.Warn("You cannot use a mesh as LOD level twice");
  10054. return this;
  10055. }
  10056. var level = new BABYLON.Internals.MeshLODLevel(distance, mesh);
  10057. this._LODLevels.push(level);
  10058. if (mesh) {
  10059. mesh._masterMesh = this;
  10060. }
  10061. this._sortLODLevels();
  10062. return this;
  10063. };
  10064. /**
  10065. * Remove a mesh from the LOD array
  10066. * @param {BABYLON.Mesh} mesh - the mesh to be removed.
  10067. * @return {BABYLON.Mesh} this mesh (for chaining)
  10068. */
  10069. Mesh.prototype.removeLODLevel = function (mesh) {
  10070. for (var index = 0; index < this._LODLevels.length; index++) {
  10071. if (this._LODLevels[index].mesh === mesh) {
  10072. this._LODLevels.splice(index, 1);
  10073. if (mesh) {
  10074. mesh._masterMesh = null;
  10075. }
  10076. }
  10077. }
  10078. this._sortLODLevels();
  10079. return this;
  10080. };
  10081. Mesh.prototype.getLOD = function (camera, boundingSphere) {
  10082. if (!this._LODLevels || this._LODLevels.length === 0) {
  10083. return this;
  10084. }
  10085. var distanceToCamera = (boundingSphere ? boundingSphere : this.getBoundingInfo().boundingSphere).centerWorld.subtract(camera.position).length();
  10086. if (this._LODLevels[this._LODLevels.length - 1].distance > distanceToCamera) {
  10087. return this;
  10088. }
  10089. for (var index = 0; index < this._LODLevels.length; index++) {
  10090. var level = this._LODLevels[index];
  10091. if (level.distance < distanceToCamera) {
  10092. if (level.mesh) {
  10093. level.mesh._preActivate();
  10094. level.mesh._updateSubMeshesBoundingInfo(this.worldMatrixFromCache);
  10095. }
  10096. return level.mesh;
  10097. }
  10098. }
  10099. return this;
  10100. };
  10101. Object.defineProperty(Mesh.prototype, "geometry", {
  10102. get: function () {
  10103. return this._geometry;
  10104. },
  10105. enumerable: true,
  10106. configurable: true
  10107. });
  10108. Mesh.prototype.getTotalVertices = function () {
  10109. if (!this._geometry) {
  10110. return 0;
  10111. }
  10112. return this._geometry.getTotalVertices();
  10113. };
  10114. Mesh.prototype.getVerticesData = function (kind) {
  10115. if (!this._geometry) {
  10116. return null;
  10117. }
  10118. return this._geometry.getVerticesData(kind);
  10119. };
  10120. Mesh.prototype.getVertexBuffer = function (kind) {
  10121. if (!this._geometry) {
  10122. return undefined;
  10123. }
  10124. return this._geometry.getVertexBuffer(kind);
  10125. };
  10126. Mesh.prototype.isVerticesDataPresent = function (kind) {
  10127. if (!this._geometry) {
  10128. if (this._delayInfo) {
  10129. return this._delayInfo.indexOf(kind) !== -1;
  10130. }
  10131. return false;
  10132. }
  10133. return this._geometry.isVerticesDataPresent(kind);
  10134. };
  10135. Mesh.prototype.getVerticesDataKinds = function () {
  10136. if (!this._geometry) {
  10137. var result = [];
  10138. if (this._delayInfo) {
  10139. for (var kind in this._delayInfo) {
  10140. result.push(kind);
  10141. }
  10142. }
  10143. return result;
  10144. }
  10145. return this._geometry.getVerticesDataKinds();
  10146. };
  10147. Mesh.prototype.getTotalIndices = function () {
  10148. if (!this._geometry) {
  10149. return 0;
  10150. }
  10151. return this._geometry.getTotalIndices();
  10152. };
  10153. Mesh.prototype.getIndices = function () {
  10154. if (!this._geometry) {
  10155. return [];
  10156. }
  10157. return this._geometry.getIndices();
  10158. };
  10159. Object.defineProperty(Mesh.prototype, "isBlocked", {
  10160. get: function () {
  10161. return this._masterMesh !== null && this._masterMesh !== undefined;
  10162. },
  10163. enumerable: true,
  10164. configurable: true
  10165. });
  10166. Mesh.prototype.isReady = function () {
  10167. if (this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADING) {
  10168. return false;
  10169. }
  10170. return _super.prototype.isReady.call(this);
  10171. };
  10172. Mesh.prototype.isDisposed = function () {
  10173. return this._isDisposed;
  10174. };
  10175. // Methods
  10176. Mesh.prototype._preActivate = function () {
  10177. var sceneRenderId = this.getScene().getRenderId();
  10178. if (this._preActivateId == sceneRenderId) {
  10179. return;
  10180. }
  10181. this._preActivateId = sceneRenderId;
  10182. this._visibleInstances = null;
  10183. };
  10184. Mesh.prototype._registerInstanceForRenderId = function (instance, renderId) {
  10185. if (!this._visibleInstances) {
  10186. this._visibleInstances = {};
  10187. this._visibleInstances.defaultRenderId = renderId;
  10188. this._visibleInstances.selfDefaultRenderId = this._renderId;
  10189. }
  10190. if (!this._visibleInstances[renderId]) {
  10191. this._visibleInstances[renderId] = new Array();
  10192. }
  10193. this._visibleInstances[renderId].push(instance);
  10194. };
  10195. Mesh.prototype.refreshBoundingInfo = function () {
  10196. var data = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  10197. if (data) {
  10198. var extend = BABYLON.Tools.ExtractMinAndMax(data, 0, this.getTotalVertices());
  10199. this._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  10200. }
  10201. if (this.subMeshes) {
  10202. for (var index = 0; index < this.subMeshes.length; index++) {
  10203. this.subMeshes[index].refreshBoundingInfo();
  10204. }
  10205. }
  10206. this._updateBoundingInfo();
  10207. };
  10208. Mesh.prototype._createGlobalSubMesh = function () {
  10209. var totalVertices = this.getTotalVertices();
  10210. if (!totalVertices || !this.getIndices()) {
  10211. return null;
  10212. }
  10213. this.releaseSubMeshes();
  10214. return new BABYLON.SubMesh(0, 0, totalVertices, 0, this.getTotalIndices(), this);
  10215. };
  10216. Mesh.prototype.subdivide = function (count) {
  10217. if (count < 1) {
  10218. return;
  10219. }
  10220. var totalIndices = this.getTotalIndices();
  10221. var subdivisionSize = (totalIndices / count) | 0;
  10222. var offset = 0;
  10223. while (subdivisionSize % 3 != 0) {
  10224. subdivisionSize++;
  10225. }
  10226. this.releaseSubMeshes();
  10227. for (var index = 0; index < count; index++) {
  10228. if (offset >= totalIndices) {
  10229. break;
  10230. }
  10231. BABYLON.SubMesh.CreateFromIndices(0, offset, Math.min(subdivisionSize, totalIndices - offset), this);
  10232. offset += subdivisionSize;
  10233. }
  10234. this.synchronizeInstances();
  10235. };
  10236. Mesh.prototype.setVerticesData = function (kind, data, updatable, stride) {
  10237. if (kind instanceof Array) {
  10238. var temp = data;
  10239. data = kind;
  10240. kind = temp;
  10241. BABYLON.Tools.Warn("Deprecated usage of setVerticesData detected (since v1.12). Current signature is setVerticesData(kind, data, updatable).");
  10242. }
  10243. if (!this._geometry) {
  10244. var vertexData = new BABYLON.VertexData();
  10245. vertexData.set(data, kind);
  10246. var scene = this.getScene();
  10247. new BABYLON.Geometry(BABYLON.Geometry.RandomId(), scene, vertexData, updatable, this);
  10248. }
  10249. else {
  10250. this._geometry.setVerticesData(kind, data, updatable, stride);
  10251. }
  10252. };
  10253. Mesh.prototype.updateVerticesData = function (kind, data, updateExtends, makeItUnique) {
  10254. if (!this._geometry) {
  10255. return;
  10256. }
  10257. if (!makeItUnique) {
  10258. this._geometry.updateVerticesData(kind, data, updateExtends);
  10259. }
  10260. else {
  10261. this.makeGeometryUnique();
  10262. this.updateVerticesData(kind, data, updateExtends, false);
  10263. }
  10264. };
  10265. Mesh.prototype.updateVerticesDataDirectly = function (kind, data, offset, makeItUnique) {
  10266. if (!this._geometry) {
  10267. return;
  10268. }
  10269. if (!makeItUnique) {
  10270. this._geometry.updateVerticesDataDirectly(kind, data, offset);
  10271. }
  10272. else {
  10273. this.makeGeometryUnique();
  10274. this.updateVerticesDataDirectly(kind, data, offset, false);
  10275. }
  10276. };
  10277. Mesh.prototype.makeGeometryUnique = function () {
  10278. if (!this._geometry) {
  10279. return;
  10280. }
  10281. var geometry = this._geometry.copy(BABYLON.Geometry.RandomId());
  10282. geometry.applyToMesh(this);
  10283. };
  10284. Mesh.prototype.setIndices = function (indices, totalVertices) {
  10285. if (!this._geometry) {
  10286. var vertexData = new BABYLON.VertexData();
  10287. vertexData.indices = indices;
  10288. var scene = this.getScene();
  10289. new BABYLON.Geometry(BABYLON.Geometry.RandomId(), scene, vertexData, false, this);
  10290. }
  10291. else {
  10292. this._geometry.setIndices(indices, totalVertices);
  10293. }
  10294. };
  10295. Mesh.prototype._bind = function (subMesh, effect, fillMode) {
  10296. var engine = this.getScene().getEngine();
  10297. // Wireframe
  10298. var indexToBind;
  10299. switch (fillMode) {
  10300. case BABYLON.Material.PointFillMode:
  10301. indexToBind = null;
  10302. break;
  10303. case BABYLON.Material.WireFrameFillMode:
  10304. indexToBind = subMesh.getLinesIndexBuffer(this.getIndices(), engine);
  10305. break;
  10306. default:
  10307. case BABYLON.Material.TriangleFillMode:
  10308. indexToBind = this._geometry.getIndexBuffer();
  10309. break;
  10310. }
  10311. // VBOs
  10312. engine.bindMultiBuffers(this._geometry.getVertexBuffers(), indexToBind, effect);
  10313. };
  10314. Mesh.prototype._draw = function (subMesh, fillMode, instancesCount) {
  10315. if (!this._geometry || !this._geometry.getVertexBuffers() || !this._geometry.getIndexBuffer()) {
  10316. return;
  10317. }
  10318. var engine = this.getScene().getEngine();
  10319. switch (fillMode) {
  10320. case BABYLON.Material.PointFillMode:
  10321. engine.drawPointClouds(subMesh.verticesStart, subMesh.verticesCount, instancesCount);
  10322. break;
  10323. case BABYLON.Material.WireFrameFillMode:
  10324. engine.draw(false, 0, subMesh.linesIndexCount, instancesCount);
  10325. break;
  10326. default:
  10327. engine.draw(true, subMesh.indexStart, subMesh.indexCount, instancesCount);
  10328. }
  10329. };
  10330. Mesh.prototype.registerBeforeRender = function (func) {
  10331. this._onBeforeRenderCallbacks.push(func);
  10332. };
  10333. Mesh.prototype.unregisterBeforeRender = function (func) {
  10334. var index = this._onBeforeRenderCallbacks.indexOf(func);
  10335. if (index > -1) {
  10336. this._onBeforeRenderCallbacks.splice(index, 1);
  10337. }
  10338. };
  10339. Mesh.prototype.registerAfterRender = function (func) {
  10340. this._onAfterRenderCallbacks.push(func);
  10341. };
  10342. Mesh.prototype.unregisterAfterRender = function (func) {
  10343. var index = this._onAfterRenderCallbacks.indexOf(func);
  10344. if (index > -1) {
  10345. this._onAfterRenderCallbacks.splice(index, 1);
  10346. }
  10347. };
  10348. Mesh.prototype._getInstancesRenderList = function (subMeshId) {
  10349. var scene = this.getScene();
  10350. this._batchCache.mustReturn = false;
  10351. this._batchCache.renderSelf[subMeshId] = this.isEnabled() && this.isVisible;
  10352. this._batchCache.visibleInstances[subMeshId] = null;
  10353. if (this._visibleInstances) {
  10354. var currentRenderId = scene.getRenderId();
  10355. this._batchCache.visibleInstances[subMeshId] = this._visibleInstances[currentRenderId];
  10356. var selfRenderId = this._renderId;
  10357. if (!this._batchCache.visibleInstances[subMeshId] && this._visibleInstances.defaultRenderId) {
  10358. this._batchCache.visibleInstances[subMeshId] = this._visibleInstances[this._visibleInstances.defaultRenderId];
  10359. currentRenderId = Math.max(this._visibleInstances.defaultRenderId, currentRenderId);
  10360. selfRenderId = Math.max(this._visibleInstances.selfDefaultRenderId, currentRenderId);
  10361. }
  10362. if (this._batchCache.visibleInstances[subMeshId] && this._batchCache.visibleInstances[subMeshId].length) {
  10363. if (this._renderIdForInstances[subMeshId] === currentRenderId) {
  10364. this._batchCache.mustReturn = true;
  10365. return this._batchCache;
  10366. }
  10367. if (currentRenderId !== selfRenderId) {
  10368. this._batchCache.renderSelf[subMeshId] = false;
  10369. }
  10370. }
  10371. this._renderIdForInstances[subMeshId] = currentRenderId;
  10372. }
  10373. return this._batchCache;
  10374. };
  10375. Mesh.prototype._renderWithInstances = function (subMesh, fillMode, batch, effect, engine) {
  10376. var visibleInstances = batch.visibleInstances[subMesh._id];
  10377. var matricesCount = visibleInstances.length + 1;
  10378. var bufferSize = matricesCount * 16 * 4;
  10379. while (this._instancesBufferSize < bufferSize) {
  10380. this._instancesBufferSize *= 2;
  10381. }
  10382. if (!this._worldMatricesInstancesBuffer || this._worldMatricesInstancesBuffer.capacity < this._instancesBufferSize) {
  10383. if (this._worldMatricesInstancesBuffer) {
  10384. engine.deleteInstancesBuffer(this._worldMatricesInstancesBuffer);
  10385. }
  10386. this._worldMatricesInstancesBuffer = engine.createInstancesBuffer(this._instancesBufferSize);
  10387. this._worldMatricesInstancesArray = new Float32Array(this._instancesBufferSize / 4);
  10388. }
  10389. var offset = 0;
  10390. var instancesCount = 0;
  10391. var world = this.getWorldMatrix();
  10392. if (batch.renderSelf[subMesh._id]) {
  10393. world.copyToArray(this._worldMatricesInstancesArray, offset);
  10394. offset += 16;
  10395. instancesCount++;
  10396. }
  10397. if (visibleInstances) {
  10398. for (var instanceIndex = 0; instanceIndex < visibleInstances.length; instanceIndex++) {
  10399. var instance = visibleInstances[instanceIndex];
  10400. instance.getWorldMatrix().copyToArray(this._worldMatricesInstancesArray, offset);
  10401. offset += 16;
  10402. instancesCount++;
  10403. }
  10404. }
  10405. var offsetLocation0 = effect.getAttributeLocationByName("world0");
  10406. var offsetLocation1 = effect.getAttributeLocationByName("world1");
  10407. var offsetLocation2 = effect.getAttributeLocationByName("world2");
  10408. var offsetLocation3 = effect.getAttributeLocationByName("world3");
  10409. var offsetLocations = [offsetLocation0, offsetLocation1, offsetLocation2, offsetLocation3];
  10410. engine.updateAndBindInstancesBuffer(this._worldMatricesInstancesBuffer, this._worldMatricesInstancesArray, offsetLocations);
  10411. this._draw(subMesh, fillMode, instancesCount);
  10412. engine.unBindInstancesBuffer(this._worldMatricesInstancesBuffer, offsetLocations);
  10413. };
  10414. Mesh.prototype._processRendering = function (subMesh, effect, fillMode, batch, hardwareInstancedRendering, onBeforeDraw) {
  10415. var scene = this.getScene();
  10416. var engine = scene.getEngine();
  10417. if (hardwareInstancedRendering) {
  10418. this._renderWithInstances(subMesh, fillMode, batch, effect, engine);
  10419. }
  10420. else {
  10421. if (batch.renderSelf[subMesh._id]) {
  10422. // Draw
  10423. if (onBeforeDraw) {
  10424. onBeforeDraw(false, this.getWorldMatrix());
  10425. }
  10426. this._draw(subMesh, fillMode);
  10427. }
  10428. if (batch.visibleInstances[subMesh._id]) {
  10429. for (var instanceIndex = 0; instanceIndex < batch.visibleInstances[subMesh._id].length; instanceIndex++) {
  10430. var instance = batch.visibleInstances[subMesh._id][instanceIndex];
  10431. // World
  10432. var world = instance.getWorldMatrix();
  10433. if (onBeforeDraw) {
  10434. onBeforeDraw(true, world);
  10435. }
  10436. // Draw
  10437. this._draw(subMesh, fillMode);
  10438. }
  10439. }
  10440. }
  10441. };
  10442. Mesh.prototype.render = function (subMesh) {
  10443. var scene = this.getScene();
  10444. // Managing instances
  10445. var batch = this._getInstancesRenderList(subMesh._id);
  10446. if (batch.mustReturn) {
  10447. return;
  10448. }
  10449. // Checking geometry state
  10450. if (!this._geometry || !this._geometry.getVertexBuffers() || !this._geometry.getIndexBuffer()) {
  10451. return;
  10452. }
  10453. for (var callbackIndex = 0; callbackIndex < this._onBeforeRenderCallbacks.length; callbackIndex++) {
  10454. this._onBeforeRenderCallbacks[callbackIndex]();
  10455. }
  10456. var engine = scene.getEngine();
  10457. var hardwareInstancedRendering = (engine.getCaps().instancedArrays !== null) && (batch.visibleInstances[subMesh._id] !== null) && (batch.visibleInstances[subMesh._id] !== undefined);
  10458. // Material
  10459. var effectiveMaterial = subMesh.getMaterial();
  10460. if (!effectiveMaterial || !effectiveMaterial.isReady(this, hardwareInstancedRendering)) {
  10461. return;
  10462. }
  10463. // Outline - step 1
  10464. var savedDepthWrite = engine.getDepthWrite();
  10465. if (this.renderOutline) {
  10466. engine.setDepthWrite(false);
  10467. scene.getOutlineRenderer().render(subMesh, batch);
  10468. engine.setDepthWrite(savedDepthWrite);
  10469. }
  10470. effectiveMaterial._preBind();
  10471. var effect = effectiveMaterial.getEffect();
  10472. // Bind
  10473. var fillMode = scene.forcePointsCloud ? BABYLON.Material.PointFillMode : (scene.forceWireframe ? BABYLON.Material.WireFrameFillMode : effectiveMaterial.fillMode);
  10474. this._bind(subMesh, effect, fillMode);
  10475. var world = this.getWorldMatrix();
  10476. effectiveMaterial.bind(world, this);
  10477. // Draw
  10478. this._processRendering(subMesh, effect, fillMode, batch, hardwareInstancedRendering, function (isInstance, world) {
  10479. if (isInstance) {
  10480. effectiveMaterial.bindOnlyWorldMatrix(world);
  10481. }
  10482. });
  10483. // Unbind
  10484. effectiveMaterial.unbind();
  10485. // Outline - step 2
  10486. if (this.renderOutline && savedDepthWrite) {
  10487. engine.setDepthWrite(true);
  10488. engine.setColorWrite(false);
  10489. scene.getOutlineRenderer().render(subMesh, batch);
  10490. engine.setColorWrite(true);
  10491. }
  10492. // Overlay
  10493. if (this.renderOverlay) {
  10494. var currentMode = engine.getAlphaMode();
  10495. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  10496. scene.getOutlineRenderer().render(subMesh, batch, true);
  10497. engine.setAlphaMode(currentMode);
  10498. }
  10499. for (callbackIndex = 0; callbackIndex < this._onAfterRenderCallbacks.length; callbackIndex++) {
  10500. this._onAfterRenderCallbacks[callbackIndex]();
  10501. }
  10502. };
  10503. Mesh.prototype.getEmittedParticleSystems = function () {
  10504. var results = new Array();
  10505. for (var index = 0; index < this.getScene().particleSystems.length; index++) {
  10506. var particleSystem = this.getScene().particleSystems[index];
  10507. if (particleSystem.emitter === this) {
  10508. results.push(particleSystem);
  10509. }
  10510. }
  10511. return results;
  10512. };
  10513. Mesh.prototype.getHierarchyEmittedParticleSystems = function () {
  10514. var results = new Array();
  10515. var descendants = this.getDescendants();
  10516. descendants.push(this);
  10517. for (var index = 0; index < this.getScene().particleSystems.length; index++) {
  10518. var particleSystem = this.getScene().particleSystems[index];
  10519. if (descendants.indexOf(particleSystem.emitter) !== -1) {
  10520. results.push(particleSystem);
  10521. }
  10522. }
  10523. return results;
  10524. };
  10525. Mesh.prototype.getChildren = function () {
  10526. var results = [];
  10527. for (var index = 0; index < this.getScene().meshes.length; index++) {
  10528. var mesh = this.getScene().meshes[index];
  10529. if (mesh.parent === this) {
  10530. results.push(mesh);
  10531. }
  10532. }
  10533. return results;
  10534. };
  10535. Mesh.prototype._checkDelayState = function () {
  10536. var _this = this;
  10537. var that = this;
  10538. var scene = this.getScene();
  10539. if (this._geometry) {
  10540. this._geometry.load(scene);
  10541. }
  10542. else if (that.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) {
  10543. that.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADING;
  10544. scene._addPendingData(that);
  10545. var getBinaryData = (this.delayLoadingFile.indexOf(".babylonbinarymeshdata") !== -1) ? true : false;
  10546. BABYLON.Tools.LoadFile(this.delayLoadingFile, function (data) {
  10547. if (data instanceof ArrayBuffer) {
  10548. _this._delayLoadingFunction(data, _this);
  10549. }
  10550. else {
  10551. _this._delayLoadingFunction(JSON.parse(data), _this);
  10552. }
  10553. _this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADED;
  10554. scene._removePendingData(_this);
  10555. }, function () {
  10556. }, scene.database, getBinaryData);
  10557. }
  10558. };
  10559. Mesh.prototype.isInFrustum = function (frustumPlanes) {
  10560. if (this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADING) {
  10561. return false;
  10562. }
  10563. if (!_super.prototype.isInFrustum.call(this, frustumPlanes)) {
  10564. return false;
  10565. }
  10566. this._checkDelayState();
  10567. return true;
  10568. };
  10569. Mesh.prototype.setMaterialByID = function (id) {
  10570. var materials = this.getScene().materials;
  10571. for (var index = 0; index < materials.length; index++) {
  10572. if (materials[index].id === id) {
  10573. this.material = materials[index];
  10574. return;
  10575. }
  10576. }
  10577. // Multi
  10578. var multiMaterials = this.getScene().multiMaterials;
  10579. for (index = 0; index < multiMaterials.length; index++) {
  10580. if (multiMaterials[index].id === id) {
  10581. this.material = multiMaterials[index];
  10582. return;
  10583. }
  10584. }
  10585. };
  10586. Mesh.prototype.getAnimatables = function () {
  10587. var results = [];
  10588. if (this.material) {
  10589. results.push(this.material);
  10590. }
  10591. if (this.skeleton) {
  10592. results.push(this.skeleton);
  10593. }
  10594. return results;
  10595. };
  10596. // Geometry
  10597. Mesh.prototype.bakeTransformIntoVertices = function (transform) {
  10598. // Position
  10599. if (!this.isVerticesDataPresent(BABYLON.VertexBuffer.PositionKind)) {
  10600. return;
  10601. }
  10602. this._resetPointsArrayCache();
  10603. var data = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  10604. var temp = [];
  10605. for (var index = 0; index < data.length; index += 3) {
  10606. BABYLON.Vector3.TransformCoordinates(BABYLON.Vector3.FromArray(data, index), transform).toArray(temp, index);
  10607. }
  10608. this.setVerticesData(BABYLON.VertexBuffer.PositionKind, temp, this.getVertexBuffer(BABYLON.VertexBuffer.PositionKind).isUpdatable());
  10609. // Normals
  10610. if (!this.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) {
  10611. return;
  10612. }
  10613. data = this.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  10614. for (index = 0; index < data.length; index += 3) {
  10615. BABYLON.Vector3.TransformNormal(BABYLON.Vector3.FromArray(data, index), transform).toArray(temp, index);
  10616. }
  10617. this.setVerticesData(BABYLON.VertexBuffer.NormalKind, temp, this.getVertexBuffer(BABYLON.VertexBuffer.NormalKind).isUpdatable());
  10618. };
  10619. // Cache
  10620. Mesh.prototype._resetPointsArrayCache = function () {
  10621. this._positions = null;
  10622. };
  10623. Mesh.prototype._generatePointsArray = function () {
  10624. if (this._positions)
  10625. return true;
  10626. this._positions = [];
  10627. var data = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  10628. if (!data) {
  10629. return false;
  10630. }
  10631. for (var index = 0; index < data.length; index += 3) {
  10632. this._positions.push(BABYLON.Vector3.FromArray(data, index));
  10633. }
  10634. return true;
  10635. };
  10636. // Clone
  10637. Mesh.prototype.clone = function (name, newParent, doNotCloneChildren) {
  10638. return new Mesh(name, this.getScene(), newParent, this, doNotCloneChildren);
  10639. };
  10640. // Dispose
  10641. Mesh.prototype.dispose = function (doNotRecurse) {
  10642. if (this._geometry) {
  10643. this._geometry.releaseForMesh(this, true);
  10644. }
  10645. // Instances
  10646. if (this._worldMatricesInstancesBuffer) {
  10647. this.getEngine().deleteInstancesBuffer(this._worldMatricesInstancesBuffer);
  10648. this._worldMatricesInstancesBuffer = null;
  10649. }
  10650. while (this.instances.length) {
  10651. this.instances[0].dispose();
  10652. }
  10653. _super.prototype.dispose.call(this, doNotRecurse);
  10654. };
  10655. // Geometric tools
  10656. Mesh.prototype.applyDisplacementMap = function (url, minHeight, maxHeight, onSuccess) {
  10657. var _this = this;
  10658. var scene = this.getScene();
  10659. var onload = function (img) {
  10660. // Getting height map data
  10661. var canvas = document.createElement("canvas");
  10662. var context = canvas.getContext("2d");
  10663. var heightMapWidth = img.width;
  10664. var heightMapHeight = img.height;
  10665. canvas.width = heightMapWidth;
  10666. canvas.height = heightMapHeight;
  10667. context.drawImage(img, 0, 0);
  10668. // Create VertexData from map data
  10669. var buffer = context.getImageData(0, 0, heightMapWidth, heightMapHeight).data;
  10670. _this.applyDisplacementMapFromBuffer(buffer, heightMapWidth, heightMapHeight, minHeight, maxHeight);
  10671. //execute success callback, if set
  10672. if (onSuccess) {
  10673. onSuccess(_this);
  10674. }
  10675. };
  10676. BABYLON.Tools.LoadImage(url, onload, function () {
  10677. }, scene.database);
  10678. };
  10679. Mesh.prototype.applyDisplacementMapFromBuffer = function (buffer, heightMapWidth, heightMapHeight, minHeight, maxHeight) {
  10680. if (!this.isVerticesDataPresent(BABYLON.VertexBuffer.PositionKind) || !this.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind) || !this.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  10681. BABYLON.Tools.Warn("Cannot call applyDisplacementMap: Given mesh is not complete. Position, Normal or UV are missing");
  10682. return;
  10683. }
  10684. var positions = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  10685. var normals = this.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  10686. var uvs = this.getVerticesData(BABYLON.VertexBuffer.UVKind);
  10687. var position = BABYLON.Vector3.Zero();
  10688. var normal = BABYLON.Vector3.Zero();
  10689. var uv = BABYLON.Vector2.Zero();
  10690. for (var index = 0; index < positions.length; index += 3) {
  10691. BABYLON.Vector3.FromArrayToRef(positions, index, position);
  10692. BABYLON.Vector3.FromArrayToRef(normals, index, normal);
  10693. BABYLON.Vector2.FromArrayToRef(uvs, (index / 3) * 2, uv);
  10694. // Compute height
  10695. var u = ((Math.abs(uv.x) * heightMapWidth) % heightMapWidth) | 0;
  10696. var v = ((Math.abs(uv.y) * heightMapHeight) % heightMapHeight) | 0;
  10697. var pos = (u + v * heightMapWidth) * 4;
  10698. var r = buffer[pos] / 255.0;
  10699. var g = buffer[pos + 1] / 255.0;
  10700. var b = buffer[pos + 2] / 255.0;
  10701. var gradient = r * 0.3 + g * 0.59 + b * 0.11;
  10702. normal.normalize();
  10703. normal.scaleInPlace(minHeight + (maxHeight - minHeight) * gradient);
  10704. position = position.add(normal);
  10705. position.toArray(positions, index);
  10706. }
  10707. BABYLON.VertexData.ComputeNormals(positions, this.getIndices(), normals);
  10708. this.updateVerticesData(BABYLON.VertexBuffer.PositionKind, positions);
  10709. this.updateVerticesData(BABYLON.VertexBuffer.NormalKind, normals);
  10710. };
  10711. Mesh.prototype.convertToFlatShadedMesh = function () {
  10712. /// <summary>Update normals and vertices to get a flat shading rendering.</summary>
  10713. /// <summary>Warning: This may imply adding vertices to the mesh in order to get exactly 3 vertices per face</summary>
  10714. var kinds = this.getVerticesDataKinds();
  10715. var vbs = [];
  10716. var data = [];
  10717. var newdata = [];
  10718. var updatableNormals = false;
  10719. for (var kindIndex = 0; kindIndex < kinds.length; kindIndex++) {
  10720. var kind = kinds[kindIndex];
  10721. var vertexBuffer = this.getVertexBuffer(kind);
  10722. if (kind === BABYLON.VertexBuffer.NormalKind) {
  10723. updatableNormals = vertexBuffer.isUpdatable();
  10724. kinds.splice(kindIndex, 1);
  10725. kindIndex--;
  10726. continue;
  10727. }
  10728. vbs[kind] = vertexBuffer;
  10729. data[kind] = vbs[kind].getData();
  10730. newdata[kind] = [];
  10731. }
  10732. // Save previous submeshes
  10733. var previousSubmeshes = this.subMeshes.slice(0);
  10734. var indices = this.getIndices();
  10735. var totalIndices = this.getTotalIndices();
  10736. for (var index = 0; index < totalIndices; index++) {
  10737. var vertexIndex = indices[index];
  10738. for (kindIndex = 0; kindIndex < kinds.length; kindIndex++) {
  10739. kind = kinds[kindIndex];
  10740. var stride = vbs[kind].getStrideSize();
  10741. for (var offset = 0; offset < stride; offset++) {
  10742. newdata[kind].push(data[kind][vertexIndex * stride + offset]);
  10743. }
  10744. }
  10745. }
  10746. // Updating faces & normal
  10747. var normals = [];
  10748. var positions = newdata[BABYLON.VertexBuffer.PositionKind];
  10749. for (index = 0; index < totalIndices; index += 3) {
  10750. indices[index] = index;
  10751. indices[index + 1] = index + 1;
  10752. indices[index + 2] = index + 2;
  10753. var p1 = BABYLON.Vector3.FromArray(positions, index * 3);
  10754. var p2 = BABYLON.Vector3.FromArray(positions, (index + 1) * 3);
  10755. var p3 = BABYLON.Vector3.FromArray(positions, (index + 2) * 3);
  10756. var p1p2 = p1.subtract(p2);
  10757. var p3p2 = p3.subtract(p2);
  10758. var normal = BABYLON.Vector3.Normalize(BABYLON.Vector3.Cross(p1p2, p3p2));
  10759. for (var localIndex = 0; localIndex < 3; localIndex++) {
  10760. normals.push(normal.x);
  10761. normals.push(normal.y);
  10762. normals.push(normal.z);
  10763. }
  10764. }
  10765. this.setIndices(indices);
  10766. this.setVerticesData(BABYLON.VertexBuffer.NormalKind, normals, updatableNormals);
  10767. for (kindIndex = 0; kindIndex < kinds.length; kindIndex++) {
  10768. kind = kinds[kindIndex];
  10769. this.setVerticesData(kind, newdata[kind], vbs[kind].isUpdatable());
  10770. }
  10771. // Updating submeshes
  10772. this.releaseSubMeshes();
  10773. for (var submeshIndex = 0; submeshIndex < previousSubmeshes.length; submeshIndex++) {
  10774. var previousOne = previousSubmeshes[submeshIndex];
  10775. var subMesh = new BABYLON.SubMesh(previousOne.materialIndex, previousOne.indexStart, previousOne.indexCount, previousOne.indexStart, previousOne.indexCount, this);
  10776. }
  10777. this.synchronizeInstances();
  10778. };
  10779. // Instances
  10780. Mesh.prototype.createInstance = function (name) {
  10781. return new BABYLON.InstancedMesh(name, this);
  10782. };
  10783. Mesh.prototype.synchronizeInstances = function () {
  10784. for (var instanceIndex = 0; instanceIndex < this.instances.length; instanceIndex++) {
  10785. var instance = this.instances[instanceIndex];
  10786. instance._syncSubMeshes();
  10787. }
  10788. };
  10789. /**
  10790. * Simplify the mesh according to the given array of settings.
  10791. * Function will return immediately and will simplify async.
  10792. * @param settings a collection of simplification settings.
  10793. * @param parallelProcessing should all levels calculate parallel or one after the other.
  10794. * @param type the type of simplification to run.
  10795. * successCallback optional success callback to be called after the simplification finished processing all settings.
  10796. */
  10797. Mesh.prototype.simplify = function (settings, parallelProcessing, type, successCallback) {
  10798. var _this = this;
  10799. if (parallelProcessing === void 0) { parallelProcessing = true; }
  10800. if (type === void 0) { type = 0 /* QUADRATIC */; }
  10801. var getSimplifier = function () {
  10802. switch (type) {
  10803. case 0 /* QUADRATIC */:
  10804. default:
  10805. return new BABYLON.QuadraticErrorSimplification(_this);
  10806. }
  10807. };
  10808. if (parallelProcessing) {
  10809. //parallel simplifier
  10810. settings.forEach(function (setting) {
  10811. var simplifier = getSimplifier();
  10812. simplifier.simplify(setting, function (newMesh) {
  10813. _this.addLODLevel(setting.distance, newMesh);
  10814. //check if it is the last
  10815. if (setting.quality === settings[settings.length - 1].quality && successCallback) {
  10816. //all done, run the success callback.
  10817. successCallback();
  10818. }
  10819. });
  10820. });
  10821. }
  10822. else {
  10823. //single simplifier.
  10824. var simplifier = getSimplifier();
  10825. var runDecimation = function (setting, callback) {
  10826. simplifier.simplify(setting, function (newMesh) {
  10827. _this.addLODLevel(setting.distance, newMesh);
  10828. //run the next quality level
  10829. callback();
  10830. });
  10831. };
  10832. BABYLON.AsyncLoop.Run(settings.length, function (loop) {
  10833. runDecimation(settings[loop.index], function () {
  10834. loop.executeNext();
  10835. });
  10836. }, function () {
  10837. //execution ended, run the success callback.
  10838. if (successCallback) {
  10839. successCallback();
  10840. }
  10841. });
  10842. }
  10843. };
  10844. // Statics
  10845. Mesh.CreateBox = function (name, size, scene, updatable) {
  10846. var box = new Mesh(name, scene);
  10847. var vertexData = BABYLON.VertexData.CreateBox(size);
  10848. vertexData.applyToMesh(box, updatable);
  10849. return box;
  10850. };
  10851. Mesh.CreateSphere = function (name, segments, diameter, scene, updatable) {
  10852. var sphere = new Mesh(name, scene);
  10853. var vertexData = BABYLON.VertexData.CreateSphere(segments, diameter);
  10854. vertexData.applyToMesh(sphere, updatable);
  10855. return sphere;
  10856. };
  10857. // Cylinder and cone (Code inspired by SharpDX.org)
  10858. Mesh.CreateCylinder = function (name, height, diameterTop, diameterBottom, tessellation, subdivisions, scene, updatable) {
  10859. // subdivisions is a new parameter, we need to support old signature
  10860. if (scene === undefined || !(scene instanceof BABYLON.Scene)) {
  10861. if (scene !== undefined) {
  10862. updatable = scene;
  10863. }
  10864. scene = subdivisions;
  10865. subdivisions = 1;
  10866. }
  10867. var cylinder = new Mesh(name, scene);
  10868. var vertexData = BABYLON.VertexData.CreateCylinder(height, diameterTop, diameterBottom, tessellation, subdivisions);
  10869. vertexData.applyToMesh(cylinder, updatable);
  10870. return cylinder;
  10871. };
  10872. // Torus (Code from SharpDX.org)
  10873. Mesh.CreateTorus = function (name, diameter, thickness, tessellation, scene, updatable) {
  10874. var torus = new Mesh(name, scene);
  10875. var vertexData = BABYLON.VertexData.CreateTorus(diameter, thickness, tessellation);
  10876. vertexData.applyToMesh(torus, updatable);
  10877. return torus;
  10878. };
  10879. Mesh.CreateTorusKnot = function (name, radius, tube, radialSegments, tubularSegments, p, q, scene, updatable) {
  10880. var torusKnot = new Mesh(name, scene);
  10881. var vertexData = BABYLON.VertexData.CreateTorusKnot(radius, tube, radialSegments, tubularSegments, p, q);
  10882. vertexData.applyToMesh(torusKnot, updatable);
  10883. return torusKnot;
  10884. };
  10885. // Lines
  10886. Mesh.CreateLines = function (name, points, scene, updatable) {
  10887. var lines = new BABYLON.LinesMesh(name, scene, updatable);
  10888. var vertexData = BABYLON.VertexData.CreateLines(points);
  10889. vertexData.applyToMesh(lines, updatable);
  10890. return lines;
  10891. };
  10892. // Plane & ground
  10893. Mesh.CreatePlane = function (name, size, scene, updatable) {
  10894. var plane = new Mesh(name, scene);
  10895. var vertexData = BABYLON.VertexData.CreatePlane(size);
  10896. vertexData.applyToMesh(plane, updatable);
  10897. return plane;
  10898. };
  10899. Mesh.CreateGround = function (name, width, height, subdivisions, scene, updatable) {
  10900. var ground = new BABYLON.GroundMesh(name, scene);
  10901. ground._setReady(false);
  10902. ground._subdivisions = subdivisions;
  10903. var vertexData = BABYLON.VertexData.CreateGround(width, height, subdivisions);
  10904. vertexData.applyToMesh(ground, updatable);
  10905. ground._setReady(true);
  10906. return ground;
  10907. };
  10908. Mesh.CreateTiledGround = function (name, xmin, zmin, xmax, zmax, subdivisions, precision, scene, updatable) {
  10909. var tiledGround = new Mesh(name, scene);
  10910. var vertexData = BABYLON.VertexData.CreateTiledGround(xmin, zmin, xmax, zmax, subdivisions, precision);
  10911. vertexData.applyToMesh(tiledGround, updatable);
  10912. return tiledGround;
  10913. };
  10914. Mesh.CreateGroundFromHeightMap = function (name, url, width, height, subdivisions, minHeight, maxHeight, scene, updatable, onReady) {
  10915. var ground = new BABYLON.GroundMesh(name, scene);
  10916. ground._subdivisions = subdivisions;
  10917. ground._setReady(false);
  10918. var onload = function (img) {
  10919. // Getting height map data
  10920. var canvas = document.createElement("canvas");
  10921. var context = canvas.getContext("2d");
  10922. var heightMapWidth = img.width;
  10923. var heightMapHeight = img.height;
  10924. canvas.width = heightMapWidth;
  10925. canvas.height = heightMapHeight;
  10926. context.drawImage(img, 0, 0);
  10927. // Create VertexData from map data
  10928. var buffer = context.getImageData(0, 0, heightMapWidth, heightMapHeight).data;
  10929. var vertexData = BABYLON.VertexData.CreateGroundFromHeightMap(width, height, subdivisions, minHeight, maxHeight, buffer, heightMapWidth, heightMapHeight);
  10930. vertexData.applyToMesh(ground, updatable);
  10931. ground._setReady(true);
  10932. //execute ready callback, if set
  10933. if (onReady) {
  10934. onReady(ground);
  10935. }
  10936. };
  10937. BABYLON.Tools.LoadImage(url, onload, function () {
  10938. }, scene.database);
  10939. return ground;
  10940. };
  10941. // Tools
  10942. Mesh.MinMax = function (meshes) {
  10943. var minVector = null;
  10944. var maxVector = null;
  10945. for (var i in meshes) {
  10946. var mesh = meshes[i];
  10947. var boundingBox = mesh.getBoundingInfo().boundingBox;
  10948. if (!minVector) {
  10949. minVector = boundingBox.minimumWorld;
  10950. maxVector = boundingBox.maximumWorld;
  10951. continue;
  10952. }
  10953. minVector.MinimizeInPlace(boundingBox.minimumWorld);
  10954. maxVector.MaximizeInPlace(boundingBox.maximumWorld);
  10955. }
  10956. return {
  10957. min: minVector,
  10958. max: maxVector
  10959. };
  10960. };
  10961. Mesh.Center = function (meshesOrMinMaxVector) {
  10962. var minMaxVector = meshesOrMinMaxVector.min !== undefined ? meshesOrMinMaxVector : Mesh.MinMax(meshesOrMinMaxVector);
  10963. return BABYLON.Vector3.Center(minMaxVector.min, minMaxVector.max);
  10964. };
  10965. Mesh.MergeMeshes = function (meshes, disposeSource, allow32BitsIndices) {
  10966. if (disposeSource === void 0) { disposeSource = true; }
  10967. var source = meshes[0];
  10968. var material = source.material;
  10969. var scene = source.getScene();
  10970. if (!allow32BitsIndices) {
  10971. var totalVertices = 0;
  10972. for (var index = 0; index < meshes.length; index++) {
  10973. totalVertices += meshes[index].getTotalVertices();
  10974. if (totalVertices > 65536) {
  10975. BABYLON.Tools.Warn("Cannot merge meshes because resulting mesh will have more than 65536 vertices. Please use allow32BitsIndices = true to use 32 bits indices");
  10976. return null;
  10977. }
  10978. }
  10979. }
  10980. // Merge
  10981. var vertexData = BABYLON.VertexData.ExtractFromMesh(source);
  10982. vertexData.transform(source.getWorldMatrix());
  10983. for (index = 1; index < meshes.length; index++) {
  10984. var otherVertexData = BABYLON.VertexData.ExtractFromMesh(meshes[index]);
  10985. otherVertexData.transform(meshes[index].getWorldMatrix());
  10986. vertexData.merge(otherVertexData);
  10987. }
  10988. var newMesh = new Mesh(source.name + "_merged", scene);
  10989. vertexData.applyToMesh(newMesh);
  10990. // Setting properties
  10991. newMesh.material = material;
  10992. newMesh.checkCollisions = source.checkCollisions;
  10993. // Cleaning
  10994. if (disposeSource) {
  10995. for (index = 0; index < meshes.length; index++) {
  10996. meshes[index].dispose();
  10997. }
  10998. }
  10999. return newMesh;
  11000. };
  11001. return Mesh;
  11002. })(BABYLON.AbstractMesh);
  11003. BABYLON.Mesh = Mesh;
  11004. })(BABYLON || (BABYLON = {}));
  11005. //# sourceMappingURL=babylon.mesh.js.map
  11006. var BABYLON;
  11007. (function (BABYLON) {
  11008. var GroundMesh = (function (_super) {
  11009. __extends(GroundMesh, _super);
  11010. function GroundMesh(name, scene) {
  11011. _super.call(this, name, scene);
  11012. this.generateOctree = false;
  11013. this._worldInverse = new BABYLON.Matrix();
  11014. }
  11015. Object.defineProperty(GroundMesh.prototype, "subdivisions", {
  11016. get: function () {
  11017. return this._subdivisions;
  11018. },
  11019. enumerable: true,
  11020. configurable: true
  11021. });
  11022. GroundMesh.prototype.optimize = function (chunksCount) {
  11023. this.subdivide(this._subdivisions);
  11024. this.createOrUpdateSubmeshesOctree(32);
  11025. };
  11026. GroundMesh.prototype.getHeightAtCoordinates = function (x, z) {
  11027. var ray = new BABYLON.Ray(new BABYLON.Vector3(x, this.getBoundingInfo().boundingBox.maximumWorld.y + 1, z), new BABYLON.Vector3(0, -1, 0));
  11028. this.getWorldMatrix().invertToRef(this._worldInverse);
  11029. ray = BABYLON.Ray.Transform(ray, this._worldInverse);
  11030. var pickInfo = this.intersects(ray);
  11031. if (pickInfo.hit) {
  11032. return pickInfo.pickedPoint.y;
  11033. }
  11034. return 0;
  11035. };
  11036. return GroundMesh;
  11037. })(BABYLON.Mesh);
  11038. BABYLON.GroundMesh = GroundMesh;
  11039. })(BABYLON || (BABYLON = {}));
  11040. //# sourceMappingURL=babylon.groundMesh.js.map
  11041. var BABYLON;
  11042. (function (BABYLON) {
  11043. /**
  11044. * Creates an instance based on a source mesh.
  11045. */
  11046. var InstancedMesh = (function (_super) {
  11047. __extends(InstancedMesh, _super);
  11048. function InstancedMesh(name, source) {
  11049. _super.call(this, name, source.getScene());
  11050. source.instances.push(this);
  11051. this._sourceMesh = source;
  11052. this.position.copyFrom(source.position);
  11053. this.rotation.copyFrom(source.rotation);
  11054. this.scaling.copyFrom(source.scaling);
  11055. if (source.rotationQuaternion) {
  11056. this.rotationQuaternion = source.rotationQuaternion.clone();
  11057. }
  11058. this.infiniteDistance = source.infiniteDistance;
  11059. this.setPivotMatrix(source.getPivotMatrix());
  11060. this.refreshBoundingInfo();
  11061. this._syncSubMeshes();
  11062. }
  11063. Object.defineProperty(InstancedMesh.prototype, "receiveShadows", {
  11064. // Methods
  11065. get: function () {
  11066. return this._sourceMesh.receiveShadows;
  11067. },
  11068. enumerable: true,
  11069. configurable: true
  11070. });
  11071. Object.defineProperty(InstancedMesh.prototype, "material", {
  11072. get: function () {
  11073. return this._sourceMesh.material;
  11074. },
  11075. enumerable: true,
  11076. configurable: true
  11077. });
  11078. Object.defineProperty(InstancedMesh.prototype, "visibility", {
  11079. get: function () {
  11080. return this._sourceMesh.visibility;
  11081. },
  11082. enumerable: true,
  11083. configurable: true
  11084. });
  11085. Object.defineProperty(InstancedMesh.prototype, "skeleton", {
  11086. get: function () {
  11087. return this._sourceMesh.skeleton;
  11088. },
  11089. enumerable: true,
  11090. configurable: true
  11091. });
  11092. InstancedMesh.prototype.getTotalVertices = function () {
  11093. return this._sourceMesh.getTotalVertices();
  11094. };
  11095. Object.defineProperty(InstancedMesh.prototype, "sourceMesh", {
  11096. get: function () {
  11097. return this._sourceMesh;
  11098. },
  11099. enumerable: true,
  11100. configurable: true
  11101. });
  11102. InstancedMesh.prototype.getVerticesData = function (kind) {
  11103. return this._sourceMesh.getVerticesData(kind);
  11104. };
  11105. InstancedMesh.prototype.isVerticesDataPresent = function (kind) {
  11106. return this._sourceMesh.isVerticesDataPresent(kind);
  11107. };
  11108. InstancedMesh.prototype.getIndices = function () {
  11109. return this._sourceMesh.getIndices();
  11110. };
  11111. Object.defineProperty(InstancedMesh.prototype, "_positions", {
  11112. get: function () {
  11113. return this._sourceMesh._positions;
  11114. },
  11115. enumerable: true,
  11116. configurable: true
  11117. });
  11118. InstancedMesh.prototype.refreshBoundingInfo = function () {
  11119. var data = this._sourceMesh.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  11120. if (data) {
  11121. var extend = BABYLON.Tools.ExtractMinAndMax(data, 0, this._sourceMesh.getTotalVertices());
  11122. this._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  11123. }
  11124. this._updateBoundingInfo();
  11125. };
  11126. InstancedMesh.prototype._preActivate = function () {
  11127. if (this._currentLOD) {
  11128. this._currentLOD._preActivate();
  11129. }
  11130. };
  11131. InstancedMesh.prototype._activate = function (renderId) {
  11132. if (this._currentLOD) {
  11133. this._currentLOD._registerInstanceForRenderId(this, renderId);
  11134. }
  11135. };
  11136. InstancedMesh.prototype.getLOD = function (camera) {
  11137. this._currentLOD = this.sourceMesh.getLOD(this.getScene().activeCamera, this.getBoundingInfo().boundingSphere);
  11138. if (this._currentLOD === this.sourceMesh) {
  11139. return this;
  11140. }
  11141. return this._currentLOD;
  11142. };
  11143. InstancedMesh.prototype._syncSubMeshes = function () {
  11144. this.releaseSubMeshes();
  11145. if (this._sourceMesh.subMeshes) {
  11146. for (var index = 0; index < this._sourceMesh.subMeshes.length; index++) {
  11147. this._sourceMesh.subMeshes[index].clone(this, this._sourceMesh);
  11148. }
  11149. }
  11150. };
  11151. InstancedMesh.prototype._generatePointsArray = function () {
  11152. return this._sourceMesh._generatePointsArray();
  11153. };
  11154. // Clone
  11155. InstancedMesh.prototype.clone = function (name, newParent, doNotCloneChildren) {
  11156. var result = this._sourceMesh.createInstance(name);
  11157. // Deep copy
  11158. BABYLON.Tools.DeepCopy(this, result, ["name"], []);
  11159. // Bounding info
  11160. this.refreshBoundingInfo();
  11161. // Parent
  11162. if (newParent) {
  11163. result.parent = newParent;
  11164. }
  11165. if (!doNotCloneChildren) {
  11166. for (var index = 0; index < this.getScene().meshes.length; index++) {
  11167. var mesh = this.getScene().meshes[index];
  11168. if (mesh.parent === this) {
  11169. mesh.clone(mesh.name, result);
  11170. }
  11171. }
  11172. }
  11173. result.computeWorldMatrix(true);
  11174. return result;
  11175. };
  11176. // Dispoe
  11177. InstancedMesh.prototype.dispose = function (doNotRecurse) {
  11178. // Remove from mesh
  11179. var index = this._sourceMesh.instances.indexOf(this);
  11180. this._sourceMesh.instances.splice(index, 1);
  11181. _super.prototype.dispose.call(this, doNotRecurse);
  11182. };
  11183. return InstancedMesh;
  11184. })(BABYLON.AbstractMesh);
  11185. BABYLON.InstancedMesh = InstancedMesh;
  11186. })(BABYLON || (BABYLON = {}));
  11187. //# sourceMappingURL=babylon.instancedMesh.js.mapvar BABYLON;
  11188. (function (BABYLON) {
  11189. var SubMesh = (function () {
  11190. function SubMesh(materialIndex, verticesStart, verticesCount, indexStart, indexCount, mesh, renderingMesh, createBoundingBox) {
  11191. if (createBoundingBox === void 0) { createBoundingBox = true; }
  11192. this.materialIndex = materialIndex;
  11193. this.verticesStart = verticesStart;
  11194. this.verticesCount = verticesCount;
  11195. this.indexStart = indexStart;
  11196. this.indexCount = indexCount;
  11197. this._renderId = 0;
  11198. this._mesh = mesh;
  11199. this._renderingMesh = renderingMesh || mesh;
  11200. mesh.subMeshes.push(this);
  11201. this._id = mesh.subMeshes.length - 1;
  11202. if (createBoundingBox) {
  11203. this.refreshBoundingInfo();
  11204. }
  11205. }
  11206. SubMesh.prototype.getBoundingInfo = function () {
  11207. return this._boundingInfo;
  11208. };
  11209. SubMesh.prototype.getMesh = function () {
  11210. return this._mesh;
  11211. };
  11212. SubMesh.prototype.getRenderingMesh = function () {
  11213. return this._renderingMesh;
  11214. };
  11215. SubMesh.prototype.getMaterial = function () {
  11216. var rootMaterial = this._renderingMesh.material;
  11217. if (rootMaterial && rootMaterial instanceof BABYLON.MultiMaterial) {
  11218. var multiMaterial = rootMaterial;
  11219. return multiMaterial.getSubMaterial(this.materialIndex);
  11220. }
  11221. if (!rootMaterial) {
  11222. return this._mesh.getScene().defaultMaterial;
  11223. }
  11224. return rootMaterial;
  11225. };
  11226. // Methods
  11227. SubMesh.prototype.refreshBoundingInfo = function () {
  11228. var data = this._renderingMesh.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  11229. if (!data) {
  11230. this._boundingInfo = this._mesh._boundingInfo;
  11231. return;
  11232. }
  11233. var indices = this._renderingMesh.getIndices();
  11234. var extend;
  11235. if (this.indexStart === 0 && this.indexCount === indices.length) {
  11236. extend = BABYLON.Tools.ExtractMinAndMax(data, this.verticesStart, this.verticesCount);
  11237. }
  11238. else {
  11239. extend = BABYLON.Tools.ExtractMinAndMaxIndexed(data, indices, this.indexStart, this.indexCount);
  11240. }
  11241. this._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  11242. };
  11243. SubMesh.prototype._checkCollision = function (collider) {
  11244. return this._boundingInfo._checkCollision(collider);
  11245. };
  11246. SubMesh.prototype.updateBoundingInfo = function (world) {
  11247. if (!this._boundingInfo) {
  11248. this.refreshBoundingInfo();
  11249. }
  11250. this._boundingInfo._update(world);
  11251. };
  11252. SubMesh.prototype.isInFrustum = function (frustumPlanes) {
  11253. return this._boundingInfo.isInFrustum(frustumPlanes);
  11254. };
  11255. SubMesh.prototype.render = function () {
  11256. this._renderingMesh.render(this);
  11257. };
  11258. SubMesh.prototype.getLinesIndexBuffer = function (indices, engine) {
  11259. if (!this._linesIndexBuffer) {
  11260. var linesIndices = [];
  11261. for (var index = this.indexStart; index < this.indexStart + this.indexCount; index += 3) {
  11262. linesIndices.push(indices[index], indices[index + 1], indices[index + 1], indices[index + 2], indices[index + 2], indices[index]);
  11263. }
  11264. this._linesIndexBuffer = engine.createIndexBuffer(linesIndices);
  11265. this.linesIndexCount = linesIndices.length;
  11266. }
  11267. return this._linesIndexBuffer;
  11268. };
  11269. SubMesh.prototype.canIntersects = function (ray) {
  11270. return ray.intersectsBox(this._boundingInfo.boundingBox);
  11271. };
  11272. SubMesh.prototype.intersects = function (ray, positions, indices, fastCheck) {
  11273. var intersectInfo = null;
  11274. for (var index = this.indexStart; index < this.indexStart + this.indexCount; index += 3) {
  11275. var p0 = positions[indices[index]];
  11276. var p1 = positions[indices[index + 1]];
  11277. var p2 = positions[indices[index + 2]];
  11278. var currentIntersectInfo = ray.intersectsTriangle(p0, p1, p2);
  11279. if (currentIntersectInfo) {
  11280. if (currentIntersectInfo.distance < 0) {
  11281. continue;
  11282. }
  11283. if (fastCheck || !intersectInfo || currentIntersectInfo.distance < intersectInfo.distance) {
  11284. intersectInfo = currentIntersectInfo;
  11285. intersectInfo.faceId = index / 3;
  11286. if (fastCheck) {
  11287. break;
  11288. }
  11289. }
  11290. }
  11291. }
  11292. return intersectInfo;
  11293. };
  11294. // Clone
  11295. SubMesh.prototype.clone = function (newMesh, newRenderingMesh) {
  11296. var result = new SubMesh(this.materialIndex, this.verticesStart, this.verticesCount, this.indexStart, this.indexCount, newMesh, newRenderingMesh, false);
  11297. result._boundingInfo = new BABYLON.BoundingInfo(this._boundingInfo.minimum, this._boundingInfo.maximum);
  11298. return result;
  11299. };
  11300. // Dispose
  11301. SubMesh.prototype.dispose = function () {
  11302. if (this._linesIndexBuffer) {
  11303. this._mesh.getScene().getEngine()._releaseBuffer(this._linesIndexBuffer);
  11304. this._linesIndexBuffer = null;
  11305. }
  11306. // Remove from mesh
  11307. var index = this._mesh.subMeshes.indexOf(this);
  11308. this._mesh.subMeshes.splice(index, 1);
  11309. };
  11310. // Statics
  11311. SubMesh.CreateFromIndices = function (materialIndex, startIndex, indexCount, mesh, renderingMesh) {
  11312. var minVertexIndex = Number.MAX_VALUE;
  11313. var maxVertexIndex = -Number.MAX_VALUE;
  11314. renderingMesh = renderingMesh || mesh;
  11315. var indices = renderingMesh.getIndices();
  11316. for (var index = startIndex; index < startIndex + indexCount; index++) {
  11317. var vertexIndex = indices[index];
  11318. if (vertexIndex < minVertexIndex)
  11319. minVertexIndex = vertexIndex;
  11320. if (vertexIndex > maxVertexIndex)
  11321. maxVertexIndex = vertexIndex;
  11322. }
  11323. return new BABYLON.SubMesh(materialIndex, minVertexIndex, maxVertexIndex - minVertexIndex + 1, startIndex, indexCount, mesh, renderingMesh);
  11324. };
  11325. return SubMesh;
  11326. })();
  11327. BABYLON.SubMesh = SubMesh;
  11328. })(BABYLON || (BABYLON = {}));
  11329. //# sourceMappingURL=babylon.subMesh.js.mapvar BABYLON;
  11330. (function (BABYLON) {
  11331. var BaseTexture = (function () {
  11332. function BaseTexture(scene) {
  11333. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NONE;
  11334. this.hasAlpha = false;
  11335. this.getAlphaFromRGB = false;
  11336. this.level = 1;
  11337. this.isCube = false;
  11338. this.isRenderTarget = false;
  11339. this.animations = new Array();
  11340. this.coordinatesIndex = 0;
  11341. this.coordinatesMode = BABYLON.Texture.EXPLICIT_MODE;
  11342. this.wrapU = BABYLON.Texture.WRAP_ADDRESSMODE;
  11343. this.wrapV = BABYLON.Texture.WRAP_ADDRESSMODE;
  11344. this.anisotropicFilteringLevel = 4;
  11345. this._scene = scene;
  11346. this._scene.textures.push(this);
  11347. }
  11348. BaseTexture.prototype.getScene = function () {
  11349. return this._scene;
  11350. };
  11351. BaseTexture.prototype.getTextureMatrix = function () {
  11352. return null;
  11353. };
  11354. BaseTexture.prototype.getReflectionTextureMatrix = function () {
  11355. return null;
  11356. };
  11357. BaseTexture.prototype.getInternalTexture = function () {
  11358. return this._texture;
  11359. };
  11360. BaseTexture.prototype.isReady = function () {
  11361. if (this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) {
  11362. return true;
  11363. }
  11364. if (this._texture) {
  11365. return this._texture.isReady;
  11366. }
  11367. return false;
  11368. };
  11369. BaseTexture.prototype.getSize = function () {
  11370. if (this._texture._width) {
  11371. return { width: this._texture._width, height: this._texture._height };
  11372. }
  11373. if (this._texture._size) {
  11374. return { width: this._texture._size, height: this._texture._size };
  11375. }
  11376. return { width: 0, height: 0 };
  11377. };
  11378. BaseTexture.prototype.getBaseSize = function () {
  11379. if (!this.isReady())
  11380. return { width: 0, height: 0 };
  11381. if (this._texture._size) {
  11382. return { width: this._texture._size, height: this._texture._size };
  11383. }
  11384. return { width: this._texture._baseWidth, height: this._texture._baseHeight };
  11385. };
  11386. BaseTexture.prototype.scale = function (ratio) {
  11387. };
  11388. Object.defineProperty(BaseTexture.prototype, "canRescale", {
  11389. get: function () {
  11390. return false;
  11391. },
  11392. enumerable: true,
  11393. configurable: true
  11394. });
  11395. BaseTexture.prototype._removeFromCache = function (url, noMipmap) {
  11396. var texturesCache = this._scene.getEngine().getLoadedTexturesCache();
  11397. for (var index = 0; index < texturesCache.length; index++) {
  11398. var texturesCacheEntry = texturesCache[index];
  11399. if (texturesCacheEntry.url === url && texturesCacheEntry.noMipmap === noMipmap) {
  11400. texturesCache.splice(index, 1);
  11401. return;
  11402. }
  11403. }
  11404. };
  11405. BaseTexture.prototype._getFromCache = function (url, noMipmap, sampling) {
  11406. var texturesCache = this._scene.getEngine().getLoadedTexturesCache();
  11407. for (var index = 0; index < texturesCache.length; index++) {
  11408. var texturesCacheEntry = texturesCache[index];
  11409. if (texturesCacheEntry.url === url && texturesCacheEntry.noMipmap === noMipmap) {
  11410. if (!sampling || sampling === texturesCacheEntry.samplingMode) {
  11411. texturesCacheEntry.references++;
  11412. return texturesCacheEntry;
  11413. }
  11414. }
  11415. }
  11416. return null;
  11417. };
  11418. BaseTexture.prototype.delayLoad = function () {
  11419. };
  11420. BaseTexture.prototype.releaseInternalTexture = function () {
  11421. if (!this._texture) {
  11422. return;
  11423. }
  11424. var texturesCache = this._scene.getEngine().getLoadedTexturesCache();
  11425. this._texture.references--;
  11426. // Final reference ?
  11427. if (this._texture.references === 0) {
  11428. var index = texturesCache.indexOf(this._texture);
  11429. texturesCache.splice(index, 1);
  11430. this._scene.getEngine()._releaseTexture(this._texture);
  11431. delete this._texture;
  11432. }
  11433. };
  11434. BaseTexture.prototype.clone = function () {
  11435. return null;
  11436. };
  11437. BaseTexture.prototype.dispose = function () {
  11438. // Remove from scene
  11439. var index = this._scene.textures.indexOf(this);
  11440. if (index >= 0) {
  11441. this._scene.textures.splice(index, 1);
  11442. }
  11443. if (this._texture === undefined) {
  11444. return;
  11445. }
  11446. this.releaseInternalTexture();
  11447. // Callback
  11448. if (this.onDispose) {
  11449. this.onDispose();
  11450. }
  11451. };
  11452. return BaseTexture;
  11453. })();
  11454. BABYLON.BaseTexture = BaseTexture;
  11455. })(BABYLON || (BABYLON = {}));
  11456. //# sourceMappingURL=babylon.baseTexture.js.mapvar BABYLON;
  11457. (function (BABYLON) {
  11458. var RenderingGroup = (function () {
  11459. function RenderingGroup(index, scene) {
  11460. this.index = index;
  11461. this._opaqueSubMeshes = new BABYLON.SmartArray(256);
  11462. this._transparentSubMeshes = new BABYLON.SmartArray(256);
  11463. this._alphaTestSubMeshes = new BABYLON.SmartArray(256);
  11464. this._scene = scene;
  11465. }
  11466. RenderingGroup.prototype.render = function (customRenderFunction) {
  11467. if (customRenderFunction) {
  11468. customRenderFunction(this._opaqueSubMeshes, this._alphaTestSubMeshes, this._transparentSubMeshes);
  11469. return true;
  11470. }
  11471. if (this._opaqueSubMeshes.length === 0 && this._alphaTestSubMeshes.length === 0 && this._transparentSubMeshes.length === 0) {
  11472. return false;
  11473. }
  11474. var engine = this._scene.getEngine();
  11475. // Opaque
  11476. var subIndex;
  11477. var submesh;
  11478. for (subIndex = 0; subIndex < this._opaqueSubMeshes.length; subIndex++) {
  11479. submesh = this._opaqueSubMeshes.data[subIndex];
  11480. submesh.render();
  11481. }
  11482. // Alpha test
  11483. engine.setAlphaTesting(true);
  11484. for (subIndex = 0; subIndex < this._alphaTestSubMeshes.length; subIndex++) {
  11485. submesh = this._alphaTestSubMeshes.data[subIndex];
  11486. submesh.render();
  11487. }
  11488. engine.setAlphaTesting(false);
  11489. // Transparent
  11490. if (this._transparentSubMeshes.length) {
  11491. for (subIndex = 0; subIndex < this._transparentSubMeshes.length; subIndex++) {
  11492. submesh = this._transparentSubMeshes.data[subIndex];
  11493. submesh._alphaIndex = submesh.getMesh().alphaIndex;
  11494. submesh._distanceToCamera = submesh.getBoundingInfo().boundingSphere.centerWorld.subtract(this._scene.activeCamera.position).length();
  11495. }
  11496. var sortedArray = this._transparentSubMeshes.data.slice(0, this._transparentSubMeshes.length);
  11497. sortedArray.sort(function (a, b) {
  11498. // Alpha index first
  11499. if (a._alphaIndex > b._alphaIndex) {
  11500. return 1;
  11501. }
  11502. if (a._alphaIndex < b._alphaIndex) {
  11503. return -1;
  11504. }
  11505. // Then distance to camera
  11506. if (a._distanceToCamera < b._distanceToCamera) {
  11507. return 1;
  11508. }
  11509. if (a._distanceToCamera > b._distanceToCamera) {
  11510. return -1;
  11511. }
  11512. return 0;
  11513. });
  11514. // Rendering
  11515. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  11516. for (subIndex = 0; subIndex < sortedArray.length; subIndex++) {
  11517. submesh = sortedArray[subIndex];
  11518. submesh.render();
  11519. }
  11520. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  11521. }
  11522. return true;
  11523. };
  11524. RenderingGroup.prototype.prepare = function () {
  11525. this._opaqueSubMeshes.reset();
  11526. this._transparentSubMeshes.reset();
  11527. this._alphaTestSubMeshes.reset();
  11528. };
  11529. RenderingGroup.prototype.dispatch = function (subMesh) {
  11530. var material = subMesh.getMaterial();
  11531. var mesh = subMesh.getMesh();
  11532. if (material.needAlphaBlending() || mesh.visibility < 1.0 || mesh.hasVertexAlpha) {
  11533. this._transparentSubMeshes.push(subMesh);
  11534. }
  11535. else if (material.needAlphaTesting()) {
  11536. this._alphaTestSubMeshes.push(subMesh);
  11537. }
  11538. else {
  11539. this._opaqueSubMeshes.push(subMesh); // Opaque
  11540. }
  11541. };
  11542. return RenderingGroup;
  11543. })();
  11544. BABYLON.RenderingGroup = RenderingGroup;
  11545. })(BABYLON || (BABYLON = {}));
  11546. //# sourceMappingURL=babylon.renderingGroup.js.mapvar BABYLON;
  11547. (function (BABYLON) {
  11548. var RenderingManager = (function () {
  11549. function RenderingManager(scene) {
  11550. this._renderingGroups = new Array();
  11551. this._scene = scene;
  11552. }
  11553. RenderingManager.prototype._renderParticles = function (index, activeMeshes) {
  11554. if (this._scene._activeParticleSystems.length === 0) {
  11555. return;
  11556. }
  11557. // Particles
  11558. var beforeParticlesDate = BABYLON.Tools.Now;
  11559. for (var particleIndex = 0; particleIndex < this._scene._activeParticleSystems.length; particleIndex++) {
  11560. var particleSystem = this._scene._activeParticleSystems.data[particleIndex];
  11561. if (particleSystem.renderingGroupId !== index) {
  11562. continue;
  11563. }
  11564. this._clearDepthBuffer();
  11565. if (!particleSystem.emitter.position || !activeMeshes || activeMeshes.indexOf(particleSystem.emitter) !== -1) {
  11566. this._scene._activeParticles += particleSystem.render();
  11567. }
  11568. }
  11569. this._scene._particlesDuration += BABYLON.Tools.Now - beforeParticlesDate;
  11570. };
  11571. RenderingManager.prototype._renderSprites = function (index) {
  11572. if (this._scene.spriteManagers.length === 0) {
  11573. return;
  11574. }
  11575. // Sprites
  11576. var beforeSpritessDate = BABYLON.Tools.Now;
  11577. for (var id = 0; id < this._scene.spriteManagers.length; id++) {
  11578. var spriteManager = this._scene.spriteManagers[id];
  11579. if (spriteManager.renderingGroupId === index) {
  11580. this._clearDepthBuffer();
  11581. spriteManager.render();
  11582. }
  11583. }
  11584. this._scene._spritesDuration += BABYLON.Tools.Now - beforeSpritessDate;
  11585. };
  11586. RenderingManager.prototype._clearDepthBuffer = function () {
  11587. if (this._depthBufferAlreadyCleaned) {
  11588. return;
  11589. }
  11590. this._scene.getEngine().clear(0, false, true);
  11591. this._depthBufferAlreadyCleaned = true;
  11592. };
  11593. RenderingManager.prototype.render = function (customRenderFunction, activeMeshes, renderParticles, renderSprites) {
  11594. for (var index = 0; index < RenderingManager.MAX_RENDERINGGROUPS; index++) {
  11595. this._depthBufferAlreadyCleaned = false;
  11596. var renderingGroup = this._renderingGroups[index];
  11597. if (renderingGroup) {
  11598. this._clearDepthBuffer();
  11599. if (!renderingGroup.render(customRenderFunction)) {
  11600. this._renderingGroups.splice(index, 1);
  11601. }
  11602. }
  11603. if (renderSprites) {
  11604. this._renderSprites(index);
  11605. }
  11606. if (renderParticles) {
  11607. this._renderParticles(index, activeMeshes);
  11608. }
  11609. }
  11610. };
  11611. RenderingManager.prototype.reset = function () {
  11612. for (var index in this._renderingGroups) {
  11613. var renderingGroup = this._renderingGroups[index];
  11614. renderingGroup.prepare();
  11615. }
  11616. };
  11617. RenderingManager.prototype.dispatch = function (subMesh) {
  11618. var mesh = subMesh.getMesh();
  11619. var renderingGroupId = mesh.renderingGroupId || 0;
  11620. if (!this._renderingGroups[renderingGroupId]) {
  11621. this._renderingGroups[renderingGroupId] = new BABYLON.RenderingGroup(renderingGroupId, this._scene);
  11622. }
  11623. this._renderingGroups[renderingGroupId].dispatch(subMesh);
  11624. };
  11625. RenderingManager.MAX_RENDERINGGROUPS = 4;
  11626. return RenderingManager;
  11627. })();
  11628. BABYLON.RenderingManager = RenderingManager;
  11629. })(BABYLON || (BABYLON = {}));
  11630. //# sourceMappingURL=babylon.renderingManager.js.map
  11631. var BABYLON;
  11632. (function (BABYLON) {
  11633. var Texture = (function (_super) {
  11634. __extends(Texture, _super);
  11635. function Texture(url, scene, noMipmap, invertY, samplingMode, onLoad, onError, buffer, deleteBuffer) {
  11636. if (samplingMode === void 0) { samplingMode = Texture.TRILINEAR_SAMPLINGMODE; }
  11637. if (onLoad === void 0) { onLoad = null; }
  11638. if (onError === void 0) { onError = null; }
  11639. if (buffer === void 0) { buffer = null; }
  11640. if (deleteBuffer === void 0) { deleteBuffer = false; }
  11641. _super.call(this, scene);
  11642. this.uOffset = 0;
  11643. this.vOffset = 0;
  11644. this.uScale = 1.0;
  11645. this.vScale = 1.0;
  11646. this.uAng = 0;
  11647. this.vAng = 0;
  11648. this.wAng = 0;
  11649. this.name = url;
  11650. this.url = url;
  11651. this._noMipmap = noMipmap;
  11652. this._invertY = invertY;
  11653. this._samplingMode = samplingMode;
  11654. this._buffer = buffer;
  11655. this._deleteBuffer = deleteBuffer;
  11656. if (!url) {
  11657. return;
  11658. }
  11659. this._texture = this._getFromCache(url, noMipmap, samplingMode);
  11660. if (!this._texture) {
  11661. if (!scene.useDelayedTextureLoading) {
  11662. this._texture = scene.getEngine().createTexture(url, noMipmap, invertY, scene, this._samplingMode, onLoad, onError, this._buffer);
  11663. if (deleteBuffer) {
  11664. delete this._buffer;
  11665. }
  11666. }
  11667. else {
  11668. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NOTLOADED;
  11669. }
  11670. }
  11671. }
  11672. Texture.prototype.delayLoad = function () {
  11673. if (this.delayLoadState != BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) {
  11674. return;
  11675. }
  11676. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADED;
  11677. this._texture = this._getFromCache(this.url, this._noMipmap, this._samplingMode);
  11678. if (!this._texture) {
  11679. this._texture = this.getScene().getEngine().createTexture(this.url, this._noMipmap, this._invertY, this.getScene(), this._samplingMode, null, null, this._buffer);
  11680. if (this._deleteBuffer) {
  11681. delete this._buffer;
  11682. }
  11683. }
  11684. };
  11685. Texture.prototype._prepareRowForTextureGeneration = function (x, y, z, t) {
  11686. x -= this.uOffset + 0.5;
  11687. y -= this.vOffset + 0.5;
  11688. z -= 0.5;
  11689. BABYLON.Vector3.TransformCoordinatesFromFloatsToRef(x, y, z, this._rowGenerationMatrix, t);
  11690. t.x *= this.uScale;
  11691. t.y *= this.vScale;
  11692. t.x += 0.5;
  11693. t.y += 0.5;
  11694. t.z += 0.5;
  11695. };
  11696. Texture.prototype.getTextureMatrix = function () {
  11697. if (this.uOffset === this._cachedUOffset && this.vOffset === this._cachedVOffset && this.uScale === this._cachedUScale && this.vScale === this._cachedVScale && this.uAng === this._cachedUAng && this.vAng === this._cachedVAng && this.wAng === this._cachedWAng) {
  11698. return this._cachedTextureMatrix;
  11699. }
  11700. this._cachedUOffset = this.uOffset;
  11701. this._cachedVOffset = this.vOffset;
  11702. this._cachedUScale = this.uScale;
  11703. this._cachedVScale = this.vScale;
  11704. this._cachedUAng = this.uAng;
  11705. this._cachedVAng = this.vAng;
  11706. this._cachedWAng = this.wAng;
  11707. if (!this._cachedTextureMatrix) {
  11708. this._cachedTextureMatrix = BABYLON.Matrix.Zero();
  11709. this._rowGenerationMatrix = new BABYLON.Matrix();
  11710. this._t0 = BABYLON.Vector3.Zero();
  11711. this._t1 = BABYLON.Vector3.Zero();
  11712. this._t2 = BABYLON.Vector3.Zero();
  11713. }
  11714. BABYLON.Matrix.RotationYawPitchRollToRef(this.vAng, this.uAng, this.wAng, this._rowGenerationMatrix);
  11715. this._prepareRowForTextureGeneration(0, 0, 0, this._t0);
  11716. this._prepareRowForTextureGeneration(1.0, 0, 0, this._t1);
  11717. this._prepareRowForTextureGeneration(0, 1.0, 0, this._t2);
  11718. this._t1.subtractInPlace(this._t0);
  11719. this._t2.subtractInPlace(this._t0);
  11720. BABYLON.Matrix.IdentityToRef(this._cachedTextureMatrix);
  11721. this._cachedTextureMatrix.m[0] = this._t1.x;
  11722. this._cachedTextureMatrix.m[1] = this._t1.y;
  11723. this._cachedTextureMatrix.m[2] = this._t1.z;
  11724. this._cachedTextureMatrix.m[4] = this._t2.x;
  11725. this._cachedTextureMatrix.m[5] = this._t2.y;
  11726. this._cachedTextureMatrix.m[6] = this._t2.z;
  11727. this._cachedTextureMatrix.m[8] = this._t0.x;
  11728. this._cachedTextureMatrix.m[9] = this._t0.y;
  11729. this._cachedTextureMatrix.m[10] = this._t0.z;
  11730. return this._cachedTextureMatrix;
  11731. };
  11732. Texture.prototype.getReflectionTextureMatrix = function () {
  11733. if (this.uOffset === this._cachedUOffset && this.vOffset === this._cachedVOffset && this.uScale === this._cachedUScale && this.vScale === this._cachedVScale && this.coordinatesMode === this._cachedCoordinatesMode) {
  11734. return this._cachedTextureMatrix;
  11735. }
  11736. if (!this._cachedTextureMatrix) {
  11737. this._cachedTextureMatrix = BABYLON.Matrix.Zero();
  11738. this._projectionModeMatrix = BABYLON.Matrix.Zero();
  11739. }
  11740. this._cachedCoordinatesMode = this.coordinatesMode;
  11741. switch (this.coordinatesMode) {
  11742. case BABYLON.Texture.SPHERICAL_MODE:
  11743. BABYLON.Matrix.IdentityToRef(this._cachedTextureMatrix);
  11744. this._cachedTextureMatrix[0] = -0.5 * this.uScale;
  11745. this._cachedTextureMatrix[5] = -0.5 * this.vScale;
  11746. this._cachedTextureMatrix[12] = 0.5 + this.uOffset;
  11747. this._cachedTextureMatrix[13] = 0.5 + this.vOffset;
  11748. break;
  11749. case BABYLON.Texture.PLANAR_MODE:
  11750. BABYLON.Matrix.IdentityToRef(this._cachedTextureMatrix);
  11751. this._cachedTextureMatrix[0] = this.uScale;
  11752. this._cachedTextureMatrix[5] = this.vScale;
  11753. this._cachedTextureMatrix[12] = this.uOffset;
  11754. this._cachedTextureMatrix[13] = this.vOffset;
  11755. break;
  11756. case BABYLON.Texture.PROJECTION_MODE:
  11757. BABYLON.Matrix.IdentityToRef(this._projectionModeMatrix);
  11758. this._projectionModeMatrix.m[0] = 0.5;
  11759. this._projectionModeMatrix.m[5] = -0.5;
  11760. this._projectionModeMatrix.m[10] = 0.0;
  11761. this._projectionModeMatrix.m[12] = 0.5;
  11762. this._projectionModeMatrix.m[13] = 0.5;
  11763. this._projectionModeMatrix.m[14] = 1.0;
  11764. this._projectionModeMatrix.m[15] = 1.0;
  11765. this.getScene().getProjectionMatrix().multiplyToRef(this._projectionModeMatrix, this._cachedTextureMatrix);
  11766. break;
  11767. default:
  11768. BABYLON.Matrix.IdentityToRef(this._cachedTextureMatrix);
  11769. break;
  11770. }
  11771. return this._cachedTextureMatrix;
  11772. };
  11773. Texture.prototype.clone = function () {
  11774. var newTexture = new BABYLON.Texture(this._texture.url, this.getScene(), this._noMipmap, this._invertY, this._samplingMode);
  11775. // Base texture
  11776. newTexture.hasAlpha = this.hasAlpha;
  11777. newTexture.level = this.level;
  11778. newTexture.wrapU = this.wrapU;
  11779. newTexture.wrapV = this.wrapV;
  11780. newTexture.coordinatesIndex = this.coordinatesIndex;
  11781. newTexture.coordinatesMode = this.coordinatesMode;
  11782. // Texture
  11783. newTexture.uOffset = this.uOffset;
  11784. newTexture.vOffset = this.vOffset;
  11785. newTexture.uScale = this.uScale;
  11786. newTexture.vScale = this.vScale;
  11787. newTexture.uAng = this.uAng;
  11788. newTexture.vAng = this.vAng;
  11789. newTexture.wAng = this.wAng;
  11790. return newTexture;
  11791. };
  11792. // Statics
  11793. Texture.CreateFromBase64String = function (data, name, scene, noMipmap, invertY, samplingMode, onLoad, onError) {
  11794. if (samplingMode === void 0) { samplingMode = Texture.TRILINEAR_SAMPLINGMODE; }
  11795. if (onLoad === void 0) { onLoad = null; }
  11796. if (onError === void 0) { onError = null; }
  11797. return new Texture("data:" + name, scene, noMipmap, invertY, samplingMode, onLoad, onError, data);
  11798. };
  11799. // Constants
  11800. Texture.NEAREST_SAMPLINGMODE = 1;
  11801. Texture.BILINEAR_SAMPLINGMODE = 2;
  11802. Texture.TRILINEAR_SAMPLINGMODE = 3;
  11803. Texture.EXPLICIT_MODE = 0;
  11804. Texture.SPHERICAL_MODE = 1;
  11805. Texture.PLANAR_MODE = 2;
  11806. Texture.CUBIC_MODE = 3;
  11807. Texture.PROJECTION_MODE = 4;
  11808. Texture.SKYBOX_MODE = 5;
  11809. Texture.CLAMP_ADDRESSMODE = 0;
  11810. Texture.WRAP_ADDRESSMODE = 1;
  11811. Texture.MIRROR_ADDRESSMODE = 2;
  11812. return Texture;
  11813. })(BABYLON.BaseTexture);
  11814. BABYLON.Texture = Texture;
  11815. })(BABYLON || (BABYLON = {}));
  11816. //# sourceMappingURL=babylon.texture.js.map
  11817. var BABYLON;
  11818. (function (BABYLON) {
  11819. var CubeTexture = (function (_super) {
  11820. __extends(CubeTexture, _super);
  11821. function CubeTexture(rootUrl, scene, extensions, noMipmap) {
  11822. _super.call(this, scene);
  11823. this.coordinatesMode = BABYLON.Texture.CUBIC_MODE;
  11824. this.name = rootUrl;
  11825. this.url = rootUrl;
  11826. this._noMipmap = noMipmap;
  11827. this.hasAlpha = false;
  11828. this._texture = this._getFromCache(rootUrl, noMipmap);
  11829. if (!extensions) {
  11830. extensions = ["_px.jpg", "_py.jpg", "_pz.jpg", "_nx.jpg", "_ny.jpg", "_nz.jpg"];
  11831. }
  11832. this._extensions = extensions;
  11833. if (!this._texture) {
  11834. if (!scene.useDelayedTextureLoading) {
  11835. this._texture = scene.getEngine().createCubeTexture(rootUrl, scene, extensions, noMipmap);
  11836. }
  11837. else {
  11838. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NOTLOADED;
  11839. }
  11840. }
  11841. this.isCube = true;
  11842. this._textureMatrix = BABYLON.Matrix.Identity();
  11843. }
  11844. CubeTexture.prototype.clone = function () {
  11845. var newTexture = new BABYLON.CubeTexture(this.url, this.getScene(), this._extensions, this._noMipmap);
  11846. // Base texture
  11847. newTexture.level = this.level;
  11848. newTexture.wrapU = this.wrapU;
  11849. newTexture.wrapV = this.wrapV;
  11850. newTexture.coordinatesIndex = this.coordinatesIndex;
  11851. newTexture.coordinatesMode = this.coordinatesMode;
  11852. return newTexture;
  11853. };
  11854. // Methods
  11855. CubeTexture.prototype.delayLoad = function () {
  11856. if (this.delayLoadState != BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) {
  11857. return;
  11858. }
  11859. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADED;
  11860. this._texture = this._getFromCache(this.url, this._noMipmap);
  11861. if (!this._texture) {
  11862. this._texture = this.getScene().getEngine().createCubeTexture(this.url, this.getScene(), this._extensions);
  11863. }
  11864. };
  11865. CubeTexture.prototype.getReflectionTextureMatrix = function () {
  11866. return this._textureMatrix;
  11867. };
  11868. return CubeTexture;
  11869. })(BABYLON.BaseTexture);
  11870. BABYLON.CubeTexture = CubeTexture;
  11871. })(BABYLON || (BABYLON = {}));
  11872. //# sourceMappingURL=babylon.cubeTexture.js.map
  11873. var BABYLON;
  11874. (function (BABYLON) {
  11875. var RenderTargetTexture = (function (_super) {
  11876. __extends(RenderTargetTexture, _super);
  11877. function RenderTargetTexture(name, size, scene, generateMipMaps, doNotChangeAspectRatio, type) {
  11878. if (doNotChangeAspectRatio === void 0) { doNotChangeAspectRatio = true; }
  11879. if (type === void 0) { type = BABYLON.Engine.TEXTURETYPE_UNSIGNED_INT; }
  11880. _super.call(this, null, scene, !generateMipMaps);
  11881. this.renderList = new Array();
  11882. this.renderParticles = true;
  11883. this.renderSprites = false;
  11884. this.coordinatesMode = BABYLON.Texture.PROJECTION_MODE;
  11885. this._currentRefreshId = -1;
  11886. this._refreshRate = 1;
  11887. this.name = name;
  11888. this.isRenderTarget = true;
  11889. this._size = size;
  11890. this._generateMipMaps = generateMipMaps;
  11891. this._doNotChangeAspectRatio = doNotChangeAspectRatio;
  11892. this._texture = scene.getEngine().createRenderTargetTexture(size, { generateMipMaps: generateMipMaps, type: type });
  11893. // Rendering groups
  11894. this._renderingManager = new BABYLON.RenderingManager(scene);
  11895. }
  11896. RenderTargetTexture.prototype.resetRefreshCounter = function () {
  11897. this._currentRefreshId = -1;
  11898. };
  11899. Object.defineProperty(RenderTargetTexture.prototype, "refreshRate", {
  11900. get: function () {
  11901. return this._refreshRate;
  11902. },
  11903. // Use 0 to render just once, 1 to render on every frame, 2 to render every two frames and so on...
  11904. set: function (value) {
  11905. this._refreshRate = value;
  11906. this.resetRefreshCounter();
  11907. },
  11908. enumerable: true,
  11909. configurable: true
  11910. });
  11911. RenderTargetTexture.prototype._shouldRender = function () {
  11912. if (this._currentRefreshId === -1) {
  11913. this._currentRefreshId = 1;
  11914. return true;
  11915. }
  11916. if (this.refreshRate === this._currentRefreshId) {
  11917. this._currentRefreshId = 1;
  11918. return true;
  11919. }
  11920. this._currentRefreshId++;
  11921. return false;
  11922. };
  11923. RenderTargetTexture.prototype.isReady = function () {
  11924. if (!this.getScene().renderTargetsEnabled) {
  11925. return false;
  11926. }
  11927. return _super.prototype.isReady.call(this);
  11928. };
  11929. RenderTargetTexture.prototype.getRenderSize = function () {
  11930. return this._size;
  11931. };
  11932. Object.defineProperty(RenderTargetTexture.prototype, "canRescale", {
  11933. get: function () {
  11934. return true;
  11935. },
  11936. enumerable: true,
  11937. configurable: true
  11938. });
  11939. RenderTargetTexture.prototype.scale = function (ratio) {
  11940. var newSize = this._size * ratio;
  11941. this.resize(newSize, this._generateMipMaps);
  11942. };
  11943. RenderTargetTexture.prototype.resize = function (size, generateMipMaps) {
  11944. this.releaseInternalTexture();
  11945. this._texture = this.getScene().getEngine().createRenderTargetTexture(size, generateMipMaps);
  11946. };
  11947. RenderTargetTexture.prototype.render = function (useCameraPostProcess) {
  11948. var scene = this.getScene();
  11949. var engine = scene.getEngine();
  11950. if (!this.activeCamera) {
  11951. this.activeCamera = scene.activeCamera;
  11952. }
  11953. if (this._waitingRenderList) {
  11954. this.renderList = [];
  11955. for (var index = 0; index < this._waitingRenderList.length; index++) {
  11956. var id = this._waitingRenderList[index];
  11957. this.renderList.push(scene.getMeshByID(id));
  11958. }
  11959. delete this._waitingRenderList;
  11960. }
  11961. if (this.renderList && this.renderList.length === 0) {
  11962. return;
  11963. }
  11964. // Bind
  11965. if (!useCameraPostProcess || !scene.postProcessManager._prepareFrame(this._texture)) {
  11966. engine.bindFramebuffer(this._texture);
  11967. }
  11968. this._renderingManager.reset();
  11969. var currentRenderList = this.renderList ? this.renderList : scene.getActiveMeshes().data;
  11970. for (var meshIndex = 0; meshIndex < currentRenderList.length; meshIndex++) {
  11971. var mesh = currentRenderList[meshIndex];
  11972. if (mesh) {
  11973. if (!mesh.isReady()) {
  11974. // Reset _currentRefreshId
  11975. this.resetRefreshCounter();
  11976. continue;
  11977. }
  11978. if (mesh.isEnabled() && mesh.isVisible && mesh.subMeshes && ((mesh.layerMask & scene.activeCamera.layerMask) !== 0)) {
  11979. mesh._activate(scene.getRenderId());
  11980. for (var subIndex = 0; subIndex < mesh.subMeshes.length; subIndex++) {
  11981. var subMesh = mesh.subMeshes[subIndex];
  11982. scene._activeVertices += subMesh.indexCount;
  11983. this._renderingManager.dispatch(subMesh);
  11984. }
  11985. }
  11986. }
  11987. }
  11988. if (this.onBeforeRender) {
  11989. this.onBeforeRender();
  11990. }
  11991. // Clear
  11992. engine.clear(scene.clearColor, true, true);
  11993. if (!this._doNotChangeAspectRatio) {
  11994. scene.updateTransformMatrix(true);
  11995. }
  11996. // Render
  11997. this._renderingManager.render(this.customRenderFunction, currentRenderList, this.renderParticles, this.renderSprites);
  11998. if (useCameraPostProcess) {
  11999. scene.postProcessManager._finalizeFrame(false, this._texture);
  12000. }
  12001. if (!this._doNotChangeAspectRatio) {
  12002. scene.updateTransformMatrix(true);
  12003. }
  12004. if (this.onAfterRender) {
  12005. this.onAfterRender();
  12006. }
  12007. // Unbind
  12008. engine.unBindFramebuffer(this._texture);
  12009. };
  12010. RenderTargetTexture.prototype.clone = function () {
  12011. var textureSize = this.getSize();
  12012. var newTexture = new RenderTargetTexture(this.name, textureSize.width, this.getScene(), this._generateMipMaps);
  12013. // Base texture
  12014. newTexture.hasAlpha = this.hasAlpha;
  12015. newTexture.level = this.level;
  12016. // RenderTarget Texture
  12017. newTexture.coordinatesMode = this.coordinatesMode;
  12018. newTexture.renderList = this.renderList.slice(0);
  12019. return newTexture;
  12020. };
  12021. return RenderTargetTexture;
  12022. })(BABYLON.Texture);
  12023. BABYLON.RenderTargetTexture = RenderTargetTexture;
  12024. })(BABYLON || (BABYLON = {}));
  12025. //# sourceMappingURL=babylon.renderTargetTexture.js.map
  12026. var BABYLON;
  12027. (function (BABYLON) {
  12028. var ProceduralTexture = (function (_super) {
  12029. __extends(ProceduralTexture, _super);
  12030. function ProceduralTexture(name, size, fragment, scene, fallbackTexture, generateMipMaps) {
  12031. if (generateMipMaps === void 0) { generateMipMaps = true; }
  12032. _super.call(this, null, scene, !generateMipMaps);
  12033. this._currentRefreshId = -1;
  12034. this._refreshRate = 1;
  12035. this._vertexDeclaration = [2];
  12036. this._vertexStrideSize = 2 * 4;
  12037. this._uniforms = new Array();
  12038. this._samplers = new Array();
  12039. this._textures = new Array();
  12040. this._floats = new Array();
  12041. this._floatsArrays = {};
  12042. this._colors3 = new Array();
  12043. this._colors4 = new Array();
  12044. this._vectors2 = new Array();
  12045. this._vectors3 = new Array();
  12046. this._matrices = new Array();
  12047. this._fallbackTextureUsed = false;
  12048. scene._proceduralTextures.push(this);
  12049. this.name = name;
  12050. this.isRenderTarget = true;
  12051. this._size = size;
  12052. this._generateMipMaps = generateMipMaps;
  12053. this.setFragment(fragment);
  12054. this._fallbackTexture = fallbackTexture;
  12055. this._texture = scene.getEngine().createRenderTargetTexture(size, generateMipMaps);
  12056. // VBO
  12057. var vertices = [];
  12058. vertices.push(1, 1);
  12059. vertices.push(-1, 1);
  12060. vertices.push(-1, -1);
  12061. vertices.push(1, -1);
  12062. this._vertexBuffer = scene.getEngine().createVertexBuffer(vertices);
  12063. // Indices
  12064. var indices = [];
  12065. indices.push(0);
  12066. indices.push(1);
  12067. indices.push(2);
  12068. indices.push(0);
  12069. indices.push(2);
  12070. indices.push(3);
  12071. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  12072. }
  12073. ProceduralTexture.prototype.reset = function () {
  12074. if (this._effect === undefined) {
  12075. return;
  12076. }
  12077. var engine = this.getScene().getEngine();
  12078. engine._releaseEffect(this._effect);
  12079. };
  12080. ProceduralTexture.prototype.isReady = function () {
  12081. var _this = this;
  12082. var engine = this.getScene().getEngine();
  12083. var shaders;
  12084. if (!this._fragment) {
  12085. return false;
  12086. }
  12087. if (this._fallbackTextureUsed) {
  12088. return true;
  12089. }
  12090. if (this._fragment.fragmentElement !== undefined) {
  12091. shaders = { vertex: "procedural", fragmentElement: this._fragment.fragmentElement };
  12092. }
  12093. else {
  12094. shaders = { vertex: "procedural", fragment: this._fragment };
  12095. }
  12096. this._effect = engine.createEffect(shaders, ["position"], this._uniforms, this._samplers, "", null, null, function () {
  12097. _this.releaseInternalTexture();
  12098. if (_this._fallbackTexture) {
  12099. _this._texture = _this._fallbackTexture._texture;
  12100. _this._texture.references++;
  12101. }
  12102. _this._fallbackTextureUsed = true;
  12103. });
  12104. return this._effect.isReady();
  12105. };
  12106. ProceduralTexture.prototype.resetRefreshCounter = function () {
  12107. this._currentRefreshId = -1;
  12108. };
  12109. ProceduralTexture.prototype.setFragment = function (fragment) {
  12110. this._fragment = fragment;
  12111. };
  12112. Object.defineProperty(ProceduralTexture.prototype, "refreshRate", {
  12113. get: function () {
  12114. return this._refreshRate;
  12115. },
  12116. // Use 0 to render just once, 1 to render on every frame, 2 to render every two frames and so on...
  12117. set: function (value) {
  12118. this._refreshRate = value;
  12119. this.resetRefreshCounter();
  12120. },
  12121. enumerable: true,
  12122. configurable: true
  12123. });
  12124. ProceduralTexture.prototype._shouldRender = function () {
  12125. if (!this.isReady() || !this._texture) {
  12126. return false;
  12127. }
  12128. if (this._fallbackTextureUsed) {
  12129. return false;
  12130. }
  12131. if (this._currentRefreshId === -1) {
  12132. this._currentRefreshId = 1;
  12133. return true;
  12134. }
  12135. if (this.refreshRate === this._currentRefreshId) {
  12136. this._currentRefreshId = 1;
  12137. return true;
  12138. }
  12139. this._currentRefreshId++;
  12140. return false;
  12141. };
  12142. ProceduralTexture.prototype.getRenderSize = function () {
  12143. return this._size;
  12144. };
  12145. ProceduralTexture.prototype.resize = function (size, generateMipMaps) {
  12146. if (this._fallbackTextureUsed) {
  12147. return;
  12148. }
  12149. this.releaseInternalTexture();
  12150. this._texture = this.getScene().getEngine().createRenderTargetTexture(size, generateMipMaps);
  12151. };
  12152. ProceduralTexture.prototype._checkUniform = function (uniformName) {
  12153. if (this._uniforms.indexOf(uniformName) === -1) {
  12154. this._uniforms.push(uniformName);
  12155. }
  12156. };
  12157. ProceduralTexture.prototype.setTexture = function (name, texture) {
  12158. if (this._samplers.indexOf(name) === -1) {
  12159. this._samplers.push(name);
  12160. }
  12161. this._textures[name] = texture;
  12162. return this;
  12163. };
  12164. ProceduralTexture.prototype.setFloat = function (name, value) {
  12165. this._checkUniform(name);
  12166. this._floats[name] = value;
  12167. return this;
  12168. };
  12169. ProceduralTexture.prototype.setFloats = function (name, value) {
  12170. this._checkUniform(name);
  12171. this._floatsArrays[name] = value;
  12172. return this;
  12173. };
  12174. ProceduralTexture.prototype.setColor3 = function (name, value) {
  12175. this._checkUniform(name);
  12176. this._colors3[name] = value;
  12177. return this;
  12178. };
  12179. ProceduralTexture.prototype.setColor4 = function (name, value) {
  12180. this._checkUniform(name);
  12181. this._colors4[name] = value;
  12182. return this;
  12183. };
  12184. ProceduralTexture.prototype.setVector2 = function (name, value) {
  12185. this._checkUniform(name);
  12186. this._vectors2[name] = value;
  12187. return this;
  12188. };
  12189. ProceduralTexture.prototype.setVector3 = function (name, value) {
  12190. this._checkUniform(name);
  12191. this._vectors3[name] = value;
  12192. return this;
  12193. };
  12194. ProceduralTexture.prototype.setMatrix = function (name, value) {
  12195. this._checkUniform(name);
  12196. this._matrices[name] = value;
  12197. return this;
  12198. };
  12199. ProceduralTexture.prototype.render = function (useCameraPostProcess) {
  12200. var scene = this.getScene();
  12201. var engine = scene.getEngine();
  12202. engine.bindFramebuffer(this._texture);
  12203. // Clear
  12204. engine.clear(scene.clearColor, true, true);
  12205. // Render
  12206. engine.enableEffect(this._effect);
  12207. engine.setState(false);
  12208. for (var name in this._textures) {
  12209. this._effect.setTexture(name, this._textures[name]);
  12210. }
  12211. for (name in this._floats) {
  12212. this._effect.setFloat(name, this._floats[name]);
  12213. }
  12214. for (name in this._floatsArrays) {
  12215. this._effect.setArray(name, this._floatsArrays[name]);
  12216. }
  12217. for (name in this._colors3) {
  12218. this._effect.setColor3(name, this._colors3[name]);
  12219. }
  12220. for (name in this._colors4) {
  12221. var color = this._colors4[name];
  12222. this._effect.setFloat4(name, color.r, color.g, color.b, color.a);
  12223. }
  12224. for (name in this._vectors2) {
  12225. this._effect.setVector2(name, this._vectors2[name]);
  12226. }
  12227. for (name in this._vectors3) {
  12228. this._effect.setVector3(name, this._vectors3[name]);
  12229. }
  12230. for (name in this._matrices) {
  12231. this._effect.setMatrix(name, this._matrices[name]);
  12232. }
  12233. // VBOs
  12234. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, this._effect);
  12235. // Draw order
  12236. engine.draw(true, 0, 6);
  12237. // Unbind
  12238. engine.unBindFramebuffer(this._texture);
  12239. };
  12240. ProceduralTexture.prototype.clone = function () {
  12241. var textureSize = this.getSize();
  12242. var newTexture = new ProceduralTexture(this.name, textureSize.width, this._fragment, this.getScene(), this._fallbackTexture, this._generateMipMaps);
  12243. // Base texture
  12244. newTexture.hasAlpha = this.hasAlpha;
  12245. newTexture.level = this.level;
  12246. // RenderTarget Texture
  12247. newTexture.coordinatesMode = this.coordinatesMode;
  12248. return newTexture;
  12249. };
  12250. ProceduralTexture.prototype.dispose = function () {
  12251. var index = this.getScene()._proceduralTextures.indexOf(this);
  12252. if (index >= 0) {
  12253. this.getScene()._proceduralTextures.splice(index, 1);
  12254. }
  12255. _super.prototype.dispose.call(this);
  12256. };
  12257. return ProceduralTexture;
  12258. })(BABYLON.Texture);
  12259. BABYLON.ProceduralTexture = ProceduralTexture;
  12260. })(BABYLON || (BABYLON = {}));
  12261. //# sourceMappingURL=babylon.proceduralTexture.js.map
  12262. var BABYLON;
  12263. (function (BABYLON) {
  12264. var WoodProceduralTexture = (function (_super) {
  12265. __extends(WoodProceduralTexture, _super);
  12266. function WoodProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  12267. _super.call(this, name, size, "wood", scene, fallbackTexture, generateMipMaps);
  12268. this._ampScale = 100.0;
  12269. this._woodColor = new BABYLON.Color3(0.32, 0.17, 0.09);
  12270. this.updateShaderUniforms();
  12271. this.refreshRate = 0;
  12272. }
  12273. WoodProceduralTexture.prototype.updateShaderUniforms = function () {
  12274. this.setFloat("ampScale", this._ampScale);
  12275. this.setColor3("woodColor", this._woodColor);
  12276. };
  12277. Object.defineProperty(WoodProceduralTexture.prototype, "ampScale", {
  12278. get: function () {
  12279. return this._ampScale;
  12280. },
  12281. set: function (value) {
  12282. this._ampScale = value;
  12283. this.updateShaderUniforms();
  12284. },
  12285. enumerable: true,
  12286. configurable: true
  12287. });
  12288. Object.defineProperty(WoodProceduralTexture.prototype, "woodColor", {
  12289. get: function () {
  12290. return this._woodColor;
  12291. },
  12292. set: function (value) {
  12293. this._woodColor = value;
  12294. this.updateShaderUniforms();
  12295. },
  12296. enumerable: true,
  12297. configurable: true
  12298. });
  12299. return WoodProceduralTexture;
  12300. })(BABYLON.ProceduralTexture);
  12301. BABYLON.WoodProceduralTexture = WoodProceduralTexture;
  12302. var FireProceduralTexture = (function (_super) {
  12303. __extends(FireProceduralTexture, _super);
  12304. function FireProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  12305. _super.call(this, name, size, "fire", scene, fallbackTexture, generateMipMaps);
  12306. this._time = 0.0;
  12307. this._speed = new BABYLON.Vector2(0.5, 0.3);
  12308. this._shift = 1.6;
  12309. this._autoGenerateTime = true;
  12310. this._alphaThreshold = 0.5;
  12311. this._fireColors = FireProceduralTexture.RedFireColors;
  12312. this.updateShaderUniforms();
  12313. this.refreshRate = 1;
  12314. }
  12315. FireProceduralTexture.prototype.updateShaderUniforms = function () {
  12316. this.setFloat("time", this._time);
  12317. this.setVector2("speed", this._speed);
  12318. this.setFloat("shift", this._shift);
  12319. this.setColor3("c1", this._fireColors[0]);
  12320. this.setColor3("c2", this._fireColors[1]);
  12321. this.setColor3("c3", this._fireColors[2]);
  12322. this.setColor3("c4", this._fireColors[3]);
  12323. this.setColor3("c5", this._fireColors[4]);
  12324. this.setColor3("c6", this._fireColors[5]);
  12325. this.setFloat("alphaThreshold", this._alphaThreshold);
  12326. };
  12327. FireProceduralTexture.prototype.render = function (useCameraPostProcess) {
  12328. if (this._autoGenerateTime) {
  12329. this._time += this.getScene().getAnimationRatio() * 0.03;
  12330. this.updateShaderUniforms();
  12331. }
  12332. _super.prototype.render.call(this, useCameraPostProcess);
  12333. };
  12334. Object.defineProperty(FireProceduralTexture, "PurpleFireColors", {
  12335. get: function () {
  12336. return [
  12337. new BABYLON.Color3(0.5, 0.0, 1.0),
  12338. new BABYLON.Color3(0.9, 0.0, 1.0),
  12339. new BABYLON.Color3(0.2, 0.0, 1.0),
  12340. new BABYLON.Color3(1.0, 0.9, 1.0),
  12341. new BABYLON.Color3(0.1, 0.1, 1.0),
  12342. new BABYLON.Color3(0.9, 0.9, 1.0)
  12343. ];
  12344. },
  12345. enumerable: true,
  12346. configurable: true
  12347. });
  12348. Object.defineProperty(FireProceduralTexture, "GreenFireColors", {
  12349. get: function () {
  12350. return [
  12351. new BABYLON.Color3(0.5, 1.0, 0.0),
  12352. new BABYLON.Color3(0.5, 1.0, 0.0),
  12353. new BABYLON.Color3(0.3, 0.4, 0.0),
  12354. new BABYLON.Color3(0.5, 1.0, 0.0),
  12355. new BABYLON.Color3(0.2, 0.0, 0.0),
  12356. new BABYLON.Color3(0.5, 1.0, 0.0)
  12357. ];
  12358. },
  12359. enumerable: true,
  12360. configurable: true
  12361. });
  12362. Object.defineProperty(FireProceduralTexture, "RedFireColors", {
  12363. get: function () {
  12364. return [
  12365. new BABYLON.Color3(0.5, 0.0, 0.1),
  12366. new BABYLON.Color3(0.9, 0.0, 0.0),
  12367. new BABYLON.Color3(0.2, 0.0, 0.0),
  12368. new BABYLON.Color3(1.0, 0.9, 0.0),
  12369. new BABYLON.Color3(0.1, 0.1, 0.1),
  12370. new BABYLON.Color3(0.9, 0.9, 0.9)
  12371. ];
  12372. },
  12373. enumerable: true,
  12374. configurable: true
  12375. });
  12376. Object.defineProperty(FireProceduralTexture, "BlueFireColors", {
  12377. get: function () {
  12378. return [
  12379. new BABYLON.Color3(0.1, 0.0, 0.5),
  12380. new BABYLON.Color3(0.0, 0.0, 0.5),
  12381. new BABYLON.Color3(0.1, 0.0, 0.2),
  12382. new BABYLON.Color3(0.0, 0.0, 1.0),
  12383. new BABYLON.Color3(0.1, 0.2, 0.3),
  12384. new BABYLON.Color3(0.0, 0.2, 0.9)
  12385. ];
  12386. },
  12387. enumerable: true,
  12388. configurable: true
  12389. });
  12390. Object.defineProperty(FireProceduralTexture.prototype, "fireColors", {
  12391. get: function () {
  12392. return this._fireColors;
  12393. },
  12394. set: function (value) {
  12395. this._fireColors = value;
  12396. this.updateShaderUniforms();
  12397. },
  12398. enumerable: true,
  12399. configurable: true
  12400. });
  12401. Object.defineProperty(FireProceduralTexture.prototype, "time", {
  12402. get: function () {
  12403. return this._time;
  12404. },
  12405. set: function (value) {
  12406. this._time = value;
  12407. this.updateShaderUniforms();
  12408. },
  12409. enumerable: true,
  12410. configurable: true
  12411. });
  12412. Object.defineProperty(FireProceduralTexture.prototype, "speed", {
  12413. get: function () {
  12414. return this._speed;
  12415. },
  12416. set: function (value) {
  12417. this._speed = value;
  12418. this.updateShaderUniforms();
  12419. },
  12420. enumerable: true,
  12421. configurable: true
  12422. });
  12423. Object.defineProperty(FireProceduralTexture.prototype, "shift", {
  12424. get: function () {
  12425. return this._shift;
  12426. },
  12427. set: function (value) {
  12428. this._shift = value;
  12429. this.updateShaderUniforms();
  12430. },
  12431. enumerable: true,
  12432. configurable: true
  12433. });
  12434. Object.defineProperty(FireProceduralTexture.prototype, "alphaThreshold", {
  12435. get: function () {
  12436. return this._alphaThreshold;
  12437. },
  12438. set: function (value) {
  12439. this._alphaThreshold = value;
  12440. this.updateShaderUniforms();
  12441. },
  12442. enumerable: true,
  12443. configurable: true
  12444. });
  12445. return FireProceduralTexture;
  12446. })(BABYLON.ProceduralTexture);
  12447. BABYLON.FireProceduralTexture = FireProceduralTexture;
  12448. var CloudProceduralTexture = (function (_super) {
  12449. __extends(CloudProceduralTexture, _super);
  12450. function CloudProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  12451. _super.call(this, name, size, "cloud", scene, fallbackTexture, generateMipMaps);
  12452. this._skyColor = new BABYLON.Color3(0.15, 0.68, 1.0);
  12453. this._cloudColor = new BABYLON.Color3(1, 1, 1);
  12454. this.updateShaderUniforms();
  12455. this.refreshRate = 0;
  12456. }
  12457. CloudProceduralTexture.prototype.updateShaderUniforms = function () {
  12458. this.setColor3("skyColor", this._skyColor);
  12459. this.setColor3("cloudColor", this._cloudColor);
  12460. };
  12461. Object.defineProperty(CloudProceduralTexture.prototype, "skyColor", {
  12462. get: function () {
  12463. return this._skyColor;
  12464. },
  12465. set: function (value) {
  12466. this._skyColor = value;
  12467. this.updateShaderUniforms();
  12468. },
  12469. enumerable: true,
  12470. configurable: true
  12471. });
  12472. Object.defineProperty(CloudProceduralTexture.prototype, "cloudColor", {
  12473. get: function () {
  12474. return this._cloudColor;
  12475. },
  12476. set: function (value) {
  12477. this._cloudColor = value;
  12478. this.updateShaderUniforms();
  12479. },
  12480. enumerable: true,
  12481. configurable: true
  12482. });
  12483. return CloudProceduralTexture;
  12484. })(BABYLON.ProceduralTexture);
  12485. BABYLON.CloudProceduralTexture = CloudProceduralTexture;
  12486. var GrassProceduralTexture = (function (_super) {
  12487. __extends(GrassProceduralTexture, _super);
  12488. function GrassProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  12489. _super.call(this, name, size, "grass", scene, fallbackTexture, generateMipMaps);
  12490. this._herb1 = new BABYLON.Color3(0.29, 0.38, 0.02);
  12491. this._herb2 = new BABYLON.Color3(0.36, 0.49, 0.09);
  12492. this._herb3 = new BABYLON.Color3(0.51, 0.6, 0.28);
  12493. this._groundColor = new BABYLON.Color3(1, 1, 1);
  12494. this._grassColors = [
  12495. new BABYLON.Color3(0.29, 0.38, 0.02),
  12496. new BABYLON.Color3(0.36, 0.49, 0.09),
  12497. new BABYLON.Color3(0.51, 0.6, 0.28)
  12498. ];
  12499. this.updateShaderUniforms();
  12500. this.refreshRate = 0;
  12501. }
  12502. GrassProceduralTexture.prototype.updateShaderUniforms = function () {
  12503. this.setColor3("herb1Color", this._grassColors[0]);
  12504. this.setColor3("herb2Color", this._grassColors[1]);
  12505. this.setColor3("herb3Color", this._grassColors[2]);
  12506. this.setColor3("groundColor", this._groundColor);
  12507. };
  12508. Object.defineProperty(GrassProceduralTexture.prototype, "grassColors", {
  12509. get: function () {
  12510. return this._grassColors;
  12511. },
  12512. set: function (value) {
  12513. this._grassColors = value;
  12514. this.updateShaderUniforms();
  12515. },
  12516. enumerable: true,
  12517. configurable: true
  12518. });
  12519. Object.defineProperty(GrassProceduralTexture.prototype, "groundColor", {
  12520. get: function () {
  12521. return this._groundColor;
  12522. },
  12523. set: function (value) {
  12524. this.groundColor = value;
  12525. this.updateShaderUniforms();
  12526. },
  12527. enumerable: true,
  12528. configurable: true
  12529. });
  12530. return GrassProceduralTexture;
  12531. })(BABYLON.ProceduralTexture);
  12532. BABYLON.GrassProceduralTexture = GrassProceduralTexture;
  12533. var RoadProceduralTexture = (function (_super) {
  12534. __extends(RoadProceduralTexture, _super);
  12535. function RoadProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  12536. _super.call(this, name, size, "road", scene, fallbackTexture, generateMipMaps);
  12537. this._roadColor = new BABYLON.Color3(0.53, 0.53, 0.53);
  12538. this.updateShaderUniforms();
  12539. this.refreshRate = 0;
  12540. }
  12541. RoadProceduralTexture.prototype.updateShaderUniforms = function () {
  12542. this.setColor3("roadColor", this._roadColor);
  12543. };
  12544. Object.defineProperty(RoadProceduralTexture.prototype, "roadColor", {
  12545. get: function () {
  12546. return this._roadColor;
  12547. },
  12548. set: function (value) {
  12549. this._roadColor = value;
  12550. this.updateShaderUniforms();
  12551. },
  12552. enumerable: true,
  12553. configurable: true
  12554. });
  12555. return RoadProceduralTexture;
  12556. })(BABYLON.ProceduralTexture);
  12557. BABYLON.RoadProceduralTexture = RoadProceduralTexture;
  12558. var BrickProceduralTexture = (function (_super) {
  12559. __extends(BrickProceduralTexture, _super);
  12560. function BrickProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  12561. _super.call(this, name, size, "brick", scene, fallbackTexture, generateMipMaps);
  12562. this._numberOfBricksHeight = 15;
  12563. this._numberOfBricksWidth = 5;
  12564. this._jointColor = new BABYLON.Color3(0.72, 0.72, 0.72);
  12565. this._brickColor = new BABYLON.Color3(0.77, 0.47, 0.40);
  12566. this.updateShaderUniforms();
  12567. this.refreshRate = 0;
  12568. }
  12569. BrickProceduralTexture.prototype.updateShaderUniforms = function () {
  12570. this.setFloat("numberOfBricksHeight", this._numberOfBricksHeight);
  12571. this.setFloat("numberOfBricksWidth", this._numberOfBricksWidth);
  12572. this.setColor3("brickColor", this._brickColor);
  12573. this.setColor3("jointColor", this._jointColor);
  12574. };
  12575. Object.defineProperty(BrickProceduralTexture.prototype, "numberOfBricksHeight", {
  12576. get: function () {
  12577. return this._numberOfBricksHeight;
  12578. },
  12579. enumerable: true,
  12580. configurable: true
  12581. });
  12582. Object.defineProperty(BrickProceduralTexture.prototype, "cloudColor", {
  12583. set: function (value) {
  12584. this._numberOfBricksHeight = value;
  12585. this.updateShaderUniforms();
  12586. },
  12587. enumerable: true,
  12588. configurable: true
  12589. });
  12590. Object.defineProperty(BrickProceduralTexture.prototype, "numberOfBricksWidth", {
  12591. get: function () {
  12592. return this._numberOfBricksWidth;
  12593. },
  12594. set: function (value) {
  12595. this._numberOfBricksHeight = value;
  12596. this.updateShaderUniforms();
  12597. },
  12598. enumerable: true,
  12599. configurable: true
  12600. });
  12601. Object.defineProperty(BrickProceduralTexture.prototype, "jointColor", {
  12602. get: function () {
  12603. return this._jointColor;
  12604. },
  12605. set: function (value) {
  12606. this._jointColor = value;
  12607. this.updateShaderUniforms();
  12608. },
  12609. enumerable: true,
  12610. configurable: true
  12611. });
  12612. Object.defineProperty(BrickProceduralTexture.prototype, "brickColor", {
  12613. get: function () {
  12614. return this._brickColor;
  12615. },
  12616. set: function (value) {
  12617. this._brickColor = value;
  12618. this.updateShaderUniforms();
  12619. },
  12620. enumerable: true,
  12621. configurable: true
  12622. });
  12623. return BrickProceduralTexture;
  12624. })(BABYLON.ProceduralTexture);
  12625. BABYLON.BrickProceduralTexture = BrickProceduralTexture;
  12626. var MarbleProceduralTexture = (function (_super) {
  12627. __extends(MarbleProceduralTexture, _super);
  12628. function MarbleProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  12629. _super.call(this, name, size, "marble", scene, fallbackTexture, generateMipMaps);
  12630. this._numberOfTilesHeight = 3;
  12631. this._numberOfTilesWidth = 3;
  12632. this._amplitude = 9.0;
  12633. this._marbleColor = new BABYLON.Color3(0.77, 0.47, 0.40);
  12634. this._jointColor = new BABYLON.Color3(0.72, 0.72, 0.72);
  12635. this.updateShaderUniforms();
  12636. this.refreshRate = 0;
  12637. }
  12638. MarbleProceduralTexture.prototype.updateShaderUniforms = function () {
  12639. this.setFloat("numberOfTilesHeight", this._numberOfTilesHeight);
  12640. this.setFloat("numberOfTilesWidth", this._numberOfTilesWidth);
  12641. this.setFloat("amplitude", this._amplitude);
  12642. this.setColor3("marbleColor", this._marbleColor);
  12643. this.setColor3("jointColor", this._jointColor);
  12644. };
  12645. Object.defineProperty(MarbleProceduralTexture.prototype, "numberOfTilesHeight", {
  12646. get: function () {
  12647. return this._numberOfTilesHeight;
  12648. },
  12649. set: function (value) {
  12650. this._numberOfTilesHeight = value;
  12651. this.updateShaderUniforms();
  12652. },
  12653. enumerable: true,
  12654. configurable: true
  12655. });
  12656. Object.defineProperty(MarbleProceduralTexture.prototype, "numberOfTilesWidth", {
  12657. get: function () {
  12658. return this._numberOfTilesWidth;
  12659. },
  12660. set: function (value) {
  12661. this._numberOfTilesWidth = value;
  12662. this.updateShaderUniforms();
  12663. },
  12664. enumerable: true,
  12665. configurable: true
  12666. });
  12667. Object.defineProperty(MarbleProceduralTexture.prototype, "jointColor", {
  12668. get: function () {
  12669. return this._jointColor;
  12670. },
  12671. set: function (value) {
  12672. this._jointColor = value;
  12673. this.updateShaderUniforms();
  12674. },
  12675. enumerable: true,
  12676. configurable: true
  12677. });
  12678. Object.defineProperty(MarbleProceduralTexture.prototype, "marbleColor", {
  12679. get: function () {
  12680. return this._marbleColor;
  12681. },
  12682. set: function (value) {
  12683. this._marbleColor = value;
  12684. this.updateShaderUniforms();
  12685. },
  12686. enumerable: true,
  12687. configurable: true
  12688. });
  12689. return MarbleProceduralTexture;
  12690. })(BABYLON.ProceduralTexture);
  12691. BABYLON.MarbleProceduralTexture = MarbleProceduralTexture;
  12692. })(BABYLON || (BABYLON = {}));
  12693. //# sourceMappingURL=babylon.standardProceduralTexture.js.map
  12694. var BABYLON;
  12695. (function (BABYLON) {
  12696. var CustomProceduralTexture = (function (_super) {
  12697. __extends(CustomProceduralTexture, _super);
  12698. function CustomProceduralTexture(name, texturePath, size, scene, fallbackTexture, generateMipMaps) {
  12699. _super.call(this, name, size, null, scene, fallbackTexture, generateMipMaps);
  12700. this._animate = true;
  12701. this._time = 0;
  12702. this._texturePath = texturePath;
  12703. //Try to load json
  12704. this.loadJson(texturePath);
  12705. this.refreshRate = 1;
  12706. }
  12707. CustomProceduralTexture.prototype.loadJson = function (jsonUrl) {
  12708. var _this = this;
  12709. var that = this;
  12710. function noConfigFile() {
  12711. BABYLON.Tools.Log("No config file found in " + jsonUrl + " trying to use ShadersStore or DOM element");
  12712. try {
  12713. that.setFragment(that._texturePath);
  12714. }
  12715. catch (ex) {
  12716. BABYLON.Tools.Error("No json or ShaderStore or DOM element found for CustomProceduralTexture");
  12717. }
  12718. }
  12719. var configFileUrl = jsonUrl + "/config.json";
  12720. var xhr = new XMLHttpRequest();
  12721. xhr.open("GET", configFileUrl, true);
  12722. xhr.addEventListener("load", function () {
  12723. if (xhr.status === 200 || BABYLON.Tools.ValidateXHRData(xhr, 1)) {
  12724. try {
  12725. _this._config = JSON.parse(xhr.response);
  12726. _this.updateShaderUniforms();
  12727. _this.updateTextures();
  12728. _this.setFragment(_this._texturePath + "/custom");
  12729. _this._animate = _this._config.animate;
  12730. _this.refreshRate = _this._config.refreshrate;
  12731. }
  12732. catch (ex) {
  12733. noConfigFile();
  12734. }
  12735. }
  12736. else {
  12737. noConfigFile();
  12738. }
  12739. }, false);
  12740. xhr.addEventListener("error", function () {
  12741. noConfigFile();
  12742. }, false);
  12743. try {
  12744. xhr.send();
  12745. }
  12746. catch (ex) {
  12747. BABYLON.Tools.Error("CustomProceduralTexture: Error on XHR send request.");
  12748. }
  12749. };
  12750. CustomProceduralTexture.prototype.isReady = function () {
  12751. if (!_super.prototype.isReady.call(this)) {
  12752. return false;
  12753. }
  12754. for (var name in this._textures) {
  12755. var texture = this._textures[name];
  12756. if (!texture.isReady()) {
  12757. return false;
  12758. }
  12759. }
  12760. return true;
  12761. };
  12762. CustomProceduralTexture.prototype.render = function (useCameraPostProcess) {
  12763. if (this._animate) {
  12764. this._time += this.getScene().getAnimationRatio() * 0.03;
  12765. this.updateShaderUniforms();
  12766. }
  12767. _super.prototype.render.call(this, useCameraPostProcess);
  12768. };
  12769. CustomProceduralTexture.prototype.updateTextures = function () {
  12770. for (var i = 0; i < this._config.sampler2Ds.length; i++) {
  12771. this.setTexture(this._config.sampler2Ds[i].sample2Dname, new BABYLON.Texture(this._texturePath + "/" + this._config.sampler2Ds[i].textureRelativeUrl, this.getScene()));
  12772. }
  12773. };
  12774. CustomProceduralTexture.prototype.updateShaderUniforms = function () {
  12775. if (this._config) {
  12776. for (var j = 0; j < this._config.uniforms.length; j++) {
  12777. var uniform = this._config.uniforms[j];
  12778. switch (uniform.type) {
  12779. case "float":
  12780. this.setFloat(uniform.name, uniform.value);
  12781. break;
  12782. case "color3":
  12783. this.setColor3(uniform.name, new BABYLON.Color3(uniform.r, uniform.g, uniform.b));
  12784. break;
  12785. case "color4":
  12786. this.setColor4(uniform.name, new BABYLON.Color4(uniform.r, uniform.g, uniform.b, uniform.a));
  12787. break;
  12788. case "vector2":
  12789. this.setVector2(uniform.name, new BABYLON.Vector2(uniform.x, uniform.y));
  12790. break;
  12791. case "vector3":
  12792. this.setVector3(uniform.name, new BABYLON.Vector3(uniform.x, uniform.y, uniform.z));
  12793. break;
  12794. }
  12795. }
  12796. }
  12797. this.setFloat("time", this._time);
  12798. };
  12799. Object.defineProperty(CustomProceduralTexture.prototype, "animate", {
  12800. get: function () {
  12801. return this._animate;
  12802. },
  12803. set: function (value) {
  12804. this._animate = value;
  12805. },
  12806. enumerable: true,
  12807. configurable: true
  12808. });
  12809. return CustomProceduralTexture;
  12810. })(BABYLON.ProceduralTexture);
  12811. BABYLON.CustomProceduralTexture = CustomProceduralTexture;
  12812. })(BABYLON || (BABYLON = {}));
  12813. //# sourceMappingURL=babylon.customProceduralTexture.js.map
  12814. var BABYLON;
  12815. (function (BABYLON) {
  12816. var MirrorTexture = (function (_super) {
  12817. __extends(MirrorTexture, _super);
  12818. function MirrorTexture(name, size, scene, generateMipMaps) {
  12819. var _this = this;
  12820. _super.call(this, name, size, scene, generateMipMaps, true);
  12821. this.mirrorPlane = new BABYLON.Plane(0, 1, 0, 1);
  12822. this._transformMatrix = BABYLON.Matrix.Zero();
  12823. this._mirrorMatrix = BABYLON.Matrix.Zero();
  12824. this.onBeforeRender = function () {
  12825. BABYLON.Matrix.ReflectionToRef(_this.mirrorPlane, _this._mirrorMatrix);
  12826. _this._savedViewMatrix = scene.getViewMatrix();
  12827. _this._mirrorMatrix.multiplyToRef(_this._savedViewMatrix, _this._transformMatrix);
  12828. scene.setTransformMatrix(_this._transformMatrix, scene.getProjectionMatrix());
  12829. scene.clipPlane = _this.mirrorPlane;
  12830. scene.getEngine().cullBackFaces = false;
  12831. };
  12832. this.onAfterRender = function () {
  12833. scene.setTransformMatrix(_this._savedViewMatrix, scene.getProjectionMatrix());
  12834. scene.getEngine().cullBackFaces = true;
  12835. delete scene.clipPlane;
  12836. };
  12837. }
  12838. MirrorTexture.prototype.clone = function () {
  12839. var textureSize = this.getSize();
  12840. var newTexture = new BABYLON.MirrorTexture(this.name, textureSize.width, this.getScene(), this._generateMipMaps);
  12841. // Base texture
  12842. newTexture.hasAlpha = this.hasAlpha;
  12843. newTexture.level = this.level;
  12844. // Mirror Texture
  12845. newTexture.mirrorPlane = this.mirrorPlane.clone();
  12846. newTexture.renderList = this.renderList.slice(0);
  12847. return newTexture;
  12848. };
  12849. return MirrorTexture;
  12850. })(BABYLON.RenderTargetTexture);
  12851. BABYLON.MirrorTexture = MirrorTexture;
  12852. })(BABYLON || (BABYLON = {}));
  12853. //# sourceMappingURL=babylon.mirrorTexture.js.map
  12854. var BABYLON;
  12855. (function (BABYLON) {
  12856. var DynamicTexture = (function (_super) {
  12857. __extends(DynamicTexture, _super);
  12858. function DynamicTexture(name, options, scene, generateMipMaps, samplingMode) {
  12859. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  12860. _super.call(this, null, scene, !generateMipMaps);
  12861. this.name = name;
  12862. this.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  12863. this.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  12864. this._generateMipMaps = generateMipMaps;
  12865. if (options.getContext) {
  12866. this._canvas = options;
  12867. this._texture = scene.getEngine().createDynamicTexture(options.width, options.height, generateMipMaps, samplingMode);
  12868. }
  12869. else {
  12870. this._canvas = document.createElement("canvas");
  12871. if (options.width) {
  12872. this._texture = scene.getEngine().createDynamicTexture(options.width, options.height, generateMipMaps, samplingMode);
  12873. }
  12874. else {
  12875. this._texture = scene.getEngine().createDynamicTexture(options, options, generateMipMaps, samplingMode);
  12876. }
  12877. }
  12878. var textureSize = this.getSize();
  12879. this._canvas.width = textureSize.width;
  12880. this._canvas.height = textureSize.height;
  12881. this._context = this._canvas.getContext("2d");
  12882. }
  12883. Object.defineProperty(DynamicTexture.prototype, "canRescale", {
  12884. get: function () {
  12885. return true;
  12886. },
  12887. enumerable: true,
  12888. configurable: true
  12889. });
  12890. DynamicTexture.prototype.scale = function (ratio) {
  12891. var textureSize = this.getSize();
  12892. textureSize.width *= ratio;
  12893. textureSize.height *= ratio;
  12894. this._canvas.width = textureSize.width;
  12895. this._canvas.height = textureSize.height;
  12896. this.releaseInternalTexture();
  12897. this._texture = this.getScene().getEngine().createDynamicTexture(textureSize.width, textureSize.height, this._generateMipMaps, this._samplingMode);
  12898. };
  12899. DynamicTexture.prototype.getContext = function () {
  12900. return this._context;
  12901. };
  12902. DynamicTexture.prototype.clear = function () {
  12903. var size = this.getSize();
  12904. this._context.fillRect(0, 0, size.width, size.height);
  12905. };
  12906. DynamicTexture.prototype.update = function (invertY) {
  12907. this.getScene().getEngine().updateDynamicTexture(this._texture, this._canvas, invertY === undefined ? true : invertY);
  12908. };
  12909. DynamicTexture.prototype.drawText = function (text, x, y, font, color, clearColor, invertY, update) {
  12910. if (update === void 0) { update = true; }
  12911. var size = this.getSize();
  12912. if (clearColor) {
  12913. this._context.fillStyle = clearColor;
  12914. this._context.fillRect(0, 0, size.width, size.height);
  12915. }
  12916. this._context.font = font;
  12917. if (x === null) {
  12918. var textSize = this._context.measureText(text);
  12919. x = (size.width - textSize.width) / 2;
  12920. }
  12921. this._context.fillStyle = color;
  12922. this._context.fillText(text, x, y);
  12923. if (update) {
  12924. this.update(invertY);
  12925. }
  12926. };
  12927. DynamicTexture.prototype.clone = function () {
  12928. var textureSize = this.getSize();
  12929. var newTexture = new DynamicTexture(this.name, textureSize.width, this.getScene(), this._generateMipMaps);
  12930. // Base texture
  12931. newTexture.hasAlpha = this.hasAlpha;
  12932. newTexture.level = this.level;
  12933. // Dynamic Texture
  12934. newTexture.wrapU = this.wrapU;
  12935. newTexture.wrapV = this.wrapV;
  12936. return newTexture;
  12937. };
  12938. return DynamicTexture;
  12939. })(BABYLON.Texture);
  12940. BABYLON.DynamicTexture = DynamicTexture;
  12941. })(BABYLON || (BABYLON = {}));
  12942. //# sourceMappingURL=babylon.dynamicTexture.js.map
  12943. var BABYLON;
  12944. (function (BABYLON) {
  12945. var VideoTexture = (function (_super) {
  12946. __extends(VideoTexture, _super);
  12947. function VideoTexture(name, urls, size, scene, generateMipMaps, invertY, samplingMode) {
  12948. var _this = this;
  12949. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  12950. _super.call(this, null, scene, !generateMipMaps, invertY);
  12951. this._autoLaunch = true;
  12952. this.name = name;
  12953. this.wrapU = BABYLON.Texture.WRAP_ADDRESSMODE;
  12954. this.wrapV = BABYLON.Texture.WRAP_ADDRESSMODE;
  12955. var requiredWidth = size.width || size;
  12956. var requiredHeight = size.height || size;
  12957. this._texture = scene.getEngine().createDynamicTexture(requiredWidth, requiredHeight, generateMipMaps, samplingMode);
  12958. var textureSize = this.getSize();
  12959. this.video = document.createElement("video");
  12960. this.video.width = textureSize.width;
  12961. this.video.height = textureSize.height;
  12962. this.video.autoplay = false;
  12963. this.video.loop = true;
  12964. this.video.addEventListener("canplaythrough", function () {
  12965. if (_this._texture) {
  12966. _this._texture.isReady = true;
  12967. }
  12968. });
  12969. urls.forEach(function (url) {
  12970. var source = document.createElement("source");
  12971. source.src = url;
  12972. _this.video.appendChild(source);
  12973. });
  12974. this._lastUpdate = BABYLON.Tools.Now;
  12975. }
  12976. VideoTexture.prototype.update = function () {
  12977. if (this._autoLaunch) {
  12978. this._autoLaunch = false;
  12979. this.video.play();
  12980. }
  12981. var now = BABYLON.Tools.Now;
  12982. if (now - this._lastUpdate < 15) {
  12983. return false;
  12984. }
  12985. this._lastUpdate = now;
  12986. this.getScene().getEngine().updateVideoTexture(this._texture, this.video, this._invertY);
  12987. return true;
  12988. };
  12989. return VideoTexture;
  12990. })(BABYLON.Texture);
  12991. BABYLON.VideoTexture = VideoTexture;
  12992. })(BABYLON || (BABYLON = {}));
  12993. //# sourceMappingURL=babylon.videoTexture.js.mapvar BABYLON;
  12994. (function (BABYLON) {
  12995. var EffectFallbacks = (function () {
  12996. function EffectFallbacks() {
  12997. this._defines = {};
  12998. this._currentRank = 32;
  12999. this._maxRank = -1;
  13000. }
  13001. EffectFallbacks.prototype.addFallback = function (rank, define) {
  13002. if (!this._defines[rank]) {
  13003. if (rank < this._currentRank) {
  13004. this._currentRank = rank;
  13005. }
  13006. if (rank > this._maxRank) {
  13007. this._maxRank = rank;
  13008. }
  13009. this._defines[rank] = new Array();
  13010. }
  13011. this._defines[rank].push(define);
  13012. };
  13013. Object.defineProperty(EffectFallbacks.prototype, "isMoreFallbacks", {
  13014. get: function () {
  13015. return this._currentRank <= this._maxRank;
  13016. },
  13017. enumerable: true,
  13018. configurable: true
  13019. });
  13020. EffectFallbacks.prototype.reduce = function (currentDefines) {
  13021. var currentFallbacks = this._defines[this._currentRank];
  13022. for (var index = 0; index < currentFallbacks.length; index++) {
  13023. currentDefines = currentDefines.replace("#define " + currentFallbacks[index], "");
  13024. }
  13025. this._currentRank++;
  13026. return currentDefines;
  13027. };
  13028. return EffectFallbacks;
  13029. })();
  13030. BABYLON.EffectFallbacks = EffectFallbacks;
  13031. var Effect = (function () {
  13032. function Effect(baseName, attributesNames, uniformsNames, samplers, engine, defines, fallbacks, onCompiled, onError) {
  13033. var _this = this;
  13034. this._isReady = false;
  13035. this._compilationError = "";
  13036. this._valueCache = [];
  13037. this._engine = engine;
  13038. this.name = baseName;
  13039. this.defines = defines;
  13040. this._uniformsNames = uniformsNames.concat(samplers);
  13041. this._samplers = samplers;
  13042. this._attributesNames = attributesNames;
  13043. this.onError = onError;
  13044. this.onCompiled = onCompiled;
  13045. var vertexSource;
  13046. var fragmentSource;
  13047. if (baseName.vertexElement) {
  13048. vertexSource = document.getElementById(baseName.vertexElement);
  13049. if (!vertexSource) {
  13050. vertexSource = baseName.vertexElement;
  13051. }
  13052. }
  13053. else {
  13054. vertexSource = baseName.vertex || baseName;
  13055. }
  13056. if (baseName.fragmentElement) {
  13057. fragmentSource = document.getElementById(baseName.fragmentElement);
  13058. if (!fragmentSource) {
  13059. fragmentSource = baseName.fragmentElement;
  13060. }
  13061. }
  13062. else {
  13063. fragmentSource = baseName.fragment || baseName;
  13064. }
  13065. this._loadVertexShader(vertexSource, function (vertexCode) {
  13066. _this._loadFragmentShader(fragmentSource, function (fragmentCode) {
  13067. _this._prepareEffect(vertexCode, fragmentCode, attributesNames, defines, fallbacks);
  13068. });
  13069. });
  13070. }
  13071. // Properties
  13072. Effect.prototype.isReady = function () {
  13073. return this._isReady;
  13074. };
  13075. Effect.prototype.getProgram = function () {
  13076. return this._program;
  13077. };
  13078. Effect.prototype.getAttributesNames = function () {
  13079. return this._attributesNames;
  13080. };
  13081. Effect.prototype.getAttributeLocation = function (index) {
  13082. return this._attributes[index];
  13083. };
  13084. Effect.prototype.getAttributeLocationByName = function (name) {
  13085. var index = this._attributesNames.indexOf(name);
  13086. return this._attributes[index];
  13087. };
  13088. Effect.prototype.getAttributesCount = function () {
  13089. return this._attributes.length;
  13090. };
  13091. Effect.prototype.getUniformIndex = function (uniformName) {
  13092. return this._uniformsNames.indexOf(uniformName);
  13093. };
  13094. Effect.prototype.getUniform = function (uniformName) {
  13095. return this._uniforms[this._uniformsNames.indexOf(uniformName)];
  13096. };
  13097. Effect.prototype.getSamplers = function () {
  13098. return this._samplers;
  13099. };
  13100. Effect.prototype.getCompilationError = function () {
  13101. return this._compilationError;
  13102. };
  13103. // Methods
  13104. Effect.prototype._loadVertexShader = function (vertex, callback) {
  13105. // DOM element ?
  13106. if (vertex instanceof HTMLElement) {
  13107. var vertexCode = BABYLON.Tools.GetDOMTextContent(vertex);
  13108. callback(vertexCode);
  13109. return;
  13110. }
  13111. // Is in local store ?
  13112. if (Effect.ShadersStore[vertex + "VertexShader"]) {
  13113. callback(Effect.ShadersStore[vertex + "VertexShader"]);
  13114. return;
  13115. }
  13116. var vertexShaderUrl;
  13117. if (vertex[0] === ".") {
  13118. vertexShaderUrl = vertex;
  13119. }
  13120. else {
  13121. vertexShaderUrl = BABYLON.Engine.ShadersRepository + vertex;
  13122. }
  13123. // Vertex shader
  13124. BABYLON.Tools.LoadFile(vertexShaderUrl + ".vertex.fx", callback);
  13125. };
  13126. Effect.prototype._loadFragmentShader = function (fragment, callback) {
  13127. // DOM element ?
  13128. if (fragment instanceof HTMLElement) {
  13129. var fragmentCode = BABYLON.Tools.GetDOMTextContent(fragment);
  13130. callback(fragmentCode);
  13131. return;
  13132. }
  13133. // Is in local store ?
  13134. if (Effect.ShadersStore[fragment + "PixelShader"]) {
  13135. callback(Effect.ShadersStore[fragment + "PixelShader"]);
  13136. return;
  13137. }
  13138. if (Effect.ShadersStore[fragment + "FragmentShader"]) {
  13139. callback(Effect.ShadersStore[fragment + "FragmentShader"]);
  13140. return;
  13141. }
  13142. var fragmentShaderUrl;
  13143. if (fragment[0] === ".") {
  13144. fragmentShaderUrl = fragment;
  13145. }
  13146. else {
  13147. fragmentShaderUrl = BABYLON.Engine.ShadersRepository + fragment;
  13148. }
  13149. // Fragment shader
  13150. BABYLON.Tools.LoadFile(fragmentShaderUrl + ".fragment.fx", callback);
  13151. };
  13152. Effect.prototype._prepareEffect = function (vertexSourceCode, fragmentSourceCode, attributesNames, defines, fallbacks) {
  13153. try {
  13154. var engine = this._engine;
  13155. this._program = engine.createShaderProgram(vertexSourceCode, fragmentSourceCode, defines);
  13156. this._uniforms = engine.getUniforms(this._program, this._uniformsNames);
  13157. this._attributes = engine.getAttributes(this._program, attributesNames);
  13158. for (var index = 0; index < this._samplers.length; index++) {
  13159. var sampler = this.getUniform(this._samplers[index]);
  13160. if (sampler == null) {
  13161. this._samplers.splice(index, 1);
  13162. index--;
  13163. }
  13164. }
  13165. engine.bindSamplers(this);
  13166. this._isReady = true;
  13167. if (this.onCompiled) {
  13168. this.onCompiled(this);
  13169. }
  13170. }
  13171. catch (e) {
  13172. // Is it a problem with precision?
  13173. if (e.message.indexOf("highp") !== -1) {
  13174. vertexSourceCode = vertexSourceCode.replace("precision highp float", "precision mediump float");
  13175. fragmentSourceCode = fragmentSourceCode.replace("precision highp float", "precision mediump float");
  13176. this._prepareEffect(vertexSourceCode, fragmentSourceCode, attributesNames, defines, fallbacks);
  13177. return;
  13178. }
  13179. // Let's go through fallbacks then
  13180. if (fallbacks && fallbacks.isMoreFallbacks) {
  13181. defines = fallbacks.reduce(defines);
  13182. this._prepareEffect(vertexSourceCode, fragmentSourceCode, attributesNames, defines, fallbacks);
  13183. }
  13184. else {
  13185. BABYLON.Tools.Error("Unable to compile effect: " + this.name);
  13186. BABYLON.Tools.Error("Defines: " + defines);
  13187. BABYLON.Tools.Error("Error: " + e.message);
  13188. this._compilationError = e.message;
  13189. if (this.onError) {
  13190. this.onError(this, this._compilationError);
  13191. }
  13192. }
  13193. }
  13194. };
  13195. Effect.prototype._bindTexture = function (channel, texture) {
  13196. this._engine._bindTexture(this._samplers.indexOf(channel), texture);
  13197. };
  13198. Effect.prototype.setTexture = function (channel, texture) {
  13199. this._engine.setTexture(this._samplers.indexOf(channel), texture);
  13200. };
  13201. Effect.prototype.setTextureFromPostProcess = function (channel, postProcess) {
  13202. this._engine.setTextureFromPostProcess(this._samplers.indexOf(channel), postProcess);
  13203. };
  13204. //public _cacheMatrix(uniformName, matrix) {
  13205. // if (!this._valueCache[uniformName]) {
  13206. // this._valueCache[uniformName] = new BABYLON.Matrix();
  13207. // }
  13208. // for (var index = 0; index < 16; index++) {
  13209. // this._valueCache[uniformName].m[index] = matrix.m[index];
  13210. // }
  13211. //};
  13212. Effect.prototype._cacheFloat2 = function (uniformName, x, y) {
  13213. if (!this._valueCache[uniformName]) {
  13214. this._valueCache[uniformName] = [x, y];
  13215. return;
  13216. }
  13217. this._valueCache[uniformName][0] = x;
  13218. this._valueCache[uniformName][1] = y;
  13219. };
  13220. Effect.prototype._cacheFloat3 = function (uniformName, x, y, z) {
  13221. if (!this._valueCache[uniformName]) {
  13222. this._valueCache[uniformName] = [x, y, z];
  13223. return;
  13224. }
  13225. this._valueCache[uniformName][0] = x;
  13226. this._valueCache[uniformName][1] = y;
  13227. this._valueCache[uniformName][2] = z;
  13228. };
  13229. Effect.prototype._cacheFloat4 = function (uniformName, x, y, z, w) {
  13230. if (!this._valueCache[uniformName]) {
  13231. this._valueCache[uniformName] = [x, y, z, w];
  13232. return;
  13233. }
  13234. this._valueCache[uniformName][0] = x;
  13235. this._valueCache[uniformName][1] = y;
  13236. this._valueCache[uniformName][2] = z;
  13237. this._valueCache[uniformName][3] = w;
  13238. };
  13239. Effect.prototype.setArray = function (uniformName, array) {
  13240. this._engine.setArray(this.getUniform(uniformName), array);
  13241. return this;
  13242. };
  13243. Effect.prototype.setArray2 = function (uniformName, array) {
  13244. this._engine.setArray2(this.getUniform(uniformName), array);
  13245. return this;
  13246. };
  13247. Effect.prototype.setArray3 = function (uniformName, array) {
  13248. this._engine.setArray3(this.getUniform(uniformName), array);
  13249. return this;
  13250. };
  13251. Effect.prototype.setArray4 = function (uniformName, array) {
  13252. this._engine.setArray4(this.getUniform(uniformName), array);
  13253. return this;
  13254. };
  13255. Effect.prototype.setMatrices = function (uniformName, matrices) {
  13256. this._engine.setMatrices(this.getUniform(uniformName), matrices);
  13257. return this;
  13258. };
  13259. Effect.prototype.setMatrix = function (uniformName, matrix) {
  13260. //if (this._valueCache[uniformName] && this._valueCache[uniformName].equals(matrix))
  13261. // return;
  13262. //this._cacheMatrix(uniformName, matrix);
  13263. this._engine.setMatrix(this.getUniform(uniformName), matrix);
  13264. return this;
  13265. };
  13266. Effect.prototype.setFloat = function (uniformName, value) {
  13267. if (this._valueCache[uniformName] && this._valueCache[uniformName] === value)
  13268. return this;
  13269. this._valueCache[uniformName] = value;
  13270. this._engine.setFloat(this.getUniform(uniformName), value);
  13271. return this;
  13272. };
  13273. Effect.prototype.setBool = function (uniformName, bool) {
  13274. if (this._valueCache[uniformName] && this._valueCache[uniformName] === bool)
  13275. return this;
  13276. this._valueCache[uniformName] = bool;
  13277. this._engine.setBool(this.getUniform(uniformName), bool ? 1 : 0);
  13278. return this;
  13279. };
  13280. Effect.prototype.setVector2 = function (uniformName, vector2) {
  13281. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === vector2.x && this._valueCache[uniformName][1] === vector2.y)
  13282. return this;
  13283. this._cacheFloat2(uniformName, vector2.x, vector2.y);
  13284. this._engine.setFloat2(this.getUniform(uniformName), vector2.x, vector2.y);
  13285. return this;
  13286. };
  13287. Effect.prototype.setFloat2 = function (uniformName, x, y) {
  13288. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === x && this._valueCache[uniformName][1] === y)
  13289. return this;
  13290. this._cacheFloat2(uniformName, x, y);
  13291. this._engine.setFloat2(this.getUniform(uniformName), x, y);
  13292. return this;
  13293. };
  13294. Effect.prototype.setVector3 = function (uniformName, vector3) {
  13295. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === vector3.x && this._valueCache[uniformName][1] === vector3.y && this._valueCache[uniformName][2] === vector3.z)
  13296. return this;
  13297. this._cacheFloat3(uniformName, vector3.x, vector3.y, vector3.z);
  13298. this._engine.setFloat3(this.getUniform(uniformName), vector3.x, vector3.y, vector3.z);
  13299. return this;
  13300. };
  13301. Effect.prototype.setFloat3 = function (uniformName, x, y, z) {
  13302. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === x && this._valueCache[uniformName][1] === y && this._valueCache[uniformName][2] === z)
  13303. return this;
  13304. this._cacheFloat3(uniformName, x, y, z);
  13305. this._engine.setFloat3(this.getUniform(uniformName), x, y, z);
  13306. return this;
  13307. };
  13308. Effect.prototype.setFloat4 = function (uniformName, x, y, z, w) {
  13309. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === x && this._valueCache[uniformName][1] === y && this._valueCache[uniformName][2] === z && this._valueCache[uniformName][3] === w)
  13310. return this;
  13311. this._cacheFloat4(uniformName, x, y, z, w);
  13312. this._engine.setFloat4(this.getUniform(uniformName), x, y, z, w);
  13313. return this;
  13314. };
  13315. Effect.prototype.setColor3 = function (uniformName, color3) {
  13316. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === color3.r && this._valueCache[uniformName][1] === color3.g && this._valueCache[uniformName][2] === color3.b)
  13317. return this;
  13318. this._cacheFloat3(uniformName, color3.r, color3.g, color3.b);
  13319. this._engine.setColor3(this.getUniform(uniformName), color3);
  13320. return this;
  13321. };
  13322. Effect.prototype.setColor4 = function (uniformName, color3, alpha) {
  13323. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === color3.r && this._valueCache[uniformName][1] === color3.g && this._valueCache[uniformName][2] === color3.b && this._valueCache[uniformName][3] === alpha)
  13324. return this;
  13325. this._cacheFloat4(uniformName, color3.r, color3.g, color3.b, alpha);
  13326. this._engine.setColor4(this.getUniform(uniformName), color3, alpha);
  13327. return this;
  13328. };
  13329. // Statics
  13330. Effect.ShadersStore={anaglyphPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\nuniform sampler2D leftSampler;\n\nvoid main(void)\n{\n vec4 leftFrag = texture2D(leftSampler, vUV);\n leftFrag = vec4(1.0, leftFrag.g, leftFrag.b, 1.0);\n\n vec4 rightFrag = texture2D(textureSampler, vUV);\n rightFrag = vec4(rightFrag.r, 1.0, 1.0, 1.0);\n\n gl_FragColor = vec4(rightFrag.rgb * leftFrag.rgb, 1.0);\n}",
  13331. blackAndWhitePixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\nvoid main(void) \n{\n float luminance = dot(texture2D(textureSampler, vUV).rgb, vec3(0.3, 0.59, 0.11));\n gl_FragColor = vec4(luminance, luminance, luminance, 1.0);\n}",
  13332. blurPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\n// Parameters\nuniform vec2 screenSize;\nuniform vec2 direction;\nuniform float blurWidth;\n\nvoid main(void)\n{\n float weights[7];\n weights[0] = 0.05;\n weights[1] = 0.1;\n weights[2] = 0.2;\n weights[3] = 0.3;\n weights[4] = 0.2;\n weights[5] = 0.1;\n weights[6] = 0.05;\n\n vec2 texelSize = vec2(1.0 / screenSize.x, 1.0 / screenSize.y);\n vec2 texelStep = texelSize * direction * blurWidth;\n vec2 start = vUV - 3.0 * texelStep;\n\n vec4 baseColor = vec4(0., 0., 0., 0.);\n vec2 texelOffset = vec2(0., 0.);\n\n for (int i = 0; i < 7; i++)\n {\n baseColor += texture2D(textureSampler, start + texelOffset) * weights[i];\n texelOffset += texelStep;\n }\n\n gl_FragColor = baseColor;\n}",
  13333. brickPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vPosition;\nvarying vec2 vUV;\n\nuniform float numberOfBricksHeight;\nuniform float numberOfBricksWidth;\nuniform vec3 brickColor;\nuniform vec3 jointColor;\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\n float total = 0.0, amplitude = 1.0;\n for (int i = 0; i < 4; i++) {\n total += noise(n) * amplitude;\n n += n;\n amplitude *= 0.5;\n }\n return total;\n}\n\nfloat round(float number){\n return sign(number)*floor(abs(number) + 0.5);\n}\n\nvoid main(void)\n{\n float brickW = 1.0 / numberOfBricksWidth;\n float brickH = 1.0 / numberOfBricksHeight;\n float jointWPercentage = 0.01;\n float jointHPercentage = 0.05;\n vec3 color = brickColor;\n float yi = vUV.y / brickH;\n float nyi = round(yi);\n float xi = vUV.x / brickW;\n\n if (mod(floor(yi), 2.0) == 0.0){\n xi = xi - 0.5;\n }\n\n float nxi = round(xi);\n vec2 brickvUV = vec2((xi - floor(xi)) / brickH, (yi - floor(yi)) / brickW);\n\n if (yi < nyi + jointHPercentage && yi > nyi - jointHPercentage){\n color = mix(jointColor, vec3(0.37, 0.25, 0.25), (yi - nyi) / jointHPercentage + 0.2);\n }\n else if (xi < nxi + jointWPercentage && xi > nxi - jointWPercentage){\n color = mix(jointColor, vec3(0.44, 0.44, 0.44), (xi - nxi) / jointWPercentage + 0.2);\n }\n else {\n float brickColorSwitch = mod(floor(yi) + floor(xi), 3.0);\n\n if (brickColorSwitch == 0.0)\n color = mix(color, vec3(0.33, 0.33, 0.33), 0.3);\n else if (brickColorSwitch == 2.0)\n color = mix(color, vec3(0.11, 0.11, 0.11), 0.3);\n }\n\n gl_FragColor = vec4(color, 1.0);\n}",
  13334. cloudPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vUV;\n\nuniform vec3 skyColor;\nuniform vec3 cloudColor;\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\n float total = 0.0, amplitude = 1.0;\n for (int i = 0; i < 4; i++) {\n total += noise(n) * amplitude;\n n += n;\n amplitude *= 0.5;\n }\n return total;\n}\n\nvoid main() {\n\n vec2 p = vUV * 12.0;\n vec3 c = mix(skyColor, cloudColor, fbm(p));\n gl_FragColor = vec4(c, 1);\n\n}",
  13335. colorPixelShader:"precision highp float;\n\nuniform vec4 color;\n\nvoid main(void) {\n gl_FragColor = color;\n}",
  13336. colorVertexShader:"precision highp float;\n\n// Attributes\nattribute vec3 position;\n\n// Uniforms\nuniform mat4 worldViewProjection;\n\nvoid main(void) {\n gl_Position = worldViewProjection * vec4(position, 1.0);\n}",
  13337. convolutionPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\nuniform vec2 screenSize;\nuniform float kernel[9];\n\nvoid main(void)\n{\n vec2 onePixel = vec2(1.0, 1.0) / screenSize;\n vec4 colorSum =\n texture2D(textureSampler, vUV + onePixel * vec2(-1, -1)) * kernel[0] +\n texture2D(textureSampler, vUV + onePixel * vec2(0, -1)) * kernel[1] +\n texture2D(textureSampler, vUV + onePixel * vec2(1, -1)) * kernel[2] +\n texture2D(textureSampler, vUV + onePixel * vec2(-1, 0)) * kernel[3] +\n texture2D(textureSampler, vUV + onePixel * vec2(0, 0)) * kernel[4] +\n texture2D(textureSampler, vUV + onePixel * vec2(1, 0)) * kernel[5] +\n texture2D(textureSampler, vUV + onePixel * vec2(-1, 1)) * kernel[6] +\n texture2D(textureSampler, vUV + onePixel * vec2(0, 1)) * kernel[7] +\n texture2D(textureSampler, vUV + onePixel * vec2(1, 1)) * kernel[8];\n\n float kernelWeight =\n kernel[0] +\n kernel[1] +\n kernel[2] +\n kernel[3] +\n kernel[4] +\n kernel[5] +\n kernel[6] +\n kernel[7] +\n kernel[8];\n\n if (kernelWeight <= 0.0) {\n kernelWeight = 1.0;\n }\n\n gl_FragColor = vec4((colorSum / kernelWeight).rgb, 1);\n}",
  13338. defaultPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n#define MAP_EXPLICIT 0.\n#define MAP_SPHERICAL 1.\n#define MAP_PLANAR 2.\n#define MAP_CUBIC 3.\n#define MAP_PROJECTION 4.\n#define MAP_SKYBOX 5.\n\n// Constants\nuniform vec3 vEyePosition;\nuniform vec3 vAmbientColor;\nuniform vec4 vDiffuseColor;\nuniform vec4 vSpecularColor;\nuniform vec3 vEmissiveColor;\n\n// Input\nvarying vec3 vPositionW;\nvarying vec3 vNormalW;\n\n#ifdef VERTEXCOLOR\nvarying vec4 vColor;\n#endif\n\n// Lights\n#ifdef LIGHT0\nuniform vec4 vLightData0;\nuniform vec4 vLightDiffuse0;\nuniform vec3 vLightSpecular0;\n#ifdef SHADOW0\nvarying vec4 vPositionFromLight0;\nuniform sampler2D shadowSampler0;\nuniform float darkness0;\n#endif\n#ifdef SPOTLIGHT0\nuniform vec4 vLightDirection0;\n#endif\n#ifdef HEMILIGHT0\nuniform vec3 vLightGround0;\n#endif\n#endif\n\n#ifdef LIGHT1\nuniform vec4 vLightData1;\nuniform vec4 vLightDiffuse1;\nuniform vec3 vLightSpecular1;\n#ifdef SHADOW1\nvarying vec4 vPositionFromLight1;\nuniform sampler2D shadowSampler1;\nuniform float darkness1;\n#endif\n#ifdef SPOTLIGHT1\nuniform vec4 vLightDirection1;\n#endif\n#ifdef HEMILIGHT1\nuniform vec3 vLightGround1;\n#endif\n#endif\n\n#ifdef LIGHT2\nuniform vec4 vLightData2;\nuniform vec4 vLightDiffuse2;\nuniform vec3 vLightSpecular2;\n#ifdef SHADOW2\nvarying vec4 vPositionFromLight2;\nuniform sampler2D shadowSampler2;\nuniform float darkness2;\n#endif\n#ifdef SPOTLIGHT2\nuniform vec4 vLightDirection2;\n#endif\n#ifdef HEMILIGHT2\nuniform vec3 vLightGround2;\n#endif\n#endif\n\n#ifdef LIGHT3\nuniform vec4 vLightData3;\nuniform vec4 vLightDiffuse3;\nuniform vec3 vLightSpecular3;\n#ifdef SHADOW3\nvarying vec4 vPositionFromLight3;\nuniform sampler2D shadowSampler3;\nuniform float darkness3;\n#endif\n#ifdef SPOTLIGHT3\nuniform vec4 vLightDirection3;\n#endif\n#ifdef HEMILIGHT3\nuniform vec3 vLightGround3;\n#endif\n#endif\n\n// Samplers\n#ifdef DIFFUSE\nvarying vec2 vDiffuseUV;\nuniform sampler2D diffuseSampler;\nuniform vec2 vDiffuseInfos;\n#endif\n\n#ifdef AMBIENT\nvarying vec2 vAmbientUV;\nuniform sampler2D ambientSampler;\nuniform vec2 vAmbientInfos;\n#endif\n\n#ifdef OPACITY \nvarying vec2 vOpacityUV;\nuniform sampler2D opacitySampler;\nuniform vec2 vOpacityInfos;\n#endif\n\n#ifdef EMISSIVE\nvarying vec2 vEmissiveUV;\nuniform vec2 vEmissiveInfos;\nuniform sampler2D emissiveSampler;\n#endif\n\n#ifdef SPECULAR\nvarying vec2 vSpecularUV;\nuniform vec2 vSpecularInfos;\nuniform sampler2D specularSampler;\n#endif\n\n// Fresnel\n#ifdef FRESNEL\nfloat computeFresnelTerm(vec3 viewDirection, vec3 worldNormal, float bias, float power)\n{\n float fresnelTerm = pow(bias + abs(dot(viewDirection, worldNormal)), power);\n return clamp(fresnelTerm, 0., 1.);\n}\n#endif\n\n#ifdef DIFFUSEFRESNEL\nuniform vec4 diffuseLeftColor;\nuniform vec4 diffuseRightColor;\n#endif\n\n#ifdef OPACITYFRESNEL\nuniform vec4 opacityParts;\n#endif\n\n#ifdef REFLECTIONFRESNEL\nuniform vec4 reflectionLeftColor;\nuniform vec4 reflectionRightColor;\n#endif\n\n#ifdef EMISSIVEFRESNEL\nuniform vec4 emissiveLeftColor;\nuniform vec4 emissiveRightColor;\n#endif\n\n// Reflection\n#ifdef REFLECTION\nvarying vec3 vPositionUVW;\nuniform samplerCube reflectionCubeSampler;\nuniform sampler2D reflection2DSampler;\nuniform vec3 vReflectionInfos;\nuniform mat4 reflectionMatrix;\nuniform mat4 view;\n\nvec3 computeReflectionCoords(float mode, vec4 worldPos, vec3 worldNormal)\n{\n if (mode == MAP_SPHERICAL)\n {\n vec3 coords = vec3(view * vec4(worldNormal, 0.0));\n\n return vec3(reflectionMatrix * vec4(coords, 1.0));\n }\n else if (mode == MAP_PLANAR)\n {\n vec3 viewDir = worldPos.xyz - vEyePosition;\n vec3 coords = normalize(reflect(viewDir, worldNormal));\n\n return vec3(reflectionMatrix * vec4(coords, 1));\n }\n else if (mode == MAP_CUBIC)\n {\n vec3 viewDir = worldPos.xyz - vEyePosition;\n vec3 coords = reflect(viewDir, worldNormal);\n\n return vec3(reflectionMatrix * vec4(coords, 0));\n }\n else if (mode == MAP_PROJECTION)\n {\n return vec3(reflectionMatrix * (view * worldPos));\n }\n else if (mode == MAP_SKYBOX)\n {\n return vPositionUVW;\n }\n\n return vec3(0, 0, 0);\n}\n#endif\n\n// Shadows\n#ifdef SHADOWS\n\nfloat unpack(vec4 color)\n{\n const vec4 bitShift = vec4(1. / (255. * 255. * 255.), 1. / (255. * 255.), 1. / 255., 1.);\n return dot(color, bitShift);\n}\n\nfloat unpackHalf(vec2 color)\n{\n return color.x + (color.y / 255.0);\n}\n\nfloat computeShadow(vec4 vPositionFromLight, sampler2D shadowSampler, float darkness)\n{\n vec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\n vec2 uv = 0.5 * depth.xy + vec2(0.5, 0.5);\n\n if (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\n {\n return 1.0;\n }\n\n float shadow = unpack(texture2D(shadowSampler, uv));\n\n if (depth.z > shadow)\n {\n return darkness;\n }\n return 1.;\n}\n\nfloat computeShadowWithPCF(vec4 vPositionFromLight, sampler2D shadowSampler)\n{\n vec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\n vec2 uv = 0.5 * depth.xy + vec2(0.5, 0.5);\n\n if (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\n {\n return 1.0;\n }\n\n float visibility = 1.;\n\n vec2 poissonDisk[4];\n poissonDisk[0] = vec2(-0.94201624, -0.39906216);\n poissonDisk[1] = vec2(0.94558609, -0.76890725);\n poissonDisk[2] = vec2(-0.094184101, -0.92938870);\n poissonDisk[3] = vec2(0.34495938, 0.29387760);\n\n // Poisson Sampling\n if (unpack(texture2D(shadowSampler, uv + poissonDisk[0] / 1500.0)) < depth.z) visibility -= 0.2;\n if (unpack(texture2D(shadowSampler, uv + poissonDisk[1] / 1500.0)) < depth.z) visibility -= 0.2;\n if (unpack(texture2D(shadowSampler, uv + poissonDisk[2] / 1500.0)) < depth.z) visibility -= 0.2;\n if (unpack(texture2D(shadowSampler, uv + poissonDisk[3] / 1500.0)) < depth.z) visibility -= 0.2;\n\n return visibility;\n}\n\n// Thanks to http://devmaster.net/\nfloat ChebychevInequality(vec2 moments, float t)\n{\n if (t <= moments.x)\n {\n return 1.0;\n }\n\n float variance = moments.y - (moments.x * moments.x);\n variance = max(variance, 0.);\n\n float d = t - moments.x;\n return variance / (variance + d * d);\n}\n\nfloat computeShadowWithVSM(vec4 vPositionFromLight, sampler2D shadowSampler)\n{\n vec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\n vec2 uv = 0.5 * depth.xy + vec2(0.5, 0.5);\n\n if (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\n {\n return 1.0;\n }\n\n vec4 texel = texture2D(shadowSampler, uv);\n\n vec2 moments = vec2(unpackHalf(texel.xy), unpackHalf(texel.zw));\n return clamp(1.0 - ChebychevInequality(moments, depth.z), 0., 1.0);\n}\n#endif\n\n// Bump\n#ifdef BUMP\n#extension GL_OES_standard_derivatives : enable\nvarying vec2 vBumpUV;\nuniform vec2 vBumpInfos;\nuniform sampler2D bumpSampler;\n\n// Thanks to http://www.thetenthplanet.de/archives/1180\nmat3 cotangent_frame(vec3 normal, vec3 p, vec2 uv)\n{\n // get edge vectors of the pixel triangle\n vec3 dp1 = dFdx(p);\n vec3 dp2 = dFdy(p);\n vec2 duv1 = dFdx(uv);\n vec2 duv2 = dFdy(uv);\n\n // solve the linear system\n vec3 dp2perp = cross(dp2, normal);\n vec3 dp1perp = cross(normal, dp1);\n vec3 tangent = dp2perp * duv1.x + dp1perp * duv2.x;\n vec3 binormal = dp2perp * duv1.y + dp1perp * duv2.y;\n\n // construct a scale-invariant frame \n float invmax = inversesqrt(max(dot(tangent, tangent), dot(binormal, binormal)));\n return mat3(tangent * invmax, binormal * invmax, normal);\n}\n\nvec3 perturbNormal(vec3 viewDir)\n{\n vec3 map = texture2D(bumpSampler, vBumpUV).xyz;\n map = map * 255. / 127. - 128. / 127.;\n mat3 TBN = cotangent_frame(vNormalW * vBumpInfos.y, -viewDir, vBumpUV);\n return normalize(TBN * map);\n}\n#endif\n\n#ifdef CLIPPLANE\nvarying float fClipDistance;\n#endif\n\n// Fog\n#ifdef FOG\n\n#define FOGMODE_NONE 0.\n#define FOGMODE_EXP 1.\n#define FOGMODE_EXP2 2.\n#define FOGMODE_LINEAR 3.\n#define E 2.71828\n\nuniform vec4 vFogInfos;\nuniform vec3 vFogColor;\nvarying float fFogDistance;\n\nfloat CalcFogFactor()\n{\n float fogCoeff = 1.0;\n float fogStart = vFogInfos.y;\n float fogEnd = vFogInfos.z;\n float fogDensity = vFogInfos.w;\n\n if (FOGMODE_LINEAR == vFogInfos.x)\n {\n fogCoeff = (fogEnd - fFogDistance) / (fogEnd - fogStart);\n }\n else if (FOGMODE_EXP == vFogInfos.x)\n {\n fogCoeff = 1.0 / pow(E, fFogDistance * fogDensity);\n }\n else if (FOGMODE_EXP2 == vFogInfos.x)\n {\n fogCoeff = 1.0 / pow(E, fFogDistance * fFogDistance * fogDensity * fogDensity);\n }\n\n return clamp(fogCoeff, 0.0, 1.0);\n}\n#endif\n\n// Light Computing\nstruct lightingInfo\n{\n vec3 diffuse;\n vec3 specular;\n};\n\nlightingInfo computeLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec3 diffuseColor, vec3 specularColor, float range) {\n lightingInfo result;\n\n vec3 lightVectorW;\n float attenuation = 1.0;\n if (lightData.w == 0.)\n {\n vec3 direction = lightData.xyz - vPositionW;\n\n attenuation = max(0., 1.0 - length(direction) / range);\n lightVectorW = normalize(direction);\n }\n else\n {\n lightVectorW = normalize(-lightData.xyz);\n }\n\n // diffuse\n float ndl = max(0., dot(vNormal, lightVectorW));\n\n // Specular\n vec3 angleW = normalize(viewDirectionW + lightVectorW);\n float specComp = max(0., dot(vNormal, angleW));\n specComp = pow(specComp, max(1., vSpecularColor.a));\n\n result.diffuse = ndl * diffuseColor * attenuation;\n result.specular = specComp * specularColor * attenuation;\n\n return result;\n}\n\nlightingInfo computeSpotLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec4 lightDirection, vec3 diffuseColor, vec3 specularColor, float range) {\n lightingInfo result;\n\n vec3 direction = lightData.xyz - vPositionW;\n vec3 lightVectorW = normalize(direction);\n float attenuation = max(0., 1.0 - length(direction) / range);\n\n // diffuse\n float cosAngle = max(0., dot(-lightDirection.xyz, lightVectorW));\n float spotAtten = 0.0;\n\n if (cosAngle >= lightDirection.w)\n {\n cosAngle = max(0., pow(cosAngle, lightData.w));\n spotAtten = max(0., (cosAngle - lightDirection.w) / (1. - cosAngle));\n\n // Diffuse\n float ndl = max(0., dot(vNormal, -lightDirection.xyz));\n\n // Specular\n vec3 angleW = normalize(viewDirectionW - lightDirection.xyz);\n float specComp = max(0., dot(vNormal, angleW));\n specComp = pow(specComp, vSpecularColor.a);\n\n result.diffuse = ndl * spotAtten * diffuseColor * attenuation;\n result.specular = specComp * specularColor * spotAtten * attenuation;\n\n return result;\n }\n\n result.diffuse = vec3(0.);\n result.specular = vec3(0.);\n\n return result;\n}\n\nlightingInfo computeHemisphericLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec3 diffuseColor, vec3 specularColor, vec3 groundColor) {\n lightingInfo result;\n\n // Diffuse\n float ndl = dot(vNormal, lightData.xyz) * 0.5 + 0.5;\n\n // Specular\n vec3 angleW = normalize(viewDirectionW + lightData.xyz);\n float specComp = max(0., dot(vNormal, angleW));\n specComp = pow(specComp, vSpecularColor.a);\n\n result.diffuse = mix(groundColor, diffuseColor, ndl);\n result.specular = specComp * specularColor;\n\n return result;\n}\n\nvoid main(void) {\n // Clip plane\n#ifdef CLIPPLANE\n if (fClipDistance > 0.0)\n discard;\n#endif\n\n vec3 viewDirectionW = normalize(vEyePosition - vPositionW);\n\n // Base color\n vec4 baseColor = vec4(1., 1., 1., 1.);\n vec3 diffuseColor = vDiffuseColor.rgb;\n\n // Alpha\n float alpha = vDiffuseColor.a;\n\n#ifdef VERTEXCOLOR\n baseColor.rgb *= vColor.rgb;\n#endif\n\n#ifdef DIFFUSE\n baseColor = texture2D(diffuseSampler, vDiffuseUV);\n\n#ifdef ALPHATEST\n if (baseColor.a < 0.4)\n discard;\n#endif\n\n#ifdef ALPHAFROMDIFFUSE\n alpha *= baseColor.a;\n#endif\n\n baseColor.rgb *= vDiffuseInfos.y;\n#endif\n\n // Bump\n vec3 normalW = normalize(vNormalW);\n\n#ifdef BUMP\n normalW = perturbNormal(viewDirectionW);\n#endif\n\n // Ambient color\n vec3 baseAmbientColor = vec3(1., 1., 1.);\n\n#ifdef AMBIENT\n baseAmbientColor = texture2D(ambientSampler, vAmbientUV).rgb * vAmbientInfos.y;\n#endif\n\n // Lighting\n vec3 diffuseBase = vec3(0., 0., 0.);\n vec3 specularBase = vec3(0., 0., 0.);\n float shadow = 1.;\n\n#ifdef LIGHT0\n#ifdef SPOTLIGHT0\n lightingInfo info = computeSpotLighting(viewDirectionW, normalW, vLightData0, vLightDirection0, vLightDiffuse0.rgb, vLightSpecular0, vLightDiffuse0.a);\n#endif\n#ifdef HEMILIGHT0\n lightingInfo info = computeHemisphericLighting(viewDirectionW, normalW, vLightData0, vLightDiffuse0.rgb, vLightSpecular0, vLightGround0);\n#endif\n#ifdef POINTDIRLIGHT0\n lightingInfo info = computeLighting(viewDirectionW, normalW, vLightData0, vLightDiffuse0.rgb, vLightSpecular0, vLightDiffuse0.a);\n#endif\n#ifdef SHADOW0\n#ifdef SHADOWVSM0\n shadow = computeShadowWithVSM(vPositionFromLight0, shadowSampler0);\n#else\n #ifdef SHADOWPCF0\n shadow = computeShadowWithPCF(vPositionFromLight0, shadowSampler0);\n #else\n shadow = computeShadow(vPositionFromLight0, shadowSampler0, darkness0);\n #endif\n#endif\n#else\n shadow = 1.;\n#endif\n diffuseBase += info.diffuse * shadow;\n specularBase += info.specular * shadow;\n#endif\n\n#ifdef LIGHT1\n#ifdef SPOTLIGHT1\n info = computeSpotLighting(viewDirectionW, normalW, vLightData1, vLightDirection1, vLightDiffuse1.rgb, vLightSpecular1, vLightDiffuse1.a);\n#endif\n#ifdef HEMILIGHT1\n info = computeHemisphericLighting(viewDirectionW, normalW, vLightData1, vLightDiffuse1.rgb, vLightSpecular1, vLightGround1);\n#endif\n#ifdef POINTDIRLIGHT1\n info = computeLighting(viewDirectionW, normalW, vLightData1, vLightDiffuse1.rgb, vLightSpecular1, vLightDiffuse1.a);\n#endif\n#ifdef SHADOW1\n#ifdef SHADOWVSM1\n shadow = computeShadowWithVSM(vPositionFromLight1, shadowSampler1);\n#else\n #ifdef SHADOWPCF1\n shadow = computeShadowWithPCF(vPositionFromLight1, shadowSampler1);\n #else\n shadow = computeShadow(vPositionFromLight1, shadowSampler1, darkness1);\n #endif\n#endif\n#else\n shadow = 1.;\n#endif\n diffuseBase += info.diffuse * shadow;\n specularBase += info.specular * shadow;\n#endif\n\n#ifdef LIGHT2\n#ifdef SPOTLIGHT2\n info = computeSpotLighting(viewDirectionW, normalW, vLightData2, vLightDirection2, vLightDiffuse2.rgb, vLightSpecular2, vLightDiffuse2.a);\n#endif\n#ifdef HEMILIGHT2\n info = computeHemisphericLighting(viewDirectionW, normalW, vLightData2, vLightDiffuse2.rgb, vLightSpecular2, vLightGround2);\n#endif\n#ifdef POINTDIRLIGHT2\n info = computeLighting(viewDirectionW, normalW, vLightData2, vLightDiffuse2.rgb, vLightSpecular2, vLightDiffuse2.a);\n#endif\n#ifdef SHADOW2\n#ifdef SHADOWVSM2\n shadow = computeShadowWithVSM(vPositionFromLight2, shadowSampler2);\n#else\n #ifdef SHADOWPCF2\n shadow = computeShadowWithPCF(vPositionFromLight2, shadowSampler2);\n #else\n shadow = computeShadow(vPositionFromLight2, shadowSampler2, darkness2);\n #endif \n#endif \n#else\n shadow = 1.;\n#endif\n diffuseBase += info.diffuse * shadow;\n specularBase += info.specular * shadow;\n#endif\n\n#ifdef LIGHT3\n#ifdef SPOTLIGHT3\n info = computeSpotLighting(viewDirectionW, normalW, vLightData3, vLightDirection3, vLightDiffuse3.rgb, vLightSpecular3, vLightDiffuse3.a);\n#endif\n#ifdef HEMILIGHT3\n info = computeHemisphericLighting(viewDirectionW, normalW, vLightData3, vLightDiffuse3.rgb, vLightSpecular3, vLightGround3);\n#endif\n#ifdef POINTDIRLIGHT3\n info = computeLighting(viewDirectionW, normalW, vLightData3, vLightDiffuse3.rgb, vLightSpecular3, vLightDiffuse3.a);\n#endif\n#ifdef SHADOW3\n#ifdef SHADOWVSM3\n shadow = computeShadowWithVSM(vPositionFromLight3, shadowSampler3);\n#else\n #ifdef SHADOWPCF3\n shadow = computeShadowWithPCF(vPositionFromLight3, shadowSampler3);\n #else\n shadow = computeShadow(vPositionFromLight3, shadowSampler3, darkness3);\n #endif \n#endif \n#else\n shadow = 1.;\n#endif\n diffuseBase += info.diffuse * shadow;\n specularBase += info.specular * shadow;\n#endif\n\n // Reflection\n vec3 reflectionColor = vec3(0., 0., 0.);\n\n#ifdef REFLECTION\n vec3 vReflectionUVW = computeReflectionCoords(vReflectionInfos.x, vec4(vPositionW, 1.0), normalW);\n\n if (vReflectionInfos.z != 0.0)\n {\n reflectionColor = textureCube(reflectionCubeSampler, vReflectionUVW).rgb * vReflectionInfos.y * shadow;\n }\n else\n {\n vec2 coords = vReflectionUVW.xy;\n\n if (vReflectionInfos.x == MAP_PROJECTION)\n {\n coords /= vReflectionUVW.z;\n }\n\n coords.y = 1.0 - coords.y;\n\n reflectionColor = texture2D(reflection2DSampler, coords).rgb * vReflectionInfos.y * shadow;\n }\n\n#ifdef REFLECTIONFRESNEL\n float reflectionFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, reflectionRightColor.a, reflectionLeftColor.a);\n\n reflectionColor *= reflectionLeftColor.rgb * (1.0 - reflectionFresnelTerm) + reflectionFresnelTerm * reflectionRightColor.rgb;\n#endif\n#endif\n\n#ifdef OPACITY\n vec4 opacityMap = texture2D(opacitySampler, vOpacityUV);\n\n#ifdef OPACITYRGB\n opacityMap.rgb = opacityMap.rgb * vec3(0.3, 0.59, 0.11);\n alpha *= (opacityMap.x + opacityMap.y + opacityMap.z)* vOpacityInfos.y;\n#else\n alpha *= opacityMap.a * vOpacityInfos.y;\n#endif\n\n#endif\n\n#ifdef VERTEXALPHA\n alpha *= vColor.a;\n#endif\n\n#ifdef OPACITYFRESNEL\n float opacityFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, opacityParts.z, opacityParts.w);\n\n alpha += opacityParts.x * (1.0 - opacityFresnelTerm) + opacityFresnelTerm * opacityParts.y;\n#endif\n\n // Emissive\n vec3 emissiveColor = vEmissiveColor;\n#ifdef EMISSIVE\n emissiveColor += texture2D(emissiveSampler, vEmissiveUV).rgb * vEmissiveInfos.y;\n#endif\n\n#ifdef EMISSIVEFRESNEL\n float emissiveFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, emissiveRightColor.a, emissiveLeftColor.a);\n\n emissiveColor *= emissiveLeftColor.rgb * (1.0 - emissiveFresnelTerm) + emissiveFresnelTerm * emissiveRightColor.rgb;\n#endif\n\n // Specular map\n vec3 specularColor = vSpecularColor.rgb;\n#ifdef SPECULAR\n specularColor = texture2D(specularSampler, vSpecularUV).rgb * vSpecularInfos.y;\n#endif\n\n // Fresnel\n#ifdef DIFFUSEFRESNEL\n float diffuseFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, diffuseRightColor.a, diffuseLeftColor.a);\n\n diffuseBase *= diffuseLeftColor.rgb * (1.0 - diffuseFresnelTerm) + diffuseFresnelTerm * diffuseRightColor.rgb;\n#endif\n\n // Composition\n vec3 finalDiffuse = clamp(diffuseBase * diffuseColor + emissiveColor + vAmbientColor, 0.0, 1.0) * baseColor.rgb;\n vec3 finalSpecular = specularBase * specularColor;\n\n#ifdef SPECULAROVERALPHA\n alpha = clamp(alpha + dot(finalSpecular, vec3(0.3, 0.59, 0.11)), 0., 1.);\n#endif\n\n vec4 color = vec4(finalDiffuse * baseAmbientColor + finalSpecular + reflectionColor, alpha);\n\n#ifdef FOG\n float fog = CalcFogFactor();\n color.rgb = fog * color.rgb + (1.0 - fog) * vFogColor;\n#endif\n\n gl_FragColor = color;\n}",
  13339. defaultVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec3 position;\nattribute vec3 normal;\n#ifdef UV1\nattribute vec2 uv;\n#endif\n#ifdef UV2\nattribute vec2 uv2;\n#endif\n#ifdef VERTEXCOLOR\nattribute vec4 color;\n#endif\n#ifdef BONES\nattribute vec4 matricesIndices;\nattribute vec4 matricesWeights;\n#endif\n\n// Uniforms\n\n#ifdef INSTANCES\nattribute vec4 world0;\nattribute vec4 world1;\nattribute vec4 world2;\nattribute vec4 world3;\n#else\nuniform mat4 world;\n#endif\n\nuniform mat4 view;\nuniform mat4 viewProjection;\n\n#ifdef DIFFUSE\nvarying vec2 vDiffuseUV;\nuniform mat4 diffuseMatrix;\nuniform vec2 vDiffuseInfos;\n#endif\n\n#ifdef AMBIENT\nvarying vec2 vAmbientUV;\nuniform mat4 ambientMatrix;\nuniform vec2 vAmbientInfos;\n#endif\n\n#ifdef OPACITY\nvarying vec2 vOpacityUV;\nuniform mat4 opacityMatrix;\nuniform vec2 vOpacityInfos;\n#endif\n\n#ifdef EMISSIVE\nvarying vec2 vEmissiveUV;\nuniform vec2 vEmissiveInfos;\nuniform mat4 emissiveMatrix;\n#endif\n\n#ifdef SPECULAR\nvarying vec2 vSpecularUV;\nuniform vec2 vSpecularInfos;\nuniform mat4 specularMatrix;\n#endif\n\n#ifdef BUMP\nvarying vec2 vBumpUV;\nuniform vec2 vBumpInfos;\nuniform mat4 bumpMatrix;\n#endif\n\n#ifdef BONES\nuniform mat4 mBones[BonesPerMesh];\n#endif\n\n#ifdef POINTSIZE\nuniform float pointSize;\n#endif\n\n// Output\nvarying vec3 vPositionW;\nvarying vec3 vNormalW;\n\n#ifdef VERTEXCOLOR\nvarying vec4 vColor;\n#endif\n\n#ifdef CLIPPLANE\nuniform vec4 vClipPlane;\nvarying float fClipDistance;\n#endif\n\n#ifdef FOG\nvarying float fFogDistance;\n#endif\n\n#ifdef SHADOWS\n#ifdef LIGHT0\nuniform mat4 lightMatrix0;\nvarying vec4 vPositionFromLight0;\n#endif\n#ifdef LIGHT1\nuniform mat4 lightMatrix1;\nvarying vec4 vPositionFromLight1;\n#endif\n#ifdef LIGHT2\nuniform mat4 lightMatrix2;\nvarying vec4 vPositionFromLight2;\n#endif\n#ifdef LIGHT3\nuniform mat4 lightMatrix3;\nvarying vec4 vPositionFromLight3;\n#endif\n#endif\n\n#ifdef REFLECTION\nvarying vec3 vPositionUVW;\n#endif\n\nvoid main(void) {\n mat4 finalWorld;\n\n#ifdef REFLECTION\n vPositionUVW = position;\n#endif \n\n#ifdef INSTANCES\n finalWorld = mat4(world0, world1, world2, world3);\n#else\n finalWorld = world;\n#endif\n\n#ifdef BONES\n mat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\n mat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\n mat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\n\n#ifdef BONES4\n mat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\n finalWorld = finalWorld * (m0 + m1 + m2 + m3);\n#else\n finalWorld = finalWorld * (m0 + m1 + m2);\n#endif \n\n#endif\n gl_Position = viewProjection * finalWorld * vec4(position, 1.0);\n\n vec4 worldPos = finalWorld * vec4(position, 1.0);\n vPositionW = vec3(worldPos);\n vNormalW = normalize(vec3(finalWorld * vec4(normal, 0.0)));\n\n // Texture coordinates\n#ifndef UV1\n vec2 uv = vec2(0., 0.);\n#endif\n#ifndef UV2\n vec2 uv2 = vec2(0., 0.);\n#endif\n\n#ifdef DIFFUSE\n if (vDiffuseInfos.x == 0.)\n {\n vDiffuseUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vDiffuseUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef AMBIENT\n if (vAmbientInfos.x == 0.)\n {\n vAmbientUV = vec2(ambientMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vAmbientUV = vec2(ambientMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef OPACITY\n if (vOpacityInfos.x == 0.)\n {\n vOpacityUV = vec2(opacityMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vOpacityUV = vec2(opacityMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef EMISSIVE\n if (vEmissiveInfos.x == 0.)\n {\n vEmissiveUV = vec2(emissiveMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vEmissiveUV = vec2(emissiveMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef SPECULAR\n if (vSpecularInfos.x == 0.)\n {\n vSpecularUV = vec2(specularMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vSpecularUV = vec2(specularMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef BUMP\n if (vBumpInfos.x == 0.)\n {\n vBumpUV = vec2(bumpMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vBumpUV = vec2(bumpMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n // Clip plane\n#ifdef CLIPPLANE\n fClipDistance = dot(worldPos, vClipPlane);\n#endif\n\n // Fog\n#ifdef FOG\n fFogDistance = (view * worldPos).z;\n#endif\n\n // Shadows\n#ifdef SHADOWS\n#ifdef LIGHT0\n vPositionFromLight0 = lightMatrix0 * worldPos;\n#endif\n#ifdef LIGHT1\n vPositionFromLight1 = lightMatrix1 * worldPos;\n#endif\n#ifdef LIGHT2\n vPositionFromLight2 = lightMatrix2 * worldPos;\n#endif\n#ifdef LIGHT3\n vPositionFromLight3 = lightMatrix3 * worldPos;\n#endif\n#endif\n\n // Vertex color\n#ifdef VERTEXCOLOR\n vColor = color;\n#endif\n\n // Point size\n#ifdef POINTSIZE\n gl_PointSize = pointSize;\n#endif\n}",
  13340. depthPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n#ifdef ALPHATEST\nvarying vec2 vUV;\nuniform sampler2D diffuseSampler;\n#endif\n\nuniform float far;\n\nvoid main(void)\n{\n#ifdef ALPHATEST\n if (texture2D(diffuseSampler, vUV).a < 0.4)\n discard;\n#endif\n\n float depth = (gl_FragCoord.z / gl_FragCoord.w) / far;\n gl_FragColor = vec4(depth, depth * depth, 0.0, 1.0);\n}",
  13341. depthVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attribute\nattribute vec3 position;\n#ifdef BONES\nattribute vec4 matricesIndices;\nattribute vec4 matricesWeights;\n#endif\n\n// Uniform\n#ifdef INSTANCES\nattribute vec4 world0;\nattribute vec4 world1;\nattribute vec4 world2;\nattribute vec4 world3;\n#else\nuniform mat4 world;\n#endif\n\nuniform mat4 viewProjection;\n#ifdef BONES\nuniform mat4 mBones[BonesPerMesh];\n#endif\n\n#ifdef ALPHATEST\nvarying vec2 vUV;\nuniform mat4 diffuseMatrix;\n#ifdef UV1\nattribute vec2 uv;\n#endif\n#ifdef UV2\nattribute vec2 uv2;\n#endif\n#endif\n\nvoid main(void)\n{\n#ifdef INSTANCES\n mat4 finalWorld = mat4(world0, world1, world2, world3);\n#else\n mat4 finalWorld = world;\n#endif\n\n#ifdef BONES\n mat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\n mat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\n mat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\n mat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\n finalWorld = finalWorld * (m0 + m1 + m2 + m3);\n gl_Position = viewProjection * finalWorld * vec4(position, 1.0);\n#else\n gl_Position = viewProjection * finalWorld * vec4(position, 1.0);\n#endif\n\n#ifdef ALPHATEST\n#ifdef UV1\n vUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\n#endif\n#ifdef UV2\n vUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\n#endif\n#endif\n}",
  13342. displayPassPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\nuniform sampler2D passSampler;\n\nvoid main(void)\n{\n gl_FragColor = texture2D(passSampler, vUV);\n}",
  13343. filterPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\nuniform mat4 kernelMatrix;\n\nvoid main(void)\n{\n vec3 baseColor = texture2D(textureSampler, vUV).rgb;\n vec3 updatedColor = (kernelMatrix * vec4(baseColor, 1.0)).rgb;\n\n gl_FragColor = vec4(updatedColor, 1.0);\n}",
  13344. firePixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nuniform float time;\nuniform vec3 c1;\nuniform vec3 c2;\nuniform vec3 c3;\nuniform vec3 c4;\nuniform vec3 c5;\nuniform vec3 c6;\nuniform vec2 speed;\nuniform float shift;\nuniform float alphaThreshold;\n\nvarying vec2 vUV;\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\n float total = 0.0, amplitude = 1.0;\n for (int i = 0; i < 4; i++) {\n total += noise(n) * amplitude;\n n += n;\n amplitude *= 0.5;\n }\n return total;\n}\n\nvoid main() {\n vec2 p = vUV * 8.0;\n float q = fbm(p - time * 0.1);\n vec2 r = vec2(fbm(p + q + time * speed.x - p.x - p.y), fbm(p + q - time * speed.y));\n vec3 c = mix(c1, c2, fbm(p + r)) + mix(c3, c4, r.x) - mix(c5, c6, r.y);\n vec3 color = c * cos(shift * vUV.y);\n float luminance = dot(color.rgb, vec3(0.3, 0.59, 0.11));\n\n gl_FragColor = vec4(color, luminance * alphaThreshold + (1.0 - alphaThreshold));\n}",
  13345. fxaaPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n#define FXAA_REDUCE_MIN (1.0/128.0)\n#define FXAA_REDUCE_MUL (1.0/8.0)\n#define FXAA_SPAN_MAX 8.0\n\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\nuniform vec2 texelSize;\n\nvoid main(){\n vec2 localTexelSize = texelSize;\n vec4 rgbNW = texture2D(textureSampler, (vUV + vec2(-1.0, -1.0) * localTexelSize));\n vec4 rgbNE = texture2D(textureSampler, (vUV + vec2(1.0, -1.0) * localTexelSize));\n vec4 rgbSW = texture2D(textureSampler, (vUV + vec2(-1.0, 1.0) * localTexelSize));\n vec4 rgbSE = texture2D(textureSampler, (vUV + vec2(1.0, 1.0) * localTexelSize));\n vec4 rgbM = texture2D(textureSampler, vUV);\n vec4 luma = vec4(0.299, 0.587, 0.114, 1.0);\n float lumaNW = dot(rgbNW, luma);\n float lumaNE = dot(rgbNE, luma);\n float lumaSW = dot(rgbSW, luma);\n float lumaSE = dot(rgbSE, luma);\n float lumaM = dot(rgbM, luma);\n float lumaMin = min(lumaM, min(min(lumaNW, lumaNE), min(lumaSW, lumaSE)));\n float lumaMax = max(lumaM, max(max(lumaNW, lumaNE), max(lumaSW, lumaSE)));\n\n vec2 dir = vec2(-((lumaNW + lumaNE) - (lumaSW + lumaSE)), ((lumaNW + lumaSW) - (lumaNE + lumaSE)));\n\n float dirReduce = max(\n (lumaNW + lumaNE + lumaSW + lumaSE) * (0.25 * FXAA_REDUCE_MUL),\n FXAA_REDUCE_MIN);\n\n float rcpDirMin = 1.0 / (min(abs(dir.x), abs(dir.y)) + dirReduce);\n dir = min(vec2(FXAA_SPAN_MAX, FXAA_SPAN_MAX),\n max(vec2(-FXAA_SPAN_MAX, -FXAA_SPAN_MAX),\n dir * rcpDirMin)) * localTexelSize;\n\n vec4 rgbA = 0.5 * (\n texture2D(textureSampler, vUV + dir * (1.0 / 3.0 - 0.5)) +\n texture2D(textureSampler, vUV + dir * (2.0 / 3.0 - 0.5)));\n\n vec4 rgbB = rgbA * 0.5 + 0.25 * (\n texture2D(textureSampler, vUV + dir * -0.5) +\n texture2D(textureSampler, vUV + dir * 0.5));\n float lumaB = dot(rgbB, luma);\n if ((lumaB < lumaMin) || (lumaB > lumaMax)) {\n gl_FragColor = rgbA;\n }\n else {\n gl_FragColor = rgbB;\n }\n}",
  13346. grassPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vPosition;\nvarying vec2 vUV;\n\nuniform vec3 herb1Color;\nuniform vec3 herb2Color;\nuniform vec3 herb3Color;\nuniform vec3 groundColor;\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\n float total = 0.0, amplitude = 1.0;\n for (int i = 0; i < 4; i++) {\n total += noise(n) * amplitude;\n n += n;\n amplitude *= 0.5;\n }\n return total;\n}\n\nvoid main(void) {\n vec3 color = mix(groundColor, herb1Color, rand(gl_FragCoord.xy * 4.0));\n color = mix(color, herb2Color, rand(gl_FragCoord.xy * 8.0));\n color = mix(color, herb3Color, rand(gl_FragCoord.xy));\n color = mix(color, herb1Color, fbm(gl_FragCoord.xy * 16.0));\n gl_FragColor = vec4(color, 1.0);\n}",
  13347. layerPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\n// Color\nuniform vec4 color;\n\nvoid main(void) {\n vec4 baseColor = texture2D(textureSampler, vUV);\n\n gl_FragColor = baseColor * color;\n}",
  13348. layerVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec2 position;\n\n// Uniforms\nuniform mat4 textureMatrix;\n\n// Output\nvarying vec2 vUV;\n\nconst vec2 madd = vec2(0.5, 0.5);\n\nvoid main(void) { \n\n vUV = vec2(textureMatrix * vec4(position * madd + madd, 1.0, 0.0));\n gl_Position = vec4(position, 0.0, 1.0);\n}",
  13349. legacydefaultPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n#define MAP_PROJECTION 4.\n\n// Constants\nuniform vec3 vEyePosition;\nuniform vec3 vAmbientColor;\nuniform vec4 vDiffuseColor;\nuniform vec4 vSpecularColor;\nuniform vec3 vEmissiveColor;\n\n// Input\nvarying vec3 vPositionW;\nvarying vec3 vNormalW;\n\n#ifdef VERTEXCOLOR\nvarying vec4 vColor;\n#endif\n\n// Lights\n#ifdef LIGHT0\nuniform vec4 vLightData0;\nuniform vec4 vLightDiffuse0;\nuniform vec3 vLightSpecular0;\n#ifdef SHADOW0\nvarying vec4 vPositionFromLight0;\nuniform sampler2D shadowSampler0;\n#endif\n#ifdef SPOTLIGHT0\nuniform vec4 vLightDirection0;\n#endif\n#ifdef HEMILIGHT0\nuniform vec3 vLightGround0;\n#endif\n#endif\n\n#ifdef LIGHT1\nuniform vec4 vLightData1;\nuniform vec4 vLightDiffuse1;\nuniform vec3 vLightSpecular1;\n#ifdef SHADOW1\nvarying vec4 vPositionFromLight1;\nuniform sampler2D shadowSampler1;\n#endif\n#ifdef SPOTLIGHT1\nuniform vec4 vLightDirection1;\n#endif\n#ifdef HEMILIGHT1\nuniform vec3 vLightGround1;\n#endif\n#endif\n\n#ifdef LIGHT2\nuniform vec4 vLightData2;\nuniform vec4 vLightDiffuse2;\nuniform vec3 vLightSpecular2;\n#ifdef SHADOW2\nvarying vec4 vPositionFromLight2;\nuniform sampler2D shadowSampler2;\n#endif\n#ifdef SPOTLIGHT2\nuniform vec4 vLightDirection2;\n#endif\n#ifdef HEMILIGHT2\nuniform vec3 vLightGround2;\n#endif\n#endif\n\n#ifdef LIGHT3\nuniform vec4 vLightData3;\nuniform vec4 vLightDiffuse3;\nuniform vec3 vLightSpecular3;\n#ifdef SHADOW3\nvarying vec4 vPositionFromLight3;\nuniform sampler2D shadowSampler3;\n#endif\n#ifdef SPOTLIGHT3\nuniform vec4 vLightDirection3;\n#endif\n#ifdef HEMILIGHT3\nuniform vec3 vLightGround3;\n#endif\n#endif\n\n// Samplers\n#ifdef DIFFUSE\nvarying vec2 vDiffuseUV;\nuniform sampler2D diffuseSampler;\nuniform vec2 vDiffuseInfos;\n#endif\n\n#ifdef AMBIENT\nvarying vec2 vAmbientUV;\nuniform sampler2D ambientSampler;\nuniform vec2 vAmbientInfos;\n#endif\n\n#ifdef OPACITY \nvarying vec2 vOpacityUV;\nuniform sampler2D opacitySampler;\nuniform vec2 vOpacityInfos;\n#endif\n\n#ifdef REFLECTION\nvarying vec3 vReflectionUVW;\nuniform samplerCube reflectionCubeSampler;\nuniform sampler2D reflection2DSampler;\nuniform vec3 vReflectionInfos;\n#endif\n\n#ifdef EMISSIVE\nvarying vec2 vEmissiveUV;\nuniform vec2 vEmissiveInfos;\nuniform sampler2D emissiveSampler;\n#endif\n\n#ifdef SPECULAR\nvarying vec2 vSpecularUV;\nuniform vec2 vSpecularInfos;\nuniform sampler2D specularSampler;\n#endif\n\n// Fresnel\n#ifdef FRESNEL\nfloat computeFresnelTerm(vec3 viewDirection, vec3 worldNormal, float bias, float power)\n{\n float fresnelTerm = pow(bias + abs(dot(viewDirection, worldNormal)), power);\n return clamp(fresnelTerm, 0., 1.);\n}\n#endif\n\n#ifdef DIFFUSEFRESNEL\nuniform vec4 diffuseLeftColor;\nuniform vec4 diffuseRightColor;\n#endif\n\n#ifdef OPACITYFRESNEL\nuniform vec4 opacityParts;\n#endif\n\n#ifdef REFLECTIONFRESNEL\nuniform vec4 reflectionLeftColor;\nuniform vec4 reflectionRightColor;\n#endif\n\n#ifdef EMISSIVEFRESNEL\nuniform vec4 emissiveLeftColor;\nuniform vec4 emissiveRightColor;\n#endif\n\n// Shadows\n#ifdef SHADOWS\n\nfloat unpack(vec4 color)\n{\n const vec4 bitShift = vec4(1. / (255. * 255. * 255.), 1. / (255. * 255.), 1. / 255., 1.);\n return dot(color, bitShift);\n}\n\nfloat unpackHalf(vec2 color)\n{\n return color.x + (color.y / 255.0);\n}\n\nfloat computeShadow(vec4 vPositionFromLight, sampler2D shadowSampler)\n{\n vec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\n vec2 uv = 0.5 * depth.xy + vec2(0.5, 0.5);\n\n if (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\n {\n return 1.0;\n }\n\n float shadow = unpack(texture2D(shadowSampler, uv));\n\n if (depth.z > shadow)\n {\n return 0.;\n }\n return 1.;\n}\n\n// Thanks to http://devmaster.net/\nfloat ChebychevInequality(vec2 moments, float t)\n{\n if (t <= moments.x)\n {\n return 1.0;\n }\n\n float variance = moments.y - (moments.x * moments.x);\n variance = max(variance, 0.);\n\n float d = t - moments.x;\n return variance / (variance + d * d);\n}\n\nfloat computeShadowWithVSM(vec4 vPositionFromLight, sampler2D shadowSampler)\n{\n vec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\n vec2 uv = 0.5 * depth.xy + vec2(0.5, 0.5);\n\n if (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\n {\n return 1.0;\n }\n\n vec4 texel = texture2D(shadowSampler, uv);\n\n vec2 moments = vec2(unpackHalf(texel.xy), unpackHalf(texel.zw));\n return clamp(1.3 - ChebychevInequality(moments, depth.z), 0., 1.0);\n}\n#endif\n\n#ifdef CLIPPLANE\nvarying float fClipDistance;\n#endif\n\n// Fog\n#ifdef FOG\n\n#define FOGMODE_NONE 0.\n#define FOGMODE_EXP 1.\n#define FOGMODE_EXP2 2.\n#define FOGMODE_LINEAR 3.\n#define E 2.71828\n\nuniform vec4 vFogInfos;\nuniform vec3 vFogColor;\nvarying float fFogDistance;\n\nfloat CalcFogFactor()\n{\n float fogCoeff = 1.0;\n float fogStart = vFogInfos.y;\n float fogEnd = vFogInfos.z;\n float fogDensity = vFogInfos.w;\n\n if (FOGMODE_LINEAR == vFogInfos.x)\n {\n fogCoeff = (fogEnd - fFogDistance) / (fogEnd - fogStart);\n }\n else if (FOGMODE_EXP == vFogInfos.x)\n {\n fogCoeff = 1.0 / pow(E, fFogDistance * fogDensity);\n }\n else if (FOGMODE_EXP2 == vFogInfos.x)\n {\n fogCoeff = 1.0 / pow(E, fFogDistance * fFogDistance * fogDensity * fogDensity);\n }\n\n return clamp(fogCoeff, 0.0, 1.0);\n}\n#endif\n\n// Light Computing\nmat3 computeLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec4 diffuseColor, vec3 specularColor) {\n mat3 result;\n\n vec3 lightVectorW;\n if (lightData.w == 0.)\n {\n lightVectorW = normalize(lightData.xyz - vPositionW);\n }\n else\n {\n lightVectorW = normalize(-lightData.xyz);\n }\n\n // diffuse\n float ndl = max(0., dot(vNormal, lightVectorW));\n\n // Specular\n vec3 angleW = normalize(viewDirectionW + lightVectorW);\n float specComp = max(0., dot(vNormal, angleW));\n specComp = max(0., pow(specComp, max(1.0, vSpecularColor.a)));\n\n result[0] = ndl * diffuseColor.rgb;\n result[1] = specComp * specularColor;\n result[2] = vec3(0.);\n\n return result;\n}\n\nmat3 computeSpotLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec4 lightDirection, vec4 diffuseColor, vec3 specularColor) {\n mat3 result;\n\n vec3 lightVectorW = normalize(lightData.xyz - vPositionW);\n\n // diffuse\n float cosAngle = max(0., dot(-lightDirection.xyz, lightVectorW));\n float spotAtten = 0.0;\n\n if (cosAngle >= lightDirection.w)\n {\n cosAngle = max(0., pow(cosAngle, lightData.w));\n spotAtten = max(0., (cosAngle - lightDirection.w) / (1. - cosAngle));\n\n // Diffuse\n float ndl = max(0., dot(vNormal, -lightDirection.xyz));\n\n // Specular\n vec3 angleW = normalize(viewDirectionW - lightDirection.xyz);\n float specComp = max(0., dot(vNormal, angleW));\n specComp = pow(specComp, vSpecularColor.a);\n\n result[0] = ndl * spotAtten * diffuseColor.rgb;\n result[1] = specComp * specularColor * spotAtten;\n result[2] = vec3(0.);\n\n return result;\n }\n\n result[0] = vec3(0.);\n result[1] = vec3(0.);\n result[2] = vec3(0.);\n\n return result;\n}\n\nmat3 computeHemisphericLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec4 diffuseColor, vec3 specularColor, vec3 groundColor) {\n mat3 result;\n\n // Diffuse\n float ndl = dot(vNormal, lightData.xyz) * 0.5 + 0.5;\n\n // Specular\n vec3 angleW = normalize(viewDirectionW + lightData.xyz);\n float specComp = max(0., dot(vNormal, angleW));\n specComp = pow(specComp, vSpecularColor.a);\n\n result[0] = mix(groundColor, diffuseColor.rgb, ndl);\n result[1] = specComp * specularColor;\n result[2] = vec3(0.);\n\n return result;\n}\n\nvoid main(void) {\n // Clip plane\n#ifdef CLIPPLANE\n if (fClipDistance > 0.0)\n discard;\n#endif\n\n vec3 viewDirectionW = normalize(vEyePosition - vPositionW);\n\n // Base color\n vec4 baseColor = vec4(1., 1., 1., 1.);\n vec3 diffuseColor = vDiffuseColor.rgb;\n\n#ifdef VERTEXCOLOR\n baseColor.rgb *= vColor.rgb;\n#endif\n\n#ifdef DIFFUSE\n baseColor = texture2D(diffuseSampler, vDiffuseUV);\n\n#ifdef ALPHATEST\n if (baseColor.a < 0.4)\n discard;\n#endif\n\n baseColor.rgb *= vDiffuseInfos.y;\n#endif\n\n // Bump\n vec3 normalW = normalize(vNormalW);\n\n // Ambient color\n vec3 baseAmbientColor = vec3(1., 1., 1.);\n\n#ifdef AMBIENT\n baseAmbientColor = texture2D(ambientSampler, vAmbientUV).rgb * vAmbientInfos.y;\n#endif\n\n // Lighting\n vec3 diffuseBase = vec3(0., 0., 0.);\n vec3 specularBase = vec3(0., 0., 0.);\n float shadow = 1.;\n\n#ifdef LIGHT0\n#ifdef SPOTLIGHT0\n mat3 info = computeSpotLighting(viewDirectionW, normalW, vLightData0, vLightDirection0, vLightDiffuse0, vLightSpecular0);\n#endif\n#ifdef HEMILIGHT0\n mat3 info = computeHemisphericLighting(viewDirectionW, normalW, vLightData0, vLightDiffuse0, vLightSpecular0, vLightGround0);\n#endif\n#ifdef POINTDIRLIGHT0\n mat3 info = computeLighting(viewDirectionW, normalW, vLightData0, vLightDiffuse0, vLightSpecular0);\n#endif\n#ifdef SHADOW0\n#ifdef SHADOWVSM0\n shadow = computeShadowWithVSM(vPositionFromLight0, shadowSampler0);\n#else\n shadow = computeShadow(vPositionFromLight0, shadowSampler0);\n#endif\n#else\n shadow = 1.;\n#endif\n diffuseBase += info[0] * shadow;\n specularBase += info[1] * shadow;\n#endif\n\n#ifdef LIGHT1\n#ifdef SPOTLIGHT1\n info = computeSpotLighting(viewDirectionW, normalW, vLightData1, vLightDirection1, vLightDiffuse1, vLightSpecular1);\n#endif\n#ifdef HEMILIGHT1\n info = computeHemisphericLighting(viewDirectionW, normalW, vLightData1, vLightDiffuse1, vLightSpecular1, vLightGround1);\n#endif\n#ifdef POINTDIRLIGHT1\n info = computeLighting(viewDirectionW, normalW, vLightData1, vLightDiffuse1, vLightSpecular1);\n#endif\n#ifdef SHADOW1\n#ifdef SHADOWVSM1\n shadow = computeShadowWithVSM(vPositionFromLight1, shadowSampler1);\n#else\n shadow = computeShadow(vPositionFromLight1, shadowSampler1);\n#endif\n#else\n shadow = 1.;\n#endif\n diffuseBase += info[0] * shadow;\n specularBase += info[1] * shadow;\n#endif\n\n#ifdef LIGHT2\n#ifdef SPOTLIGHT2\n info = computeSpotLighting(viewDirectionW, normalW, vLightData2, vLightDirection2, vLightDiffuse2, vLightSpecular2);\n#endif\n#ifdef HEMILIGHT2\n info = computeHemisphericLighting(viewDirectionW, normalW, vLightData2, vLightDiffuse2, vLightSpecular2, vLightGround2);\n#endif\n#ifdef POINTDIRLIGHT2\n info = computeLighting(viewDirectionW, normalW, vLightData2, vLightDiffuse2, vLightSpecular2);\n#endif\n#ifdef SHADOW2\n#ifdef SHADOWVSM2\n shadow = computeShadowWithVSM(vPositionFromLight2, shadowSampler2);\n#else\n shadow = computeShadow(vPositionFromLight2, shadowSampler2);\n#endif \n#else\n shadow = 1.;\n#endif\n diffuseBase += info[0] * shadow;\n specularBase += info[1] * shadow;\n#endif\n\n#ifdef LIGHT3\n#ifdef SPOTLIGHT3\n info = computeSpotLighting(viewDirectionW, normalW, vLightData3, vLightDirection3, vLightDiffuse3, vLightSpecular3);\n#endif\n#ifdef HEMILIGHT3\n info = computeHemisphericLighting(viewDirectionW, normalW, vLightData3, vLightDiffuse3, vLightSpecular3, vLightGround3);\n#endif\n#ifdef POINTDIRLIGHT3\n info = computeLighting(viewDirectionW, normalW, vLightData3, vLightDiffuse3, vLightSpecular3);\n#endif\n#ifdef SHADOW3\n#ifdef SHADOWVSM3\n shadow = computeShadowWithVSM(vPositionFromLight3, shadowSampler3);\n#else\n shadow = computeShadow(vPositionFromLight3, shadowSampler3);\n#endif \n#else\n shadow = 1.;\n#endif\n diffuseBase += info[0] * shadow;\n specularBase += info[1] * shadow;\n#endif\n\n // Reflection\n vec3 reflectionColor = vec3(0., 0., 0.);\n\n#ifdef REFLECTION\n if (vReflectionInfos.z != 0.0)\n {\n reflectionColor = textureCube(reflectionCubeSampler, vReflectionUVW).rgb * vReflectionInfos.y;\n }\n else\n {\n vec2 coords = vReflectionUVW.xy;\n\n if (vReflectionInfos.x == MAP_PROJECTION)\n {\n coords /= vReflectionUVW.z;\n }\n\n coords.y = 1.0 - coords.y;\n\n reflectionColor = texture2D(reflection2DSampler, coords).rgb * vReflectionInfos.y;\n }\n\n#ifdef REFLECTIONFRESNEL\n float reflectionFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, reflectionRightColor.a, reflectionLeftColor.a);\n\n reflectionColor *= reflectionLeftColor.rgb * (1.0 - reflectionFresnelTerm) + reflectionFresnelTerm * reflectionRightColor.rgb;\n#endif\n#endif\n\n // Alpha\n float alpha = vDiffuseColor.a;\n\n#ifdef OPACITY\n vec4 opacityMap = texture2D(opacitySampler, vOpacityUV);\n#ifdef OPACITYRGB\n opacityMap.rgb = opacityMap.rgb * vec3(0.3, 0.59, 0.11);\n alpha *= (opacityMap.x + opacityMap.y + opacityMap.z)* vOpacityInfos.y;\n#else\n alpha *= opacityMap.a * vOpacityInfos.y;\n#endif\n#endif\n\n#ifdef VERTEXALPHA\n alpha *= vColor.a;\n#endif\n\n#ifdef OPACITYFRESNEL\n float opacityFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, opacityParts.z, opacityParts.w);\n\n alpha += opacityParts.x * (1.0 - opacityFresnelTerm) + opacityFresnelTerm * opacityParts.y;\n#endif\n\n // Emissive\n vec3 emissiveColor = vEmissiveColor;\n#ifdef EMISSIVE\n emissiveColor += texture2D(emissiveSampler, vEmissiveUV).rgb * vEmissiveInfos.y;\n#endif\n\n#ifdef EMISSIVEFRESNEL\n float emissiveFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, emissiveRightColor.a, emissiveLeftColor.a);\n\n emissiveColor *= emissiveLeftColor.rgb * (1.0 - emissiveFresnelTerm) + emissiveFresnelTerm * emissiveRightColor.rgb;\n#endif\n\n // Specular map\n vec3 specularColor = vSpecularColor.rgb;\n#ifdef SPECULAR\n specularColor = texture2D(specularSampler, vSpecularUV).rgb * vSpecularInfos.y;\n#endif\n\n // Fresnel\n#ifdef DIFFUSEFRESNEL\n float diffuseFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, diffuseRightColor.a, diffuseLeftColor.a);\n\n diffuseBase *= diffuseLeftColor.rgb * (1.0 - diffuseFresnelTerm) + diffuseFresnelTerm * diffuseRightColor.rgb;\n#endif\n\n // Composition\n vec3 finalDiffuse = clamp(diffuseBase * diffuseColor + emissiveColor + vAmbientColor, 0.0, 1.0) * baseColor.rgb;\n vec3 finalSpecular = specularBase * specularColor;\n\n vec4 color = vec4(finalDiffuse * baseAmbientColor + finalSpecular + reflectionColor, alpha);\n\n#ifdef FOG\n float fog = CalcFogFactor();\n color.rgb = fog * color.rgb + (1.0 - fog) * vFogColor;\n#endif\n\n gl_FragColor = color;\n}",
  13350. legacydefaultVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n#define MAP_EXPLICIT 0.\n#define MAP_SPHERICAL 1.\n#define MAP_PLANAR 2.\n#define MAP_CUBIC 3.\n#define MAP_PROJECTION 4.\n#define MAP_SKYBOX 5.\n\n// Attributes\nattribute vec3 position;\nattribute vec3 normal;\n#ifdef UV1\nattribute vec2 uv;\n#endif\n#ifdef UV2\nattribute vec2 uv2;\n#endif\n#ifdef VERTEXCOLOR\nattribute vec4 color;\n#endif\n#ifdef BONES\nattribute vec4 matricesIndices;\nattribute vec4 matricesWeights;\n#endif\n\n// Uniforms\nuniform mat4 world;\nuniform mat4 view;\nuniform mat4 viewProjection;\n\n#ifdef DIFFUSE\nvarying vec2 vDiffuseUV;\nuniform mat4 diffuseMatrix;\nuniform vec2 vDiffuseInfos;\n#endif\n\n#ifdef AMBIENT\nvarying vec2 vAmbientUV;\nuniform mat4 ambientMatrix;\nuniform vec2 vAmbientInfos;\n#endif\n\n#ifdef OPACITY\nvarying vec2 vOpacityUV;\nuniform mat4 opacityMatrix;\nuniform vec2 vOpacityInfos;\n#endif\n\n#ifdef REFLECTION\nuniform vec3 vEyePosition;\nvarying vec3 vReflectionUVW;\nuniform vec3 vReflectionInfos;\nuniform mat4 reflectionMatrix;\n#endif\n\n#ifdef EMISSIVE\nvarying vec2 vEmissiveUV;\nuniform vec2 vEmissiveInfos;\nuniform mat4 emissiveMatrix;\n#endif\n\n#ifdef SPECULAR\nvarying vec2 vSpecularUV;\nuniform vec2 vSpecularInfos;\nuniform mat4 specularMatrix;\n#endif\n\n#ifdef BUMP\nvarying vec2 vBumpUV;\nuniform vec2 vBumpInfos;\nuniform mat4 bumpMatrix;\n#endif\n\n#ifdef BONES\nuniform mat4 mBones[BonesPerMesh];\n#endif\n\n// Output\nvarying vec3 vPositionW;\nvarying vec3 vNormalW;\n\n#ifdef VERTEXCOLOR\nvarying vec4 vColor;\n#endif\n\n#ifdef CLIPPLANE\nuniform vec4 vClipPlane;\nvarying float fClipDistance;\n#endif\n\n#ifdef FOG\nvarying float fFogDistance;\n#endif\n\n#ifdef SHADOWS\n#ifdef LIGHT0\nuniform mat4 lightMatrix0;\nvarying vec4 vPositionFromLight0;\n#endif\n#ifdef LIGHT1\nuniform mat4 lightMatrix1;\nvarying vec4 vPositionFromLight1;\n#endif\n#ifdef LIGHT2\nuniform mat4 lightMatrix2;\nvarying vec4 vPositionFromLight2;\n#endif\n#ifdef LIGHT3\nuniform mat4 lightMatrix3;\nvarying vec4 vPositionFromLight3;\n#endif\n#endif\n\n#ifdef REFLECTION\nvec3 computeReflectionCoords(float mode, vec4 worldPos, vec3 worldNormal)\n{\n if (mode == MAP_SPHERICAL)\n {\n vec3 coords = vec3(view * vec4(worldNormal, 0.0));\n\n return vec3(reflectionMatrix * vec4(coords, 1.0));\n }\n else if (mode == MAP_PLANAR)\n {\n vec3 viewDir = worldPos.xyz - vEyePosition;\n vec3 coords = normalize(reflect(viewDir, worldNormal));\n\n return vec3(reflectionMatrix * vec4(coords, 1));\n }\n else if (mode == MAP_CUBIC)\n {\n vec3 viewDir = worldPos.xyz - vEyePosition;\n vec3 coords = reflect(viewDir, worldNormal);\n\n return vec3(reflectionMatrix * vec4(coords, 0));\n }\n else if (mode == MAP_PROJECTION)\n {\n return vec3(reflectionMatrix * (view * worldPos));\n }\n else if (mode == MAP_SKYBOX)\n {\n return position;\n }\n\n return vec3(0, 0, 0);\n}\n#endif\n\nvoid main(void) {\n mat4 finalWorld;\n\n#ifdef BONES\n mat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\n mat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\n mat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\n\n#ifdef BONES4\n mat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\n finalWorld = world * (m0 + m1 + m2 + m3);\n#else\n finalWorld = world * (m0 + m1 + m2);\n#endif \n\n#else\n finalWorld = world;\n#endif\n\n gl_Position = viewProjection * finalWorld * vec4(position, 1.0);\n\n vec4 worldPos = finalWorld * vec4(position, 1.0);\n vPositionW = vec3(worldPos);\n vNormalW = normalize(vec3(finalWorld * vec4(normal, 0.0)));\n\n // Texture coordinates\n#ifndef UV1\n vec2 uv = vec2(0., 0.);\n#endif\n#ifndef UV2\n vec2 uv2 = vec2(0., 0.);\n#endif\n\n#ifdef DIFFUSE\n if (vDiffuseInfos.x == 0.)\n {\n vDiffuseUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vDiffuseUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef AMBIENT\n if (vAmbientInfos.x == 0.)\n {\n vAmbientUV = vec2(ambientMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vAmbientUV = vec2(ambientMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef OPACITY\n if (vOpacityInfos.x == 0.)\n {\n vOpacityUV = vec2(opacityMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vOpacityUV = vec2(opacityMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef REFLECTION\n vReflectionUVW = computeReflectionCoords(vReflectionInfos.x, vec4(vPositionW, 1.0), vNormalW);\n#endif\n\n#ifdef EMISSIVE\n if (vEmissiveInfos.x == 0.)\n {\n vEmissiveUV = vec2(emissiveMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vEmissiveUV = vec2(emissiveMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef SPECULAR\n if (vSpecularInfos.x == 0.)\n {\n vSpecularUV = vec2(specularMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vSpecularUV = vec2(specularMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n#ifdef BUMP\n if (vBumpInfos.x == 0.)\n {\n vBumpUV = vec2(bumpMatrix * vec4(uv, 1.0, 0.0));\n }\n else\n {\n vBumpUV = vec2(bumpMatrix * vec4(uv2, 1.0, 0.0));\n }\n#endif\n\n // Clip plane\n#ifdef CLIPPLANE\n fClipDistance = dot(worldPos, vClipPlane);\n#endif\n\n // Fog\n#ifdef FOG\n fFogDistance = (view * worldPos).z;\n#endif\n\n // Shadows\n#ifdef SHADOWS\n#ifdef LIGHT0\n vPositionFromLight0 = lightMatrix0 * worldPos;\n#endif\n#ifdef LIGHT1\n vPositionFromLight1 = lightMatrix1 * worldPos;\n#endif\n#ifdef LIGHT2\n vPositionFromLight2 = lightMatrix2 * worldPos;\n#endif\n#ifdef LIGHT3\n vPositionFromLight3 = lightMatrix3 * worldPos;\n#endif\n#endif\n\n // Vertex color\n#ifdef VERTEXCOLOR\n vColor = color;\n#endif\n}",
  13351. lensFlarePixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\n// Color\nuniform vec4 color;\n\nvoid main(void) {\n vec4 baseColor = texture2D(textureSampler, vUV);\n\n gl_FragColor = baseColor * color;\n}",
  13352. lensFlareVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec2 position;\n\n// Uniforms\nuniform mat4 viewportMatrix;\n\n// Output\nvarying vec2 vUV;\n\nconst vec2 madd = vec2(0.5, 0.5);\n\nvoid main(void) { \n\n vUV = position * madd + madd;\n gl_Position = viewportMatrix * vec4(position, 0.0, 1.0);\n}",
  13353. marblePixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vPosition;\nvarying vec2 vUV;\n\nuniform float numberOfTilesHeight;\nuniform float numberOfTilesWidth;\nuniform float amplitude;\nuniform vec3 brickColor;\nuniform vec3 jointColor;\n\nconst vec3 tileSize = vec3(1.1, 1.0, 1.1);\nconst vec3 tilePct = vec3(0.98, 1.0, 0.98);\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat turbulence(vec2 P)\n{\n float val = 0.0;\n float freq = 1.0;\n for (int i = 0; i < 4; i++)\n {\n val += abs(noise(P*freq) / freq);\n freq *= 2.07;\n }\n return val;\n}\n\nfloat round(float number){\n return sign(number)*floor(abs(number) + 0.5);\n}\n\nvec3 marble_color(float x)\n{\n vec3 col;\n x = 0.5*(x + 1.);\n x = sqrt(x); \n x = sqrt(x);\n x = sqrt(x);\n col = vec3(.2 + .75*x); \n col.b *= 0.95; \n return col;\n}\n\nvoid main()\n{\n float brickW = 1.0 / numberOfTilesWidth;\n float brickH = 1.0 / numberOfTilesHeight;\n float jointWPercentage = 0.01;\n float jointHPercentage = 0.01;\n vec3 color = brickColor;\n float yi = vUV.y / brickH;\n float nyi = round(yi);\n float xi = vUV.x / brickW;\n\n if (mod(floor(yi), 2.0) == 0.0){\n xi = xi - 0.5;\n }\n\n float nxi = round(xi);\n vec2 brickvUV = vec2((xi - floor(xi)) / brickH, (yi - floor(yi)) / brickW);\n\n if (yi < nyi + jointHPercentage && yi > nyi - jointHPercentage){\n color = mix(jointColor, vec3(0.37, 0.25, 0.25), (yi - nyi) / jointHPercentage + 0.2);\n }\n else if (xi < nxi + jointWPercentage && xi > nxi - jointWPercentage){\n color = mix(jointColor, vec3(0.44, 0.44, 0.44), (xi - nxi) / jointWPercentage + 0.2);\n }\n else {\n float t = 6.28 * brickvUV.x / (tileSize.x + noise(vec2(vUV)*6.0));\n t += amplitude * turbulence(brickvUV.xy);\n t = sin(t);\n color = marble_color(t);\n }\n\n gl_FragColor = vec4(color, 0.0);\n}",
  13354. oculusDistortionCorrectionPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\nuniform vec2 LensCenter;\nuniform vec2 Scale;\nuniform vec2 ScaleIn;\nuniform vec4 HmdWarpParam;\n\nvec2 HmdWarp(vec2 in01) {\n\n vec2 theta = (in01 - LensCenter) * ScaleIn; // Scales to [-1, 1]\n float rSq = theta.x * theta.x + theta.y * theta.y;\n vec2 rvector = theta * (HmdWarpParam.x + HmdWarpParam.y * rSq + HmdWarpParam.z * rSq * rSq + HmdWarpParam.w * rSq * rSq * rSq);\n return LensCenter + Scale * rvector;\n}\n\nvoid main(void)\n{\n vec2 tc = HmdWarp(vUV);\n if (tc.x <0.0 || tc.x>1.0 || tc.y<0.0 || tc.y>1.0)\n gl_FragColor = vec4(0.0, 0.0, 0.0, 1.0);\n else{\n gl_FragColor = vec4(texture2D(textureSampler, tc).rgb, 1.0);\n }\n}",
  13355. outlinePixelShader:"precision highp float;\n\nuniform vec4 color;\n\n#ifdef ALPHATEST\nvarying vec2 vUV;\nuniform sampler2D diffuseSampler;\n#endif\n\nvoid main(void) {\n#ifdef ALPHATEST\n if (texture2D(diffuseSampler, vUV).a < 0.4)\n discard;\n#endif\n\n gl_FragColor = color;\n}",
  13356. outlineVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attribute\nattribute vec3 position;\nattribute vec3 normal;\n\n#ifdef BONES\nattribute vec4 matricesIndices;\nattribute vec4 matricesWeights;\n#endif\n\n// Uniform\nuniform float offset;\n\n#ifdef INSTANCES\nattribute vec4 world0;\nattribute vec4 world1;\nattribute vec4 world2;\nattribute vec4 world3;\n#else\nuniform mat4 world;\n#endif\n\nuniform mat4 viewProjection;\n#ifdef BONES\nuniform mat4 mBones[BonesPerMesh];\n#endif\n\n#ifdef ALPHATEST\nvarying vec2 vUV;\nuniform mat4 diffuseMatrix;\n#ifdef UV1\nattribute vec2 uv;\n#endif\n#ifdef UV2\nattribute vec2 uv2;\n#endif\n#endif\n\nvoid main(void)\n{\n#ifdef INSTANCES\n mat4 finalWorld = mat4(world0, world1, world2, world3);\n#else\n mat4 finalWorld = world;\n#endif\n\n vec3 offsetPosition = position + normal * offset;\n\n#ifdef BONES\n mat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\n mat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\n mat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\n mat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\n finalWorld = finalWorld * (m0 + m1 + m2 + m3);\n gl_Position = viewProjection * finalWorld * vec4(offsetPosition, 1.0);\n#else\n gl_Position = viewProjection * finalWorld * vec4(offsetPosition, 1.0);\n#endif\n\n#ifdef ALPHATEST\n#ifdef UV1\n vUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\n#endif\n#ifdef UV2\n vUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\n#endif\n#endif\n}",
  13357. particlesPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nvarying vec4 vColor;\nuniform vec4 textureMask;\nuniform sampler2D diffuseSampler;\n\n#ifdef CLIPPLANE\nvarying float fClipDistance;\n#endif\n\nvoid main(void) {\n#ifdef CLIPPLANE\n if (fClipDistance > 0.0)\n discard;\n#endif\n vec4 baseColor = texture2D(diffuseSampler, vUV);\n\n gl_FragColor = (baseColor * textureMask + (vec4(1., 1., 1., 1.) - textureMask)) * vColor;\n}",
  13358. particlesVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec3 position;\nattribute vec4 color;\nattribute vec4 options;\n\n// Uniforms\nuniform mat4 view;\nuniform mat4 projection;\n\n// Output\nvarying vec2 vUV;\nvarying vec4 vColor;\n\n#ifdef CLIPPLANE\nuniform vec4 vClipPlane;\nuniform mat4 invView;\nvarying float fClipDistance;\n#endif\n\nvoid main(void) { \n vec3 viewPos = (view * vec4(position, 1.0)).xyz; \n vec3 cornerPos;\n float size = options.y;\n float angle = options.x;\n vec2 offset = options.zw;\n\n cornerPos = vec3(offset.x - 0.5, offset.y - 0.5, 0.) * size;\n\n // Rotate\n vec3 rotatedCorner;\n rotatedCorner.x = cornerPos.x * cos(angle) - cornerPos.y * sin(angle);\n rotatedCorner.y = cornerPos.x * sin(angle) + cornerPos.y * cos(angle);\n rotatedCorner.z = 0.;\n\n // Position\n viewPos += rotatedCorner;\n gl_Position = projection * vec4(viewPos, 1.0); \n \n vColor = color;\n vUV = offset;\n\n // Clip plane\n#ifdef CLIPPLANE\n vec4 worldPos = invView * vec4(viewPos, 1.0);\n fClipDistance = dot(worldPos, vClipPlane);\n#endif\n}",
  13359. passPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\n\nvoid main(void) \n{\n gl_FragColor = texture2D(textureSampler, vUV);\n}",
  13360. postprocessVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec2 position;\n\n// Output\nvarying vec2 vUV;\n\nconst vec2 madd = vec2(0.5, 0.5);\n\nvoid main(void) { \n\n vUV = position * madd + madd;\n gl_Position = vec4(position, 0.0, 1.0);\n}",
  13361. proceduralVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec2 position;\n\n// Output\nvarying vec2 vPosition;\nvarying vec2 vUV;\n\nconst vec2 madd = vec2(0.5, 0.5);\n\nvoid main(void) { \n vPosition = position;\n vUV = position * madd + madd;\n gl_Position = vec4(position, 0.0, 1.0);\n}",
  13362. refractionPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D textureSampler;\nuniform sampler2D refractionSampler;\n\n// Parameters\nuniform vec3 baseColor;\nuniform float depth;\nuniform float colorLevel;\n\nvoid main() {\n float ref = 1.0 - texture2D(refractionSampler, vUV).r;\n\n vec2 uv = vUV - vec2(0.5);\n vec2 offset = uv * depth * ref;\n vec3 sourceColor = texture2D(textureSampler, vUV - offset).rgb;\n\n gl_FragColor = vec4(sourceColor + sourceColor * ref * colorLevel, 1.0);\n}",
  13363. roadPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vUV; \nuniform vec3 roadColor;\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\n float total = 0.0, amplitude = 1.0;\n for (int i = 0; i < 4; i++) {\n total += noise(n) * amplitude;\n n += n;\n amplitude *= 0.5;\n }\n return total;\n}\n\nvoid main(void) {\n float ratioy = mod(gl_FragCoord.y * 100.0 , fbm(vUV * 2.0));\n vec3 color = roadColor * ratioy;\n gl_FragColor = vec4(color, 1.0);\n}",
  13364. shadowMapPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvec4 pack(float depth)\n{\n const vec4 bitOffset = vec4(255. * 255. * 255., 255. * 255., 255., 1.);\n const vec4 bitMask = vec4(0., 1. / 255., 1. / 255., 1. / 255.);\n \n vec4 comp = mod(depth * bitOffset * vec4(254.), vec4(255.)) / vec4(254.);\n comp -= comp.xxyz * bitMask;\n \n return comp;\n}\n\n// Thanks to http://devmaster.net/\nvec2 packHalf(float depth) \n{ \n const vec2 bitOffset = vec2(1.0 / 255., 0.);\n vec2 color = vec2(depth, fract(depth * 255.));\n\n return color - (color.yy * bitOffset);\n}\n\n#ifndef VSM\nvarying vec4 vPosition;\n#endif\n\n#ifdef ALPHATEST\nvarying vec2 vUV;\nuniform sampler2D diffuseSampler;\n#endif\n\nvoid main(void)\n{\n#ifdef ALPHATEST\n if (texture2D(diffuseSampler, vUV).a < 0.4)\n discard;\n#endif\n\n#ifdef VSM\n float moment1 = gl_FragCoord.z / gl_FragCoord.w;\n float moment2 = moment1 * moment1;\n gl_FragColor = vec4(packHalf(moment1), packHalf(moment2));\n#else\n gl_FragColor = pack(vPosition.z / vPosition.w);\n#endif\n}",
  13365. shadowMapVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attribute\nattribute vec3 position;\n#ifdef BONES\nattribute vec4 matricesIndices;\nattribute vec4 matricesWeights;\n#endif\n\n// Uniform\n#ifdef INSTANCES\nattribute vec4 world0;\nattribute vec4 world1;\nattribute vec4 world2;\nattribute vec4 world3;\n#else\nuniform mat4 world;\n#endif\n\nuniform mat4 viewProjection;\n#ifdef BONES\nuniform mat4 mBones[BonesPerMesh];\n#endif\n\n#ifndef VSM\nvarying vec4 vPosition;\n#endif\n\n#ifdef ALPHATEST\nvarying vec2 vUV;\nuniform mat4 diffuseMatrix;\n#ifdef UV1\nattribute vec2 uv;\n#endif\n#ifdef UV2\nattribute vec2 uv2;\n#endif\n#endif\n\nvoid main(void)\n{\n#ifdef INSTANCES\n mat4 finalWorld = mat4(world0, world1, world2, world3);\n#else\n mat4 finalWorld = world;\n#endif\n\n#ifdef BONES\n mat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\n mat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\n mat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\n mat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\n finalWorld = finalWorld * (m0 + m1 + m2 + m3);\n gl_Position = viewProjection * finalWorld * vec4(position, 1.0);\n#else\n#ifndef VSM\n vPosition = viewProjection * finalWorld * vec4(position, 1.0);\n#endif\n gl_Position = viewProjection * finalWorld * vec4(position, 1.0);\n#endif\n\n#ifdef ALPHATEST\n#ifdef UV1\n vUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\n#endif\n#ifdef UV2\n vUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\n#endif\n#endif\n}",
  13366. spritesPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nuniform bool alphaTest;\n\nvarying vec4 vColor;\n\n// Samplers\nvarying vec2 vUV;\nuniform sampler2D diffuseSampler;\n\n// Fog\n#ifdef FOG\n\n#define FOGMODE_NONE 0.\n#define FOGMODE_EXP 1.\n#define FOGMODE_EXP2 2.\n#define FOGMODE_LINEAR 3.\n#define E 2.71828\n\nuniform vec4 vFogInfos;\nuniform vec3 vFogColor;\nvarying float fFogDistance;\n\nfloat CalcFogFactor()\n{\n float fogCoeff = 1.0;\n float fogStart = vFogInfos.y;\n float fogEnd = vFogInfos.z;\n float fogDensity = vFogInfos.w;\n\n if (FOGMODE_LINEAR == vFogInfos.x)\n {\n fogCoeff = (fogEnd - fFogDistance) / (fogEnd - fogStart);\n }\n else if (FOGMODE_EXP == vFogInfos.x)\n {\n fogCoeff = 1.0 / pow(E, fFogDistance * fogDensity);\n }\n else if (FOGMODE_EXP2 == vFogInfos.x)\n {\n fogCoeff = 1.0 / pow(E, fFogDistance * fFogDistance * fogDensity * fogDensity);\n }\n\n return min(1., max(0., fogCoeff));\n}\n#endif\n\n\nvoid main(void) {\n vec4 baseColor = texture2D(diffuseSampler, vUV);\n\n if (alphaTest) \n {\n if (baseColor.a < 0.95)\n discard;\n }\n\n baseColor *= vColor;\n\n#ifdef FOG\n float fog = CalcFogFactor();\n baseColor.rgb = fog * baseColor.rgb + (1.0 - fog) * vFogColor;\n#endif\n\n gl_FragColor = baseColor;\n}",
  13367. spritesVertexShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n// Attributes\nattribute vec3 position;\nattribute vec4 options;\nattribute vec4 cellInfo;\nattribute vec4 color;\n\n// Uniforms\nuniform vec2 textureInfos;\nuniform mat4 view;\nuniform mat4 projection;\n\n// Output\nvarying vec2 vUV;\nvarying vec4 vColor;\n\n#ifdef FOG\nvarying float fFogDistance;\n#endif\n\nvoid main(void) { \n vec3 viewPos = (view * vec4(position, 1.0)).xyz; \n vec3 cornerPos;\n \n float angle = options.x;\n float size = options.y;\n vec2 offset = options.zw;\n vec2 uvScale = textureInfos.xy;\n\n cornerPos = vec3(offset.x - 0.5, offset.y - 0.5, 0.) * size;\n\n // Rotate\n vec3 rotatedCorner;\n rotatedCorner.x = cornerPos.x * cos(angle) - cornerPos.y * sin(angle);\n rotatedCorner.y = cornerPos.x * sin(angle) + cornerPos.y * cos(angle);\n rotatedCorner.z = 0.;\n\n // Position\n viewPos += rotatedCorner;\n gl_Position = projection * vec4(viewPos, 1.0); \n\n // Color\n vColor = color;\n \n // Texture\n vec2 uvOffset = vec2(abs(offset.x - cellInfo.x), 1.0 - abs(offset.y - cellInfo.y));\n\n vUV = (uvOffset + cellInfo.zw) * uvScale;\n\n // Fog\n#ifdef FOG\n fFogDistance = viewPos.z;\n#endif\n}",
  13368. ssaoPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\n#define SAMPLES 16\n\nuniform sampler2D textureSampler;\nuniform sampler2D randomSampler;\n\nuniform float randTextureTiles;\nuniform float samplesFactor;\nuniform vec3 sampleSphere[16];\n\nvarying vec2 vUV;\n\nconst vec2 offset1 = vec2(0.0, 0.01);\nconst vec2 offset2 = vec2(0.01, 0.0);\n\nvec3 normalFromDepth(const float depth, const vec2 coords) {\n float depth1 = texture2D(textureSampler, coords + offset1).r;\n float depth2 = texture2D(textureSampler, coords + offset2).r;\n\n vec3 p1 = vec3(offset1, depth1 - depth);\n vec3 p2 = vec3(offset2, depth2 - depth);\n\n vec3 normal = cross(p1, p2);\n normal.z = -normal.z;\n\n return normalize(normal);\n}\n\nvoid main(void)\n{\n const float totalStrength = 1.0;\n const float base = 0.2;\n const float area = 0.0075;\n const float fallOff = 0.000001;\n const float radius = 0.0005;\n\n vec3 random = texture2D(randomSampler, vUV * randTextureTiles).rgb;\n float depth = texture2D(textureSampler, vUV).r;\n vec3 position = vec3(vUV, depth);\n vec3 normal = normalFromDepth(depth, vUV);\n float radiusDepth = radius / depth;\n float occlusion = 0.0;\n\n vec3 ray;\n vec3 hemiRay;\n float occlusionDepth;\n float difference;\n\n for (int i = 0; i < SAMPLES; i++)\n {\n ray = radiusDepth * reflect(sampleSphere[i], random);\n hemiRay = position + dot(ray, normal) * ray;\n\n occlusionDepth = texture2D(textureSampler, clamp(hemiRay.xy, 0.0, 1.0)).r;\n difference = depth - occlusionDepth;\n\n occlusion += step(fallOff, difference) * (1.0 - smoothstep(fallOff, area, difference));\n }\n\n float ao = 1.0 - totalStrength * occlusion * samplesFactor;\n\n float result = clamp(ao + base, 0.0, 1.0);\n gl_FragColor.r = result;\n gl_FragColor.g = result;\n gl_FragColor.b = result;\n gl_FragColor.a = 1.0;\n}",
  13369. ssaoCombinePixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nuniform sampler2D textureSampler;\nuniform sampler2D originalColor;\n\nvarying vec2 vUV;\n\nvoid main(void) {\n gl_FragColor = texture2D(originalColor, vUV) * texture2D(textureSampler, vUV);\n}",
  13370. volumetricLightScatteringPixelShader:"// Inspired by http://http.developer.nvidia.com/GPUGems3/gpugems3_ch13.html\n\n#ifdef GL_ES\nprecision mediump float;\n#endif\n\nuniform sampler2D textureSampler;\nuniform sampler2D lightScatteringSampler;\n\nuniform vec2 lightPositionOnScreen;\n\nvarying vec2 vUV;\n\nvoid main(void) {\n \n float decay = 0.96815;\n float exposure = 0.3;\n float density = 0.926;\n float weight = 0.58767;\n\n const int NUM_SAMPLES = 100;\n\n vec2 tc = vUV;\n vec2 deltaTexCoord = (tc - lightPositionOnScreen.xy);\n deltaTexCoord *= 1.0 / float(NUM_SAMPLES) * density;\n\n float illuminationDecay = 1.0;\n\n vec4 color = texture2D(lightScatteringSampler, tc) * 0.4;\n\n for(int i=0; i < NUM_SAMPLES; i++)\n {\n tc -= deltaTexCoord;\n vec4 sample = texture2D(lightScatteringSampler, tc) * 0.4;\n sample *= illuminationDecay * weight;\n color += sample;\n illuminationDecay *= decay;\n }\n\n vec4 realColor = texture2D(textureSampler, vUV);\n gl_FragColor = ((vec4((vec3(color.r, color.g, color.b) * exposure), 1)) + (realColor * (1.5 - 0.4)));\n}",
  13371. volumetricLightScatteringPassPixelShader:"#ifdef GL_ES\nprecision mediump float;\n#endif\n\n#if defined(ALPHATEST) || defined(BASIC_RENDER)\nvarying vec2 vUV;\nuniform sampler2D diffuseSampler;\n#endif\n\nvoid main(void)\n{\n#ifdef ALPHATEST\n if (texture2D(diffuseSampler, vUV).a < 0.4)\n discard;\n#endif\n\n#ifdef BASIC_RENDER\n gl_FragColor = texture2D(diffuseSampler, vUV);\n#else\n gl_FragColor = vec4(0.0, 0.0, 0.0, 1.0);\n#endif\n}",
  13372. woodPixelShader:"#ifdef GL_ES\nprecision highp float;\n#endif\n\nvarying vec2 vPosition;\nvarying vec2 vUV;\n\nuniform float ampScale;\nuniform vec3 woodColor;\n\nfloat rand(vec2 n) {\n return fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\n}\n\nfloat noise(vec2 n) {\n const vec2 d = vec2(0.0, 1.0);\n vec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\n return mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\n}\n\nfloat fbm(vec2 n) {\n float total = 0.0, amplitude = 1.0;\n for (int i = 0; i < 4; i++) {\n total += noise(n) * amplitude;\n n += n;\n amplitude *= 0.5;\n }\n return total;\n}\n\nvoid main(void) {\n float ratioy = mod(vUV.x * ampScale, 2.0 + fbm(vUV * 0.8));\n vec3 wood = woodColor * ratioy;\n gl_FragColor = vec4(wood, 1.0);\n}",
  13373. };
  13374. return Effect;
  13375. })();
  13376. BABYLON.Effect = Effect;
  13377. })(BABYLON || (BABYLON = {}));
  13378. //# sourceMappingURL=babylon.effect.js.mapvar BABYLON;
  13379. (function (BABYLON) {
  13380. var Material = (function () {
  13381. function Material(name, scene, doNotAdd) {
  13382. this.name = name;
  13383. this.checkReadyOnEveryCall = true;
  13384. this.checkReadyOnlyOnce = false;
  13385. this.state = "";
  13386. this.alpha = 1.0;
  13387. this.backFaceCulling = true;
  13388. this._wasPreviouslyReady = false;
  13389. this._fillMode = Material.TriangleFillMode;
  13390. this.pointSize = 1.0;
  13391. this.id = name;
  13392. this._scene = scene;
  13393. if (!doNotAdd) {
  13394. scene.materials.push(this);
  13395. }
  13396. }
  13397. Object.defineProperty(Material, "TriangleFillMode", {
  13398. get: function () {
  13399. return Material._TriangleFillMode;
  13400. },
  13401. enumerable: true,
  13402. configurable: true
  13403. });
  13404. Object.defineProperty(Material, "WireFrameFillMode", {
  13405. get: function () {
  13406. return Material._WireFrameFillMode;
  13407. },
  13408. enumerable: true,
  13409. configurable: true
  13410. });
  13411. Object.defineProperty(Material, "PointFillMode", {
  13412. get: function () {
  13413. return Material._PointFillMode;
  13414. },
  13415. enumerable: true,
  13416. configurable: true
  13417. });
  13418. Object.defineProperty(Material.prototype, "wireframe", {
  13419. get: function () {
  13420. return this._fillMode === Material.WireFrameFillMode;
  13421. },
  13422. set: function (value) {
  13423. this._fillMode = (value ? Material.WireFrameFillMode : Material.TriangleFillMode);
  13424. },
  13425. enumerable: true,
  13426. configurable: true
  13427. });
  13428. Object.defineProperty(Material.prototype, "pointsCloud", {
  13429. get: function () {
  13430. return this._fillMode === Material.PointFillMode;
  13431. },
  13432. set: function (value) {
  13433. this._fillMode = (value ? Material.PointFillMode : Material.TriangleFillMode);
  13434. },
  13435. enumerable: true,
  13436. configurable: true
  13437. });
  13438. Object.defineProperty(Material.prototype, "fillMode", {
  13439. get: function () {
  13440. return this._fillMode;
  13441. },
  13442. set: function (value) {
  13443. this._fillMode = value;
  13444. },
  13445. enumerable: true,
  13446. configurable: true
  13447. });
  13448. Material.prototype.isReady = function (mesh, useInstances) {
  13449. return true;
  13450. };
  13451. Material.prototype.getEffect = function () {
  13452. return this._effect;
  13453. };
  13454. Material.prototype.getScene = function () {
  13455. return this._scene;
  13456. };
  13457. Material.prototype.needAlphaBlending = function () {
  13458. return (this.alpha < 1.0);
  13459. };
  13460. Material.prototype.needAlphaTesting = function () {
  13461. return false;
  13462. };
  13463. Material.prototype.getAlphaTestTexture = function () {
  13464. return null;
  13465. };
  13466. Material.prototype.trackCreation = function (onCompiled, onError) {
  13467. };
  13468. Material.prototype._preBind = function () {
  13469. var engine = this._scene.getEngine();
  13470. engine.enableEffect(this._effect);
  13471. engine.setState(this.backFaceCulling);
  13472. };
  13473. Material.prototype.bind = function (world, mesh) {
  13474. this._scene._cachedMaterial = this;
  13475. if (this.onBind) {
  13476. this.onBind(this);
  13477. }
  13478. };
  13479. Material.prototype.bindOnlyWorldMatrix = function (world) {
  13480. };
  13481. Material.prototype.unbind = function () {
  13482. };
  13483. Material.prototype.dispose = function (forceDisposeEffect) {
  13484. // Remove from scene
  13485. var index = this._scene.materials.indexOf(this);
  13486. this._scene.materials.splice(index, 1);
  13487. // Shader are kept in cache for further use but we can get rid of this by using forceDisposeEffect
  13488. if (forceDisposeEffect && this._effect) {
  13489. this._scene.getEngine()._releaseEffect(this._effect);
  13490. this._effect = null;
  13491. }
  13492. // Callback
  13493. if (this.onDispose) {
  13494. this.onDispose();
  13495. }
  13496. };
  13497. Material._TriangleFillMode = 0;
  13498. Material._WireFrameFillMode = 1;
  13499. Material._PointFillMode = 2;
  13500. return Material;
  13501. })();
  13502. BABYLON.Material = Material;
  13503. })(BABYLON || (BABYLON = {}));
  13504. //# sourceMappingURL=babylon.material.js.map
  13505. var BABYLON;
  13506. (function (BABYLON) {
  13507. var maxSimultaneousLights = 4;
  13508. var FresnelParameters = (function () {
  13509. function FresnelParameters() {
  13510. this.isEnabled = true;
  13511. this.leftColor = BABYLON.Color3.White();
  13512. this.rightColor = BABYLON.Color3.Black();
  13513. this.bias = 0;
  13514. this.power = 1;
  13515. }
  13516. return FresnelParameters;
  13517. })();
  13518. BABYLON.FresnelParameters = FresnelParameters;
  13519. var StandardMaterial = (function (_super) {
  13520. __extends(StandardMaterial, _super);
  13521. function StandardMaterial(name, scene) {
  13522. var _this = this;
  13523. _super.call(this, name, scene);
  13524. this.ambientColor = new BABYLON.Color3(0, 0, 0);
  13525. this.diffuseColor = new BABYLON.Color3(1, 1, 1);
  13526. this.specularColor = new BABYLON.Color3(1, 1, 1);
  13527. this.specularPower = 64;
  13528. this.emissiveColor = new BABYLON.Color3(0, 0, 0);
  13529. this.useAlphaFromDiffuseTexture = false;
  13530. this.useSpecularOverAlpha = true;
  13531. this.fogEnabled = true;
  13532. this._cachedDefines = null;
  13533. this._renderTargets = new BABYLON.SmartArray(16);
  13534. this._worldViewProjectionMatrix = BABYLON.Matrix.Zero();
  13535. this._globalAmbientColor = new BABYLON.Color3(0, 0, 0);
  13536. this._scaledDiffuse = new BABYLON.Color3();
  13537. this._scaledSpecular = new BABYLON.Color3();
  13538. this.getRenderTargetTextures = function () {
  13539. _this._renderTargets.reset();
  13540. if (_this.reflectionTexture && _this.reflectionTexture.isRenderTarget) {
  13541. _this._renderTargets.push(_this.reflectionTexture);
  13542. }
  13543. return _this._renderTargets;
  13544. };
  13545. }
  13546. StandardMaterial.prototype.needAlphaBlending = function () {
  13547. return (this.alpha < 1.0) || (this.opacityTexture != null) || this._shouldUseAlphaFromDiffuseTexture() || this.opacityFresnelParameters && this.opacityFresnelParameters.isEnabled;
  13548. };
  13549. StandardMaterial.prototype.needAlphaTesting = function () {
  13550. return this.diffuseTexture != null && this.diffuseTexture.hasAlpha && !this.diffuseTexture.getAlphaFromRGB;
  13551. };
  13552. StandardMaterial.prototype._shouldUseAlphaFromDiffuseTexture = function () {
  13553. return this.diffuseTexture != null && this.diffuseTexture.hasAlpha && this.useAlphaFromDiffuseTexture;
  13554. };
  13555. StandardMaterial.prototype.getAlphaTestTexture = function () {
  13556. return this.diffuseTexture;
  13557. };
  13558. // Methods
  13559. StandardMaterial.prototype.isReady = function (mesh, useInstances) {
  13560. if (this.checkReadyOnlyOnce) {
  13561. if (this._wasPreviouslyReady) {
  13562. return true;
  13563. }
  13564. }
  13565. var scene = this.getScene();
  13566. if (!this.checkReadyOnEveryCall) {
  13567. if (this._renderId === scene.getRenderId()) {
  13568. return true;
  13569. }
  13570. }
  13571. var engine = scene.getEngine();
  13572. var defines = [];
  13573. var fallbacks = new BABYLON.EffectFallbacks();
  13574. // Textures
  13575. if (scene.texturesEnabled) {
  13576. if (this.diffuseTexture && StandardMaterial.DiffuseTextureEnabled) {
  13577. if (!this.diffuseTexture.isReady()) {
  13578. return false;
  13579. }
  13580. else {
  13581. defines.push("#define DIFFUSE");
  13582. }
  13583. }
  13584. if (this.ambientTexture && StandardMaterial.AmbientTextureEnabled) {
  13585. if (!this.ambientTexture.isReady()) {
  13586. return false;
  13587. }
  13588. else {
  13589. defines.push("#define AMBIENT");
  13590. }
  13591. }
  13592. if (this.opacityTexture && StandardMaterial.OpacityTextureEnabled) {
  13593. if (!this.opacityTexture.isReady()) {
  13594. return false;
  13595. }
  13596. else {
  13597. defines.push("#define OPACITY");
  13598. if (this.opacityTexture.getAlphaFromRGB) {
  13599. defines.push("#define OPACITYRGB");
  13600. }
  13601. }
  13602. }
  13603. if (this.reflectionTexture && StandardMaterial.ReflectionTextureEnabled) {
  13604. if (!this.reflectionTexture.isReady()) {
  13605. return false;
  13606. }
  13607. else {
  13608. defines.push("#define REFLECTION");
  13609. fallbacks.addFallback(0, "REFLECTION");
  13610. }
  13611. }
  13612. if (this.emissiveTexture && StandardMaterial.EmissiveTextureEnabled) {
  13613. if (!this.emissiveTexture.isReady()) {
  13614. return false;
  13615. }
  13616. else {
  13617. defines.push("#define EMISSIVE");
  13618. }
  13619. }
  13620. if (this.specularTexture && StandardMaterial.SpecularTextureEnabled) {
  13621. if (!this.specularTexture.isReady()) {
  13622. return false;
  13623. }
  13624. else {
  13625. defines.push("#define SPECULAR");
  13626. fallbacks.addFallback(0, "SPECULAR");
  13627. }
  13628. }
  13629. }
  13630. if (scene.getEngine().getCaps().standardDerivatives && this.bumpTexture && StandardMaterial.BumpTextureEnabled) {
  13631. if (!this.bumpTexture.isReady()) {
  13632. return false;
  13633. }
  13634. else {
  13635. defines.push("#define BUMP");
  13636. fallbacks.addFallback(0, "BUMP");
  13637. }
  13638. }
  13639. // Effect
  13640. if (this.useSpecularOverAlpha) {
  13641. defines.push("#define SPECULAROVERALPHA");
  13642. fallbacks.addFallback(0, "SPECULAROVERALPHA");
  13643. }
  13644. if (scene.clipPlane) {
  13645. defines.push("#define CLIPPLANE");
  13646. }
  13647. if (engine.getAlphaTesting()) {
  13648. defines.push("#define ALPHATEST");
  13649. }
  13650. if (this._shouldUseAlphaFromDiffuseTexture()) {
  13651. defines.push("#define ALPHAFROMDIFFUSE");
  13652. }
  13653. // Point size
  13654. if (this.pointsCloud || scene.forcePointsCloud) {
  13655. defines.push("#define POINTSIZE");
  13656. }
  13657. // Fog
  13658. if (scene.fogEnabled && mesh && mesh.applyFog && scene.fogMode !== BABYLON.Scene.FOGMODE_NONE && this.fogEnabled) {
  13659. defines.push("#define FOG");
  13660. fallbacks.addFallback(1, "FOG");
  13661. }
  13662. var shadowsActivated = false;
  13663. var lightIndex = 0;
  13664. if (scene.lightsEnabled) {
  13665. for (var index = 0; index < scene.lights.length; index++) {
  13666. var light = scene.lights[index];
  13667. if (!light.isEnabled()) {
  13668. continue;
  13669. }
  13670. // Excluded check
  13671. if (light._excludedMeshesIds.length > 0) {
  13672. for (var excludedIndex = 0; excludedIndex < light._excludedMeshesIds.length; excludedIndex++) {
  13673. var excludedMesh = scene.getMeshByID(light._excludedMeshesIds[excludedIndex]);
  13674. if (excludedMesh) {
  13675. light.excludedMeshes.push(excludedMesh);
  13676. }
  13677. }
  13678. light._excludedMeshesIds = [];
  13679. }
  13680. // Included check
  13681. if (light._includedOnlyMeshesIds.length > 0) {
  13682. for (var includedOnlyIndex = 0; includedOnlyIndex < light._includedOnlyMeshesIds.length; includedOnlyIndex++) {
  13683. var includedOnlyMesh = scene.getMeshByID(light._includedOnlyMeshesIds[includedOnlyIndex]);
  13684. if (includedOnlyMesh) {
  13685. light.includedOnlyMeshes.push(includedOnlyMesh);
  13686. }
  13687. }
  13688. light._includedOnlyMeshesIds = [];
  13689. }
  13690. if (!light.canAffectMesh(mesh)) {
  13691. continue;
  13692. }
  13693. defines.push("#define LIGHT" + lightIndex);
  13694. if (lightIndex > 0) {
  13695. fallbacks.addFallback(lightIndex, "LIGHT" + lightIndex);
  13696. }
  13697. var type;
  13698. if (light instanceof BABYLON.SpotLight) {
  13699. type = "#define SPOTLIGHT" + lightIndex;
  13700. }
  13701. else if (light instanceof BABYLON.HemisphericLight) {
  13702. type = "#define HEMILIGHT" + lightIndex;
  13703. }
  13704. else {
  13705. type = "#define POINTDIRLIGHT" + lightIndex;
  13706. }
  13707. defines.push(type);
  13708. if (lightIndex > 0) {
  13709. fallbacks.addFallback(lightIndex, type.replace("#define ", ""));
  13710. }
  13711. // Shadows
  13712. if (scene.shadowsEnabled) {
  13713. var shadowGenerator = light.getShadowGenerator();
  13714. if (mesh && mesh.receiveShadows && shadowGenerator) {
  13715. defines.push("#define SHADOW" + lightIndex);
  13716. fallbacks.addFallback(0, "SHADOW" + lightIndex);
  13717. if (!shadowsActivated) {
  13718. defines.push("#define SHADOWS");
  13719. shadowsActivated = true;
  13720. }
  13721. if (shadowGenerator.useVarianceShadowMap) {
  13722. defines.push("#define SHADOWVSM" + lightIndex);
  13723. if (lightIndex > 0) {
  13724. fallbacks.addFallback(0, "SHADOWVSM" + lightIndex);
  13725. }
  13726. }
  13727. if (shadowGenerator.usePoissonSampling) {
  13728. defines.push("#define SHADOWPCF" + lightIndex);
  13729. if (lightIndex > 0) {
  13730. fallbacks.addFallback(0, "SHADOWPCF" + lightIndex);
  13731. }
  13732. }
  13733. }
  13734. }
  13735. lightIndex++;
  13736. if (lightIndex === maxSimultaneousLights)
  13737. break;
  13738. }
  13739. }
  13740. if (StandardMaterial.FresnelEnabled) {
  13741. // Fresnel
  13742. if (this.diffuseFresnelParameters && this.diffuseFresnelParameters.isEnabled || this.opacityFresnelParameters && this.opacityFresnelParameters.isEnabled || this.emissiveFresnelParameters && this.emissiveFresnelParameters.isEnabled || this.reflectionFresnelParameters && this.reflectionFresnelParameters.isEnabled) {
  13743. var fresnelRank = 1;
  13744. if (this.diffuseFresnelParameters && this.diffuseFresnelParameters.isEnabled) {
  13745. defines.push("#define DIFFUSEFRESNEL");
  13746. fallbacks.addFallback(fresnelRank, "DIFFUSEFRESNEL");
  13747. fresnelRank++;
  13748. }
  13749. if (this.opacityFresnelParameters && this.opacityFresnelParameters.isEnabled) {
  13750. defines.push("#define OPACITYFRESNEL");
  13751. fallbacks.addFallback(fresnelRank, "OPACITYFRESNEL");
  13752. fresnelRank++;
  13753. }
  13754. if (this.reflectionFresnelParameters && this.reflectionFresnelParameters.isEnabled) {
  13755. defines.push("#define REFLECTIONFRESNEL");
  13756. fallbacks.addFallback(fresnelRank, "REFLECTIONFRESNEL");
  13757. fresnelRank++;
  13758. }
  13759. if (this.emissiveFresnelParameters && this.emissiveFresnelParameters.isEnabled) {
  13760. defines.push("#define EMISSIVEFRESNEL");
  13761. fallbacks.addFallback(fresnelRank, "EMISSIVEFRESNEL");
  13762. fresnelRank++;
  13763. }
  13764. defines.push("#define FRESNEL");
  13765. fallbacks.addFallback(fresnelRank - 1, "FRESNEL");
  13766. }
  13767. }
  13768. // Attribs
  13769. var attribs = [BABYLON.VertexBuffer.PositionKind, BABYLON.VertexBuffer.NormalKind];
  13770. if (mesh) {
  13771. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  13772. attribs.push(BABYLON.VertexBuffer.UVKind);
  13773. defines.push("#define UV1");
  13774. }
  13775. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  13776. attribs.push(BABYLON.VertexBuffer.UV2Kind);
  13777. defines.push("#define UV2");
  13778. }
  13779. if (mesh.useVertexColors && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.ColorKind)) {
  13780. attribs.push(BABYLON.VertexBuffer.ColorKind);
  13781. defines.push("#define VERTEXCOLOR");
  13782. if (mesh.hasVertexAlpha) {
  13783. defines.push("#define VERTEXALPHA");
  13784. }
  13785. }
  13786. if (mesh.useBones) {
  13787. attribs.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  13788. attribs.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  13789. defines.push("#define BONES");
  13790. defines.push("#define BonesPerMesh " + (mesh.skeleton.bones.length + 1));
  13791. defines.push("#define BONES4");
  13792. fallbacks.addFallback(0, "BONES4");
  13793. }
  13794. // Instances
  13795. if (useInstances) {
  13796. defines.push("#define INSTANCES");
  13797. attribs.push("world0");
  13798. attribs.push("world1");
  13799. attribs.push("world2");
  13800. attribs.push("world3");
  13801. }
  13802. }
  13803. // Get correct effect
  13804. var join = defines.join("\n");
  13805. if (this._cachedDefines !== join) {
  13806. this._cachedDefines = join;
  13807. scene.resetCachedMaterial();
  13808. // Legacy browser patch
  13809. var shaderName = "default";
  13810. if (!scene.getEngine().getCaps().standardDerivatives) {
  13811. shaderName = "legacydefault";
  13812. }
  13813. this._effect = scene.getEngine().createEffect(shaderName, attribs, ["world", "view", "viewProjection", "vEyePosition", "vLightsType", "vAmbientColor", "vDiffuseColor", "vSpecularColor", "vEmissiveColor", "vLightData0", "vLightDiffuse0", "vLightSpecular0", "vLightDirection0", "vLightGround0", "lightMatrix0", "vLightData1", "vLightDiffuse1", "vLightSpecular1", "vLightDirection1", "vLightGround1", "lightMatrix1", "vLightData2", "vLightDiffuse2", "vLightSpecular2", "vLightDirection2", "vLightGround2", "lightMatrix2", "vLightData3", "vLightDiffuse3", "vLightSpecular3", "vLightDirection3", "vLightGround3", "lightMatrix3", "vFogInfos", "vFogColor", "pointSize", "vDiffuseInfos", "vAmbientInfos", "vOpacityInfos", "vReflectionInfos", "vEmissiveInfos", "vSpecularInfos", "vBumpInfos", "mBones", "vClipPlane", "diffuseMatrix", "ambientMatrix", "opacityMatrix", "reflectionMatrix", "emissiveMatrix", "specularMatrix", "bumpMatrix", "darkness0", "darkness1", "darkness2", "darkness3", "diffuseLeftColor", "diffuseRightColor", "opacityParts", "reflectionLeftColor", "reflectionRightColor", "emissiveLeftColor", "emissiveRightColor"], ["diffuseSampler", "ambientSampler", "opacitySampler", "reflectionCubeSampler", "reflection2DSampler", "emissiveSampler", "specularSampler", "bumpSampler", "shadowSampler0", "shadowSampler1", "shadowSampler2", "shadowSampler3"], join, fallbacks, this.onCompiled, this.onError);
  13814. }
  13815. if (!this._effect.isReady()) {
  13816. return false;
  13817. }
  13818. this._renderId = scene.getRenderId();
  13819. this._wasPreviouslyReady = true;
  13820. return true;
  13821. };
  13822. StandardMaterial.prototype.unbind = function () {
  13823. if (this.reflectionTexture && this.reflectionTexture.isRenderTarget) {
  13824. this._effect.setTexture("reflection2DSampler", null);
  13825. }
  13826. };
  13827. StandardMaterial.prototype.bindOnlyWorldMatrix = function (world) {
  13828. this._effect.setMatrix("world", world);
  13829. };
  13830. StandardMaterial.prototype.bind = function (world, mesh) {
  13831. var scene = this.getScene();
  13832. // Matrices
  13833. this.bindOnlyWorldMatrix(world);
  13834. this._effect.setMatrix("viewProjection", scene.getTransformMatrix());
  13835. // Bones
  13836. if (mesh.useBones) {
  13837. this._effect.setMatrices("mBones", mesh.skeleton.getTransformMatrices());
  13838. }
  13839. if (scene.getCachedMaterial() !== this) {
  13840. if (StandardMaterial.FresnelEnabled) {
  13841. // Fresnel
  13842. if (this.diffuseFresnelParameters && this.diffuseFresnelParameters.isEnabled) {
  13843. this._effect.setColor4("diffuseLeftColor", this.diffuseFresnelParameters.leftColor, this.diffuseFresnelParameters.power);
  13844. this._effect.setColor4("diffuseRightColor", this.diffuseFresnelParameters.rightColor, this.diffuseFresnelParameters.bias);
  13845. }
  13846. if (this.opacityFresnelParameters && this.opacityFresnelParameters.isEnabled) {
  13847. this._effect.setColor4("opacityParts", new BABYLON.Color3(this.opacityFresnelParameters.leftColor.toLuminance(), this.opacityFresnelParameters.rightColor.toLuminance(), this.opacityFresnelParameters.bias), this.opacityFresnelParameters.power);
  13848. }
  13849. if (this.reflectionFresnelParameters && this.reflectionFresnelParameters.isEnabled) {
  13850. this._effect.setColor4("reflectionLeftColor", this.reflectionFresnelParameters.leftColor, this.reflectionFresnelParameters.power);
  13851. this._effect.setColor4("reflectionRightColor", this.reflectionFresnelParameters.rightColor, this.reflectionFresnelParameters.bias);
  13852. }
  13853. if (this.emissiveFresnelParameters && this.emissiveFresnelParameters.isEnabled) {
  13854. this._effect.setColor4("emissiveLeftColor", this.emissiveFresnelParameters.leftColor, this.emissiveFresnelParameters.power);
  13855. this._effect.setColor4("emissiveRightColor", this.emissiveFresnelParameters.rightColor, this.emissiveFresnelParameters.bias);
  13856. }
  13857. }
  13858. // Textures
  13859. if (this.diffuseTexture && StandardMaterial.DiffuseTextureEnabled) {
  13860. this._effect.setTexture("diffuseSampler", this.diffuseTexture);
  13861. this._effect.setFloat2("vDiffuseInfos", this.diffuseTexture.coordinatesIndex, this.diffuseTexture.level);
  13862. this._effect.setMatrix("diffuseMatrix", this.diffuseTexture.getTextureMatrix());
  13863. }
  13864. if (this.ambientTexture && StandardMaterial.AmbientTextureEnabled) {
  13865. this._effect.setTexture("ambientSampler", this.ambientTexture);
  13866. this._effect.setFloat2("vAmbientInfos", this.ambientTexture.coordinatesIndex, this.ambientTexture.level);
  13867. this._effect.setMatrix("ambientMatrix", this.ambientTexture.getTextureMatrix());
  13868. }
  13869. if (this.opacityTexture && StandardMaterial.OpacityTextureEnabled) {
  13870. this._effect.setTexture("opacitySampler", this.opacityTexture);
  13871. this._effect.setFloat2("vOpacityInfos", this.opacityTexture.coordinatesIndex, this.opacityTexture.level);
  13872. this._effect.setMatrix("opacityMatrix", this.opacityTexture.getTextureMatrix());
  13873. }
  13874. if (this.reflectionTexture && StandardMaterial.ReflectionTextureEnabled) {
  13875. if (this.reflectionTexture.isCube) {
  13876. this._effect.setTexture("reflectionCubeSampler", this.reflectionTexture);
  13877. }
  13878. else {
  13879. this._effect.setTexture("reflection2DSampler", this.reflectionTexture);
  13880. }
  13881. this._effect.setMatrix("reflectionMatrix", this.reflectionTexture.getReflectionTextureMatrix());
  13882. this._effect.setFloat3("vReflectionInfos", this.reflectionTexture.coordinatesMode, this.reflectionTexture.level, this.reflectionTexture.isCube ? 1 : 0);
  13883. }
  13884. if (this.emissiveTexture && StandardMaterial.EmissiveTextureEnabled) {
  13885. this._effect.setTexture("emissiveSampler", this.emissiveTexture);
  13886. this._effect.setFloat2("vEmissiveInfos", this.emissiveTexture.coordinatesIndex, this.emissiveTexture.level);
  13887. this._effect.setMatrix("emissiveMatrix", this.emissiveTexture.getTextureMatrix());
  13888. }
  13889. if (this.specularTexture && StandardMaterial.SpecularTextureEnabled) {
  13890. this._effect.setTexture("specularSampler", this.specularTexture);
  13891. this._effect.setFloat2("vSpecularInfos", this.specularTexture.coordinatesIndex, this.specularTexture.level);
  13892. this._effect.setMatrix("specularMatrix", this.specularTexture.getTextureMatrix());
  13893. }
  13894. if (this.bumpTexture && scene.getEngine().getCaps().standardDerivatives && StandardMaterial.BumpTextureEnabled) {
  13895. this._effect.setTexture("bumpSampler", this.bumpTexture);
  13896. this._effect.setFloat2("vBumpInfos", this.bumpTexture.coordinatesIndex, 1.0 / this.bumpTexture.level);
  13897. this._effect.setMatrix("bumpMatrix", this.bumpTexture.getTextureMatrix());
  13898. }
  13899. // Clip plane
  13900. if (scene.clipPlane) {
  13901. var clipPlane = scene.clipPlane;
  13902. this._effect.setFloat4("vClipPlane", clipPlane.normal.x, clipPlane.normal.y, clipPlane.normal.z, clipPlane.d);
  13903. }
  13904. // Point size
  13905. if (this.pointsCloud) {
  13906. this._effect.setFloat("pointSize", this.pointSize);
  13907. }
  13908. // Colors
  13909. scene.ambientColor.multiplyToRef(this.ambientColor, this._globalAmbientColor);
  13910. // Scaling down color according to emissive
  13911. this._scaledSpecular.r = this.specularColor.r * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.r);
  13912. this._scaledSpecular.g = this.specularColor.g * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.g);
  13913. this._scaledSpecular.b = this.specularColor.b * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.b);
  13914. this._effect.setVector3("vEyePosition", scene.activeCamera.position);
  13915. this._effect.setColor3("vAmbientColor", this._globalAmbientColor);
  13916. this._effect.setColor4("vSpecularColor", this._scaledSpecular, this.specularPower);
  13917. this._effect.setColor3("vEmissiveColor", this.emissiveColor);
  13918. }
  13919. // Scaling down color according to emissive
  13920. this._scaledDiffuse.r = this.diffuseColor.r * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.r);
  13921. this._scaledDiffuse.g = this.diffuseColor.g * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.g);
  13922. this._scaledDiffuse.b = this.diffuseColor.b * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.b);
  13923. this._effect.setColor4("vDiffuseColor", this._scaledDiffuse, this.alpha * mesh.visibility);
  13924. if (scene.lightsEnabled) {
  13925. var lightIndex = 0;
  13926. for (var index = 0; index < scene.lights.length; index++) {
  13927. var light = scene.lights[index];
  13928. if (!light.isEnabled()) {
  13929. continue;
  13930. }
  13931. if (!light.canAffectMesh(mesh)) {
  13932. continue;
  13933. }
  13934. if (light instanceof BABYLON.PointLight) {
  13935. // Point Light
  13936. light.transferToEffect(this._effect, "vLightData" + lightIndex);
  13937. }
  13938. else if (light instanceof BABYLON.DirectionalLight) {
  13939. // Directional Light
  13940. light.transferToEffect(this._effect, "vLightData" + lightIndex);
  13941. }
  13942. else if (light instanceof BABYLON.SpotLight) {
  13943. // Spot Light
  13944. light.transferToEffect(this._effect, "vLightData" + lightIndex, "vLightDirection" + lightIndex);
  13945. }
  13946. else if (light instanceof BABYLON.HemisphericLight) {
  13947. // Hemispheric Light
  13948. light.transferToEffect(this._effect, "vLightData" + lightIndex, "vLightGround" + lightIndex);
  13949. }
  13950. light.diffuse.scaleToRef(light.intensity, this._scaledDiffuse);
  13951. light.specular.scaleToRef(light.intensity, this._scaledSpecular);
  13952. this._effect.setColor4("vLightDiffuse" + lightIndex, this._scaledDiffuse, light.range);
  13953. this._effect.setColor3("vLightSpecular" + lightIndex, this._scaledSpecular);
  13954. // Shadows
  13955. if (scene.shadowsEnabled) {
  13956. var shadowGenerator = light.getShadowGenerator();
  13957. if (mesh.receiveShadows && shadowGenerator) {
  13958. this._effect.setMatrix("lightMatrix" + lightIndex, shadowGenerator.getTransformMatrix());
  13959. this._effect.setTexture("shadowSampler" + lightIndex, shadowGenerator.getShadowMap());
  13960. this._effect.setFloat("darkness" + lightIndex, shadowGenerator.getDarkness());
  13961. }
  13962. }
  13963. lightIndex++;
  13964. if (lightIndex === maxSimultaneousLights)
  13965. break;
  13966. }
  13967. }
  13968. // View
  13969. if (scene.fogEnabled && mesh.applyFog && scene.fogMode !== BABYLON.Scene.FOGMODE_NONE || this.reflectionTexture) {
  13970. this._effect.setMatrix("view", scene.getViewMatrix());
  13971. }
  13972. // Fog
  13973. if (scene.fogEnabled && mesh.applyFog && scene.fogMode !== BABYLON.Scene.FOGMODE_NONE) {
  13974. this._effect.setFloat4("vFogInfos", scene.fogMode, scene.fogStart, scene.fogEnd, scene.fogDensity);
  13975. this._effect.setColor3("vFogColor", scene.fogColor);
  13976. }
  13977. _super.prototype.bind.call(this, world, mesh);
  13978. };
  13979. StandardMaterial.prototype.getAnimatables = function () {
  13980. var results = [];
  13981. if (this.diffuseTexture && this.diffuseTexture.animations && this.diffuseTexture.animations.length > 0) {
  13982. results.push(this.diffuseTexture);
  13983. }
  13984. if (this.ambientTexture && this.ambientTexture.animations && this.ambientTexture.animations.length > 0) {
  13985. results.push(this.ambientTexture);
  13986. }
  13987. if (this.opacityTexture && this.opacityTexture.animations && this.opacityTexture.animations.length > 0) {
  13988. results.push(this.opacityTexture);
  13989. }
  13990. if (this.reflectionTexture && this.reflectionTexture.animations && this.reflectionTexture.animations.length > 0) {
  13991. results.push(this.reflectionTexture);
  13992. }
  13993. if (this.emissiveTexture && this.emissiveTexture.animations && this.emissiveTexture.animations.length > 0) {
  13994. results.push(this.emissiveTexture);
  13995. }
  13996. if (this.specularTexture && this.specularTexture.animations && this.specularTexture.animations.length > 0) {
  13997. results.push(this.specularTexture);
  13998. }
  13999. if (this.bumpTexture && this.bumpTexture.animations && this.bumpTexture.animations.length > 0) {
  14000. results.push(this.bumpTexture);
  14001. }
  14002. return results;
  14003. };
  14004. StandardMaterial.prototype.dispose = function (forceDisposeEffect) {
  14005. if (this.diffuseTexture) {
  14006. this.diffuseTexture.dispose();
  14007. }
  14008. if (this.ambientTexture) {
  14009. this.ambientTexture.dispose();
  14010. }
  14011. if (this.opacityTexture) {
  14012. this.opacityTexture.dispose();
  14013. }
  14014. if (this.reflectionTexture) {
  14015. this.reflectionTexture.dispose();
  14016. }
  14017. if (this.emissiveTexture) {
  14018. this.emissiveTexture.dispose();
  14019. }
  14020. if (this.specularTexture) {
  14021. this.specularTexture.dispose();
  14022. }
  14023. if (this.bumpTexture) {
  14024. this.bumpTexture.dispose();
  14025. }
  14026. _super.prototype.dispose.call(this, forceDisposeEffect);
  14027. };
  14028. StandardMaterial.prototype.clone = function (name) {
  14029. var newStandardMaterial = new StandardMaterial(name, this.getScene());
  14030. // Base material
  14031. newStandardMaterial.checkReadyOnEveryCall = this.checkReadyOnEveryCall;
  14032. newStandardMaterial.alpha = this.alpha;
  14033. newStandardMaterial.fillMode = this.fillMode;
  14034. newStandardMaterial.backFaceCulling = this.backFaceCulling;
  14035. // Standard material
  14036. if (this.diffuseTexture && this.diffuseTexture.clone) {
  14037. newStandardMaterial.diffuseTexture = this.diffuseTexture.clone();
  14038. }
  14039. if (this.ambientTexture && this.ambientTexture.clone) {
  14040. newStandardMaterial.ambientTexture = this.ambientTexture.clone();
  14041. }
  14042. if (this.opacityTexture && this.opacityTexture.clone) {
  14043. newStandardMaterial.opacityTexture = this.opacityTexture.clone();
  14044. }
  14045. if (this.reflectionTexture && this.reflectionTexture.clone) {
  14046. newStandardMaterial.reflectionTexture = this.reflectionTexture.clone();
  14047. }
  14048. if (this.emissiveTexture && this.emissiveTexture.clone) {
  14049. newStandardMaterial.emissiveTexture = this.emissiveTexture.clone();
  14050. }
  14051. if (this.specularTexture && this.specularTexture.clone) {
  14052. newStandardMaterial.specularTexture = this.specularTexture.clone();
  14053. }
  14054. if (this.bumpTexture && this.bumpTexture.clone) {
  14055. newStandardMaterial.bumpTexture = this.bumpTexture.clone();
  14056. }
  14057. newStandardMaterial.ambientColor = this.ambientColor.clone();
  14058. newStandardMaterial.diffuseColor = this.diffuseColor.clone();
  14059. newStandardMaterial.specularColor = this.specularColor.clone();
  14060. newStandardMaterial.specularPower = this.specularPower;
  14061. newStandardMaterial.emissiveColor = this.emissiveColor.clone();
  14062. return newStandardMaterial;
  14063. };
  14064. // Statics
  14065. // Flags used to enable or disable a type of texture for all Standard Materials
  14066. StandardMaterial.DiffuseTextureEnabled = true;
  14067. StandardMaterial.AmbientTextureEnabled = true;
  14068. StandardMaterial.OpacityTextureEnabled = true;
  14069. StandardMaterial.ReflectionTextureEnabled = true;
  14070. StandardMaterial.EmissiveTextureEnabled = true;
  14071. StandardMaterial.SpecularTextureEnabled = true;
  14072. StandardMaterial.BumpTextureEnabled = true;
  14073. StandardMaterial.FresnelEnabled = true;
  14074. return StandardMaterial;
  14075. })(BABYLON.Material);
  14076. BABYLON.StandardMaterial = StandardMaterial;
  14077. })(BABYLON || (BABYLON = {}));
  14078. //# sourceMappingURL=babylon.standardMaterial.js.map
  14079. var BABYLON;
  14080. (function (BABYLON) {
  14081. var MultiMaterial = (function (_super) {
  14082. __extends(MultiMaterial, _super);
  14083. function MultiMaterial(name, scene) {
  14084. _super.call(this, name, scene, true);
  14085. this.subMaterials = new Array();
  14086. scene.multiMaterials.push(this);
  14087. }
  14088. // Properties
  14089. MultiMaterial.prototype.getSubMaterial = function (index) {
  14090. if (index < 0 || index >= this.subMaterials.length) {
  14091. return this.getScene().defaultMaterial;
  14092. }
  14093. return this.subMaterials[index];
  14094. };
  14095. // Methods
  14096. MultiMaterial.prototype.isReady = function (mesh) {
  14097. for (var index = 0; index < this.subMaterials.length; index++) {
  14098. var subMaterial = this.subMaterials[index];
  14099. if (subMaterial) {
  14100. if (!this.subMaterials[index].isReady(mesh)) {
  14101. return false;
  14102. }
  14103. }
  14104. }
  14105. return true;
  14106. };
  14107. return MultiMaterial;
  14108. })(BABYLON.Material);
  14109. BABYLON.MultiMaterial = MultiMaterial;
  14110. })(BABYLON || (BABYLON = {}));
  14111. //# sourceMappingURL=babylon.multiMaterial.js.mapvar BABYLON;
  14112. (function (BABYLON) {
  14113. var Database = (function () {
  14114. function Database(urlToScene, callbackManifestChecked) {
  14115. // Handling various flavors of prefixed version of IndexedDB
  14116. this.idbFactory = (window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB);
  14117. this.callbackManifestChecked = callbackManifestChecked;
  14118. this.currentSceneUrl = BABYLON.Database.ReturnFullUrlLocation(urlToScene);
  14119. this.db = null;
  14120. this.enableSceneOffline = false;
  14121. this.enableTexturesOffline = false;
  14122. this.manifestVersionFound = 0;
  14123. this.mustUpdateRessources = false;
  14124. this.hasReachedQuota = false;
  14125. this.checkManifestFile();
  14126. }
  14127. Database.prototype.checkManifestFile = function () {
  14128. var _this = this;
  14129. function noManifestFile() {
  14130. BABYLON.Tools.Log("Valid manifest file not found. Scene & textures will be loaded directly from the web server.");
  14131. that.enableSceneOffline = false;
  14132. that.enableTexturesOffline = false;
  14133. that.callbackManifestChecked(false);
  14134. }
  14135. var that = this;
  14136. var manifestURL = this.currentSceneUrl + ".manifest";
  14137. var xhr = new XMLHttpRequest();
  14138. var manifestURLTimeStamped = manifestURL + (manifestURL.match(/\?/) == null ? "?" : "&") + (new Date()).getTime();
  14139. xhr.open("GET", manifestURLTimeStamped, true);
  14140. xhr.addEventListener("load", function () {
  14141. if (xhr.status === 200 || BABYLON.Tools.ValidateXHRData(xhr, 1)) {
  14142. try {
  14143. var manifestFile = JSON.parse(xhr.response);
  14144. _this.enableSceneOffline = manifestFile.enableSceneOffline;
  14145. _this.enableTexturesOffline = manifestFile.enableTexturesOffline;
  14146. if (manifestFile.version && !isNaN(parseInt(manifestFile.version))) {
  14147. _this.manifestVersionFound = manifestFile.version;
  14148. }
  14149. if (_this.callbackManifestChecked) {
  14150. _this.callbackManifestChecked(true);
  14151. }
  14152. }
  14153. catch (ex) {
  14154. noManifestFile();
  14155. }
  14156. }
  14157. else {
  14158. noManifestFile();
  14159. }
  14160. }, false);
  14161. xhr.addEventListener("error", function (event) {
  14162. noManifestFile();
  14163. }, false);
  14164. try {
  14165. xhr.send();
  14166. }
  14167. catch (ex) {
  14168. BABYLON.Tools.Error("Error on XHR send request.");
  14169. that.callbackManifestChecked(false);
  14170. }
  14171. };
  14172. Database.prototype.openAsync = function (successCallback, errorCallback) {
  14173. var _this = this;
  14174. function handleError() {
  14175. that.isSupported = false;
  14176. if (errorCallback)
  14177. errorCallback();
  14178. }
  14179. var that = this;
  14180. if (!this.idbFactory || !(this.enableSceneOffline || this.enableTexturesOffline)) {
  14181. // Your browser doesn't support IndexedDB
  14182. this.isSupported = false;
  14183. if (errorCallback)
  14184. errorCallback();
  14185. }
  14186. else {
  14187. // If the DB hasn't been opened or created yet
  14188. if (!this.db) {
  14189. this.hasReachedQuota = false;
  14190. this.isSupported = true;
  14191. var request = this.idbFactory.open("babylonjs", 1);
  14192. // Could occur if user is blocking the quota for the DB and/or doesn't grant access to IndexedDB
  14193. request.onerror = function (event) {
  14194. handleError();
  14195. };
  14196. // executes when a version change transaction cannot complete due to other active transactions
  14197. request.onblocked = function (event) {
  14198. BABYLON.Tools.Error("IDB request blocked. Please reload the page.");
  14199. handleError();
  14200. };
  14201. // DB has been opened successfully
  14202. request.onsuccess = function (event) {
  14203. _this.db = request.result;
  14204. successCallback();
  14205. };
  14206. // Initialization of the DB. Creating Scenes & Textures stores
  14207. request.onupgradeneeded = function (event) {
  14208. _this.db = (event.target).result;
  14209. try {
  14210. var scenesStore = _this.db.createObjectStore("scenes", { keyPath: "sceneUrl" });
  14211. var versionsStore = _this.db.createObjectStore("versions", { keyPath: "sceneUrl" });
  14212. var texturesStore = _this.db.createObjectStore("textures", { keyPath: "textureUrl" });
  14213. }
  14214. catch (ex) {
  14215. BABYLON.Tools.Error("Error while creating object stores. Exception: " + ex.message);
  14216. handleError();
  14217. }
  14218. };
  14219. }
  14220. else {
  14221. if (successCallback)
  14222. successCallback();
  14223. }
  14224. }
  14225. };
  14226. Database.prototype.loadImageFromDB = function (url, image) {
  14227. var _this = this;
  14228. var completeURL = BABYLON.Database.ReturnFullUrlLocation(url);
  14229. var saveAndLoadImage = function () {
  14230. if (!_this.hasReachedQuota && _this.db !== null) {
  14231. // the texture is not yet in the DB, let's try to save it
  14232. _this._saveImageIntoDBAsync(completeURL, image);
  14233. }
  14234. else {
  14235. image.src = url;
  14236. }
  14237. };
  14238. if (!this.mustUpdateRessources) {
  14239. this._loadImageFromDBAsync(completeURL, image, saveAndLoadImage);
  14240. }
  14241. else {
  14242. saveAndLoadImage();
  14243. }
  14244. };
  14245. Database.prototype._loadImageFromDBAsync = function (url, image, notInDBCallback) {
  14246. if (this.isSupported && this.db !== null) {
  14247. var texture;
  14248. var transaction = this.db.transaction(["textures"]);
  14249. transaction.onabort = function (event) {
  14250. image.src = url;
  14251. };
  14252. transaction.oncomplete = function (event) {
  14253. var blobTextureURL;
  14254. if (texture) {
  14255. var URL = window.URL || window.webkitURL;
  14256. blobTextureURL = URL.createObjectURL(texture.data, { oneTimeOnly: true });
  14257. image.onerror = function () {
  14258. BABYLON.Tools.Error("Error loading image from blob URL: " + blobTextureURL + " switching back to web url: " + url);
  14259. image.src = url;
  14260. };
  14261. image.src = blobTextureURL;
  14262. }
  14263. else {
  14264. notInDBCallback();
  14265. }
  14266. };
  14267. var getRequest = transaction.objectStore("textures").get(url);
  14268. getRequest.onsuccess = function (event) {
  14269. texture = (event.target).result;
  14270. };
  14271. getRequest.onerror = function (event) {
  14272. BABYLON.Tools.Error("Error loading texture " + url + " from DB.");
  14273. image.src = url;
  14274. };
  14275. }
  14276. else {
  14277. BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open.");
  14278. image.src = url;
  14279. }
  14280. };
  14281. Database.prototype._saveImageIntoDBAsync = function (url, image) {
  14282. var _this = this;
  14283. if (this.isSupported) {
  14284. // In case of error (type not supported or quota exceeded), we're at least sending back XHR data to allow texture loading later on
  14285. var generateBlobUrl = function () {
  14286. var blobTextureURL;
  14287. if (blob) {
  14288. var URL = window.URL || window.webkitURL;
  14289. try {
  14290. blobTextureURL = URL.createObjectURL(blob, { oneTimeOnly: true });
  14291. }
  14292. catch (ex) {
  14293. blobTextureURL = URL.createObjectURL(blob);
  14294. }
  14295. }
  14296. image.src = blobTextureURL;
  14297. };
  14298. if (BABYLON.Database.isUASupportingBlobStorage) {
  14299. var xhr = new XMLHttpRequest(), blob;
  14300. xhr.open("GET", url, true);
  14301. xhr.responseType = "blob";
  14302. xhr.addEventListener("load", function () {
  14303. if (xhr.status === 200) {
  14304. // Blob as response (XHR2)
  14305. blob = xhr.response;
  14306. var transaction = _this.db.transaction(["textures"], "readwrite");
  14307. // the transaction could abort because of a QuotaExceededError error
  14308. transaction.onabort = function (event) {
  14309. try {
  14310. if (event.srcElement.error.name === "QuotaExceededError") {
  14311. this.hasReachedQuota = true;
  14312. }
  14313. }
  14314. catch (ex) {
  14315. }
  14316. generateBlobUrl();
  14317. };
  14318. transaction.oncomplete = function (event) {
  14319. generateBlobUrl();
  14320. };
  14321. var newTexture = { textureUrl: url, data: blob };
  14322. try {
  14323. // Put the blob into the dabase
  14324. var addRequest = transaction.objectStore("textures").put(newTexture);
  14325. addRequest.onsuccess = function (event) {
  14326. };
  14327. addRequest.onerror = function (event) {
  14328. generateBlobUrl();
  14329. };
  14330. }
  14331. catch (ex) {
  14332. // "DataCloneError" generated by Chrome when you try to inject blob into IndexedDB
  14333. if (ex.code === 25) {
  14334. BABYLON.Database.isUASupportingBlobStorage = false;
  14335. }
  14336. image.src = url;
  14337. }
  14338. }
  14339. else {
  14340. image.src = url;
  14341. }
  14342. }, false);
  14343. xhr.addEventListener("error", function (event) {
  14344. BABYLON.Tools.Error("Error in XHR request in BABYLON.Database.");
  14345. image.src = url;
  14346. }, false);
  14347. xhr.send();
  14348. }
  14349. else {
  14350. image.src = url;
  14351. }
  14352. }
  14353. else {
  14354. BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open.");
  14355. image.src = url;
  14356. }
  14357. };
  14358. Database.prototype._checkVersionFromDB = function (url, versionLoaded) {
  14359. var _this = this;
  14360. var updateVersion = function (event) {
  14361. // the version is not yet in the DB or we need to update it
  14362. _this._saveVersionIntoDBAsync(url, versionLoaded);
  14363. };
  14364. this._loadVersionFromDBAsync(url, versionLoaded, updateVersion);
  14365. };
  14366. Database.prototype._loadVersionFromDBAsync = function (url, callback, updateInDBCallback) {
  14367. var _this = this;
  14368. if (this.isSupported) {
  14369. var version;
  14370. try {
  14371. var transaction = this.db.transaction(["versions"]);
  14372. transaction.oncomplete = function (event) {
  14373. if (version) {
  14374. // If the version in the JSON file is > than the version in DB
  14375. if (_this.manifestVersionFound > version.data) {
  14376. _this.mustUpdateRessources = true;
  14377. updateInDBCallback();
  14378. }
  14379. else {
  14380. callback(version.data);
  14381. }
  14382. }
  14383. else {
  14384. _this.mustUpdateRessources = true;
  14385. updateInDBCallback();
  14386. }
  14387. };
  14388. transaction.onabort = function (event) {
  14389. callback(-1);
  14390. };
  14391. var getRequest = transaction.objectStore("versions").get(url);
  14392. getRequest.onsuccess = function (event) {
  14393. version = (event.target).result;
  14394. };
  14395. getRequest.onerror = function (event) {
  14396. BABYLON.Tools.Error("Error loading version for scene " + url + " from DB.");
  14397. callback(-1);
  14398. };
  14399. }
  14400. catch (ex) {
  14401. BABYLON.Tools.Error("Error while accessing 'versions' object store (READ OP). Exception: " + ex.message);
  14402. callback(-1);
  14403. }
  14404. }
  14405. else {
  14406. BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open.");
  14407. callback(-1);
  14408. }
  14409. };
  14410. Database.prototype._saveVersionIntoDBAsync = function (url, callback) {
  14411. var _this = this;
  14412. if (this.isSupported && !this.hasReachedQuota) {
  14413. try {
  14414. // Open a transaction to the database
  14415. var transaction = this.db.transaction(["versions"], "readwrite");
  14416. // the transaction could abort because of a QuotaExceededError error
  14417. transaction.onabort = function (event) {
  14418. try {
  14419. if (event.srcElement.error.name === "QuotaExceededError") {
  14420. _this.hasReachedQuota = true;
  14421. }
  14422. }
  14423. catch (ex) {
  14424. }
  14425. callback(-1);
  14426. };
  14427. transaction.oncomplete = function (event) {
  14428. callback(_this.manifestVersionFound);
  14429. };
  14430. var newVersion = { sceneUrl: url, data: this.manifestVersionFound };
  14431. // Put the scene into the database
  14432. var addRequest = transaction.objectStore("versions").put(newVersion);
  14433. addRequest.onsuccess = function (event) {
  14434. };
  14435. addRequest.onerror = function (event) {
  14436. BABYLON.Tools.Error("Error in DB add version request in BABYLON.Database.");
  14437. };
  14438. }
  14439. catch (ex) {
  14440. BABYLON.Tools.Error("Error while accessing 'versions' object store (WRITE OP). Exception: " + ex.message);
  14441. callback(-1);
  14442. }
  14443. }
  14444. else {
  14445. callback(-1);
  14446. }
  14447. };
  14448. Database.prototype.loadFileFromDB = function (url, sceneLoaded, progressCallBack, errorCallback, useArrayBuffer) {
  14449. var _this = this;
  14450. var completeUrl = BABYLON.Database.ReturnFullUrlLocation(url);
  14451. var saveAndLoadFile = function (event) {
  14452. // the scene is not yet in the DB, let's try to save it
  14453. _this._saveFileIntoDBAsync(completeUrl, sceneLoaded, progressCallBack);
  14454. };
  14455. this._checkVersionFromDB(completeUrl, function (version) {
  14456. if (version !== -1) {
  14457. if (!_this.mustUpdateRessources) {
  14458. _this._loadFileFromDBAsync(completeUrl, sceneLoaded, saveAndLoadFile, useArrayBuffer);
  14459. }
  14460. else {
  14461. _this._saveFileIntoDBAsync(completeUrl, sceneLoaded, progressCallBack, useArrayBuffer);
  14462. }
  14463. }
  14464. else {
  14465. errorCallback();
  14466. }
  14467. });
  14468. };
  14469. Database.prototype._loadFileFromDBAsync = function (url, callback, notInDBCallback, useArrayBuffer) {
  14470. if (this.isSupported) {
  14471. var targetStore;
  14472. if (url.indexOf(".babylon") !== -1) {
  14473. targetStore = "scenes";
  14474. }
  14475. else {
  14476. targetStore = "textures";
  14477. }
  14478. var file;
  14479. var transaction = this.db.transaction([targetStore]);
  14480. transaction.oncomplete = function (event) {
  14481. if (file) {
  14482. callback(file.data);
  14483. }
  14484. else {
  14485. notInDBCallback();
  14486. }
  14487. };
  14488. transaction.onabort = function (event) {
  14489. notInDBCallback();
  14490. };
  14491. var getRequest = transaction.objectStore(targetStore).get(url);
  14492. getRequest.onsuccess = function (event) {
  14493. file = (event.target).result;
  14494. };
  14495. getRequest.onerror = function (event) {
  14496. BABYLON.Tools.Error("Error loading file " + url + " from DB.");
  14497. notInDBCallback();
  14498. };
  14499. }
  14500. else {
  14501. BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open.");
  14502. callback();
  14503. }
  14504. };
  14505. Database.prototype._saveFileIntoDBAsync = function (url, callback, progressCallback, useArrayBuffer) {
  14506. var _this = this;
  14507. if (this.isSupported) {
  14508. var targetStore;
  14509. if (url.indexOf(".babylon") !== -1) {
  14510. targetStore = "scenes";
  14511. }
  14512. else {
  14513. targetStore = "textures";
  14514. }
  14515. // Create XHR
  14516. var xhr = new XMLHttpRequest(), fileData;
  14517. xhr.open("GET", url, true);
  14518. if (useArrayBuffer) {
  14519. xhr.responseType = "arraybuffer";
  14520. }
  14521. xhr.onprogress = progressCallback;
  14522. xhr.addEventListener("load", function () {
  14523. if (xhr.status === 200 || BABYLON.Tools.ValidateXHRData(xhr, !useArrayBuffer ? 1 : 6)) {
  14524. // Blob as response (XHR2)
  14525. //fileData = xhr.responseText;
  14526. fileData = !useArrayBuffer ? xhr.responseText : xhr.response;
  14527. if (!_this.hasReachedQuota) {
  14528. // Open a transaction to the database
  14529. var transaction = _this.db.transaction([targetStore], "readwrite");
  14530. // the transaction could abort because of a QuotaExceededError error
  14531. transaction.onabort = function (event) {
  14532. try {
  14533. if (event.srcElement.error.name === "QuotaExceededError") {
  14534. this.hasReachedQuota = true;
  14535. }
  14536. }
  14537. catch (ex) {
  14538. }
  14539. callback(fileData);
  14540. };
  14541. transaction.oncomplete = function (event) {
  14542. callback(fileData);
  14543. };
  14544. var newFile;
  14545. if (targetStore === "scenes") {
  14546. newFile = { sceneUrl: url, data: fileData, version: _this.manifestVersionFound };
  14547. }
  14548. else {
  14549. newFile = { textureUrl: url, data: fileData };
  14550. }
  14551. try {
  14552. // Put the scene into the database
  14553. var addRequest = transaction.objectStore(targetStore).put(newFile);
  14554. addRequest.onsuccess = function (event) {
  14555. };
  14556. addRequest.onerror = function (event) {
  14557. BABYLON.Tools.Error("Error in DB add file request in BABYLON.Database.");
  14558. };
  14559. }
  14560. catch (ex) {
  14561. callback(fileData);
  14562. }
  14563. }
  14564. else {
  14565. callback(fileData);
  14566. }
  14567. }
  14568. else {
  14569. callback();
  14570. }
  14571. }, false);
  14572. xhr.addEventListener("error", function (event) {
  14573. BABYLON.Tools.Error("error on XHR request.");
  14574. callback();
  14575. }, false);
  14576. xhr.send();
  14577. }
  14578. else {
  14579. BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open.");
  14580. callback();
  14581. }
  14582. };
  14583. Database.isUASupportingBlobStorage = true;
  14584. Database.parseURL = function (url) {
  14585. var a = document.createElement('a');
  14586. a.href = url;
  14587. var urlWithoutHash = url.substring(0, url.lastIndexOf("#"));
  14588. var fileName = url.substring(urlWithoutHash.lastIndexOf("/") + 1, url.length);
  14589. var absLocation = url.substring(0, url.indexOf(fileName, 0));
  14590. return absLocation;
  14591. };
  14592. Database.ReturnFullUrlLocation = function (url) {
  14593. if (url.indexOf("http:/") === -1) {
  14594. return (BABYLON.Database.parseURL(window.location.href) + url);
  14595. }
  14596. else {
  14597. return url;
  14598. }
  14599. };
  14600. return Database;
  14601. })();
  14602. BABYLON.Database = Database;
  14603. })(BABYLON || (BABYLON = {}));
  14604. //# sourceMappingURL=babylon.database.js.mapvar BABYLON;
  14605. (function (BABYLON) {
  14606. var SpriteManager = (function () {
  14607. function SpriteManager(name, imgUrl, capacity, cellSize, scene, epsilon) {
  14608. this.name = name;
  14609. this.cellSize = cellSize;
  14610. this.sprites = new Array();
  14611. this.renderingGroupId = 0;
  14612. this.fogEnabled = true;
  14613. this._vertexDeclaration = [3, 4, 4, 4];
  14614. this._vertexStrideSize = 15 * 4; // 15 floats per sprite (x, y, z, angle, size, offsetX, offsetY, invertU, invertV, cellIndexX, cellIndexY, color)
  14615. this._capacity = capacity;
  14616. this._spriteTexture = new BABYLON.Texture(imgUrl, scene, true, false);
  14617. this._spriteTexture.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  14618. this._spriteTexture.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  14619. this._epsilon = epsilon === undefined ? 0.01 : epsilon;
  14620. this._scene = scene;
  14621. this._scene.spriteManagers.push(this);
  14622. // VBO
  14623. this._vertexDeclaration = [3, 4, 4, 4];
  14624. this._vertexStrideSize = 15 * 4;
  14625. this._vertexBuffer = scene.getEngine().createDynamicVertexBuffer(capacity * this._vertexStrideSize * 4);
  14626. var indices = [];
  14627. var index = 0;
  14628. for (var count = 0; count < capacity; count++) {
  14629. indices.push(index);
  14630. indices.push(index + 1);
  14631. indices.push(index + 2);
  14632. indices.push(index);
  14633. indices.push(index + 2);
  14634. indices.push(index + 3);
  14635. index += 4;
  14636. }
  14637. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  14638. this._vertices = new Float32Array(capacity * this._vertexStrideSize);
  14639. // Effects
  14640. this._effectBase = this._scene.getEngine().createEffect("sprites", ["position", "options", "cellInfo", "color"], ["view", "projection", "textureInfos", "alphaTest"], ["diffuseSampler"], "");
  14641. this._effectFog = this._scene.getEngine().createEffect("sprites", ["position", "options", "cellInfo", "color"], ["view", "projection", "textureInfos", "alphaTest", "vFogInfos", "vFogColor"], ["diffuseSampler"], "#define FOG");
  14642. }
  14643. SpriteManager.prototype._appendSpriteVertex = function (index, sprite, offsetX, offsetY, rowSize) {
  14644. var arrayOffset = index * 15;
  14645. if (offsetX == 0)
  14646. offsetX = this._epsilon;
  14647. else if (offsetX == 1)
  14648. offsetX = 1 - this._epsilon;
  14649. if (offsetY == 0)
  14650. offsetY = this._epsilon;
  14651. else if (offsetY == 1)
  14652. offsetY = 1 - this._epsilon;
  14653. this._vertices[arrayOffset] = sprite.position.x;
  14654. this._vertices[arrayOffset + 1] = sprite.position.y;
  14655. this._vertices[arrayOffset + 2] = sprite.position.z;
  14656. this._vertices[arrayOffset + 3] = sprite.angle;
  14657. this._vertices[arrayOffset + 4] = sprite.size;
  14658. this._vertices[arrayOffset + 5] = offsetX;
  14659. this._vertices[arrayOffset + 6] = offsetY;
  14660. this._vertices[arrayOffset + 7] = sprite.invertU ? 1 : 0;
  14661. this._vertices[arrayOffset + 8] = sprite.invertV ? 1 : 0;
  14662. var offset = (sprite.cellIndex / rowSize) >> 0;
  14663. this._vertices[arrayOffset + 9] = sprite.cellIndex - offset * rowSize;
  14664. this._vertices[arrayOffset + 10] = offset;
  14665. // Color
  14666. this._vertices[arrayOffset + 11] = sprite.color.r;
  14667. this._vertices[arrayOffset + 12] = sprite.color.g;
  14668. this._vertices[arrayOffset + 13] = sprite.color.b;
  14669. this._vertices[arrayOffset + 14] = sprite.color.a;
  14670. };
  14671. SpriteManager.prototype.render = function () {
  14672. // Check
  14673. if (!this._effectBase.isReady() || !this._effectFog.isReady() || !this._spriteTexture || !this._spriteTexture.isReady())
  14674. return;
  14675. var engine = this._scene.getEngine();
  14676. var baseSize = this._spriteTexture.getBaseSize();
  14677. // Sprites
  14678. var deltaTime = engine.getDeltaTime();
  14679. var max = Math.min(this._capacity, this.sprites.length);
  14680. var rowSize = baseSize.width / this.cellSize;
  14681. var offset = 0;
  14682. for (var index = 0; index < max; index++) {
  14683. var sprite = this.sprites[index];
  14684. if (!sprite) {
  14685. continue;
  14686. }
  14687. sprite._animate(deltaTime);
  14688. this._appendSpriteVertex(offset++, sprite, 0, 0, rowSize);
  14689. this._appendSpriteVertex(offset++, sprite, 1, 0, rowSize);
  14690. this._appendSpriteVertex(offset++, sprite, 1, 1, rowSize);
  14691. this._appendSpriteVertex(offset++, sprite, 0, 1, rowSize);
  14692. }
  14693. engine.updateDynamicVertexBuffer(this._vertexBuffer, this._vertices);
  14694. // Render
  14695. var effect = this._effectBase;
  14696. if (this._scene.fogEnabled && this._scene.fogMode !== BABYLON.Scene.FOGMODE_NONE && this.fogEnabled) {
  14697. effect = this._effectFog;
  14698. }
  14699. engine.enableEffect(effect);
  14700. var viewMatrix = this._scene.getViewMatrix();
  14701. effect.setTexture("diffuseSampler", this._spriteTexture);
  14702. effect.setMatrix("view", viewMatrix);
  14703. effect.setMatrix("projection", this._scene.getProjectionMatrix());
  14704. effect.setFloat2("textureInfos", this.cellSize / baseSize.width, this.cellSize / baseSize.height);
  14705. // Fog
  14706. if (this._scene.fogEnabled && this._scene.fogMode !== BABYLON.Scene.FOGMODE_NONE && this.fogEnabled) {
  14707. effect.setFloat4("vFogInfos", this._scene.fogMode, this._scene.fogStart, this._scene.fogEnd, this._scene.fogDensity);
  14708. effect.setColor3("vFogColor", this._scene.fogColor);
  14709. }
  14710. // VBOs
  14711. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, effect);
  14712. // Draw order
  14713. effect.setBool("alphaTest", true);
  14714. engine.setColorWrite(false);
  14715. engine.draw(true, 0, max * 6);
  14716. engine.setColorWrite(true);
  14717. effect.setBool("alphaTest", false);
  14718. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  14719. engine.draw(true, 0, max * 6);
  14720. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  14721. };
  14722. SpriteManager.prototype.dispose = function () {
  14723. if (this._vertexBuffer) {
  14724. this._scene.getEngine()._releaseBuffer(this._vertexBuffer);
  14725. this._vertexBuffer = null;
  14726. }
  14727. if (this._indexBuffer) {
  14728. this._scene.getEngine()._releaseBuffer(this._indexBuffer);
  14729. this._indexBuffer = null;
  14730. }
  14731. if (this._spriteTexture) {
  14732. this._spriteTexture.dispose();
  14733. this._spriteTexture = null;
  14734. }
  14735. // Remove from scene
  14736. var index = this._scene.spriteManagers.indexOf(this);
  14737. this._scene.spriteManagers.splice(index, 1);
  14738. // Callback
  14739. if (this.onDispose) {
  14740. this.onDispose();
  14741. }
  14742. };
  14743. return SpriteManager;
  14744. })();
  14745. BABYLON.SpriteManager = SpriteManager;
  14746. })(BABYLON || (BABYLON = {}));
  14747. //# sourceMappingURL=babylon.spriteManager.js.mapvar BABYLON;
  14748. (function (BABYLON) {
  14749. var Sprite = (function () {
  14750. function Sprite(name, manager) {
  14751. this.name = name;
  14752. this.color = new BABYLON.Color4(1.0, 1.0, 1.0, 1.0);
  14753. this.size = 1.0;
  14754. this.angle = 0;
  14755. this.cellIndex = 0;
  14756. this.invertU = 0;
  14757. this.invertV = 0;
  14758. this.animations = new Array();
  14759. this._animationStarted = false;
  14760. this._loopAnimation = false;
  14761. this._fromIndex = 0;
  14762. this._toIndex = 0;
  14763. this._delay = 0;
  14764. this._direction = 1;
  14765. this._frameCount = 0;
  14766. this._time = 0;
  14767. this._manager = manager;
  14768. this._manager.sprites.push(this);
  14769. this.position = BABYLON.Vector3.Zero();
  14770. }
  14771. Sprite.prototype.playAnimation = function (from, to, loop, delay) {
  14772. this._fromIndex = from;
  14773. this._toIndex = to;
  14774. this._loopAnimation = loop;
  14775. this._delay = delay;
  14776. this._animationStarted = true;
  14777. this._direction = from < to ? 1 : -1;
  14778. this.cellIndex = from;
  14779. this._time = 0;
  14780. };
  14781. Sprite.prototype.stopAnimation = function () {
  14782. this._animationStarted = false;
  14783. };
  14784. Sprite.prototype._animate = function (deltaTime) {
  14785. if (!this._animationStarted)
  14786. return;
  14787. this._time += deltaTime;
  14788. if (this._time > this._delay) {
  14789. this._time = this._time % this._delay;
  14790. this.cellIndex += this._direction;
  14791. if (this.cellIndex == this._toIndex) {
  14792. if (this._loopAnimation) {
  14793. this.cellIndex = this._fromIndex;
  14794. }
  14795. else {
  14796. this._animationStarted = false;
  14797. if (this.disposeWhenFinishedAnimating) {
  14798. this.dispose();
  14799. }
  14800. }
  14801. }
  14802. }
  14803. };
  14804. Sprite.prototype.dispose = function () {
  14805. for (var i = 0; i < this._manager.sprites.length; i++) {
  14806. if (this._manager.sprites[i] == this) {
  14807. this._manager.sprites.splice(i, 1);
  14808. }
  14809. }
  14810. };
  14811. return Sprite;
  14812. })();
  14813. BABYLON.Sprite = Sprite;
  14814. })(BABYLON || (BABYLON = {}));
  14815. //# sourceMappingURL=babylon.sprite.js.mapvar BABYLON;
  14816. (function (BABYLON) {
  14817. var Layer = (function () {
  14818. function Layer(name, imgUrl, scene, isBackground, color) {
  14819. this.name = name;
  14820. this._vertexDeclaration = [2];
  14821. this._vertexStrideSize = 2 * 4;
  14822. this.texture = imgUrl ? new BABYLON.Texture(imgUrl, scene, true) : null;
  14823. this.isBackground = isBackground === undefined ? true : isBackground;
  14824. this.color = color === undefined ? new BABYLON.Color4(1, 1, 1, 1) : color;
  14825. this._scene = scene;
  14826. this._scene.layers.push(this);
  14827. // VBO
  14828. var vertices = [];
  14829. vertices.push(1, 1);
  14830. vertices.push(-1, 1);
  14831. vertices.push(-1, -1);
  14832. vertices.push(1, -1);
  14833. this._vertexBuffer = scene.getEngine().createVertexBuffer(vertices);
  14834. // Indices
  14835. var indices = [];
  14836. indices.push(0);
  14837. indices.push(1);
  14838. indices.push(2);
  14839. indices.push(0);
  14840. indices.push(2);
  14841. indices.push(3);
  14842. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  14843. // Effects
  14844. this._effect = this._scene.getEngine().createEffect("layer", ["position"], ["textureMatrix", "color"], ["textureSampler"], "");
  14845. }
  14846. Layer.prototype.render = function () {
  14847. // Check
  14848. if (!this._effect.isReady() || !this.texture || !this.texture.isReady())
  14849. return;
  14850. var engine = this._scene.getEngine();
  14851. // Render
  14852. engine.enableEffect(this._effect);
  14853. engine.setState(false);
  14854. // Texture
  14855. this._effect.setTexture("textureSampler", this.texture);
  14856. this._effect.setMatrix("textureMatrix", this.texture.getTextureMatrix());
  14857. // Color
  14858. this._effect.setFloat4("color", this.color.r, this.color.g, this.color.b, this.color.a);
  14859. // VBOs
  14860. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, this._effect);
  14861. // Draw order
  14862. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  14863. engine.draw(true, 0, 6);
  14864. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  14865. };
  14866. Layer.prototype.dispose = function () {
  14867. if (this._vertexBuffer) {
  14868. this._scene.getEngine()._releaseBuffer(this._vertexBuffer);
  14869. this._vertexBuffer = null;
  14870. }
  14871. if (this._indexBuffer) {
  14872. this._scene.getEngine()._releaseBuffer(this._indexBuffer);
  14873. this._indexBuffer = null;
  14874. }
  14875. if (this.texture) {
  14876. this.texture.dispose();
  14877. this.texture = null;
  14878. }
  14879. // Remove from scene
  14880. var index = this._scene.layers.indexOf(this);
  14881. this._scene.layers.splice(index, 1);
  14882. // Callback
  14883. if (this.onDispose) {
  14884. this.onDispose();
  14885. }
  14886. };
  14887. return Layer;
  14888. })();
  14889. BABYLON.Layer = Layer;
  14890. })(BABYLON || (BABYLON = {}));
  14891. //# sourceMappingURL=babylon.layer.js.mapvar BABYLON;
  14892. (function (BABYLON) {
  14893. var Particle = (function () {
  14894. function Particle() {
  14895. this.position = BABYLON.Vector3.Zero();
  14896. this.direction = BABYLON.Vector3.Zero();
  14897. this.color = new BABYLON.Color4(0, 0, 0, 0);
  14898. this.colorStep = new BABYLON.Color4(0, 0, 0, 0);
  14899. this.lifeTime = 1.0;
  14900. this.age = 0;
  14901. this.size = 0;
  14902. this.angle = 0;
  14903. this.angularSpeed = 0;
  14904. }
  14905. Particle.prototype.copyTo = function (other) {
  14906. other.position.copyFrom(this.position);
  14907. other.direction.copyFrom(this.direction);
  14908. other.color.copyFrom(this.color);
  14909. other.colorStep.copyFrom(this.colorStep);
  14910. other.lifeTime = this.lifeTime;
  14911. other.age = this.age;
  14912. other.size = this.size;
  14913. other.angle = this.angle;
  14914. other.angularSpeed = this.angularSpeed;
  14915. };
  14916. return Particle;
  14917. })();
  14918. BABYLON.Particle = Particle;
  14919. })(BABYLON || (BABYLON = {}));
  14920. //# sourceMappingURL=babylon.particle.js.mapvar BABYLON;
  14921. (function (BABYLON) {
  14922. var randomNumber = function (min, max) {
  14923. if (min === max) {
  14924. return (min);
  14925. }
  14926. var random = Math.random();
  14927. return ((random * (max - min)) + min);
  14928. };
  14929. var ParticleSystem = (function () {
  14930. function ParticleSystem(name, capacity, scene, customEffect) {
  14931. var _this = this;
  14932. this.name = name;
  14933. this.renderingGroupId = 0;
  14934. this.emitter = null;
  14935. this.emitRate = 10;
  14936. this.manualEmitCount = -1;
  14937. this.updateSpeed = 0.01;
  14938. this.targetStopDuration = 0;
  14939. this.disposeOnStop = false;
  14940. this.minEmitPower = 1;
  14941. this.maxEmitPower = 1;
  14942. this.minLifeTime = 1;
  14943. this.maxLifeTime = 1;
  14944. this.minSize = 1;
  14945. this.maxSize = 1;
  14946. this.minAngularSpeed = 0;
  14947. this.maxAngularSpeed = 0;
  14948. this.blendMode = ParticleSystem.BLENDMODE_ONEONE;
  14949. this.forceDepthWrite = false;
  14950. this.gravity = BABYLON.Vector3.Zero();
  14951. this.direction1 = new BABYLON.Vector3(0, 1.0, 0);
  14952. this.direction2 = new BABYLON.Vector3(0, 1.0, 0);
  14953. this.minEmitBox = new BABYLON.Vector3(-0.5, -0.5, -0.5);
  14954. this.maxEmitBox = new BABYLON.Vector3(0.5, 0.5, 0.5);
  14955. this.color1 = new BABYLON.Color4(1.0, 1.0, 1.0, 1.0);
  14956. this.color2 = new BABYLON.Color4(1.0, 1.0, 1.0, 1.0);
  14957. this.colorDead = new BABYLON.Color4(0, 0, 0, 1.0);
  14958. this.textureMask = new BABYLON.Color4(1.0, 1.0, 1.0, 1.0);
  14959. this.particles = new Array();
  14960. this._vertexDeclaration = [3, 4, 4];
  14961. this._vertexStrideSize = 11 * 4; // 11 floats per particle (x, y, z, r, g, b, a, angle, size, offsetX, offsetY)
  14962. this._stockParticles = new Array();
  14963. this._newPartsExcess = 0;
  14964. this._scaledColorStep = new BABYLON.Color4(0, 0, 0, 0);
  14965. this._colorDiff = new BABYLON.Color4(0, 0, 0, 0);
  14966. this._scaledDirection = BABYLON.Vector3.Zero();
  14967. this._scaledGravity = BABYLON.Vector3.Zero();
  14968. this._currentRenderId = -1;
  14969. this._started = false;
  14970. this._stopped = false;
  14971. this._actualFrame = 0;
  14972. this.id = name;
  14973. this._capacity = capacity;
  14974. this._scene = scene;
  14975. this._customEffect = customEffect;
  14976. scene.particleSystems.push(this);
  14977. // VBO
  14978. this._vertexBuffer = scene.getEngine().createDynamicVertexBuffer(capacity * this._vertexStrideSize * 4);
  14979. var indices = [];
  14980. var index = 0;
  14981. for (var count = 0; count < capacity; count++) {
  14982. indices.push(index);
  14983. indices.push(index + 1);
  14984. indices.push(index + 2);
  14985. indices.push(index);
  14986. indices.push(index + 2);
  14987. indices.push(index + 3);
  14988. index += 4;
  14989. }
  14990. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  14991. this._vertices = new Float32Array(capacity * this._vertexStrideSize);
  14992. // Default behaviors
  14993. this.startDirectionFunction = function (emitPower, worldMatrix, directionToUpdate) {
  14994. var randX = randomNumber(_this.direction1.x, _this.direction2.x);
  14995. var randY = randomNumber(_this.direction1.y, _this.direction2.y);
  14996. var randZ = randomNumber(_this.direction1.z, _this.direction2.z);
  14997. BABYLON.Vector3.TransformNormalFromFloatsToRef(randX * emitPower, randY * emitPower, randZ * emitPower, worldMatrix, directionToUpdate);
  14998. };
  14999. this.startPositionFunction = function (worldMatrix, positionToUpdate) {
  15000. var randX = randomNumber(_this.minEmitBox.x, _this.maxEmitBox.x);
  15001. var randY = randomNumber(_this.minEmitBox.y, _this.maxEmitBox.y);
  15002. var randZ = randomNumber(_this.minEmitBox.z, _this.maxEmitBox.z);
  15003. BABYLON.Vector3.TransformCoordinatesFromFloatsToRef(randX, randY, randZ, worldMatrix, positionToUpdate);
  15004. };
  15005. this.updateFunction = function (particles) {
  15006. for (var index = 0; index < particles.length; index++) {
  15007. var particle = particles[index];
  15008. particle.age += _this._scaledUpdateSpeed;
  15009. if (particle.age >= particle.lifeTime) {
  15010. _this.recycleParticle(particle);
  15011. index--;
  15012. continue;
  15013. }
  15014. else {
  15015. particle.colorStep.scaleToRef(_this._scaledUpdateSpeed, _this._scaledColorStep);
  15016. particle.color.addInPlace(_this._scaledColorStep);
  15017. if (particle.color.a < 0)
  15018. particle.color.a = 0;
  15019. particle.angle += particle.angularSpeed * _this._scaledUpdateSpeed;
  15020. particle.direction.scaleToRef(_this._scaledUpdateSpeed, _this._scaledDirection);
  15021. particle.position.addInPlace(_this._scaledDirection);
  15022. _this.gravity.scaleToRef(_this._scaledUpdateSpeed, _this._scaledGravity);
  15023. particle.direction.addInPlace(_this._scaledGravity);
  15024. }
  15025. }
  15026. };
  15027. }
  15028. ParticleSystem.prototype.recycleParticle = function (particle) {
  15029. var lastParticle = this.particles.pop();
  15030. if (lastParticle !== particle) {
  15031. lastParticle.copyTo(particle);
  15032. this._stockParticles.push(lastParticle);
  15033. }
  15034. };
  15035. ParticleSystem.prototype.getCapacity = function () {
  15036. return this._capacity;
  15037. };
  15038. ParticleSystem.prototype.isAlive = function () {
  15039. return this._alive;
  15040. };
  15041. ParticleSystem.prototype.isStarted = function () {
  15042. return this._started;
  15043. };
  15044. ParticleSystem.prototype.start = function () {
  15045. this._started = true;
  15046. this._stopped = false;
  15047. this._actualFrame = 0;
  15048. };
  15049. ParticleSystem.prototype.stop = function () {
  15050. this._stopped = true;
  15051. };
  15052. ParticleSystem.prototype._appendParticleVertex = function (index, particle, offsetX, offsetY) {
  15053. var offset = index * 11;
  15054. this._vertices[offset] = particle.position.x;
  15055. this._vertices[offset + 1] = particle.position.y;
  15056. this._vertices[offset + 2] = particle.position.z;
  15057. this._vertices[offset + 3] = particle.color.r;
  15058. this._vertices[offset + 4] = particle.color.g;
  15059. this._vertices[offset + 5] = particle.color.b;
  15060. this._vertices[offset + 6] = particle.color.a;
  15061. this._vertices[offset + 7] = particle.angle;
  15062. this._vertices[offset + 8] = particle.size;
  15063. this._vertices[offset + 9] = offsetX;
  15064. this._vertices[offset + 10] = offsetY;
  15065. };
  15066. ParticleSystem.prototype._update = function (newParticles) {
  15067. // Update current
  15068. this._alive = this.particles.length > 0;
  15069. this.updateFunction(this.particles);
  15070. // Add new ones
  15071. var worldMatrix;
  15072. if (this.emitter.position) {
  15073. worldMatrix = this.emitter.getWorldMatrix();
  15074. }
  15075. else {
  15076. worldMatrix = BABYLON.Matrix.Translation(this.emitter.x, this.emitter.y, this.emitter.z);
  15077. }
  15078. for (var index = 0; index < newParticles; index++) {
  15079. if (this.particles.length === this._capacity) {
  15080. break;
  15081. }
  15082. if (this._stockParticles.length !== 0) {
  15083. var particle = this._stockParticles.pop();
  15084. particle.age = 0;
  15085. }
  15086. else {
  15087. particle = new BABYLON.Particle();
  15088. }
  15089. this.particles.push(particle);
  15090. var emitPower = randomNumber(this.minEmitPower, this.maxEmitPower);
  15091. this.startDirectionFunction(emitPower, worldMatrix, particle.direction);
  15092. particle.lifeTime = randomNumber(this.minLifeTime, this.maxLifeTime);
  15093. particle.size = randomNumber(this.minSize, this.maxSize);
  15094. particle.angularSpeed = randomNumber(this.minAngularSpeed, this.maxAngularSpeed);
  15095. this.startPositionFunction(worldMatrix, particle.position);
  15096. var step = randomNumber(0, 1.0);
  15097. BABYLON.Color4.LerpToRef(this.color1, this.color2, step, particle.color);
  15098. this.colorDead.subtractToRef(particle.color, this._colorDiff);
  15099. this._colorDiff.scaleToRef(1.0 / particle.lifeTime, particle.colorStep);
  15100. }
  15101. };
  15102. ParticleSystem.prototype._getEffect = function () {
  15103. if (this._customEffect) {
  15104. return this._customEffect;
  15105. }
  15106. ;
  15107. var defines = [];
  15108. if (this._scene.clipPlane) {
  15109. defines.push("#define CLIPPLANE");
  15110. }
  15111. // Effect
  15112. var join = defines.join("\n");
  15113. if (this._cachedDefines !== join) {
  15114. this._cachedDefines = join;
  15115. this._effect = this._scene.getEngine().createEffect("particles", ["position", "color", "options"], ["invView", "view", "projection", "vClipPlane", "textureMask"], ["diffuseSampler"], join);
  15116. }
  15117. return this._effect;
  15118. };
  15119. ParticleSystem.prototype.animate = function () {
  15120. if (!this._started)
  15121. return;
  15122. var effect = this._getEffect();
  15123. // Check
  15124. if (!this.emitter || !effect.isReady() || !this.particleTexture || !this.particleTexture.isReady())
  15125. return;
  15126. if (this._currentRenderId === this._scene.getRenderId()) {
  15127. return;
  15128. }
  15129. this._currentRenderId = this._scene.getRenderId();
  15130. this._scaledUpdateSpeed = this.updateSpeed * this._scene.getAnimationRatio();
  15131. // determine the number of particles we need to create
  15132. var emitCout;
  15133. if (this.manualEmitCount > -1) {
  15134. emitCout = this.manualEmitCount;
  15135. this.manualEmitCount = 0;
  15136. }
  15137. else {
  15138. emitCout = this.emitRate;
  15139. }
  15140. var newParticles = ((emitCout * this._scaledUpdateSpeed) >> 0);
  15141. this._newPartsExcess += emitCout * this._scaledUpdateSpeed - newParticles;
  15142. if (this._newPartsExcess > 1.0) {
  15143. newParticles += this._newPartsExcess >> 0;
  15144. this._newPartsExcess -= this._newPartsExcess >> 0;
  15145. }
  15146. this._alive = false;
  15147. if (!this._stopped) {
  15148. this._actualFrame += this._scaledUpdateSpeed;
  15149. if (this.targetStopDuration && this._actualFrame >= this.targetStopDuration)
  15150. this.stop();
  15151. }
  15152. else {
  15153. newParticles = 0;
  15154. }
  15155. this._update(newParticles);
  15156. // Stopped?
  15157. if (this._stopped) {
  15158. if (!this._alive) {
  15159. this._started = false;
  15160. if (this.disposeOnStop) {
  15161. this._scene._toBeDisposed.push(this);
  15162. }
  15163. }
  15164. }
  15165. // Update VBO
  15166. var offset = 0;
  15167. for (var index = 0; index < this.particles.length; index++) {
  15168. var particle = this.particles[index];
  15169. this._appendParticleVertex(offset++, particle, 0, 0);
  15170. this._appendParticleVertex(offset++, particle, 1, 0);
  15171. this._appendParticleVertex(offset++, particle, 1, 1);
  15172. this._appendParticleVertex(offset++, particle, 0, 1);
  15173. }
  15174. var engine = this._scene.getEngine();
  15175. engine.updateDynamicVertexBuffer(this._vertexBuffer, this._vertices);
  15176. };
  15177. ParticleSystem.prototype.render = function () {
  15178. var effect = this._getEffect();
  15179. // Check
  15180. if (!this.emitter || !effect.isReady() || !this.particleTexture || !this.particleTexture.isReady() || !this.particles.length)
  15181. return 0;
  15182. var engine = this._scene.getEngine();
  15183. // Render
  15184. engine.enableEffect(effect);
  15185. engine.setState(false);
  15186. var viewMatrix = this._scene.getViewMatrix();
  15187. effect.setTexture("diffuseSampler", this.particleTexture);
  15188. effect.setMatrix("view", viewMatrix);
  15189. effect.setMatrix("projection", this._scene.getProjectionMatrix());
  15190. effect.setFloat4("textureMask", this.textureMask.r, this.textureMask.g, this.textureMask.b, this.textureMask.a);
  15191. if (this._scene.clipPlane) {
  15192. var clipPlane = this._scene.clipPlane;
  15193. var invView = viewMatrix.clone();
  15194. invView.invert();
  15195. effect.setMatrix("invView", invView);
  15196. effect.setFloat4("vClipPlane", clipPlane.normal.x, clipPlane.normal.y, clipPlane.normal.z, clipPlane.d);
  15197. }
  15198. // VBOs
  15199. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, effect);
  15200. // Draw order
  15201. if (this.blendMode === ParticleSystem.BLENDMODE_ONEONE) {
  15202. engine.setAlphaMode(BABYLON.Engine.ALPHA_ADD);
  15203. }
  15204. else {
  15205. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  15206. }
  15207. if (this.forceDepthWrite) {
  15208. engine.setDepthWrite(true);
  15209. }
  15210. engine.draw(true, 0, this.particles.length * 6);
  15211. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  15212. return this.particles.length;
  15213. };
  15214. ParticleSystem.prototype.dispose = function () {
  15215. if (this._vertexBuffer) {
  15216. this._scene.getEngine()._releaseBuffer(this._vertexBuffer);
  15217. this._vertexBuffer = null;
  15218. }
  15219. if (this._indexBuffer) {
  15220. this._scene.getEngine()._releaseBuffer(this._indexBuffer);
  15221. this._indexBuffer = null;
  15222. }
  15223. if (this.particleTexture) {
  15224. this.particleTexture.dispose();
  15225. this.particleTexture = null;
  15226. }
  15227. // Remove from scene
  15228. var index = this._scene.particleSystems.indexOf(this);
  15229. this._scene.particleSystems.splice(index, 1);
  15230. // Callback
  15231. if (this.onDispose) {
  15232. this.onDispose();
  15233. }
  15234. };
  15235. // Clone
  15236. ParticleSystem.prototype.clone = function (name, newEmitter) {
  15237. var result = new ParticleSystem(name, this._capacity, this._scene);
  15238. BABYLON.Tools.DeepCopy(this, result, ["particles"], ["_vertexDeclaration", "_vertexStrideSize"]);
  15239. if (newEmitter === undefined) {
  15240. newEmitter = this.emitter;
  15241. }
  15242. result.emitter = newEmitter;
  15243. if (this.particleTexture) {
  15244. result.particleTexture = new BABYLON.Texture(this.particleTexture.url, this._scene);
  15245. }
  15246. result.start();
  15247. return result;
  15248. };
  15249. // Statics
  15250. ParticleSystem.BLENDMODE_ONEONE = 0;
  15251. ParticleSystem.BLENDMODE_STANDARD = 1;
  15252. return ParticleSystem;
  15253. })();
  15254. BABYLON.ParticleSystem = ParticleSystem;
  15255. })(BABYLON || (BABYLON = {}));
  15256. //# sourceMappingURL=babylon.particleSystem.js.mapvar BABYLON;
  15257. (function (BABYLON) {
  15258. var Animation = (function () {
  15259. function Animation(name, targetProperty, framePerSecond, dataType, loopMode) {
  15260. this.name = name;
  15261. this.targetProperty = targetProperty;
  15262. this.framePerSecond = framePerSecond;
  15263. this.dataType = dataType;
  15264. this.loopMode = loopMode;
  15265. this._offsetsCache = {};
  15266. this._highLimitsCache = {};
  15267. this._stopped = false;
  15268. this.targetPropertyPath = targetProperty.split(".");
  15269. this.dataType = dataType;
  15270. this.loopMode = loopMode === undefined ? Animation.ANIMATIONLOOPMODE_CYCLE : loopMode;
  15271. }
  15272. Animation.CreateAndStartAnimation = function (name, mesh, tartgetProperty, framePerSecond, totalFrame, from, to, loopMode) {
  15273. var dataType = undefined;
  15274. if (!isNaN(parseFloat(from)) && isFinite(from)) {
  15275. dataType = Animation.ANIMATIONTYPE_FLOAT;
  15276. }
  15277. else if (from instanceof BABYLON.Quaternion) {
  15278. dataType = Animation.ANIMATIONTYPE_QUATERNION;
  15279. }
  15280. else if (from instanceof BABYLON.Vector3) {
  15281. dataType = Animation.ANIMATIONTYPE_VECTOR3;
  15282. }
  15283. else if (from instanceof BABYLON.Vector2) {
  15284. dataType = Animation.ANIMATIONTYPE_VECTOR2;
  15285. }
  15286. else if (from instanceof BABYLON.Color3) {
  15287. dataType = Animation.ANIMATIONTYPE_COLOR3;
  15288. }
  15289. if (dataType == undefined) {
  15290. return;
  15291. }
  15292. var animation = new Animation(name, tartgetProperty, framePerSecond, dataType, loopMode);
  15293. var keys = [];
  15294. keys.push({ frame: 0, value: from });
  15295. keys.push({ frame: totalFrame, value: to });
  15296. animation.setKeys(keys);
  15297. mesh.animations.push(animation);
  15298. mesh.getScene().beginAnimation(mesh, 0, totalFrame, (animation.loopMode === 1));
  15299. };
  15300. // Methods
  15301. Animation.prototype.isStopped = function () {
  15302. return this._stopped;
  15303. };
  15304. Animation.prototype.getKeys = function () {
  15305. return this._keys;
  15306. };
  15307. Animation.prototype.getEasingFunction = function () {
  15308. return this._easingFunction;
  15309. };
  15310. Animation.prototype.setEasingFunction = function (easingFunction) {
  15311. this._easingFunction = easingFunction;
  15312. };
  15313. Animation.prototype.floatInterpolateFunction = function (startValue, endValue, gradient) {
  15314. return startValue + (endValue - startValue) * gradient;
  15315. };
  15316. Animation.prototype.quaternionInterpolateFunction = function (startValue, endValue, gradient) {
  15317. return BABYLON.Quaternion.Slerp(startValue, endValue, gradient);
  15318. };
  15319. Animation.prototype.vector3InterpolateFunction = function (startValue, endValue, gradient) {
  15320. return BABYLON.Vector3.Lerp(startValue, endValue, gradient);
  15321. };
  15322. Animation.prototype.vector2InterpolateFunction = function (startValue, endValue, gradient) {
  15323. return BABYLON.Vector2.Lerp(startValue, endValue, gradient);
  15324. };
  15325. Animation.prototype.color3InterpolateFunction = function (startValue, endValue, gradient) {
  15326. return BABYLON.Color3.Lerp(startValue, endValue, gradient);
  15327. };
  15328. Animation.prototype.matrixInterpolateFunction = function (startValue, endValue, gradient) {
  15329. var startScale = new BABYLON.Vector3(0, 0, 0);
  15330. var startRotation = new BABYLON.Quaternion();
  15331. var startTranslation = new BABYLON.Vector3(0, 0, 0);
  15332. startValue.decompose(startScale, startRotation, startTranslation);
  15333. var endScale = new BABYLON.Vector3(0, 0, 0);
  15334. var endRotation = new BABYLON.Quaternion();
  15335. var endTranslation = new BABYLON.Vector3(0, 0, 0);
  15336. endValue.decompose(endScale, endRotation, endTranslation);
  15337. var resultScale = this.vector3InterpolateFunction(startScale, endScale, gradient);
  15338. var resultRotation = this.quaternionInterpolateFunction(startRotation, endRotation, gradient);
  15339. var resultTranslation = this.vector3InterpolateFunction(startTranslation, endTranslation, gradient);
  15340. var result = BABYLON.Matrix.Compose(resultScale, resultRotation, resultTranslation);
  15341. return result;
  15342. };
  15343. Animation.prototype.clone = function () {
  15344. var clone = new Animation(this.name, this.targetPropertyPath.join("."), this.framePerSecond, this.dataType, this.loopMode);
  15345. clone.setKeys(this._keys);
  15346. return clone;
  15347. };
  15348. Animation.prototype.setKeys = function (values) {
  15349. this._keys = values.slice(0);
  15350. this._offsetsCache = {};
  15351. this._highLimitsCache = {};
  15352. };
  15353. Animation.prototype._getKeyValue = function (value) {
  15354. if (typeof value === "function") {
  15355. return value();
  15356. }
  15357. return value;
  15358. };
  15359. Animation.prototype._interpolate = function (currentFrame, repeatCount, loopMode, offsetValue, highLimitValue) {
  15360. if (loopMode === Animation.ANIMATIONLOOPMODE_CONSTANT && repeatCount > 0) {
  15361. return highLimitValue.clone ? highLimitValue.clone() : highLimitValue;
  15362. }
  15363. this.currentFrame = currentFrame;
  15364. for (var key = 0; key < this._keys.length; key++) {
  15365. // for each frame, we need the key just before the frame superior
  15366. if (this._keys[key + 1].frame >= currentFrame) {
  15367. var startValue = this._getKeyValue(this._keys[key].value);
  15368. var endValue = this._getKeyValue(this._keys[key + 1].value);
  15369. // gradient : percent of currentFrame between the frame inf and the frame sup
  15370. var gradient = (currentFrame - this._keys[key].frame) / (this._keys[key + 1].frame - this._keys[key].frame);
  15371. // check for easingFunction and correction of gradient
  15372. if (this._easingFunction != null) {
  15373. gradient = this._easingFunction.ease(gradient);
  15374. }
  15375. switch (this.dataType) {
  15376. case Animation.ANIMATIONTYPE_FLOAT:
  15377. switch (loopMode) {
  15378. case Animation.ANIMATIONLOOPMODE_CYCLE:
  15379. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  15380. return this.floatInterpolateFunction(startValue, endValue, gradient);
  15381. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  15382. return offsetValue * repeatCount + this.floatInterpolateFunction(startValue, endValue, gradient);
  15383. }
  15384. break;
  15385. case Animation.ANIMATIONTYPE_QUATERNION:
  15386. var quaternion = null;
  15387. switch (loopMode) {
  15388. case Animation.ANIMATIONLOOPMODE_CYCLE:
  15389. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  15390. quaternion = this.quaternionInterpolateFunction(startValue, endValue, gradient);
  15391. break;
  15392. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  15393. quaternion = this.quaternionInterpolateFunction(startValue, endValue, gradient).add(offsetValue.scale(repeatCount));
  15394. break;
  15395. }
  15396. return quaternion;
  15397. case Animation.ANIMATIONTYPE_VECTOR3:
  15398. switch (loopMode) {
  15399. case Animation.ANIMATIONLOOPMODE_CYCLE:
  15400. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  15401. return this.vector3InterpolateFunction(startValue, endValue, gradient);
  15402. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  15403. return this.vector3InterpolateFunction(startValue, endValue, gradient).add(offsetValue.scale(repeatCount));
  15404. }
  15405. case Animation.ANIMATIONTYPE_VECTOR2:
  15406. switch (loopMode) {
  15407. case Animation.ANIMATIONLOOPMODE_CYCLE:
  15408. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  15409. return this.vector2InterpolateFunction(startValue, endValue, gradient);
  15410. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  15411. return this.vector2InterpolateFunction(startValue, endValue, gradient).add(offsetValue.scale(repeatCount));
  15412. }
  15413. case Animation.ANIMATIONTYPE_COLOR3:
  15414. switch (loopMode) {
  15415. case Animation.ANIMATIONLOOPMODE_CYCLE:
  15416. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  15417. return this.color3InterpolateFunction(startValue, endValue, gradient);
  15418. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  15419. return this.color3InterpolateFunction(startValue, endValue, gradient).add(offsetValue.scale(repeatCount));
  15420. }
  15421. case Animation.ANIMATIONTYPE_MATRIX:
  15422. switch (loopMode) {
  15423. case Animation.ANIMATIONLOOPMODE_CYCLE:
  15424. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  15425. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  15426. return startValue;
  15427. }
  15428. default:
  15429. break;
  15430. }
  15431. break;
  15432. }
  15433. }
  15434. return this._getKeyValue(this._keys[this._keys.length - 1].value);
  15435. };
  15436. Animation.prototype.animate = function (delay, from, to, loop, speedRatio) {
  15437. if (!this.targetPropertyPath || this.targetPropertyPath.length < 1) {
  15438. this._stopped = true;
  15439. return false;
  15440. }
  15441. var returnValue = true;
  15442. // Adding a start key at frame 0 if missing
  15443. if (this._keys[0].frame !== 0) {
  15444. var newKey = { frame: 0, value: this._keys[0].value };
  15445. this._keys.splice(0, 0, newKey);
  15446. }
  15447. // Check limits
  15448. if (from < this._keys[0].frame || from > this._keys[this._keys.length - 1].frame) {
  15449. from = this._keys[0].frame;
  15450. }
  15451. if (to < this._keys[0].frame || to > this._keys[this._keys.length - 1].frame) {
  15452. to = this._keys[this._keys.length - 1].frame;
  15453. }
  15454. // Compute ratio
  15455. var range = to - from;
  15456. var offsetValue;
  15457. // ratio represents the frame delta between from and to
  15458. var ratio = delay * (this.framePerSecond * speedRatio) / 1000.0;
  15459. var highLimitValue = 0;
  15460. if (ratio > range && !loop) {
  15461. returnValue = false;
  15462. highLimitValue = this._getKeyValue(this._keys[this._keys.length - 1].value);
  15463. }
  15464. else {
  15465. // Get max value if required
  15466. if (this.loopMode !== Animation.ANIMATIONLOOPMODE_CYCLE) {
  15467. var keyOffset = to.toString() + from.toString();
  15468. if (!this._offsetsCache[keyOffset]) {
  15469. var fromValue = this._interpolate(from, 0, Animation.ANIMATIONLOOPMODE_CYCLE);
  15470. var toValue = this._interpolate(to, 0, Animation.ANIMATIONLOOPMODE_CYCLE);
  15471. switch (this.dataType) {
  15472. case Animation.ANIMATIONTYPE_FLOAT:
  15473. this._offsetsCache[keyOffset] = toValue - fromValue;
  15474. break;
  15475. case Animation.ANIMATIONTYPE_QUATERNION:
  15476. this._offsetsCache[keyOffset] = toValue.subtract(fromValue);
  15477. break;
  15478. case Animation.ANIMATIONTYPE_VECTOR3:
  15479. this._offsetsCache[keyOffset] = toValue.subtract(fromValue);
  15480. case Animation.ANIMATIONTYPE_VECTOR2:
  15481. this._offsetsCache[keyOffset] = toValue.subtract(fromValue);
  15482. case Animation.ANIMATIONTYPE_COLOR3:
  15483. this._offsetsCache[keyOffset] = toValue.subtract(fromValue);
  15484. default:
  15485. break;
  15486. }
  15487. this._highLimitsCache[keyOffset] = toValue;
  15488. }
  15489. highLimitValue = this._highLimitsCache[keyOffset];
  15490. offsetValue = this._offsetsCache[keyOffset];
  15491. }
  15492. }
  15493. if (offsetValue === undefined) {
  15494. switch (this.dataType) {
  15495. case Animation.ANIMATIONTYPE_FLOAT:
  15496. offsetValue = 0;
  15497. break;
  15498. case Animation.ANIMATIONTYPE_QUATERNION:
  15499. offsetValue = new BABYLON.Quaternion(0, 0, 0, 0);
  15500. break;
  15501. case Animation.ANIMATIONTYPE_VECTOR3:
  15502. offsetValue = BABYLON.Vector3.Zero();
  15503. break;
  15504. case Animation.ANIMATIONTYPE_VECTOR2:
  15505. offsetValue = BABYLON.Vector2.Zero();
  15506. break;
  15507. case Animation.ANIMATIONTYPE_COLOR3:
  15508. offsetValue = BABYLON.Color3.Black();
  15509. }
  15510. }
  15511. // Compute value
  15512. var repeatCount = (ratio / range) >> 0;
  15513. var currentFrame = returnValue ? from + ratio % range : to;
  15514. var currentValue = this._interpolate(currentFrame, repeatCount, this.loopMode, offsetValue, highLimitValue);
  15515. // Set value
  15516. if (this.targetPropertyPath.length > 1) {
  15517. var property = this._target[this.targetPropertyPath[0]];
  15518. for (var index = 1; index < this.targetPropertyPath.length - 1; index++) {
  15519. property = property[this.targetPropertyPath[index]];
  15520. }
  15521. property[this.targetPropertyPath[this.targetPropertyPath.length - 1]] = currentValue;
  15522. }
  15523. else {
  15524. this._target[this.targetPropertyPath[0]] = currentValue;
  15525. }
  15526. if (this._target.markAsDirty) {
  15527. this._target.markAsDirty(this.targetProperty);
  15528. }
  15529. if (!returnValue) {
  15530. this._stopped = true;
  15531. }
  15532. return returnValue;
  15533. };
  15534. Object.defineProperty(Animation, "ANIMATIONTYPE_FLOAT", {
  15535. get: function () {
  15536. return Animation._ANIMATIONTYPE_FLOAT;
  15537. },
  15538. enumerable: true,
  15539. configurable: true
  15540. });
  15541. Object.defineProperty(Animation, "ANIMATIONTYPE_VECTOR3", {
  15542. get: function () {
  15543. return Animation._ANIMATIONTYPE_VECTOR3;
  15544. },
  15545. enumerable: true,
  15546. configurable: true
  15547. });
  15548. Object.defineProperty(Animation, "ANIMATIONTYPE_VECTOR2", {
  15549. get: function () {
  15550. return Animation._ANIMATIONTYPE_VECTOR2;
  15551. },
  15552. enumerable: true,
  15553. configurable: true
  15554. });
  15555. Object.defineProperty(Animation, "ANIMATIONTYPE_QUATERNION", {
  15556. get: function () {
  15557. return Animation._ANIMATIONTYPE_QUATERNION;
  15558. },
  15559. enumerable: true,
  15560. configurable: true
  15561. });
  15562. Object.defineProperty(Animation, "ANIMATIONTYPE_MATRIX", {
  15563. get: function () {
  15564. return Animation._ANIMATIONTYPE_MATRIX;
  15565. },
  15566. enumerable: true,
  15567. configurable: true
  15568. });
  15569. Object.defineProperty(Animation, "ANIMATIONTYPE_COLOR3", {
  15570. get: function () {
  15571. return Animation._ANIMATIONTYPE_COLOR3;
  15572. },
  15573. enumerable: true,
  15574. configurable: true
  15575. });
  15576. Object.defineProperty(Animation, "ANIMATIONLOOPMODE_RELATIVE", {
  15577. get: function () {
  15578. return Animation._ANIMATIONLOOPMODE_RELATIVE;
  15579. },
  15580. enumerable: true,
  15581. configurable: true
  15582. });
  15583. Object.defineProperty(Animation, "ANIMATIONLOOPMODE_CYCLE", {
  15584. get: function () {
  15585. return Animation._ANIMATIONLOOPMODE_CYCLE;
  15586. },
  15587. enumerable: true,
  15588. configurable: true
  15589. });
  15590. Object.defineProperty(Animation, "ANIMATIONLOOPMODE_CONSTANT", {
  15591. get: function () {
  15592. return Animation._ANIMATIONLOOPMODE_CONSTANT;
  15593. },
  15594. enumerable: true,
  15595. configurable: true
  15596. });
  15597. // Statics
  15598. Animation._ANIMATIONTYPE_FLOAT = 0;
  15599. Animation._ANIMATIONTYPE_VECTOR3 = 1;
  15600. Animation._ANIMATIONTYPE_QUATERNION = 2;
  15601. Animation._ANIMATIONTYPE_MATRIX = 3;
  15602. Animation._ANIMATIONTYPE_COLOR3 = 4;
  15603. Animation._ANIMATIONTYPE_VECTOR2 = 5;
  15604. Animation._ANIMATIONLOOPMODE_RELATIVE = 0;
  15605. Animation._ANIMATIONLOOPMODE_CYCLE = 1;
  15606. Animation._ANIMATIONLOOPMODE_CONSTANT = 2;
  15607. return Animation;
  15608. })();
  15609. BABYLON.Animation = Animation;
  15610. })(BABYLON || (BABYLON = {}));
  15611. //# sourceMappingURL=babylon.animation.js.mapvar BABYLON;
  15612. (function (BABYLON) {
  15613. var Animatable = (function () {
  15614. function Animatable(scene, target, fromFrame, toFrame, loopAnimation, speedRatio, onAnimationEnd, animations) {
  15615. if (fromFrame === void 0) { fromFrame = 0; }
  15616. if (toFrame === void 0) { toFrame = 100; }
  15617. if (loopAnimation === void 0) { loopAnimation = false; }
  15618. if (speedRatio === void 0) { speedRatio = 1.0; }
  15619. this.target = target;
  15620. this.fromFrame = fromFrame;
  15621. this.toFrame = toFrame;
  15622. this.loopAnimation = loopAnimation;
  15623. this.speedRatio = speedRatio;
  15624. this.onAnimationEnd = onAnimationEnd;
  15625. this._animations = new Array();
  15626. this._paused = false;
  15627. this.animationStarted = false;
  15628. if (animations) {
  15629. this.appendAnimations(target, animations);
  15630. }
  15631. this._scene = scene;
  15632. scene._activeAnimatables.push(this);
  15633. }
  15634. // Methods
  15635. Animatable.prototype.appendAnimations = function (target, animations) {
  15636. for (var index = 0; index < animations.length; index++) {
  15637. var animation = animations[index];
  15638. animation._target = target;
  15639. this._animations.push(animation);
  15640. }
  15641. };
  15642. Animatable.prototype.getAnimationByTargetProperty = function (property) {
  15643. var animations = this._animations;
  15644. for (var index = 0; index < animations.length; index++) {
  15645. if (animations[index].targetProperty === property) {
  15646. return animations[index];
  15647. }
  15648. }
  15649. return null;
  15650. };
  15651. Animatable.prototype.pause = function () {
  15652. if (this._paused) {
  15653. return;
  15654. }
  15655. this._paused = true;
  15656. };
  15657. Animatable.prototype.restart = function () {
  15658. this._paused = false;
  15659. };
  15660. Animatable.prototype.stop = function () {
  15661. var index = this._scene._activeAnimatables.indexOf(this);
  15662. if (index > -1) {
  15663. this._scene._activeAnimatables.splice(index, 1);
  15664. }
  15665. if (this.onAnimationEnd) {
  15666. this.onAnimationEnd();
  15667. }
  15668. };
  15669. Animatable.prototype._animate = function (delay) {
  15670. if (this._paused) {
  15671. if (!this._pausedDelay) {
  15672. this._pausedDelay = delay;
  15673. }
  15674. return true;
  15675. }
  15676. if (!this._localDelayOffset) {
  15677. this._localDelayOffset = delay;
  15678. }
  15679. else if (this._pausedDelay) {
  15680. this._localDelayOffset += delay - this._pausedDelay;
  15681. this._pausedDelay = null;
  15682. }
  15683. // Animating
  15684. var running = false;
  15685. var animations = this._animations;
  15686. for (var index = 0; index < animations.length; index++) {
  15687. var animation = animations[index];
  15688. var isRunning = animation.animate(delay - this._localDelayOffset, this.fromFrame, this.toFrame, this.loopAnimation, this.speedRatio);
  15689. running = running || isRunning;
  15690. }
  15691. if (!running && this.onAnimationEnd) {
  15692. this.onAnimationEnd();
  15693. }
  15694. return running;
  15695. };
  15696. return Animatable;
  15697. })();
  15698. BABYLON.Animatable = Animatable;
  15699. })(BABYLON || (BABYLON = {}));
  15700. //# sourceMappingURL=babylon.animatable.js.map
  15701. var BABYLON;
  15702. (function (BABYLON) {
  15703. var EasingFunction = (function () {
  15704. function EasingFunction() {
  15705. // Properties
  15706. this._easingMode = EasingFunction.EASINGMODE_EASEIN;
  15707. }
  15708. Object.defineProperty(EasingFunction, "EASINGMODE_EASEIN", {
  15709. get: function () {
  15710. return EasingFunction._EASINGMODE_EASEIN;
  15711. },
  15712. enumerable: true,
  15713. configurable: true
  15714. });
  15715. Object.defineProperty(EasingFunction, "EASINGMODE_EASEOUT", {
  15716. get: function () {
  15717. return EasingFunction._EASINGMODE_EASEOUT;
  15718. },
  15719. enumerable: true,
  15720. configurable: true
  15721. });
  15722. Object.defineProperty(EasingFunction, "EASINGMODE_EASEINOUT", {
  15723. get: function () {
  15724. return EasingFunction._EASINGMODE_EASEINOUT;
  15725. },
  15726. enumerable: true,
  15727. configurable: true
  15728. });
  15729. EasingFunction.prototype.setEasingMode = function (easingMode) {
  15730. var n = Math.min(Math.max(easingMode, 0), 2);
  15731. this._easingMode = n;
  15732. };
  15733. EasingFunction.prototype.getEasingMode = function () {
  15734. return this._easingMode;
  15735. };
  15736. EasingFunction.prototype.easeInCore = function (gradient) {
  15737. throw new Error('You must implement this method');
  15738. };
  15739. EasingFunction.prototype.ease = function (gradient) {
  15740. switch (this._easingMode) {
  15741. case EasingFunction.EASINGMODE_EASEIN:
  15742. return this.easeInCore(gradient);
  15743. case EasingFunction.EASINGMODE_EASEOUT:
  15744. return (1 - this.easeInCore(1 - gradient));
  15745. }
  15746. if (gradient >= 0.5) {
  15747. return (((1 - this.easeInCore((1 - gradient) * 2)) * 0.5) + 0.5);
  15748. }
  15749. return (this.easeInCore(gradient * 2) * 0.5);
  15750. };
  15751. //Statics
  15752. EasingFunction._EASINGMODE_EASEIN = 0;
  15753. EasingFunction._EASINGMODE_EASEOUT = 1;
  15754. EasingFunction._EASINGMODE_EASEINOUT = 2;
  15755. return EasingFunction;
  15756. })();
  15757. BABYLON.EasingFunction = EasingFunction;
  15758. var CircleEase = (function (_super) {
  15759. __extends(CircleEase, _super);
  15760. function CircleEase() {
  15761. _super.apply(this, arguments);
  15762. }
  15763. CircleEase.prototype.easeInCore = function (gradient) {
  15764. gradient = Math.max(0, Math.min(1, gradient));
  15765. return (1.0 - Math.sqrt(1.0 - (gradient * gradient)));
  15766. };
  15767. return CircleEase;
  15768. })(EasingFunction);
  15769. BABYLON.CircleEase = CircleEase;
  15770. var BackEase = (function (_super) {
  15771. __extends(BackEase, _super);
  15772. function BackEase(amplitude) {
  15773. if (amplitude === void 0) { amplitude = 1; }
  15774. _super.call(this);
  15775. this.amplitude = amplitude;
  15776. }
  15777. BackEase.prototype.easeInCore = function (gradient) {
  15778. var num = Math.max(0, this.amplitude);
  15779. return (Math.pow(gradient, 3.0) - ((gradient * num) * Math.sin(3.1415926535897931 * gradient)));
  15780. };
  15781. return BackEase;
  15782. })(EasingFunction);
  15783. BABYLON.BackEase = BackEase;
  15784. var BounceEase = (function (_super) {
  15785. __extends(BounceEase, _super);
  15786. function BounceEase(bounces, bounciness) {
  15787. if (bounces === void 0) { bounces = 3; }
  15788. if (bounciness === void 0) { bounciness = 2; }
  15789. _super.call(this);
  15790. this.bounces = bounces;
  15791. this.bounciness = bounciness;
  15792. }
  15793. BounceEase.prototype.easeInCore = function (gradient) {
  15794. var y = Math.max(0.0, this.bounces);
  15795. var bounciness = this.bounciness;
  15796. if (bounciness <= 1.0) {
  15797. bounciness = 1.001;
  15798. }
  15799. var num9 = Math.pow(bounciness, y);
  15800. var num5 = 1.0 - bounciness;
  15801. var num4 = ((1.0 - num9) / num5) + (num9 * 0.5);
  15802. var num15 = gradient * num4;
  15803. var num65 = Math.log((-num15 * (1.0 - bounciness)) + 1.0) / Math.log(bounciness);
  15804. var num3 = Math.floor(num65);
  15805. var num13 = num3 + 1.0;
  15806. var num8 = (1.0 - Math.pow(bounciness, num3)) / (num5 * num4);
  15807. var num12 = (1.0 - Math.pow(bounciness, num13)) / (num5 * num4);
  15808. var num7 = (num8 + num12) * 0.5;
  15809. var num6 = gradient - num7;
  15810. var num2 = num7 - num8;
  15811. return (((-Math.pow(1.0 / bounciness, y - num3) / (num2 * num2)) * (num6 - num2)) * (num6 + num2));
  15812. };
  15813. return BounceEase;
  15814. })(EasingFunction);
  15815. BABYLON.BounceEase = BounceEase;
  15816. var CubicEase = (function (_super) {
  15817. __extends(CubicEase, _super);
  15818. function CubicEase() {
  15819. _super.apply(this, arguments);
  15820. }
  15821. CubicEase.prototype.easeInCore = function (gradient) {
  15822. return (gradient * gradient * gradient);
  15823. };
  15824. return CubicEase;
  15825. })(EasingFunction);
  15826. BABYLON.CubicEase = CubicEase;
  15827. var ElasticEase = (function (_super) {
  15828. __extends(ElasticEase, _super);
  15829. function ElasticEase(oscillations, springiness) {
  15830. if (oscillations === void 0) { oscillations = 3; }
  15831. if (springiness === void 0) { springiness = 3; }
  15832. _super.call(this);
  15833. this.oscillations = oscillations;
  15834. this.springiness = springiness;
  15835. }
  15836. ElasticEase.prototype.easeInCore = function (gradient) {
  15837. var num2;
  15838. var num3 = Math.max(0.0, this.oscillations);
  15839. var num = Math.max(0.0, this.springiness);
  15840. if (num == 0) {
  15841. num2 = gradient;
  15842. }
  15843. else {
  15844. num2 = (Math.exp(num * gradient) - 1.0) / (Math.exp(num) - 1.0);
  15845. }
  15846. return (num2 * Math.sin(((6.2831853071795862 * num3) + 1.5707963267948966) * gradient));
  15847. };
  15848. return ElasticEase;
  15849. })(EasingFunction);
  15850. BABYLON.ElasticEase = ElasticEase;
  15851. var ExponentialEase = (function (_super) {
  15852. __extends(ExponentialEase, _super);
  15853. function ExponentialEase(exponent) {
  15854. if (exponent === void 0) { exponent = 2; }
  15855. _super.call(this);
  15856. this.exponent = exponent;
  15857. }
  15858. ExponentialEase.prototype.easeInCore = function (gradient) {
  15859. if (this.exponent <= 0) {
  15860. return gradient;
  15861. }
  15862. return ((Math.exp(this.exponent * gradient) - 1.0) / (Math.exp(this.exponent) - 1.0));
  15863. };
  15864. return ExponentialEase;
  15865. })(EasingFunction);
  15866. BABYLON.ExponentialEase = ExponentialEase;
  15867. var PowerEase = (function (_super) {
  15868. __extends(PowerEase, _super);
  15869. function PowerEase(power) {
  15870. if (power === void 0) { power = 2; }
  15871. _super.call(this);
  15872. this.power = power;
  15873. }
  15874. PowerEase.prototype.easeInCore = function (gradient) {
  15875. var y = Math.max(0.0, this.power);
  15876. return Math.pow(gradient, y);
  15877. };
  15878. return PowerEase;
  15879. })(EasingFunction);
  15880. BABYLON.PowerEase = PowerEase;
  15881. var QuadraticEase = (function (_super) {
  15882. __extends(QuadraticEase, _super);
  15883. function QuadraticEase() {
  15884. _super.apply(this, arguments);
  15885. }
  15886. QuadraticEase.prototype.easeInCore = function (gradient) {
  15887. return (gradient * gradient);
  15888. };
  15889. return QuadraticEase;
  15890. })(EasingFunction);
  15891. BABYLON.QuadraticEase = QuadraticEase;
  15892. var QuarticEase = (function (_super) {
  15893. __extends(QuarticEase, _super);
  15894. function QuarticEase() {
  15895. _super.apply(this, arguments);
  15896. }
  15897. QuarticEase.prototype.easeInCore = function (gradient) {
  15898. return (gradient * gradient * gradient * gradient);
  15899. };
  15900. return QuarticEase;
  15901. })(EasingFunction);
  15902. BABYLON.QuarticEase = QuarticEase;
  15903. var QuinticEase = (function (_super) {
  15904. __extends(QuinticEase, _super);
  15905. function QuinticEase() {
  15906. _super.apply(this, arguments);
  15907. }
  15908. QuinticEase.prototype.easeInCore = function (gradient) {
  15909. return (gradient * gradient * gradient * gradient * gradient);
  15910. };
  15911. return QuinticEase;
  15912. })(EasingFunction);
  15913. BABYLON.QuinticEase = QuinticEase;
  15914. var SineEase = (function (_super) {
  15915. __extends(SineEase, _super);
  15916. function SineEase() {
  15917. _super.apply(this, arguments);
  15918. }
  15919. SineEase.prototype.easeInCore = function (gradient) {
  15920. return (1.0 - Math.sin(1.5707963267948966 * (1.0 - gradient)));
  15921. };
  15922. return SineEase;
  15923. })(EasingFunction);
  15924. BABYLON.SineEase = SineEase;
  15925. var BezierCurveEase = (function (_super) {
  15926. __extends(BezierCurveEase, _super);
  15927. function BezierCurveEase(x1, y1, x2, y2) {
  15928. if (x1 === void 0) { x1 = 0; }
  15929. if (y1 === void 0) { y1 = 0; }
  15930. if (x2 === void 0) { x2 = 1; }
  15931. if (y2 === void 0) { y2 = 1; }
  15932. _super.call(this);
  15933. this.x1 = x1;
  15934. this.y1 = y1;
  15935. this.x2 = x2;
  15936. this.y2 = y2;
  15937. }
  15938. BezierCurveEase.prototype.easeInCore = function (gradient) {
  15939. return BABYLON.BezierCurve.interpolate(gradient, this.x1, this.y1, this.x2, this.y2);
  15940. };
  15941. return BezierCurveEase;
  15942. })(EasingFunction);
  15943. BABYLON.BezierCurveEase = BezierCurveEase;
  15944. })(BABYLON || (BABYLON = {}));
  15945. //# sourceMappingURL=babylon.easing.js.mapvar BABYLON;
  15946. (function (BABYLON) {
  15947. var Octree = (function () {
  15948. function Octree(creationFunc, maxBlockCapacity, maxDepth) {
  15949. if (maxDepth === void 0) { maxDepth = 2; }
  15950. this.maxDepth = maxDepth;
  15951. this.dynamicContent = new Array();
  15952. this._maxBlockCapacity = maxBlockCapacity || 64;
  15953. this._selectionContent = new BABYLON.SmartArray(1024);
  15954. this._creationFunc = creationFunc;
  15955. }
  15956. // Methods
  15957. Octree.prototype.update = function (worldMin, worldMax, entries) {
  15958. Octree._CreateBlocks(worldMin, worldMax, entries, this._maxBlockCapacity, 0, this.maxDepth, this, this._creationFunc);
  15959. };
  15960. Octree.prototype.addMesh = function (entry) {
  15961. for (var index = 0; index < this.blocks.length; index++) {
  15962. var block = this.blocks[index];
  15963. block.addEntry(entry);
  15964. }
  15965. };
  15966. Octree.prototype.select = function (frustumPlanes, allowDuplicate) {
  15967. this._selectionContent.reset();
  15968. for (var index = 0; index < this.blocks.length; index++) {
  15969. var block = this.blocks[index];
  15970. block.select(frustumPlanes, this._selectionContent, allowDuplicate);
  15971. }
  15972. if (allowDuplicate) {
  15973. this._selectionContent.concat(this.dynamicContent);
  15974. }
  15975. else {
  15976. this._selectionContent.concatWithNoDuplicate(this.dynamicContent);
  15977. }
  15978. return this._selectionContent;
  15979. };
  15980. Octree.prototype.intersects = function (sphereCenter, sphereRadius, allowDuplicate) {
  15981. this._selectionContent.reset();
  15982. for (var index = 0; index < this.blocks.length; index++) {
  15983. var block = this.blocks[index];
  15984. block.intersects(sphereCenter, sphereRadius, this._selectionContent, allowDuplicate);
  15985. }
  15986. if (allowDuplicate) {
  15987. this._selectionContent.concat(this.dynamicContent);
  15988. }
  15989. else {
  15990. this._selectionContent.concatWithNoDuplicate(this.dynamicContent);
  15991. }
  15992. return this._selectionContent;
  15993. };
  15994. Octree.prototype.intersectsRay = function (ray) {
  15995. this._selectionContent.reset();
  15996. for (var index = 0; index < this.blocks.length; index++) {
  15997. var block = this.blocks[index];
  15998. block.intersectsRay(ray, this._selectionContent);
  15999. }
  16000. this._selectionContent.concatWithNoDuplicate(this.dynamicContent);
  16001. return this._selectionContent;
  16002. };
  16003. Octree._CreateBlocks = function (worldMin, worldMax, entries, maxBlockCapacity, currentDepth, maxDepth, target, creationFunc) {
  16004. target.blocks = new Array();
  16005. var blockSize = new BABYLON.Vector3((worldMax.x - worldMin.x) / 2, (worldMax.y - worldMin.y) / 2, (worldMax.z - worldMin.z) / 2);
  16006. for (var x = 0; x < 2; x++) {
  16007. for (var y = 0; y < 2; y++) {
  16008. for (var z = 0; z < 2; z++) {
  16009. var localMin = worldMin.add(blockSize.multiplyByFloats(x, y, z));
  16010. var localMax = worldMin.add(blockSize.multiplyByFloats(x + 1, y + 1, z + 1));
  16011. var block = new BABYLON.OctreeBlock(localMin, localMax, maxBlockCapacity, currentDepth + 1, maxDepth, creationFunc);
  16012. block.addEntries(entries);
  16013. target.blocks.push(block);
  16014. }
  16015. }
  16016. }
  16017. };
  16018. Octree.CreationFuncForMeshes = function (entry, block) {
  16019. if (!entry.isBlocked && entry.getBoundingInfo().boundingBox.intersectsMinMax(block.minPoint, block.maxPoint)) {
  16020. block.entries.push(entry);
  16021. }
  16022. };
  16023. Octree.CreationFuncForSubMeshes = function (entry, block) {
  16024. if (entry.getBoundingInfo().boundingBox.intersectsMinMax(block.minPoint, block.maxPoint)) {
  16025. block.entries.push(entry);
  16026. }
  16027. };
  16028. return Octree;
  16029. })();
  16030. BABYLON.Octree = Octree;
  16031. })(BABYLON || (BABYLON = {}));
  16032. //# sourceMappingURL=babylon.octree.js.mapvar BABYLON;
  16033. (function (BABYLON) {
  16034. var OctreeBlock = (function () {
  16035. function OctreeBlock(minPoint, maxPoint, capacity, depth, maxDepth, creationFunc) {
  16036. this.entries = new Array();
  16037. this._boundingVectors = new Array();
  16038. this._capacity = capacity;
  16039. this._depth = depth;
  16040. this._maxDepth = maxDepth;
  16041. this._creationFunc = creationFunc;
  16042. this._minPoint = minPoint;
  16043. this._maxPoint = maxPoint;
  16044. this._boundingVectors.push(minPoint.clone());
  16045. this._boundingVectors.push(maxPoint.clone());
  16046. this._boundingVectors.push(minPoint.clone());
  16047. this._boundingVectors[2].x = maxPoint.x;
  16048. this._boundingVectors.push(minPoint.clone());
  16049. this._boundingVectors[3].y = maxPoint.y;
  16050. this._boundingVectors.push(minPoint.clone());
  16051. this._boundingVectors[4].z = maxPoint.z;
  16052. this._boundingVectors.push(maxPoint.clone());
  16053. this._boundingVectors[5].z = minPoint.z;
  16054. this._boundingVectors.push(maxPoint.clone());
  16055. this._boundingVectors[6].x = minPoint.x;
  16056. this._boundingVectors.push(maxPoint.clone());
  16057. this._boundingVectors[7].y = minPoint.y;
  16058. }
  16059. Object.defineProperty(OctreeBlock.prototype, "capacity", {
  16060. // Property
  16061. get: function () {
  16062. return this._capacity;
  16063. },
  16064. enumerable: true,
  16065. configurable: true
  16066. });
  16067. Object.defineProperty(OctreeBlock.prototype, "minPoint", {
  16068. get: function () {
  16069. return this._minPoint;
  16070. },
  16071. enumerable: true,
  16072. configurable: true
  16073. });
  16074. Object.defineProperty(OctreeBlock.prototype, "maxPoint", {
  16075. get: function () {
  16076. return this._maxPoint;
  16077. },
  16078. enumerable: true,
  16079. configurable: true
  16080. });
  16081. // Methods
  16082. OctreeBlock.prototype.addEntry = function (entry) {
  16083. if (this.blocks) {
  16084. for (var index = 0; index < this.blocks.length; index++) {
  16085. var block = this.blocks[index];
  16086. block.addEntry(entry);
  16087. }
  16088. return;
  16089. }
  16090. this._creationFunc(entry, this);
  16091. if (this.entries.length > this.capacity && this._depth < this._maxDepth) {
  16092. this.createInnerBlocks();
  16093. }
  16094. };
  16095. OctreeBlock.prototype.addEntries = function (entries) {
  16096. for (var index = 0; index < entries.length; index++) {
  16097. var mesh = entries[index];
  16098. this.addEntry(mesh);
  16099. }
  16100. };
  16101. OctreeBlock.prototype.select = function (frustumPlanes, selection, allowDuplicate) {
  16102. if (BABYLON.BoundingBox.IsInFrustum(this._boundingVectors, frustumPlanes)) {
  16103. if (this.blocks) {
  16104. for (var index = 0; index < this.blocks.length; index++) {
  16105. var block = this.blocks[index];
  16106. block.select(frustumPlanes, selection, allowDuplicate);
  16107. }
  16108. return;
  16109. }
  16110. if (allowDuplicate) {
  16111. selection.concat(this.entries);
  16112. }
  16113. else {
  16114. selection.concatWithNoDuplicate(this.entries);
  16115. }
  16116. }
  16117. };
  16118. OctreeBlock.prototype.intersects = function (sphereCenter, sphereRadius, selection, allowDuplicate) {
  16119. if (BABYLON.BoundingBox.IntersectsSphere(this._minPoint, this._maxPoint, sphereCenter, sphereRadius)) {
  16120. if (this.blocks) {
  16121. for (var index = 0; index < this.blocks.length; index++) {
  16122. var block = this.blocks[index];
  16123. block.intersects(sphereCenter, sphereRadius, selection, allowDuplicate);
  16124. }
  16125. return;
  16126. }
  16127. if (allowDuplicate) {
  16128. selection.concat(this.entries);
  16129. }
  16130. else {
  16131. selection.concatWithNoDuplicate(this.entries);
  16132. }
  16133. }
  16134. };
  16135. OctreeBlock.prototype.intersectsRay = function (ray, selection) {
  16136. if (ray.intersectsBoxMinMax(this._minPoint, this._maxPoint)) {
  16137. if (this.blocks) {
  16138. for (var index = 0; index < this.blocks.length; index++) {
  16139. var block = this.blocks[index];
  16140. block.intersectsRay(ray, selection);
  16141. }
  16142. return;
  16143. }
  16144. selection.concatWithNoDuplicate(this.entries);
  16145. }
  16146. };
  16147. OctreeBlock.prototype.createInnerBlocks = function () {
  16148. BABYLON.Octree._CreateBlocks(this._minPoint, this._maxPoint, this.entries, this._capacity, this._depth, this._maxDepth, this, this._creationFunc);
  16149. };
  16150. return OctreeBlock;
  16151. })();
  16152. BABYLON.OctreeBlock = OctreeBlock;
  16153. })(BABYLON || (BABYLON = {}));
  16154. //# sourceMappingURL=babylon.octreeBlock.js.mapvar BABYLON;
  16155. (function (BABYLON) {
  16156. var Bone = (function () {
  16157. function Bone(name, skeleton, parentBone, matrix) {
  16158. this.name = name;
  16159. this.children = new Array();
  16160. this.animations = new Array();
  16161. this._worldTransform = new BABYLON.Matrix();
  16162. this._absoluteTransform = new BABYLON.Matrix();
  16163. this._invertedAbsoluteTransform = new BABYLON.Matrix();
  16164. this._skeleton = skeleton;
  16165. this._matrix = matrix;
  16166. this._baseMatrix = matrix;
  16167. skeleton.bones.push(this);
  16168. if (parentBone) {
  16169. this._parent = parentBone;
  16170. parentBone.children.push(this);
  16171. }
  16172. else {
  16173. this._parent = null;
  16174. }
  16175. this._updateDifferenceMatrix();
  16176. }
  16177. // Members
  16178. Bone.prototype.getParent = function () {
  16179. return this._parent;
  16180. };
  16181. Bone.prototype.getLocalMatrix = function () {
  16182. return this._matrix;
  16183. };
  16184. Bone.prototype.getBaseMatrix = function () {
  16185. return this._baseMatrix;
  16186. };
  16187. Bone.prototype.getWorldMatrix = function () {
  16188. return this._worldTransform;
  16189. };
  16190. Bone.prototype.getInvertedAbsoluteTransform = function () {
  16191. return this._invertedAbsoluteTransform;
  16192. };
  16193. Bone.prototype.getAbsoluteMatrix = function () {
  16194. var matrix = this._matrix.clone();
  16195. var parent = this._parent;
  16196. while (parent) {
  16197. matrix = matrix.multiply(parent.getLocalMatrix());
  16198. parent = parent.getParent();
  16199. }
  16200. return matrix;
  16201. };
  16202. // Methods
  16203. Bone.prototype.updateMatrix = function (matrix) {
  16204. this._matrix = matrix;
  16205. this._skeleton._markAsDirty();
  16206. this._updateDifferenceMatrix();
  16207. };
  16208. Bone.prototype._updateDifferenceMatrix = function () {
  16209. if (this._parent) {
  16210. this._matrix.multiplyToRef(this._parent._absoluteTransform, this._absoluteTransform);
  16211. }
  16212. else {
  16213. this._absoluteTransform.copyFrom(this._matrix);
  16214. }
  16215. this._absoluteTransform.invertToRef(this._invertedAbsoluteTransform);
  16216. for (var index = 0; index < this.children.length; index++) {
  16217. this.children[index]._updateDifferenceMatrix();
  16218. }
  16219. };
  16220. Bone.prototype.markAsDirty = function () {
  16221. this._skeleton._markAsDirty();
  16222. };
  16223. return Bone;
  16224. })();
  16225. BABYLON.Bone = Bone;
  16226. })(BABYLON || (BABYLON = {}));
  16227. //# sourceMappingURL=babylon.bone.js.mapvar BABYLON;
  16228. (function (BABYLON) {
  16229. var Skeleton = (function () {
  16230. function Skeleton(name, id, scene) {
  16231. this.name = name;
  16232. this.id = id;
  16233. this.bones = new Array();
  16234. this._isDirty = true;
  16235. this._identity = BABYLON.Matrix.Identity();
  16236. this.bones = [];
  16237. this._scene = scene;
  16238. scene.skeletons.push(this);
  16239. }
  16240. // Members
  16241. Skeleton.prototype.getTransformMatrices = function () {
  16242. return this._transformMatrices;
  16243. };
  16244. // Methods
  16245. Skeleton.prototype._markAsDirty = function () {
  16246. this._isDirty = true;
  16247. };
  16248. Skeleton.prototype.prepare = function () {
  16249. if (!this._isDirty) {
  16250. return;
  16251. }
  16252. if (!this._transformMatrices || this._transformMatrices.length !== 16 * (this.bones.length + 1)) {
  16253. this._transformMatrices = new Float32Array(16 * (this.bones.length + 1));
  16254. }
  16255. for (var index = 0; index < this.bones.length; index++) {
  16256. var bone = this.bones[index];
  16257. var parentBone = bone.getParent();
  16258. if (parentBone) {
  16259. bone.getLocalMatrix().multiplyToRef(parentBone.getWorldMatrix(), bone.getWorldMatrix());
  16260. }
  16261. else {
  16262. bone.getWorldMatrix().copyFrom(bone.getLocalMatrix());
  16263. }
  16264. bone.getInvertedAbsoluteTransform().multiplyToArray(bone.getWorldMatrix(), this._transformMatrices, index * 16);
  16265. }
  16266. this._identity.copyToArray(this._transformMatrices, this.bones.length * 16);
  16267. this._isDirty = false;
  16268. };
  16269. Skeleton.prototype.getAnimatables = function () {
  16270. if (!this._animatables || this._animatables.length != this.bones.length) {
  16271. this._animatables = [];
  16272. for (var index = 0; index < this.bones.length; index++) {
  16273. this._animatables.push(this.bones[index]);
  16274. }
  16275. }
  16276. return this._animatables;
  16277. };
  16278. Skeleton.prototype.clone = function (name, id) {
  16279. var result = new BABYLON.Skeleton(name, id || name, this._scene);
  16280. for (var index = 0; index < this.bones.length; index++) {
  16281. var source = this.bones[index];
  16282. var parentBone = null;
  16283. if (source.getParent()) {
  16284. var parentIndex = this.bones.indexOf(source.getParent());
  16285. parentBone = result.bones[parentIndex];
  16286. }
  16287. var bone = new BABYLON.Bone(source.name, result, parentBone, source.getBaseMatrix());
  16288. BABYLON.Tools.DeepCopy(source.animations, bone.animations);
  16289. }
  16290. return result;
  16291. };
  16292. return Skeleton;
  16293. })();
  16294. BABYLON.Skeleton = Skeleton;
  16295. })(BABYLON || (BABYLON = {}));
  16296. //# sourceMappingURL=babylon.skeleton.js.mapvar BABYLON;
  16297. (function (BABYLON) {
  16298. var PostProcess = (function () {
  16299. function PostProcess(name, fragmentUrl, parameters, samplers, ratio, camera, samplingMode, engine, reusable) {
  16300. this.name = name;
  16301. this.width = -1;
  16302. this.height = -1;
  16303. this._reusable = false;
  16304. this._textures = new BABYLON.SmartArray(2);
  16305. this._currentRenderTextureInd = 0;
  16306. if (camera != null) {
  16307. this._camera = camera;
  16308. this._scene = camera.getScene();
  16309. camera.attachPostProcess(this);
  16310. this._engine = this._scene.getEngine();
  16311. }
  16312. else {
  16313. this._engine = engine;
  16314. }
  16315. this._renderRatio = ratio;
  16316. this.renderTargetSamplingMode = samplingMode ? samplingMode : BABYLON.Texture.NEAREST_SAMPLINGMODE;
  16317. this._reusable = reusable || false;
  16318. samplers = samplers || [];
  16319. samplers.push("textureSampler");
  16320. this._effect = this._engine.createEffect({ vertex: "postprocess", fragment: fragmentUrl }, ["position"], parameters || [], samplers, "");
  16321. }
  16322. PostProcess.prototype.isReusable = function () {
  16323. return this._reusable;
  16324. };
  16325. PostProcess.prototype.activate = function (camera, sourceTexture) {
  16326. camera = camera || this._camera;
  16327. var scene = camera.getScene();
  16328. var maxSize = camera.getEngine().getCaps().maxTextureSize;
  16329. var desiredWidth = ((sourceTexture ? sourceTexture._width : this._engine.getRenderingCanvas().width) * this._renderRatio) | 0;
  16330. var desiredHeight = ((sourceTexture ? sourceTexture._height : this._engine.getRenderingCanvas().height) * this._renderRatio) | 0;
  16331. desiredWidth = BABYLON.Tools.GetExponantOfTwo(desiredWidth, maxSize);
  16332. desiredHeight = BABYLON.Tools.GetExponantOfTwo(desiredHeight, maxSize);
  16333. if (this.width !== desiredWidth || this.height !== desiredHeight) {
  16334. if (this._textures.length > 0) {
  16335. for (var i = 0; i < this._textures.length; i++) {
  16336. this._engine._releaseTexture(this._textures.data[i]);
  16337. }
  16338. this._textures.reset();
  16339. }
  16340. this.width = desiredWidth;
  16341. this.height = desiredHeight;
  16342. this._textures.push(this._engine.createRenderTargetTexture({ width: this.width, height: this.height }, { generateMipMaps: false, generateDepthBuffer: camera._postProcesses.indexOf(this) === camera._postProcessesTakenIndices[0], samplingMode: this.renderTargetSamplingMode }));
  16343. if (this._reusable) {
  16344. this._textures.push(this._engine.createRenderTargetTexture({ width: this.width, height: this.height }, { generateMipMaps: false, generateDepthBuffer: camera._postProcesses.indexOf(this) === camera._postProcessesTakenIndices[0], samplingMode: this.renderTargetSamplingMode }));
  16345. }
  16346. if (this.onSizeChanged) {
  16347. this.onSizeChanged();
  16348. }
  16349. }
  16350. this._engine.bindFramebuffer(this._textures.data[this._currentRenderTextureInd]);
  16351. if (this.onActivate) {
  16352. this.onActivate(camera);
  16353. }
  16354. // Clear
  16355. this._engine.clear(scene.clearColor, scene.autoClear || scene.forceWireframe, true);
  16356. if (this._reusable) {
  16357. this._currentRenderTextureInd = (this._currentRenderTextureInd + 1) % 2;
  16358. }
  16359. };
  16360. PostProcess.prototype.apply = function () {
  16361. // Check
  16362. if (!this._effect.isReady())
  16363. return null;
  16364. // States
  16365. this._engine.enableEffect(this._effect);
  16366. this._engine.setState(false);
  16367. this._engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  16368. this._engine.setDepthBuffer(false);
  16369. this._engine.setDepthWrite(false);
  16370. // Texture
  16371. this._effect._bindTexture("textureSampler", this._textures.data[this._currentRenderTextureInd]);
  16372. // Parameters
  16373. if (this.onApply) {
  16374. this.onApply(this._effect);
  16375. }
  16376. return this._effect;
  16377. };
  16378. PostProcess.prototype.dispose = function (camera) {
  16379. camera = camera || this._camera;
  16380. if (this._textures.length > 0) {
  16381. for (var i = 0; i < this._textures.length; i++) {
  16382. this._engine._releaseTexture(this._textures.data[i]);
  16383. }
  16384. this._textures.reset();
  16385. }
  16386. camera.detachPostProcess(this);
  16387. var index = camera._postProcesses.indexOf(this);
  16388. if (index === camera._postProcessesTakenIndices[0] && camera._postProcessesTakenIndices.length > 0) {
  16389. this._camera._postProcesses[camera._postProcessesTakenIndices[0]].width = -1; // invalidate frameBuffer to hint the postprocess to create a depth buffer
  16390. }
  16391. };
  16392. return PostProcess;
  16393. })();
  16394. BABYLON.PostProcess = PostProcess;
  16395. })(BABYLON || (BABYLON = {}));
  16396. //# sourceMappingURL=babylon.postProcess.js.mapvar BABYLON;
  16397. (function (BABYLON) {
  16398. var PostProcessManager = (function () {
  16399. function PostProcessManager(scene) {
  16400. this._vertexDeclaration = [2];
  16401. this._vertexStrideSize = 2 * 4;
  16402. this._scene = scene;
  16403. // VBO
  16404. var vertices = [];
  16405. vertices.push(1, 1);
  16406. vertices.push(-1, 1);
  16407. vertices.push(-1, -1);
  16408. vertices.push(1, -1);
  16409. this._vertexBuffer = scene.getEngine().createVertexBuffer(vertices);
  16410. // Indices
  16411. var indices = [];
  16412. indices.push(0);
  16413. indices.push(1);
  16414. indices.push(2);
  16415. indices.push(0);
  16416. indices.push(2);
  16417. indices.push(3);
  16418. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  16419. }
  16420. // Methods
  16421. PostProcessManager.prototype._prepareFrame = function (sourceTexture) {
  16422. var postProcesses = this._scene.activeCamera._postProcesses;
  16423. var postProcessesTakenIndices = this._scene.activeCamera._postProcessesTakenIndices;
  16424. if (postProcessesTakenIndices.length === 0 || !this._scene.postProcessesEnabled) {
  16425. return false;
  16426. }
  16427. postProcesses[this._scene.activeCamera._postProcessesTakenIndices[0]].activate(this._scene.activeCamera, sourceTexture);
  16428. return true;
  16429. };
  16430. PostProcessManager.prototype._finalizeFrame = function (doNotPresent, targetTexture) {
  16431. var postProcesses = this._scene.activeCamera._postProcesses;
  16432. var postProcessesTakenIndices = this._scene.activeCamera._postProcessesTakenIndices;
  16433. if (postProcessesTakenIndices.length === 0 || !this._scene.postProcessesEnabled) {
  16434. return;
  16435. }
  16436. var engine = this._scene.getEngine();
  16437. for (var index = 0; index < postProcessesTakenIndices.length; index++) {
  16438. if (index < postProcessesTakenIndices.length - 1) {
  16439. postProcesses[postProcessesTakenIndices[index + 1]].activate(this._scene.activeCamera);
  16440. }
  16441. else {
  16442. if (targetTexture) {
  16443. engine.bindFramebuffer(targetTexture);
  16444. }
  16445. else {
  16446. engine.restoreDefaultFramebuffer();
  16447. }
  16448. }
  16449. if (doNotPresent) {
  16450. break;
  16451. }
  16452. var pp = postProcesses[postProcessesTakenIndices[index]];
  16453. var effect = pp.apply();
  16454. if (effect) {
  16455. if (pp.onBeforeRender) {
  16456. pp.onBeforeRender(effect);
  16457. }
  16458. // VBOs
  16459. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, effect);
  16460. // Draw order
  16461. engine.draw(true, 0, 6);
  16462. }
  16463. }
  16464. // Restore depth buffer
  16465. engine.setDepthBuffer(true);
  16466. engine.setDepthWrite(true);
  16467. };
  16468. PostProcessManager.prototype.dispose = function () {
  16469. if (this._vertexBuffer) {
  16470. this._scene.getEngine()._releaseBuffer(this._vertexBuffer);
  16471. this._vertexBuffer = null;
  16472. }
  16473. if (this._indexBuffer) {
  16474. this._scene.getEngine()._releaseBuffer(this._indexBuffer);
  16475. this._indexBuffer = null;
  16476. }
  16477. };
  16478. return PostProcessManager;
  16479. })();
  16480. BABYLON.PostProcessManager = PostProcessManager;
  16481. })(BABYLON || (BABYLON = {}));
  16482. //# sourceMappingURL=babylon.postProcessManager.js.map
  16483. var BABYLON;
  16484. (function (BABYLON) {
  16485. var PassPostProcess = (function (_super) {
  16486. __extends(PassPostProcess, _super);
  16487. function PassPostProcess(name, ratio, camera, samplingMode, engine, reusable) {
  16488. _super.call(this, name, "pass", null, null, ratio, camera, samplingMode, engine, reusable);
  16489. }
  16490. return PassPostProcess;
  16491. })(BABYLON.PostProcess);
  16492. BABYLON.PassPostProcess = PassPostProcess;
  16493. })(BABYLON || (BABYLON = {}));
  16494. //# sourceMappingURL=babylon.passPostProcess.js.map
  16495. var BABYLON;
  16496. (function (BABYLON) {
  16497. var BlurPostProcess = (function (_super) {
  16498. __extends(BlurPostProcess, _super);
  16499. function BlurPostProcess(name, direction, blurWidth, ratio, camera, samplingMode, engine, reusable) {
  16500. var _this = this;
  16501. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.BILINEAR_SAMPLINGMODE; }
  16502. _super.call(this, name, "blur", ["screenSize", "direction", "blurWidth"], null, ratio, camera, samplingMode, engine, reusable);
  16503. this.direction = direction;
  16504. this.blurWidth = blurWidth;
  16505. this.onApply = function (effect) {
  16506. effect.setFloat2("screenSize", _this.width, _this.height);
  16507. effect.setVector2("direction", _this.direction);
  16508. effect.setFloat("blurWidth", _this.blurWidth);
  16509. };
  16510. }
  16511. return BlurPostProcess;
  16512. })(BABYLON.PostProcess);
  16513. BABYLON.BlurPostProcess = BlurPostProcess;
  16514. })(BABYLON || (BABYLON = {}));
  16515. //# sourceMappingURL=babylon.blurPostProcess.js.map
  16516. var BABYLON;
  16517. (function (BABYLON) {
  16518. var FilterPostProcess = (function (_super) {
  16519. __extends(FilterPostProcess, _super);
  16520. function FilterPostProcess(name, kernelMatrix, ratio, camera, samplingMode, engine, reusable) {
  16521. var _this = this;
  16522. _super.call(this, name, "filter", ["kernelMatrix"], null, ratio, camera, samplingMode, engine, reusable);
  16523. this.kernelMatrix = kernelMatrix;
  16524. this.onApply = function (effect) {
  16525. effect.setMatrix("kernelMatrix", _this.kernelMatrix);
  16526. };
  16527. }
  16528. return FilterPostProcess;
  16529. })(BABYLON.PostProcess);
  16530. BABYLON.FilterPostProcess = FilterPostProcess;
  16531. })(BABYLON || (BABYLON = {}));
  16532. //# sourceMappingURL=babylon.filterPostProcess.js.map
  16533. var BABYLON;
  16534. (function (BABYLON) {
  16535. var RefractionPostProcess = (function (_super) {
  16536. __extends(RefractionPostProcess, _super);
  16537. function RefractionPostProcess(name, refractionTextureUrl, color, depth, colorLevel, ratio, camera, samplingMode, engine, reusable) {
  16538. var _this = this;
  16539. _super.call(this, name, "refraction", ["baseColor", "depth", "colorLevel"], ["refractionSampler"], ratio, camera, samplingMode, engine, reusable);
  16540. this.color = color;
  16541. this.depth = depth;
  16542. this.colorLevel = colorLevel;
  16543. this.onActivate = function (cam) {
  16544. _this._refRexture = _this._refRexture || new BABYLON.Texture(refractionTextureUrl, cam.getScene());
  16545. };
  16546. this.onApply = function (effect) {
  16547. effect.setColor3("baseColor", _this.color);
  16548. effect.setFloat("depth", _this.depth);
  16549. effect.setFloat("colorLevel", _this.colorLevel);
  16550. effect.setTexture("refractionSampler", _this._refRexture);
  16551. };
  16552. }
  16553. // Methods
  16554. RefractionPostProcess.prototype.dispose = function (camera) {
  16555. if (this._refRexture) {
  16556. this._refRexture.dispose();
  16557. }
  16558. _super.prototype.dispose.call(this, camera);
  16559. };
  16560. return RefractionPostProcess;
  16561. })(BABYLON.PostProcess);
  16562. BABYLON.RefractionPostProcess = RefractionPostProcess;
  16563. })(BABYLON || (BABYLON = {}));
  16564. //# sourceMappingURL=babylon.refractionPostProcess.js.map
  16565. var BABYLON;
  16566. (function (BABYLON) {
  16567. var BlackAndWhitePostProcess = (function (_super) {
  16568. __extends(BlackAndWhitePostProcess, _super);
  16569. function BlackAndWhitePostProcess(name, ratio, camera, samplingMode, engine, reusable) {
  16570. _super.call(this, name, "blackAndWhite", null, null, ratio, camera, samplingMode, engine, reusable);
  16571. }
  16572. return BlackAndWhitePostProcess;
  16573. })(BABYLON.PostProcess);
  16574. BABYLON.BlackAndWhitePostProcess = BlackAndWhitePostProcess;
  16575. })(BABYLON || (BABYLON = {}));
  16576. //# sourceMappingURL=babylon.blackAndWhitePostProcess.js.map
  16577. var BABYLON;
  16578. (function (BABYLON) {
  16579. var ConvolutionPostProcess = (function (_super) {
  16580. __extends(ConvolutionPostProcess, _super);
  16581. function ConvolutionPostProcess(name, kernel, ratio, camera, samplingMode, engine, reusable) {
  16582. var _this = this;
  16583. _super.call(this, name, "convolution", ["kernel", "screenSize"], null, ratio, camera, samplingMode, engine, reusable);
  16584. this.kernel = kernel;
  16585. this.onApply = function (effect) {
  16586. effect.setFloat2("screenSize", _this.width, _this.height);
  16587. effect.setArray("kernel", _this.kernel);
  16588. };
  16589. }
  16590. // Statics
  16591. // Based on http://en.wikipedia.org/wiki/Kernel_(image_processing)
  16592. ConvolutionPostProcess.EdgeDetect0Kernel = [1, 0, -1, 0, 0, 0, -1, 0, 1];
  16593. ConvolutionPostProcess.EdgeDetect1Kernel = [0, 1, 0, 1, -4, 1, 0, 1, 0];
  16594. ConvolutionPostProcess.EdgeDetect2Kernel = [-1, -1, -1, -1, 8, -1, -1, -1, -1];
  16595. ConvolutionPostProcess.SharpenKernel = [0, -1, 0, -1, 5, -1, 0, -1, 0];
  16596. ConvolutionPostProcess.EmbossKernel = [-2, -1, 0, -1, 1, 1, 0, 1, 2];
  16597. ConvolutionPostProcess.GaussianKernel = [0, 1, 0, 1, 1, 1, 0, 1, 0];
  16598. return ConvolutionPostProcess;
  16599. })(BABYLON.PostProcess);
  16600. BABYLON.ConvolutionPostProcess = ConvolutionPostProcess;
  16601. })(BABYLON || (BABYLON = {}));
  16602. //# sourceMappingURL=babylon.convolutionPostProcess.js.map
  16603. var BABYLON;
  16604. (function (BABYLON) {
  16605. var FxaaPostProcess = (function (_super) {
  16606. __extends(FxaaPostProcess, _super);
  16607. function FxaaPostProcess(name, ratio, camera, samplingMode, engine, reusable) {
  16608. var _this = this;
  16609. _super.call(this, name, "fxaa", ["texelSize"], null, ratio, camera, samplingMode, engine, reusable);
  16610. this.onSizeChanged = function () {
  16611. _this.texelWidth = 1.0 / _this.width;
  16612. _this.texelHeight = 1.0 / _this.height;
  16613. };
  16614. this.onApply = function (effect) {
  16615. effect.setFloat2("texelSize", _this.texelWidth, _this.texelHeight);
  16616. };
  16617. }
  16618. return FxaaPostProcess;
  16619. })(BABYLON.PostProcess);
  16620. BABYLON.FxaaPostProcess = FxaaPostProcess;
  16621. })(BABYLON || (BABYLON = {}));
  16622. //# sourceMappingURL=babylon.fxaaPostProcess.js.mapvar BABYLON;
  16623. (function (BABYLON) {
  16624. var LensFlare = (function () {
  16625. function LensFlare(size, position, color, imgUrl, system) {
  16626. this.size = size;
  16627. this.position = position;
  16628. this.dispose = function () {
  16629. if (this.texture) {
  16630. this.texture.dispose();
  16631. }
  16632. // Remove from scene
  16633. var index = this._system.lensFlares.indexOf(this);
  16634. this._system.lensFlares.splice(index, 1);
  16635. };
  16636. this.color = color || new BABYLON.Color3(1, 1, 1);
  16637. this.texture = imgUrl ? new BABYLON.Texture(imgUrl, system.getScene(), true) : null;
  16638. this._system = system;
  16639. system.lensFlares.push(this);
  16640. }
  16641. return LensFlare;
  16642. })();
  16643. BABYLON.LensFlare = LensFlare;
  16644. })(BABYLON || (BABYLON = {}));
  16645. //# sourceMappingURL=babylon.lensFlare.js.mapvar BABYLON;
  16646. (function (BABYLON) {
  16647. var LensFlareSystem = (function () {
  16648. function LensFlareSystem(name, emitter, scene) {
  16649. this.name = name;
  16650. this.lensFlares = new Array();
  16651. this.borderLimit = 300;
  16652. this._vertexDeclaration = [2];
  16653. this._vertexStrideSize = 2 * 4;
  16654. this._isEnabled = true;
  16655. this._scene = scene;
  16656. this._emitter = emitter;
  16657. scene.lensFlareSystems.push(this);
  16658. this.meshesSelectionPredicate = function (m) { return m.material && m.isVisible && m.isEnabled() && m.isBlocker && ((m.layerMask & scene.activeCamera.layerMask) != 0); };
  16659. // VBO
  16660. var vertices = [];
  16661. vertices.push(1, 1);
  16662. vertices.push(-1, 1);
  16663. vertices.push(-1, -1);
  16664. vertices.push(1, -1);
  16665. this._vertexBuffer = scene.getEngine().createVertexBuffer(vertices);
  16666. // Indices
  16667. var indices = [];
  16668. indices.push(0);
  16669. indices.push(1);
  16670. indices.push(2);
  16671. indices.push(0);
  16672. indices.push(2);
  16673. indices.push(3);
  16674. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  16675. // Effects
  16676. this._effect = this._scene.getEngine().createEffect("lensFlare", ["position"], ["color", "viewportMatrix"], ["textureSampler"], "");
  16677. }
  16678. Object.defineProperty(LensFlareSystem.prototype, "isEnabled", {
  16679. get: function () {
  16680. return this._isEnabled;
  16681. },
  16682. set: function (value) {
  16683. this._isEnabled = value;
  16684. },
  16685. enumerable: true,
  16686. configurable: true
  16687. });
  16688. LensFlareSystem.prototype.getScene = function () {
  16689. return this._scene;
  16690. };
  16691. LensFlareSystem.prototype.getEmitter = function () {
  16692. return this._emitter;
  16693. };
  16694. LensFlareSystem.prototype.getEmitterPosition = function () {
  16695. return this._emitter.getAbsolutePosition ? this._emitter.getAbsolutePosition() : this._emitter.position;
  16696. };
  16697. LensFlareSystem.prototype.computeEffectivePosition = function (globalViewport) {
  16698. var position = this.getEmitterPosition();
  16699. position = BABYLON.Vector3.Project(position, BABYLON.Matrix.Identity(), this._scene.getTransformMatrix(), globalViewport);
  16700. this._positionX = position.x;
  16701. this._positionY = position.y;
  16702. position = BABYLON.Vector3.TransformCoordinates(this.getEmitterPosition(), this._scene.getViewMatrix());
  16703. if (position.z > 0) {
  16704. if ((this._positionX > globalViewport.x) && (this._positionX < globalViewport.x + globalViewport.width)) {
  16705. if ((this._positionY > globalViewport.y) && (this._positionY < globalViewport.y + globalViewport.height))
  16706. return true;
  16707. }
  16708. }
  16709. return false;
  16710. };
  16711. LensFlareSystem.prototype._isVisible = function () {
  16712. if (!this._isEnabled) {
  16713. return false;
  16714. }
  16715. var emitterPosition = this.getEmitterPosition();
  16716. var direction = emitterPosition.subtract(this._scene.activeCamera.position);
  16717. var distance = direction.length();
  16718. direction.normalize();
  16719. var ray = new BABYLON.Ray(this._scene.activeCamera.position, direction);
  16720. var pickInfo = this._scene.pickWithRay(ray, this.meshesSelectionPredicate, true);
  16721. return !pickInfo.hit || pickInfo.distance > distance;
  16722. };
  16723. LensFlareSystem.prototype.render = function () {
  16724. if (!this._effect.isReady())
  16725. return false;
  16726. var engine = this._scene.getEngine();
  16727. var viewport = this._scene.activeCamera.viewport;
  16728. var globalViewport = viewport.toGlobal(engine);
  16729. // Position
  16730. if (!this.computeEffectivePosition(globalViewport)) {
  16731. return false;
  16732. }
  16733. // Visibility
  16734. if (!this._isVisible()) {
  16735. return false;
  16736. }
  16737. // Intensity
  16738. var awayX;
  16739. var awayY;
  16740. if (this._positionX < this.borderLimit + globalViewport.x) {
  16741. awayX = this.borderLimit + globalViewport.x - this._positionX;
  16742. }
  16743. else if (this._positionX > globalViewport.x + globalViewport.width - this.borderLimit) {
  16744. awayX = this._positionX - globalViewport.x - globalViewport.width + this.borderLimit;
  16745. }
  16746. else {
  16747. awayX = 0;
  16748. }
  16749. if (this._positionY < this.borderLimit + globalViewport.y) {
  16750. awayY = this.borderLimit + globalViewport.y - this._positionY;
  16751. }
  16752. else if (this._positionY > globalViewport.y + globalViewport.height - this.borderLimit) {
  16753. awayY = this._positionY - globalViewport.y - globalViewport.height + this.borderLimit;
  16754. }
  16755. else {
  16756. awayY = 0;
  16757. }
  16758. var away = (awayX > awayY) ? awayX : awayY;
  16759. if (away > this.borderLimit) {
  16760. away = this.borderLimit;
  16761. }
  16762. var intensity = 1.0 - (away / this.borderLimit);
  16763. if (intensity < 0) {
  16764. return false;
  16765. }
  16766. if (intensity > 1.0) {
  16767. intensity = 1.0;
  16768. }
  16769. // Position
  16770. var centerX = globalViewport.x + globalViewport.width / 2;
  16771. var centerY = globalViewport.y + globalViewport.height / 2;
  16772. var distX = centerX - this._positionX;
  16773. var distY = centerY - this._positionY;
  16774. // Effects
  16775. engine.enableEffect(this._effect);
  16776. engine.setState(false);
  16777. engine.setDepthBuffer(false);
  16778. engine.setAlphaMode(BABYLON.Engine.ALPHA_ADD);
  16779. // VBOs
  16780. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, this._effect);
  16781. for (var index = 0; index < this.lensFlares.length; index++) {
  16782. var flare = this.lensFlares[index];
  16783. var x = centerX - (distX * flare.position);
  16784. var y = centerY - (distY * flare.position);
  16785. var cw = flare.size;
  16786. var ch = flare.size * engine.getAspectRatio(this._scene.activeCamera);
  16787. var cx = 2 * (x / globalViewport.width) - 1.0;
  16788. var cy = 1.0 - 2 * (y / globalViewport.height);
  16789. var viewportMatrix = BABYLON.Matrix.FromValues(cw / 2, 0, 0, 0, 0, ch / 2, 0, 0, 0, 0, 1, 0, cx, cy, 0, 1);
  16790. this._effect.setMatrix("viewportMatrix", viewportMatrix);
  16791. // Texture
  16792. this._effect.setTexture("textureSampler", flare.texture);
  16793. // Color
  16794. this._effect.setFloat4("color", flare.color.r * intensity, flare.color.g * intensity, flare.color.b * intensity, 1.0);
  16795. // Draw order
  16796. engine.draw(true, 0, 6);
  16797. }
  16798. engine.setDepthBuffer(true);
  16799. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  16800. return true;
  16801. };
  16802. LensFlareSystem.prototype.dispose = function () {
  16803. if (this._vertexBuffer) {
  16804. this._scene.getEngine()._releaseBuffer(this._vertexBuffer);
  16805. this._vertexBuffer = null;
  16806. }
  16807. if (this._indexBuffer) {
  16808. this._scene.getEngine()._releaseBuffer(this._indexBuffer);
  16809. this._indexBuffer = null;
  16810. }
  16811. while (this.lensFlares.length) {
  16812. this.lensFlares[0].dispose();
  16813. }
  16814. // Remove from scene
  16815. var index = this._scene.lensFlareSystems.indexOf(this);
  16816. this._scene.lensFlareSystems.splice(index, 1);
  16817. };
  16818. return LensFlareSystem;
  16819. })();
  16820. BABYLON.LensFlareSystem = LensFlareSystem;
  16821. })(BABYLON || (BABYLON = {}));
  16822. //# sourceMappingURL=babylon.lensFlareSystem.js.mapvar BABYLON;
  16823. (function (BABYLON) {
  16824. var IntersectionInfo = (function () {
  16825. function IntersectionInfo(bu, bv, distance) {
  16826. this.bu = bu;
  16827. this.bv = bv;
  16828. this.distance = distance;
  16829. this.faceId = 0;
  16830. }
  16831. return IntersectionInfo;
  16832. })();
  16833. BABYLON.IntersectionInfo = IntersectionInfo;
  16834. var PickingInfo = (function () {
  16835. function PickingInfo() {
  16836. this.hit = false;
  16837. this.distance = 0;
  16838. this.pickedPoint = null;
  16839. this.pickedMesh = null;
  16840. this.bu = 0;
  16841. this.bv = 0;
  16842. this.faceId = -1;
  16843. }
  16844. // Methods
  16845. PickingInfo.prototype.getNormal = function () {
  16846. if (!this.pickedMesh || !this.pickedMesh.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) {
  16847. return null;
  16848. }
  16849. var indices = this.pickedMesh.getIndices();
  16850. var normals = this.pickedMesh.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  16851. var normal0 = BABYLON.Vector3.FromArray(normals, indices[this.faceId * 3] * 3);
  16852. var normal1 = BABYLON.Vector3.FromArray(normals, indices[this.faceId * 3 + 1] * 3);
  16853. var normal2 = BABYLON.Vector3.FromArray(normals, indices[this.faceId * 3 + 2] * 3);
  16854. normal0 = normal0.scale(this.bu);
  16855. normal1 = normal1.scale(this.bv);
  16856. normal2 = normal2.scale(1.0 - this.bu - this.bv);
  16857. return new BABYLON.Vector3(normal0.x + normal1.x + normal2.x, normal0.y + normal1.y + normal2.y, normal0.z + normal1.z + normal2.z);
  16858. };
  16859. PickingInfo.prototype.getTextureCoordinates = function () {
  16860. if (!this.pickedMesh || !this.pickedMesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  16861. return null;
  16862. }
  16863. var indices = this.pickedMesh.getIndices();
  16864. var uvs = this.pickedMesh.getVerticesData(BABYLON.VertexBuffer.UVKind);
  16865. var uv0 = BABYLON.Vector2.FromArray(uvs, indices[this.faceId * 3] * 2);
  16866. var uv1 = BABYLON.Vector2.FromArray(uvs, indices[this.faceId * 3 + 1] * 2);
  16867. var uv2 = BABYLON.Vector2.FromArray(uvs, indices[this.faceId * 3 + 2] * 2);
  16868. uv0 = uv0.scale(this.bu);
  16869. uv1 = uv1.scale(this.bv);
  16870. uv2 = uv2.scale(1.0 - this.bu - this.bv);
  16871. return new BABYLON.Vector2(uv0.x + uv1.x + uv2.x, uv0.y + uv1.y + uv2.y);
  16872. };
  16873. return PickingInfo;
  16874. })();
  16875. BABYLON.PickingInfo = PickingInfo;
  16876. })(BABYLON || (BABYLON = {}));
  16877. //# sourceMappingURL=babylon.pickingInfo.js.mapvar BABYLON;
  16878. (function (BABYLON) {
  16879. var FilesInput = (function () {
  16880. /// Register to core BabylonJS object: engine, scene, rendering canvas, callback function when the scene will be loaded,
  16881. /// loading progress callback and optionnal addionnal logic to call in the rendering loop
  16882. function FilesInput(p_engine, p_scene, p_canvas, p_sceneLoadedCallback, p_progressCallback, p_additionnalRenderLoopLogicCallback, p_textureLoadingCallback, p_startingProcessingFilesCallback) {
  16883. this.engine = p_engine;
  16884. this.canvas = p_canvas;
  16885. this.currentScene = p_scene;
  16886. this.sceneLoadedCallback = p_sceneLoadedCallback;
  16887. this.progressCallback = p_progressCallback;
  16888. this.additionnalRenderLoopLogicCallback = p_additionnalRenderLoopLogicCallback;
  16889. this.textureLoadingCallback = p_textureLoadingCallback;
  16890. this.startingProcessingFilesCallback = p_startingProcessingFilesCallback;
  16891. }
  16892. FilesInput.prototype.monitorElementForDragNDrop = function (p_elementToMonitor) {
  16893. var _this = this;
  16894. if (p_elementToMonitor) {
  16895. this.elementToMonitor = p_elementToMonitor;
  16896. this.elementToMonitor.addEventListener("dragenter", function (e) {
  16897. _this.drag(e);
  16898. }, false);
  16899. this.elementToMonitor.addEventListener("dragover", function (e) {
  16900. _this.drag(e);
  16901. }, false);
  16902. this.elementToMonitor.addEventListener("drop", function (e) {
  16903. _this.drop(e);
  16904. }, false);
  16905. }
  16906. };
  16907. FilesInput.prototype.renderFunction = function () {
  16908. if (this.additionnalRenderLoopLogicCallback) {
  16909. this.additionnalRenderLoopLogicCallback();
  16910. }
  16911. if (this.currentScene) {
  16912. if (this.textureLoadingCallback) {
  16913. var remaining = this.currentScene.getWaitingItemsCount();
  16914. if (remaining > 0) {
  16915. this.textureLoadingCallback(remaining);
  16916. }
  16917. }
  16918. this.currentScene.render();
  16919. }
  16920. };
  16921. FilesInput.prototype.drag = function (e) {
  16922. e.stopPropagation();
  16923. e.preventDefault();
  16924. };
  16925. FilesInput.prototype.drop = function (eventDrop) {
  16926. eventDrop.stopPropagation();
  16927. eventDrop.preventDefault();
  16928. this.loadFiles(eventDrop);
  16929. };
  16930. FilesInput.prototype.loadFiles = function (event) {
  16931. var _this = this;
  16932. var that = this;
  16933. if (this.startingProcessingFilesCallback)
  16934. this.startingProcessingFilesCallback();
  16935. var sceneFileToLoad;
  16936. var filesToLoad;
  16937. // Handling data transfer via drag'n'drop
  16938. if (event && event.dataTransfer && event.dataTransfer.files) {
  16939. filesToLoad = event.dataTransfer.files;
  16940. }
  16941. // Handling files from input files
  16942. if (event && event.target && event.target.files) {
  16943. filesToLoad = event.target.files;
  16944. }
  16945. if (filesToLoad && filesToLoad.length > 0) {
  16946. for (var i = 0; i < filesToLoad.length; i++) {
  16947. switch (filesToLoad[i].type) {
  16948. case "image/jpeg":
  16949. case "image/png":
  16950. BABYLON.FilesInput.FilesTextures[filesToLoad[i].name] = filesToLoad[i];
  16951. break;
  16952. case "image/targa":
  16953. case "image/vnd.ms-dds":
  16954. case "audio/wav":
  16955. case "audio/x-wav":
  16956. case "audio/mp3":
  16957. case "audio/mpeg":
  16958. case "audio/mpeg3":
  16959. case "audio/x-mpeg-3":
  16960. case "audio/ogg":
  16961. BABYLON.FilesInput.FilesToLoad[filesToLoad[i].name] = filesToLoad[i];
  16962. break;
  16963. default:
  16964. if (filesToLoad[i].name.indexOf(".babylon") !== -1 && filesToLoad[i].name.indexOf(".manifest") === -1 && filesToLoad[i].name.indexOf(".incremental") === -1 && filesToLoad[i].name.indexOf(".babylonmeshdata") === -1 && filesToLoad[i].name.indexOf(".babylongeometrydata") === -1) {
  16965. sceneFileToLoad = filesToLoad[i];
  16966. }
  16967. break;
  16968. }
  16969. }
  16970. // If a ".babylon" file has been provided
  16971. if (sceneFileToLoad) {
  16972. if (this.currentScene) {
  16973. this.engine.stopRenderLoop();
  16974. this.currentScene.dispose();
  16975. }
  16976. BABYLON.SceneLoader.Load("file:", sceneFileToLoad, this.engine, function (newScene) {
  16977. that.currentScene = newScene;
  16978. // Wait for textures and shaders to be ready
  16979. that.currentScene.executeWhenReady(function () {
  16980. // Attach camera to canvas inputs
  16981. if (that.currentScene.activeCamera) {
  16982. that.currentScene.activeCamera.attachControl(that.canvas);
  16983. }
  16984. if (that.sceneLoadedCallback) {
  16985. that.sceneLoadedCallback(sceneFileToLoad, that.currentScene);
  16986. }
  16987. that.engine.runRenderLoop(function () {
  16988. that.renderFunction();
  16989. });
  16990. });
  16991. }, function (progress) {
  16992. if (_this.progressCallback) {
  16993. _this.progressCallback(progress);
  16994. }
  16995. });
  16996. }
  16997. else {
  16998. BABYLON.Tools.Error("Please provide a valid .babylon file.");
  16999. }
  17000. }
  17001. };
  17002. FilesInput.FilesTextures = new Array();
  17003. FilesInput.FilesToLoad = new Array();
  17004. return FilesInput;
  17005. })();
  17006. BABYLON.FilesInput = FilesInput;
  17007. })(BABYLON || (BABYLON = {}));
  17008. //# sourceMappingURL=babylon.filesInput.js.mapvar BABYLON;
  17009. (function (BABYLON) {
  17010. var OimoJSPlugin = (function () {
  17011. function OimoJSPlugin() {
  17012. this._registeredMeshes = [];
  17013. /**
  17014. * Update the body position according to the mesh position
  17015. * @param mesh
  17016. */
  17017. this.updateBodyPosition = function (mesh) {
  17018. for (var index = 0; index < this._registeredMeshes.length; index++) {
  17019. var registeredMesh = this._registeredMeshes[index];
  17020. if (registeredMesh.mesh === mesh || registeredMesh.mesh === mesh.parent) {
  17021. var body = registeredMesh.body.body;
  17022. mesh.computeWorldMatrix(true);
  17023. var center = mesh.getBoundingInfo().boundingBox.center;
  17024. body.setPosition(center.x, center.y, center.z);
  17025. body.setRotation(mesh.rotation.x, mesh.rotation.y, mesh.rotation.z);
  17026. return;
  17027. }
  17028. // Case where the parent has been updated
  17029. if (registeredMesh.mesh.parent === mesh) {
  17030. mesh.computeWorldMatrix(true);
  17031. registeredMesh.mesh.computeWorldMatrix(true);
  17032. var absolutePosition = registeredMesh.mesh.getAbsolutePosition();
  17033. var absoluteRotation = mesh.rotation;
  17034. body = registeredMesh.body.body;
  17035. body.setPosition(absolutePosition.x, absolutePosition.y, absolutePosition.z);
  17036. body.setRotation(absoluteRotation.x, absoluteRotation.y, absoluteRotation.z);
  17037. return;
  17038. }
  17039. }
  17040. };
  17041. }
  17042. OimoJSPlugin.prototype._checkWithEpsilon = function (value) {
  17043. return value < BABYLON.PhysicsEngine.Epsilon ? BABYLON.PhysicsEngine.Epsilon : value;
  17044. };
  17045. OimoJSPlugin.prototype.initialize = function (iterations) {
  17046. this._world = new OIMO.World();
  17047. this._world.clear();
  17048. };
  17049. OimoJSPlugin.prototype.setGravity = function (gravity) {
  17050. this._world.gravity = gravity;
  17051. };
  17052. OimoJSPlugin.prototype.registerMesh = function (mesh, impostor, options) {
  17053. var body = null;
  17054. this.unregisterMesh(mesh);
  17055. mesh.computeWorldMatrix(true);
  17056. switch (impostor) {
  17057. case BABYLON.PhysicsEngine.SphereImpostor:
  17058. var initialRotation = null;
  17059. if (mesh.rotationQuaternion) {
  17060. initialRotation = mesh.rotationQuaternion.clone();
  17061. mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1);
  17062. mesh.computeWorldMatrix(true);
  17063. }
  17064. var bbox = mesh.getBoundingInfo().boundingBox;
  17065. var radiusX = bbox.maximumWorld.x - bbox.minimumWorld.x;
  17066. var radiusY = bbox.maximumWorld.y - bbox.minimumWorld.y;
  17067. var radiusZ = bbox.maximumWorld.z - bbox.minimumWorld.z;
  17068. var size = Math.max(this._checkWithEpsilon(radiusX), this._checkWithEpsilon(radiusY), this._checkWithEpsilon(radiusZ)) / 2;
  17069. // The delta between the mesh position and the mesh bounding box center
  17070. var deltaPosition = mesh.position.subtract(bbox.center);
  17071. // Transform delta position with the rotation
  17072. if (initialRotation) {
  17073. var m = new BABYLON.Matrix();
  17074. initialRotation.toRotationMatrix(m);
  17075. deltaPosition = BABYLON.Vector3.TransformCoordinates(deltaPosition, m);
  17076. }
  17077. body = new OIMO.Body({
  17078. type: 'sphere',
  17079. size: [size],
  17080. pos: [bbox.center.x, bbox.center.y, bbox.center.z],
  17081. rot: [mesh.rotation.x / OIMO.TO_RAD, mesh.rotation.y / OIMO.TO_RAD, mesh.rotation.z / OIMO.TO_RAD],
  17082. move: options.mass != 0,
  17083. config: [options.mass, options.friction, options.restitution],
  17084. world: this._world
  17085. });
  17086. // Restore rotation
  17087. if (initialRotation) {
  17088. body.setQuaternion(initialRotation);
  17089. }
  17090. this._registeredMeshes.push({
  17091. mesh: mesh,
  17092. body: body,
  17093. delta: deltaPosition
  17094. });
  17095. break;
  17096. case BABYLON.PhysicsEngine.PlaneImpostor:
  17097. case BABYLON.PhysicsEngine.BoxImpostor:
  17098. initialRotation = null;
  17099. if (mesh.rotationQuaternion) {
  17100. initialRotation = mesh.rotationQuaternion.clone();
  17101. mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1);
  17102. mesh.computeWorldMatrix(true);
  17103. }
  17104. bbox = mesh.getBoundingInfo().boundingBox;
  17105. var min = bbox.minimumWorld;
  17106. var max = bbox.maximumWorld;
  17107. var box = max.subtract(min);
  17108. var sizeX = this._checkWithEpsilon(box.x);
  17109. var sizeY = this._checkWithEpsilon(box.y);
  17110. var sizeZ = this._checkWithEpsilon(box.z);
  17111. // The delta between the mesh position and the mesh boudning box center
  17112. deltaPosition = mesh.position.subtract(bbox.center);
  17113. // Transform delta position with the rotation
  17114. if (initialRotation) {
  17115. m = new BABYLON.Matrix();
  17116. initialRotation.toRotationMatrix(m);
  17117. deltaPosition = BABYLON.Vector3.TransformCoordinates(deltaPosition, m);
  17118. }
  17119. body = new OIMO.Body({
  17120. type: 'box',
  17121. size: [sizeX, sizeY, sizeZ],
  17122. pos: [bbox.center.x, bbox.center.y, bbox.center.z],
  17123. rot: [mesh.rotation.x / OIMO.TO_RAD, mesh.rotation.y / OIMO.TO_RAD, mesh.rotation.z / OIMO.TO_RAD],
  17124. move: options.mass != 0,
  17125. config: [options.mass, options.friction, options.restitution],
  17126. world: this._world
  17127. });
  17128. if (initialRotation) {
  17129. body.setQuaternion(initialRotation);
  17130. }
  17131. this._registeredMeshes.push({
  17132. mesh: mesh,
  17133. body: body,
  17134. delta: deltaPosition
  17135. });
  17136. break;
  17137. }
  17138. return body;
  17139. };
  17140. OimoJSPlugin.prototype.registerMeshesAsCompound = function (parts, options) {
  17141. var types = [], sizes = [], positions = [], rotations = [];
  17142. var initialMesh = parts[0].mesh;
  17143. for (var index = 0; index < parts.length; index++) {
  17144. var part = parts[index];
  17145. var bodyParameters = this._createBodyAsCompound(part, options, initialMesh);
  17146. types.push(bodyParameters.type);
  17147. sizes.push.apply(sizes, bodyParameters.size);
  17148. positions.push.apply(positions, bodyParameters.pos);
  17149. rotations.push.apply(rotations, bodyParameters.rot);
  17150. }
  17151. var body = new OIMO.Body({
  17152. type: types,
  17153. size: sizes,
  17154. pos: positions,
  17155. rot: rotations,
  17156. move: options.mass != 0,
  17157. config: [options.mass, options.friction, options.restitution],
  17158. world: this._world
  17159. });
  17160. this._registeredMeshes.push({
  17161. mesh: initialMesh,
  17162. body: body
  17163. });
  17164. return body;
  17165. };
  17166. OimoJSPlugin.prototype._createBodyAsCompound = function (part, options, initialMesh) {
  17167. var bodyParameters = null;
  17168. var mesh = part.mesh;
  17169. // We need the bounding box/sphere info to compute the physics body
  17170. mesh.computeWorldMatrix();
  17171. switch (part.impostor) {
  17172. case BABYLON.PhysicsEngine.SphereImpostor:
  17173. var bbox = mesh.getBoundingInfo().boundingBox;
  17174. var radiusX = bbox.maximumWorld.x - bbox.minimumWorld.x;
  17175. var radiusY = bbox.maximumWorld.y - bbox.minimumWorld.y;
  17176. var radiusZ = bbox.maximumWorld.z - bbox.minimumWorld.z;
  17177. var size = Math.max(this._checkWithEpsilon(radiusX), this._checkWithEpsilon(radiusY), this._checkWithEpsilon(radiusZ)) / 2;
  17178. bodyParameters = {
  17179. type: 'sphere',
  17180. /* bug with oimo : sphere needs 3 sizes in this case */
  17181. size: [size, -1, -1],
  17182. pos: [mesh.position.x, mesh.position.y, mesh.position.z],
  17183. rot: [mesh.rotation.x / OIMO.TO_RAD, mesh.rotation.y / OIMO.TO_RAD, mesh.rotation.z / OIMO.TO_RAD]
  17184. };
  17185. break;
  17186. case BABYLON.PhysicsEngine.PlaneImpostor:
  17187. case BABYLON.PhysicsEngine.BoxImpostor:
  17188. bbox = mesh.getBoundingInfo().boundingBox;
  17189. var min = bbox.minimumWorld;
  17190. var max = bbox.maximumWorld;
  17191. var box = max.subtract(min);
  17192. var sizeX = this._checkWithEpsilon(box.x);
  17193. var sizeY = this._checkWithEpsilon(box.y);
  17194. var sizeZ = this._checkWithEpsilon(box.z);
  17195. var relativePosition = mesh.position;
  17196. bodyParameters = {
  17197. type: 'box',
  17198. size: [sizeX, sizeY, sizeZ],
  17199. pos: [relativePosition.x, relativePosition.y, relativePosition.z],
  17200. rot: [mesh.rotation.x / OIMO.TO_RAD, mesh.rotation.y / OIMO.TO_RAD, mesh.rotation.z / OIMO.TO_RAD]
  17201. };
  17202. break;
  17203. }
  17204. return bodyParameters;
  17205. };
  17206. OimoJSPlugin.prototype.unregisterMesh = function (mesh) {
  17207. for (var index = 0; index < this._registeredMeshes.length; index++) {
  17208. var registeredMesh = this._registeredMeshes[index];
  17209. if (registeredMesh.mesh === mesh || registeredMesh.mesh === mesh.parent) {
  17210. if (registeredMesh.body) {
  17211. this._world.removeRigidBody(registeredMesh.body.body);
  17212. this._unbindBody(registeredMesh.body);
  17213. }
  17214. this._registeredMeshes.splice(index, 1);
  17215. return;
  17216. }
  17217. }
  17218. };
  17219. OimoJSPlugin.prototype._unbindBody = function (body) {
  17220. for (var index = 0; index < this._registeredMeshes.length; index++) {
  17221. var registeredMesh = this._registeredMeshes[index];
  17222. if (registeredMesh.body === body) {
  17223. registeredMesh.body = null;
  17224. }
  17225. }
  17226. };
  17227. OimoJSPlugin.prototype.applyImpulse = function (mesh, force, contactPoint) {
  17228. for (var index = 0; index < this._registeredMeshes.length; index++) {
  17229. var registeredMesh = this._registeredMeshes[index];
  17230. if (registeredMesh.mesh === mesh || registeredMesh.mesh === mesh.parent) {
  17231. // Get object mass to have a behaviour similar to cannon.js
  17232. var mass = registeredMesh.body.body.massInfo.mass;
  17233. // The force is scaled with the mass of object
  17234. registeredMesh.body.body.applyImpulse(contactPoint.scale(OIMO.INV_SCALE), force.scale(OIMO.INV_SCALE * mass));
  17235. return;
  17236. }
  17237. }
  17238. };
  17239. OimoJSPlugin.prototype.createLink = function (mesh1, mesh2, pivot1, pivot2, options) {
  17240. var body1 = null, body2 = null;
  17241. for (var index = 0; index < this._registeredMeshes.length; index++) {
  17242. var registeredMesh = this._registeredMeshes[index];
  17243. if (registeredMesh.mesh === mesh1) {
  17244. body1 = registeredMesh.body.body;
  17245. }
  17246. else if (registeredMesh.mesh === mesh2) {
  17247. body2 = registeredMesh.body.body;
  17248. }
  17249. }
  17250. if (!body1 || !body2) {
  17251. return false;
  17252. }
  17253. if (!options) {
  17254. options = {};
  17255. }
  17256. new OIMO.Link({
  17257. type: options.type,
  17258. body1: body1,
  17259. body2: body2,
  17260. min: options.min,
  17261. max: options.max,
  17262. axe1: options.axe1,
  17263. axe2: options.axe2,
  17264. pos1: [pivot1.x, pivot1.y, pivot1.z],
  17265. pos2: [pivot2.x, pivot2.y, pivot2.z],
  17266. collision: options.collision,
  17267. spring: options.spring,
  17268. world: this._world
  17269. });
  17270. return true;
  17271. };
  17272. OimoJSPlugin.prototype.dispose = function () {
  17273. this._world.clear();
  17274. while (this._registeredMeshes.length) {
  17275. this.unregisterMesh(this._registeredMeshes[0].mesh);
  17276. }
  17277. };
  17278. OimoJSPlugin.prototype.isSupported = function () {
  17279. return OIMO !== undefined;
  17280. };
  17281. OimoJSPlugin.prototype._getLastShape = function (body) {
  17282. var lastShape = body.shapes;
  17283. while (lastShape.next) {
  17284. lastShape = lastShape.next;
  17285. }
  17286. return lastShape;
  17287. };
  17288. OimoJSPlugin.prototype.runOneStep = function (time) {
  17289. this._world.step();
  17290. // Update the position of all registered meshes
  17291. var i = this._registeredMeshes.length;
  17292. var m;
  17293. while (i--) {
  17294. var body = this._registeredMeshes[i].body.body;
  17295. var mesh = this._registeredMeshes[i].mesh;
  17296. var delta = this._registeredMeshes[i].delta;
  17297. if (!body.sleeping) {
  17298. if (body.shapes.next) {
  17299. var parentShape = this._getLastShape(body);
  17300. mesh.position.x = parentShape.position.x * OIMO.WORLD_SCALE;
  17301. mesh.position.y = parentShape.position.y * OIMO.WORLD_SCALE;
  17302. mesh.position.z = parentShape.position.z * OIMO.WORLD_SCALE;
  17303. var mtx = BABYLON.Matrix.FromArray(body.getMatrix());
  17304. if (!mesh.rotationQuaternion) {
  17305. mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1);
  17306. }
  17307. mesh.rotationQuaternion.fromRotationMatrix(mtx);
  17308. mesh.computeWorldMatrix();
  17309. }
  17310. else {
  17311. m = body.getMatrix();
  17312. mtx = BABYLON.Matrix.FromArray(m);
  17313. // Body position
  17314. var bodyX = mtx.m[12], bodyY = mtx.m[13], bodyZ = mtx.m[14];
  17315. if (!delta) {
  17316. mesh.position.x = bodyX;
  17317. mesh.position.y = bodyY;
  17318. mesh.position.z = bodyZ;
  17319. }
  17320. else {
  17321. mesh.position.x = bodyX + delta.x;
  17322. mesh.position.y = bodyY + delta.y;
  17323. mesh.position.z = bodyZ + delta.z;
  17324. }
  17325. if (!mesh.rotationQuaternion) {
  17326. mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1);
  17327. }
  17328. mesh.rotationQuaternion.fromRotationMatrix(mtx);
  17329. mesh.computeWorldMatrix();
  17330. }
  17331. }
  17332. }
  17333. };
  17334. return OimoJSPlugin;
  17335. })();
  17336. BABYLON.OimoJSPlugin = OimoJSPlugin;
  17337. })(BABYLON || (BABYLON = {}));
  17338. //# sourceMappingURL=babylon.oimoJSPlugin.js.mapvar BABYLON;
  17339. (function (BABYLON) {
  17340. var PhysicsEngine = (function () {
  17341. function PhysicsEngine(plugin) {
  17342. this._currentPlugin = plugin || new BABYLON.OimoJSPlugin();
  17343. }
  17344. PhysicsEngine.prototype._initialize = function (gravity) {
  17345. this._currentPlugin.initialize();
  17346. this._setGravity(gravity);
  17347. };
  17348. PhysicsEngine.prototype._runOneStep = function (delta) {
  17349. if (delta > 0.1) {
  17350. delta = 0.1;
  17351. }
  17352. else if (delta <= 0) {
  17353. delta = 1.0 / 60.0;
  17354. }
  17355. this._currentPlugin.runOneStep(delta);
  17356. };
  17357. PhysicsEngine.prototype._setGravity = function (gravity) {
  17358. this.gravity = gravity || new BABYLON.Vector3(0, -9.82, 0);
  17359. this._currentPlugin.setGravity(this.gravity);
  17360. };
  17361. PhysicsEngine.prototype._registerMesh = function (mesh, impostor, options) {
  17362. return this._currentPlugin.registerMesh(mesh, impostor, options);
  17363. };
  17364. PhysicsEngine.prototype._registerMeshesAsCompound = function (parts, options) {
  17365. return this._currentPlugin.registerMeshesAsCompound(parts, options);
  17366. };
  17367. PhysicsEngine.prototype._unregisterMesh = function (mesh) {
  17368. this._currentPlugin.unregisterMesh(mesh);
  17369. };
  17370. PhysicsEngine.prototype._applyImpulse = function (mesh, force, contactPoint) {
  17371. this._currentPlugin.applyImpulse(mesh, force, contactPoint);
  17372. };
  17373. PhysicsEngine.prototype._createLink = function (mesh1, mesh2, pivot1, pivot2, options) {
  17374. return this._currentPlugin.createLink(mesh1, mesh2, pivot1, pivot2, options);
  17375. };
  17376. PhysicsEngine.prototype._updateBodyPosition = function (mesh) {
  17377. this._currentPlugin.updateBodyPosition(mesh);
  17378. };
  17379. PhysicsEngine.prototype.dispose = function () {
  17380. this._currentPlugin.dispose();
  17381. };
  17382. PhysicsEngine.prototype.isSupported = function () {
  17383. return this._currentPlugin.isSupported();
  17384. };
  17385. // Statics
  17386. PhysicsEngine.NoImpostor = 0;
  17387. PhysicsEngine.SphereImpostor = 1;
  17388. PhysicsEngine.BoxImpostor = 2;
  17389. PhysicsEngine.PlaneImpostor = 3;
  17390. PhysicsEngine.MeshImpostor = 4;
  17391. PhysicsEngine.CapsuleImpostor = 5;
  17392. PhysicsEngine.ConeImpostor = 6;
  17393. PhysicsEngine.CylinderImpostor = 7;
  17394. PhysicsEngine.ConvexHullImpostor = 8;
  17395. PhysicsEngine.Epsilon = 0.001;
  17396. return PhysicsEngine;
  17397. })();
  17398. BABYLON.PhysicsEngine = PhysicsEngine;
  17399. })(BABYLON || (BABYLON = {}));
  17400. //# sourceMappingURL=babylon.physicsEngine.js.mapvar BABYLON;
  17401. (function (BABYLON) {
  17402. var serializeLight = function (light) {
  17403. var serializationObject = {};
  17404. serializationObject.name = light.name;
  17405. serializationObject.id = light.id;
  17406. serializationObject.tags = BABYLON.Tags.GetTags(light);
  17407. if (light instanceof BABYLON.PointLight) {
  17408. serializationObject.type = 0;
  17409. serializationObject.position = light.position.asArray();
  17410. }
  17411. else if (light instanceof BABYLON.DirectionalLight) {
  17412. serializationObject.type = 1;
  17413. var directionalLight = light;
  17414. serializationObject.position = directionalLight.position.asArray();
  17415. serializationObject.direction = directionalLight.direction.asArray();
  17416. }
  17417. else if (light instanceof BABYLON.SpotLight) {
  17418. serializationObject.type = 2;
  17419. var spotLight = light;
  17420. serializationObject.position = spotLight.position.asArray();
  17421. serializationObject.direction = spotLight.position.asArray();
  17422. serializationObject.angle = spotLight.angle;
  17423. serializationObject.exponent = spotLight.exponent;
  17424. }
  17425. else if (light instanceof BABYLON.HemisphericLight) {
  17426. serializationObject.type = 3;
  17427. var hemisphericLight = light;
  17428. serializationObject.direction = hemisphericLight.direction.asArray();
  17429. serializationObject.groundColor = hemisphericLight.groundColor.asArray();
  17430. }
  17431. if (light.intensity) {
  17432. serializationObject.intensity = light.intensity;
  17433. }
  17434. serializationObject.range = light.range;
  17435. serializationObject.diffuse = light.diffuse.asArray();
  17436. serializationObject.specular = light.specular.asArray();
  17437. return serializationObject;
  17438. };
  17439. var serializeFresnelParameter = function (fresnelParameter) {
  17440. var serializationObject = {};
  17441. serializationObject.isEnabled = fresnelParameter.isEnabled;
  17442. serializationObject.leftColor = fresnelParameter.leftColor;
  17443. serializationObject.rightColor = fresnelParameter.rightColor;
  17444. serializationObject.bias = fresnelParameter.bias;
  17445. serializationObject.power = fresnelParameter.power;
  17446. return serializationObject;
  17447. };
  17448. var serializeCamera = function (camera) {
  17449. var serializationObject = {};
  17450. serializationObject.name = camera.name;
  17451. serializationObject.tags = BABYLON.Tags.GetTags(camera);
  17452. serializationObject.id = camera.id;
  17453. serializationObject.position = camera.position.asArray();
  17454. // Parent
  17455. if (camera.parent) {
  17456. serializationObject.parentId = camera.parent.id;
  17457. }
  17458. // Target
  17459. serializationObject.rotation = camera.rotation.asArray();
  17460. // Locked target
  17461. if (camera.lockedTarget && camera.lockedTarget.id) {
  17462. serializationObject.lockedTargetId = camera.lockedTarget.id;
  17463. }
  17464. serializationObject.fov = camera.fov;
  17465. serializationObject.minZ = camera.minZ;
  17466. serializationObject.maxZ = camera.maxZ;
  17467. serializationObject.speed = camera.speed;
  17468. serializationObject.inertia = camera.inertia;
  17469. serializationObject.checkCollisions = camera.checkCollisions;
  17470. serializationObject.applyGravity = camera.applyGravity;
  17471. if (camera.ellipsoid) {
  17472. serializationObject.ellipsoid = camera.ellipsoid.asArray();
  17473. }
  17474. // Animations
  17475. appendAnimations(camera, serializationObject);
  17476. // Layer mask
  17477. serializationObject.layerMask = camera.layerMask;
  17478. return serializationObject;
  17479. };
  17480. var appendAnimations = function (source, destination) {
  17481. if (source.animations) {
  17482. destination.animations = [];
  17483. for (var animationIndex = 0; animationIndex < source.animations.length; animationIndex++) {
  17484. var animation = source.animations[animationIndex];
  17485. destination.animations.push(serializeAnimation(animation));
  17486. }
  17487. }
  17488. };
  17489. var serializeAnimation = function (animation) {
  17490. var serializationObject = {};
  17491. serializationObject.name = animation.name;
  17492. serializationObject.property = animation.targetProperty;
  17493. serializationObject.framePerSecond = animation.framePerSecond;
  17494. serializationObject.dataType = animation.dataType;
  17495. serializationObject.loopBehavior = animation.loopMode;
  17496. var dataType = animation.dataType;
  17497. serializationObject.keys = [];
  17498. var keys = animation.getKeys();
  17499. for (var index = 0; index < keys.length; index++) {
  17500. var animationKey = keys[index];
  17501. var key = {};
  17502. key.frame = animationKey.frame;
  17503. switch (dataType) {
  17504. case BABYLON.Animation.ANIMATIONTYPE_FLOAT:
  17505. key.values = [animationKey.value];
  17506. break;
  17507. case BABYLON.Animation.ANIMATIONTYPE_QUATERNION:
  17508. case BABYLON.Animation.ANIMATIONTYPE_MATRIX:
  17509. case BABYLON.Animation.ANIMATIONTYPE_VECTOR3:
  17510. key.values = animationKey.value.asArray();
  17511. break;
  17512. }
  17513. serializationObject.keys.push(key);
  17514. }
  17515. return serializationObject;
  17516. };
  17517. var serializeMultiMaterial = function (material) {
  17518. var serializationObject = {};
  17519. serializationObject.name = material.name;
  17520. serializationObject.id = material.id;
  17521. serializationObject.tags = BABYLON.Tags.GetTags(material);
  17522. serializationObject.materials = [];
  17523. for (var matIndex = 0; matIndex < material.subMaterials.length; matIndex++) {
  17524. var subMat = material.subMaterials[matIndex];
  17525. if (subMat) {
  17526. serializationObject.materials.push(subMat.id);
  17527. }
  17528. else {
  17529. serializationObject.materials.push(null);
  17530. }
  17531. }
  17532. return serializationObject;
  17533. };
  17534. var serializeMaterial = function (material) {
  17535. var serializationObject = {};
  17536. serializationObject.name = material.name;
  17537. serializationObject.ambient = material.ambientColor.asArray();
  17538. serializationObject.diffuse = material.diffuseColor.asArray();
  17539. serializationObject.specular = material.specularColor.asArray();
  17540. serializationObject.specularPower = material.specularPower;
  17541. serializationObject.emissive = material.emissiveColor.asArray();
  17542. serializationObject.alpha = material.alpha;
  17543. serializationObject.id = material.id;
  17544. serializationObject.tags = BABYLON.Tags.GetTags(material);
  17545. serializationObject.backFaceCulling = material.backFaceCulling;
  17546. if (material.diffuseTexture) {
  17547. serializationObject.diffuseTexture = serializeTexture(material.diffuseTexture);
  17548. }
  17549. if (material.diffuseFresnelParameters) {
  17550. serializationObject.diffuseFresnelParameters = serializeFresnelParameter(material.diffuseFresnelParameters);
  17551. }
  17552. if (material.ambientTexture) {
  17553. serializationObject.ambientTexture = serializeTexture(material.ambientTexture);
  17554. }
  17555. if (material.opacityTexture) {
  17556. serializationObject.opacityTexture = serializeTexture(material.opacityTexture);
  17557. }
  17558. if (material.opacityFresnelParameters) {
  17559. serializationObject.opacityFresnelParameters = serializeFresnelParameter(material.opacityFresnelParameters);
  17560. }
  17561. if (material.reflectionTexture) {
  17562. serializationObject.reflectionTexture = serializeTexture(material.reflectionTexture);
  17563. }
  17564. if (material.reflectionFresnelParameters) {
  17565. serializationObject.reflectionFresnelParameters = serializeFresnelParameter(material.reflectionFresnelParameters);
  17566. }
  17567. if (material.emissiveTexture) {
  17568. serializationObject.emissiveTexture = serializeTexture(material.emissiveTexture);
  17569. }
  17570. if (material.emissiveFresnelParameters) {
  17571. serializationObject.emissiveFresnelParameters = serializeFresnelParameter(material.emissiveFresnelParameters);
  17572. }
  17573. if (material.specularTexture) {
  17574. serializationObject.specularTexture = serializeTexture(material.specularTexture);
  17575. }
  17576. if (material.bumpTexture) {
  17577. serializationObject.bumpTexture = serializeTexture(material.bumpTexture);
  17578. }
  17579. return serializationObject;
  17580. };
  17581. var serializeTexture = function (texture) {
  17582. var serializationObject = {};
  17583. if (!texture.name) {
  17584. return null;
  17585. }
  17586. if (texture instanceof BABYLON.CubeTexture) {
  17587. serializationObject.name = texture.name;
  17588. serializationObject.hasAlpha = texture.hasAlpha;
  17589. serializationObject.level = texture.level;
  17590. serializationObject.coordinatesMode = texture.coordinatesMode;
  17591. return serializationObject;
  17592. }
  17593. if (texture instanceof BABYLON.MirrorTexture) {
  17594. var mirrorTexture = texture;
  17595. serializationObject.renderTargetSize = mirrorTexture.getRenderSize();
  17596. serializationObject.renderList = [];
  17597. for (var index = 0; index < mirrorTexture.renderList.length; index++) {
  17598. serializationObject.renderList.push(mirrorTexture.renderList[index].id);
  17599. }
  17600. serializationObject.mirrorPlane = mirrorTexture.mirrorPlane.asArray();
  17601. }
  17602. else if (texture instanceof BABYLON.RenderTargetTexture) {
  17603. var renderTargetTexture = texture;
  17604. serializationObject.renderTargetSize = renderTargetTexture.getRenderSize();
  17605. serializationObject.renderList = [];
  17606. for (index = 0; index < renderTargetTexture.renderList.length; index++) {
  17607. serializationObject.renderList.push(renderTargetTexture.renderList[index].id);
  17608. }
  17609. }
  17610. var regularTexture = texture;
  17611. serializationObject.name = texture.name;
  17612. serializationObject.hasAlpha = texture.hasAlpha;
  17613. serializationObject.level = texture.level;
  17614. serializationObject.coordinatesIndex = texture.coordinatesIndex;
  17615. serializationObject.coordinatesMode = texture.coordinatesMode;
  17616. serializationObject.uOffset = regularTexture.uOffset;
  17617. serializationObject.vOffset = regularTexture.vOffset;
  17618. serializationObject.uScale = regularTexture.uScale;
  17619. serializationObject.vScale = regularTexture.vScale;
  17620. serializationObject.uAng = regularTexture.uAng;
  17621. serializationObject.vAng = regularTexture.vAng;
  17622. serializationObject.wAng = regularTexture.wAng;
  17623. serializationObject.wrapU = texture.wrapU;
  17624. serializationObject.wrapV = texture.wrapV;
  17625. // Animations
  17626. appendAnimations(texture, serializationObject);
  17627. return serializationObject;
  17628. };
  17629. var serializeSkeleton = function (skeleton) {
  17630. var serializationObject = {};
  17631. serializationObject.name = skeleton.name;
  17632. serializationObject.id = skeleton.id;
  17633. serializationObject.bones = [];
  17634. for (var index = 0; index < skeleton.bones.length; index++) {
  17635. var bone = skeleton.bones[index];
  17636. var serializedBone = {
  17637. parentBoneIndex: bone.getParent() ? skeleton.bones.indexOf(bone.getParent()) : -1,
  17638. name: bone.name,
  17639. matrix: bone.getLocalMatrix().toArray()
  17640. };
  17641. serializationObject.bones.push(serializedBone);
  17642. if (bone.animations && bone.animations.length > 0) {
  17643. serializedBone.animation = serializeAnimation(bone.animations[0]);
  17644. }
  17645. }
  17646. return serializationObject;
  17647. };
  17648. var serializeParticleSystem = function (particleSystem) {
  17649. var serializationObject = {};
  17650. serializationObject.emitterId = particleSystem.emitter.id;
  17651. serializationObject.capacity = particleSystem.getCapacity();
  17652. if (particleSystem.particleTexture) {
  17653. serializationObject.textureName = particleSystem.particleTexture.name;
  17654. }
  17655. serializationObject.minAngularSpeed = particleSystem.minAngularSpeed;
  17656. serializationObject.maxAngularSpeed = particleSystem.maxAngularSpeed;
  17657. serializationObject.minSize = particleSystem.minSize;
  17658. serializationObject.maxSize = particleSystem.maxSize;
  17659. serializationObject.minLifeTime = particleSystem.minLifeTime;
  17660. serializationObject.maxLifeTime = particleSystem.maxLifeTime;
  17661. serializationObject.emitRate = particleSystem.emitRate;
  17662. serializationObject.minEmitBox = particleSystem.minEmitBox.asArray();
  17663. serializationObject.maxEmitBox = particleSystem.maxEmitBox.asArray();
  17664. serializationObject.gravity = particleSystem.gravity.asArray();
  17665. serializationObject.direction1 = particleSystem.direction1.asArray();
  17666. serializationObject.direction2 = particleSystem.direction2.asArray();
  17667. serializationObject.color1 = particleSystem.color1.asArray();
  17668. serializationObject.color2 = particleSystem.color2.asArray();
  17669. serializationObject.colorDead = particleSystem.colorDead.asArray();
  17670. serializationObject.updateSpeed = particleSystem.updateSpeed;
  17671. serializationObject.targetStopDuration = particleSystem.targetStopDuration;
  17672. serializationObject.textureMask = particleSystem.textureMask.asArray();
  17673. serializationObject.blendMode = particleSystem.blendMode;
  17674. return serializationObject;
  17675. };
  17676. var serializeLensFlareSystem = function (lensFlareSystem) {
  17677. var serializationObject = {};
  17678. serializationObject.emitterId = lensFlareSystem.getEmitter().id;
  17679. serializationObject.borderLimit = lensFlareSystem.borderLimit;
  17680. serializationObject.flares = [];
  17681. for (var index = 0; index < lensFlareSystem.lensFlares.length; index++) {
  17682. var flare = lensFlareSystem.lensFlares[index];
  17683. serializationObject.flares.push({
  17684. size: flare.size,
  17685. position: flare.position,
  17686. color: flare.color.asArray(),
  17687. textureName: BABYLON.Tools.GetFilename(flare.texture.name)
  17688. });
  17689. }
  17690. return serializationObject;
  17691. };
  17692. var serializeShadowGenerator = function (light) {
  17693. var serializationObject = {};
  17694. var shadowGenerator = light.getShadowGenerator();
  17695. serializationObject.lightId = light.id;
  17696. serializationObject.mapSize = shadowGenerator.getShadowMap().getRenderSize();
  17697. serializationObject.useVarianceShadowMap = shadowGenerator.useVarianceShadowMap;
  17698. serializationObject.usePoissonSampling = shadowGenerator.usePoissonSampling;
  17699. serializationObject.renderList = [];
  17700. for (var meshIndex = 0; meshIndex < shadowGenerator.getShadowMap().renderList.length; meshIndex++) {
  17701. var mesh = shadowGenerator.getShadowMap().renderList[meshIndex];
  17702. serializationObject.renderList.push(mesh.id);
  17703. }
  17704. return serializationObject;
  17705. };
  17706. var serializedGeometries = [];
  17707. var serializeGeometry = function (geometry, serializationGeometries) {
  17708. if (serializedGeometries[geometry.id]) {
  17709. return;
  17710. }
  17711. if (geometry instanceof BABYLON.Geometry.Primitives.Box) {
  17712. serializationGeometries.boxes.push(serializeBox(geometry));
  17713. }
  17714. else if (geometry instanceof BABYLON.Geometry.Primitives.Sphere) {
  17715. serializationGeometries.spheres.push(serializeSphere(geometry));
  17716. }
  17717. else if (geometry instanceof BABYLON.Geometry.Primitives.Cylinder) {
  17718. serializationGeometries.cylinders.push(serializeCylinder(geometry));
  17719. }
  17720. else if (geometry instanceof BABYLON.Geometry.Primitives.Torus) {
  17721. serializationGeometries.toruses.push(serializeTorus(geometry));
  17722. }
  17723. else if (geometry instanceof BABYLON.Geometry.Primitives.Ground) {
  17724. serializationGeometries.grounds.push(serializeGround(geometry));
  17725. }
  17726. else if (geometry instanceof BABYLON.Geometry.Primitives.Plane) {
  17727. serializationGeometries.planes.push(serializePlane(geometry));
  17728. }
  17729. else if (geometry instanceof BABYLON.Geometry.Primitives.TorusKnot) {
  17730. serializationGeometries.torusKnots.push(serializeTorusKnot(geometry));
  17731. }
  17732. else if (geometry instanceof BABYLON.Geometry.Primitives._Primitive) {
  17733. throw new Error("Unknow primitive type");
  17734. }
  17735. else {
  17736. serializationGeometries.vertexData.push(serializeVertexData(geometry));
  17737. }
  17738. serializedGeometries[geometry.id] = true;
  17739. };
  17740. var serializeGeometryBase = function (geometry) {
  17741. var serializationObject = {};
  17742. serializationObject.id = geometry.id;
  17743. if (BABYLON.Tags.HasTags(geometry)) {
  17744. serializationObject.tags = BABYLON.Tags.GetTags(geometry);
  17745. }
  17746. return serializationObject;
  17747. };
  17748. var serializeVertexData = function (vertexData) {
  17749. var serializationObject = serializeGeometryBase(vertexData);
  17750. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.PositionKind)) {
  17751. serializationObject.positions = vertexData.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  17752. }
  17753. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) {
  17754. serializationObject.normals = vertexData.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  17755. }
  17756. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  17757. serializationObject.uvs = vertexData.getVerticesData(BABYLON.VertexBuffer.UVKind);
  17758. }
  17759. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  17760. serializationObject.uvs2 = vertexData.getVerticesData(BABYLON.VertexBuffer.UV2Kind);
  17761. }
  17762. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.ColorKind)) {
  17763. serializationObject.colors = vertexData.getVerticesData(BABYLON.VertexBuffer.ColorKind);
  17764. }
  17765. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind)) {
  17766. serializationObject.matricesIndices = vertexData.getVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind);
  17767. serializationObject.matricesIndices._isExpanded = true;
  17768. }
  17769. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind)) {
  17770. serializationObject.matricesWeights = vertexData.getVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind);
  17771. }
  17772. serializationObject.indices = vertexData.getIndices();
  17773. return serializationObject;
  17774. };
  17775. var serializePrimitive = function (primitive) {
  17776. var serializationObject = serializeGeometryBase(primitive);
  17777. serializationObject.canBeRegenerated = primitive.canBeRegenerated();
  17778. return serializationObject;
  17779. };
  17780. var serializeBox = function (box) {
  17781. var serializationObject = serializePrimitive(box);
  17782. serializationObject.size = box.size;
  17783. return serializationObject;
  17784. };
  17785. var serializeSphere = function (sphere) {
  17786. var serializationObject = serializePrimitive(sphere);
  17787. serializationObject.segments = sphere.segments;
  17788. serializationObject.diameter = sphere.diameter;
  17789. return serializationObject;
  17790. };
  17791. var serializeCylinder = function (cylinder) {
  17792. var serializationObject = serializePrimitive(cylinder);
  17793. serializationObject.height = cylinder.height;
  17794. serializationObject.diameterTop = cylinder.diameterTop;
  17795. serializationObject.diameterBottom = cylinder.diameterBottom;
  17796. serializationObject.tessellation = cylinder.tessellation;
  17797. return serializationObject;
  17798. };
  17799. var serializeTorus = function (torus) {
  17800. var serializationObject = serializePrimitive(torus);
  17801. serializationObject.diameter = torus.diameter;
  17802. serializationObject.thickness = torus.thickness;
  17803. serializationObject.tessellation = torus.tessellation;
  17804. return serializationObject;
  17805. };
  17806. var serializeGround = function (ground) {
  17807. var serializationObject = serializePrimitive(ground);
  17808. serializationObject.width = ground.width;
  17809. serializationObject.height = ground.height;
  17810. serializationObject.subdivisions = ground.subdivisions;
  17811. return serializationObject;
  17812. };
  17813. var serializePlane = function (plane) {
  17814. var serializationObject = serializePrimitive(plane);
  17815. serializationObject.size = plane.size;
  17816. return serializationObject;
  17817. };
  17818. var serializeTorusKnot = function (torusKnot) {
  17819. var serializationObject = serializePrimitive(torusKnot);
  17820. serializationObject.radius = torusKnot.radius;
  17821. serializationObject.tube = torusKnot.tube;
  17822. serializationObject.radialSegments = torusKnot.radialSegments;
  17823. serializationObject.tubularSegments = torusKnot.tubularSegments;
  17824. serializationObject.p = torusKnot.p;
  17825. serializationObject.q = torusKnot.q;
  17826. return serializationObject;
  17827. };
  17828. var serializeMesh = function (mesh, serializationScene) {
  17829. var serializationObject = {};
  17830. serializationObject.name = mesh.name;
  17831. serializationObject.id = mesh.id;
  17832. if (BABYLON.Tags.HasTags(mesh)) {
  17833. serializationObject.tags = BABYLON.Tags.GetTags(mesh);
  17834. }
  17835. serializationObject.position = mesh.position.asArray();
  17836. if (mesh.rotationQuaternion) {
  17837. serializationObject.rotationQuaternion = mesh.rotationQuaternion.asArray();
  17838. }
  17839. else if (mesh.rotation) {
  17840. serializationObject.rotation = mesh.rotation.asArray();
  17841. }
  17842. serializationObject.scaling = mesh.scaling.asArray();
  17843. serializationObject.localMatrix = mesh.getPivotMatrix().asArray();
  17844. serializationObject.isEnabled = mesh.isEnabled();
  17845. serializationObject.isVisible = mesh.isVisible;
  17846. serializationObject.infiniteDistance = mesh.infiniteDistance;
  17847. serializationObject.pickable = mesh.isPickable;
  17848. serializationObject.receiveShadows = mesh.receiveShadows;
  17849. serializationObject.billboardMode = mesh.billboardMode;
  17850. serializationObject.visibility = mesh.visibility;
  17851. serializationObject.checkCollisions = mesh.checkCollisions;
  17852. // Parent
  17853. if (mesh.parent) {
  17854. serializationObject.parentId = mesh.parent.id;
  17855. }
  17856. // Geometry
  17857. var geometry = mesh._geometry;
  17858. if (geometry) {
  17859. var geometryId = geometry.id;
  17860. serializationObject.geometryId = geometryId;
  17861. if (!mesh.getScene().getGeometryByID(geometryId)) {
  17862. // geometry was in the memory but not added to the scene, nevertheless it's better to serialize too be able to reload the mesh with its geometry
  17863. serializeGeometry(geometry, serializationScene.geometries);
  17864. }
  17865. // SubMeshes
  17866. serializationObject.subMeshes = [];
  17867. for (var subIndex = 0; subIndex < mesh.subMeshes.length; subIndex++) {
  17868. var subMesh = mesh.subMeshes[subIndex];
  17869. serializationObject.subMeshes.push({
  17870. materialIndex: subMesh.materialIndex,
  17871. verticesStart: subMesh.verticesStart,
  17872. verticesCount: subMesh.verticesCount,
  17873. indexStart: subMesh.indexStart,
  17874. indexCount: subMesh.indexCount
  17875. });
  17876. }
  17877. }
  17878. // Material
  17879. if (mesh.material) {
  17880. serializationObject.materialId = mesh.material.id;
  17881. }
  17882. else {
  17883. mesh.material = null;
  17884. }
  17885. // Skeleton
  17886. if (mesh.skeleton) {
  17887. serializationObject.skeletonId = mesh.skeleton.id;
  17888. }
  17889. // Physics
  17890. if (mesh.getPhysicsImpostor() !== BABYLON.PhysicsEngine.NoImpostor) {
  17891. serializationObject.physicsMass = mesh.getPhysicsMass();
  17892. serializationObject.physicsFriction = mesh.getPhysicsFriction();
  17893. serializationObject.physicsRestitution = mesh.getPhysicsRestitution();
  17894. switch (mesh.getPhysicsImpostor()) {
  17895. case BABYLON.PhysicsEngine.BoxImpostor:
  17896. serializationObject.physicsImpostor = 1;
  17897. break;
  17898. case BABYLON.PhysicsEngine.SphereImpostor:
  17899. serializationObject.physicsImpostor = 2;
  17900. break;
  17901. }
  17902. }
  17903. // Instances
  17904. serializationObject.instances = [];
  17905. for (var index = 0; index < mesh.instances.length; index++) {
  17906. var instance = mesh.instances[index];
  17907. var serializationInstance = {
  17908. name: instance.name,
  17909. position: instance.position,
  17910. rotation: instance.rotation,
  17911. rotationQuaternion: instance.rotationQuaternion,
  17912. scaling: instance.scaling
  17913. };
  17914. serializationObject.instances.push(serializationInstance);
  17915. // Animations
  17916. appendAnimations(instance, serializationInstance);
  17917. }
  17918. // Animations
  17919. appendAnimations(mesh, serializationObject);
  17920. // Layer mask
  17921. serializationObject.layerMask = mesh.layerMask;
  17922. return serializationObject;
  17923. };
  17924. var SceneSerializer = (function () {
  17925. function SceneSerializer() {
  17926. }
  17927. SceneSerializer.Serialize = function (scene) {
  17928. var serializationObject = {};
  17929. // Scene
  17930. serializationObject.useDelayedTextureLoading = scene.useDelayedTextureLoading;
  17931. serializationObject.autoClear = scene.autoClear;
  17932. serializationObject.clearColor = scene.clearColor.asArray();
  17933. serializationObject.ambientColor = scene.ambientColor.asArray();
  17934. serializationObject.gravity = scene.gravity.asArray();
  17935. // Fog
  17936. if (scene.fogMode && scene.fogMode !== 0) {
  17937. serializationObject.fogMode = scene.fogMode;
  17938. serializationObject.fogColor = scene.fogColor.asArray();
  17939. serializationObject.fogStart = scene.fogStart;
  17940. serializationObject.fogEnd = scene.fogEnd;
  17941. serializationObject.fogDensity = scene.fogDensity;
  17942. }
  17943. // Lights
  17944. serializationObject.lights = [];
  17945. for (var index = 0; index < scene.lights.length; index++) {
  17946. var light = scene.lights[index];
  17947. serializationObject.lights.push(serializeLight(light));
  17948. }
  17949. // Cameras
  17950. serializationObject.cameras = [];
  17951. for (index = 0; index < scene.cameras.length; index++) {
  17952. var camera = scene.cameras[index];
  17953. if (camera instanceof BABYLON.FreeCamera) {
  17954. serializationObject.cameras.push(serializeCamera(camera));
  17955. }
  17956. }
  17957. if (scene.activeCamera) {
  17958. serializationObject.activeCameraID = scene.activeCamera.id;
  17959. }
  17960. // Materials
  17961. serializationObject.materials = [];
  17962. serializationObject.multiMaterials = [];
  17963. for (index = 0; index < scene.materials.length; index++) {
  17964. var material = scene.materials[index];
  17965. if (material instanceof BABYLON.StandardMaterial) {
  17966. serializationObject.materials.push(serializeMaterial(material));
  17967. }
  17968. else if (material instanceof BABYLON.MultiMaterial) {
  17969. serializationObject.multiMaterials.push(serializeMultiMaterial(material));
  17970. }
  17971. }
  17972. // Skeletons
  17973. serializationObject.skeletons = [];
  17974. for (index = 0; index < scene.skeletons.length; index++) {
  17975. serializationObject.skeletons.push(serializeSkeleton(scene.skeletons[index]));
  17976. }
  17977. // Geometries
  17978. serializationObject.geometries = {};
  17979. serializationObject.geometries.boxes = [];
  17980. serializationObject.geometries.spheres = [];
  17981. serializationObject.geometries.cylinders = [];
  17982. serializationObject.geometries.toruses = [];
  17983. serializationObject.geometries.grounds = [];
  17984. serializationObject.geometries.planes = [];
  17985. serializationObject.geometries.torusKnots = [];
  17986. serializationObject.geometries.vertexData = [];
  17987. serializedGeometries = [];
  17988. var geometries = scene.getGeometries();
  17989. for (var index = 0; index < geometries.length; index++) {
  17990. var geometry = geometries[index];
  17991. if (geometry.isReady()) {
  17992. serializeGeometry(geometry, serializationObject.geometries);
  17993. }
  17994. }
  17995. // Meshes
  17996. serializationObject.meshes = [];
  17997. for (index = 0; index < scene.meshes.length; index++) {
  17998. var abstractMesh = scene.meshes[index];
  17999. if (abstractMesh instanceof BABYLON.Mesh) {
  18000. var mesh = abstractMesh;
  18001. if (mesh.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADED || mesh.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_NONE) {
  18002. serializationObject.meshes.push(serializeMesh(mesh, serializationObject));
  18003. }
  18004. }
  18005. }
  18006. // Particles Systems
  18007. serializationObject.particleSystems = [];
  18008. for (index = 0; index < scene.particleSystems.length; index++) {
  18009. serializationObject.particleSystems.push(serializeParticleSystem(scene.particleSystems[index]));
  18010. }
  18011. // Lens flares
  18012. serializationObject.lensFlareSystems = [];
  18013. for (index = 0; index < scene.lensFlareSystems.length; index++) {
  18014. serializationObject.lensFlareSystems.push(serializeLensFlareSystem(scene.lensFlareSystems[index]));
  18015. }
  18016. // Shadows
  18017. serializationObject.shadowGenerators = [];
  18018. for (index = 0; index < scene.lights.length; index++) {
  18019. light = scene.lights[index];
  18020. if (light.getShadowGenerator()) {
  18021. serializationObject.shadowGenerators.push(serializeShadowGenerator(light));
  18022. }
  18023. }
  18024. return serializationObject;
  18025. };
  18026. return SceneSerializer;
  18027. })();
  18028. BABYLON.SceneSerializer = SceneSerializer;
  18029. })(BABYLON || (BABYLON = {}));
  18030. //# sourceMappingURL=babylon.sceneSerializer.js.mapvar BABYLON;
  18031. (function (BABYLON) {
  18032. var SceneLoader = (function () {
  18033. function SceneLoader() {
  18034. }
  18035. Object.defineProperty(SceneLoader, "ForceFullSceneLoadingForIncremental", {
  18036. get: function () {
  18037. return SceneLoader._ForceFullSceneLoadingForIncremental;
  18038. },
  18039. set: function (value) {
  18040. SceneLoader._ForceFullSceneLoadingForIncremental = value;
  18041. },
  18042. enumerable: true,
  18043. configurable: true
  18044. });
  18045. Object.defineProperty(SceneLoader, "ShowLoadingScreen", {
  18046. get: function () {
  18047. return SceneLoader._ShowLoadingScreen;
  18048. },
  18049. set: function (value) {
  18050. SceneLoader._ShowLoadingScreen = value;
  18051. },
  18052. enumerable: true,
  18053. configurable: true
  18054. });
  18055. SceneLoader._getPluginForFilename = function (sceneFilename) {
  18056. var dotPosition = sceneFilename.lastIndexOf(".");
  18057. var queryStringPosition = sceneFilename.indexOf("?");
  18058. var extension = sceneFilename.substring(dotPosition, queryStringPosition).toLowerCase();
  18059. for (var index = 0; index < this._registeredPlugins.length; index++) {
  18060. var plugin = this._registeredPlugins[index];
  18061. if (plugin.extensions.indexOf(extension) !== -1) {
  18062. return plugin;
  18063. }
  18064. }
  18065. return this._registeredPlugins[this._registeredPlugins.length - 1];
  18066. };
  18067. // Public functions
  18068. SceneLoader.RegisterPlugin = function (plugin) {
  18069. plugin.extensions = plugin.extensions.toLowerCase();
  18070. SceneLoader._registeredPlugins.push(plugin);
  18071. };
  18072. SceneLoader.ImportMesh = function (meshesNames, rootUrl, sceneFilename, scene, onsuccess, progressCallBack, onerror) {
  18073. var manifestChecked = function (success) {
  18074. scene.database = database;
  18075. var plugin = SceneLoader._getPluginForFilename(sceneFilename);
  18076. var importMeshFromData = function (data) {
  18077. var meshes = [];
  18078. var particleSystems = [];
  18079. var skeletons = [];
  18080. try {
  18081. if (!plugin.importMesh(meshesNames, scene, data, rootUrl, meshes, particleSystems, skeletons)) {
  18082. if (onerror) {
  18083. onerror(scene, 'unable to load the scene');
  18084. }
  18085. return;
  18086. }
  18087. }
  18088. catch (e) {
  18089. if (onerror) {
  18090. onerror(scene, e);
  18091. }
  18092. return;
  18093. }
  18094. if (onsuccess) {
  18095. scene.importedMeshesFiles.push(rootUrl + sceneFilename);
  18096. onsuccess(meshes, particleSystems, skeletons);
  18097. }
  18098. };
  18099. if (sceneFilename.substr && sceneFilename.substr(0, 5) === "data:") {
  18100. // Direct load
  18101. importMeshFromData(sceneFilename.substr(5));
  18102. return;
  18103. }
  18104. BABYLON.Tools.LoadFile(rootUrl + sceneFilename, function (data) {
  18105. importMeshFromData(data);
  18106. }, progressCallBack, database);
  18107. };
  18108. // Checking if a manifest file has been set for this scene and if offline mode has been requested
  18109. var database = new BABYLON.Database(rootUrl + sceneFilename, manifestChecked);
  18110. };
  18111. /**
  18112. * Load a scene
  18113. * @param rootUrl a string that defines the root url for scene and resources
  18114. * @param sceneFilename a string that defines the name of the scene file. can start with "data:" following by the stringified version of the scene
  18115. * @param engine is the instance of BABYLON.Engine to use to create the scene
  18116. */
  18117. SceneLoader.Load = function (rootUrl, sceneFilename, engine, onsuccess, progressCallBack, onerror) {
  18118. SceneLoader.Append(rootUrl, sceneFilename, new BABYLON.Scene(engine), onsuccess, progressCallBack, onerror);
  18119. };
  18120. /**
  18121. * Append a scene
  18122. * @param rootUrl a string that defines the root url for scene and resources
  18123. * @param sceneFilename a string that defines the name of the scene file. can start with "data:" following by the stringified version of the scene
  18124. * @param scene is the instance of BABYLON.Scene to append to
  18125. */
  18126. SceneLoader.Append = function (rootUrl, sceneFilename, scene, onsuccess, progressCallBack, onerror) {
  18127. var plugin = this._getPluginForFilename(sceneFilename.name || sceneFilename);
  18128. var database;
  18129. if (SceneLoader.ShowLoadingScreen) {
  18130. scene.getEngine().displayLoadingUI();
  18131. }
  18132. var loadSceneFromData = function (data) {
  18133. scene.database = database;
  18134. if (!plugin.load(scene, data, rootUrl)) {
  18135. if (onerror) {
  18136. onerror(scene);
  18137. }
  18138. scene.getEngine().hideLoadingUI();
  18139. return;
  18140. }
  18141. if (onsuccess) {
  18142. onsuccess(scene);
  18143. }
  18144. if (SceneLoader.ShowLoadingScreen) {
  18145. scene.executeWhenReady(function () {
  18146. scene.getEngine().hideLoadingUI();
  18147. });
  18148. }
  18149. };
  18150. var manifestChecked = function (success) {
  18151. BABYLON.Tools.LoadFile(rootUrl + sceneFilename, loadSceneFromData, progressCallBack, database);
  18152. };
  18153. if (sceneFilename.substr && sceneFilename.substr(0, 5) === "data:") {
  18154. // Direct load
  18155. loadSceneFromData(sceneFilename.substr(5));
  18156. return;
  18157. }
  18158. if (rootUrl.indexOf("file:") === -1) {
  18159. // Checking if a manifest file has been set for this scene and if offline mode has been requested
  18160. database = new BABYLON.Database(rootUrl + sceneFilename, manifestChecked);
  18161. }
  18162. else {
  18163. BABYLON.Tools.ReadFile(sceneFilename, loadSceneFromData, progressCallBack);
  18164. }
  18165. };
  18166. // Flags
  18167. SceneLoader._ForceFullSceneLoadingForIncremental = false;
  18168. SceneLoader._ShowLoadingScreen = true;
  18169. // Members
  18170. SceneLoader._registeredPlugins = new Array();
  18171. return SceneLoader;
  18172. })();
  18173. BABYLON.SceneLoader = SceneLoader;
  18174. ;
  18175. })(BABYLON || (BABYLON = {}));
  18176. //# sourceMappingURL=babylon.sceneLoader.js.mapvar BABYLON;
  18177. (function (BABYLON) {
  18178. var Internals;
  18179. (function (Internals) {
  18180. var checkColors4 = function (colors, count) {
  18181. // Check if color3 was used
  18182. if (colors.length === count * 3) {
  18183. var colors4 = [];
  18184. for (var index = 0; index < colors.length; index += 3) {
  18185. var newIndex = (index / 3) * 4;
  18186. colors4[newIndex] = colors[index];
  18187. colors4[newIndex + 1] = colors[index + 1];
  18188. colors4[newIndex + 2] = colors[index + 2];
  18189. colors4[newIndex + 3] = 1.0;
  18190. }
  18191. return colors4;
  18192. }
  18193. return colors;
  18194. };
  18195. var loadCubeTexture = function (rootUrl, parsedTexture, scene) {
  18196. var texture = new BABYLON.CubeTexture(rootUrl + parsedTexture.name, scene);
  18197. texture.name = parsedTexture.name;
  18198. texture.hasAlpha = parsedTexture.hasAlpha;
  18199. texture.level = parsedTexture.level;
  18200. texture.coordinatesMode = parsedTexture.coordinatesMode;
  18201. return texture;
  18202. };
  18203. var loadTexture = function (rootUrl, parsedTexture, scene) {
  18204. if (!parsedTexture.name && !parsedTexture.isRenderTarget) {
  18205. return null;
  18206. }
  18207. if (parsedTexture.isCube) {
  18208. return loadCubeTexture(rootUrl, parsedTexture, scene);
  18209. }
  18210. var texture;
  18211. if (parsedTexture.mirrorPlane) {
  18212. texture = new BABYLON.MirrorTexture(parsedTexture.name, parsedTexture.renderTargetSize, scene);
  18213. texture._waitingRenderList = parsedTexture.renderList;
  18214. texture.mirrorPlane = BABYLON.Plane.FromArray(parsedTexture.mirrorPlane);
  18215. }
  18216. else if (parsedTexture.isRenderTarget) {
  18217. texture = new BABYLON.RenderTargetTexture(parsedTexture.name, parsedTexture.renderTargetSize, scene);
  18218. texture._waitingRenderList = parsedTexture.renderList;
  18219. }
  18220. else {
  18221. texture = new BABYLON.Texture(rootUrl + parsedTexture.name, scene);
  18222. }
  18223. texture.name = parsedTexture.name;
  18224. texture.hasAlpha = parsedTexture.hasAlpha;
  18225. texture.getAlphaFromRGB = parsedTexture.getAlphaFromRGB;
  18226. texture.level = parsedTexture.level;
  18227. texture.coordinatesIndex = parsedTexture.coordinatesIndex;
  18228. texture.coordinatesMode = parsedTexture.coordinatesMode;
  18229. texture.uOffset = parsedTexture.uOffset;
  18230. texture.vOffset = parsedTexture.vOffset;
  18231. texture.uScale = parsedTexture.uScale;
  18232. texture.vScale = parsedTexture.vScale;
  18233. texture.uAng = parsedTexture.uAng;
  18234. texture.vAng = parsedTexture.vAng;
  18235. texture.wAng = parsedTexture.wAng;
  18236. texture.wrapU = parsedTexture.wrapU;
  18237. texture.wrapV = parsedTexture.wrapV;
  18238. // Animations
  18239. if (parsedTexture.animations) {
  18240. for (var animationIndex = 0; animationIndex < parsedTexture.animations.length; animationIndex++) {
  18241. var parsedAnimation = parsedTexture.animations[animationIndex];
  18242. texture.animations.push(parseAnimation(parsedAnimation));
  18243. }
  18244. }
  18245. return texture;
  18246. };
  18247. var parseSkeleton = function (parsedSkeleton, scene) {
  18248. var skeleton = new BABYLON.Skeleton(parsedSkeleton.name, parsedSkeleton.id, scene);
  18249. for (var index = 0; index < parsedSkeleton.bones.length; index++) {
  18250. var parsedBone = parsedSkeleton.bones[index];
  18251. var parentBone = null;
  18252. if (parsedBone.parentBoneIndex > -1) {
  18253. parentBone = skeleton.bones[parsedBone.parentBoneIndex];
  18254. }
  18255. var bone = new BABYLON.Bone(parsedBone.name, skeleton, parentBone, BABYLON.Matrix.FromArray(parsedBone.matrix));
  18256. if (parsedBone.animation) {
  18257. bone.animations.push(parseAnimation(parsedBone.animation));
  18258. }
  18259. }
  18260. return skeleton;
  18261. };
  18262. var parseFresnelParameters = function (parsedFresnelParameters) {
  18263. var fresnelParameters = new BABYLON.FresnelParameters();
  18264. fresnelParameters.isEnabled = parsedFresnelParameters.isEnabled;
  18265. fresnelParameters.leftColor = BABYLON.Color3.FromArray(parsedFresnelParameters.leftColor);
  18266. fresnelParameters.rightColor = BABYLON.Color3.FromArray(parsedFresnelParameters.rightColor);
  18267. fresnelParameters.bias = parsedFresnelParameters.bias;
  18268. fresnelParameters.power = parsedFresnelParameters.power || 1.0;
  18269. return fresnelParameters;
  18270. };
  18271. var parseMaterial = function (parsedMaterial, scene, rootUrl) {
  18272. var material;
  18273. material = new BABYLON.StandardMaterial(parsedMaterial.name, scene);
  18274. material.ambientColor = BABYLON.Color3.FromArray(parsedMaterial.ambient);
  18275. material.diffuseColor = BABYLON.Color3.FromArray(parsedMaterial.diffuse);
  18276. material.specularColor = BABYLON.Color3.FromArray(parsedMaterial.specular);
  18277. material.specularPower = parsedMaterial.specularPower;
  18278. material.emissiveColor = BABYLON.Color3.FromArray(parsedMaterial.emissive);
  18279. material.alpha = parsedMaterial.alpha;
  18280. material.id = parsedMaterial.id;
  18281. BABYLON.Tags.AddTagsTo(material, parsedMaterial.tags);
  18282. material.backFaceCulling = parsedMaterial.backFaceCulling;
  18283. material.wireframe = parsedMaterial.wireframe;
  18284. if (parsedMaterial.diffuseTexture) {
  18285. material.diffuseTexture = loadTexture(rootUrl, parsedMaterial.diffuseTexture, scene);
  18286. }
  18287. if (parsedMaterial.diffuseFresnelParameters) {
  18288. material.diffuseFresnelParameters = parseFresnelParameters(parsedMaterial.diffuseFresnelParameters);
  18289. }
  18290. if (parsedMaterial.ambientTexture) {
  18291. material.ambientTexture = loadTexture(rootUrl, parsedMaterial.ambientTexture, scene);
  18292. }
  18293. if (parsedMaterial.opacityTexture) {
  18294. material.opacityTexture = loadTexture(rootUrl, parsedMaterial.opacityTexture, scene);
  18295. }
  18296. if (parsedMaterial.opacityFresnelParameters) {
  18297. material.opacityFresnelParameters = parseFresnelParameters(parsedMaterial.opacityFresnelParameters);
  18298. }
  18299. if (parsedMaterial.reflectionTexture) {
  18300. material.reflectionTexture = loadTexture(rootUrl, parsedMaterial.reflectionTexture, scene);
  18301. }
  18302. if (parsedMaterial.reflectionFresnelParameters) {
  18303. material.reflectionFresnelParameters = parseFresnelParameters(parsedMaterial.reflectionFresnelParameters);
  18304. }
  18305. if (parsedMaterial.emissiveTexture) {
  18306. material.emissiveTexture = loadTexture(rootUrl, parsedMaterial.emissiveTexture, scene);
  18307. }
  18308. if (parsedMaterial.emissiveFresnelParameters) {
  18309. material.emissiveFresnelParameters = parseFresnelParameters(parsedMaterial.emissiveFresnelParameters);
  18310. }
  18311. if (parsedMaterial.specularTexture) {
  18312. material.specularTexture = loadTexture(rootUrl, parsedMaterial.specularTexture, scene);
  18313. }
  18314. if (parsedMaterial.bumpTexture) {
  18315. material.bumpTexture = loadTexture(rootUrl, parsedMaterial.bumpTexture, scene);
  18316. }
  18317. return material;
  18318. };
  18319. var parseMaterialById = function (id, parsedData, scene, rootUrl) {
  18320. for (var index = 0; index < parsedData.materials.length; index++) {
  18321. var parsedMaterial = parsedData.materials[index];
  18322. if (parsedMaterial.id === id) {
  18323. return parseMaterial(parsedMaterial, scene, rootUrl);
  18324. }
  18325. }
  18326. return null;
  18327. };
  18328. var parseMultiMaterial = function (parsedMultiMaterial, scene) {
  18329. var multiMaterial = new BABYLON.MultiMaterial(parsedMultiMaterial.name, scene);
  18330. multiMaterial.id = parsedMultiMaterial.id;
  18331. BABYLON.Tags.AddTagsTo(multiMaterial, parsedMultiMaterial.tags);
  18332. for (var matIndex = 0; matIndex < parsedMultiMaterial.materials.length; matIndex++) {
  18333. var subMatId = parsedMultiMaterial.materials[matIndex];
  18334. if (subMatId) {
  18335. multiMaterial.subMaterials.push(scene.getMaterialByID(subMatId));
  18336. }
  18337. else {
  18338. multiMaterial.subMaterials.push(null);
  18339. }
  18340. }
  18341. return multiMaterial;
  18342. };
  18343. var parseLensFlareSystem = function (parsedLensFlareSystem, scene, rootUrl) {
  18344. var emitter = scene.getLastEntryByID(parsedLensFlareSystem.emitterId);
  18345. var lensFlareSystem = new BABYLON.LensFlareSystem("lensFlareSystem#" + parsedLensFlareSystem.emitterId, emitter, scene);
  18346. lensFlareSystem.borderLimit = parsedLensFlareSystem.borderLimit;
  18347. for (var index = 0; index < parsedLensFlareSystem.flares.length; index++) {
  18348. var parsedFlare = parsedLensFlareSystem.flares[index];
  18349. var flare = new BABYLON.LensFlare(parsedFlare.size, parsedFlare.position, BABYLON.Color3.FromArray(parsedFlare.color), rootUrl + parsedFlare.textureName, lensFlareSystem);
  18350. }
  18351. return lensFlareSystem;
  18352. };
  18353. var parseParticleSystem = function (parsedParticleSystem, scene, rootUrl) {
  18354. var emitter = scene.getLastMeshByID(parsedParticleSystem.emitterId);
  18355. var particleSystem = new BABYLON.ParticleSystem("particles#" + emitter.name, parsedParticleSystem.capacity, scene);
  18356. if (parsedParticleSystem.textureName) {
  18357. particleSystem.particleTexture = new BABYLON.Texture(rootUrl + parsedParticleSystem.textureName, scene);
  18358. particleSystem.particleTexture.name = parsedParticleSystem.textureName;
  18359. }
  18360. particleSystem.minAngularSpeed = parsedParticleSystem.minAngularSpeed;
  18361. particleSystem.maxAngularSpeed = parsedParticleSystem.maxAngularSpeed;
  18362. particleSystem.minSize = parsedParticleSystem.minSize;
  18363. particleSystem.maxSize = parsedParticleSystem.maxSize;
  18364. particleSystem.minLifeTime = parsedParticleSystem.minLifeTime;
  18365. particleSystem.maxLifeTime = parsedParticleSystem.maxLifeTime;
  18366. particleSystem.emitter = emitter;
  18367. particleSystem.emitRate = parsedParticleSystem.emitRate;
  18368. particleSystem.minEmitBox = BABYLON.Vector3.FromArray(parsedParticleSystem.minEmitBox);
  18369. particleSystem.maxEmitBox = BABYLON.Vector3.FromArray(parsedParticleSystem.maxEmitBox);
  18370. particleSystem.gravity = BABYLON.Vector3.FromArray(parsedParticleSystem.gravity);
  18371. particleSystem.direction1 = BABYLON.Vector3.FromArray(parsedParticleSystem.direction1);
  18372. particleSystem.direction2 = BABYLON.Vector3.FromArray(parsedParticleSystem.direction2);
  18373. particleSystem.color1 = BABYLON.Color4.FromArray(parsedParticleSystem.color1);
  18374. particleSystem.color2 = BABYLON.Color4.FromArray(parsedParticleSystem.color2);
  18375. particleSystem.colorDead = BABYLON.Color4.FromArray(parsedParticleSystem.colorDead);
  18376. particleSystem.updateSpeed = parsedParticleSystem.updateSpeed;
  18377. particleSystem.targetStopDuration = parsedParticleSystem.targetStopFrame;
  18378. particleSystem.textureMask = BABYLON.Color4.FromArray(parsedParticleSystem.textureMask);
  18379. particleSystem.blendMode = parsedParticleSystem.blendMode;
  18380. particleSystem.start();
  18381. return particleSystem;
  18382. };
  18383. var parseShadowGenerator = function (parsedShadowGenerator, scene) {
  18384. var light = scene.getLightByID(parsedShadowGenerator.lightId);
  18385. var shadowGenerator = new BABYLON.ShadowGenerator(parsedShadowGenerator.mapSize, light);
  18386. for (var meshIndex = 0; meshIndex < parsedShadowGenerator.renderList.length; meshIndex++) {
  18387. var mesh = scene.getMeshByID(parsedShadowGenerator.renderList[meshIndex]);
  18388. shadowGenerator.getShadowMap().renderList.push(mesh);
  18389. }
  18390. if (parsedShadowGenerator.usePoissonSampling) {
  18391. shadowGenerator.usePoissonSampling = true;
  18392. }
  18393. else {
  18394. shadowGenerator.useVarianceShadowMap = parsedShadowGenerator.useVarianceShadowMap;
  18395. }
  18396. return shadowGenerator;
  18397. };
  18398. var parseAnimation = function (parsedAnimation) {
  18399. var animation = new BABYLON.Animation(parsedAnimation.name, parsedAnimation.property, parsedAnimation.framePerSecond, parsedAnimation.dataType, parsedAnimation.loopBehavior);
  18400. var dataType = parsedAnimation.dataType;
  18401. var keys = [];
  18402. for (var index = 0; index < parsedAnimation.keys.length; index++) {
  18403. var key = parsedAnimation.keys[index];
  18404. var data;
  18405. switch (dataType) {
  18406. case BABYLON.Animation.ANIMATIONTYPE_FLOAT:
  18407. data = key.values[0];
  18408. break;
  18409. case BABYLON.Animation.ANIMATIONTYPE_QUATERNION:
  18410. data = BABYLON.Quaternion.FromArray(key.values);
  18411. break;
  18412. case BABYLON.Animation.ANIMATIONTYPE_MATRIX:
  18413. data = BABYLON.Matrix.FromArray(key.values);
  18414. break;
  18415. case BABYLON.Animation.ANIMATIONTYPE_VECTOR3:
  18416. default:
  18417. data = BABYLON.Vector3.FromArray(key.values);
  18418. break;
  18419. }
  18420. keys.push({
  18421. frame: key.frame,
  18422. value: data
  18423. });
  18424. }
  18425. animation.setKeys(keys);
  18426. return animation;
  18427. };
  18428. var parseLight = function (parsedLight, scene) {
  18429. var light;
  18430. switch (parsedLight.type) {
  18431. case 0:
  18432. light = new BABYLON.PointLight(parsedLight.name, BABYLON.Vector3.FromArray(parsedLight.position), scene);
  18433. break;
  18434. case 1:
  18435. light = new BABYLON.DirectionalLight(parsedLight.name, BABYLON.Vector3.FromArray(parsedLight.direction), scene);
  18436. light.position = BABYLON.Vector3.FromArray(parsedLight.position);
  18437. break;
  18438. case 2:
  18439. light = new BABYLON.SpotLight(parsedLight.name, BABYLON.Vector3.FromArray(parsedLight.position), BABYLON.Vector3.FromArray(parsedLight.direction), parsedLight.angle, parsedLight.exponent, scene);
  18440. break;
  18441. case 3:
  18442. light = new BABYLON.HemisphericLight(parsedLight.name, BABYLON.Vector3.FromArray(parsedLight.direction), scene);
  18443. light.groundColor = BABYLON.Color3.FromArray(parsedLight.groundColor);
  18444. break;
  18445. }
  18446. light.id = parsedLight.id;
  18447. BABYLON.Tags.AddTagsTo(light, parsedLight.tags);
  18448. if (parsedLight.intensity !== undefined) {
  18449. light.intensity = parsedLight.intensity;
  18450. }
  18451. if (parsedLight.range) {
  18452. light.range = parsedLight.range;
  18453. }
  18454. light.diffuse = BABYLON.Color3.FromArray(parsedLight.diffuse);
  18455. light.specular = BABYLON.Color3.FromArray(parsedLight.specular);
  18456. if (parsedLight.excludedMeshesIds) {
  18457. light._excludedMeshesIds = parsedLight.excludedMeshesIds;
  18458. }
  18459. // Parent
  18460. if (parsedLight.parentId) {
  18461. light._waitingParentId = parsedLight.parentId;
  18462. }
  18463. if (parsedLight.includedOnlyMeshesIds) {
  18464. light._includedOnlyMeshesIds = parsedLight.includedOnlyMeshesIds;
  18465. }
  18466. // Animations
  18467. if (parsedLight.animations) {
  18468. for (var animationIndex = 0; animationIndex < parsedLight.animations.length; animationIndex++) {
  18469. var parsedAnimation = parsedLight.animations[animationIndex];
  18470. light.animations.push(parseAnimation(parsedAnimation));
  18471. }
  18472. }
  18473. if (parsedLight.autoAnimate) {
  18474. scene.beginAnimation(light, parsedLight.autoAnimateFrom, parsedLight.autoAnimateTo, parsedLight.autoAnimateLoop, 1.0);
  18475. }
  18476. };
  18477. var parseCamera = function (parsedCamera, scene) {
  18478. var camera;
  18479. var position = BABYLON.Vector3.FromArray(parsedCamera.position);
  18480. var lockedTargetMesh = (parsedCamera.lockedTargetId) ? scene.getLastMeshByID(parsedCamera.lockedTargetId) : null;
  18481. if (parsedCamera.type === "AnaglyphArcRotateCamera" || parsedCamera.type === "ArcRotateCamera") {
  18482. var alpha = parsedCamera.alpha;
  18483. var beta = parsedCamera.beta;
  18484. var radius = parsedCamera.radius;
  18485. if (parsedCamera.type === "AnaglyphArcRotateCamera") {
  18486. var eye_space = parsedCamera.eye_space;
  18487. camera = new BABYLON.AnaglyphArcRotateCamera(parsedCamera.name, alpha, beta, radius, lockedTargetMesh, eye_space, scene);
  18488. }
  18489. else {
  18490. camera = new BABYLON.ArcRotateCamera(parsedCamera.name, alpha, beta, radius, lockedTargetMesh, scene);
  18491. }
  18492. }
  18493. else if (parsedCamera.type === "AnaglyphFreeCamera") {
  18494. eye_space = parsedCamera.eye_space;
  18495. camera = new BABYLON.AnaglyphFreeCamera(parsedCamera.name, position, eye_space, scene);
  18496. }
  18497. else if (parsedCamera.type === "DeviceOrientationCamera") {
  18498. camera = new BABYLON.DeviceOrientationCamera(parsedCamera.name, position, scene);
  18499. }
  18500. else if (parsedCamera.type === "FollowCamera") {
  18501. camera = new BABYLON.FollowCamera(parsedCamera.name, position, scene);
  18502. camera.heightOffset = parsedCamera.heightOffset;
  18503. camera.radius = parsedCamera.radius;
  18504. camera.rotationOffset = parsedCamera.rotationOffset;
  18505. if (lockedTargetMesh)
  18506. camera.target = lockedTargetMesh;
  18507. }
  18508. else if (parsedCamera.type === "GamepadCamera") {
  18509. camera = new BABYLON.GamepadCamera(parsedCamera.name, position, scene);
  18510. }
  18511. else if (parsedCamera.type === "OculusCamera") {
  18512. camera = new BABYLON.OculusCamera(parsedCamera.name, position, scene);
  18513. }
  18514. else if (parsedCamera.type === "OculusGamepadCamera") {
  18515. camera = new BABYLON.OculusGamepadCamera(parsedCamera.name, position, scene);
  18516. }
  18517. else if (parsedCamera.type === "TouchCamera") {
  18518. camera = new BABYLON.TouchCamera(parsedCamera.name, position, scene);
  18519. }
  18520. else if (parsedCamera.type === "VirtualJoysticksCamera") {
  18521. camera = new BABYLON.VirtualJoysticksCamera(parsedCamera.name, position, scene);
  18522. }
  18523. else if (parsedCamera.type === "WebVRCamera") {
  18524. camera = new BABYLON.WebVRCamera(parsedCamera.name, position, scene);
  18525. }
  18526. else if (parsedCamera.type === "VRDeviceOrientationCamera") {
  18527. camera = new BABYLON.VRDeviceOrientationCamera(parsedCamera.name, position, scene);
  18528. }
  18529. else {
  18530. // Free Camera is the default value
  18531. camera = new BABYLON.FreeCamera(parsedCamera.name, position, scene);
  18532. }
  18533. // Test for lockedTargetMesh & FreeCamera outside of if-else-if nest, since things like GamepadCamera extend FreeCamera
  18534. if (lockedTargetMesh && camera instanceof BABYLON.FreeCamera) {
  18535. camera.lockedTarget = lockedTargetMesh;
  18536. }
  18537. camera.id = parsedCamera.id;
  18538. BABYLON.Tags.AddTagsTo(camera, parsedCamera.tags);
  18539. // Parent
  18540. if (parsedCamera.parentId) {
  18541. camera._waitingParentId = parsedCamera.parentId;
  18542. }
  18543. // Target
  18544. if (parsedCamera.target) {
  18545. camera.setTarget(BABYLON.Vector3.FromArray(parsedCamera.target));
  18546. }
  18547. else {
  18548. camera.rotation = BABYLON.Vector3.FromArray(parsedCamera.rotation);
  18549. }
  18550. camera.fov = parsedCamera.fov;
  18551. camera.minZ = parsedCamera.minZ;
  18552. camera.maxZ = parsedCamera.maxZ;
  18553. camera.speed = parsedCamera.speed;
  18554. camera.inertia = parsedCamera.inertia;
  18555. camera.checkCollisions = parsedCamera.checkCollisions;
  18556. camera.applyGravity = parsedCamera.applyGravity;
  18557. if (parsedCamera.ellipsoid) {
  18558. camera.ellipsoid = BABYLON.Vector3.FromArray(parsedCamera.ellipsoid);
  18559. }
  18560. // Animations
  18561. if (parsedCamera.animations) {
  18562. for (var animationIndex = 0; animationIndex < parsedCamera.animations.length; animationIndex++) {
  18563. var parsedAnimation = parsedCamera.animations[animationIndex];
  18564. camera.animations.push(parseAnimation(parsedAnimation));
  18565. }
  18566. }
  18567. if (parsedCamera.autoAnimate) {
  18568. scene.beginAnimation(camera, parsedCamera.autoAnimateFrom, parsedCamera.autoAnimateTo, parsedCamera.autoAnimateLoop, 1.0);
  18569. }
  18570. // Layer Mask
  18571. if (parsedCamera.layerMask && (!isNaN(parsedCamera.layerMask))) {
  18572. camera.layerMask = Math.abs(parseInt(parsedCamera.layerMask));
  18573. }
  18574. else {
  18575. camera.layerMask = 0xFFFFFFFF;
  18576. }
  18577. return camera;
  18578. };
  18579. var parseGeometry = function (parsedGeometry, scene) {
  18580. var id = parsedGeometry.id;
  18581. return scene.getGeometryByID(id);
  18582. };
  18583. var parseBox = function (parsedBox, scene) {
  18584. if (parseGeometry(parsedBox, scene)) {
  18585. return null; // null since geometry could be something else than a box...
  18586. }
  18587. var box = new BABYLON.Geometry.Primitives.Box(parsedBox.id, scene, parsedBox.size, parsedBox.canBeRegenerated, null);
  18588. BABYLON.Tags.AddTagsTo(box, parsedBox.tags);
  18589. scene.pushGeometry(box, true);
  18590. return box;
  18591. };
  18592. var parseSphere = function (parsedSphere, scene) {
  18593. if (parseGeometry(parsedSphere, scene)) {
  18594. return null; // null since geometry could be something else than a sphere...
  18595. }
  18596. var sphere = new BABYLON.Geometry.Primitives.Sphere(parsedSphere.id, scene, parsedSphere.segments, parsedSphere.diameter, parsedSphere.canBeRegenerated, null);
  18597. BABYLON.Tags.AddTagsTo(sphere, parsedSphere.tags);
  18598. scene.pushGeometry(sphere, true);
  18599. return sphere;
  18600. };
  18601. var parseCylinder = function (parsedCylinder, scene) {
  18602. if (parseGeometry(parsedCylinder, scene)) {
  18603. return null; // null since geometry could be something else than a cylinder...
  18604. }
  18605. var cylinder = new BABYLON.Geometry.Primitives.Cylinder(parsedCylinder.id, scene, parsedCylinder.height, parsedCylinder.diameterTop, parsedCylinder.diameterBottom, parsedCylinder.tessellation, parsedCylinder.subdivisions, parsedCylinder.canBeRegenerated, null);
  18606. BABYLON.Tags.AddTagsTo(cylinder, parsedCylinder.tags);
  18607. scene.pushGeometry(cylinder, true);
  18608. return cylinder;
  18609. };
  18610. var parseTorus = function (parsedTorus, scene) {
  18611. if (parseGeometry(parsedTorus, scene)) {
  18612. return null; // null since geometry could be something else than a torus...
  18613. }
  18614. var torus = new BABYLON.Geometry.Primitives.Torus(parsedTorus.id, scene, parsedTorus.diameter, parsedTorus.thickness, parsedTorus.tessellation, parsedTorus.canBeRegenerated, null);
  18615. BABYLON.Tags.AddTagsTo(torus, parsedTorus.tags);
  18616. scene.pushGeometry(torus, true);
  18617. return torus;
  18618. };
  18619. var parseGround = function (parsedGround, scene) {
  18620. if (parseGeometry(parsedGround, scene)) {
  18621. return null; // null since geometry could be something else than a ground...
  18622. }
  18623. var ground = new BABYLON.Geometry.Primitives.Ground(parsedGround.id, scene, parsedGround.width, parsedGround.height, parsedGround.subdivisions, parsedGround.canBeRegenerated, null);
  18624. BABYLON.Tags.AddTagsTo(ground, parsedGround.tags);
  18625. scene.pushGeometry(ground, true);
  18626. return ground;
  18627. };
  18628. var parsePlane = function (parsedPlane, scene) {
  18629. if (parseGeometry(parsedPlane, scene)) {
  18630. return null; // null since geometry could be something else than a plane...
  18631. }
  18632. var plane = new BABYLON.Geometry.Primitives.Plane(parsedPlane.id, scene, parsedPlane.size, parsedPlane.canBeRegenerated, null);
  18633. BABYLON.Tags.AddTagsTo(plane, parsedPlane.tags);
  18634. scene.pushGeometry(plane, true);
  18635. return plane;
  18636. };
  18637. var parseTorusKnot = function (parsedTorusKnot, scene) {
  18638. if (parseGeometry(parsedTorusKnot, scene)) {
  18639. return null; // null since geometry could be something else than a torusKnot...
  18640. }
  18641. var torusKnot = new BABYLON.Geometry.Primitives.TorusKnot(parsedTorusKnot.id, scene, parsedTorusKnot.radius, parsedTorusKnot.tube, parsedTorusKnot.radialSegments, parsedTorusKnot.tubularSegments, parsedTorusKnot.p, parsedTorusKnot.q, parsedTorusKnot.canBeRegenerated, null);
  18642. BABYLON.Tags.AddTagsTo(torusKnot, parsedTorusKnot.tags);
  18643. scene.pushGeometry(torusKnot, true);
  18644. return torusKnot;
  18645. };
  18646. var parseVertexData = function (parsedVertexData, scene, rootUrl) {
  18647. if (parseGeometry(parsedVertexData, scene)) {
  18648. return null; // null since geometry could be a primitive
  18649. }
  18650. var geometry = new BABYLON.Geometry(parsedVertexData.id, scene);
  18651. BABYLON.Tags.AddTagsTo(geometry, parsedVertexData.tags);
  18652. if (parsedVertexData.delayLoadingFile) {
  18653. geometry.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NOTLOADED;
  18654. geometry.delayLoadingFile = rootUrl + parsedVertexData.delayLoadingFile;
  18655. geometry._boundingInfo = new BABYLON.BoundingInfo(BABYLON.Vector3.FromArray(parsedVertexData.boundingBoxMinimum), BABYLON.Vector3.FromArray(parsedVertexData.boundingBoxMaximum));
  18656. geometry._delayInfo = [];
  18657. if (parsedVertexData.hasUVs) {
  18658. geometry._delayInfo.push(BABYLON.VertexBuffer.UVKind);
  18659. }
  18660. if (parsedVertexData.hasUVs2) {
  18661. geometry._delayInfo.push(BABYLON.VertexBuffer.UV2Kind);
  18662. }
  18663. if (parsedVertexData.hasColors) {
  18664. geometry._delayInfo.push(BABYLON.VertexBuffer.ColorKind);
  18665. }
  18666. if (parsedVertexData.hasMatricesIndices) {
  18667. geometry._delayInfo.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  18668. }
  18669. if (parsedVertexData.hasMatricesWeights) {
  18670. geometry._delayInfo.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  18671. }
  18672. geometry._delayLoadingFunction = importVertexData;
  18673. }
  18674. else {
  18675. importVertexData(parsedVertexData, geometry);
  18676. }
  18677. scene.pushGeometry(geometry, true);
  18678. return geometry;
  18679. };
  18680. var parseMesh = function (parsedMesh, scene, rootUrl) {
  18681. var mesh = new BABYLON.Mesh(parsedMesh.name, scene);
  18682. mesh.id = parsedMesh.id;
  18683. BABYLON.Tags.AddTagsTo(mesh, parsedMesh.tags);
  18684. mesh.position = BABYLON.Vector3.FromArray(parsedMesh.position);
  18685. if (parsedMesh.rotationQuaternion) {
  18686. mesh.rotationQuaternion = BABYLON.Quaternion.FromArray(parsedMesh.rotationQuaternion);
  18687. }
  18688. else if (parsedMesh.rotation) {
  18689. mesh.rotation = BABYLON.Vector3.FromArray(parsedMesh.rotation);
  18690. }
  18691. mesh.scaling = BABYLON.Vector3.FromArray(parsedMesh.scaling);
  18692. if (parsedMesh.localMatrix) {
  18693. mesh.setPivotMatrix(BABYLON.Matrix.FromArray(parsedMesh.localMatrix));
  18694. }
  18695. else if (parsedMesh.pivotMatrix) {
  18696. mesh.setPivotMatrix(BABYLON.Matrix.FromArray(parsedMesh.pivotMatrix));
  18697. }
  18698. mesh.setEnabled(parsedMesh.isEnabled);
  18699. mesh.isVisible = parsedMesh.isVisible;
  18700. mesh.infiniteDistance = parsedMesh.infiniteDistance;
  18701. mesh.showBoundingBox = parsedMesh.showBoundingBox;
  18702. mesh.showSubMeshesBoundingBox = parsedMesh.showSubMeshesBoundingBox;
  18703. if (parsedMesh.applyFog !== undefined) {
  18704. mesh.applyFog = parsedMesh.applyFog;
  18705. }
  18706. if (parsedMesh.pickable !== undefined) {
  18707. mesh.isPickable = parsedMesh.pickable;
  18708. }
  18709. if (parsedMesh.alphaIndex !== undefined) {
  18710. mesh.alphaIndex = parsedMesh.alphaIndex;
  18711. }
  18712. mesh.receiveShadows = parsedMesh.receiveShadows;
  18713. mesh.billboardMode = parsedMesh.billboardMode;
  18714. if (parsedMesh.visibility !== undefined) {
  18715. mesh.visibility = parsedMesh.visibility;
  18716. }
  18717. mesh.checkCollisions = parsedMesh.checkCollisions;
  18718. mesh._shouldGenerateFlatShading = parsedMesh.useFlatShading;
  18719. // Parent
  18720. if (parsedMesh.parentId) {
  18721. mesh._waitingParentId = parsedMesh.parentId;
  18722. }
  18723. // Actions
  18724. if (parsedMesh.actions !== undefined) {
  18725. mesh._waitingActions = parsedMesh.actions;
  18726. }
  18727. // Geometry
  18728. mesh.hasVertexAlpha = parsedMesh.hasVertexAlpha;
  18729. if (parsedMesh.delayLoadingFile) {
  18730. mesh.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NOTLOADED;
  18731. mesh.delayLoadingFile = rootUrl + parsedMesh.delayLoadingFile;
  18732. mesh._boundingInfo = new BABYLON.BoundingInfo(BABYLON.Vector3.FromArray(parsedMesh.boundingBoxMinimum), BABYLON.Vector3.FromArray(parsedMesh.boundingBoxMaximum));
  18733. if (parsedMesh._binaryInfo) {
  18734. mesh._binaryInfo = parsedMesh._binaryInfo;
  18735. }
  18736. mesh._delayInfo = [];
  18737. if (parsedMesh.hasUVs) {
  18738. mesh._delayInfo.push(BABYLON.VertexBuffer.UVKind);
  18739. }
  18740. if (parsedMesh.hasUVs2) {
  18741. mesh._delayInfo.push(BABYLON.VertexBuffer.UV2Kind);
  18742. }
  18743. if (parsedMesh.hasColors) {
  18744. mesh._delayInfo.push(BABYLON.VertexBuffer.ColorKind);
  18745. }
  18746. if (parsedMesh.hasMatricesIndices) {
  18747. mesh._delayInfo.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  18748. }
  18749. if (parsedMesh.hasMatricesWeights) {
  18750. mesh._delayInfo.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  18751. }
  18752. mesh._delayLoadingFunction = importGeometry;
  18753. if (BABYLON.SceneLoader.ForceFullSceneLoadingForIncremental) {
  18754. mesh._checkDelayState();
  18755. }
  18756. }
  18757. else {
  18758. importGeometry(parsedMesh, mesh);
  18759. }
  18760. // Material
  18761. if (parsedMesh.materialId) {
  18762. mesh.setMaterialByID(parsedMesh.materialId);
  18763. }
  18764. else {
  18765. mesh.material = null;
  18766. }
  18767. // Skeleton
  18768. if (parsedMesh.skeletonId > -1) {
  18769. mesh.skeleton = scene.getLastSkeletonByID(parsedMesh.skeletonId);
  18770. }
  18771. // Physics
  18772. if (parsedMesh.physicsImpostor) {
  18773. if (!scene.isPhysicsEnabled()) {
  18774. scene.enablePhysics();
  18775. }
  18776. mesh.setPhysicsState({ impostor: parsedMesh.physicsImpostor, mass: parsedMesh.physicsMass, friction: parsedMesh.physicsFriction, restitution: parsedMesh.physicsRestitution });
  18777. }
  18778. // Animations
  18779. if (parsedMesh.animations) {
  18780. for (var animationIndex = 0; animationIndex < parsedMesh.animations.length; animationIndex++) {
  18781. var parsedAnimation = parsedMesh.animations[animationIndex];
  18782. mesh.animations.push(parseAnimation(parsedAnimation));
  18783. }
  18784. }
  18785. if (parsedMesh.autoAnimate) {
  18786. scene.beginAnimation(mesh, parsedMesh.autoAnimateFrom, parsedMesh.autoAnimateTo, parsedMesh.autoAnimateLoop, 1.0);
  18787. }
  18788. // Layer Mask
  18789. if (parsedMesh.layerMask && (!isNaN(parsedMesh.layerMask))) {
  18790. mesh.layerMask = Math.abs(parseInt(parsedMesh.layerMask));
  18791. }
  18792. else {
  18793. mesh.layerMask = 0xFFFFFFFF;
  18794. }
  18795. // Instances
  18796. if (parsedMesh.instances) {
  18797. for (var index = 0; index < parsedMesh.instances.length; index++) {
  18798. var parsedInstance = parsedMesh.instances[index];
  18799. var instance = mesh.createInstance(parsedInstance.name);
  18800. BABYLON.Tags.AddTagsTo(instance, parsedInstance.tags);
  18801. instance.position = BABYLON.Vector3.FromArray(parsedInstance.position);
  18802. if (parsedInstance.rotationQuaternion) {
  18803. instance.rotationQuaternion = BABYLON.Quaternion.FromArray(parsedInstance.rotationQuaternion);
  18804. }
  18805. else if (parsedInstance.rotation) {
  18806. instance.rotation = BABYLON.Vector3.FromArray(parsedInstance.rotation);
  18807. }
  18808. instance.scaling = BABYLON.Vector3.FromArray(parsedInstance.scaling);
  18809. instance.checkCollisions = mesh.checkCollisions;
  18810. if (parsedMesh.animations) {
  18811. for (animationIndex = 0; animationIndex < parsedMesh.animations.length; animationIndex++) {
  18812. parsedAnimation = parsedMesh.animations[animationIndex];
  18813. instance.animations.push(parseAnimation(parsedAnimation));
  18814. }
  18815. }
  18816. }
  18817. }
  18818. return mesh;
  18819. };
  18820. var parseActions = function (parsedActions, object, scene) {
  18821. var actionManager = new BABYLON.ActionManager(scene);
  18822. if (object === null)
  18823. scene.actionManager = actionManager;
  18824. else
  18825. object.actionManager = actionManager;
  18826. // instanciate a new object
  18827. var instanciate = function (name, params) {
  18828. var newInstance = Object.create(BABYLON[name].prototype);
  18829. newInstance.constructor.apply(newInstance, params);
  18830. return newInstance;
  18831. };
  18832. var parseParameter = function (name, value, target, propertyPath) {
  18833. if (propertyPath === null) {
  18834. // String, boolean or float
  18835. var floatValue = parseFloat(value);
  18836. if (value === "true" || value === "false")
  18837. return value === "true";
  18838. else
  18839. return isNaN(floatValue) ? value : floatValue;
  18840. }
  18841. var effectiveTarget = propertyPath.split(".");
  18842. var values = value.split(",");
  18843. for (var i = 0; i < effectiveTarget.length; i++) {
  18844. target = target[effectiveTarget[i]];
  18845. }
  18846. // Return appropriate value with its type
  18847. if (target instanceof Boolean)
  18848. return values[0] === "true";
  18849. if (target instanceof String)
  18850. return values[0];
  18851. // Parameters with multiple values such as Vector3 etc.
  18852. var split = new Array();
  18853. for (var i = 0; i < values.length; i++)
  18854. split.push(parseFloat(values[i]));
  18855. if (target instanceof BABYLON.Vector3)
  18856. return BABYLON.Vector3.FromArray(split);
  18857. if (target instanceof BABYLON.Vector4)
  18858. return BABYLON.Vector4.FromArray(split);
  18859. if (target instanceof BABYLON.Color3)
  18860. return BABYLON.Color3.FromArray(split);
  18861. if (target instanceof BABYLON.Color4)
  18862. return BABYLON.Color4.FromArray(split);
  18863. return parseFloat(values[0]);
  18864. };
  18865. // traverse graph per trigger
  18866. var traverse = function (parsedAction, trigger, condition, action) {
  18867. var parameters = new Array();
  18868. var target = null;
  18869. var propertyPath = null;
  18870. // Parameters
  18871. if (parsedAction.type === 2)
  18872. parameters.push(actionManager);
  18873. else
  18874. parameters.push(trigger);
  18875. for (var i = 0; i < parsedAction.properties.length; i++) {
  18876. var value = parsedAction.properties[i].value;
  18877. var name = parsedAction.properties[i].name;
  18878. if (name === "target")
  18879. value = target = scene.getNodeByName(value);
  18880. else if (name === "parent")
  18881. value = scene.getNodeByName(value);
  18882. else if (name === "sound")
  18883. value = scene.getSoundByName(value);
  18884. else if (name !== "propertyPath") {
  18885. if (parsedAction.type === 2 && name === "operator")
  18886. value = BABYLON.ValueCondition[value];
  18887. else
  18888. value = parseParameter(name, value, target, name === "value" ? propertyPath : null);
  18889. }
  18890. else {
  18891. propertyPath = value;
  18892. }
  18893. parameters.push(value);
  18894. }
  18895. parameters.push(condition);
  18896. // If interpolate value action
  18897. if (parsedAction.name === "InterpolateValueAction") {
  18898. var param = parameters[parameters.length - 2];
  18899. parameters[parameters.length - 1] = param;
  18900. parameters[parameters.length - 2] = condition;
  18901. }
  18902. // Action or condition(s)
  18903. var newAction = instanciate(parsedAction.name, parameters);
  18904. if (newAction instanceof BABYLON.Condition) {
  18905. condition = newAction;
  18906. newAction = action;
  18907. }
  18908. else {
  18909. condition = null;
  18910. if (action)
  18911. action.then(newAction);
  18912. else
  18913. actionManager.registerAction(newAction);
  18914. }
  18915. for (var i = 0; i < parsedAction.children.length; i++)
  18916. traverse(parsedAction.children[i], trigger, condition, newAction);
  18917. };
  18918. for (var i = 0; i < parsedActions.children.length; i++) {
  18919. var triggerParams;
  18920. var trigger = parsedActions.children[i];
  18921. if (trigger.properties.length > 0) {
  18922. triggerParams = { trigger: BABYLON.ActionManager[trigger.name], parameter: scene.getMeshByName(trigger.properties[0].value) };
  18923. }
  18924. else
  18925. triggerParams = BABYLON.ActionManager[trigger.name];
  18926. for (var j = 0; j < trigger.children.length; j++)
  18927. traverse(trigger.children[j], triggerParams, null, null);
  18928. }
  18929. };
  18930. var parseSound = function (parsedSound, scene, rootUrl) {
  18931. var soundName = parsedSound.name;
  18932. var soundUrl = rootUrl + soundName;
  18933. var options = {
  18934. autoplay: parsedSound.autoplay,
  18935. loop: parsedSound.loop,
  18936. volume: parsedSound.volume,
  18937. spatialSound: parsedSound.spatialSound,
  18938. maxDistance: parsedSound.maxDistance,
  18939. rolloffFactor: parsedSound.rolloffFactor,
  18940. refDistance: parsedSound.refDistance,
  18941. distanceModel: parsedSound.distanceModel,
  18942. panningModel: parsedSound.panningModel,
  18943. playbackRate: parsedSound.playbackRate
  18944. };
  18945. var newSound = new BABYLON.Sound(soundName, soundUrl, scene, function () {
  18946. scene._removePendingData(newSound);
  18947. }, options);
  18948. scene._addPendingData(newSound);
  18949. if (parsedSound.position) {
  18950. var soundPosition = BABYLON.Vector3.FromArray(parsedSound.position);
  18951. newSound.setPosition(soundPosition);
  18952. }
  18953. if (parsedSound.isDirectional) {
  18954. newSound.setDirectionalCone(parsedSound.coneInnerAngle || 360, parsedSound.coneOuterAngle || 360, parsedSound.coneOuterGain || 0);
  18955. if (parsedSound.localDirectionToMesh) {
  18956. var localDirectionToMesh = BABYLON.Vector3.FromArray(parsedSound.localDirectionToMesh);
  18957. newSound.setLocalDirectionToMesh(localDirectionToMesh);
  18958. }
  18959. }
  18960. if (parsedSound.connectedMeshId) {
  18961. var connectedMesh = scene.getMeshByID(parsedSound.connectedMeshId);
  18962. if (connectedMesh) {
  18963. newSound.attachToMesh(connectedMesh);
  18964. }
  18965. }
  18966. };
  18967. var isDescendantOf = function (mesh, names, hierarchyIds) {
  18968. names = (names instanceof Array) ? names : [names];
  18969. for (var i in names) {
  18970. if (mesh.name === names[i]) {
  18971. hierarchyIds.push(mesh.id);
  18972. return true;
  18973. }
  18974. }
  18975. if (mesh.parentId && hierarchyIds.indexOf(mesh.parentId) !== -1) {
  18976. hierarchyIds.push(mesh.id);
  18977. return true;
  18978. }
  18979. return false;
  18980. };
  18981. var importVertexData = function (parsedVertexData, geometry) {
  18982. var vertexData = new BABYLON.VertexData();
  18983. // positions
  18984. var positions = parsedVertexData.positions;
  18985. if (positions) {
  18986. vertexData.set(positions, BABYLON.VertexBuffer.PositionKind);
  18987. }
  18988. // normals
  18989. var normals = parsedVertexData.normals;
  18990. if (normals) {
  18991. vertexData.set(normals, BABYLON.VertexBuffer.NormalKind);
  18992. }
  18993. // uvs
  18994. var uvs = parsedVertexData.uvs;
  18995. if (uvs) {
  18996. vertexData.set(uvs, BABYLON.VertexBuffer.UVKind);
  18997. }
  18998. // uv2s
  18999. var uv2s = parsedVertexData.uv2s;
  19000. if (uv2s) {
  19001. vertexData.set(uv2s, BABYLON.VertexBuffer.UV2Kind);
  19002. }
  19003. // colors
  19004. var colors = parsedVertexData.colors;
  19005. if (colors) {
  19006. vertexData.set(checkColors4(colors, positions.length / 3), BABYLON.VertexBuffer.ColorKind);
  19007. }
  19008. // matricesIndices
  19009. var matricesIndices = parsedVertexData.matricesIndices;
  19010. if (matricesIndices) {
  19011. vertexData.set(matricesIndices, BABYLON.VertexBuffer.MatricesIndicesKind);
  19012. }
  19013. // matricesWeights
  19014. var matricesWeights = parsedVertexData.matricesWeights;
  19015. if (matricesWeights) {
  19016. vertexData.set(matricesWeights, BABYLON.VertexBuffer.MatricesWeightsKind);
  19017. }
  19018. // indices
  19019. var indices = parsedVertexData.indices;
  19020. if (indices) {
  19021. vertexData.indices = indices;
  19022. }
  19023. geometry.setAllVerticesData(vertexData, parsedVertexData.updatable);
  19024. };
  19025. var importGeometry = function (parsedGeometry, mesh) {
  19026. var scene = mesh.getScene();
  19027. // Geometry
  19028. var geometryId = parsedGeometry.geometryId;
  19029. if (geometryId) {
  19030. var geometry = scene.getGeometryByID(geometryId);
  19031. if (geometry) {
  19032. geometry.applyToMesh(mesh);
  19033. }
  19034. }
  19035. else if (parsedGeometry instanceof ArrayBuffer) {
  19036. var binaryInfo = mesh._binaryInfo;
  19037. if (binaryInfo.positionsAttrDesc && binaryInfo.positionsAttrDesc.count > 0) {
  19038. var positionsData = new Float32Array(parsedGeometry, binaryInfo.positionsAttrDesc.offset, binaryInfo.positionsAttrDesc.count);
  19039. mesh.setVerticesData(BABYLON.VertexBuffer.PositionKind, positionsData, false);
  19040. }
  19041. if (binaryInfo.normalsAttrDesc && binaryInfo.normalsAttrDesc.count > 0) {
  19042. var normalsData = new Float32Array(parsedGeometry, binaryInfo.normalsAttrDesc.offset, binaryInfo.normalsAttrDesc.count);
  19043. mesh.setVerticesData(BABYLON.VertexBuffer.NormalKind, normalsData, false);
  19044. }
  19045. if (binaryInfo.uvsAttrDesc && binaryInfo.uvsAttrDesc.count > 0) {
  19046. var uvsData = new Float32Array(parsedGeometry, binaryInfo.uvsAttrDesc.offset, binaryInfo.uvsAttrDesc.count);
  19047. mesh.setVerticesData(BABYLON.VertexBuffer.UVKind, uvsData, false);
  19048. }
  19049. if (binaryInfo.uvs2AttrDesc && binaryInfo.uvs2AttrDesc.count > 0) {
  19050. var uvs2Data = new Float32Array(parsedGeometry, binaryInfo.uvs2AttrDesc.offset, binaryInfo.uvs2AttrDesc.count);
  19051. mesh.setVerticesData(BABYLON.VertexBuffer.UV2Kind, uvs2Data, false);
  19052. }
  19053. if (binaryInfo.colorsAttrDesc && binaryInfo.colorsAttrDesc.count > 0) {
  19054. var colorsData = new Float32Array(parsedGeometry, binaryInfo.colorsAttrDesc.offset, binaryInfo.colorsAttrDesc.count);
  19055. mesh.setVerticesData(BABYLON.VertexBuffer.ColorKind, colorsData, false);
  19056. }
  19057. if (binaryInfo.matricesIndicesAttrDesc && binaryInfo.matricesIndicesAttrDesc.count > 0) {
  19058. var matricesIndicesData = new Int32Array(parsedGeometry, binaryInfo.matricesIndicesAttrDesc.offset, binaryInfo.matricesIndicesAttrDesc.count);
  19059. mesh.setVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, matricesIndicesData, false);
  19060. }
  19061. if (binaryInfo.matricesWeightsAttrDesc && binaryInfo.matricesWeightsAttrDesc.count > 0) {
  19062. var matricesWeightsData = new Float32Array(parsedGeometry, binaryInfo.matricesWeightsAttrDesc.offset, binaryInfo.matricesWeightsAttrDesc.count);
  19063. mesh.setVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind, matricesWeightsData, false);
  19064. }
  19065. if (binaryInfo.indicesAttrDesc && binaryInfo.indicesAttrDesc.count > 0) {
  19066. var indicesData = new Int32Array(parsedGeometry, binaryInfo.indicesAttrDesc.offset, binaryInfo.indicesAttrDesc.count);
  19067. mesh.setIndices(indicesData);
  19068. }
  19069. if (binaryInfo.subMeshesAttrDesc && binaryInfo.subMeshesAttrDesc.count > 0) {
  19070. var subMeshesData = new Int32Array(parsedGeometry, binaryInfo.subMeshesAttrDesc.offset, binaryInfo.subMeshesAttrDesc.count * 5);
  19071. mesh.subMeshes = [];
  19072. for (var i = 0; i < binaryInfo.subMeshesAttrDesc.count; i++) {
  19073. var materialIndex = subMeshesData[(i * 5) + 0];
  19074. var verticesStart = subMeshesData[(i * 5) + 1];
  19075. var verticesCount = subMeshesData[(i * 5) + 2];
  19076. var indexStart = subMeshesData[(i * 5) + 3];
  19077. var indexCount = subMeshesData[(i * 5) + 4];
  19078. var subMesh = new BABYLON.SubMesh(materialIndex, verticesStart, verticesCount, indexStart, indexCount, mesh);
  19079. }
  19080. }
  19081. }
  19082. else if (parsedGeometry.positions && parsedGeometry.normals && parsedGeometry.indices) {
  19083. mesh.setVerticesData(BABYLON.VertexBuffer.PositionKind, parsedGeometry.positions, false);
  19084. mesh.setVerticesData(BABYLON.VertexBuffer.NormalKind, parsedGeometry.normals, false);
  19085. if (parsedGeometry.uvs) {
  19086. mesh.setVerticesData(BABYLON.VertexBuffer.UVKind, parsedGeometry.uvs, false);
  19087. }
  19088. if (parsedGeometry.uvs2) {
  19089. mesh.setVerticesData(BABYLON.VertexBuffer.UV2Kind, parsedGeometry.uvs2, false);
  19090. }
  19091. if (parsedGeometry.colors) {
  19092. mesh.setVerticesData(BABYLON.VertexBuffer.ColorKind, checkColors4(parsedGeometry.colors, parsedGeometry.positions.length / 3), false);
  19093. }
  19094. if (parsedGeometry.matricesIndices) {
  19095. if (!parsedGeometry.matricesIndices._isExpanded) {
  19096. var floatIndices = [];
  19097. for (var i = 0; i < parsedGeometry.matricesIndices.length; i++) {
  19098. var matricesIndex = parsedGeometry.matricesIndices[i];
  19099. floatIndices.push(matricesIndex & 0x000000FF);
  19100. floatIndices.push((matricesIndex & 0x0000FF00) >> 8);
  19101. floatIndices.push((matricesIndex & 0x00FF0000) >> 16);
  19102. floatIndices.push(matricesIndex >> 24);
  19103. }
  19104. mesh.setVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, floatIndices, false);
  19105. }
  19106. else {
  19107. delete parsedGeometry.matricesIndices._isExpanded;
  19108. mesh.setVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, parsedGeometry.matricesIndices, false);
  19109. }
  19110. }
  19111. if (parsedGeometry.matricesWeights) {
  19112. mesh.setVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind, parsedGeometry.matricesWeights, false);
  19113. }
  19114. mesh.setIndices(parsedGeometry.indices);
  19115. // SubMeshes
  19116. if (parsedGeometry.subMeshes) {
  19117. mesh.subMeshes = [];
  19118. for (var subIndex = 0; subIndex < parsedGeometry.subMeshes.length; subIndex++) {
  19119. var parsedSubMesh = parsedGeometry.subMeshes[subIndex];
  19120. var subMesh = new BABYLON.SubMesh(parsedSubMesh.materialIndex, parsedSubMesh.verticesStart, parsedSubMesh.verticesCount, parsedSubMesh.indexStart, parsedSubMesh.indexCount, mesh);
  19121. }
  19122. }
  19123. }
  19124. // Flat shading
  19125. if (mesh._shouldGenerateFlatShading) {
  19126. mesh.convertToFlatShadedMesh();
  19127. delete mesh._shouldGenerateFlatShading;
  19128. }
  19129. // Update
  19130. mesh.computeWorldMatrix(true);
  19131. // Octree
  19132. if (scene._selectionOctree) {
  19133. scene._selectionOctree.addMesh(mesh);
  19134. }
  19135. };
  19136. BABYLON.SceneLoader.RegisterPlugin({
  19137. extensions: ".babylon",
  19138. importMesh: function (meshesNames, scene, data, rootUrl, meshes, particleSystems, skeletons) {
  19139. var parsedData = JSON.parse(data);
  19140. var loadedSkeletonsIds = [];
  19141. var loadedMaterialsIds = [];
  19142. var hierarchyIds = [];
  19143. for (var index = 0; index < parsedData.meshes.length; index++) {
  19144. var parsedMesh = parsedData.meshes[index];
  19145. if (!meshesNames || isDescendantOf(parsedMesh, meshesNames, hierarchyIds)) {
  19146. if (meshesNames instanceof Array) {
  19147. // Remove found mesh name from list.
  19148. delete meshesNames[meshesNames.indexOf(parsedMesh.name)];
  19149. }
  19150. // Material ?
  19151. if (parsedMesh.materialId) {
  19152. var materialFound = (loadedMaterialsIds.indexOf(parsedMesh.materialId) !== -1);
  19153. if (!materialFound) {
  19154. for (var multimatIndex = 0; multimatIndex < parsedData.multiMaterials.length; multimatIndex++) {
  19155. var parsedMultiMaterial = parsedData.multiMaterials[multimatIndex];
  19156. if (parsedMultiMaterial.id == parsedMesh.materialId) {
  19157. for (var matIndex = 0; matIndex < parsedMultiMaterial.materials.length; matIndex++) {
  19158. var subMatId = parsedMultiMaterial.materials[matIndex];
  19159. loadedMaterialsIds.push(subMatId);
  19160. parseMaterialById(subMatId, parsedData, scene, rootUrl);
  19161. }
  19162. loadedMaterialsIds.push(parsedMultiMaterial.id);
  19163. parseMultiMaterial(parsedMultiMaterial, scene);
  19164. materialFound = true;
  19165. break;
  19166. }
  19167. }
  19168. }
  19169. if (!materialFound) {
  19170. loadedMaterialsIds.push(parsedMesh.materialId);
  19171. parseMaterialById(parsedMesh.materialId, parsedData, scene, rootUrl);
  19172. }
  19173. }
  19174. // Skeleton ?
  19175. if (parsedMesh.skeletonId > -1 && scene.skeletons) {
  19176. var skeletonAlreadyLoaded = (loadedSkeletonsIds.indexOf(parsedMesh.skeletonId) > -1);
  19177. if (!skeletonAlreadyLoaded) {
  19178. for (var skeletonIndex = 0; skeletonIndex < parsedData.skeletons.length; skeletonIndex++) {
  19179. var parsedSkeleton = parsedData.skeletons[skeletonIndex];
  19180. if (parsedSkeleton.id === parsedMesh.skeletonId) {
  19181. skeletons.push(parseSkeleton(parsedSkeleton, scene));
  19182. loadedSkeletonsIds.push(parsedSkeleton.id);
  19183. }
  19184. }
  19185. }
  19186. }
  19187. var mesh = parseMesh(parsedMesh, scene, rootUrl);
  19188. meshes.push(mesh);
  19189. }
  19190. }
  19191. for (index = 0; index < scene.meshes.length; index++) {
  19192. var currentMesh = scene.meshes[index];
  19193. if (currentMesh._waitingParentId) {
  19194. currentMesh.parent = scene.getLastEntryByID(currentMesh._waitingParentId);
  19195. currentMesh._waitingParentId = undefined;
  19196. }
  19197. }
  19198. // Particles
  19199. if (parsedData.particleSystems) {
  19200. for (index = 0; index < parsedData.particleSystems.length; index++) {
  19201. var parsedParticleSystem = parsedData.particleSystems[index];
  19202. if (hierarchyIds.indexOf(parsedParticleSystem.emitterId) !== -1) {
  19203. particleSystems.push(parseParticleSystem(parsedParticleSystem, scene, rootUrl));
  19204. }
  19205. }
  19206. }
  19207. return true;
  19208. },
  19209. load: function (scene, data, rootUrl) {
  19210. var parsedData = JSON.parse(data);
  19211. // Scene
  19212. scene.useDelayedTextureLoading = parsedData.useDelayedTextureLoading && !BABYLON.SceneLoader.ForceFullSceneLoadingForIncremental;
  19213. scene.autoClear = parsedData.autoClear;
  19214. scene.clearColor = BABYLON.Color3.FromArray(parsedData.clearColor);
  19215. scene.ambientColor = BABYLON.Color3.FromArray(parsedData.ambientColor);
  19216. scene.gravity = BABYLON.Vector3.FromArray(parsedData.gravity);
  19217. // Fog
  19218. if (parsedData.fogMode && parsedData.fogMode !== 0) {
  19219. scene.fogMode = parsedData.fogMode;
  19220. scene.fogColor = BABYLON.Color3.FromArray(parsedData.fogColor);
  19221. scene.fogStart = parsedData.fogStart;
  19222. scene.fogEnd = parsedData.fogEnd;
  19223. scene.fogDensity = parsedData.fogDensity;
  19224. }
  19225. for (var index = 0; index < parsedData.lights.length; index++) {
  19226. var parsedLight = parsedData.lights[index];
  19227. parseLight(parsedLight, scene);
  19228. }
  19229. // Materials
  19230. if (parsedData.materials) {
  19231. for (index = 0; index < parsedData.materials.length; index++) {
  19232. var parsedMaterial = parsedData.materials[index];
  19233. parseMaterial(parsedMaterial, scene, rootUrl);
  19234. }
  19235. }
  19236. if (parsedData.multiMaterials) {
  19237. for (index = 0; index < parsedData.multiMaterials.length; index++) {
  19238. var parsedMultiMaterial = parsedData.multiMaterials[index];
  19239. parseMultiMaterial(parsedMultiMaterial, scene);
  19240. }
  19241. }
  19242. // Skeletons
  19243. if (parsedData.skeletons) {
  19244. for (index = 0; index < parsedData.skeletons.length; index++) {
  19245. var parsedSkeleton = parsedData.skeletons[index];
  19246. parseSkeleton(parsedSkeleton, scene);
  19247. }
  19248. }
  19249. // Geometries
  19250. var geometries = parsedData.geometries;
  19251. if (geometries) {
  19252. // Boxes
  19253. var boxes = geometries.boxes;
  19254. if (boxes) {
  19255. for (index = 0; index < boxes.length; index++) {
  19256. var parsedBox = boxes[index];
  19257. parseBox(parsedBox, scene);
  19258. }
  19259. }
  19260. // Spheres
  19261. var spheres = geometries.spheres;
  19262. if (spheres) {
  19263. for (index = 0; index < spheres.length; index++) {
  19264. var parsedSphere = spheres[index];
  19265. parseSphere(parsedSphere, scene);
  19266. }
  19267. }
  19268. // Cylinders
  19269. var cylinders = geometries.cylinders;
  19270. if (cylinders) {
  19271. for (index = 0; index < cylinders.length; index++) {
  19272. var parsedCylinder = cylinders[index];
  19273. parseCylinder(parsedCylinder, scene);
  19274. }
  19275. }
  19276. // Toruses
  19277. var toruses = geometries.toruses;
  19278. if (toruses) {
  19279. for (index = 0; index < toruses.length; index++) {
  19280. var parsedTorus = toruses[index];
  19281. parseTorus(parsedTorus, scene);
  19282. }
  19283. }
  19284. // Grounds
  19285. var grounds = geometries.grounds;
  19286. if (grounds) {
  19287. for (index = 0; index < grounds.length; index++) {
  19288. var parsedGround = grounds[index];
  19289. parseGround(parsedGround, scene);
  19290. }
  19291. }
  19292. // Planes
  19293. var planes = geometries.planes;
  19294. if (planes) {
  19295. for (index = 0; index < planes.length; index++) {
  19296. var parsedPlane = planes[index];
  19297. parsePlane(parsedPlane, scene);
  19298. }
  19299. }
  19300. // TorusKnots
  19301. var torusKnots = geometries.torusKnots;
  19302. if (torusKnots) {
  19303. for (index = 0; index < torusKnots.length; index++) {
  19304. var parsedTorusKnot = torusKnots[index];
  19305. parseTorusKnot(parsedTorusKnot, scene);
  19306. }
  19307. }
  19308. // VertexData
  19309. var vertexData = geometries.vertexData;
  19310. if (vertexData) {
  19311. for (index = 0; index < vertexData.length; index++) {
  19312. var parsedVertexData = vertexData[index];
  19313. parseVertexData(parsedVertexData, scene, rootUrl);
  19314. }
  19315. }
  19316. }
  19317. for (index = 0; index < parsedData.meshes.length; index++) {
  19318. var parsedMesh = parsedData.meshes[index];
  19319. parseMesh(parsedMesh, scene, rootUrl);
  19320. }
  19321. for (index = 0; index < parsedData.cameras.length; index++) {
  19322. var parsedCamera = parsedData.cameras[index];
  19323. parseCamera(parsedCamera, scene);
  19324. }
  19325. if (parsedData.activeCameraID) {
  19326. scene.setActiveCameraByID(parsedData.activeCameraID);
  19327. }
  19328. for (index = 0; index < scene.cameras.length; index++) {
  19329. var camera = scene.cameras[index];
  19330. if (camera._waitingParentId) {
  19331. camera.parent = scene.getLastEntryByID(camera._waitingParentId);
  19332. camera._waitingParentId = undefined;
  19333. }
  19334. }
  19335. for (index = 0; index < scene.lights.length; index++) {
  19336. var light = scene.lights[index];
  19337. if (light._waitingParentId) {
  19338. light.parent = scene.getLastEntryByID(light._waitingParentId);
  19339. light._waitingParentId = undefined;
  19340. }
  19341. }
  19342. // Sounds
  19343. if (parsedData.sounds && BABYLON.Engine.audioEngine.canUseWebAudio) {
  19344. for (index = 0; index < parsedData.sounds.length; index++) {
  19345. var parsedSound = parsedData.sounds[index];
  19346. parseSound(parsedSound, scene, rootUrl);
  19347. }
  19348. }
  19349. for (index = 0; index < scene.meshes.length; index++) {
  19350. var mesh = scene.meshes[index];
  19351. if (mesh._waitingParentId) {
  19352. mesh.parent = scene.getLastEntryByID(mesh._waitingParentId);
  19353. mesh._waitingParentId = undefined;
  19354. }
  19355. if (mesh._waitingActions) {
  19356. parseActions(mesh._waitingActions, mesh, scene);
  19357. mesh._waitingActions = undefined;
  19358. }
  19359. }
  19360. // Particles Systems
  19361. if (parsedData.particleSystems) {
  19362. for (index = 0; index < parsedData.particleSystems.length; index++) {
  19363. var parsedParticleSystem = parsedData.particleSystems[index];
  19364. parseParticleSystem(parsedParticleSystem, scene, rootUrl);
  19365. }
  19366. }
  19367. // Lens flares
  19368. if (parsedData.lensFlareSystems) {
  19369. for (index = 0; index < parsedData.lensFlareSystems.length; index++) {
  19370. var parsedLensFlareSystem = parsedData.lensFlareSystems[index];
  19371. parseLensFlareSystem(parsedLensFlareSystem, scene, rootUrl);
  19372. }
  19373. }
  19374. // Shadows
  19375. if (parsedData.shadowGenerators) {
  19376. for (index = 0; index < parsedData.shadowGenerators.length; index++) {
  19377. var parsedShadowGenerator = parsedData.shadowGenerators[index];
  19378. parseShadowGenerator(parsedShadowGenerator, scene);
  19379. }
  19380. }
  19381. // Actions (scene)
  19382. if (parsedData.actions) {
  19383. parseActions(parsedData.actions, null, scene);
  19384. }
  19385. // Finish
  19386. return true;
  19387. }
  19388. });
  19389. })(Internals = BABYLON.Internals || (BABYLON.Internals = {}));
  19390. })(BABYLON || (BABYLON = {}));
  19391. //# sourceMappingURL=babylon.babylonFileLoader.js.mapvar BABYLON;
  19392. (function (BABYLON) {
  19393. // Unique ID when we import meshes from Babylon to CSG
  19394. var currentCSGMeshId = 0;
  19395. // # class Vertex
  19396. // Represents a vertex of a polygon. Use your own vertex class instead of this
  19397. // one to provide additional features like texture coordinates and vertex
  19398. // colors. Custom vertex classes need to provide a `pos` property and `clone()`,
  19399. // `flip()`, and `interpolate()` methods that behave analogous to the ones
  19400. // defined by `BABYLON.CSG.Vertex`. This class provides `normal` so convenience
  19401. // functions like `BABYLON.CSG.sphere()` can return a smooth vertex normal, but `normal`
  19402. // is not used anywhere else.
  19403. // Same goes for uv, it allows to keep the original vertex uv coordinates of the 2 meshes
  19404. var Vertex = (function () {
  19405. function Vertex(pos, normal, uv) {
  19406. this.pos = pos;
  19407. this.normal = normal;
  19408. this.uv = uv;
  19409. }
  19410. Vertex.prototype.clone = function () {
  19411. return new Vertex(this.pos.clone(), this.normal.clone(), this.uv.clone());
  19412. };
  19413. // Invert all orientation-specific data (e.g. vertex normal). Called when the
  19414. // orientation of a polygon is flipped.
  19415. Vertex.prototype.flip = function () {
  19416. this.normal = this.normal.scale(-1);
  19417. };
  19418. // Create a new vertex between this vertex and `other` by linearly
  19419. // interpolating all properties using a parameter of `t`. Subclasses should
  19420. // override this to interpolate additional properties.
  19421. Vertex.prototype.interpolate = function (other, t) {
  19422. return new Vertex(BABYLON.Vector3.Lerp(this.pos, other.pos, t), BABYLON.Vector3.Lerp(this.normal, other.normal, t), BABYLON.Vector2.Lerp(this.uv, other.uv, t));
  19423. };
  19424. return Vertex;
  19425. })();
  19426. // # class Plane
  19427. // Represents a plane in 3D space.
  19428. var Plane = (function () {
  19429. function Plane(normal, w) {
  19430. this.normal = normal;
  19431. this.w = w;
  19432. }
  19433. Plane.FromPoints = function (a, b, c) {
  19434. var v0 = c.subtract(a);
  19435. var v1 = b.subtract(a);
  19436. if (v0.lengthSquared() === 0 || v1.lengthSquared() === 0) {
  19437. return null;
  19438. }
  19439. var n = BABYLON.Vector3.Normalize(BABYLON.Vector3.Cross(v0, v1));
  19440. return new Plane(n, BABYLON.Vector3.Dot(n, a));
  19441. };
  19442. Plane.prototype.clone = function () {
  19443. return new Plane(this.normal.clone(), this.w);
  19444. };
  19445. Plane.prototype.flip = function () {
  19446. this.normal.scaleInPlace(-1);
  19447. this.w = -this.w;
  19448. };
  19449. // Split `polygon` by this plane if needed, then put the polygon or polygon
  19450. // fragments in the appropriate lists. Coplanar polygons go into either
  19451. // `coplanarFront` or `coplanarBack` depending on their orientation with
  19452. // respect to this plane. Polygons in front or in back of this plane go into
  19453. // either `front` or `back`.
  19454. Plane.prototype.splitPolygon = function (polygon, coplanarFront, coplanarBack, front, back) {
  19455. var COPLANAR = 0;
  19456. var FRONT = 1;
  19457. var BACK = 2;
  19458. var SPANNING = 3;
  19459. // Classify each point as well as the entire polygon into one of the above
  19460. // four classes.
  19461. var polygonType = 0;
  19462. var types = [];
  19463. for (var i = 0; i < polygon.vertices.length; i++) {
  19464. var t = BABYLON.Vector3.Dot(this.normal, polygon.vertices[i].pos) - this.w;
  19465. var type = (t < -Plane.EPSILON) ? BACK : (t > Plane.EPSILON) ? FRONT : COPLANAR;
  19466. polygonType |= type;
  19467. types.push(type);
  19468. }
  19469. switch (polygonType) {
  19470. case COPLANAR:
  19471. (BABYLON.Vector3.Dot(this.normal, polygon.plane.normal) > 0 ? coplanarFront : coplanarBack).push(polygon);
  19472. break;
  19473. case FRONT:
  19474. front.push(polygon);
  19475. break;
  19476. case BACK:
  19477. back.push(polygon);
  19478. break;
  19479. case SPANNING:
  19480. var f = [], b = [];
  19481. for (i = 0; i < polygon.vertices.length; i++) {
  19482. var j = (i + 1) % polygon.vertices.length;
  19483. var ti = types[i], tj = types[j];
  19484. var vi = polygon.vertices[i], vj = polygon.vertices[j];
  19485. if (ti != BACK)
  19486. f.push(vi);
  19487. if (ti != FRONT)
  19488. b.push(ti != BACK ? vi.clone() : vi);
  19489. if ((ti | tj) == SPANNING) {
  19490. t = (this.w - BABYLON.Vector3.Dot(this.normal, vi.pos)) / BABYLON.Vector3.Dot(this.normal, vj.pos.subtract(vi.pos));
  19491. var v = vi.interpolate(vj, t);
  19492. f.push(v);
  19493. b.push(v.clone());
  19494. }
  19495. }
  19496. if (f.length >= 3) {
  19497. var poly = new Polygon(f, polygon.shared);
  19498. if (poly.plane)
  19499. front.push(poly);
  19500. }
  19501. if (b.length >= 3) {
  19502. poly = new Polygon(b, polygon.shared);
  19503. if (poly.plane)
  19504. back.push(poly);
  19505. }
  19506. break;
  19507. }
  19508. };
  19509. // `BABYLON.CSG.Plane.EPSILON` is the tolerance used by `splitPolygon()` to decide if a
  19510. // point is on the plane.
  19511. Plane.EPSILON = 1e-5;
  19512. return Plane;
  19513. })();
  19514. // # class Polygon
  19515. // Represents a convex polygon. The vertices used to initialize a polygon must
  19516. // be coplanar and form a convex loop.
  19517. //
  19518. // Each convex polygon has a `shared` property, which is shared between all
  19519. // polygons that are clones of each other or were split from the same polygon.
  19520. // This can be used to define per-polygon properties (such as surface color).
  19521. var Polygon = (function () {
  19522. function Polygon(vertices, shared) {
  19523. this.vertices = vertices;
  19524. this.shared = shared;
  19525. this.plane = Plane.FromPoints(vertices[0].pos, vertices[1].pos, vertices[2].pos);
  19526. }
  19527. Polygon.prototype.clone = function () {
  19528. var vertices = this.vertices.map(function (v) { return v.clone(); });
  19529. return new Polygon(vertices, this.shared);
  19530. };
  19531. Polygon.prototype.flip = function () {
  19532. this.vertices.reverse().map(function (v) {
  19533. v.flip();
  19534. });
  19535. this.plane.flip();
  19536. };
  19537. return Polygon;
  19538. })();
  19539. // # class Node
  19540. // Holds a node in a BSP tree. A BSP tree is built from a collection of polygons
  19541. // by picking a polygon to split along. That polygon (and all other coplanar
  19542. // polygons) are added directly to that node and the other polygons are added to
  19543. // the front and/or back subtrees. This is not a leafy BSP tree since there is
  19544. // no distinction between internal and leaf nodes.
  19545. var Node = (function () {
  19546. function Node(polygons) {
  19547. this.plane = null;
  19548. this.front = null;
  19549. this.back = null;
  19550. this.polygons = [];
  19551. if (polygons) {
  19552. this.build(polygons);
  19553. }
  19554. }
  19555. Node.prototype.clone = function () {
  19556. var node = new Node();
  19557. node.plane = this.plane && this.plane.clone();
  19558. node.front = this.front && this.front.clone();
  19559. node.back = this.back && this.back.clone();
  19560. node.polygons = this.polygons.map(function (p) { return p.clone(); });
  19561. return node;
  19562. };
  19563. // Convert solid space to empty space and empty space to solid space.
  19564. Node.prototype.invert = function () {
  19565. for (var i = 0; i < this.polygons.length; i++) {
  19566. this.polygons[i].flip();
  19567. }
  19568. if (this.plane) {
  19569. this.plane.flip();
  19570. }
  19571. if (this.front) {
  19572. this.front.invert();
  19573. }
  19574. if (this.back) {
  19575. this.back.invert();
  19576. }
  19577. var temp = this.front;
  19578. this.front = this.back;
  19579. this.back = temp;
  19580. };
  19581. // Recursively remove all polygons in `polygons` that are inside this BSP
  19582. // tree.
  19583. Node.prototype.clipPolygons = function (polygons) {
  19584. if (!this.plane)
  19585. return polygons.slice();
  19586. var front = [], back = [];
  19587. for (var i = 0; i < polygons.length; i++) {
  19588. this.plane.splitPolygon(polygons[i], front, back, front, back);
  19589. }
  19590. if (this.front) {
  19591. front = this.front.clipPolygons(front);
  19592. }
  19593. if (this.back) {
  19594. back = this.back.clipPolygons(back);
  19595. }
  19596. else {
  19597. back = [];
  19598. }
  19599. return front.concat(back);
  19600. };
  19601. // Remove all polygons in this BSP tree that are inside the other BSP tree
  19602. // `bsp`.
  19603. Node.prototype.clipTo = function (bsp) {
  19604. this.polygons = bsp.clipPolygons(this.polygons);
  19605. if (this.front)
  19606. this.front.clipTo(bsp);
  19607. if (this.back)
  19608. this.back.clipTo(bsp);
  19609. };
  19610. // Return a list of all polygons in this BSP tree.
  19611. Node.prototype.allPolygons = function () {
  19612. var polygons = this.polygons.slice();
  19613. if (this.front)
  19614. polygons = polygons.concat(this.front.allPolygons());
  19615. if (this.back)
  19616. polygons = polygons.concat(this.back.allPolygons());
  19617. return polygons;
  19618. };
  19619. // Build a BSP tree out of `polygons`. When called on an existing tree, the
  19620. // new polygons are filtered down to the bottom of the tree and become new
  19621. // nodes there. Each set of polygons is partitioned using the first polygon
  19622. // (no heuristic is used to pick a good split).
  19623. Node.prototype.build = function (polygons) {
  19624. if (!polygons.length)
  19625. return;
  19626. if (!this.plane)
  19627. this.plane = polygons[0].plane.clone();
  19628. var front = [], back = [];
  19629. for (var i = 0; i < polygons.length; i++) {
  19630. this.plane.splitPolygon(polygons[i], this.polygons, this.polygons, front, back);
  19631. }
  19632. if (front.length) {
  19633. if (!this.front)
  19634. this.front = new Node();
  19635. this.front.build(front);
  19636. }
  19637. if (back.length) {
  19638. if (!this.back)
  19639. this.back = new Node();
  19640. this.back.build(back);
  19641. }
  19642. };
  19643. return Node;
  19644. })();
  19645. var CSG = (function () {
  19646. function CSG() {
  19647. this.polygons = new Array();
  19648. }
  19649. // Convert BABYLON.Mesh to BABYLON.CSG
  19650. CSG.FromMesh = function (mesh) {
  19651. var vertex, normal, uv, position, polygon, polygons = [], vertices;
  19652. if (mesh instanceof BABYLON.Mesh) {
  19653. mesh.computeWorldMatrix(true);
  19654. var matrix = mesh.getWorldMatrix();
  19655. var meshPosition = mesh.position.clone();
  19656. var meshRotation = mesh.rotation.clone();
  19657. var meshScaling = mesh.scaling.clone();
  19658. }
  19659. else {
  19660. throw 'BABYLON.CSG: Wrong Mesh type, must be BABYLON.Mesh';
  19661. }
  19662. var indices = mesh.getIndices(), positions = mesh.getVerticesData(BABYLON.VertexBuffer.PositionKind), normals = mesh.getVerticesData(BABYLON.VertexBuffer.NormalKind), uvs = mesh.getVerticesData(BABYLON.VertexBuffer.UVKind);
  19663. var subMeshes = mesh.subMeshes;
  19664. for (var sm = 0, sml = subMeshes.length; sm < sml; sm++) {
  19665. for (var i = subMeshes[sm].indexStart, il = subMeshes[sm].indexCount + subMeshes[sm].indexStart; i < il; i += 3) {
  19666. vertices = [];
  19667. for (var j = 0; j < 3; j++) {
  19668. var sourceNormal = new BABYLON.Vector3(normals[indices[i + j] * 3], normals[indices[i + j] * 3 + 1], normals[indices[i + j] * 3 + 2]);
  19669. uv = new BABYLON.Vector2(uvs[indices[i + j] * 2], uvs[indices[i + j] * 2 + 1]);
  19670. var sourcePosition = new BABYLON.Vector3(positions[indices[i + j] * 3], positions[indices[i + j] * 3 + 1], positions[indices[i + j] * 3 + 2]);
  19671. position = BABYLON.Vector3.TransformCoordinates(sourcePosition, matrix);
  19672. normal = BABYLON.Vector3.TransformNormal(sourceNormal, matrix);
  19673. vertex = new Vertex(position, normal, uv);
  19674. vertices.push(vertex);
  19675. }
  19676. polygon = new Polygon(vertices, { subMeshId: sm, meshId: currentCSGMeshId, materialIndex: subMeshes[sm].materialIndex });
  19677. // To handle the case of degenerated triangle
  19678. // polygon.plane == null <=> the polygon does not represent 1 single plane <=> the triangle is degenerated
  19679. if (polygon.plane)
  19680. polygons.push(polygon);
  19681. }
  19682. }
  19683. var csg = CSG.FromPolygons(polygons);
  19684. csg.matrix = matrix;
  19685. csg.position = meshPosition;
  19686. csg.rotation = meshRotation;
  19687. csg.scaling = meshScaling;
  19688. currentCSGMeshId++;
  19689. return csg;
  19690. };
  19691. // Construct a BABYLON.CSG solid from a list of `BABYLON.CSG.Polygon` instances.
  19692. CSG.FromPolygons = function (polygons) {
  19693. var csg = new BABYLON.CSG();
  19694. csg.polygons = polygons;
  19695. return csg;
  19696. };
  19697. CSG.prototype.clone = function () {
  19698. var csg = new BABYLON.CSG();
  19699. csg.polygons = this.polygons.map(function (p) { return p.clone(); });
  19700. csg.copyTransformAttributes(this);
  19701. return csg;
  19702. };
  19703. CSG.prototype.toPolygons = function () {
  19704. return this.polygons;
  19705. };
  19706. CSG.prototype.union = function (csg) {
  19707. var a = new Node(this.clone().polygons);
  19708. var b = new Node(csg.clone().polygons);
  19709. a.clipTo(b);
  19710. b.clipTo(a);
  19711. b.invert();
  19712. b.clipTo(a);
  19713. b.invert();
  19714. a.build(b.allPolygons());
  19715. return CSG.FromPolygons(a.allPolygons()).copyTransformAttributes(this);
  19716. };
  19717. CSG.prototype.unionInPlace = function (csg) {
  19718. var a = new Node(this.polygons);
  19719. var b = new Node(csg.polygons);
  19720. a.clipTo(b);
  19721. b.clipTo(a);
  19722. b.invert();
  19723. b.clipTo(a);
  19724. b.invert();
  19725. a.build(b.allPolygons());
  19726. this.polygons = a.allPolygons();
  19727. };
  19728. CSG.prototype.subtract = function (csg) {
  19729. var a = new Node(this.clone().polygons);
  19730. var b = new Node(csg.clone().polygons);
  19731. a.invert();
  19732. a.clipTo(b);
  19733. b.clipTo(a);
  19734. b.invert();
  19735. b.clipTo(a);
  19736. b.invert();
  19737. a.build(b.allPolygons());
  19738. a.invert();
  19739. return CSG.FromPolygons(a.allPolygons()).copyTransformAttributes(this);
  19740. };
  19741. CSG.prototype.subtractInPlace = function (csg) {
  19742. var a = new Node(this.polygons);
  19743. var b = new Node(csg.polygons);
  19744. a.invert();
  19745. a.clipTo(b);
  19746. b.clipTo(a);
  19747. b.invert();
  19748. b.clipTo(a);
  19749. b.invert();
  19750. a.build(b.allPolygons());
  19751. a.invert();
  19752. this.polygons = a.allPolygons();
  19753. };
  19754. CSG.prototype.intersect = function (csg) {
  19755. var a = new Node(this.clone().polygons);
  19756. var b = new Node(csg.clone().polygons);
  19757. a.invert();
  19758. b.clipTo(a);
  19759. b.invert();
  19760. a.clipTo(b);
  19761. b.clipTo(a);
  19762. a.build(b.allPolygons());
  19763. a.invert();
  19764. return CSG.FromPolygons(a.allPolygons()).copyTransformAttributes(this);
  19765. };
  19766. CSG.prototype.intersectInPlace = function (csg) {
  19767. var a = new Node(this.polygons);
  19768. var b = new Node(csg.polygons);
  19769. a.invert();
  19770. b.clipTo(a);
  19771. b.invert();
  19772. a.clipTo(b);
  19773. b.clipTo(a);
  19774. a.build(b.allPolygons());
  19775. a.invert();
  19776. this.polygons = a.allPolygons();
  19777. };
  19778. // Return a new BABYLON.CSG solid with solid and empty space switched. This solid is
  19779. // not modified.
  19780. CSG.prototype.inverse = function () {
  19781. var csg = this.clone();
  19782. csg.inverseInPlace();
  19783. return csg;
  19784. };
  19785. CSG.prototype.inverseInPlace = function () {
  19786. this.polygons.map(function (p) {
  19787. p.flip();
  19788. });
  19789. };
  19790. // This is used to keep meshes transformations so they can be restored
  19791. // when we build back a Babylon Mesh
  19792. // NB : All CSG operations are performed in world coordinates
  19793. CSG.prototype.copyTransformAttributes = function (csg) {
  19794. this.matrix = csg.matrix;
  19795. this.position = csg.position;
  19796. this.rotation = csg.rotation;
  19797. this.scaling = csg.scaling;
  19798. return this;
  19799. };
  19800. // Build Raw mesh from CSG
  19801. // Coordinates here are in world space
  19802. CSG.prototype.buildMeshGeometry = function (name, scene, keepSubMeshes) {
  19803. var matrix = this.matrix.clone();
  19804. matrix.invert();
  19805. var mesh = new BABYLON.Mesh(name, scene), vertices = [], indices = [], normals = [], uvs = [], vertex = BABYLON.Vector3.Zero(), normal = BABYLON.Vector3.Zero(), uv = BABYLON.Vector2.Zero(), polygons = this.polygons, polygonIndices = [0, 0, 0], polygon, vertice_dict = {}, vertex_idx, currentIndex = 0, subMesh_dict = {}, subMesh_obj;
  19806. if (keepSubMeshes) {
  19807. // Sort Polygons, since subMeshes are indices range
  19808. polygons.sort(function (a, b) {
  19809. if (a.shared.meshId === b.shared.meshId) {
  19810. return a.shared.subMeshId - b.shared.subMeshId;
  19811. }
  19812. else {
  19813. return a.shared.meshId - b.shared.meshId;
  19814. }
  19815. });
  19816. }
  19817. for (var i = 0, il = polygons.length; i < il; i++) {
  19818. polygon = polygons[i];
  19819. // Building SubMeshes
  19820. if (!subMesh_dict[polygon.shared.meshId]) {
  19821. subMesh_dict[polygon.shared.meshId] = {};
  19822. }
  19823. if (!subMesh_dict[polygon.shared.meshId][polygon.shared.subMeshId]) {
  19824. subMesh_dict[polygon.shared.meshId][polygon.shared.subMeshId] = {
  19825. indexStart: +Infinity,
  19826. indexEnd: -Infinity,
  19827. materialIndex: polygon.shared.materialIndex
  19828. };
  19829. }
  19830. subMesh_obj = subMesh_dict[polygon.shared.meshId][polygon.shared.subMeshId];
  19831. for (var j = 2, jl = polygon.vertices.length; j < jl; j++) {
  19832. polygonIndices[0] = 0;
  19833. polygonIndices[1] = j - 1;
  19834. polygonIndices[2] = j;
  19835. for (var k = 0; k < 3; k++) {
  19836. vertex.copyFrom(polygon.vertices[polygonIndices[k]].pos);
  19837. normal.copyFrom(polygon.vertices[polygonIndices[k]].normal);
  19838. uv.copyFrom(polygon.vertices[polygonIndices[k]].uv);
  19839. var localVertex = BABYLON.Vector3.TransformCoordinates(vertex, matrix);
  19840. var localNormal = BABYLON.Vector3.TransformNormal(normal, matrix);
  19841. vertex_idx = vertice_dict[localVertex.x + ',' + localVertex.y + ',' + localVertex.z];
  19842. // Check if 2 points can be merged
  19843. if (!(typeof vertex_idx !== 'undefined' && normals[vertex_idx * 3] === localNormal.x && normals[vertex_idx * 3 + 1] === localNormal.y && normals[vertex_idx * 3 + 2] === localNormal.z && uvs[vertex_idx * 2] === uv.x && uvs[vertex_idx * 2 + 1] === uv.y)) {
  19844. vertices.push(localVertex.x, localVertex.y, localVertex.z);
  19845. uvs.push(uv.x, uv.y);
  19846. normals.push(normal.x, normal.y, normal.z);
  19847. vertex_idx = vertice_dict[localVertex.x + ',' + localVertex.y + ',' + localVertex.z] = (vertices.length / 3) - 1;
  19848. }
  19849. indices.push(vertex_idx);
  19850. subMesh_obj.indexStart = Math.min(currentIndex, subMesh_obj.indexStart);
  19851. subMesh_obj.indexEnd = Math.max(currentIndex, subMesh_obj.indexEnd);
  19852. currentIndex++;
  19853. }
  19854. }
  19855. }
  19856. mesh.setVerticesData(BABYLON.VertexBuffer.PositionKind, vertices);
  19857. mesh.setVerticesData(BABYLON.VertexBuffer.NormalKind, normals);
  19858. mesh.setVerticesData(BABYLON.VertexBuffer.UVKind, uvs);
  19859. mesh.setIndices(indices);
  19860. if (keepSubMeshes) {
  19861. // We offset the materialIndex by the previous number of materials in the CSG mixed meshes
  19862. var materialIndexOffset = 0, materialMaxIndex;
  19863. mesh.subMeshes.length = 0;
  19864. for (var m in subMesh_dict) {
  19865. materialMaxIndex = -1;
  19866. for (var sm in subMesh_dict[m]) {
  19867. subMesh_obj = subMesh_dict[m][sm];
  19868. BABYLON.SubMesh.CreateFromIndices(subMesh_obj.materialIndex + materialIndexOffset, subMesh_obj.indexStart, subMesh_obj.indexEnd - subMesh_obj.indexStart + 1, mesh);
  19869. materialMaxIndex = Math.max(subMesh_obj.materialIndex, materialMaxIndex);
  19870. }
  19871. materialIndexOffset += ++materialMaxIndex;
  19872. }
  19873. }
  19874. return mesh;
  19875. };
  19876. // Build Mesh from CSG taking material and transforms into account
  19877. CSG.prototype.toMesh = function (name, material, scene, keepSubMeshes) {
  19878. var mesh = this.buildMeshGeometry(name, scene, keepSubMeshes);
  19879. mesh.material = material;
  19880. mesh.position.copyFrom(this.position);
  19881. mesh.rotation.copyFrom(this.rotation);
  19882. mesh.scaling.copyFrom(this.scaling);
  19883. mesh.computeWorldMatrix(true);
  19884. return mesh;
  19885. };
  19886. return CSG;
  19887. })();
  19888. BABYLON.CSG = CSG;
  19889. })(BABYLON || (BABYLON = {}));
  19890. //# sourceMappingURL=babylon.csg.js.map
  19891. var BABYLON;
  19892. (function (BABYLON) {
  19893. var OculusDistortionCorrectionPostProcess = (function (_super) {
  19894. __extends(OculusDistortionCorrectionPostProcess, _super);
  19895. //ANY
  19896. function OculusDistortionCorrectionPostProcess(name, camera, isRightEye, cameraSettings) {
  19897. var _this = this;
  19898. _super.call(this, name, "oculusDistortionCorrection", [
  19899. 'LensCenter',
  19900. 'Scale',
  19901. 'ScaleIn',
  19902. 'HmdWarpParam'
  19903. ], null, cameraSettings.PostProcessScaleFactor, camera, BABYLON.Texture.BILINEAR_SAMPLINGMODE, null, null);
  19904. this._isRightEye = isRightEye;
  19905. this._distortionFactors = cameraSettings.DistortionK;
  19906. this._postProcessScaleFactor = cameraSettings.PostProcessScaleFactor;
  19907. this._lensCenterOffset = cameraSettings.LensCenterOffset;
  19908. this.onSizeChanged = function () {
  19909. _this.aspectRatio = _this.width * .5 / _this.height;
  19910. _this._scaleIn = new BABYLON.Vector2(2, 2 / _this.aspectRatio);
  19911. _this._scaleFactor = new BABYLON.Vector2(.5 * (1 / _this._postProcessScaleFactor), .5 * (1 / _this._postProcessScaleFactor) * _this.aspectRatio);
  19912. _this._lensCenter = new BABYLON.Vector2(_this._isRightEye ? 0.5 - _this._lensCenterOffset * 0.5 : 0.5 + _this._lensCenterOffset * 0.5, 0.5);
  19913. };
  19914. this.onApply = function (effect) {
  19915. effect.setFloat2("LensCenter", _this._lensCenter.x, _this._lensCenter.y);
  19916. effect.setFloat2("Scale", _this._scaleFactor.x, _this._scaleFactor.y);
  19917. effect.setFloat2("ScaleIn", _this._scaleIn.x, _this._scaleIn.y);
  19918. effect.setFloat4("HmdWarpParam", _this._distortionFactors[0], _this._distortionFactors[1], _this._distortionFactors[2], _this._distortionFactors[3]);
  19919. };
  19920. }
  19921. return OculusDistortionCorrectionPostProcess;
  19922. })(BABYLON.PostProcess);
  19923. BABYLON.OculusDistortionCorrectionPostProcess = OculusDistortionCorrectionPostProcess;
  19924. })(BABYLON || (BABYLON = {}));
  19925. //# sourceMappingURL=babylon.oculusDistortionCorrectionPostProcess.js.map// Mainly based on these 2 articles :
  19926. // Creating an universal virtual touch joystick working for all Touch models thanks to Hand.JS : http://blogs.msdn.com/b/davrous/archive/2013/02/22/creating-an-universal-virtual-touch-joystick-working-for-all-touch-models-thanks-to-hand-js.aspx
  19927. // & on Seb Lee-Delisle original work: http://seb.ly/2011/04/multi-touch-game-controller-in-javascripthtml5-for-ipad/
  19928. var BABYLON;
  19929. (function (BABYLON) {
  19930. (function (JoystickAxis) {
  19931. JoystickAxis[JoystickAxis["X"] = 0] = "X";
  19932. JoystickAxis[JoystickAxis["Y"] = 1] = "Y";
  19933. JoystickAxis[JoystickAxis["Z"] = 2] = "Z";
  19934. })(BABYLON.JoystickAxis || (BABYLON.JoystickAxis = {}));
  19935. var JoystickAxis = BABYLON.JoystickAxis;
  19936. var VirtualJoystick = (function () {
  19937. function VirtualJoystick(leftJoystick) {
  19938. var _this = this;
  19939. if (leftJoystick) {
  19940. this._leftJoystick = true;
  19941. }
  19942. else {
  19943. this._leftJoystick = false;
  19944. }
  19945. this._joystickIndex = VirtualJoystick._globalJoystickIndex;
  19946. VirtualJoystick._globalJoystickIndex++;
  19947. // By default left & right arrow keys are moving the X
  19948. // and up & down keys are moving the Y
  19949. this._axisTargetedByLeftAndRight = 0 /* X */;
  19950. this._axisTargetedByUpAndDown = 1 /* Y */;
  19951. this.reverseLeftRight = false;
  19952. this.reverseUpDown = false;
  19953. // collections of pointers
  19954. this._touches = new BABYLON.VirtualJoystick.Collection();
  19955. this.deltaPosition = BABYLON.Vector3.Zero();
  19956. this._joystickSensibility = 25;
  19957. this._inversedSensibility = 1 / (this._joystickSensibility / 1000);
  19958. this._rotationSpeed = 25;
  19959. this._inverseRotationSpeed = 1 / (this._rotationSpeed / 1000);
  19960. this._rotateOnAxisRelativeToMesh = false;
  19961. // injecting a canvas element on top of the canvas 3D game
  19962. if (!VirtualJoystick.vjCanvas) {
  19963. window.addEventListener("resize", function () {
  19964. VirtualJoystick.vjCanvasWidth = window.innerWidth;
  19965. VirtualJoystick.vjCanvasHeight = window.innerHeight;
  19966. VirtualJoystick.vjCanvas.width = VirtualJoystick.vjCanvasWidth;
  19967. VirtualJoystick.vjCanvas.height = VirtualJoystick.vjCanvasHeight;
  19968. VirtualJoystick.halfWidth = VirtualJoystick.vjCanvasWidth / 2;
  19969. VirtualJoystick.halfHeight = VirtualJoystick.vjCanvasHeight / 2;
  19970. }, false);
  19971. VirtualJoystick.vjCanvas = document.createElement("canvas");
  19972. VirtualJoystick.vjCanvasWidth = window.innerWidth;
  19973. VirtualJoystick.vjCanvasHeight = window.innerHeight;
  19974. VirtualJoystick.vjCanvas.width = window.innerWidth;
  19975. VirtualJoystick.vjCanvas.height = window.innerHeight;
  19976. VirtualJoystick.vjCanvas.style.width = "100%";
  19977. VirtualJoystick.vjCanvas.style.height = "100%";
  19978. VirtualJoystick.vjCanvas.style.position = "absolute";
  19979. VirtualJoystick.vjCanvas.style.backgroundColor = "transparent";
  19980. VirtualJoystick.vjCanvas.style.top = "0px";
  19981. VirtualJoystick.vjCanvas.style.left = "0px";
  19982. VirtualJoystick.vjCanvas.style.zIndex = "5";
  19983. VirtualJoystick.vjCanvas.style.msTouchAction = "none";
  19984. VirtualJoystick.vjCanvasContext = VirtualJoystick.vjCanvas.getContext('2d');
  19985. VirtualJoystick.vjCanvasContext.strokeStyle = "#ffffff";
  19986. VirtualJoystick.vjCanvasContext.lineWidth = 2;
  19987. document.body.appendChild(VirtualJoystick.vjCanvas);
  19988. }
  19989. VirtualJoystick.halfWidth = VirtualJoystick.vjCanvas.width / 2;
  19990. VirtualJoystick.halfHeight = VirtualJoystick.vjCanvas.height / 2;
  19991. this.pressed = false;
  19992. // default joystick color
  19993. this._joystickColor = "cyan";
  19994. this._joystickPointerID = -1;
  19995. // current joystick position
  19996. this._joystickPointerPos = new BABYLON.Vector2(0, 0);
  19997. // origin joystick position
  19998. this._joystickPointerStartPos = new BABYLON.Vector2(0, 0);
  19999. this._deltaJoystickVector = new BABYLON.Vector2(0, 0);
  20000. VirtualJoystick.vjCanvas.addEventListener('pointerdown', function (evt) {
  20001. _this._onPointerDown(evt);
  20002. }, false);
  20003. VirtualJoystick.vjCanvas.addEventListener('pointermove', function (evt) {
  20004. _this._onPointerMove(evt);
  20005. }, false);
  20006. VirtualJoystick.vjCanvas.addEventListener('pointerup', function (evt) {
  20007. _this._onPointerUp(evt);
  20008. }, false);
  20009. VirtualJoystick.vjCanvas.addEventListener('pointerout', function (evt) {
  20010. _this._onPointerUp(evt);
  20011. }, false);
  20012. VirtualJoystick.vjCanvas.addEventListener("contextmenu", function (evt) {
  20013. evt.preventDefault(); // Disables system menu
  20014. }, false);
  20015. requestAnimationFrame(function () {
  20016. _this._drawVirtualJoystick();
  20017. });
  20018. }
  20019. VirtualJoystick.prototype.setJoystickSensibility = function (newJoystickSensibility) {
  20020. this._joystickSensibility = newJoystickSensibility;
  20021. this._inversedSensibility = 1 / (this._joystickSensibility / 1000);
  20022. };
  20023. VirtualJoystick.prototype._onPointerDown = function (e) {
  20024. var positionOnScreenCondition;
  20025. e.preventDefault();
  20026. if (this._leftJoystick === true) {
  20027. positionOnScreenCondition = (e.clientX < VirtualJoystick.halfWidth);
  20028. }
  20029. else {
  20030. positionOnScreenCondition = (e.clientX > VirtualJoystick.halfWidth);
  20031. }
  20032. if (positionOnScreenCondition && this._joystickPointerID < 0) {
  20033. // First contact will be dedicated to the virtual joystick
  20034. this._joystickPointerID = e.pointerId;
  20035. this._joystickPointerStartPos.x = e.clientX;
  20036. this._joystickPointerStartPos.y = e.clientY;
  20037. this._joystickPointerPos = this._joystickPointerStartPos.clone();
  20038. this._deltaJoystickVector.x = 0;
  20039. this._deltaJoystickVector.y = 0;
  20040. this.pressed = true;
  20041. this._touches.add(e.pointerId.toString(), e);
  20042. }
  20043. else {
  20044. // You can only trigger the action buttons with a joystick declared
  20045. if (VirtualJoystick._globalJoystickIndex < 2 && this._action) {
  20046. this._action();
  20047. this._touches.add(e.pointerId.toString(), e);
  20048. }
  20049. }
  20050. };
  20051. VirtualJoystick.prototype._onPointerMove = function (e) {
  20052. // If the current pointer is the one associated to the joystick (first touch contact)
  20053. if (this._joystickPointerID == e.pointerId) {
  20054. this._joystickPointerPos.x = e.clientX;
  20055. this._joystickPointerPos.y = e.clientY;
  20056. this._deltaJoystickVector = this._joystickPointerPos.clone();
  20057. this._deltaJoystickVector = this._deltaJoystickVector.subtract(this._joystickPointerStartPos);
  20058. var directionLeftRight = this.reverseLeftRight ? -1 : 1;
  20059. var deltaJoystickX = directionLeftRight * this._deltaJoystickVector.x / this._inversedSensibility;
  20060. switch (this._axisTargetedByLeftAndRight) {
  20061. case 0 /* X */:
  20062. this.deltaPosition.x = Math.min(1, Math.max(-1, deltaJoystickX));
  20063. break;
  20064. case 1 /* Y */:
  20065. this.deltaPosition.y = Math.min(1, Math.max(-1, deltaJoystickX));
  20066. break;
  20067. case 2 /* Z */:
  20068. this.deltaPosition.z = Math.min(1, Math.max(-1, deltaJoystickX));
  20069. break;
  20070. }
  20071. var directionUpDown = this.reverseUpDown ? 1 : -1;
  20072. var deltaJoystickY = directionUpDown * this._deltaJoystickVector.y / this._inversedSensibility;
  20073. switch (this._axisTargetedByUpAndDown) {
  20074. case 0 /* X */:
  20075. this.deltaPosition.x = Math.min(1, Math.max(-1, deltaJoystickY));
  20076. break;
  20077. case 1 /* Y */:
  20078. this.deltaPosition.y = Math.min(1, Math.max(-1, deltaJoystickY));
  20079. break;
  20080. case 2 /* Z */:
  20081. this.deltaPosition.z = Math.min(1, Math.max(-1, deltaJoystickY));
  20082. break;
  20083. }
  20084. }
  20085. else {
  20086. if (this._touches.item(e.pointerId.toString())) {
  20087. this._touches.item(e.pointerId.toString()).x = e.clientX;
  20088. this._touches.item(e.pointerId.toString()).y = e.clientY;
  20089. }
  20090. }
  20091. };
  20092. VirtualJoystick.prototype._onPointerUp = function (e) {
  20093. this._clearCanvas();
  20094. if (this._joystickPointerID == e.pointerId) {
  20095. this._joystickPointerID = -1;
  20096. this.pressed = false;
  20097. }
  20098. this._deltaJoystickVector.x = 0;
  20099. this._deltaJoystickVector.y = 0;
  20100. this._touches.remove(e.pointerId.toString());
  20101. };
  20102. /**
  20103. * Change the color of the virtual joystick
  20104. * @param newColor a string that must be a CSS color value (like "red") or the hexa value (like "#FF0000")
  20105. */
  20106. VirtualJoystick.prototype.setJoystickColor = function (newColor) {
  20107. this._joystickColor = newColor;
  20108. };
  20109. VirtualJoystick.prototype.setActionOnTouch = function (action) {
  20110. this._action = action;
  20111. };
  20112. // Define which axis you'd like to control for left & right
  20113. VirtualJoystick.prototype.setAxisForLeftRight = function (axis) {
  20114. switch (axis) {
  20115. case 0 /* X */:
  20116. case 1 /* Y */:
  20117. case 2 /* Z */:
  20118. this._axisTargetedByLeftAndRight = axis;
  20119. break;
  20120. default:
  20121. this._axisTargetedByLeftAndRight = 0 /* X */;
  20122. break;
  20123. }
  20124. };
  20125. // Define which axis you'd like to control for up & down
  20126. VirtualJoystick.prototype.setAxisForUpDown = function (axis) {
  20127. switch (axis) {
  20128. case 0 /* X */:
  20129. case 1 /* Y */:
  20130. case 2 /* Z */:
  20131. this._axisTargetedByUpAndDown = axis;
  20132. break;
  20133. default:
  20134. this._axisTargetedByUpAndDown = 1 /* Y */;
  20135. break;
  20136. }
  20137. };
  20138. VirtualJoystick.prototype._clearCanvas = function () {
  20139. if (this._leftJoystick) {
  20140. VirtualJoystick.vjCanvasContext.clearRect(0, 0, VirtualJoystick.vjCanvasWidth / 2, VirtualJoystick.vjCanvasHeight);
  20141. }
  20142. else {
  20143. VirtualJoystick.vjCanvasContext.clearRect(VirtualJoystick.vjCanvasWidth / 2, 0, VirtualJoystick.vjCanvasWidth, VirtualJoystick.vjCanvasHeight);
  20144. }
  20145. };
  20146. VirtualJoystick.prototype._drawVirtualJoystick = function () {
  20147. var _this = this;
  20148. if (this.pressed) {
  20149. this._clearCanvas();
  20150. this._touches.forEach(function (touch) {
  20151. if (touch.pointerId === _this._joystickPointerID) {
  20152. VirtualJoystick.vjCanvasContext.beginPath();
  20153. VirtualJoystick.vjCanvasContext.strokeStyle = _this._joystickColor;
  20154. VirtualJoystick.vjCanvasContext.lineWidth = 6;
  20155. VirtualJoystick.vjCanvasContext.arc(_this._joystickPointerStartPos.x, _this._joystickPointerStartPos.y, 40, 0, Math.PI * 2, true);
  20156. VirtualJoystick.vjCanvasContext.stroke();
  20157. VirtualJoystick.vjCanvasContext.beginPath();
  20158. VirtualJoystick.vjCanvasContext.strokeStyle = _this._joystickColor;
  20159. VirtualJoystick.vjCanvasContext.lineWidth = 2;
  20160. VirtualJoystick.vjCanvasContext.arc(_this._joystickPointerStartPos.x, _this._joystickPointerStartPos.y, 60, 0, Math.PI * 2, true);
  20161. VirtualJoystick.vjCanvasContext.stroke();
  20162. VirtualJoystick.vjCanvasContext.beginPath();
  20163. VirtualJoystick.vjCanvasContext.strokeStyle = _this._joystickColor;
  20164. VirtualJoystick.vjCanvasContext.arc(_this._joystickPointerPos.x, _this._joystickPointerPos.y, 40, 0, Math.PI * 2, true);
  20165. VirtualJoystick.vjCanvasContext.stroke();
  20166. }
  20167. else {
  20168. VirtualJoystick.vjCanvasContext.beginPath();
  20169. VirtualJoystick.vjCanvasContext.fillStyle = "white";
  20170. VirtualJoystick.vjCanvasContext.beginPath();
  20171. VirtualJoystick.vjCanvasContext.strokeStyle = "red";
  20172. VirtualJoystick.vjCanvasContext.lineWidth = 6;
  20173. VirtualJoystick.vjCanvasContext.arc(touch.x, touch.y, 40, 0, Math.PI * 2, true);
  20174. VirtualJoystick.vjCanvasContext.stroke();
  20175. }
  20176. ;
  20177. });
  20178. }
  20179. requestAnimationFrame(function () {
  20180. _this._drawVirtualJoystick();
  20181. });
  20182. };
  20183. VirtualJoystick.prototype.releaseCanvas = function () {
  20184. if (VirtualJoystick.vjCanvas) {
  20185. document.body.removeChild(VirtualJoystick.vjCanvas);
  20186. VirtualJoystick.vjCanvas = null;
  20187. }
  20188. };
  20189. // Used to draw the virtual joystick inside a 2D canvas on top of the WebGL rendering canvas
  20190. VirtualJoystick._globalJoystickIndex = 0;
  20191. return VirtualJoystick;
  20192. })();
  20193. BABYLON.VirtualJoystick = VirtualJoystick;
  20194. })(BABYLON || (BABYLON = {}));
  20195. var BABYLON;
  20196. (function (BABYLON) {
  20197. var VirtualJoystick;
  20198. (function (VirtualJoystick) {
  20199. var Collection = (function () {
  20200. function Collection() {
  20201. this._count = 0;
  20202. this._collection = new Array();
  20203. }
  20204. Collection.prototype.Count = function () {
  20205. return this._count;
  20206. };
  20207. Collection.prototype.add = function (key, item) {
  20208. if (this._collection[key] != undefined) {
  20209. return undefined;
  20210. }
  20211. this._collection[key] = item;
  20212. return ++this._count;
  20213. };
  20214. Collection.prototype.remove = function (key) {
  20215. if (this._collection[key] == undefined) {
  20216. return undefined;
  20217. }
  20218. delete this._collection[key];
  20219. return --this._count;
  20220. };
  20221. Collection.prototype.item = function (key) {
  20222. return this._collection[key];
  20223. };
  20224. Collection.prototype.forEach = function (block) {
  20225. var key;
  20226. for (key in this._collection) {
  20227. if (this._collection.hasOwnProperty(key)) {
  20228. block(this._collection[key]);
  20229. }
  20230. }
  20231. };
  20232. return Collection;
  20233. })();
  20234. VirtualJoystick.Collection = Collection;
  20235. })(VirtualJoystick = BABYLON.VirtualJoystick || (BABYLON.VirtualJoystick = {}));
  20236. })(BABYLON || (BABYLON = {}));
  20237. //# sourceMappingURL=babylon.virtualJoystick.js.map
  20238. var BABYLON;
  20239. (function (BABYLON) {
  20240. var OculusRiftDevKit2013_Metric = {
  20241. HResolution: 1280,
  20242. VResolution: 800,
  20243. HScreenSize: 0.149759993,
  20244. VScreenSize: 0.0935999975,
  20245. VScreenCenter: 0.0467999987,
  20246. EyeToScreenDistance: 0.0410000011,
  20247. LensSeparationDistance: 0.0635000020,
  20248. InterpupillaryDistance: 0.0640000030,
  20249. DistortionK: [1.0, 0.219999999, 0.239999995, 0.0],
  20250. ChromaAbCorrection: [0.995999992, -0.00400000019, 1.01400006, 0.0],
  20251. PostProcessScaleFactor: 1.714605507808412,
  20252. LensCenterOffset: 0.151976421
  20253. };
  20254. var _OculusInnerCamera = (function (_super) {
  20255. __extends(_OculusInnerCamera, _super);
  20256. function _OculusInnerCamera(name, position, scene, isLeftEye) {
  20257. _super.call(this, name, position, scene);
  20258. this._workMatrix = new BABYLON.Matrix();
  20259. this._actualUp = new BABYLON.Vector3(0, 0, 0);
  20260. // Constants
  20261. this._aspectRatioAspectRatio = OculusRiftDevKit2013_Metric.HResolution / (2 * OculusRiftDevKit2013_Metric.VResolution);
  20262. this._aspectRatioFov = (2 * Math.atan((OculusRiftDevKit2013_Metric.PostProcessScaleFactor * OculusRiftDevKit2013_Metric.VScreenSize) / (2 * OculusRiftDevKit2013_Metric.EyeToScreenDistance)));
  20263. var hMeters = (OculusRiftDevKit2013_Metric.HScreenSize / 4) - (OculusRiftDevKit2013_Metric.LensSeparationDistance / 2);
  20264. var h = (4 * hMeters) / OculusRiftDevKit2013_Metric.HScreenSize;
  20265. this._hMatrix = BABYLON.Matrix.Translation(isLeftEye ? h : -h, 0, 0);
  20266. this.viewport = new BABYLON.Viewport(isLeftEye ? 0 : 0.5, 0, 0.5, 1.0);
  20267. this._preViewMatrix = BABYLON.Matrix.Translation(isLeftEye ? .5 * OculusRiftDevKit2013_Metric.InterpupillaryDistance : -.5 * OculusRiftDevKit2013_Metric.InterpupillaryDistance, 0, 0);
  20268. // Postprocess
  20269. var postProcess = new BABYLON.OculusDistortionCorrectionPostProcess("Oculus Distortion", this, !isLeftEye, OculusRiftDevKit2013_Metric);
  20270. }
  20271. _OculusInnerCamera.prototype.getProjectionMatrix = function () {
  20272. BABYLON.Matrix.PerspectiveFovLHToRef(this._aspectRatioFov, this._aspectRatioAspectRatio, this.minZ, this.maxZ, this._workMatrix);
  20273. this._workMatrix.multiplyToRef(this._hMatrix, this._projectionMatrix);
  20274. return this._projectionMatrix;
  20275. };
  20276. _OculusInnerCamera.prototype._getViewMatrix = function () {
  20277. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._cameraRotationMatrix);
  20278. BABYLON.Vector3.TransformCoordinatesToRef(this._referencePoint, this._cameraRotationMatrix, this._transformedReferencePoint);
  20279. BABYLON.Vector3.TransformNormalToRef(this.upVector, this._cameraRotationMatrix, this._actualUp);
  20280. // Computing target and final matrix
  20281. this.position.addToRef(this._transformedReferencePoint, this._currentTarget);
  20282. BABYLON.Matrix.LookAtLHToRef(this.position, this._currentTarget, this._actualUp, this._workMatrix);
  20283. this._workMatrix.multiplyToRef(this._preViewMatrix, this._viewMatrix);
  20284. return this._viewMatrix;
  20285. };
  20286. return _OculusInnerCamera;
  20287. })(BABYLON.FreeCamera);
  20288. var OculusCamera = (function (_super) {
  20289. __extends(OculusCamera, _super);
  20290. function OculusCamera(name, position, scene) {
  20291. _super.call(this, name, position, scene);
  20292. this._leftCamera = new _OculusInnerCamera(name + "_left", position.clone(), scene, true);
  20293. this._rightCamera = new _OculusInnerCamera(name + "_right", position.clone(), scene, false);
  20294. this.subCameras.push(this._leftCamera);
  20295. this.subCameras.push(this._rightCamera);
  20296. this._deviceOrientationHandler = this._onOrientationEvent.bind(this);
  20297. }
  20298. OculusCamera.prototype._update = function () {
  20299. this._leftCamera.position.copyFrom(this.position);
  20300. this._rightCamera.position.copyFrom(this.position);
  20301. this._updateCamera(this._leftCamera);
  20302. this._updateCamera(this._rightCamera);
  20303. _super.prototype._update.call(this);
  20304. };
  20305. OculusCamera.prototype._updateCamera = function (camera) {
  20306. camera.minZ = this.minZ;
  20307. camera.maxZ = this.maxZ;
  20308. camera.rotation.x = this.rotation.x;
  20309. camera.rotation.y = this.rotation.y;
  20310. camera.rotation.z = this.rotation.z;
  20311. };
  20312. // Oculus events
  20313. OculusCamera.prototype._onOrientationEvent = function (evt) {
  20314. var yaw = evt.alpha / 180 * Math.PI;
  20315. var pitch = evt.beta / 180 * Math.PI;
  20316. var roll = evt.gamma / 180 * Math.PI;
  20317. if (!this._offsetOrientation) {
  20318. this._offsetOrientation = {
  20319. yaw: yaw,
  20320. pitch: pitch,
  20321. roll: roll
  20322. };
  20323. return;
  20324. }
  20325. else {
  20326. this.rotation.y += yaw - this._offsetOrientation.yaw;
  20327. this.rotation.x += pitch - this._offsetOrientation.pitch;
  20328. this.rotation.z += this._offsetOrientation.roll - roll;
  20329. this._offsetOrientation.yaw = yaw;
  20330. this._offsetOrientation.pitch = pitch;
  20331. this._offsetOrientation.roll = roll;
  20332. }
  20333. };
  20334. OculusCamera.prototype.attachControl = function (element, noPreventDefault) {
  20335. _super.prototype.attachControl.call(this, element, noPreventDefault);
  20336. window.addEventListener("deviceorientation", this._deviceOrientationHandler);
  20337. };
  20338. OculusCamera.prototype.detachControl = function (element) {
  20339. _super.prototype.detachControl.call(this, element);
  20340. window.removeEventListener("deviceorientation", this._deviceOrientationHandler);
  20341. };
  20342. return OculusCamera;
  20343. })(BABYLON.FreeCamera);
  20344. BABYLON.OculusCamera = OculusCamera;
  20345. })(BABYLON || (BABYLON = {}));
  20346. //# sourceMappingURL=babylon.oculusCamera.js.map
  20347. var BABYLON;
  20348. (function (BABYLON) {
  20349. var OculusRiftDevKit2013_Metric = {
  20350. HResolution: 1280,
  20351. VResolution: 800,
  20352. HScreenSize: 0.149759993,
  20353. VScreenSize: 0.0935999975,
  20354. VScreenCenter: 0.0467999987,
  20355. EyeToScreenDistance: 0.0410000011,
  20356. LensSeparationDistance: 0.0635000020,
  20357. InterpupillaryDistance: 0.0640000030,
  20358. DistortionK: [1.0, 0.219999999, 0.239999995, 0.0],
  20359. ChromaAbCorrection: [0.995999992, -0.00400000019, 1.01400006, 0.0],
  20360. PostProcessScaleFactor: 1.714605507808412,
  20361. LensCenterOffset: 0.151976421
  20362. };
  20363. var _OculusInnerGamepadCamera = (function (_super) {
  20364. __extends(_OculusInnerGamepadCamera, _super);
  20365. function _OculusInnerGamepadCamera(name, position, scene, isLeftEye) {
  20366. _super.call(this, name, position, scene);
  20367. this._workMatrix = new BABYLON.Matrix();
  20368. this._actualUp = new BABYLON.Vector3(0, 0, 0);
  20369. // Constants
  20370. this._aspectRatioAspectRatio = OculusRiftDevKit2013_Metric.HResolution / (2 * OculusRiftDevKit2013_Metric.VResolution);
  20371. this._aspectRatioFov = (2 * Math.atan((OculusRiftDevKit2013_Metric.PostProcessScaleFactor * OculusRiftDevKit2013_Metric.VScreenSize) / (2 * OculusRiftDevKit2013_Metric.EyeToScreenDistance)));
  20372. var hMeters = (OculusRiftDevKit2013_Metric.HScreenSize / 4) - (OculusRiftDevKit2013_Metric.LensSeparationDistance / 2);
  20373. var h = (4 * hMeters) / OculusRiftDevKit2013_Metric.HScreenSize;
  20374. this._hMatrix = BABYLON.Matrix.Translation(isLeftEye ? h : -h, 0, 0);
  20375. this.viewport = new BABYLON.Viewport(isLeftEye ? 0 : 0.5, 0, 0.5, 1.0);
  20376. this._preViewMatrix = BABYLON.Matrix.Translation(isLeftEye ? .5 * OculusRiftDevKit2013_Metric.InterpupillaryDistance : -.5 * OculusRiftDevKit2013_Metric.InterpupillaryDistance, 0, 0);
  20377. // Postprocess
  20378. var postProcess = new BABYLON.OculusDistortionCorrectionPostProcess("Oculus Distortion", this, !isLeftEye, OculusRiftDevKit2013_Metric);
  20379. }
  20380. _OculusInnerGamepadCamera.prototype.getProjectionMatrix = function () {
  20381. BABYLON.Matrix.PerspectiveFovLHToRef(this._aspectRatioFov, this._aspectRatioAspectRatio, this.minZ, this.maxZ, this._workMatrix);
  20382. this._workMatrix.multiplyToRef(this._hMatrix, this._projectionMatrix);
  20383. return this._projectionMatrix;
  20384. };
  20385. _OculusInnerGamepadCamera.prototype._getViewMatrix = function () {
  20386. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._cameraRotationMatrix);
  20387. BABYLON.Vector3.TransformCoordinatesToRef(this._referencePoint, this._cameraRotationMatrix, this._transformedReferencePoint);
  20388. BABYLON.Vector3.TransformNormalToRef(this.upVector, this._cameraRotationMatrix, this._actualUp);
  20389. // Computing target and final matrix
  20390. this.position.addToRef(this._transformedReferencePoint, this._currentTarget);
  20391. BABYLON.Matrix.LookAtLHToRef(this.position, this._currentTarget, this._actualUp, this._workMatrix);
  20392. this._workMatrix.multiplyToRef(this._preViewMatrix, this._viewMatrix);
  20393. return this._viewMatrix;
  20394. };
  20395. return _OculusInnerGamepadCamera;
  20396. })(BABYLON.FreeCamera);
  20397. var OculusGamepadCamera = (function (_super) {
  20398. __extends(OculusGamepadCamera, _super);
  20399. function OculusGamepadCamera(name, position, scene) {
  20400. var _this = this;
  20401. _super.call(this, name, position, scene);
  20402. this.angularSensibility = 200;
  20403. this.moveSensibility = 75;
  20404. this._leftCamera = new _OculusInnerGamepadCamera(name + "_left", position.clone(), scene, true);
  20405. this._rightCamera = new _OculusInnerGamepadCamera(name + "_right", position.clone(), scene, false);
  20406. this.subCameras.push(this._leftCamera);
  20407. this.subCameras.push(this._rightCamera);
  20408. this._deviceOrientationHandler = this._onOrientationEvent.bind(this);
  20409. this._gamepads = new BABYLON.Gamepads(function (gamepad) {
  20410. _this._onNewGameConnected(gamepad);
  20411. });
  20412. }
  20413. OculusGamepadCamera.prototype._onNewGameConnected = function (gamepad) {
  20414. // Only the first gamepad can control the camera
  20415. if (gamepad.index === 0) {
  20416. this._gamepad = gamepad;
  20417. }
  20418. };
  20419. OculusGamepadCamera.prototype._update = function () {
  20420. this._leftCamera.position.copyFrom(this.position);
  20421. this._rightCamera.position.copyFrom(this.position);
  20422. this._updateCamera(this._leftCamera);
  20423. this._updateCamera(this._rightCamera);
  20424. _super.prototype._update.call(this);
  20425. };
  20426. OculusGamepadCamera.prototype._checkInputs = function () {
  20427. if (!this._gamepad) {
  20428. return;
  20429. }
  20430. var LSValues = this._gamepad.leftStick;
  20431. var normalizedLX = LSValues.x / this.moveSensibility;
  20432. var normalizedLY = LSValues.y / this.moveSensibility;
  20433. LSValues.x = Math.abs(normalizedLX) > 0.005 ? 0 + normalizedLX : 0;
  20434. LSValues.y = Math.abs(normalizedLY) > 0.005 ? 0 + normalizedLY : 0;
  20435. var cameraTransform = BABYLON.Matrix.RotationYawPitchRoll(this.rotation.y, this.rotation.x, 0);
  20436. var deltaTransform = BABYLON.Vector3.TransformCoordinates(new BABYLON.Vector3(LSValues.x, 0, -LSValues.y), cameraTransform);
  20437. this.cameraDirection = this.cameraDirection.add(deltaTransform);
  20438. };
  20439. OculusGamepadCamera.prototype._updateCamera = function (camera) {
  20440. camera.minZ = this.minZ;
  20441. camera.maxZ = this.maxZ;
  20442. camera.rotation.x = this.rotation.x;
  20443. camera.rotation.y = this.rotation.y;
  20444. camera.rotation.z = this.rotation.z;
  20445. };
  20446. // Oculus events
  20447. OculusGamepadCamera.prototype._onOrientationEvent = function (evt) {
  20448. var yaw = evt.alpha / 180 * Math.PI;
  20449. var pitch = evt.beta / 180 * Math.PI;
  20450. var roll = evt.gamma / 180 * Math.PI;
  20451. if (!this._offsetOrientation) {
  20452. this._offsetOrientation = {
  20453. yaw: yaw,
  20454. pitch: pitch,
  20455. roll: roll
  20456. };
  20457. return;
  20458. }
  20459. else {
  20460. this.rotation.y += yaw - this._offsetOrientation.yaw;
  20461. this.rotation.x += pitch - this._offsetOrientation.pitch;
  20462. this.rotation.z += this._offsetOrientation.roll - roll;
  20463. this._offsetOrientation.yaw = yaw;
  20464. this._offsetOrientation.pitch = pitch;
  20465. this._offsetOrientation.roll = roll;
  20466. }
  20467. };
  20468. OculusGamepadCamera.prototype.attachControl = function (element, noPreventDefault) {
  20469. _super.prototype.attachControl.call(this, element, noPreventDefault);
  20470. window.addEventListener("deviceorientation", this._deviceOrientationHandler);
  20471. };
  20472. OculusGamepadCamera.prototype.detachControl = function (element) {
  20473. _super.prototype.detachControl.call(this, element);
  20474. window.removeEventListener("deviceorientation", this._deviceOrientationHandler);
  20475. };
  20476. OculusGamepadCamera.prototype.dispose = function () {
  20477. this._gamepads.dispose();
  20478. _super.prototype.dispose.call(this);
  20479. };
  20480. return OculusGamepadCamera;
  20481. })(BABYLON.FreeCamera);
  20482. BABYLON.OculusGamepadCamera = OculusGamepadCamera;
  20483. })(BABYLON || (BABYLON = {}));
  20484. //# sourceMappingURL=babylon.oculusGamepadCamera.js.map
  20485. var BABYLON;
  20486. (function (BABYLON) {
  20487. // We're mainly based on the logic defined into the FreeCamera code
  20488. var VirtualJoysticksCamera = (function (_super) {
  20489. __extends(VirtualJoysticksCamera, _super);
  20490. function VirtualJoysticksCamera(name, position, scene) {
  20491. _super.call(this, name, position, scene);
  20492. this._leftjoystick = new BABYLON.VirtualJoystick(true);
  20493. this._leftjoystick.setAxisForUpDown(2 /* Z */);
  20494. this._leftjoystick.setAxisForLeftRight(0 /* X */);
  20495. this._leftjoystick.setJoystickSensibility(0.15);
  20496. this._rightjoystick = new BABYLON.VirtualJoystick(false);
  20497. this._rightjoystick.setAxisForUpDown(0 /* X */);
  20498. this._rightjoystick.setAxisForLeftRight(1 /* Y */);
  20499. this._rightjoystick.reverseUpDown = true;
  20500. this._rightjoystick.setJoystickSensibility(0.05);
  20501. this._rightjoystick.setJoystickColor("yellow");
  20502. }
  20503. VirtualJoysticksCamera.prototype._checkInputs = function () {
  20504. var cameraTransform = BABYLON.Matrix.RotationYawPitchRoll(this.rotation.y, this.rotation.x, 0);
  20505. var deltaTransform = BABYLON.Vector3.TransformCoordinates(this._leftjoystick.deltaPosition, cameraTransform);
  20506. this.cameraDirection = this.cameraDirection.add(deltaTransform);
  20507. this.cameraRotation = this.cameraRotation.addVector3(this._rightjoystick.deltaPosition);
  20508. if (!this._leftjoystick.pressed) {
  20509. this._leftjoystick.deltaPosition = this._leftjoystick.deltaPosition.scale(0.9);
  20510. }
  20511. if (!this._rightjoystick.pressed) {
  20512. this._rightjoystick.deltaPosition = this._rightjoystick.deltaPosition.scale(0.9);
  20513. }
  20514. };
  20515. VirtualJoysticksCamera.prototype.dispose = function () {
  20516. this._leftjoystick.releaseCanvas();
  20517. _super.prototype.dispose.call(this);
  20518. };
  20519. return VirtualJoysticksCamera;
  20520. })(BABYLON.FreeCamera);
  20521. BABYLON.VirtualJoysticksCamera = VirtualJoysticksCamera;
  20522. })(BABYLON || (BABYLON = {}));
  20523. //# sourceMappingURL=babylon.virtualJoysticksCamera.js.map
  20524. var BABYLON;
  20525. (function (BABYLON) {
  20526. var ShaderMaterial = (function (_super) {
  20527. __extends(ShaderMaterial, _super);
  20528. function ShaderMaterial(name, scene, shaderPath, options) {
  20529. _super.call(this, name, scene);
  20530. this._textures = new Array();
  20531. this._floats = new Array();
  20532. this._floatsArrays = {};
  20533. this._colors3 = new Array();
  20534. this._colors4 = new Array();
  20535. this._vectors2 = new Array();
  20536. this._vectors3 = new Array();
  20537. this._matrices = new Array();
  20538. this._cachedWorldViewMatrix = new BABYLON.Matrix();
  20539. this._shaderPath = shaderPath;
  20540. options.needAlphaBlending = options.needAlphaBlending || false;
  20541. options.needAlphaTesting = options.needAlphaTesting || false;
  20542. options.attributes = options.attributes || ["position", "normal", "uv"];
  20543. options.uniforms = options.uniforms || ["worldViewProjection"];
  20544. options.samplers = options.samplers || [];
  20545. this._options = options;
  20546. }
  20547. ShaderMaterial.prototype.needAlphaBlending = function () {
  20548. return this._options.needAlphaBlending;
  20549. };
  20550. ShaderMaterial.prototype.needAlphaTesting = function () {
  20551. return this._options.needAlphaTesting;
  20552. };
  20553. ShaderMaterial.prototype._checkUniform = function (uniformName) {
  20554. if (this._options.uniforms.indexOf(uniformName) === -1) {
  20555. this._options.uniforms.push(uniformName);
  20556. }
  20557. };
  20558. ShaderMaterial.prototype.setTexture = function (name, texture) {
  20559. if (this._options.samplers.indexOf(name) === -1) {
  20560. this._options.samplers.push(name);
  20561. }
  20562. this._textures[name] = texture;
  20563. return this;
  20564. };
  20565. ShaderMaterial.prototype.setFloat = function (name, value) {
  20566. this._checkUniform(name);
  20567. this._floats[name] = value;
  20568. return this;
  20569. };
  20570. ShaderMaterial.prototype.setFloats = function (name, value) {
  20571. this._checkUniform(name);
  20572. this._floatsArrays[name] = value;
  20573. return this;
  20574. };
  20575. ShaderMaterial.prototype.setColor3 = function (name, value) {
  20576. this._checkUniform(name);
  20577. this._colors3[name] = value;
  20578. return this;
  20579. };
  20580. ShaderMaterial.prototype.setColor4 = function (name, value) {
  20581. this._checkUniform(name);
  20582. this._colors4[name] = value;
  20583. return this;
  20584. };
  20585. ShaderMaterial.prototype.setVector2 = function (name, value) {
  20586. this._checkUniform(name);
  20587. this._vectors2[name] = value;
  20588. return this;
  20589. };
  20590. ShaderMaterial.prototype.setVector3 = function (name, value) {
  20591. this._checkUniform(name);
  20592. this._vectors3[name] = value;
  20593. return this;
  20594. };
  20595. ShaderMaterial.prototype.setMatrix = function (name, value) {
  20596. this._checkUniform(name);
  20597. this._matrices[name] = value;
  20598. return this;
  20599. };
  20600. ShaderMaterial.prototype.isReady = function () {
  20601. var scene = this.getScene();
  20602. var engine = scene.getEngine();
  20603. if (!this.checkReadyOnEveryCall) {
  20604. if (this._renderId === scene.getRenderId()) {
  20605. return true;
  20606. }
  20607. }
  20608. var previousEffect = this._effect;
  20609. this._effect = engine.createEffect(this._shaderPath, this._options.attributes, this._options.uniforms, this._options.samplers, "", null, this.onCompiled, this.onError);
  20610. if (!this._effect.isReady()) {
  20611. return false;
  20612. }
  20613. if (previousEffect !== this._effect) {
  20614. scene.resetCachedMaterial();
  20615. }
  20616. this._renderId = scene.getRenderId();
  20617. return true;
  20618. };
  20619. ShaderMaterial.prototype.bindOnlyWorldMatrix = function (world) {
  20620. var scene = this.getScene();
  20621. if (this._options.uniforms.indexOf("world") !== -1) {
  20622. this._effect.setMatrix("world", world);
  20623. }
  20624. if (this._options.uniforms.indexOf("worldView") !== -1) {
  20625. world.multiplyToRef(scene.getViewMatrix(), this._cachedWorldViewMatrix);
  20626. this._effect.setMatrix("worldView", this._cachedWorldViewMatrix);
  20627. }
  20628. if (this._options.uniforms.indexOf("worldViewProjection") !== -1) {
  20629. this._effect.setMatrix("worldViewProjection", world.multiply(scene.getTransformMatrix()));
  20630. }
  20631. };
  20632. ShaderMaterial.prototype.bind = function (world) {
  20633. // Std values
  20634. this.bindOnlyWorldMatrix(world);
  20635. if (this.getScene().getCachedMaterial() !== this) {
  20636. if (this._options.uniforms.indexOf("view") !== -1) {
  20637. this._effect.setMatrix("view", this.getScene().getViewMatrix());
  20638. }
  20639. if (this._options.uniforms.indexOf("projection") !== -1) {
  20640. this._effect.setMatrix("projection", this.getScene().getProjectionMatrix());
  20641. }
  20642. if (this._options.uniforms.indexOf("viewProjection") !== -1) {
  20643. this._effect.setMatrix("viewProjection", this.getScene().getTransformMatrix());
  20644. }
  20645. for (var name in this._textures) {
  20646. this._effect.setTexture(name, this._textures[name]);
  20647. }
  20648. for (name in this._floats) {
  20649. this._effect.setFloat(name, this._floats[name]);
  20650. }
  20651. for (name in this._floatsArrays) {
  20652. this._effect.setArray(name, this._floatsArrays[name]);
  20653. }
  20654. for (name in this._colors3) {
  20655. this._effect.setColor3(name, this._colors3[name]);
  20656. }
  20657. for (name in this._colors4) {
  20658. var color = this._colors4[name];
  20659. this._effect.setFloat4(name, color.r, color.g, color.b, color.a);
  20660. }
  20661. for (name in this._vectors2) {
  20662. this._effect.setVector2(name, this._vectors2[name]);
  20663. }
  20664. for (name in this._vectors3) {
  20665. this._effect.setVector3(name, this._vectors3[name]);
  20666. }
  20667. for (name in this._matrices) {
  20668. this._effect.setMatrix(name, this._matrices[name]);
  20669. }
  20670. }
  20671. _super.prototype.bind.call(this, world, null);
  20672. };
  20673. ShaderMaterial.prototype.dispose = function (forceDisposeEffect) {
  20674. for (var name in this._textures) {
  20675. this._textures[name].dispose();
  20676. }
  20677. this._textures = [];
  20678. _super.prototype.dispose.call(this, forceDisposeEffect);
  20679. };
  20680. return ShaderMaterial;
  20681. })(BABYLON.Material);
  20682. BABYLON.ShaderMaterial = ShaderMaterial;
  20683. })(BABYLON || (BABYLON = {}));
  20684. //# sourceMappingURL=babylon.shaderMaterial.js.mapvar BABYLON;
  20685. (function (BABYLON) {
  20686. var VertexData = (function () {
  20687. function VertexData() {
  20688. }
  20689. VertexData.prototype.set = function (data, kind) {
  20690. switch (kind) {
  20691. case BABYLON.VertexBuffer.PositionKind:
  20692. this.positions = data;
  20693. break;
  20694. case BABYLON.VertexBuffer.NormalKind:
  20695. this.normals = data;
  20696. break;
  20697. case BABYLON.VertexBuffer.UVKind:
  20698. this.uvs = data;
  20699. break;
  20700. case BABYLON.VertexBuffer.UV2Kind:
  20701. this.uv2s = data;
  20702. break;
  20703. case BABYLON.VertexBuffer.ColorKind:
  20704. this.colors = data;
  20705. break;
  20706. case BABYLON.VertexBuffer.MatricesIndicesKind:
  20707. this.matricesIndices = data;
  20708. break;
  20709. case BABYLON.VertexBuffer.MatricesWeightsKind:
  20710. this.matricesWeights = data;
  20711. break;
  20712. }
  20713. };
  20714. VertexData.prototype.applyToMesh = function (mesh, updatable) {
  20715. this._applyTo(mesh, updatable);
  20716. };
  20717. VertexData.prototype.applyToGeometry = function (geometry, updatable) {
  20718. this._applyTo(geometry, updatable);
  20719. };
  20720. VertexData.prototype.updateMesh = function (mesh, updateExtends, makeItUnique) {
  20721. this._update(mesh);
  20722. };
  20723. VertexData.prototype.updateGeometry = function (geometry, updateExtends, makeItUnique) {
  20724. this._update(geometry);
  20725. };
  20726. VertexData.prototype._applyTo = function (meshOrGeometry, updatable) {
  20727. if (this.positions) {
  20728. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.PositionKind, this.positions, updatable);
  20729. }
  20730. if (this.normals) {
  20731. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.NormalKind, this.normals, updatable);
  20732. }
  20733. if (this.uvs) {
  20734. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.UVKind, this.uvs, updatable);
  20735. }
  20736. if (this.uv2s) {
  20737. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.UV2Kind, this.uv2s, updatable);
  20738. }
  20739. if (this.colors) {
  20740. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.ColorKind, this.colors, updatable);
  20741. }
  20742. if (this.matricesIndices) {
  20743. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, this.matricesIndices, updatable);
  20744. }
  20745. if (this.matricesWeights) {
  20746. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind, this.matricesWeights, updatable);
  20747. }
  20748. if (this.indices) {
  20749. meshOrGeometry.setIndices(this.indices);
  20750. }
  20751. };
  20752. VertexData.prototype._update = function (meshOrGeometry, updateExtends, makeItUnique) {
  20753. if (this.positions) {
  20754. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.PositionKind, this.positions, updateExtends, makeItUnique);
  20755. }
  20756. if (this.normals) {
  20757. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.NormalKind, this.normals, updateExtends, makeItUnique);
  20758. }
  20759. if (this.uvs) {
  20760. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.UVKind, this.uvs, updateExtends, makeItUnique);
  20761. }
  20762. if (this.uv2s) {
  20763. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.UV2Kind, this.uv2s, updateExtends, makeItUnique);
  20764. }
  20765. if (this.colors) {
  20766. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.ColorKind, this.colors, updateExtends, makeItUnique);
  20767. }
  20768. if (this.matricesIndices) {
  20769. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, this.matricesIndices, updateExtends, makeItUnique);
  20770. }
  20771. if (this.matricesWeights) {
  20772. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind, this.matricesWeights, updateExtends, makeItUnique);
  20773. }
  20774. if (this.indices) {
  20775. meshOrGeometry.setIndices(this.indices);
  20776. }
  20777. };
  20778. VertexData.prototype.transform = function (matrix) {
  20779. var transformed = BABYLON.Vector3.Zero();
  20780. if (this.positions) {
  20781. var position = BABYLON.Vector3.Zero();
  20782. for (var index = 0; index < this.positions.length; index += 3) {
  20783. BABYLON.Vector3.FromArrayToRef(this.positions, index, position);
  20784. BABYLON.Vector3.TransformCoordinatesToRef(position, matrix, transformed);
  20785. this.positions[index] = transformed.x;
  20786. this.positions[index + 1] = transformed.y;
  20787. this.positions[index + 2] = transformed.z;
  20788. }
  20789. }
  20790. if (this.normals) {
  20791. var normal = BABYLON.Vector3.Zero();
  20792. for (index = 0; index < this.normals.length; index += 3) {
  20793. BABYLON.Vector3.FromArrayToRef(this.normals, index, normal);
  20794. BABYLON.Vector3.TransformNormalToRef(normal, matrix, transformed);
  20795. this.normals[index] = transformed.x;
  20796. this.normals[index + 1] = transformed.y;
  20797. this.normals[index + 2] = transformed.z;
  20798. }
  20799. }
  20800. };
  20801. VertexData.prototype.merge = function (other) {
  20802. if (other.indices) {
  20803. if (!this.indices) {
  20804. this.indices = [];
  20805. }
  20806. var offset = this.positions ? this.positions.length / 3 : 0;
  20807. for (var index = 0; index < other.indices.length; index++) {
  20808. this.indices.push(other.indices[index] + offset);
  20809. }
  20810. }
  20811. if (other.positions) {
  20812. if (!this.positions) {
  20813. this.positions = [];
  20814. }
  20815. for (index = 0; index < other.positions.length; index++) {
  20816. this.positions.push(other.positions[index]);
  20817. }
  20818. }
  20819. if (other.normals) {
  20820. if (!this.normals) {
  20821. this.normals = [];
  20822. }
  20823. for (index = 0; index < other.normals.length; index++) {
  20824. this.normals.push(other.normals[index]);
  20825. }
  20826. }
  20827. if (other.uvs) {
  20828. if (!this.uvs) {
  20829. this.uvs = [];
  20830. }
  20831. for (index = 0; index < other.uvs.length; index++) {
  20832. this.uvs.push(other.uvs[index]);
  20833. }
  20834. }
  20835. if (other.uv2s) {
  20836. if (!this.uv2s) {
  20837. this.uv2s = [];
  20838. }
  20839. for (index = 0; index < other.uv2s.length; index++) {
  20840. this.uv2s.push(other.uv2s[index]);
  20841. }
  20842. }
  20843. if (other.matricesIndices) {
  20844. if (!this.matricesIndices) {
  20845. this.matricesIndices = [];
  20846. }
  20847. for (index = 0; index < other.matricesIndices.length; index++) {
  20848. this.matricesIndices.push(other.matricesIndices[index]);
  20849. }
  20850. }
  20851. if (other.matricesWeights) {
  20852. if (!this.matricesWeights) {
  20853. this.matricesWeights = [];
  20854. }
  20855. for (index = 0; index < other.matricesWeights.length; index++) {
  20856. this.matricesWeights.push(other.matricesWeights[index]);
  20857. }
  20858. }
  20859. if (other.colors) {
  20860. if (!this.colors) {
  20861. this.colors = [];
  20862. }
  20863. for (index = 0; index < other.colors.length; index++) {
  20864. this.colors.push(other.colors[index]);
  20865. }
  20866. }
  20867. };
  20868. // Statics
  20869. VertexData.ExtractFromMesh = function (mesh) {
  20870. return VertexData._ExtractFrom(mesh);
  20871. };
  20872. VertexData.ExtractFromGeometry = function (geometry) {
  20873. return VertexData._ExtractFrom(geometry);
  20874. };
  20875. VertexData._ExtractFrom = function (meshOrGeometry) {
  20876. var result = new BABYLON.VertexData();
  20877. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.PositionKind)) {
  20878. result.positions = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  20879. }
  20880. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) {
  20881. result.normals = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  20882. }
  20883. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  20884. result.uvs = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.UVKind);
  20885. }
  20886. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  20887. result.uv2s = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.UV2Kind);
  20888. }
  20889. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.ColorKind)) {
  20890. result.colors = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.ColorKind);
  20891. }
  20892. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind)) {
  20893. result.matricesIndices = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind);
  20894. }
  20895. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind)) {
  20896. result.matricesWeights = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind);
  20897. }
  20898. result.indices = meshOrGeometry.getIndices();
  20899. return result;
  20900. };
  20901. VertexData.CreateBox = function (size) {
  20902. var normalsSource = [
  20903. new BABYLON.Vector3(0, 0, 1),
  20904. new BABYLON.Vector3(0, 0, -1),
  20905. new BABYLON.Vector3(1, 0, 0),
  20906. new BABYLON.Vector3(-1, 0, 0),
  20907. new BABYLON.Vector3(0, 1, 0),
  20908. new BABYLON.Vector3(0, -1, 0)
  20909. ];
  20910. var indices = [];
  20911. var positions = [];
  20912. var normals = [];
  20913. var uvs = [];
  20914. size = size || 1;
  20915. for (var index = 0; index < normalsSource.length; index++) {
  20916. var normal = normalsSource[index];
  20917. // Get two vectors perpendicular to the face normal and to each other.
  20918. var side1 = new BABYLON.Vector3(normal.y, normal.z, normal.x);
  20919. var side2 = BABYLON.Vector3.Cross(normal, side1);
  20920. // Six indices (two triangles) per face.
  20921. var verticesLength = positions.length / 3;
  20922. indices.push(verticesLength);
  20923. indices.push(verticesLength + 1);
  20924. indices.push(verticesLength + 2);
  20925. indices.push(verticesLength);
  20926. indices.push(verticesLength + 2);
  20927. indices.push(verticesLength + 3);
  20928. // Four vertices per face.
  20929. var vertex = normal.subtract(side1).subtract(side2).scale(size / 2);
  20930. positions.push(vertex.x, vertex.y, vertex.z);
  20931. normals.push(normal.x, normal.y, normal.z);
  20932. uvs.push(1.0, 1.0);
  20933. vertex = normal.subtract(side1).add(side2).scale(size / 2);
  20934. positions.push(vertex.x, vertex.y, vertex.z);
  20935. normals.push(normal.x, normal.y, normal.z);
  20936. uvs.push(0.0, 1.0);
  20937. vertex = normal.add(side1).add(side2).scale(size / 2);
  20938. positions.push(vertex.x, vertex.y, vertex.z);
  20939. normals.push(normal.x, normal.y, normal.z);
  20940. uvs.push(0.0, 0.0);
  20941. vertex = normal.add(side1).subtract(side2).scale(size / 2);
  20942. positions.push(vertex.x, vertex.y, vertex.z);
  20943. normals.push(normal.x, normal.y, normal.z);
  20944. uvs.push(1.0, 0.0);
  20945. }
  20946. // Result
  20947. var vertexData = new BABYLON.VertexData();
  20948. vertexData.indices = indices;
  20949. vertexData.positions = positions;
  20950. vertexData.normals = normals;
  20951. vertexData.uvs = uvs;
  20952. return vertexData;
  20953. };
  20954. VertexData.CreateSphere = function (segments, diameter) {
  20955. segments = segments || 32;
  20956. diameter = diameter || 1;
  20957. var radius = diameter / 2;
  20958. var totalZRotationSteps = 2 + segments;
  20959. var totalYRotationSteps = 2 * totalZRotationSteps;
  20960. var indices = [];
  20961. var positions = [];
  20962. var normals = [];
  20963. var uvs = [];
  20964. for (var zRotationStep = 0; zRotationStep <= totalZRotationSteps; zRotationStep++) {
  20965. var normalizedZ = zRotationStep / totalZRotationSteps;
  20966. var angleZ = (normalizedZ * Math.PI);
  20967. for (var yRotationStep = 0; yRotationStep <= totalYRotationSteps; yRotationStep++) {
  20968. var normalizedY = yRotationStep / totalYRotationSteps;
  20969. var angleY = normalizedY * Math.PI * 2;
  20970. var rotationZ = BABYLON.Matrix.RotationZ(-angleZ);
  20971. var rotationY = BABYLON.Matrix.RotationY(angleY);
  20972. var afterRotZ = BABYLON.Vector3.TransformCoordinates(BABYLON.Vector3.Up(), rotationZ);
  20973. var complete = BABYLON.Vector3.TransformCoordinates(afterRotZ, rotationY);
  20974. var vertex = complete.scale(radius);
  20975. var normal = BABYLON.Vector3.Normalize(vertex);
  20976. positions.push(vertex.x, vertex.y, vertex.z);
  20977. normals.push(normal.x, normal.y, normal.z);
  20978. uvs.push(normalizedZ, normalizedY);
  20979. }
  20980. if (zRotationStep > 0) {
  20981. var verticesCount = positions.length / 3;
  20982. for (var firstIndex = verticesCount - 2 * (totalYRotationSteps + 1); (firstIndex + totalYRotationSteps + 2) < verticesCount; firstIndex++) {
  20983. indices.push((firstIndex));
  20984. indices.push((firstIndex + 1));
  20985. indices.push(firstIndex + totalYRotationSteps + 1);
  20986. indices.push((firstIndex + totalYRotationSteps + 1));
  20987. indices.push((firstIndex + 1));
  20988. indices.push((firstIndex + totalYRotationSteps + 2));
  20989. }
  20990. }
  20991. }
  20992. // Result
  20993. var vertexData = new BABYLON.VertexData();
  20994. vertexData.indices = indices;
  20995. vertexData.positions = positions;
  20996. vertexData.normals = normals;
  20997. vertexData.uvs = uvs;
  20998. return vertexData;
  20999. };
  21000. VertexData.CreateCylinder = function (height, diameterTop, diameterBottom, tessellation, subdivisions) {
  21001. if (subdivisions === void 0) { subdivisions = 1; }
  21002. var radiusTop = diameterTop / 2;
  21003. var radiusBottom = diameterBottom / 2;
  21004. var indices = [];
  21005. var positions = [];
  21006. var normals = [];
  21007. var uvs = [];
  21008. height = height || 1;
  21009. diameterTop = diameterTop || 0.5;
  21010. diameterBottom = diameterBottom || 1;
  21011. tessellation = tessellation || 16;
  21012. subdivisions = subdivisions || 1;
  21013. subdivisions = (subdivisions < 1) ? 1 : subdivisions;
  21014. var getCircleVector = function (i) {
  21015. var angle = (i * 2.0 * Math.PI / tessellation);
  21016. var dx = Math.cos(angle);
  21017. var dz = Math.sin(angle);
  21018. return new BABYLON.Vector3(dx, 0, dz);
  21019. };
  21020. var createCylinderCap = function (isTop) {
  21021. var radius = isTop ? radiusTop : radiusBottom;
  21022. if (radius == 0) {
  21023. return;
  21024. }
  21025. var vbase = positions.length / 3;
  21026. var offset = new BABYLON.Vector3(0, height / 2, 0);
  21027. var textureScale = new BABYLON.Vector2(0.5, 0.5);
  21028. if (!isTop) {
  21029. offset.scaleInPlace(-1);
  21030. textureScale.x = -textureScale.x;
  21031. }
  21032. for (i = 0; i < tessellation; i++) {
  21033. var circleVector = getCircleVector(i);
  21034. var position = circleVector.scale(radius).add(offset);
  21035. var textureCoordinate = new BABYLON.Vector2(circleVector.x * textureScale.x + 0.5, circleVector.z * textureScale.y + 0.5);
  21036. positions.push(position.x, position.y, position.z);
  21037. uvs.push(textureCoordinate.x, textureCoordinate.y);
  21038. }
  21039. for (var i = 0; i < tessellation - 2; i++) {
  21040. if (!isTop) {
  21041. indices.push(vbase);
  21042. indices.push(vbase + (i + 2) % tessellation);
  21043. indices.push(vbase + (i + 1) % tessellation);
  21044. }
  21045. else {
  21046. indices.push(vbase);
  21047. indices.push(vbase + (i + 1) % tessellation);
  21048. indices.push(vbase + (i + 2) % tessellation);
  21049. }
  21050. }
  21051. };
  21052. var base = new BABYLON.Vector3(0, -1, 0).scale(height / 2);
  21053. var offset = new BABYLON.Vector3(0, 1, 0).scale(height / subdivisions);
  21054. var stride = tessellation + 1;
  21055. for (var i = 0; i <= tessellation; i++) {
  21056. var circleVector = getCircleVector(i);
  21057. var textureCoordinate = new BABYLON.Vector2(i / tessellation, 0);
  21058. var position, radius = radiusBottom;
  21059. for (var s = 0; s <= subdivisions; s++) {
  21060. // Update variables
  21061. position = circleVector.scale(radius);
  21062. position.addInPlace(base.add(offset.scale(s)));
  21063. textureCoordinate.y += 1 / subdivisions;
  21064. radius += (radiusTop - radiusBottom) / subdivisions;
  21065. // Push in arrays
  21066. positions.push(position.x, position.y, position.z);
  21067. uvs.push(textureCoordinate.x, textureCoordinate.y);
  21068. }
  21069. }
  21070. subdivisions += 1;
  21071. for (var s = 0; s < subdivisions - 1; s++) {
  21072. for (var i = 0; i <= tessellation; i++) {
  21073. indices.push(i * subdivisions + s);
  21074. indices.push((i * subdivisions + (s + subdivisions)) % (stride * subdivisions));
  21075. indices.push(i * subdivisions + (s + 1));
  21076. indices.push(i * subdivisions + (s + 1));
  21077. indices.push((i * subdivisions + (s + subdivisions)) % (stride * subdivisions));
  21078. indices.push((i * subdivisions + (s + subdivisions + 1)) % (stride * subdivisions));
  21079. }
  21080. }
  21081. // Create flat triangle fan caps to seal the top and bottom.
  21082. createCylinderCap(true);
  21083. createCylinderCap(false);
  21084. // Normals
  21085. BABYLON.VertexData.ComputeNormals(positions, indices, normals);
  21086. // Result
  21087. var vertexData = new BABYLON.VertexData();
  21088. vertexData.indices = indices;
  21089. vertexData.positions = positions;
  21090. vertexData.normals = normals;
  21091. vertexData.uvs = uvs;
  21092. return vertexData;
  21093. };
  21094. VertexData.CreateTorus = function (diameter, thickness, tessellation) {
  21095. var indices = [];
  21096. var positions = [];
  21097. var normals = [];
  21098. var uvs = [];
  21099. diameter = diameter || 1;
  21100. thickness = thickness || 0.5;
  21101. tessellation = tessellation || 16;
  21102. var stride = tessellation + 1;
  21103. for (var i = 0; i <= tessellation; i++) {
  21104. var u = i / tessellation;
  21105. var outerAngle = i * Math.PI * 2.0 / tessellation - Math.PI / 2.0;
  21106. var transform = BABYLON.Matrix.Translation(diameter / 2.0, 0, 0).multiply(BABYLON.Matrix.RotationY(outerAngle));
  21107. for (var j = 0; j <= tessellation; j++) {
  21108. var v = 1 - j / tessellation;
  21109. var innerAngle = j * Math.PI * 2.0 / tessellation + Math.PI;
  21110. var dx = Math.cos(innerAngle);
  21111. var dy = Math.sin(innerAngle);
  21112. // Create a vertex.
  21113. var normal = new BABYLON.Vector3(dx, dy, 0);
  21114. var position = normal.scale(thickness / 2);
  21115. var textureCoordinate = new BABYLON.Vector2(u, v);
  21116. position = BABYLON.Vector3.TransformCoordinates(position, transform);
  21117. normal = BABYLON.Vector3.TransformNormal(normal, transform);
  21118. positions.push(position.x, position.y, position.z);
  21119. normals.push(normal.x, normal.y, normal.z);
  21120. uvs.push(textureCoordinate.x, textureCoordinate.y);
  21121. // And create indices for two triangles.
  21122. var nextI = (i + 1) % stride;
  21123. var nextJ = (j + 1) % stride;
  21124. indices.push(i * stride + j);
  21125. indices.push(i * stride + nextJ);
  21126. indices.push(nextI * stride + j);
  21127. indices.push(i * stride + nextJ);
  21128. indices.push(nextI * stride + nextJ);
  21129. indices.push(nextI * stride + j);
  21130. }
  21131. }
  21132. // Result
  21133. var vertexData = new BABYLON.VertexData();
  21134. vertexData.indices = indices;
  21135. vertexData.positions = positions;
  21136. vertexData.normals = normals;
  21137. vertexData.uvs = uvs;
  21138. return vertexData;
  21139. };
  21140. VertexData.CreateLines = function (points) {
  21141. var indices = [];
  21142. var positions = [];
  21143. for (var index = 0; index < points.length; index++) {
  21144. positions.push(points[index].x, points[index].y, points[index].z);
  21145. if (index > 0) {
  21146. indices.push(index - 1);
  21147. indices.push(index);
  21148. }
  21149. }
  21150. // Result
  21151. var vertexData = new BABYLON.VertexData();
  21152. vertexData.indices = indices;
  21153. vertexData.positions = positions;
  21154. return vertexData;
  21155. };
  21156. VertexData.CreateGround = function (width, height, subdivisions) {
  21157. var indices = [];
  21158. var positions = [];
  21159. var normals = [];
  21160. var uvs = [];
  21161. var row, col;
  21162. width = width || 1;
  21163. height = height || 1;
  21164. subdivisions = subdivisions || 1;
  21165. for (row = 0; row <= subdivisions; row++) {
  21166. for (col = 0; col <= subdivisions; col++) {
  21167. var position = new BABYLON.Vector3((col * width) / subdivisions - (width / 2.0), 0, ((subdivisions - row) * height) / subdivisions - (height / 2.0));
  21168. var normal = new BABYLON.Vector3(0, 1.0, 0);
  21169. positions.push(position.x, position.y, position.z);
  21170. normals.push(normal.x, normal.y, normal.z);
  21171. uvs.push(col / subdivisions, 1.0 - row / subdivisions);
  21172. }
  21173. }
  21174. for (row = 0; row < subdivisions; row++) {
  21175. for (col = 0; col < subdivisions; col++) {
  21176. indices.push(col + 1 + (row + 1) * (subdivisions + 1));
  21177. indices.push(col + 1 + row * (subdivisions + 1));
  21178. indices.push(col + row * (subdivisions + 1));
  21179. indices.push(col + (row + 1) * (subdivisions + 1));
  21180. indices.push(col + 1 + (row + 1) * (subdivisions + 1));
  21181. indices.push(col + row * (subdivisions + 1));
  21182. }
  21183. }
  21184. // Result
  21185. var vertexData = new BABYLON.VertexData();
  21186. vertexData.indices = indices;
  21187. vertexData.positions = positions;
  21188. vertexData.normals = normals;
  21189. vertexData.uvs = uvs;
  21190. return vertexData;
  21191. };
  21192. VertexData.CreateTiledGround = function (xmin, zmin, xmax, zmax, subdivisions, precision) {
  21193. if (subdivisions === void 0) { subdivisions = { w: 1, h: 1 }; }
  21194. if (precision === void 0) { precision = { w: 1, h: 1 }; }
  21195. var indices = [];
  21196. var positions = [];
  21197. var normals = [];
  21198. var uvs = [];
  21199. var row, col, tileRow, tileCol;
  21200. subdivisions.h = (subdivisions.w < 1) ? 1 : subdivisions.h;
  21201. subdivisions.w = (subdivisions.w < 1) ? 1 : subdivisions.w;
  21202. precision.w = (precision.w < 1) ? 1 : precision.w;
  21203. precision.h = (precision.h < 1) ? 1 : precision.h;
  21204. var tileSize = {
  21205. 'w': (xmax - xmin) / subdivisions.w,
  21206. 'h': (zmax - zmin) / subdivisions.h
  21207. };
  21208. for (tileRow = 0; tileRow < subdivisions.h; tileRow++) {
  21209. for (tileCol = 0; tileCol < subdivisions.w; tileCol++) {
  21210. applyTile(xmin + tileCol * tileSize.w, zmin + tileRow * tileSize.h, xmin + (tileCol + 1) * tileSize.w, zmin + (tileRow + 1) * tileSize.h);
  21211. }
  21212. }
  21213. function applyTile(xTileMin, zTileMin, xTileMax, zTileMax) {
  21214. // Indices
  21215. var base = positions.length / 3;
  21216. var rowLength = precision.w + 1;
  21217. for (row = 0; row < precision.h; row++) {
  21218. for (col = 0; col < precision.w; col++) {
  21219. var square = [
  21220. base + col + row * rowLength,
  21221. base + (col + 1) + row * rowLength,
  21222. base + (col + 1) + (row + 1) * rowLength,
  21223. base + col + (row + 1) * rowLength
  21224. ];
  21225. indices.push(square[1]);
  21226. indices.push(square[2]);
  21227. indices.push(square[3]);
  21228. indices.push(square[0]);
  21229. indices.push(square[1]);
  21230. indices.push(square[3]);
  21231. }
  21232. }
  21233. // Position, normals and uvs
  21234. var position = BABYLON.Vector3.Zero();
  21235. var normal = new BABYLON.Vector3(0, 1.0, 0);
  21236. for (row = 0; row <= precision.h; row++) {
  21237. position.z = (row * (zTileMax - zTileMin)) / precision.h + zTileMin;
  21238. for (col = 0; col <= precision.w; col++) {
  21239. position.x = (col * (xTileMax - xTileMin)) / precision.w + xTileMin;
  21240. position.y = 0;
  21241. positions.push(position.x, position.y, position.z);
  21242. normals.push(normal.x, normal.y, normal.z);
  21243. uvs.push(col / precision.w, row / precision.h);
  21244. }
  21245. }
  21246. }
  21247. // Result
  21248. var vertexData = new BABYLON.VertexData();
  21249. vertexData.indices = indices;
  21250. vertexData.positions = positions;
  21251. vertexData.normals = normals;
  21252. vertexData.uvs = uvs;
  21253. return vertexData;
  21254. };
  21255. VertexData.CreateGroundFromHeightMap = function (width, height, subdivisions, minHeight, maxHeight, buffer, bufferWidth, bufferHeight) {
  21256. var indices = [];
  21257. var positions = [];
  21258. var normals = [];
  21259. var uvs = [];
  21260. var row, col;
  21261. for (row = 0; row <= subdivisions; row++) {
  21262. for (col = 0; col <= subdivisions; col++) {
  21263. var position = new BABYLON.Vector3((col * width) / subdivisions - (width / 2.0), 0, ((subdivisions - row) * height) / subdivisions - (height / 2.0));
  21264. // Compute height
  21265. var heightMapX = (((position.x + width / 2) / width) * (bufferWidth - 1)) | 0;
  21266. var heightMapY = ((1.0 - (position.z + height / 2) / height) * (bufferHeight - 1)) | 0;
  21267. var pos = (heightMapX + heightMapY * bufferWidth) * 4;
  21268. var r = buffer[pos] / 255.0;
  21269. var g = buffer[pos + 1] / 255.0;
  21270. var b = buffer[pos + 2] / 255.0;
  21271. var gradient = r * 0.3 + g * 0.59 + b * 0.11;
  21272. position.y = minHeight + (maxHeight - minHeight) * gradient;
  21273. // Add vertex
  21274. positions.push(position.x, position.y, position.z);
  21275. normals.push(0, 0, 0);
  21276. uvs.push(col / subdivisions, 1.0 - row / subdivisions);
  21277. }
  21278. }
  21279. for (row = 0; row < subdivisions; row++) {
  21280. for (col = 0; col < subdivisions; col++) {
  21281. indices.push(col + 1 + (row + 1) * (subdivisions + 1));
  21282. indices.push(col + 1 + row * (subdivisions + 1));
  21283. indices.push(col + row * (subdivisions + 1));
  21284. indices.push(col + (row + 1) * (subdivisions + 1));
  21285. indices.push(col + 1 + (row + 1) * (subdivisions + 1));
  21286. indices.push(col + row * (subdivisions + 1));
  21287. }
  21288. }
  21289. // Normals
  21290. BABYLON.VertexData.ComputeNormals(positions, indices, normals);
  21291. // Result
  21292. var vertexData = new BABYLON.VertexData();
  21293. vertexData.indices = indices;
  21294. vertexData.positions = positions;
  21295. vertexData.normals = normals;
  21296. vertexData.uvs = uvs;
  21297. return vertexData;
  21298. };
  21299. VertexData.CreatePlane = function (size) {
  21300. var indices = [];
  21301. var positions = [];
  21302. var normals = [];
  21303. var uvs = [];
  21304. size = size || 1;
  21305. // Vertices
  21306. var halfSize = size / 2.0;
  21307. positions.push(-halfSize, -halfSize, 0);
  21308. normals.push(0, 0, -1.0);
  21309. uvs.push(0.0, 0.0);
  21310. positions.push(halfSize, -halfSize, 0);
  21311. normals.push(0, 0, -1.0);
  21312. uvs.push(1.0, 0.0);
  21313. positions.push(halfSize, halfSize, 0);
  21314. normals.push(0, 0, -1.0);
  21315. uvs.push(1.0, 1.0);
  21316. positions.push(-halfSize, halfSize, 0);
  21317. normals.push(0, 0, -1.0);
  21318. uvs.push(0.0, 1.0);
  21319. // Indices
  21320. indices.push(0);
  21321. indices.push(1);
  21322. indices.push(2);
  21323. indices.push(0);
  21324. indices.push(2);
  21325. indices.push(3);
  21326. // Result
  21327. var vertexData = new BABYLON.VertexData();
  21328. vertexData.indices = indices;
  21329. vertexData.positions = positions;
  21330. vertexData.normals = normals;
  21331. vertexData.uvs = uvs;
  21332. return vertexData;
  21333. };
  21334. // based on http://code.google.com/p/away3d/source/browse/trunk/fp10/Away3D/src/away3d/primitives/TorusKnot.as?spec=svn2473&r=2473
  21335. VertexData.CreateTorusKnot = function (radius, tube, radialSegments, tubularSegments, p, q) {
  21336. var indices = [];
  21337. var positions = [];
  21338. var normals = [];
  21339. var uvs = [];
  21340. radius = radius || 2;
  21341. tube = tube || 0.5;
  21342. radialSegments = radialSegments || 32;
  21343. tubularSegments = tubularSegments || 32;
  21344. p = p || 2;
  21345. q = q || 3;
  21346. // Helper
  21347. var getPos = function (angle) {
  21348. var cu = Math.cos(angle);
  21349. var su = Math.sin(angle);
  21350. var quOverP = q / p * angle;
  21351. var cs = Math.cos(quOverP);
  21352. var tx = radius * (2 + cs) * 0.5 * cu;
  21353. var ty = radius * (2 + cs) * su * 0.5;
  21354. var tz = radius * Math.sin(quOverP) * 0.5;
  21355. return new BABYLON.Vector3(tx, ty, tz);
  21356. };
  21357. for (var i = 0; i <= radialSegments; i++) {
  21358. var modI = i % radialSegments;
  21359. var u = modI / radialSegments * 2 * p * Math.PI;
  21360. var p1 = getPos(u);
  21361. var p2 = getPos(u + 0.01);
  21362. var tang = p2.subtract(p1);
  21363. var n = p2.add(p1);
  21364. var bitan = BABYLON.Vector3.Cross(tang, n);
  21365. n = BABYLON.Vector3.Cross(bitan, tang);
  21366. bitan.normalize();
  21367. n.normalize();
  21368. for (var j = 0; j < tubularSegments; j++) {
  21369. var modJ = j % tubularSegments;
  21370. var v = modJ / tubularSegments * 2 * Math.PI;
  21371. var cx = -tube * Math.cos(v);
  21372. var cy = tube * Math.sin(v);
  21373. positions.push(p1.x + cx * n.x + cy * bitan.x);
  21374. positions.push(p1.y + cx * n.y + cy * bitan.y);
  21375. positions.push(p1.z + cx * n.z + cy * bitan.z);
  21376. uvs.push(i / radialSegments);
  21377. uvs.push(j / tubularSegments);
  21378. }
  21379. }
  21380. for (i = 0; i < radialSegments; i++) {
  21381. for (j = 0; j < tubularSegments; j++) {
  21382. var jNext = (j + 1) % tubularSegments;
  21383. var a = i * tubularSegments + j;
  21384. var b = (i + 1) * tubularSegments + j;
  21385. var c = (i + 1) * tubularSegments + jNext;
  21386. var d = i * tubularSegments + jNext;
  21387. indices.push(d);
  21388. indices.push(b);
  21389. indices.push(a);
  21390. indices.push(d);
  21391. indices.push(c);
  21392. indices.push(b);
  21393. }
  21394. }
  21395. // Normals
  21396. BABYLON.VertexData.ComputeNormals(positions, indices, normals);
  21397. // Result
  21398. var vertexData = new BABYLON.VertexData();
  21399. vertexData.indices = indices;
  21400. vertexData.positions = positions;
  21401. vertexData.normals = normals;
  21402. vertexData.uvs = uvs;
  21403. return vertexData;
  21404. };
  21405. // Tools
  21406. VertexData.ComputeNormals = function (positions, indices, normals) {
  21407. var positionVectors = [];
  21408. var facesOfVertices = [];
  21409. var index;
  21410. for (index = 0; index < positions.length; index += 3) {
  21411. var vector3 = new BABYLON.Vector3(positions[index], positions[index + 1], positions[index + 2]);
  21412. positionVectors.push(vector3);
  21413. facesOfVertices.push([]);
  21414. }
  21415. // Compute normals
  21416. var facesNormals = [];
  21417. for (index = 0; index < indices.length / 3; index++) {
  21418. var i1 = indices[index * 3];
  21419. var i2 = indices[index * 3 + 1];
  21420. var i3 = indices[index * 3 + 2];
  21421. var p1 = positionVectors[i1];
  21422. var p2 = positionVectors[i2];
  21423. var p3 = positionVectors[i3];
  21424. var p1p2 = p1.subtract(p2);
  21425. var p3p2 = p3.subtract(p2);
  21426. facesNormals[index] = BABYLON.Vector3.Normalize(BABYLON.Vector3.Cross(p1p2, p3p2));
  21427. facesOfVertices[i1].push(index);
  21428. facesOfVertices[i2].push(index);
  21429. facesOfVertices[i3].push(index);
  21430. }
  21431. for (index = 0; index < positionVectors.length; index++) {
  21432. var faces = facesOfVertices[index];
  21433. var normal = BABYLON.Vector3.Zero();
  21434. for (var faceIndex = 0; faceIndex < faces.length; faceIndex++) {
  21435. normal.addInPlace(facesNormals[faces[faceIndex]]);
  21436. }
  21437. normal = BABYLON.Vector3.Normalize(normal.scale(1.0 / faces.length));
  21438. normals[index * 3] = normal.x;
  21439. normals[index * 3 + 1] = normal.y;
  21440. normals[index * 3 + 2] = normal.z;
  21441. }
  21442. };
  21443. return VertexData;
  21444. })();
  21445. BABYLON.VertexData = VertexData;
  21446. })(BABYLON || (BABYLON = {}));
  21447. //# sourceMappingURL=babylon.mesh.vertexData.js.map
  21448. var BABYLON;
  21449. (function (BABYLON) {
  21450. var buildCamera = function (that, name) {
  21451. that._leftCamera.isIntermediate = true;
  21452. that.subCameras.push(that._leftCamera);
  21453. that.subCameras.push(that._rightCamera);
  21454. that._leftTexture = new BABYLON.PassPostProcess(name + "_leftTexture", 1.0, that._leftCamera);
  21455. that._anaglyphPostProcess = new BABYLON.AnaglyphPostProcess(name + "_anaglyph", 1.0, that._rightCamera);
  21456. that._anaglyphPostProcess.onApply = function (effect) {
  21457. effect.setTextureFromPostProcess("leftSampler", that._leftTexture);
  21458. };
  21459. that._update();
  21460. };
  21461. var AnaglyphArcRotateCamera = (function (_super) {
  21462. __extends(AnaglyphArcRotateCamera, _super);
  21463. // ANY
  21464. function AnaglyphArcRotateCamera(name, alpha, beta, radius, target, eyeSpace, scene) {
  21465. _super.call(this, name, alpha, beta, radius, target, scene);
  21466. this._eyeSpace = BABYLON.Tools.ToRadians(eyeSpace);
  21467. this._leftCamera = new BABYLON.ArcRotateCamera(name + "_left", alpha - this._eyeSpace, beta, radius, target, scene);
  21468. this._rightCamera = new BABYLON.ArcRotateCamera(name + "_right", alpha + this._eyeSpace, beta, radius, target, scene);
  21469. buildCamera(this, name);
  21470. }
  21471. AnaglyphArcRotateCamera.prototype._update = function () {
  21472. this._updateCamera(this._leftCamera);
  21473. this._updateCamera(this._rightCamera);
  21474. this._leftCamera.alpha = this.alpha - this._eyeSpace;
  21475. this._rightCamera.alpha = this.alpha + this._eyeSpace;
  21476. _super.prototype._update.call(this);
  21477. };
  21478. AnaglyphArcRotateCamera.prototype._updateCamera = function (camera) {
  21479. camera.beta = this.beta;
  21480. camera.radius = this.radius;
  21481. camera.minZ = this.minZ;
  21482. camera.maxZ = this.maxZ;
  21483. camera.fov = this.fov;
  21484. camera.target = this.target;
  21485. };
  21486. return AnaglyphArcRotateCamera;
  21487. })(BABYLON.ArcRotateCamera);
  21488. BABYLON.AnaglyphArcRotateCamera = AnaglyphArcRotateCamera;
  21489. var AnaglyphFreeCamera = (function (_super) {
  21490. __extends(AnaglyphFreeCamera, _super);
  21491. function AnaglyphFreeCamera(name, position, eyeSpace, scene) {
  21492. _super.call(this, name, position, scene);
  21493. this._eyeSpace = BABYLON.Tools.ToRadians(eyeSpace);
  21494. this._transformMatrix = new BABYLON.Matrix();
  21495. this._leftCamera = new BABYLON.FreeCamera(name + "_left", position.clone(), scene);
  21496. this._rightCamera = new BABYLON.FreeCamera(name + "_right", position.clone(), scene);
  21497. buildCamera(this, name);
  21498. }
  21499. AnaglyphFreeCamera.prototype._getSubCameraPosition = function (eyeSpace, result) {
  21500. var target = this.getTarget();
  21501. BABYLON.Matrix.Translation(-target.x, -target.y, -target.z).multiplyToRef(BABYLON.Matrix.RotationY(eyeSpace), this._transformMatrix);
  21502. this._transformMatrix = this._transformMatrix.multiply(BABYLON.Matrix.Translation(target.x, target.y, target.z));
  21503. BABYLON.Vector3.TransformCoordinatesToRef(this.position, this._transformMatrix, result);
  21504. };
  21505. AnaglyphFreeCamera.prototype._update = function () {
  21506. this._getSubCameraPosition(-this._eyeSpace, this._leftCamera.position);
  21507. this._getSubCameraPosition(this._eyeSpace, this._rightCamera.position);
  21508. this._updateCamera(this._leftCamera);
  21509. this._updateCamera(this._rightCamera);
  21510. _super.prototype._update.call(this);
  21511. };
  21512. AnaglyphFreeCamera.prototype._updateCamera = function (camera) {
  21513. camera.minZ = this.minZ;
  21514. camera.maxZ = this.maxZ;
  21515. camera.fov = this.fov;
  21516. camera.viewport = this.viewport;
  21517. camera.setTarget(this.getTarget());
  21518. };
  21519. return AnaglyphFreeCamera;
  21520. })(BABYLON.FreeCamera);
  21521. BABYLON.AnaglyphFreeCamera = AnaglyphFreeCamera;
  21522. })(BABYLON || (BABYLON = {}));
  21523. //# sourceMappingURL=babylon.anaglyphCamera.js.map
  21524. var BABYLON;
  21525. (function (BABYLON) {
  21526. var AnaglyphPostProcess = (function (_super) {
  21527. __extends(AnaglyphPostProcess, _super);
  21528. function AnaglyphPostProcess(name, ratio, camera, samplingMode, engine, reusable) {
  21529. _super.call(this, name, "anaglyph", null, ["leftSampler"], ratio, camera, samplingMode, engine, reusable);
  21530. }
  21531. return AnaglyphPostProcess;
  21532. })(BABYLON.PostProcess);
  21533. BABYLON.AnaglyphPostProcess = AnaglyphPostProcess;
  21534. })(BABYLON || (BABYLON = {}));
  21535. //# sourceMappingURL=babylon.anaglyphPostProcess.js.mapvar BABYLON;
  21536. (function (BABYLON) {
  21537. var Tags = (function () {
  21538. function Tags() {
  21539. }
  21540. Tags.EnableFor = function (obj) {
  21541. obj._tags = obj._tags || {};
  21542. obj.hasTags = function () {
  21543. return Tags.HasTags(obj);
  21544. };
  21545. obj.addTags = function (tagsString) {
  21546. return Tags.AddTagsTo(obj, tagsString);
  21547. };
  21548. obj.removeTags = function (tagsString) {
  21549. return Tags.RemoveTagsFrom(obj, tagsString);
  21550. };
  21551. obj.matchesTagsQuery = function (tagsQuery) {
  21552. return Tags.MatchesQuery(obj, tagsQuery);
  21553. };
  21554. };
  21555. Tags.DisableFor = function (obj) {
  21556. delete obj._tags;
  21557. delete obj.hasTags;
  21558. delete obj.addTags;
  21559. delete obj.removeTags;
  21560. delete obj.matchesTagsQuery;
  21561. };
  21562. Tags.HasTags = function (obj) {
  21563. if (!obj._tags) {
  21564. return false;
  21565. }
  21566. return !BABYLON.Tools.IsEmpty(obj._tags);
  21567. };
  21568. Tags.GetTags = function (obj) {
  21569. if (!obj._tags) {
  21570. return null;
  21571. }
  21572. return obj._tags;
  21573. };
  21574. // the tags 'true' and 'false' are reserved and cannot be used as tags
  21575. // a tag cannot start with '||', '&&', and '!'
  21576. // it cannot contain whitespaces
  21577. Tags.AddTagsTo = function (obj, tagsString) {
  21578. if (!tagsString) {
  21579. return;
  21580. }
  21581. var tags = tagsString.split(" ");
  21582. for (var t in tags) {
  21583. Tags._AddTagTo(obj, tags[t]);
  21584. }
  21585. };
  21586. Tags._AddTagTo = function (obj, tag) {
  21587. tag = tag.trim();
  21588. if (tag === "" || tag === "true" || tag === "false") {
  21589. return;
  21590. }
  21591. if (tag.match(/[\s]/) || tag.match(/^([!]|([|]|[&]){2})/)) {
  21592. return;
  21593. }
  21594. Tags.EnableFor(obj);
  21595. obj._tags[tag] = true;
  21596. };
  21597. Tags.RemoveTagsFrom = function (obj, tagsString) {
  21598. if (!Tags.HasTags(obj)) {
  21599. return;
  21600. }
  21601. var tags = tagsString.split(" ");
  21602. for (var t in tags) {
  21603. Tags._RemoveTagFrom(obj, tags[t]);
  21604. }
  21605. };
  21606. Tags._RemoveTagFrom = function (obj, tag) {
  21607. delete obj._tags[tag];
  21608. };
  21609. Tags.MatchesQuery = function (obj, tagsQuery) {
  21610. if (tagsQuery === undefined) {
  21611. return true;
  21612. }
  21613. if (tagsQuery === "") {
  21614. return Tags.HasTags(obj);
  21615. }
  21616. return BABYLON.Internals.AndOrNotEvaluator.Eval(tagsQuery, function (r) { return Tags.HasTags(obj) && obj._tags[r]; });
  21617. };
  21618. return Tags;
  21619. })();
  21620. BABYLON.Tags = Tags;
  21621. })(BABYLON || (BABYLON = {}));
  21622. //# sourceMappingURL=babylon.tags.js.mapvar BABYLON;
  21623. (function (BABYLON) {
  21624. var Internals;
  21625. (function (Internals) {
  21626. var AndOrNotEvaluator = (function () {
  21627. function AndOrNotEvaluator() {
  21628. }
  21629. AndOrNotEvaluator.Eval = function (query, evaluateCallback) {
  21630. if (!query.match(/\([^\(\)]*\)/g)) {
  21631. query = AndOrNotEvaluator._HandleParenthesisContent(query, evaluateCallback);
  21632. }
  21633. else {
  21634. query = query.replace(/\([^\(\)]*\)/g, function (r) {
  21635. // remove parenthesis
  21636. r = r.slice(1, r.length - 1);
  21637. return AndOrNotEvaluator._HandleParenthesisContent(r, evaluateCallback);
  21638. });
  21639. }
  21640. if (query === "true") {
  21641. return true;
  21642. }
  21643. if (query === "false") {
  21644. return false;
  21645. }
  21646. return AndOrNotEvaluator.Eval(query, evaluateCallback);
  21647. };
  21648. AndOrNotEvaluator._HandleParenthesisContent = function (parenthesisContent, evaluateCallback) {
  21649. evaluateCallback = evaluateCallback || (function (r) {
  21650. return r === "true" ? true : false;
  21651. });
  21652. var result;
  21653. var or = parenthesisContent.split("||");
  21654. for (var i in or) {
  21655. var ori = AndOrNotEvaluator._SimplifyNegation(or[i].trim());
  21656. var and = ori.split("&&");
  21657. if (and.length > 1) {
  21658. for (var j = 0; j < and.length; ++j) {
  21659. var andj = AndOrNotEvaluator._SimplifyNegation(and[j].trim());
  21660. if (andj !== "true" && andj !== "false") {
  21661. if (andj[0] === "!") {
  21662. result = !evaluateCallback(andj.substring(1));
  21663. }
  21664. else {
  21665. result = evaluateCallback(andj);
  21666. }
  21667. }
  21668. else {
  21669. result = andj === "true" ? true : false;
  21670. }
  21671. if (!result) {
  21672. ori = "false";
  21673. break;
  21674. }
  21675. }
  21676. }
  21677. if (result || ori === "true") {
  21678. result = true;
  21679. break;
  21680. }
  21681. // result equals false (or undefined)
  21682. if (ori !== "true" && ori !== "false") {
  21683. if (ori[0] === "!") {
  21684. result = !evaluateCallback(ori.substring(1));
  21685. }
  21686. else {
  21687. result = evaluateCallback(ori);
  21688. }
  21689. }
  21690. else {
  21691. result = ori === "true" ? true : false;
  21692. }
  21693. }
  21694. // the whole parenthesis scope is replaced by 'true' or 'false'
  21695. return result ? "true" : "false";
  21696. };
  21697. AndOrNotEvaluator._SimplifyNegation = function (booleanString) {
  21698. booleanString = booleanString.replace(/^[\s!]+/, function (r) {
  21699. // remove whitespaces
  21700. r = r.replace(/[\s]/g, function () { return ""; });
  21701. return r.length % 2 ? "!" : "";
  21702. });
  21703. booleanString = booleanString.trim();
  21704. if (booleanString === "!true") {
  21705. booleanString = "false";
  21706. }
  21707. else if (booleanString === "!false") {
  21708. booleanString = "true";
  21709. }
  21710. return booleanString;
  21711. };
  21712. return AndOrNotEvaluator;
  21713. })();
  21714. Internals.AndOrNotEvaluator = AndOrNotEvaluator;
  21715. })(Internals = BABYLON.Internals || (BABYLON.Internals = {}));
  21716. })(BABYLON || (BABYLON = {}));
  21717. //# sourceMappingURL=babylon.andOrNotEvaluator.js.mapvar BABYLON;
  21718. (function (BABYLON) {
  21719. var PostProcessRenderPass = (function () {
  21720. function PostProcessRenderPass(scene, name, size, renderList, beforeRender, afterRender) {
  21721. this._enabled = true;
  21722. this._refCount = 0;
  21723. this._name = name;
  21724. this._renderTexture = new BABYLON.RenderTargetTexture(name, size, scene);
  21725. this.setRenderList(renderList);
  21726. this._renderTexture.onBeforeRender = beforeRender;
  21727. this._renderTexture.onAfterRender = afterRender;
  21728. this._scene = scene;
  21729. this._renderList = renderList;
  21730. }
  21731. // private
  21732. PostProcessRenderPass.prototype._incRefCount = function () {
  21733. if (this._refCount === 0) {
  21734. this._scene.customRenderTargets.push(this._renderTexture);
  21735. }
  21736. return ++this._refCount;
  21737. };
  21738. PostProcessRenderPass.prototype._decRefCount = function () {
  21739. this._refCount--;
  21740. if (this._refCount <= 0) {
  21741. this._scene.customRenderTargets.splice(this._scene.customRenderTargets.indexOf(this._renderTexture), 1);
  21742. }
  21743. return this._refCount;
  21744. };
  21745. PostProcessRenderPass.prototype._update = function () {
  21746. this.setRenderList(this._renderList);
  21747. };
  21748. // public
  21749. PostProcessRenderPass.prototype.setRenderList = function (renderList) {
  21750. this._renderTexture.renderList = renderList;
  21751. };
  21752. PostProcessRenderPass.prototype.getRenderTexture = function () {
  21753. return this._renderTexture;
  21754. };
  21755. return PostProcessRenderPass;
  21756. })();
  21757. BABYLON.PostProcessRenderPass = PostProcessRenderPass;
  21758. })(BABYLON || (BABYLON = {}));
  21759. //# sourceMappingURL=babylon.postProcessRenderPass.js.mapvar BABYLON;
  21760. (function (BABYLON) {
  21761. var PostProcessRenderEffect = (function () {
  21762. function PostProcessRenderEffect(engine, name, getPostProcess, singleInstance) {
  21763. this._engine = engine;
  21764. this._name = name;
  21765. this._singleInstance = singleInstance || true;
  21766. this._getPostProcess = getPostProcess;
  21767. this._cameras = [];
  21768. this._indicesForCamera = [];
  21769. this._postProcesses = {};
  21770. this._renderPasses = {};
  21771. this._renderEffectAsPasses = {};
  21772. }
  21773. PostProcessRenderEffect.prototype._update = function () {
  21774. for (var renderPassName in this._renderPasses) {
  21775. this._renderPasses[renderPassName]._update();
  21776. }
  21777. };
  21778. PostProcessRenderEffect.prototype.addPass = function (renderPass) {
  21779. this._renderPasses[renderPass._name] = renderPass;
  21780. this._linkParameters();
  21781. };
  21782. PostProcessRenderEffect.prototype.removePass = function (renderPass) {
  21783. delete this._renderPasses[renderPass._name];
  21784. this._linkParameters();
  21785. };
  21786. PostProcessRenderEffect.prototype.addRenderEffectAsPass = function (renderEffect) {
  21787. this._renderEffectAsPasses[renderEffect._name] = renderEffect;
  21788. this._linkParameters();
  21789. };
  21790. PostProcessRenderEffect.prototype.getPass = function (passName) {
  21791. for (var renderPassName in this._renderPasses) {
  21792. if (renderPassName === passName) {
  21793. return this._renderPasses[passName];
  21794. }
  21795. }
  21796. };
  21797. PostProcessRenderEffect.prototype.emptyPasses = function () {
  21798. this._renderPasses = {};
  21799. this._linkParameters();
  21800. };
  21801. PostProcessRenderEffect.prototype._attachCameras = function (cameras) {
  21802. var cameraKey;
  21803. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  21804. for (var i = 0; i < _cam.length; i++) {
  21805. var camera = _cam[i];
  21806. var cameraName = camera.name;
  21807. if (this._singleInstance) {
  21808. cameraKey = 0;
  21809. }
  21810. else {
  21811. cameraKey = cameraName;
  21812. }
  21813. this._postProcesses[cameraKey] = this._postProcesses[cameraKey] || this._getPostProcess();
  21814. var index = camera.attachPostProcess(this._postProcesses[cameraKey]);
  21815. if (!this._indicesForCamera[cameraName]) {
  21816. this._indicesForCamera[cameraName] = [];
  21817. }
  21818. this._indicesForCamera[cameraName].push(index);
  21819. if (this._cameras.indexOf(camera) === -1) {
  21820. this._cameras[cameraName] = camera;
  21821. }
  21822. for (var passName in this._renderPasses) {
  21823. this._renderPasses[passName]._incRefCount();
  21824. }
  21825. }
  21826. this._linkParameters();
  21827. };
  21828. PostProcessRenderEffect.prototype._detachCameras = function (cameras) {
  21829. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  21830. for (var i = 0; i < _cam.length; i++) {
  21831. var camera = _cam[i];
  21832. var cameraName = camera.name;
  21833. camera.detachPostProcess(this._postProcesses[this._singleInstance ? 0 : cameraName], this._indicesForCamera[cameraName]);
  21834. var index = this._cameras.indexOf(cameraName);
  21835. this._indicesForCamera.splice(index, 1);
  21836. this._cameras.splice(index, 1);
  21837. for (var passName in this._renderPasses) {
  21838. this._renderPasses[passName]._decRefCount();
  21839. }
  21840. }
  21841. };
  21842. PostProcessRenderEffect.prototype._enable = function (cameras) {
  21843. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  21844. for (var i = 0; i < _cam.length; i++) {
  21845. var camera = _cam[i];
  21846. var cameraName = camera.name;
  21847. for (var j = 0; j < this._indicesForCamera[cameraName].length; j++) {
  21848. if (camera._postProcesses[this._indicesForCamera[cameraName][j]] === undefined) {
  21849. cameras[i].attachPostProcess(this._postProcesses[this._singleInstance ? 0 : cameraName], this._indicesForCamera[cameraName][j]);
  21850. }
  21851. }
  21852. for (var passName in this._renderPasses) {
  21853. this._renderPasses[passName]._incRefCount();
  21854. }
  21855. }
  21856. };
  21857. PostProcessRenderEffect.prototype._disable = function (cameras) {
  21858. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  21859. for (var i = 0; i < _cam.length; i++) {
  21860. var camera = _cam[i];
  21861. var cameraName = camera.Name;
  21862. camera.detachPostProcess(this._postProcesses[this._singleInstance ? 0 : cameraName], this._indicesForCamera[cameraName]);
  21863. for (var passName in this._renderPasses) {
  21864. this._renderPasses[passName]._decRefCount();
  21865. }
  21866. }
  21867. };
  21868. PostProcessRenderEffect.prototype.getPostProcess = function (camera) {
  21869. if (this._singleInstance) {
  21870. return this._postProcesses[0];
  21871. }
  21872. else {
  21873. return this._postProcesses[camera.name];
  21874. }
  21875. };
  21876. PostProcessRenderEffect.prototype._linkParameters = function () {
  21877. var _this = this;
  21878. for (var index in this._postProcesses) {
  21879. if (this.applyParameters) {
  21880. this.applyParameters(this._postProcesses[index]);
  21881. }
  21882. this._postProcesses[index].onBeforeRender = function (effect) {
  21883. _this._linkTextures(effect);
  21884. };
  21885. }
  21886. };
  21887. PostProcessRenderEffect.prototype._linkTextures = function (effect) {
  21888. for (var renderPassName in this._renderPasses) {
  21889. effect.setTexture(renderPassName, this._renderPasses[renderPassName].getRenderTexture());
  21890. }
  21891. for (var renderEffectName in this._renderEffectAsPasses) {
  21892. effect.setTextureFromPostProcess(renderEffectName + "Sampler", this._renderEffectAsPasses[renderEffectName].getPostProcess());
  21893. }
  21894. };
  21895. return PostProcessRenderEffect;
  21896. })();
  21897. BABYLON.PostProcessRenderEffect = PostProcessRenderEffect;
  21898. })(BABYLON || (BABYLON = {}));
  21899. //# sourceMappingURL=babylon.postProcessRenderEffect.js.mapvar BABYLON;
  21900. (function (BABYLON) {
  21901. var PostProcessRenderPipeline = (function () {
  21902. function PostProcessRenderPipeline(engine, name) {
  21903. this._engine = engine;
  21904. this._name = name;
  21905. this._renderEffects = {};
  21906. this._renderEffectsForIsolatedPass = {};
  21907. this._cameras = [];
  21908. }
  21909. PostProcessRenderPipeline.prototype.addEffect = function (renderEffect) {
  21910. this._renderEffects[renderEffect._name] = renderEffect;
  21911. };
  21912. PostProcessRenderPipeline.prototype._enableEffect = function (renderEffectName, cameras) {
  21913. var renderEffects = this._renderEffects[renderEffectName];
  21914. if (!renderEffects) {
  21915. return;
  21916. }
  21917. renderEffects._enable(BABYLON.Tools.MakeArray(cameras || this._cameras));
  21918. };
  21919. PostProcessRenderPipeline.prototype._disableEffect = function (renderEffectName, cameras) {
  21920. var renderEffects = this._renderEffects[renderEffectName];
  21921. if (!renderEffects) {
  21922. return;
  21923. }
  21924. renderEffects._disable(BABYLON.Tools.MakeArray(cameras || this._cameras));
  21925. };
  21926. PostProcessRenderPipeline.prototype._attachCameras = function (cameras, unique) {
  21927. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  21928. var indicesToDelete = [];
  21929. for (var i = 0; i < _cam.length; i++) {
  21930. var camera = _cam[i];
  21931. var cameraName = camera.name;
  21932. if (this._cameras.indexOf(camera) === -1) {
  21933. this._cameras[cameraName] = camera;
  21934. }
  21935. else if (unique) {
  21936. indicesToDelete.push(i);
  21937. }
  21938. }
  21939. for (var i = 0; i < indicesToDelete.length; i++) {
  21940. cameras.splice(indicesToDelete[i], 1);
  21941. }
  21942. for (var renderEffectName in this._renderEffects) {
  21943. this._renderEffects[renderEffectName]._attachCameras(_cam);
  21944. }
  21945. };
  21946. PostProcessRenderPipeline.prototype._detachCameras = function (cameras) {
  21947. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  21948. for (var renderEffectName in this._renderEffects) {
  21949. this._renderEffects[renderEffectName]._detachCameras(_cam);
  21950. }
  21951. for (var i = 0; i < _cam.length; i++) {
  21952. this._cameras.splice(this._cameras.indexOf(_cam[i]), 1);
  21953. }
  21954. };
  21955. PostProcessRenderPipeline.prototype._enableDisplayOnlyPass = function (passName, cameras) {
  21956. var _this = this;
  21957. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  21958. var pass = null;
  21959. for (var renderEffectName in this._renderEffects) {
  21960. pass = this._renderEffects[renderEffectName].getPass(passName);
  21961. if (pass != null) {
  21962. break;
  21963. }
  21964. }
  21965. if (pass === null) {
  21966. return;
  21967. }
  21968. for (var renderEffectName in this._renderEffects) {
  21969. this._renderEffects[renderEffectName]._disable(_cam);
  21970. }
  21971. pass._name = PostProcessRenderPipeline.PASS_SAMPLER_NAME;
  21972. for (var i = 0; i < _cam.length; i++) {
  21973. var camera = _cam[i];
  21974. var cameraName = camera.name;
  21975. this._renderEffectsForIsolatedPass[cameraName] = this._renderEffectsForIsolatedPass[cameraName] || new BABYLON.PostProcessRenderEffect(this._engine, PostProcessRenderPipeline.PASS_EFFECT_NAME, function () {
  21976. return new BABYLON.DisplayPassPostProcess(PostProcessRenderPipeline.PASS_EFFECT_NAME, 1.0, null, null, _this._engine, true);
  21977. });
  21978. this._renderEffectsForIsolatedPass[cameraName].emptyPasses();
  21979. this._renderEffectsForIsolatedPass[cameraName].addPass(pass);
  21980. this._renderEffectsForIsolatedPass[cameraName]._attachCameras(camera);
  21981. }
  21982. };
  21983. PostProcessRenderPipeline.prototype._disableDisplayOnlyPass = function (cameras) {
  21984. var _this = this;
  21985. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  21986. for (var i = 0; i < _cam.length; i++) {
  21987. var camera = _cam[i];
  21988. var cameraName = camera.name;
  21989. this._renderEffectsForIsolatedPass[cameraName] = this._renderEffectsForIsolatedPass[cameraName] || new BABYLON.PostProcessRenderEffect(this._engine, PostProcessRenderPipeline.PASS_EFFECT_NAME, function () {
  21990. return new BABYLON.DisplayPassPostProcess(PostProcessRenderPipeline.PASS_EFFECT_NAME, 1.0, null, null, _this._engine, true);
  21991. });
  21992. this._renderEffectsForIsolatedPass[cameraName]._disable(camera);
  21993. }
  21994. for (var renderEffectName in this._renderEffects) {
  21995. this._renderEffects[renderEffectName]._enable(_cam);
  21996. }
  21997. };
  21998. PostProcessRenderPipeline.prototype._update = function () {
  21999. for (var renderEffectName in this._renderEffects) {
  22000. this._renderEffects[renderEffectName]._update();
  22001. }
  22002. for (var i = 0; i < this._cameras.length; i++) {
  22003. var cameraName = this._cameras[i].name;
  22004. if (this._renderEffectsForIsolatedPass[cameraName]) {
  22005. this._renderEffectsForIsolatedPass[cameraName]._update();
  22006. }
  22007. }
  22008. };
  22009. PostProcessRenderPipeline.PASS_EFFECT_NAME = "passEffect";
  22010. PostProcessRenderPipeline.PASS_SAMPLER_NAME = "passSampler";
  22011. return PostProcessRenderPipeline;
  22012. })();
  22013. BABYLON.PostProcessRenderPipeline = PostProcessRenderPipeline;
  22014. })(BABYLON || (BABYLON = {}));
  22015. //# sourceMappingURL=babylon.postProcessRenderPipeline.js.mapvar BABYLON;
  22016. (function (BABYLON) {
  22017. var PostProcessRenderPipelineManager = (function () {
  22018. function PostProcessRenderPipelineManager() {
  22019. this._renderPipelines = {};
  22020. }
  22021. PostProcessRenderPipelineManager.prototype.addPipeline = function (renderPipeline) {
  22022. this._renderPipelines[renderPipeline._name] = renderPipeline;
  22023. };
  22024. PostProcessRenderPipelineManager.prototype.attachCamerasToRenderPipeline = function (renderPipelineName, cameras, unique) {
  22025. var renderPipeline = this._renderPipelines[renderPipelineName];
  22026. if (!renderPipeline) {
  22027. return;
  22028. }
  22029. renderPipeline._attachCameras(cameras, unique);
  22030. };
  22031. PostProcessRenderPipelineManager.prototype.detachCamerasFromRenderPipeline = function (renderPipelineName, cameras) {
  22032. var renderPipeline = this._renderPipelines[renderPipelineName];
  22033. if (!renderPipeline) {
  22034. return;
  22035. }
  22036. renderPipeline._detachCameras(cameras);
  22037. };
  22038. PostProcessRenderPipelineManager.prototype.enableEffectInPipeline = function (renderPipelineName, renderEffectName, cameras) {
  22039. var renderPipeline = this._renderPipelines[renderPipelineName];
  22040. if (!renderPipeline) {
  22041. return;
  22042. }
  22043. renderPipeline._enableEffect(renderEffectName, cameras);
  22044. };
  22045. PostProcessRenderPipelineManager.prototype.disableEffectInPipeline = function (renderPipelineName, renderEffectName, cameras) {
  22046. var renderPipeline = this._renderPipelines[renderPipelineName];
  22047. if (!renderPipeline) {
  22048. return;
  22049. }
  22050. renderPipeline._disableEffect(renderEffectName, cameras);
  22051. };
  22052. PostProcessRenderPipelineManager.prototype.enableDisplayOnlyPassInPipeline = function (renderPipelineName, passName, cameras) {
  22053. var renderPipeline = this._renderPipelines[renderPipelineName];
  22054. if (!renderPipeline) {
  22055. return;
  22056. }
  22057. renderPipeline._enableDisplayOnlyPass(passName, cameras);
  22058. };
  22059. PostProcessRenderPipelineManager.prototype.disableDisplayOnlyPassInPipeline = function (renderPipelineName, cameras) {
  22060. var renderPipeline = this._renderPipelines[renderPipelineName];
  22061. if (!renderPipeline) {
  22062. return;
  22063. }
  22064. renderPipeline._disableDisplayOnlyPass(cameras);
  22065. };
  22066. PostProcessRenderPipelineManager.prototype.update = function () {
  22067. for (var renderPipelineName in this._renderPipelines) {
  22068. this._renderPipelines[renderPipelineName]._update();
  22069. }
  22070. };
  22071. return PostProcessRenderPipelineManager;
  22072. })();
  22073. BABYLON.PostProcessRenderPipelineManager = PostProcessRenderPipelineManager;
  22074. })(BABYLON || (BABYLON = {}));
  22075. //# sourceMappingURL=babylon.postProcessRenderPipelineManager.js.map
  22076. var BABYLON;
  22077. (function (BABYLON) {
  22078. var DisplayPassPostProcess = (function (_super) {
  22079. __extends(DisplayPassPostProcess, _super);
  22080. function DisplayPassPostProcess(name, ratio, camera, samplingMode, engine, reusable) {
  22081. _super.call(this, name, "displayPass", ["passSampler"], ["passSampler"], ratio, camera, samplingMode, engine, reusable);
  22082. }
  22083. return DisplayPassPostProcess;
  22084. })(BABYLON.PostProcess);
  22085. BABYLON.DisplayPassPostProcess = DisplayPassPostProcess;
  22086. })(BABYLON || (BABYLON = {}));
  22087. //# sourceMappingURL=babylon.displayPassPostProcess.js.mapvar BABYLON;
  22088. (function (BABYLON) {
  22089. var BoundingBoxRenderer = (function () {
  22090. function BoundingBoxRenderer(scene) {
  22091. this.frontColor = new BABYLON.Color3(1, 1, 1);
  22092. this.backColor = new BABYLON.Color3(0.1, 0.1, 0.1);
  22093. this.showBackLines = true;
  22094. this.renderList = new BABYLON.SmartArray(32);
  22095. this._scene = scene;
  22096. this._colorShader = new BABYLON.ShaderMaterial("colorShader", scene, "color", {
  22097. attributes: ["position"],
  22098. uniforms: ["worldViewProjection", "color"]
  22099. });
  22100. var engine = this._scene.getEngine();
  22101. var boxdata = BABYLON.VertexData.CreateBox(1.0);
  22102. this._vb = new BABYLON.VertexBuffer(engine, boxdata.positions, BABYLON.VertexBuffer.PositionKind, false);
  22103. this._ib = engine.createIndexBuffer([0, 1, 1, 2, 2, 3, 3, 0, 4, 5, 5, 6, 6, 7, 7, 4, 0, 7, 1, 6, 2, 5, 3, 4]);
  22104. }
  22105. BoundingBoxRenderer.prototype.reset = function () {
  22106. this.renderList.reset();
  22107. };
  22108. BoundingBoxRenderer.prototype.render = function () {
  22109. if (this.renderList.length === 0 || !this._colorShader.isReady()) {
  22110. return;
  22111. }
  22112. var engine = this._scene.getEngine();
  22113. engine.setDepthWrite(false);
  22114. this._colorShader._preBind();
  22115. for (var boundingBoxIndex = 0; boundingBoxIndex < this.renderList.length; boundingBoxIndex++) {
  22116. var boundingBox = this.renderList.data[boundingBoxIndex];
  22117. var min = boundingBox.minimum;
  22118. var max = boundingBox.maximum;
  22119. var diff = max.subtract(min);
  22120. var median = min.add(diff.scale(0.5));
  22121. var worldMatrix = BABYLON.Matrix.Scaling(diff.x, diff.y, diff.z).multiply(BABYLON.Matrix.Translation(median.x, median.y, median.z)).multiply(boundingBox.getWorldMatrix());
  22122. // VBOs
  22123. engine.bindBuffers(this._vb.getBuffer(), this._ib, [3], 3 * 4, this._colorShader.getEffect());
  22124. if (this.showBackLines) {
  22125. // Back
  22126. engine.setDepthFunctionToGreaterOrEqual();
  22127. this._scene.resetCachedMaterial();
  22128. this._colorShader.setColor4("color", this.backColor.toColor4());
  22129. this._colorShader.bind(worldMatrix);
  22130. // Draw order
  22131. engine.draw(false, 0, 24);
  22132. }
  22133. // Front
  22134. engine.setDepthFunctionToLess();
  22135. this._scene.resetCachedMaterial();
  22136. this._colorShader.setColor4("color", this.frontColor.toColor4());
  22137. this._colorShader.bind(worldMatrix);
  22138. // Draw order
  22139. engine.draw(false, 0, 24);
  22140. }
  22141. this._colorShader.unbind();
  22142. engine.setDepthFunctionToLessOrEqual();
  22143. engine.setDepthWrite(true);
  22144. };
  22145. BoundingBoxRenderer.prototype.dispose = function () {
  22146. this._colorShader.dispose();
  22147. this._vb.dispose();
  22148. this._scene.getEngine()._releaseBuffer(this._ib);
  22149. };
  22150. return BoundingBoxRenderer;
  22151. })();
  22152. BABYLON.BoundingBoxRenderer = BoundingBoxRenderer;
  22153. })(BABYLON || (BABYLON = {}));
  22154. //# sourceMappingURL=babylon.boundingBoxRenderer.js.mapvar BABYLON;
  22155. (function (BABYLON) {
  22156. var Internals;
  22157. (function (Internals) {
  22158. /*
  22159. * Based on jsTGALoader - Javascript loader for TGA file
  22160. * By Vincent Thibault
  22161. * @blog http://blog.robrowser.com/javascript-tga-loader.html
  22162. */
  22163. var TGATools = (function () {
  22164. function TGATools() {
  22165. }
  22166. TGATools.GetTGAHeader = function (data) {
  22167. var offset = 0;
  22168. var header = {
  22169. id_length: data[offset++],
  22170. colormap_type: data[offset++],
  22171. image_type: data[offset++],
  22172. colormap_index: data[offset++] | data[offset++] << 8,
  22173. colormap_length: data[offset++] | data[offset++] << 8,
  22174. colormap_size: data[offset++],
  22175. origin: [
  22176. data[offset++] | data[offset++] << 8,
  22177. data[offset++] | data[offset++] << 8
  22178. ],
  22179. width: data[offset++] | data[offset++] << 8,
  22180. height: data[offset++] | data[offset++] << 8,
  22181. pixel_size: data[offset++],
  22182. flags: data[offset++]
  22183. };
  22184. return header;
  22185. };
  22186. TGATools.UploadContent = function (gl, data) {
  22187. // Not enough data to contain header ?
  22188. if (data.length < 19) {
  22189. BABYLON.Tools.Error("Unable to load TGA file - Not enough data to contain header");
  22190. return;
  22191. }
  22192. // Read Header
  22193. var offset = 18;
  22194. var header = TGATools.GetTGAHeader(data);
  22195. // Assume it's a valid Targa file.
  22196. if (header.id_length + offset > data.length) {
  22197. BABYLON.Tools.Error("Unable to load TGA file - Not enough data");
  22198. return;
  22199. }
  22200. // Skip not needed data
  22201. offset += header.id_length;
  22202. var use_rle = false;
  22203. var use_pal = false;
  22204. var use_rgb = false;
  22205. var use_grey = false;
  22206. switch (header.image_type) {
  22207. case TGATools._TYPE_RLE_INDEXED:
  22208. use_rle = true;
  22209. case TGATools._TYPE_INDEXED:
  22210. use_pal = true;
  22211. break;
  22212. case TGATools._TYPE_RLE_RGB:
  22213. use_rle = true;
  22214. case TGATools._TYPE_RGB:
  22215. use_rgb = true;
  22216. break;
  22217. case TGATools._TYPE_RLE_GREY:
  22218. use_rle = true;
  22219. case TGATools._TYPE_GREY:
  22220. use_grey = true;
  22221. break;
  22222. }
  22223. var pixel_data;
  22224. var numAlphaBits = header.flags & 0xf;
  22225. var pixel_size = header.pixel_size >> 3;
  22226. var pixel_total = header.width * header.height * pixel_size;
  22227. // Read palettes
  22228. var palettes;
  22229. if (use_pal) {
  22230. palettes = data.subarray(offset, offset += header.colormap_length * (header.colormap_size >> 3));
  22231. }
  22232. // Read LRE
  22233. if (use_rle) {
  22234. pixel_data = new Uint8Array(pixel_total);
  22235. var c, count, i;
  22236. var localOffset = 0;
  22237. var pixels = new Uint8Array(pixel_size);
  22238. while (offset < pixel_total && localOffset < pixel_total) {
  22239. c = data[offset++];
  22240. count = (c & 0x7f) + 1;
  22241. // RLE pixels
  22242. if (c & 0x80) {
  22243. for (i = 0; i < pixel_size; ++i) {
  22244. pixels[i] = data[offset++];
  22245. }
  22246. for (i = 0; i < count; ++i) {
  22247. pixel_data.set(pixels, localOffset + i * pixel_size);
  22248. }
  22249. localOffset += pixel_size * count;
  22250. }
  22251. else {
  22252. count *= pixel_size;
  22253. for (i = 0; i < count; ++i) {
  22254. pixel_data[localOffset + i] = data[offset++];
  22255. }
  22256. localOffset += count;
  22257. }
  22258. }
  22259. }
  22260. else {
  22261. pixel_data = data.subarray(offset, offset += (use_pal ? header.width * header.height : pixel_total));
  22262. }
  22263. // Load to texture
  22264. var x_start, y_start, x_step, y_step, y_end, x_end;
  22265. switch ((header.flags & TGATools._ORIGIN_MASK) >> TGATools._ORIGIN_SHIFT) {
  22266. default:
  22267. case TGATools._ORIGIN_UL:
  22268. x_start = 0;
  22269. x_step = 1;
  22270. x_end = header.width;
  22271. y_start = 0;
  22272. y_step = 1;
  22273. y_end = header.height;
  22274. break;
  22275. case TGATools._ORIGIN_BL:
  22276. x_start = 0;
  22277. x_step = 1;
  22278. x_end = header.width;
  22279. y_start = header.height - 1;
  22280. y_step = -1;
  22281. y_end = -1;
  22282. break;
  22283. case TGATools._ORIGIN_UR:
  22284. x_start = header.width - 1;
  22285. x_step = -1;
  22286. x_end = -1;
  22287. y_start = 0;
  22288. y_step = 1;
  22289. y_end = header.height;
  22290. break;
  22291. case TGATools._ORIGIN_BR:
  22292. x_start = header.width - 1;
  22293. x_step = -1;
  22294. x_end = -1;
  22295. y_start = header.height - 1;
  22296. y_step = -1;
  22297. y_end = -1;
  22298. break;
  22299. }
  22300. // Load the specify method
  22301. var func = '_getImageData' + (use_grey ? 'Grey' : '') + (header.pixel_size) + 'bits';
  22302. var imageData = TGATools[func](header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end);
  22303. gl.texImage2D(gl.TEXTURE_2D, 0, gl.RGBA, header.width, header.height, 0, gl.RGBA, gl.UNSIGNED_BYTE, imageData);
  22304. };
  22305. TGATools._getImageData8bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  22306. var image = pixel_data, colormap = palettes;
  22307. var width = header.width, height = header.height;
  22308. var color, i = 0, x, y;
  22309. var imageData = new Uint8Array(width * height * 4);
  22310. for (y = y_start; y !== y_end; y += y_step) {
  22311. for (x = x_start; x !== x_end; x += x_step, i++) {
  22312. color = image[i];
  22313. imageData[(x + width * y) * 4 + 3] = 255;
  22314. imageData[(x + width * y) * 4 + 2] = colormap[(color * 3) + 0];
  22315. imageData[(x + width * y) * 4 + 1] = colormap[(color * 3) + 1];
  22316. imageData[(x + width * y) * 4 + 0] = colormap[(color * 3) + 2];
  22317. }
  22318. }
  22319. return imageData;
  22320. };
  22321. TGATools._getImageData16bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  22322. var image = pixel_data;
  22323. var width = header.width, height = header.height;
  22324. var color, i = 0, x, y;
  22325. var imageData = new Uint8Array(width * height * 4);
  22326. for (y = y_start; y !== y_end; y += y_step) {
  22327. for (x = x_start; x !== x_end; x += x_step, i += 2) {
  22328. color = image[i + 0] + (image[i + 1] << 8); // Inversed ?
  22329. imageData[(x + width * y) * 4 + 0] = (color & 0x7C00) >> 7;
  22330. imageData[(x + width * y) * 4 + 1] = (color & 0x03E0) >> 2;
  22331. imageData[(x + width * y) * 4 + 2] = (color & 0x001F) >> 3;
  22332. imageData[(x + width * y) * 4 + 3] = (color & 0x8000) ? 0 : 255;
  22333. }
  22334. }
  22335. return imageData;
  22336. };
  22337. TGATools._getImageData24bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  22338. var image = pixel_data;
  22339. var width = header.width, height = header.height;
  22340. var i = 0, x, y;
  22341. var imageData = new Uint8Array(width * height * 4);
  22342. for (y = y_start; y !== y_end; y += y_step) {
  22343. for (x = x_start; x !== x_end; x += x_step, i += 3) {
  22344. imageData[(x + width * y) * 4 + 3] = 255;
  22345. imageData[(x + width * y) * 4 + 2] = image[i + 0];
  22346. imageData[(x + width * y) * 4 + 1] = image[i + 1];
  22347. imageData[(x + width * y) * 4 + 0] = image[i + 2];
  22348. }
  22349. }
  22350. return imageData;
  22351. };
  22352. TGATools._getImageData32bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  22353. var image = pixel_data;
  22354. var width = header.width, height = header.height;
  22355. var i = 0, x, y;
  22356. var imageData = new Uint8Array(width * height * 4);
  22357. for (y = y_start; y !== y_end; y += y_step) {
  22358. for (x = x_start; x !== x_end; x += x_step, i += 4) {
  22359. imageData[(x + width * y) * 4 + 2] = image[i + 0];
  22360. imageData[(x + width * y) * 4 + 1] = image[i + 1];
  22361. imageData[(x + width * y) * 4 + 0] = image[i + 2];
  22362. imageData[(x + width * y) * 4 + 3] = image[i + 3];
  22363. }
  22364. }
  22365. return imageData;
  22366. };
  22367. TGATools._getImageDataGrey8bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  22368. var image = pixel_data;
  22369. var width = header.width, height = header.height;
  22370. var color, i = 0, x, y;
  22371. var imageData = new Uint8Array(width * height * 4);
  22372. for (y = y_start; y !== y_end; y += y_step) {
  22373. for (x = x_start; x !== x_end; x += x_step, i++) {
  22374. color = image[i];
  22375. imageData[(x + width * y) * 4 + 0] = color;
  22376. imageData[(x + width * y) * 4 + 1] = color;
  22377. imageData[(x + width * y) * 4 + 2] = color;
  22378. imageData[(x + width * y) * 4 + 3] = 255;
  22379. }
  22380. }
  22381. return imageData;
  22382. };
  22383. TGATools._getImageDataGrey16bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  22384. var image = pixel_data;
  22385. var width = header.width, height = header.height;
  22386. var i = 0, x, y;
  22387. var imageData = new Uint8Array(width * height * 4);
  22388. for (y = y_start; y !== y_end; y += y_step) {
  22389. for (x = x_start; x !== x_end; x += x_step, i += 2) {
  22390. imageData[(x + width * y) * 4 + 0] = image[i + 0];
  22391. imageData[(x + width * y) * 4 + 1] = image[i + 0];
  22392. imageData[(x + width * y) * 4 + 2] = image[i + 0];
  22393. imageData[(x + width * y) * 4 + 3] = image[i + 1];
  22394. }
  22395. }
  22396. return imageData;
  22397. };
  22398. TGATools._TYPE_NO_DATA = 0;
  22399. TGATools._TYPE_INDEXED = 1;
  22400. TGATools._TYPE_RGB = 2;
  22401. TGATools._TYPE_GREY = 3;
  22402. TGATools._TYPE_RLE_INDEXED = 9;
  22403. TGATools._TYPE_RLE_RGB = 10;
  22404. TGATools._TYPE_RLE_GREY = 11;
  22405. TGATools._ORIGIN_MASK = 0x30;
  22406. TGATools._ORIGIN_SHIFT = 0x04;
  22407. TGATools._ORIGIN_BL = 0x00;
  22408. TGATools._ORIGIN_BR = 0x01;
  22409. TGATools._ORIGIN_UL = 0x02;
  22410. TGATools._ORIGIN_UR = 0x03;
  22411. return TGATools;
  22412. })();
  22413. Internals.TGATools = TGATools;
  22414. })(Internals = BABYLON.Internals || (BABYLON.Internals = {}));
  22415. })(BABYLON || (BABYLON = {}));
  22416. //# sourceMappingURL=babylon.tools.tga.js.mapvar BABYLON;
  22417. (function (BABYLON) {
  22418. var Internals;
  22419. (function (Internals) {
  22420. // Based on demo done by Brandon Jones - http://media.tojicode.com/webgl-samples/dds.html
  22421. // All values and structures referenced from:
  22422. // http://msdn.microsoft.com/en-us/library/bb943991.aspx/
  22423. var DDS_MAGIC = 0x20534444;
  22424. var DDSD_CAPS = 0x1, DDSD_HEIGHT = 0x2, DDSD_WIDTH = 0x4, DDSD_PITCH = 0x8, DDSD_PIXELFORMAT = 0x1000, DDSD_MIPMAPCOUNT = 0x20000, DDSD_LINEARSIZE = 0x80000, DDSD_DEPTH = 0x800000;
  22425. var DDSCAPS_COMPLEX = 0x8, DDSCAPS_MIPMAP = 0x400000, DDSCAPS_TEXTURE = 0x1000;
  22426. var DDSCAPS2_CUBEMAP = 0x200, DDSCAPS2_CUBEMAP_POSITIVEX = 0x400, DDSCAPS2_CUBEMAP_NEGATIVEX = 0x800, DDSCAPS2_CUBEMAP_POSITIVEY = 0x1000, DDSCAPS2_CUBEMAP_NEGATIVEY = 0x2000, DDSCAPS2_CUBEMAP_POSITIVEZ = 0x4000, DDSCAPS2_CUBEMAP_NEGATIVEZ = 0x8000, DDSCAPS2_VOLUME = 0x200000;
  22427. var DDPF_ALPHAPIXELS = 0x1, DDPF_ALPHA = 0x2, DDPF_FOURCC = 0x4, DDPF_RGB = 0x40, DDPF_YUV = 0x200, DDPF_LUMINANCE = 0x20000;
  22428. function FourCCToInt32(value) {
  22429. return value.charCodeAt(0) + (value.charCodeAt(1) << 8) + (value.charCodeAt(2) << 16) + (value.charCodeAt(3) << 24);
  22430. }
  22431. function Int32ToFourCC(value) {
  22432. return String.fromCharCode(value & 0xff, (value >> 8) & 0xff, (value >> 16) & 0xff, (value >> 24) & 0xff);
  22433. }
  22434. var FOURCC_DXT1 = FourCCToInt32("DXT1");
  22435. var FOURCC_DXT3 = FourCCToInt32("DXT3");
  22436. var FOURCC_DXT5 = FourCCToInt32("DXT5");
  22437. var headerLengthInt = 31; // The header length in 32 bit ints
  22438. // Offsets into the header array
  22439. var off_magic = 0;
  22440. var off_size = 1;
  22441. var off_flags = 2;
  22442. var off_height = 3;
  22443. var off_width = 4;
  22444. var off_mipmapCount = 7;
  22445. var off_pfFlags = 20;
  22446. var off_pfFourCC = 21;
  22447. var off_RGBbpp = 22;
  22448. var off_RMask = 23;
  22449. var off_GMask = 24;
  22450. var off_BMask = 25;
  22451. var off_AMask = 26;
  22452. var off_caps1 = 27;
  22453. var off_caps2 = 28;
  22454. ;
  22455. var DDSTools = (function () {
  22456. function DDSTools() {
  22457. }
  22458. DDSTools.GetDDSInfo = function (arrayBuffer) {
  22459. var header = new Int32Array(arrayBuffer, 0, headerLengthInt);
  22460. var mipmapCount = 1;
  22461. if (header[off_flags] & DDSD_MIPMAPCOUNT) {
  22462. mipmapCount = Math.max(1, header[off_mipmapCount]);
  22463. }
  22464. return {
  22465. width: header[off_width],
  22466. height: header[off_height],
  22467. mipmapCount: mipmapCount,
  22468. isFourCC: (header[off_pfFlags] & DDPF_FOURCC) === DDPF_FOURCC,
  22469. isRGB: (header[off_pfFlags] & DDPF_RGB) === DDPF_RGB,
  22470. isLuminance: (header[off_pfFlags] & DDPF_LUMINANCE) === DDPF_LUMINANCE,
  22471. isCube: (header[off_caps2] & DDSCAPS2_CUBEMAP) === DDSCAPS2_CUBEMAP
  22472. };
  22473. };
  22474. DDSTools.GetRGBAArrayBuffer = function (width, height, dataOffset, dataLength, arrayBuffer) {
  22475. var byteArray = new Uint8Array(dataLength);
  22476. var srcData = new Uint8Array(arrayBuffer);
  22477. var index = 0;
  22478. for (var y = height - 1; y >= 0; y--) {
  22479. for (var x = 0; x < width; x++) {
  22480. var srcPos = dataOffset + (x + y * width) * 4;
  22481. byteArray[index + 2] = srcData[srcPos];
  22482. byteArray[index + 1] = srcData[srcPos + 1];
  22483. byteArray[index] = srcData[srcPos + 2];
  22484. byteArray[index + 3] = srcData[srcPos + 3];
  22485. index += 4;
  22486. }
  22487. }
  22488. return byteArray;
  22489. };
  22490. DDSTools.GetRGBArrayBuffer = function (width, height, dataOffset, dataLength, arrayBuffer) {
  22491. var byteArray = new Uint8Array(dataLength);
  22492. var srcData = new Uint8Array(arrayBuffer);
  22493. var index = 0;
  22494. for (var y = height - 1; y >= 0; y--) {
  22495. for (var x = 0; x < width; x++) {
  22496. var srcPos = dataOffset + (x + y * width) * 3;
  22497. byteArray[index + 2] = srcData[srcPos];
  22498. byteArray[index + 1] = srcData[srcPos + 1];
  22499. byteArray[index] = srcData[srcPos + 2];
  22500. index += 3;
  22501. }
  22502. }
  22503. return byteArray;
  22504. };
  22505. DDSTools.GetLuminanceArrayBuffer = function (width, height, dataOffset, dataLength, arrayBuffer) {
  22506. var byteArray = new Uint8Array(dataLength);
  22507. var srcData = new Uint8Array(arrayBuffer);
  22508. var index = 0;
  22509. for (var y = height - 1; y >= 0; y--) {
  22510. for (var x = 0; x < width; x++) {
  22511. var srcPos = dataOffset + (x + y * width);
  22512. byteArray[index] = srcData[srcPos];
  22513. index++;
  22514. }
  22515. }
  22516. return byteArray;
  22517. };
  22518. DDSTools.UploadDDSLevels = function (gl, ext, arrayBuffer, info, loadMipmaps, faces) {
  22519. var header = new Int32Array(arrayBuffer, 0, headerLengthInt), fourCC, blockBytes, internalFormat, width, height, dataLength, dataOffset, byteArray, mipmapCount, i;
  22520. if (header[off_magic] != DDS_MAGIC) {
  22521. BABYLON.Tools.Error("Invalid magic number in DDS header");
  22522. return;
  22523. }
  22524. if (!info.isFourCC && !info.isRGB && !info.isLuminance) {
  22525. BABYLON.Tools.Error("Unsupported format, must contain a FourCC, RGB or LUMINANCE code");
  22526. return;
  22527. }
  22528. if (info.isFourCC) {
  22529. fourCC = header[off_pfFourCC];
  22530. switch (fourCC) {
  22531. case FOURCC_DXT1:
  22532. blockBytes = 8;
  22533. internalFormat = ext.COMPRESSED_RGBA_S3TC_DXT1_EXT;
  22534. break;
  22535. case FOURCC_DXT3:
  22536. blockBytes = 16;
  22537. internalFormat = ext.COMPRESSED_RGBA_S3TC_DXT3_EXT;
  22538. break;
  22539. case FOURCC_DXT5:
  22540. blockBytes = 16;
  22541. internalFormat = ext.COMPRESSED_RGBA_S3TC_DXT5_EXT;
  22542. break;
  22543. default:
  22544. console.error("Unsupported FourCC code:", Int32ToFourCC(fourCC));
  22545. return;
  22546. }
  22547. }
  22548. mipmapCount = 1;
  22549. if (header[off_flags] & DDSD_MIPMAPCOUNT && loadMipmaps !== false) {
  22550. mipmapCount = Math.max(1, header[off_mipmapCount]);
  22551. }
  22552. var bpp = header[off_RGBbpp];
  22553. for (var face = 0; face < faces; face++) {
  22554. var sampler = faces == 1 ? gl.TEXTURE_2D : (gl.TEXTURE_CUBE_MAP_POSITIVE_X + face);
  22555. width = header[off_width];
  22556. height = header[off_height];
  22557. dataOffset = header[off_size] + 4;
  22558. for (i = 0; i < mipmapCount; ++i) {
  22559. if (info.isRGB) {
  22560. if (bpp == 24) {
  22561. dataLength = width * height * 3;
  22562. byteArray = DDSTools.GetRGBArrayBuffer(width, height, dataOffset, dataLength, arrayBuffer);
  22563. gl.texImage2D(sampler, i, gl.RGB, width, height, 0, gl.RGB, gl.UNSIGNED_BYTE, byteArray);
  22564. }
  22565. else {
  22566. dataLength = width * height * 4;
  22567. byteArray = DDSTools.GetRGBAArrayBuffer(width, height, dataOffset, dataLength, arrayBuffer);
  22568. gl.texImage2D(sampler, i, gl.RGBA, width, height, 0, gl.RGBA, gl.UNSIGNED_BYTE, byteArray);
  22569. }
  22570. }
  22571. else if (info.isLuminance) {
  22572. var unpackAlignment = gl.getParameter(gl.UNPACK_ALIGNMENT);
  22573. var unpaddedRowSize = width;
  22574. var paddedRowSize = Math.floor((width + unpackAlignment - 1) / unpackAlignment) * unpackAlignment;
  22575. dataLength = paddedRowSize * (height - 1) + unpaddedRowSize;
  22576. byteArray = DDSTools.GetLuminanceArrayBuffer(width, height, dataOffset, dataLength, arrayBuffer);
  22577. gl.texImage2D(sampler, i, gl.LUMINANCE, width, height, 0, gl.LUMINANCE, gl.UNSIGNED_BYTE, byteArray);
  22578. }
  22579. else {
  22580. dataLength = Math.max(4, width) / 4 * Math.max(4, height) / 4 * blockBytes;
  22581. byteArray = new Uint8Array(arrayBuffer, dataOffset, dataLength);
  22582. gl.compressedTexImage2D(sampler, i, internalFormat, width, height, 0, byteArray);
  22583. }
  22584. dataOffset += dataLength;
  22585. width *= 0.5;
  22586. height *= 0.5;
  22587. width = Math.max(1.0, width);
  22588. height = Math.max(1.0, height);
  22589. }
  22590. }
  22591. };
  22592. return DDSTools;
  22593. })();
  22594. Internals.DDSTools = DDSTools;
  22595. })(Internals = BABYLON.Internals || (BABYLON.Internals = {}));
  22596. })(BABYLON || (BABYLON = {}));
  22597. //# sourceMappingURL=babylon.tools.dds.js.mapvar BABYLON;
  22598. (function (BABYLON) {
  22599. var SmartArray = (function () {
  22600. function SmartArray(capacity) {
  22601. this.length = 0;
  22602. this._duplicateId = 0;
  22603. this.data = new Array(capacity);
  22604. this._id = SmartArray._GlobalId++;
  22605. }
  22606. SmartArray.prototype.push = function (value) {
  22607. this.data[this.length++] = value;
  22608. if (this.length > this.data.length) {
  22609. this.data.length *= 2;
  22610. }
  22611. if (!value.__smartArrayFlags) {
  22612. value.__smartArrayFlags = {};
  22613. }
  22614. value.__smartArrayFlags[this._id] = this._duplicateId;
  22615. };
  22616. SmartArray.prototype.pushNoDuplicate = function (value) {
  22617. if (value.__smartArrayFlags && value.__smartArrayFlags[this._id] === this._duplicateId) {
  22618. return;
  22619. }
  22620. this.push(value);
  22621. };
  22622. SmartArray.prototype.sort = function (compareFn) {
  22623. this.data.sort(compareFn);
  22624. };
  22625. SmartArray.prototype.reset = function () {
  22626. this.length = 0;
  22627. this._duplicateId++;
  22628. };
  22629. SmartArray.prototype.concat = function (array) {
  22630. if (array.length === 0) {
  22631. return;
  22632. }
  22633. if (this.length + array.length > this.data.length) {
  22634. this.data.length = (this.length + array.length) * 2;
  22635. }
  22636. for (var index = 0; index < array.length; index++) {
  22637. this.data[this.length++] = (array.data || array)[index];
  22638. }
  22639. };
  22640. SmartArray.prototype.concatWithNoDuplicate = function (array) {
  22641. if (array.length === 0) {
  22642. return;
  22643. }
  22644. if (this.length + array.length > this.data.length) {
  22645. this.data.length = (this.length + array.length) * 2;
  22646. }
  22647. for (var index = 0; index < array.length; index++) {
  22648. var item = (array.data || array)[index];
  22649. this.pushNoDuplicate(item);
  22650. }
  22651. };
  22652. SmartArray.prototype.indexOf = function (value) {
  22653. var position = this.data.indexOf(value);
  22654. if (position >= this.length) {
  22655. return -1;
  22656. }
  22657. return position;
  22658. };
  22659. // Statics
  22660. SmartArray._GlobalId = 0;
  22661. return SmartArray;
  22662. })();
  22663. BABYLON.SmartArray = SmartArray;
  22664. })(BABYLON || (BABYLON = {}));
  22665. //# sourceMappingURL=babylon.smartArray.js.mapvar BABYLON;
  22666. (function (BABYLON) {
  22667. var CannonJSPlugin = (function () {
  22668. function CannonJSPlugin() {
  22669. this._registeredMeshes = [];
  22670. this._physicsMaterials = [];
  22671. this.updateBodyPosition = function (mesh) {
  22672. for (var index = 0; index < this._registeredMeshes.length; index++) {
  22673. var registeredMesh = this._registeredMeshes[index];
  22674. if (registeredMesh.mesh === mesh || registeredMesh.mesh === mesh.parent) {
  22675. var body = registeredMesh.body;
  22676. var center = mesh.getBoundingInfo().boundingBox.center;
  22677. body.position.set(center.x, center.z, center.y);
  22678. body.quaternion.x = mesh.rotationQuaternion.x;
  22679. body.quaternion.z = mesh.rotationQuaternion.y;
  22680. body.quaternion.y = mesh.rotationQuaternion.z;
  22681. body.quaternion.w = -mesh.rotationQuaternion.w;
  22682. return;
  22683. }
  22684. }
  22685. };
  22686. }
  22687. CannonJSPlugin.prototype.initialize = function (iterations) {
  22688. if (iterations === void 0) { iterations = 10; }
  22689. this._world = new CANNON.World();
  22690. this._world.broadphase = new CANNON.NaiveBroadphase();
  22691. this._world.solver.iterations = iterations;
  22692. };
  22693. CannonJSPlugin.prototype._checkWithEpsilon = function (value) {
  22694. return value < BABYLON.PhysicsEngine.Epsilon ? BABYLON.PhysicsEngine.Epsilon : value;
  22695. };
  22696. CannonJSPlugin.prototype.runOneStep = function (delta) {
  22697. this._world.step(delta);
  22698. for (var index = 0; index < this._registeredMeshes.length; index++) {
  22699. var registeredMesh = this._registeredMeshes[index];
  22700. if (registeredMesh.isChild) {
  22701. continue;
  22702. }
  22703. // Body position
  22704. var bodyX = registeredMesh.body.position.x, bodyY = registeredMesh.body.position.y, bodyZ = registeredMesh.body.position.z;
  22705. var deltaPos = registeredMesh.delta;
  22706. if (deltaPos) {
  22707. registeredMesh.mesh.position.x = bodyX + deltaPos.x;
  22708. registeredMesh.mesh.position.y = bodyZ + deltaPos.y;
  22709. registeredMesh.mesh.position.z = bodyY + deltaPos.z;
  22710. }
  22711. else {
  22712. registeredMesh.mesh.position.x = bodyX;
  22713. registeredMesh.mesh.position.y = bodyZ;
  22714. registeredMesh.mesh.position.z = bodyY;
  22715. }
  22716. if (!registeredMesh.mesh.rotationQuaternion) {
  22717. registeredMesh.mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1);
  22718. }
  22719. registeredMesh.mesh.rotationQuaternion.x = registeredMesh.body.quaternion.x;
  22720. registeredMesh.mesh.rotationQuaternion.y = registeredMesh.body.quaternion.z;
  22721. registeredMesh.mesh.rotationQuaternion.z = registeredMesh.body.quaternion.y;
  22722. registeredMesh.mesh.rotationQuaternion.w = -registeredMesh.body.quaternion.w;
  22723. }
  22724. };
  22725. CannonJSPlugin.prototype.setGravity = function (gravity) {
  22726. this._world.gravity.set(gravity.x, gravity.z, gravity.y);
  22727. };
  22728. CannonJSPlugin.prototype.registerMesh = function (mesh, impostor, options) {
  22729. this.unregisterMesh(mesh);
  22730. mesh.computeWorldMatrix(true);
  22731. switch (impostor) {
  22732. case BABYLON.PhysicsEngine.SphereImpostor:
  22733. var bbox = mesh.getBoundingInfo().boundingBox;
  22734. var radiusX = bbox.maximumWorld.x - bbox.minimumWorld.x;
  22735. var radiusY = bbox.maximumWorld.y - bbox.minimumWorld.y;
  22736. var radiusZ = bbox.maximumWorld.z - bbox.minimumWorld.z;
  22737. return this._createSphere(Math.max(this._checkWithEpsilon(radiusX), this._checkWithEpsilon(radiusY), this._checkWithEpsilon(radiusZ)) / 2, mesh, options);
  22738. case BABYLON.PhysicsEngine.BoxImpostor:
  22739. bbox = mesh.getBoundingInfo().boundingBox;
  22740. var min = bbox.minimumWorld;
  22741. var max = bbox.maximumWorld;
  22742. var box = max.subtract(min).scale(0.5);
  22743. return this._createBox(this._checkWithEpsilon(box.x), this._checkWithEpsilon(box.y), this._checkWithEpsilon(box.z), mesh, options);
  22744. case BABYLON.PhysicsEngine.PlaneImpostor:
  22745. return this._createPlane(mesh, options);
  22746. case BABYLON.PhysicsEngine.MeshImpostor:
  22747. var rawVerts = mesh.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  22748. var rawFaces = mesh.getIndices();
  22749. return this._createConvexPolyhedron(rawVerts, rawFaces, mesh, options);
  22750. }
  22751. return null;
  22752. };
  22753. CannonJSPlugin.prototype._createSphere = function (radius, mesh, options) {
  22754. var shape = new CANNON.Sphere(radius);
  22755. if (!options) {
  22756. return shape;
  22757. }
  22758. return this._createRigidBodyFromShape(shape, mesh, options.mass, options.friction, options.restitution);
  22759. };
  22760. CannonJSPlugin.prototype._createBox = function (x, y, z, mesh, options) {
  22761. var shape = new CANNON.Box(new CANNON.Vec3(x, z, y));
  22762. if (!options) {
  22763. return shape;
  22764. }
  22765. return this._createRigidBodyFromShape(shape, mesh, options.mass, options.friction, options.restitution);
  22766. };
  22767. CannonJSPlugin.prototype._createPlane = function (mesh, options) {
  22768. var shape = new CANNON.Plane();
  22769. if (!options) {
  22770. return shape;
  22771. }
  22772. return this._createRigidBodyFromShape(shape, mesh, options.mass, options.friction, options.restitution);
  22773. };
  22774. CannonJSPlugin.prototype._createConvexPolyhedron = function (rawVerts, rawFaces, mesh, options) {
  22775. var verts = [], faces = [];
  22776. mesh.computeWorldMatrix(true);
  22777. for (var i = 0; i < rawVerts.length; i += 3) {
  22778. var transformed = BABYLON.Vector3.Zero();
  22779. BABYLON.Vector3.TransformNormalFromFloatsToRef(rawVerts[i], rawVerts[i + 1], rawVerts[i + 2], mesh.getWorldMatrix(), transformed);
  22780. verts.push(new CANNON.Vec3(transformed.x, transformed.z, transformed.y));
  22781. }
  22782. for (var j = 0; j < rawFaces.length; j += 3) {
  22783. faces.push([rawFaces[j], rawFaces[j + 2], rawFaces[j + 1]]);
  22784. }
  22785. var shape = new CANNON.ConvexPolyhedron(verts, faces);
  22786. if (!options) {
  22787. return shape;
  22788. }
  22789. return this._createRigidBodyFromShape(shape, mesh, options.mass, options.friction, options.restitution);
  22790. };
  22791. CannonJSPlugin.prototype._addMaterial = function (friction, restitution) {
  22792. var index;
  22793. var mat;
  22794. for (index = 0; index < this._physicsMaterials.length; index++) {
  22795. mat = this._physicsMaterials[index];
  22796. if (mat.friction === friction && mat.restitution === restitution) {
  22797. return mat;
  22798. }
  22799. }
  22800. var currentMat = new CANNON.Material();
  22801. currentMat.friction = friction;
  22802. currentMat.restitution = restitution;
  22803. this._physicsMaterials.push(currentMat);
  22804. for (index = 0; index < this._physicsMaterials.length; index++) {
  22805. mat = this._physicsMaterials[index];
  22806. var contactMaterial = new CANNON.ContactMaterial(mat, currentMat, mat.friction * currentMat.friction, mat.restitution * currentMat.restitution);
  22807. contactMaterial.contactEquationStiffness = 1e10;
  22808. contactMaterial.contactEquationRegularizationTime = 10;
  22809. this._world.addContactMaterial(contactMaterial);
  22810. }
  22811. return currentMat;
  22812. };
  22813. CannonJSPlugin.prototype._createRigidBodyFromShape = function (shape, mesh, mass, friction, restitution) {
  22814. var initialRotation = null;
  22815. if (mesh.rotationQuaternion) {
  22816. initialRotation = mesh.rotationQuaternion.clone();
  22817. mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1);
  22818. }
  22819. // The delta between the mesh position and the mesh bounding box center
  22820. var bbox = mesh.getBoundingInfo().boundingBox;
  22821. var deltaPosition = mesh.position.subtract(bbox.center);
  22822. var material = this._addMaterial(friction, restitution);
  22823. var body = new CANNON.RigidBody(mass, shape, material);
  22824. if (initialRotation) {
  22825. body.quaternion.x = initialRotation.x;
  22826. body.quaternion.z = initialRotation.y;
  22827. body.quaternion.y = initialRotation.z;
  22828. body.quaternion.w = -initialRotation.w;
  22829. }
  22830. body.position.set(bbox.center.x, bbox.center.z, bbox.center.y);
  22831. this._world.add(body);
  22832. this._registeredMeshes.push({ mesh: mesh, body: body, material: material, delta: deltaPosition });
  22833. return body;
  22834. };
  22835. CannonJSPlugin.prototype.registerMeshesAsCompound = function (parts, options) {
  22836. var compoundShape = new CANNON.Compound();
  22837. for (var index = 0; index < parts.length; index++) {
  22838. var mesh = parts[index].mesh;
  22839. var shape = this.registerMesh(mesh, parts[index].impostor);
  22840. if (index == 0) {
  22841. compoundShape.addChild(shape, new CANNON.Vec3(0, 0, 0));
  22842. }
  22843. else {
  22844. compoundShape.addChild(shape, new CANNON.Vec3(mesh.position.x, mesh.position.z, mesh.position.y));
  22845. }
  22846. }
  22847. var initialMesh = parts[0].mesh;
  22848. var body = this._createRigidBodyFromShape(compoundShape, initialMesh, options.mass, options.friction, options.restitution);
  22849. body.parts = parts;
  22850. return body;
  22851. };
  22852. CannonJSPlugin.prototype._unbindBody = function (body) {
  22853. for (var index = 0; index < this._registeredMeshes.length; index++) {
  22854. var registeredMesh = this._registeredMeshes[index];
  22855. if (registeredMesh.body === body) {
  22856. registeredMesh.body = null;
  22857. registeredMesh.delta = 0;
  22858. }
  22859. }
  22860. };
  22861. CannonJSPlugin.prototype.unregisterMesh = function (mesh) {
  22862. for (var index = 0; index < this._registeredMeshes.length; index++) {
  22863. var registeredMesh = this._registeredMeshes[index];
  22864. if (registeredMesh.mesh === mesh) {
  22865. // Remove body
  22866. if (registeredMesh.body) {
  22867. this._world.remove(registeredMesh.body);
  22868. this._unbindBody(registeredMesh.body);
  22869. }
  22870. this._registeredMeshes.splice(index, 1);
  22871. return;
  22872. }
  22873. }
  22874. };
  22875. CannonJSPlugin.prototype.applyImpulse = function (mesh, force, contactPoint) {
  22876. var worldPoint = new CANNON.Vec3(contactPoint.x, contactPoint.z, contactPoint.y);
  22877. var impulse = new CANNON.Vec3(force.x, force.z, force.y);
  22878. for (var index = 0; index < this._registeredMeshes.length; index++) {
  22879. var registeredMesh = this._registeredMeshes[index];
  22880. if (registeredMesh.mesh === mesh) {
  22881. registeredMesh.body.applyImpulse(impulse, worldPoint);
  22882. return;
  22883. }
  22884. }
  22885. };
  22886. CannonJSPlugin.prototype.createLink = function (mesh1, mesh2, pivot1, pivot2) {
  22887. var body1 = null, body2 = null;
  22888. for (var index = 0; index < this._registeredMeshes.length; index++) {
  22889. var registeredMesh = this._registeredMeshes[index];
  22890. if (registeredMesh.mesh === mesh1) {
  22891. body1 = registeredMesh.body;
  22892. }
  22893. else if (registeredMesh.mesh === mesh2) {
  22894. body2 = registeredMesh.body;
  22895. }
  22896. }
  22897. if (!body1 || !body2) {
  22898. return false;
  22899. }
  22900. var constraint = new CANNON.PointToPointConstraint(body1, new CANNON.Vec3(pivot1.x, pivot1.z, pivot1.y), body2, new CANNON.Vec3(pivot2.x, pivot2.z, pivot2.y));
  22901. this._world.addConstraint(constraint);
  22902. return true;
  22903. };
  22904. CannonJSPlugin.prototype.dispose = function () {
  22905. while (this._registeredMeshes.length) {
  22906. this.unregisterMesh(this._registeredMeshes[0].mesh);
  22907. }
  22908. };
  22909. CannonJSPlugin.prototype.isSupported = function () {
  22910. return window.CANNON !== undefined;
  22911. };
  22912. return CannonJSPlugin;
  22913. })();
  22914. BABYLON.CannonJSPlugin = CannonJSPlugin;
  22915. })(BABYLON || (BABYLON = {}));
  22916. //# sourceMappingURL=babylon.cannonJSPlugin.js.map
  22917. var BABYLON;
  22918. (function (BABYLON) {
  22919. var Condition = (function () {
  22920. function Condition(actionManager) {
  22921. this._actionManager = actionManager;
  22922. }
  22923. Condition.prototype.isValid = function () {
  22924. return true;
  22925. };
  22926. Condition.prototype._getProperty = function (propertyPath) {
  22927. return this._actionManager._getProperty(propertyPath);
  22928. };
  22929. Condition.prototype._getEffectiveTarget = function (target, propertyPath) {
  22930. return this._actionManager._getEffectiveTarget(target, propertyPath);
  22931. };
  22932. return Condition;
  22933. })();
  22934. BABYLON.Condition = Condition;
  22935. var ValueCondition = (function (_super) {
  22936. __extends(ValueCondition, _super);
  22937. function ValueCondition(actionManager, target, propertyPath, value, operator) {
  22938. if (operator === void 0) { operator = ValueCondition.IsEqual; }
  22939. _super.call(this, actionManager);
  22940. this.propertyPath = propertyPath;
  22941. this.value = value;
  22942. this.operator = operator;
  22943. this._target = this._getEffectiveTarget(target, this.propertyPath);
  22944. this._property = this._getProperty(this.propertyPath);
  22945. }
  22946. Object.defineProperty(ValueCondition, "IsEqual", {
  22947. get: function () {
  22948. return ValueCondition._IsEqual;
  22949. },
  22950. enumerable: true,
  22951. configurable: true
  22952. });
  22953. Object.defineProperty(ValueCondition, "IsDifferent", {
  22954. get: function () {
  22955. return ValueCondition._IsDifferent;
  22956. },
  22957. enumerable: true,
  22958. configurable: true
  22959. });
  22960. Object.defineProperty(ValueCondition, "IsGreater", {
  22961. get: function () {
  22962. return ValueCondition._IsGreater;
  22963. },
  22964. enumerable: true,
  22965. configurable: true
  22966. });
  22967. Object.defineProperty(ValueCondition, "IsLesser", {
  22968. get: function () {
  22969. return ValueCondition._IsLesser;
  22970. },
  22971. enumerable: true,
  22972. configurable: true
  22973. });
  22974. // Methods
  22975. ValueCondition.prototype.isValid = function () {
  22976. switch (this.operator) {
  22977. case ValueCondition.IsGreater:
  22978. return this._target[this._property] > this.value;
  22979. case ValueCondition.IsLesser:
  22980. return this._target[this._property] < this.value;
  22981. case ValueCondition.IsEqual:
  22982. case ValueCondition.IsDifferent:
  22983. var check;
  22984. if (this.value.equals) {
  22985. check = this.value.equals(this._target[this._property]);
  22986. }
  22987. else {
  22988. check = this.value === this._target[this._property];
  22989. }
  22990. return this.operator === ValueCondition.IsEqual ? check : !check;
  22991. }
  22992. return false;
  22993. };
  22994. // Statics
  22995. ValueCondition._IsEqual = 0;
  22996. ValueCondition._IsDifferent = 1;
  22997. ValueCondition._IsGreater = 2;
  22998. ValueCondition._IsLesser = 3;
  22999. return ValueCondition;
  23000. })(Condition);
  23001. BABYLON.ValueCondition = ValueCondition;
  23002. var PredicateCondition = (function (_super) {
  23003. __extends(PredicateCondition, _super);
  23004. function PredicateCondition(actionManager, predicate) {
  23005. _super.call(this, actionManager);
  23006. this.predicate = predicate;
  23007. }
  23008. PredicateCondition.prototype.isValid = function () {
  23009. return this.predicate();
  23010. };
  23011. return PredicateCondition;
  23012. })(Condition);
  23013. BABYLON.PredicateCondition = PredicateCondition;
  23014. var StateCondition = (function (_super) {
  23015. __extends(StateCondition, _super);
  23016. function StateCondition(actionManager, target, value) {
  23017. _super.call(this, actionManager);
  23018. this.value = value;
  23019. this._target = target;
  23020. }
  23021. // Methods
  23022. StateCondition.prototype.isValid = function () {
  23023. return this._target.state === this.value;
  23024. };
  23025. return StateCondition;
  23026. })(Condition);
  23027. BABYLON.StateCondition = StateCondition;
  23028. })(BABYLON || (BABYLON = {}));
  23029. //# sourceMappingURL=babylon.condition.js.mapvar BABYLON;
  23030. (function (BABYLON) {
  23031. var Action = (function () {
  23032. function Action(triggerOptions, condition) {
  23033. this.triggerOptions = triggerOptions;
  23034. if (triggerOptions.parameter) {
  23035. this.trigger = triggerOptions.trigger;
  23036. this._triggerParameter = triggerOptions.parameter;
  23037. }
  23038. else {
  23039. this.trigger = triggerOptions;
  23040. }
  23041. this._nextActiveAction = this;
  23042. this._condition = condition;
  23043. }
  23044. // Methods
  23045. Action.prototype._prepare = function () {
  23046. };
  23047. Action.prototype.getTriggerParameter = function () {
  23048. return this._triggerParameter;
  23049. };
  23050. Action.prototype._executeCurrent = function (evt) {
  23051. if (this._condition) {
  23052. var currentRenderId = this._actionManager.getScene().getRenderId();
  23053. // We cache the current evaluation for the current frame
  23054. if (this._condition._evaluationId === currentRenderId) {
  23055. if (!this._condition._currentResult) {
  23056. return;
  23057. }
  23058. }
  23059. else {
  23060. this._condition._evaluationId = currentRenderId;
  23061. if (!this._condition.isValid()) {
  23062. this._condition._currentResult = false;
  23063. return;
  23064. }
  23065. this._condition._currentResult = true;
  23066. }
  23067. }
  23068. this._nextActiveAction.execute(evt);
  23069. if (this._nextActiveAction._child) {
  23070. if (!this._nextActiveAction._child._actionManager) {
  23071. this._nextActiveAction._child._actionManager = this._actionManager;
  23072. }
  23073. this._nextActiveAction = this._nextActiveAction._child;
  23074. }
  23075. else {
  23076. this._nextActiveAction = this;
  23077. }
  23078. };
  23079. Action.prototype.execute = function (evt) {
  23080. };
  23081. Action.prototype.then = function (action) {
  23082. this._child = action;
  23083. action._actionManager = this._actionManager;
  23084. action._prepare();
  23085. return action;
  23086. };
  23087. Action.prototype._getProperty = function (propertyPath) {
  23088. return this._actionManager._getProperty(propertyPath);
  23089. };
  23090. Action.prototype._getEffectiveTarget = function (target, propertyPath) {
  23091. return this._actionManager._getEffectiveTarget(target, propertyPath);
  23092. };
  23093. return Action;
  23094. })();
  23095. BABYLON.Action = Action;
  23096. })(BABYLON || (BABYLON = {}));
  23097. //# sourceMappingURL=babylon.action.js.mapvar BABYLON;
  23098. (function (BABYLON) {
  23099. /**
  23100. * ActionEvent is the event beint sent when an action is triggered.
  23101. */
  23102. var ActionEvent = (function () {
  23103. /**
  23104. * @constructor
  23105. * @param source The mesh that triggered the action.
  23106. * @param pointerX the X mouse cursor position at the time of the event
  23107. * @param pointerY the Y mouse cursor position at the time of the event
  23108. * @param meshUnderPointer The mesh that is currently pointed at (can be null)
  23109. * @param sourceEvent the original (browser) event that triggered the ActionEvent
  23110. */
  23111. function ActionEvent(source, pointerX, pointerY, meshUnderPointer, sourceEvent) {
  23112. this.source = source;
  23113. this.pointerX = pointerX;
  23114. this.pointerY = pointerY;
  23115. this.meshUnderPointer = meshUnderPointer;
  23116. this.sourceEvent = sourceEvent;
  23117. }
  23118. /**
  23119. * Helper function to auto-create an ActionEvent from a source mesh.
  23120. * @param source the source mesh that triggered the event
  23121. * @param evt {Event} The original (browser) event
  23122. */
  23123. ActionEvent.CreateNew = function (source, evt) {
  23124. var scene = source.getScene();
  23125. return new ActionEvent(source, scene.pointerX, scene.pointerY, scene.meshUnderPointer, evt);
  23126. };
  23127. /**
  23128. * Helper function to auto-create an ActionEvent from a scene. If triggered by a mesh use ActionEvent.CreateNew
  23129. * @param scene the scene where the event occurred
  23130. * @param evt {Event} The original (browser) event
  23131. */
  23132. ActionEvent.CreateNewFromScene = function (scene, evt) {
  23133. return new ActionEvent(null, scene.pointerX, scene.pointerY, scene.meshUnderPointer, evt);
  23134. };
  23135. return ActionEvent;
  23136. })();
  23137. BABYLON.ActionEvent = ActionEvent;
  23138. /**
  23139. * Action Manager manages all events to be triggered on a given mesh or the global scene.
  23140. * A single scene can have many Action Managers to handle predefined actions on specific meshes.
  23141. */
  23142. var ActionManager = (function () {
  23143. function ActionManager(scene) {
  23144. // Members
  23145. this.actions = new Array();
  23146. this._scene = scene;
  23147. scene._actionManagers.push(this);
  23148. }
  23149. Object.defineProperty(ActionManager, "NothingTrigger", {
  23150. get: function () {
  23151. return ActionManager._NothingTrigger;
  23152. },
  23153. enumerable: true,
  23154. configurable: true
  23155. });
  23156. Object.defineProperty(ActionManager, "OnPickTrigger", {
  23157. get: function () {
  23158. return ActionManager._OnPickTrigger;
  23159. },
  23160. enumerable: true,
  23161. configurable: true
  23162. });
  23163. Object.defineProperty(ActionManager, "OnLeftPickTrigger", {
  23164. get: function () {
  23165. return ActionManager._OnLeftPickTrigger;
  23166. },
  23167. enumerable: true,
  23168. configurable: true
  23169. });
  23170. Object.defineProperty(ActionManager, "OnRightPickTrigger", {
  23171. get: function () {
  23172. return ActionManager._OnRightPickTrigger;
  23173. },
  23174. enumerable: true,
  23175. configurable: true
  23176. });
  23177. Object.defineProperty(ActionManager, "OnCenterPickTrigger", {
  23178. get: function () {
  23179. return ActionManager._OnCenterPickTrigger;
  23180. },
  23181. enumerable: true,
  23182. configurable: true
  23183. });
  23184. Object.defineProperty(ActionManager, "OnPointerOverTrigger", {
  23185. get: function () {
  23186. return ActionManager._OnPointerOverTrigger;
  23187. },
  23188. enumerable: true,
  23189. configurable: true
  23190. });
  23191. Object.defineProperty(ActionManager, "OnPointerOutTrigger", {
  23192. get: function () {
  23193. return ActionManager._OnPointerOutTrigger;
  23194. },
  23195. enumerable: true,
  23196. configurable: true
  23197. });
  23198. Object.defineProperty(ActionManager, "OnEveryFrameTrigger", {
  23199. get: function () {
  23200. return ActionManager._OnEveryFrameTrigger;
  23201. },
  23202. enumerable: true,
  23203. configurable: true
  23204. });
  23205. Object.defineProperty(ActionManager, "OnIntersectionEnterTrigger", {
  23206. get: function () {
  23207. return ActionManager._OnIntersectionEnterTrigger;
  23208. },
  23209. enumerable: true,
  23210. configurable: true
  23211. });
  23212. Object.defineProperty(ActionManager, "OnIntersectionExitTrigger", {
  23213. get: function () {
  23214. return ActionManager._OnIntersectionExitTrigger;
  23215. },
  23216. enumerable: true,
  23217. configurable: true
  23218. });
  23219. Object.defineProperty(ActionManager, "OnKeyDownTrigger", {
  23220. get: function () {
  23221. return ActionManager._OnKeyDownTrigger;
  23222. },
  23223. enumerable: true,
  23224. configurable: true
  23225. });
  23226. Object.defineProperty(ActionManager, "OnKeyUpTrigger", {
  23227. get: function () {
  23228. return ActionManager._OnKeyUpTrigger;
  23229. },
  23230. enumerable: true,
  23231. configurable: true
  23232. });
  23233. // Methods
  23234. ActionManager.prototype.dispose = function () {
  23235. var index = this._scene._actionManagers.indexOf(this);
  23236. if (index > -1) {
  23237. this._scene._actionManagers.splice(index, 1);
  23238. }
  23239. };
  23240. ActionManager.prototype.getScene = function () {
  23241. return this._scene;
  23242. };
  23243. /**
  23244. * Does this action manager handles actions of any of the given triggers
  23245. * @param {number[]} triggers - the triggers to be tested
  23246. * @return {boolean} whether one (or more) of the triggers is handeled
  23247. */
  23248. ActionManager.prototype.hasSpecificTriggers = function (triggers) {
  23249. for (var index = 0; index < this.actions.length; index++) {
  23250. var action = this.actions[index];
  23251. if (triggers.indexOf(action.trigger) > -1) {
  23252. return true;
  23253. }
  23254. }
  23255. return false;
  23256. };
  23257. Object.defineProperty(ActionManager.prototype, "hasPointerTriggers", {
  23258. /**
  23259. * Does this action manager has pointer triggers
  23260. * @return {boolean} whether or not it has pointer triggers
  23261. */
  23262. get: function () {
  23263. for (var index = 0; index < this.actions.length; index++) {
  23264. var action = this.actions[index];
  23265. if (action.trigger >= ActionManager._OnPickTrigger && action.trigger <= ActionManager._OnPointerOutTrigger) {
  23266. return true;
  23267. }
  23268. }
  23269. return false;
  23270. },
  23271. enumerable: true,
  23272. configurable: true
  23273. });
  23274. Object.defineProperty(ActionManager.prototype, "hasPickTriggers", {
  23275. /**
  23276. * Does this action manager has pick triggers
  23277. * @return {boolean} whether or not it has pick triggers
  23278. */
  23279. get: function () {
  23280. for (var index = 0; index < this.actions.length; index++) {
  23281. var action = this.actions[index];
  23282. if (action.trigger >= ActionManager._OnPickTrigger && action.trigger <= ActionManager._OnCenterPickTrigger) {
  23283. return true;
  23284. }
  23285. }
  23286. return false;
  23287. },
  23288. enumerable: true,
  23289. configurable: true
  23290. });
  23291. /**
  23292. * Registers an action to this action manager
  23293. * @param {BABYLON.Action} action - the action to be registered
  23294. * @return {BABYLON.Action} the action amended (prepared) after registration
  23295. */
  23296. ActionManager.prototype.registerAction = function (action) {
  23297. if (action.trigger === ActionManager.OnEveryFrameTrigger) {
  23298. if (this.getScene().actionManager !== this) {
  23299. BABYLON.Tools.Warn("OnEveryFrameTrigger can only be used with scene.actionManager");
  23300. return null;
  23301. }
  23302. }
  23303. this.actions.push(action);
  23304. action._actionManager = this;
  23305. action._prepare();
  23306. return action;
  23307. };
  23308. /**
  23309. * Process a specific trigger
  23310. * @param {number} trigger - the trigger to process
  23311. * @param evt {BABYLON.ActionEvent} the event details to be processed
  23312. */
  23313. ActionManager.prototype.processTrigger = function (trigger, evt) {
  23314. for (var index = 0; index < this.actions.length; index++) {
  23315. var action = this.actions[index];
  23316. if (action.trigger === trigger) {
  23317. if (trigger === ActionManager.OnKeyUpTrigger || trigger === ActionManager.OnKeyDownTrigger) {
  23318. var parameter = action.getTriggerParameter();
  23319. if (parameter) {
  23320. var unicode = evt.sourceEvent.charCode ? evt.sourceEvent.charCode : evt.sourceEvent.keyCode;
  23321. var actualkey = String.fromCharCode(unicode).toLowerCase();
  23322. if (actualkey !== parameter.toLowerCase()) {
  23323. continue;
  23324. }
  23325. }
  23326. }
  23327. action._executeCurrent(evt);
  23328. }
  23329. }
  23330. };
  23331. ActionManager.prototype._getEffectiveTarget = function (target, propertyPath) {
  23332. var properties = propertyPath.split(".");
  23333. for (var index = 0; index < properties.length - 1; index++) {
  23334. target = target[properties[index]];
  23335. }
  23336. return target;
  23337. };
  23338. ActionManager.prototype._getProperty = function (propertyPath) {
  23339. var properties = propertyPath.split(".");
  23340. return properties[properties.length - 1];
  23341. };
  23342. // Statics
  23343. ActionManager._NothingTrigger = 0;
  23344. ActionManager._OnPickTrigger = 1;
  23345. ActionManager._OnLeftPickTrigger = 2;
  23346. ActionManager._OnRightPickTrigger = 3;
  23347. ActionManager._OnCenterPickTrigger = 4;
  23348. ActionManager._OnPointerOverTrigger = 5;
  23349. ActionManager._OnPointerOutTrigger = 6;
  23350. ActionManager._OnEveryFrameTrigger = 7;
  23351. ActionManager._OnIntersectionEnterTrigger = 8;
  23352. ActionManager._OnIntersectionExitTrigger = 9;
  23353. ActionManager._OnKeyDownTrigger = 10;
  23354. ActionManager._OnKeyUpTrigger = 11;
  23355. return ActionManager;
  23356. })();
  23357. BABYLON.ActionManager = ActionManager;
  23358. })(BABYLON || (BABYLON = {}));
  23359. //# sourceMappingURL=babylon.actionManager.js.map
  23360. var BABYLON;
  23361. (function (BABYLON) {
  23362. var InterpolateValueAction = (function (_super) {
  23363. __extends(InterpolateValueAction, _super);
  23364. function InterpolateValueAction(triggerOptions, target, propertyPath, value, duration, condition, stopOtherAnimations) {
  23365. if (duration === void 0) { duration = 1000; }
  23366. _super.call(this, triggerOptions, condition);
  23367. this.propertyPath = propertyPath;
  23368. this.value = value;
  23369. this.duration = duration;
  23370. this.stopOtherAnimations = stopOtherAnimations;
  23371. this._target = target;
  23372. }
  23373. InterpolateValueAction.prototype._prepare = function () {
  23374. this._target = this._getEffectiveTarget(this._target, this.propertyPath);
  23375. this._property = this._getProperty(this.propertyPath);
  23376. };
  23377. InterpolateValueAction.prototype.execute = function () {
  23378. var scene = this._actionManager.getScene();
  23379. var keys = [
  23380. {
  23381. frame: 0,
  23382. value: this._target[this._property]
  23383. },
  23384. {
  23385. frame: 100,
  23386. value: this.value
  23387. }
  23388. ];
  23389. var dataType;
  23390. if (typeof this.value === "number") {
  23391. dataType = BABYLON.Animation.ANIMATIONTYPE_FLOAT;
  23392. }
  23393. else if (this.value instanceof BABYLON.Color3) {
  23394. dataType = BABYLON.Animation.ANIMATIONTYPE_COLOR3;
  23395. }
  23396. else if (this.value instanceof BABYLON.Vector3) {
  23397. dataType = BABYLON.Animation.ANIMATIONTYPE_VECTOR3;
  23398. }
  23399. else if (this.value instanceof BABYLON.Matrix) {
  23400. dataType = BABYLON.Animation.ANIMATIONTYPE_MATRIX;
  23401. }
  23402. else if (this.value instanceof BABYLON.Quaternion) {
  23403. dataType = BABYLON.Animation.ANIMATIONTYPE_QUATERNION;
  23404. }
  23405. else {
  23406. BABYLON.Tools.Warn("InterpolateValueAction: Unsupported type (" + typeof this.value + ")");
  23407. return;
  23408. }
  23409. var animation = new BABYLON.Animation("InterpolateValueAction", this._property, 100 * (1000.0 / this.duration), dataType, BABYLON.Animation.ANIMATIONLOOPMODE_CONSTANT);
  23410. animation.setKeys(keys);
  23411. if (this.stopOtherAnimations) {
  23412. scene.stopAnimation(this._target);
  23413. }
  23414. scene.beginDirectAnimation(this._target, [animation], 0, 100);
  23415. };
  23416. return InterpolateValueAction;
  23417. })(BABYLON.Action);
  23418. BABYLON.InterpolateValueAction = InterpolateValueAction;
  23419. })(BABYLON || (BABYLON = {}));
  23420. //# sourceMappingURL=babylon.interpolateValueAction.js.map
  23421. var BABYLON;
  23422. (function (BABYLON) {
  23423. var SwitchBooleanAction = (function (_super) {
  23424. __extends(SwitchBooleanAction, _super);
  23425. function SwitchBooleanAction(triggerOptions, target, propertyPath, condition) {
  23426. _super.call(this, triggerOptions, condition);
  23427. this.propertyPath = propertyPath;
  23428. this._target = target;
  23429. }
  23430. SwitchBooleanAction.prototype._prepare = function () {
  23431. this._target = this._getEffectiveTarget(this._target, this.propertyPath);
  23432. this._property = this._getProperty(this.propertyPath);
  23433. };
  23434. SwitchBooleanAction.prototype.execute = function () {
  23435. this._target[this._property] = !this._target[this._property];
  23436. };
  23437. return SwitchBooleanAction;
  23438. })(BABYLON.Action);
  23439. BABYLON.SwitchBooleanAction = SwitchBooleanAction;
  23440. var SetStateAction = (function (_super) {
  23441. __extends(SetStateAction, _super);
  23442. function SetStateAction(triggerOptions, target, value, condition) {
  23443. _super.call(this, triggerOptions, condition);
  23444. this.value = value;
  23445. this._target = target;
  23446. }
  23447. SetStateAction.prototype.execute = function () {
  23448. this._target.state = this.value;
  23449. };
  23450. return SetStateAction;
  23451. })(BABYLON.Action);
  23452. BABYLON.SetStateAction = SetStateAction;
  23453. var SetValueAction = (function (_super) {
  23454. __extends(SetValueAction, _super);
  23455. function SetValueAction(triggerOptions, target, propertyPath, value, condition) {
  23456. _super.call(this, triggerOptions, condition);
  23457. this.propertyPath = propertyPath;
  23458. this.value = value;
  23459. this._target = target;
  23460. }
  23461. SetValueAction.prototype._prepare = function () {
  23462. this._target = this._getEffectiveTarget(this._target, this.propertyPath);
  23463. this._property = this._getProperty(this.propertyPath);
  23464. };
  23465. SetValueAction.prototype.execute = function () {
  23466. this._target[this._property] = this.value;
  23467. };
  23468. return SetValueAction;
  23469. })(BABYLON.Action);
  23470. BABYLON.SetValueAction = SetValueAction;
  23471. var IncrementValueAction = (function (_super) {
  23472. __extends(IncrementValueAction, _super);
  23473. function IncrementValueAction(triggerOptions, target, propertyPath, value, condition) {
  23474. _super.call(this, triggerOptions, condition);
  23475. this.propertyPath = propertyPath;
  23476. this.value = value;
  23477. this._target = target;
  23478. }
  23479. IncrementValueAction.prototype._prepare = function () {
  23480. this._target = this._getEffectiveTarget(this._target, this.propertyPath);
  23481. this._property = this._getProperty(this.propertyPath);
  23482. if (typeof this._target[this._property] !== "number") {
  23483. BABYLON.Tools.Warn("Warning: IncrementValueAction can only be used with number values");
  23484. }
  23485. };
  23486. IncrementValueAction.prototype.execute = function () {
  23487. this._target[this._property] += this.value;
  23488. };
  23489. return IncrementValueAction;
  23490. })(BABYLON.Action);
  23491. BABYLON.IncrementValueAction = IncrementValueAction;
  23492. var PlayAnimationAction = (function (_super) {
  23493. __extends(PlayAnimationAction, _super);
  23494. function PlayAnimationAction(triggerOptions, target, from, to, loop, condition) {
  23495. _super.call(this, triggerOptions, condition);
  23496. this.from = from;
  23497. this.to = to;
  23498. this.loop = loop;
  23499. this._target = target;
  23500. }
  23501. PlayAnimationAction.prototype._prepare = function () {
  23502. };
  23503. PlayAnimationAction.prototype.execute = function () {
  23504. var scene = this._actionManager.getScene();
  23505. scene.beginAnimation(this._target, this.from, this.to, this.loop);
  23506. };
  23507. return PlayAnimationAction;
  23508. })(BABYLON.Action);
  23509. BABYLON.PlayAnimationAction = PlayAnimationAction;
  23510. var StopAnimationAction = (function (_super) {
  23511. __extends(StopAnimationAction, _super);
  23512. function StopAnimationAction(triggerOptions, target, condition) {
  23513. _super.call(this, triggerOptions, condition);
  23514. this._target = target;
  23515. }
  23516. StopAnimationAction.prototype._prepare = function () {
  23517. };
  23518. StopAnimationAction.prototype.execute = function () {
  23519. var scene = this._actionManager.getScene();
  23520. scene.stopAnimation(this._target);
  23521. };
  23522. return StopAnimationAction;
  23523. })(BABYLON.Action);
  23524. BABYLON.StopAnimationAction = StopAnimationAction;
  23525. var DoNothingAction = (function (_super) {
  23526. __extends(DoNothingAction, _super);
  23527. function DoNothingAction(triggerOptions, condition) {
  23528. if (triggerOptions === void 0) { triggerOptions = BABYLON.ActionManager.NothingTrigger; }
  23529. _super.call(this, triggerOptions, condition);
  23530. }
  23531. DoNothingAction.prototype.execute = function () {
  23532. };
  23533. return DoNothingAction;
  23534. })(BABYLON.Action);
  23535. BABYLON.DoNothingAction = DoNothingAction;
  23536. var CombineAction = (function (_super) {
  23537. __extends(CombineAction, _super);
  23538. function CombineAction(triggerOptions, children, condition) {
  23539. _super.call(this, triggerOptions, condition);
  23540. this.children = children;
  23541. }
  23542. CombineAction.prototype._prepare = function () {
  23543. for (var index = 0; index < this.children.length; index++) {
  23544. this.children[index]._actionManager = this._actionManager;
  23545. this.children[index]._prepare();
  23546. }
  23547. };
  23548. CombineAction.prototype.execute = function (evt) {
  23549. for (var index = 0; index < this.children.length; index++) {
  23550. this.children[index].execute(evt);
  23551. }
  23552. };
  23553. return CombineAction;
  23554. })(BABYLON.Action);
  23555. BABYLON.CombineAction = CombineAction;
  23556. var ExecuteCodeAction = (function (_super) {
  23557. __extends(ExecuteCodeAction, _super);
  23558. function ExecuteCodeAction(triggerOptions, func, condition) {
  23559. _super.call(this, triggerOptions, condition);
  23560. this.func = func;
  23561. }
  23562. ExecuteCodeAction.prototype.execute = function (evt) {
  23563. this.func(evt);
  23564. };
  23565. return ExecuteCodeAction;
  23566. })(BABYLON.Action);
  23567. BABYLON.ExecuteCodeAction = ExecuteCodeAction;
  23568. var SetParentAction = (function (_super) {
  23569. __extends(SetParentAction, _super);
  23570. function SetParentAction(triggerOptions, target, parent, condition) {
  23571. _super.call(this, triggerOptions, condition);
  23572. this._target = target;
  23573. this._parent = parent;
  23574. }
  23575. SetParentAction.prototype._prepare = function () {
  23576. };
  23577. SetParentAction.prototype.execute = function () {
  23578. if (this._target.parent === this._parent) {
  23579. return;
  23580. }
  23581. var invertParentWorldMatrix = this._parent.getWorldMatrix().clone();
  23582. invertParentWorldMatrix.invert();
  23583. this._target.position = BABYLON.Vector3.TransformCoordinates(this._target.position, invertParentWorldMatrix);
  23584. this._target.parent = this._parent;
  23585. };
  23586. return SetParentAction;
  23587. })(BABYLON.Action);
  23588. BABYLON.SetParentAction = SetParentAction;
  23589. var PlaySoundAction = (function (_super) {
  23590. __extends(PlaySoundAction, _super);
  23591. function PlaySoundAction(triggerOptions, sound, condition) {
  23592. _super.call(this, triggerOptions, condition);
  23593. this._sound = sound;
  23594. }
  23595. PlaySoundAction.prototype._prepare = function () {
  23596. };
  23597. PlaySoundAction.prototype.execute = function () {
  23598. if (this._sound !== undefined)
  23599. this._sound.play();
  23600. };
  23601. return PlaySoundAction;
  23602. })(BABYLON.Action);
  23603. BABYLON.PlaySoundAction = PlaySoundAction;
  23604. var StopSoundAction = (function (_super) {
  23605. __extends(StopSoundAction, _super);
  23606. function StopSoundAction(triggerOptions, sound, condition) {
  23607. _super.call(this, triggerOptions, condition);
  23608. this._sound = sound;
  23609. }
  23610. StopSoundAction.prototype._prepare = function () {
  23611. };
  23612. StopSoundAction.prototype.execute = function () {
  23613. if (this._sound !== undefined)
  23614. this._sound.stop();
  23615. };
  23616. return StopSoundAction;
  23617. })(BABYLON.Action);
  23618. BABYLON.StopSoundAction = StopSoundAction;
  23619. })(BABYLON || (BABYLON = {}));
  23620. //# sourceMappingURL=babylon.directActions.js.map
  23621. var BABYLON;
  23622. (function (BABYLON) {
  23623. var Geometry = (function () {
  23624. function Geometry(id, scene, vertexData, updatable, mesh) {
  23625. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NONE;
  23626. this._totalVertices = 0;
  23627. this._indices = [];
  23628. this.id = id;
  23629. this._engine = scene.getEngine();
  23630. this._meshes = [];
  23631. this._scene = scene;
  23632. // vertexData
  23633. if (vertexData) {
  23634. this.setAllVerticesData(vertexData, updatable);
  23635. }
  23636. else {
  23637. this._totalVertices = 0;
  23638. this._indices = [];
  23639. }
  23640. // applyToMesh
  23641. if (mesh) {
  23642. this.applyToMesh(mesh);
  23643. mesh.computeWorldMatrix(true);
  23644. }
  23645. }
  23646. Geometry.prototype.getScene = function () {
  23647. return this._scene;
  23648. };
  23649. Geometry.prototype.getEngine = function () {
  23650. return this._engine;
  23651. };
  23652. Geometry.prototype.isReady = function () {
  23653. return this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADED || this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_NONE;
  23654. };
  23655. Geometry.prototype.setAllVerticesData = function (vertexData, updatable) {
  23656. vertexData.applyToGeometry(this, updatable);
  23657. };
  23658. Geometry.prototype.setVerticesData = function (kind, data, updatable, stride) {
  23659. this._vertexBuffers = this._vertexBuffers || {};
  23660. if (this._vertexBuffers[kind]) {
  23661. this._vertexBuffers[kind].dispose();
  23662. }
  23663. this._vertexBuffers[kind] = new BABYLON.VertexBuffer(this._engine, data, kind, updatable, this._meshes.length === 0, stride);
  23664. if (kind === BABYLON.VertexBuffer.PositionKind) {
  23665. stride = this._vertexBuffers[kind].getStrideSize();
  23666. this._totalVertices = data.length / stride;
  23667. var extend = BABYLON.Tools.ExtractMinAndMax(data, 0, this._totalVertices);
  23668. var meshes = this._meshes;
  23669. var numOfMeshes = meshes.length;
  23670. for (var index = 0; index < numOfMeshes; index++) {
  23671. var mesh = meshes[index];
  23672. mesh._resetPointsArrayCache();
  23673. mesh._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  23674. mesh._createGlobalSubMesh();
  23675. mesh.computeWorldMatrix(true);
  23676. }
  23677. }
  23678. };
  23679. Geometry.prototype.updateVerticesDataDirectly = function (kind, data, offset) {
  23680. var vertexBuffer = this.getVertexBuffer(kind);
  23681. if (!vertexBuffer) {
  23682. return;
  23683. }
  23684. vertexBuffer.updateDirectly(data, offset);
  23685. };
  23686. Geometry.prototype.updateVerticesData = function (kind, data, updateExtends) {
  23687. var vertexBuffer = this.getVertexBuffer(kind);
  23688. if (!vertexBuffer) {
  23689. return;
  23690. }
  23691. vertexBuffer.update(data);
  23692. if (kind === BABYLON.VertexBuffer.PositionKind) {
  23693. var extend;
  23694. var stride = vertexBuffer.getStrideSize();
  23695. this._totalVertices = data.length / stride;
  23696. if (updateExtends) {
  23697. extend = BABYLON.Tools.ExtractMinAndMax(data, 0, this._totalVertices);
  23698. }
  23699. var meshes = this._meshes;
  23700. var numOfMeshes = meshes.length;
  23701. for (var index = 0; index < numOfMeshes; index++) {
  23702. var mesh = meshes[index];
  23703. mesh._resetPointsArrayCache();
  23704. if (updateExtends) {
  23705. mesh._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  23706. }
  23707. }
  23708. }
  23709. };
  23710. Geometry.prototype.getTotalVertices = function () {
  23711. if (!this.isReady()) {
  23712. return 0;
  23713. }
  23714. return this._totalVertices;
  23715. };
  23716. Geometry.prototype.getVerticesData = function (kind) {
  23717. var vertexBuffer = this.getVertexBuffer(kind);
  23718. if (!vertexBuffer) {
  23719. return null;
  23720. }
  23721. return vertexBuffer.getData();
  23722. };
  23723. Geometry.prototype.getVertexBuffer = function (kind) {
  23724. if (!this.isReady()) {
  23725. return null;
  23726. }
  23727. return this._vertexBuffers[kind];
  23728. };
  23729. Geometry.prototype.getVertexBuffers = function () {
  23730. if (!this.isReady()) {
  23731. return null;
  23732. }
  23733. return this._vertexBuffers;
  23734. };
  23735. Geometry.prototype.isVerticesDataPresent = function (kind) {
  23736. if (!this._vertexBuffers) {
  23737. if (this._delayInfo) {
  23738. return this._delayInfo.indexOf(kind) !== -1;
  23739. }
  23740. return false;
  23741. }
  23742. return this._vertexBuffers[kind] !== undefined;
  23743. };
  23744. Geometry.prototype.getVerticesDataKinds = function () {
  23745. var result = [];
  23746. if (!this._vertexBuffers && this._delayInfo) {
  23747. for (var kind in this._delayInfo) {
  23748. result.push(kind);
  23749. }
  23750. }
  23751. else {
  23752. for (kind in this._vertexBuffers) {
  23753. result.push(kind);
  23754. }
  23755. }
  23756. return result;
  23757. };
  23758. Geometry.prototype.setIndices = function (indices, totalVertices) {
  23759. if (this._indexBuffer) {
  23760. this._engine._releaseBuffer(this._indexBuffer);
  23761. }
  23762. this._indices = indices;
  23763. if (this._meshes.length !== 0 && this._indices) {
  23764. this._indexBuffer = this._engine.createIndexBuffer(this._indices);
  23765. }
  23766. if (totalVertices !== undefined) {
  23767. this._totalVertices = totalVertices;
  23768. }
  23769. var meshes = this._meshes;
  23770. var numOfMeshes = meshes.length;
  23771. for (var index = 0; index < numOfMeshes; index++) {
  23772. meshes[index]._createGlobalSubMesh();
  23773. }
  23774. };
  23775. Geometry.prototype.getTotalIndices = function () {
  23776. if (!this.isReady()) {
  23777. return 0;
  23778. }
  23779. return this._indices.length;
  23780. };
  23781. Geometry.prototype.getIndices = function () {
  23782. if (!this.isReady()) {
  23783. return null;
  23784. }
  23785. return this._indices;
  23786. };
  23787. Geometry.prototype.getIndexBuffer = function () {
  23788. if (!this.isReady()) {
  23789. return null;
  23790. }
  23791. return this._indexBuffer;
  23792. };
  23793. Geometry.prototype.releaseForMesh = function (mesh, shouldDispose) {
  23794. var meshes = this._meshes;
  23795. var index = meshes.indexOf(mesh);
  23796. if (index === -1) {
  23797. return;
  23798. }
  23799. for (var kind in this._vertexBuffers) {
  23800. this._vertexBuffers[kind].dispose();
  23801. }
  23802. if (this._indexBuffer && this._engine._releaseBuffer(this._indexBuffer)) {
  23803. this._indexBuffer = null;
  23804. }
  23805. meshes.splice(index, 1);
  23806. mesh._geometry = null;
  23807. if (meshes.length === 0 && shouldDispose) {
  23808. this.dispose();
  23809. }
  23810. };
  23811. Geometry.prototype.applyToMesh = function (mesh) {
  23812. if (mesh._geometry === this) {
  23813. return;
  23814. }
  23815. var previousGeometry = mesh._geometry;
  23816. if (previousGeometry) {
  23817. previousGeometry.releaseForMesh(mesh);
  23818. }
  23819. var meshes = this._meshes;
  23820. // must be done before setting vertexBuffers because of mesh._createGlobalSubMesh()
  23821. mesh._geometry = this;
  23822. this._scene.pushGeometry(this);
  23823. meshes.push(mesh);
  23824. if (this.isReady()) {
  23825. this._applyToMesh(mesh);
  23826. }
  23827. else {
  23828. mesh._boundingInfo = this._boundingInfo;
  23829. }
  23830. };
  23831. Geometry.prototype._applyToMesh = function (mesh) {
  23832. var numOfMeshes = this._meshes.length;
  23833. for (var kind in this._vertexBuffers) {
  23834. if (numOfMeshes === 1) {
  23835. this._vertexBuffers[kind].create();
  23836. }
  23837. this._vertexBuffers[kind]._buffer.references = numOfMeshes;
  23838. if (kind === BABYLON.VertexBuffer.PositionKind) {
  23839. mesh._resetPointsArrayCache();
  23840. var extend = BABYLON.Tools.ExtractMinAndMax(this._vertexBuffers[kind].getData(), 0, this._totalVertices);
  23841. mesh._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  23842. mesh._createGlobalSubMesh();
  23843. //bounding info was just created again, world matrix should be applied again.
  23844. mesh._updateBoundingInfo();
  23845. }
  23846. }
  23847. // indexBuffer
  23848. if (numOfMeshes === 1 && this._indices) {
  23849. this._indexBuffer = this._engine.createIndexBuffer(this._indices);
  23850. }
  23851. if (this._indexBuffer) {
  23852. this._indexBuffer.references = numOfMeshes;
  23853. }
  23854. };
  23855. Geometry.prototype.load = function (scene, onLoaded) {
  23856. var _this = this;
  23857. if (this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADING) {
  23858. return;
  23859. }
  23860. if (this.isReady()) {
  23861. if (onLoaded) {
  23862. onLoaded();
  23863. }
  23864. return;
  23865. }
  23866. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADING;
  23867. scene._addPendingData(this);
  23868. BABYLON.Tools.LoadFile(this.delayLoadingFile, function (data) {
  23869. _this._delayLoadingFunction(JSON.parse(data), _this);
  23870. _this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADED;
  23871. _this._delayInfo = [];
  23872. scene._removePendingData(_this);
  23873. var meshes = _this._meshes;
  23874. var numOfMeshes = meshes.length;
  23875. for (var index = 0; index < numOfMeshes; index++) {
  23876. _this._applyToMesh(meshes[index]);
  23877. }
  23878. if (onLoaded) {
  23879. onLoaded();
  23880. }
  23881. }, function () {
  23882. }, scene.database);
  23883. };
  23884. Geometry.prototype.dispose = function () {
  23885. var meshes = this._meshes;
  23886. var numOfMeshes = meshes.length;
  23887. var index;
  23888. for (index = 0; index < numOfMeshes; index++) {
  23889. this.releaseForMesh(meshes[index]);
  23890. }
  23891. this._meshes = [];
  23892. for (var kind in this._vertexBuffers) {
  23893. this._vertexBuffers[kind].dispose();
  23894. }
  23895. this._vertexBuffers = [];
  23896. this._totalVertices = 0;
  23897. if (this._indexBuffer) {
  23898. this._engine._releaseBuffer(this._indexBuffer);
  23899. }
  23900. this._indexBuffer = null;
  23901. this._indices = [];
  23902. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NONE;
  23903. this.delayLoadingFile = null;
  23904. this._delayLoadingFunction = null;
  23905. this._delayInfo = [];
  23906. this._boundingInfo = null; // todo: .dispose()
  23907. var geometries = this._scene.getGeometries();
  23908. index = geometries.indexOf(this);
  23909. if (index > -1) {
  23910. geometries.splice(index, 1);
  23911. }
  23912. };
  23913. Geometry.prototype.copy = function (id) {
  23914. var vertexData = new BABYLON.VertexData();
  23915. vertexData.indices = [];
  23916. var indices = this.getIndices();
  23917. for (var index = 0; index < indices.length; index++) {
  23918. vertexData.indices.push(indices[index]);
  23919. }
  23920. var updatable = false;
  23921. var stopChecking = false;
  23922. for (var kind in this._vertexBuffers) {
  23923. vertexData.set(this.getVerticesData(kind), kind);
  23924. if (!stopChecking) {
  23925. updatable = this.getVertexBuffer(kind).isUpdatable();
  23926. stopChecking = !updatable;
  23927. }
  23928. }
  23929. var geometry = new Geometry(id, this._scene, vertexData, updatable, null);
  23930. geometry.delayLoadState = this.delayLoadState;
  23931. geometry.delayLoadingFile = this.delayLoadingFile;
  23932. geometry._delayLoadingFunction = this._delayLoadingFunction;
  23933. for (kind in this._delayInfo) {
  23934. geometry._delayInfo = geometry._delayInfo || [];
  23935. geometry._delayInfo.push(kind);
  23936. }
  23937. // Bounding info
  23938. var extend = BABYLON.Tools.ExtractMinAndMax(this.getVerticesData(BABYLON.VertexBuffer.PositionKind), 0, this.getTotalVertices());
  23939. geometry._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  23940. return geometry;
  23941. };
  23942. // Statics
  23943. Geometry.ExtractFromMesh = function (mesh, id) {
  23944. var geometry = mesh._geometry;
  23945. if (!geometry) {
  23946. return null;
  23947. }
  23948. return geometry.copy(id);
  23949. };
  23950. // from http://stackoverflow.com/questions/105034/how-to-create-a-guid-uuid-in-javascript/2117523#answer-2117523
  23951. // be aware Math.random() could cause collisions
  23952. Geometry.RandomId = function () {
  23953. return 'xxxxxxxx-xxxx-4xxx-yxxx-xxxxxxxxxxxx'.replace(/[xy]/g, function (c) {
  23954. var r = Math.random() * 16 | 0, v = c === 'x' ? r : (r & 0x3 | 0x8);
  23955. return v.toString(16);
  23956. });
  23957. };
  23958. return Geometry;
  23959. })();
  23960. BABYLON.Geometry = Geometry;
  23961. /////// Primitives //////////////////////////////////////////////
  23962. var Geometry;
  23963. (function (Geometry) {
  23964. var Primitives;
  23965. (function (Primitives) {
  23966. /// Abstract class
  23967. var _Primitive = (function (_super) {
  23968. __extends(_Primitive, _super);
  23969. function _Primitive(id, scene, vertexData, canBeRegenerated, mesh) {
  23970. this._beingRegenerated = true;
  23971. this._canBeRegenerated = canBeRegenerated;
  23972. _super.call(this, id, scene, vertexData, false, mesh); // updatable = false to be sure not to update vertices
  23973. this._beingRegenerated = false;
  23974. }
  23975. _Primitive.prototype.canBeRegenerated = function () {
  23976. return this._canBeRegenerated;
  23977. };
  23978. _Primitive.prototype.regenerate = function () {
  23979. if (!this._canBeRegenerated) {
  23980. return;
  23981. }
  23982. this._beingRegenerated = true;
  23983. this.setAllVerticesData(this._regenerateVertexData(), false);
  23984. this._beingRegenerated = false;
  23985. };
  23986. _Primitive.prototype.asNewGeometry = function (id) {
  23987. return _super.prototype.copy.call(this, id);
  23988. };
  23989. // overrides
  23990. _Primitive.prototype.setAllVerticesData = function (vertexData, updatable) {
  23991. if (!this._beingRegenerated) {
  23992. return;
  23993. }
  23994. _super.prototype.setAllVerticesData.call(this, vertexData, false);
  23995. };
  23996. _Primitive.prototype.setVerticesData = function (kind, data, updatable) {
  23997. if (!this._beingRegenerated) {
  23998. return;
  23999. }
  24000. _super.prototype.setVerticesData.call(this, kind, data, false);
  24001. };
  24002. // to override
  24003. // protected
  24004. _Primitive.prototype._regenerateVertexData = function () {
  24005. throw new Error("Abstract method");
  24006. };
  24007. _Primitive.prototype.copy = function (id) {
  24008. throw new Error("Must be overriden in sub-classes.");
  24009. };
  24010. return _Primitive;
  24011. })(Geometry);
  24012. Primitives._Primitive = _Primitive;
  24013. var Box = (function (_super) {
  24014. __extends(Box, _super);
  24015. function Box(id, scene, size, canBeRegenerated, mesh) {
  24016. this.size = size;
  24017. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  24018. }
  24019. Box.prototype._regenerateVertexData = function () {
  24020. return BABYLON.VertexData.CreateBox(this.size);
  24021. };
  24022. Box.prototype.copy = function (id) {
  24023. return new Box(id, this.getScene(), this.size, this.canBeRegenerated(), null);
  24024. };
  24025. return Box;
  24026. })(_Primitive);
  24027. Primitives.Box = Box;
  24028. var Sphere = (function (_super) {
  24029. __extends(Sphere, _super);
  24030. function Sphere(id, scene, segments, diameter, canBeRegenerated, mesh) {
  24031. this.segments = segments;
  24032. this.diameter = diameter;
  24033. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  24034. }
  24035. Sphere.prototype._regenerateVertexData = function () {
  24036. return BABYLON.VertexData.CreateSphere(this.segments, this.diameter);
  24037. };
  24038. Sphere.prototype.copy = function (id) {
  24039. return new Sphere(id, this.getScene(), this.segments, this.diameter, this.canBeRegenerated(), null);
  24040. };
  24041. return Sphere;
  24042. })(_Primitive);
  24043. Primitives.Sphere = Sphere;
  24044. var Cylinder = (function (_super) {
  24045. __extends(Cylinder, _super);
  24046. function Cylinder(id, scene, height, diameterTop, diameterBottom, tessellation, subdivisions, canBeRegenerated, mesh) {
  24047. if (subdivisions === void 0) { subdivisions = 1; }
  24048. this.height = height;
  24049. this.diameterTop = diameterTop;
  24050. this.diameterBottom = diameterBottom;
  24051. this.tessellation = tessellation;
  24052. this.subdivisions = subdivisions;
  24053. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  24054. }
  24055. Cylinder.prototype._regenerateVertexData = function () {
  24056. return BABYLON.VertexData.CreateCylinder(this.height, this.diameterTop, this.diameterBottom, this.tessellation, this.subdivisions);
  24057. };
  24058. Cylinder.prototype.copy = function (id) {
  24059. return new Cylinder(id, this.getScene(), this.height, this.diameterTop, this.diameterBottom, this.tessellation, this.subdivisions, this.canBeRegenerated(), null);
  24060. };
  24061. return Cylinder;
  24062. })(_Primitive);
  24063. Primitives.Cylinder = Cylinder;
  24064. var Torus = (function (_super) {
  24065. __extends(Torus, _super);
  24066. function Torus(id, scene, diameter, thickness, tessellation, canBeRegenerated, mesh) {
  24067. this.diameter = diameter;
  24068. this.thickness = thickness;
  24069. this.tessellation = tessellation;
  24070. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  24071. }
  24072. Torus.prototype._regenerateVertexData = function () {
  24073. return BABYLON.VertexData.CreateTorus(this.diameter, this.thickness, this.tessellation);
  24074. };
  24075. Torus.prototype.copy = function (id) {
  24076. return new Torus(id, this.getScene(), this.diameter, this.thickness, this.tessellation, this.canBeRegenerated(), null);
  24077. };
  24078. return Torus;
  24079. })(_Primitive);
  24080. Primitives.Torus = Torus;
  24081. var Ground = (function (_super) {
  24082. __extends(Ground, _super);
  24083. function Ground(id, scene, width, height, subdivisions, canBeRegenerated, mesh) {
  24084. this.width = width;
  24085. this.height = height;
  24086. this.subdivisions = subdivisions;
  24087. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  24088. }
  24089. Ground.prototype._regenerateVertexData = function () {
  24090. return BABYLON.VertexData.CreateGround(this.width, this.height, this.subdivisions);
  24091. };
  24092. Ground.prototype.copy = function (id) {
  24093. return new Ground(id, this.getScene(), this.width, this.height, this.subdivisions, this.canBeRegenerated(), null);
  24094. };
  24095. return Ground;
  24096. })(_Primitive);
  24097. Primitives.Ground = Ground;
  24098. var TiledGround = (function (_super) {
  24099. __extends(TiledGround, _super);
  24100. function TiledGround(id, scene, xmin, zmin, xmax, zmax, subdivisions, precision, canBeRegenerated, mesh) {
  24101. this.xmin = xmin;
  24102. this.zmin = zmin;
  24103. this.xmax = xmax;
  24104. this.zmax = zmax;
  24105. this.subdivisions = subdivisions;
  24106. this.precision = precision;
  24107. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  24108. }
  24109. TiledGround.prototype._regenerateVertexData = function () {
  24110. return BABYLON.VertexData.CreateTiledGround(this.xmin, this.zmin, this.xmax, this.zmax, this.subdivisions, this.precision);
  24111. };
  24112. TiledGround.prototype.copy = function (id) {
  24113. return new TiledGround(id, this.getScene(), this.xmin, this.zmin, this.xmax, this.zmax, this.subdivisions, this.precision, this.canBeRegenerated(), null);
  24114. };
  24115. return TiledGround;
  24116. })(_Primitive);
  24117. Primitives.TiledGround = TiledGround;
  24118. var Plane = (function (_super) {
  24119. __extends(Plane, _super);
  24120. function Plane(id, scene, size, canBeRegenerated, mesh) {
  24121. this.size = size;
  24122. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  24123. }
  24124. Plane.prototype._regenerateVertexData = function () {
  24125. return BABYLON.VertexData.CreatePlane(this.size);
  24126. };
  24127. Plane.prototype.copy = function (id) {
  24128. return new Plane(id, this.getScene(), this.size, this.canBeRegenerated(), null);
  24129. };
  24130. return Plane;
  24131. })(_Primitive);
  24132. Primitives.Plane = Plane;
  24133. var TorusKnot = (function (_super) {
  24134. __extends(TorusKnot, _super);
  24135. function TorusKnot(id, scene, radius, tube, radialSegments, tubularSegments, p, q, canBeRegenerated, mesh) {
  24136. this.radius = radius;
  24137. this.tube = tube;
  24138. this.radialSegments = radialSegments;
  24139. this.tubularSegments = tubularSegments;
  24140. this.p = p;
  24141. this.q = q;
  24142. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  24143. }
  24144. TorusKnot.prototype._regenerateVertexData = function () {
  24145. return BABYLON.VertexData.CreateTorusKnot(this.radius, this.tube, this.radialSegments, this.tubularSegments, this.p, this.q);
  24146. };
  24147. TorusKnot.prototype.copy = function (id) {
  24148. return new TorusKnot(id, this.getScene(), this.radius, this.tube, this.radialSegments, this.tubularSegments, this.p, this.q, this.canBeRegenerated(), null);
  24149. };
  24150. return TorusKnot;
  24151. })(_Primitive);
  24152. Primitives.TorusKnot = TorusKnot;
  24153. })(Primitives = Geometry.Primitives || (Geometry.Primitives = {}));
  24154. })(Geometry = BABYLON.Geometry || (BABYLON.Geometry = {}));
  24155. })(BABYLON || (BABYLON = {}));
  24156. //# sourceMappingURL=babylon.geometry.js.map
  24157. var BABYLON;
  24158. (function (BABYLON) {
  24159. var Gamepads = (function () {
  24160. function Gamepads(ongamedpadconnected) {
  24161. var _this = this;
  24162. this.babylonGamepads = [];
  24163. this.oneGamepadConnected = false;
  24164. this.isMonitoring = false;
  24165. this.gamepadEventSupported = 'GamepadEvent' in window;
  24166. this.gamepadSupportAvailable = (navigator.getGamepads || !!navigator.webkitGetGamepads || !!navigator.msGetGamepads || !!navigator.webkitGamepads);
  24167. this.buttonADataURL = "data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAEAAAABACAYAAACqaXHeAAAABGdBTUEAAK/INwWK6QAAABl0RVh0U29mdHdhcmUAQWRvYmUgSW1hZ2VSZWFkeXHJZTwAAA9aSURBVHja7FtpbBzneX7m3otcihSpm9Z9UJalxPKhVLZlp6ktNzEaxE0CtAnQAgnSoPWPBi3syuiPwordFi5Qt2haFygCoylSV4Vby6os1I3kOLYrS65kXXQoypJJSaFEUTyXy925+rzfzC6HFFlL1kpAIe7i5czO7H7zPs97ft8MtTAMcSu/dNzirxkCZgiYIWCGgBkCZgi4hV/mDR5fSxAt+0ZiX0ucDxMSTJLK+f83BFSA6TFgK75OclshouKBFbA+xaV4k7Z+fD6sNRlmjYFXQMu4NiUVS/oHe5/ecnHo3MYxd7QthN9UcsdW6FqEPwgDOFbqpAajL2VlTrTULzj4Ow8+s4+nipSxWMoxIUkyrl/pGswFtIR7WzHgDCX77K7vfHNkbOA+AryjYZadb27OIJdzCNZBKmXw4kbk35qPsTEfJbeEkZESentHMdBfGtY142gu1bDvqV/925f4tQJlNCaj4hXX7RHXS0AFuJEAXvfHr/zmk67vPjir0V68aFEe8xtuQ6O1FHlrEXLmHBiaDUtzYBlpNYjrF+GFZfhhCcPeBQy53ehzT+H8QBe6uwfRf7l8xjKsvX/y5X98jl8fThDhJ4i46QQkrS5I6v7oX7/++77vPtLUlFnZtnIRlubvxRxnHbJmE79sxD/SqG0oZk8MFarRqufUkQAFrxcXSkfx0eB+nOggKX2jHYZhvf79r/z4L2IiipO84aYRkASfefnAX695p3P3c9mM/UufuaMVdzRvxVx7A0xaWdOMqVULJ6Z3TZv6KmHo0ztK6CkfxpHe3Th0pAuF0fLbn1u+9cmv3vW77bE3fGoSPi0BVfAvvPEHm9rPv//iooWz5m9Z/wCWZx+Go9UrN48QTD9IGMZ1cJIzTPisRQclPMrhME4W9mDfB2+i+2z/+TXz7/z2E7/85+9OIuGGE6BV3H77zm/d33nx6Ktr18zFg2t+DQude2n1tLJ8tcJ90vDhpG5Am7qTkJAQErywiLOld7G3/d9xvL0Hy1vWPbbtS3//00Q4hDeaAFXintrx1fu7+jp2r13bgofX/gaazbVkJQdLT9P6VqRFDSu2hIgXlBUBLgtCr3cce47/CMePX0Rr08qtzz7+8k8TpfKGtcKq1jPZre7oObyjdWkGd628l7AXwvMCeL7HjO6qrS8S1E5kTE9tfbiur665ccU9EB1EF9Ep0WXesEZIJb9j5/b/XUtzNrt29Rw0og2lchmBVqLo8LSAHlCixbTpddGm8Y7pjkttCCUP+JQy3FiatNuxdvUx9F4ayopO/OL9sQeEN4oA/eHn577oWPbGVes11PsrUBxjDafze1Te1VzouqnK2TgmLQljQqmrnAsT+iaPVb5b2co7EC+QhBgUeM1R1AcrsGp9Jy6+4W8U3fZ8r+e3EnOI2uaAX3l+zgNB4O9rW5/B8tY5WGo9BtOrJ4uMfUl+uj0B8HTmPXj8Pex86xVEnTDBBSE2r78fX9i09RPyZfT2A5ceIMSPwDOH8JH7Kk5+fAHtR0Zh6MZ9e7534Wc3wgO0sXLhD9OpFOa0egjGMhguD8BgTJooMfPbV1h/umz25ondcFP90IzY2iTgrfY9uH31aqSc9CeSEHkBEyITv28M8XMGc2/z0HGCpWCs8BS/9sWrDYOrJuCBZ+vu5sUfXbicia5kYGzUw4DWTwJKbApSjHuTBBjT2H68zg0MD4KlEwabZi0Y7wd85u/3O9/B6sVrPlEXeiF9nMmRxPt6Qf4y/HyIbh3HwkdF1zefGt5fUwK8wP2WAGwh02MFE/5ogYr3Qg/STL0W3d8aB1ppa+Pw0uI2Tz6/134Mg+UoIGZlZ2HMLaJYHkPICr6//RBamvPj/UA4dYKsegGrXqAXMaqNsDT6SreOY5Gu/FptCeBFN+caAphGiKFiGaOjA3AJHoGt6r7GgNbjqjo5yQkBUVHQ8PaJExjiaZ2yue12nO27gCNdHSptvf/xGdw11I2UZSmvCIJgQiJMhoEfeqpNDvUSRvUB5hMX9fUecg0aBi+Hm2uaAz633bmbm1VN8+h07LfKJdkOkQB2fL4BTlsj8No4YLG2putMSjwjp3QNvZdH8YsiExV501isFjU30lpF7D8dVfCA8sFHp7BuWYtaIwiCsCrCSDVhh9IX8k0CoHsoMQ84FrfFAE3zQAK0VaLzO9tK79XKAxSj+aYALt3XLfNipZD1v492YexrE/sP0zBgUIQIoYaflAXbz16CzyY6YKqYl8uheTarRioD7xAxCQHUpv18L1Yud+Iloujtk4zQo9WZcKURqjbHclzKvj0Gvcw8UA6oY2WqonSuGQGb5I+TJgEFEsB4daXzc0eopabcX13W0BXwgAnRZL4Q62s8ppnR/pFz/QjF+tRvxeIsY/cizGwRt83P4czACL8HdA1JUivCNGVogvdkNkgaGDNe4CvXFyJ8n+B5XGLJ1FmJXJ53AzjZKgGbatkKL5c/liNWIPO8uM/4VO2uKCQZjLmBqQAGJ4EmI8NMabDTOuyUobYXmPlCEpiqA1IkYdWSBpjpEDl6wsrF9aAjqHNOPXDyXAGprAknY5B0btOGGk/GlfE1taqofCNuuYNIJ+omOiZ1rpUHtEYWjkpWoP5EWV2sb5isA7aIQTHHxaIniNADui8PIs0Eb6SY/Z0UQc+j+mXYuoM7Vy/Age7zkBUyCZGLhRLSOYcWpfXFA1wPhqup8JNKq5UkKeoqSHxPLSoqnUQtw5ioc60IyE/VkOji8mYE2nZELNgCXLaOkGDFJBg4OzCMDEcxCfAzS1pQX5fHSNDLClLGwmwzls6vQ09hGFJYegdZ1hha2bqIBNelB5Qjog02TzpFNVEquYpMuTSYr/lcQPKPJHoRQ8W1GYO3lDgpO9pPWTEZEQGnuodg5Hyk66Lyd8fKOQQ6gqyWict7GeuWz8HQyWEFw+bB7ksF3Nk2V1nfpZTLQqSLslzXlDmHpsQ1osVoy/Solwf/GpdErpaAQUqjWxL2GWcWaSfAMIis7RBwiuCdtD1OgmNHBJCg7r4uZBnbdjaaq+3YewB+USYicY8juYPnMtloqdCjG3f39eO+3JKIAFadSiiZigBdgdcqItMxsmZbIbvUIKlzzQjoEgLGRjU2KTp8AjRCkzEnAG0mtQh8Ku0oAqok8JzP+Lw0MkB3jpKjKpapaL5WKZxafDdBqoC6O8LtyMAQhoZdzG7MwLU8FUYKPINcl+qimismRj26v2I71I3jDxfdpM41I6CTsmG4X0djKyc8RYu9t0Vl2QJbBJ5xFPiICJIg1hdhR3fs5HnWeldleZXABLA98b7Y5HtjkgwNEtbTN4iFC5oI3I1CTsAbsfVjAizJB3Qbx9HphRp6eqr3TDprSYA0FI/3ntOxbpUNM2OjpEcE6HYEWkhIKw+ICeBxi+T09F1WZU+iJq2n8fRDf4Ymu3XSrcOIgg8H9uOFn31fNUVC0oddZ7B5YxtDwlTgo66SEici2fokwCJjju0hw7J54WypQsB7tSRAza+H+nld30Y+m2b7SS+Qn9PKFl1egRciHIfWpxC8x+7tdA97+3zUcNyWX4Ci/THOoD2x/hmlQTox+3gDjWYeg/4gmF853xjBpUsjaGnJR24fu36FNzX5pmfY7EPStlSLIgb6gwk616QRYk8tS88/l/2PT/loyqbQkEmhPpNGNp1CmvtieQHvONGtL4sdy9Hjp5kkpTWmSzM7L529hErHs0cCpt2qW00BymDV3JXSU8HkAXKIjtNnedxS48m4Mr5cR9YlMrx+XTqNRmbP2ZkMOjvHKir/PNa5pouiitFjH44iZ6YwO5tFAy+eo6SdpOUJyhBQTJR+HT9HYLJaFve0PqQmTQLaVOCdmIRIWE+wrmWTzG8iAugF7qgWjSWkGbYa32EjJQTkGFv5dBZNJKCeHdb77UPXZP1rWhKLZ4Rqjv2Fz86lLMNlpusCY9BnqTNUIyTgrVhhs7rVq2KoW2TSxWlXLOCqWX4svmpzZdEjWvgQcdVWPnu+i4ClUS+HyLIFnsVf/9eBduw8eKYy2D1XMxO8Jg+IB9wl+3s/uAC3qKMpXY88m/ecnUHaSis3Na8Ab1UtaCh3j1y+sm8m9o0J+9Fv9MR4Zhw6DufTWasOebsOs+xZKHJOtvtQtertulrwV+0BtH5yWvyW7CxubsCTX9+KUQZ4ga7qmdGUFmrya8QWHwcxlReMF8Mw4QETrR8oy7tq2ivH5Tvya8n8aXZMGc4An/nRDpy52FfR8b5KCJCImt8YkYF/KDtnegfwz3sPodGajQajCTk9z/4mQ6iphMWv9AA9IeMWdyYdn+gBkVc5amwHWV6lHvVaI2YZzfinN95Ngv/htcT/p31CRNbdV8l8e++xD5HPNeHxhx5Bgf18kTN5T1kvjBfEjGjBJCai4gnjHqAnlvqS8e9NeujEjEul/NokDbai4V/2voafHD1S0evdWLeb8ojMNyly5fS//ffbcD0L33j4K4RX4rtMh/UUGLXmr6BWXN9MEFAhYfzmZ6hcXI+TpISRH8061Ui68gTWGUJP4aU9P8ZrB39S+Xkx1ummPSMkbebnJcxU1jm4D5eGhvB7j32HJcpUJHhxLIfxTZpxwGa8eKrHC51a9Tmp+N5P1RsQ01cJAwEflHw8/+pfYn/HgaQ+n7/a1vd6k+BUS2XvVD401TXhu488gQ0r71QUuLJsrWT8mSYtfkBMm0BAmFhNrgDX4oRqqeaJMw4c6TyIv/qPP0Xf8KUJ6sXuP1XluuEEyGsD5TXKgsqBNQvW4RtbnkDb4ttJQlGt/IQqLMJE7tWqOSBZCSrL6dFSqq3AnzhzDC/tewHt5w4nr3suvgN0+P8o3TeegFe3vYDHtj+xhLt/Q3kkeW5d693YuuHXsWHZPcixW4tCwo+trVU9QEs8G6HFqW5kdBiHTu3H64dfxpGuK8r665Tv7tz2D6e/tP23cT0E1OA5QR2iiIbs1i9u/9qTPPC12CtwlIofjZVvW/BZ3LVsC5bPW4u5DQuxaPay2NpRIuy61IkLA+dw8hdHceDUPpw49z9TXUysvWPXtl3bQ4yQtMJ1a18DAsbvRO/atvM5DXXPPbp9yzP8+GXBXTkngKYBdTWvE5RXdm87+HQEfLh2T57UIAdM95Js9+04LKSDbLzG31+Omxpx9xfxKR6AukkhMP0aKuUHsag5VEzE3fGSddsUVu6KFzIE+H/iJry0mX+bu8VfMwTMEDBDwAwBMwTMEHALv/5XgAEASpR5N6rB30UAAAAASUVORK5CYII=";
  24168. this._callbackGamepadConnected = ongamedpadconnected;
  24169. if (this.gamepadSupportAvailable) {
  24170. // Checking if the gamepad connected event is supported (like in Firefox)
  24171. if (this.gamepadEventSupported) {
  24172. window.addEventListener('gamepadconnected', function (evt) {
  24173. _this._onGamepadConnected(evt);
  24174. }, false);
  24175. window.addEventListener('gamepaddisconnected', function (evt) {
  24176. _this._onGamepadDisconnected(evt);
  24177. }, false);
  24178. }
  24179. else {
  24180. this._startMonitoringGamepads();
  24181. }
  24182. if (!this.oneGamepadConnected) {
  24183. this._insertGamepadDOMInstructions();
  24184. }
  24185. }
  24186. else {
  24187. this._insertGamepadDOMNotSupported();
  24188. }
  24189. }
  24190. Gamepads.prototype._insertGamepadDOMInstructions = function () {
  24191. Gamepads.gamepadDOMInfo = document.createElement("div");
  24192. var buttonAImage = document.createElement("img");
  24193. buttonAImage.src = this.buttonADataURL;
  24194. var spanMessage = document.createElement("span");
  24195. spanMessage.innerHTML = "<strong>to activate gamepad</strong>";
  24196. Gamepads.gamepadDOMInfo.appendChild(buttonAImage);
  24197. Gamepads.gamepadDOMInfo.appendChild(spanMessage);
  24198. Gamepads.gamepadDOMInfo.style.position = "absolute";
  24199. Gamepads.gamepadDOMInfo.style.width = "100%";
  24200. Gamepads.gamepadDOMInfo.style.height = "48px";
  24201. Gamepads.gamepadDOMInfo.style.bottom = "0px";
  24202. Gamepads.gamepadDOMInfo.style.backgroundColor = "rgba(1, 1, 1, 0.15)";
  24203. Gamepads.gamepadDOMInfo.style.textAlign = "center";
  24204. Gamepads.gamepadDOMInfo.style.zIndex = "10";
  24205. buttonAImage.style.position = "relative";
  24206. buttonAImage.style.bottom = "8px";
  24207. spanMessage.style.position = "relative";
  24208. spanMessage.style.fontSize = "32px";
  24209. spanMessage.style.bottom = "32px";
  24210. spanMessage.style.color = "green";
  24211. document.body.appendChild(Gamepads.gamepadDOMInfo);
  24212. };
  24213. Gamepads.prototype._insertGamepadDOMNotSupported = function () {
  24214. Gamepads.gamepadDOMInfo = document.createElement("div");
  24215. var spanMessage = document.createElement("span");
  24216. spanMessage.innerHTML = "<strong>gamepad not supported</strong>";
  24217. Gamepads.gamepadDOMInfo.appendChild(spanMessage);
  24218. Gamepads.gamepadDOMInfo.style.position = "absolute";
  24219. Gamepads.gamepadDOMInfo.style.width = "100%";
  24220. Gamepads.gamepadDOMInfo.style.height = "40px";
  24221. Gamepads.gamepadDOMInfo.style.bottom = "0px";
  24222. Gamepads.gamepadDOMInfo.style.backgroundColor = "rgba(1, 1, 1, 0.15)";
  24223. Gamepads.gamepadDOMInfo.style.textAlign = "center";
  24224. Gamepads.gamepadDOMInfo.style.zIndex = "10";
  24225. spanMessage.style.position = "relative";
  24226. spanMessage.style.fontSize = "32px";
  24227. spanMessage.style.color = "red";
  24228. document.body.appendChild(Gamepads.gamepadDOMInfo);
  24229. };
  24230. Gamepads.prototype.dispose = function () {
  24231. document.body.removeChild(Gamepads.gamepadDOMInfo);
  24232. };
  24233. Gamepads.prototype._onGamepadConnected = function (evt) {
  24234. var newGamepad = this._addNewGamepad(evt.gamepad);
  24235. if (this._callbackGamepadConnected)
  24236. this._callbackGamepadConnected(newGamepad);
  24237. this._startMonitoringGamepads();
  24238. };
  24239. Gamepads.prototype._addNewGamepad = function (gamepad) {
  24240. if (!this.oneGamepadConnected) {
  24241. this.oneGamepadConnected = true;
  24242. if (Gamepads.gamepadDOMInfo) {
  24243. document.body.removeChild(Gamepads.gamepadDOMInfo);
  24244. Gamepads.gamepadDOMInfo = null;
  24245. }
  24246. }
  24247. var newGamepad;
  24248. if (gamepad.id.search("Xbox 360") !== -1 || gamepad.id.search("xinput") !== -1) {
  24249. newGamepad = new BABYLON.Xbox360Pad(gamepad.id, gamepad.index, gamepad);
  24250. }
  24251. else {
  24252. newGamepad = new BABYLON.GenericPad(gamepad.id, gamepad.index, gamepad);
  24253. }
  24254. this.babylonGamepads.push(newGamepad);
  24255. return newGamepad;
  24256. };
  24257. Gamepads.prototype._onGamepadDisconnected = function (evt) {
  24258. for (var i in this.babylonGamepads) {
  24259. if (this.babylonGamepads[i].index == evt.gamepad.index) {
  24260. this.babylonGamepads.splice(i, 1);
  24261. break;
  24262. }
  24263. }
  24264. // If no gamepads are left, stop the polling loop.
  24265. if (this.babylonGamepads.length == 0) {
  24266. this._stopMonitoringGamepads();
  24267. }
  24268. };
  24269. Gamepads.prototype._startMonitoringGamepads = function () {
  24270. if (!this.isMonitoring) {
  24271. this.isMonitoring = true;
  24272. this._checkGamepadsStatus();
  24273. }
  24274. };
  24275. Gamepads.prototype._stopMonitoringGamepads = function () {
  24276. this.isMonitoring = false;
  24277. };
  24278. Gamepads.prototype._checkGamepadsStatus = function () {
  24279. var _this = this;
  24280. // updating gamepad objects
  24281. this._updateGamepadObjects();
  24282. for (var i in this.babylonGamepads) {
  24283. this.babylonGamepads[i].update();
  24284. }
  24285. if (this.isMonitoring) {
  24286. if (window.requestAnimationFrame) {
  24287. window.requestAnimationFrame(function () {
  24288. _this._checkGamepadsStatus();
  24289. });
  24290. }
  24291. else if (window.mozRequestAnimationFrame) {
  24292. window.mozRequestAnimationFrame(function () {
  24293. _this._checkGamepadsStatus();
  24294. });
  24295. }
  24296. else if (window.webkitRequestAnimationFrame) {
  24297. window.webkitRequestAnimationFrame(function () {
  24298. _this._checkGamepadsStatus();
  24299. });
  24300. }
  24301. }
  24302. };
  24303. // This function is called only on Chrome, which does not yet support
  24304. // connection/disconnection events, but requires you to monitor
  24305. // an array for changes.
  24306. Gamepads.prototype._updateGamepadObjects = function () {
  24307. var gamepads = navigator.getGamepads ? navigator.getGamepads() : (navigator.webkitGetGamepads ? navigator.webkitGetGamepads() : []);
  24308. for (var i = 0; i < gamepads.length; i++) {
  24309. if (gamepads[i]) {
  24310. if (!(gamepads[i].index in this.babylonGamepads)) {
  24311. var newGamepad = this._addNewGamepad(gamepads[i]);
  24312. if (this._callbackGamepadConnected) {
  24313. this._callbackGamepadConnected(newGamepad);
  24314. }
  24315. }
  24316. else {
  24317. this.babylonGamepads[i].browserGamepad = gamepads[i];
  24318. }
  24319. }
  24320. }
  24321. };
  24322. return Gamepads;
  24323. })();
  24324. BABYLON.Gamepads = Gamepads;
  24325. var StickValues = (function () {
  24326. function StickValues(x, y) {
  24327. this.x = x;
  24328. this.y = y;
  24329. }
  24330. return StickValues;
  24331. })();
  24332. BABYLON.StickValues = StickValues;
  24333. var Gamepad = (function () {
  24334. function Gamepad(id, index, browserGamepad) {
  24335. this.id = id;
  24336. this.index = index;
  24337. this.browserGamepad = browserGamepad;
  24338. if (this.browserGamepad.axes.length >= 2) {
  24339. this._leftStick = { x: this.browserGamepad.axes[0], y: this.browserGamepad.axes[1] };
  24340. }
  24341. if (this.browserGamepad.axes.length >= 4) {
  24342. this._rightStick = { x: this.browserGamepad.axes[2], y: this.browserGamepad.axes[3] };
  24343. }
  24344. }
  24345. Gamepad.prototype.onleftstickchanged = function (callback) {
  24346. this._onleftstickchanged = callback;
  24347. };
  24348. Gamepad.prototype.onrightstickchanged = function (callback) {
  24349. this._onrightstickchanged = callback;
  24350. };
  24351. Object.defineProperty(Gamepad.prototype, "leftStick", {
  24352. get: function () {
  24353. return this._leftStick;
  24354. },
  24355. set: function (newValues) {
  24356. if (this._onleftstickchanged && (this._leftStick.x !== newValues.x || this._leftStick.y !== newValues.y)) {
  24357. this._onleftstickchanged(newValues);
  24358. }
  24359. this._leftStick = newValues;
  24360. },
  24361. enumerable: true,
  24362. configurable: true
  24363. });
  24364. Object.defineProperty(Gamepad.prototype, "rightStick", {
  24365. get: function () {
  24366. return this._rightStick;
  24367. },
  24368. set: function (newValues) {
  24369. if (this._onrightstickchanged && (this._rightStick.x !== newValues.x || this._rightStick.y !== newValues.y)) {
  24370. this._onrightstickchanged(newValues);
  24371. }
  24372. this._rightStick = newValues;
  24373. },
  24374. enumerable: true,
  24375. configurable: true
  24376. });
  24377. Gamepad.prototype.update = function () {
  24378. if (this._leftStick) {
  24379. this.leftStick = { x: this.browserGamepad.axes[0], y: this.browserGamepad.axes[1] };
  24380. }
  24381. if (this._rightStick) {
  24382. this.rightStick = { x: this.browserGamepad.axes[2], y: this.browserGamepad.axes[3] };
  24383. }
  24384. };
  24385. return Gamepad;
  24386. })();
  24387. BABYLON.Gamepad = Gamepad;
  24388. var GenericPad = (function (_super) {
  24389. __extends(GenericPad, _super);
  24390. function GenericPad(id, index, gamepad) {
  24391. _super.call(this, id, index, gamepad);
  24392. this.id = id;
  24393. this.index = index;
  24394. this.gamepad = gamepad;
  24395. this._buttons = new Array(gamepad.buttons.length);
  24396. }
  24397. GenericPad.prototype.onbuttondown = function (callback) {
  24398. this._onbuttondown = callback;
  24399. };
  24400. GenericPad.prototype.onbuttonup = function (callback) {
  24401. this._onbuttonup = callback;
  24402. };
  24403. GenericPad.prototype._setButtonValue = function (newValue, currentValue, buttonIndex) {
  24404. if (newValue !== currentValue) {
  24405. if (this._onbuttondown && newValue === 1) {
  24406. this._onbuttondown(buttonIndex);
  24407. }
  24408. if (this._onbuttonup && newValue === 0) {
  24409. this._onbuttonup(buttonIndex);
  24410. }
  24411. }
  24412. return newValue;
  24413. };
  24414. GenericPad.prototype.update = function () {
  24415. _super.prototype.update.call(this);
  24416. for (var index = 0; index < this._buttons.length; index++) {
  24417. this._buttons[index] = this._setButtonValue(this.gamepad.buttons[index].value, this._buttons[index], index);
  24418. }
  24419. };
  24420. return GenericPad;
  24421. })(Gamepad);
  24422. BABYLON.GenericPad = GenericPad;
  24423. (function (Xbox360Button) {
  24424. Xbox360Button[Xbox360Button["A"] = 0] = "A";
  24425. Xbox360Button[Xbox360Button["B"] = 1] = "B";
  24426. Xbox360Button[Xbox360Button["X"] = 2] = "X";
  24427. Xbox360Button[Xbox360Button["Y"] = 3] = "Y";
  24428. Xbox360Button[Xbox360Button["Start"] = 4] = "Start";
  24429. Xbox360Button[Xbox360Button["Back"] = 5] = "Back";
  24430. Xbox360Button[Xbox360Button["LB"] = 6] = "LB";
  24431. Xbox360Button[Xbox360Button["RB"] = 7] = "RB";
  24432. Xbox360Button[Xbox360Button["LeftStick"] = 8] = "LeftStick";
  24433. Xbox360Button[Xbox360Button["RightStick"] = 9] = "RightStick";
  24434. })(BABYLON.Xbox360Button || (BABYLON.Xbox360Button = {}));
  24435. var Xbox360Button = BABYLON.Xbox360Button;
  24436. (function (Xbox360Dpad) {
  24437. Xbox360Dpad[Xbox360Dpad["Up"] = 0] = "Up";
  24438. Xbox360Dpad[Xbox360Dpad["Down"] = 1] = "Down";
  24439. Xbox360Dpad[Xbox360Dpad["Left"] = 2] = "Left";
  24440. Xbox360Dpad[Xbox360Dpad["Right"] = 3] = "Right";
  24441. })(BABYLON.Xbox360Dpad || (BABYLON.Xbox360Dpad = {}));
  24442. var Xbox360Dpad = BABYLON.Xbox360Dpad;
  24443. var Xbox360Pad = (function (_super) {
  24444. __extends(Xbox360Pad, _super);
  24445. function Xbox360Pad() {
  24446. _super.apply(this, arguments);
  24447. this._leftTrigger = 0;
  24448. this._rightTrigger = 0;
  24449. this._buttonA = 0;
  24450. this._buttonB = 0;
  24451. this._buttonX = 0;
  24452. this._buttonY = 0;
  24453. this._buttonBack = 0;
  24454. this._buttonStart = 0;
  24455. this._buttonLB = 0;
  24456. this._buttonRB = 0;
  24457. this._buttonLeftStick = 0;
  24458. this._buttonRightStick = 0;
  24459. this._dPadUp = 0;
  24460. this._dPadDown = 0;
  24461. this._dPadLeft = 0;
  24462. this._dPadRight = 0;
  24463. }
  24464. Xbox360Pad.prototype.onlefttriggerchanged = function (callback) {
  24465. this._onlefttriggerchanged = callback;
  24466. };
  24467. Xbox360Pad.prototype.onrighttriggerchanged = function (callback) {
  24468. this._onrighttriggerchanged = callback;
  24469. };
  24470. Object.defineProperty(Xbox360Pad.prototype, "leftTrigger", {
  24471. get: function () {
  24472. return this._leftTrigger;
  24473. },
  24474. set: function (newValue) {
  24475. if (this._onlefttriggerchanged && this._leftTrigger !== newValue) {
  24476. this._onlefttriggerchanged(newValue);
  24477. }
  24478. this._leftTrigger = newValue;
  24479. },
  24480. enumerable: true,
  24481. configurable: true
  24482. });
  24483. Object.defineProperty(Xbox360Pad.prototype, "rightTrigger", {
  24484. get: function () {
  24485. return this._rightTrigger;
  24486. },
  24487. set: function (newValue) {
  24488. if (this._onrighttriggerchanged && this._rightTrigger !== newValue) {
  24489. this._onrighttriggerchanged(newValue);
  24490. }
  24491. this._rightTrigger = newValue;
  24492. },
  24493. enumerable: true,
  24494. configurable: true
  24495. });
  24496. Xbox360Pad.prototype.onbuttondown = function (callback) {
  24497. this._onbuttondown = callback;
  24498. };
  24499. Xbox360Pad.prototype.onbuttonup = function (callback) {
  24500. this._onbuttonup = callback;
  24501. };
  24502. Xbox360Pad.prototype.ondpaddown = function (callback) {
  24503. this._ondpaddown = callback;
  24504. };
  24505. Xbox360Pad.prototype.ondpadup = function (callback) {
  24506. this._ondpadup = callback;
  24507. };
  24508. Xbox360Pad.prototype._setButtonValue = function (newValue, currentValue, buttonType) {
  24509. if (newValue !== currentValue) {
  24510. if (this._onbuttondown && newValue === 1) {
  24511. this._onbuttondown(buttonType);
  24512. }
  24513. if (this._onbuttonup && newValue === 0) {
  24514. this._onbuttonup(buttonType);
  24515. }
  24516. }
  24517. return newValue;
  24518. };
  24519. Xbox360Pad.prototype._setDPadValue = function (newValue, currentValue, buttonType) {
  24520. if (newValue !== currentValue) {
  24521. if (this._ondpaddown && newValue === 1) {
  24522. this._ondpaddown(buttonType);
  24523. }
  24524. if (this._ondpadup && newValue === 0) {
  24525. this._ondpadup(buttonType);
  24526. }
  24527. }
  24528. return newValue;
  24529. };
  24530. Object.defineProperty(Xbox360Pad.prototype, "buttonA", {
  24531. get: function () {
  24532. return this._buttonA;
  24533. },
  24534. set: function (value) {
  24535. this._buttonA = this._setButtonValue(value, this._buttonA, 0 /* A */);
  24536. },
  24537. enumerable: true,
  24538. configurable: true
  24539. });
  24540. Object.defineProperty(Xbox360Pad.prototype, "buttonB", {
  24541. get: function () {
  24542. return this._buttonB;
  24543. },
  24544. set: function (value) {
  24545. this._buttonB = this._setButtonValue(value, this._buttonB, 1 /* B */);
  24546. },
  24547. enumerable: true,
  24548. configurable: true
  24549. });
  24550. Object.defineProperty(Xbox360Pad.prototype, "buttonX", {
  24551. get: function () {
  24552. return this._buttonX;
  24553. },
  24554. set: function (value) {
  24555. this._buttonX = this._setButtonValue(value, this._buttonX, 2 /* X */);
  24556. },
  24557. enumerable: true,
  24558. configurable: true
  24559. });
  24560. Object.defineProperty(Xbox360Pad.prototype, "buttonY", {
  24561. get: function () {
  24562. return this._buttonY;
  24563. },
  24564. set: function (value) {
  24565. this._buttonY = this._setButtonValue(value, this._buttonY, 3 /* Y */);
  24566. },
  24567. enumerable: true,
  24568. configurable: true
  24569. });
  24570. Object.defineProperty(Xbox360Pad.prototype, "buttonStart", {
  24571. get: function () {
  24572. return this._buttonStart;
  24573. },
  24574. set: function (value) {
  24575. this._buttonStart = this._setButtonValue(value, this._buttonStart, 4 /* Start */);
  24576. },
  24577. enumerable: true,
  24578. configurable: true
  24579. });
  24580. Object.defineProperty(Xbox360Pad.prototype, "buttonBack", {
  24581. get: function () {
  24582. return this._buttonBack;
  24583. },
  24584. set: function (value) {
  24585. this._buttonBack = this._setButtonValue(value, this._buttonBack, 5 /* Back */);
  24586. },
  24587. enumerable: true,
  24588. configurable: true
  24589. });
  24590. Object.defineProperty(Xbox360Pad.prototype, "buttonLB", {
  24591. get: function () {
  24592. return this._buttonLB;
  24593. },
  24594. set: function (value) {
  24595. this._buttonLB = this._setButtonValue(value, this._buttonLB, 6 /* LB */);
  24596. },
  24597. enumerable: true,
  24598. configurable: true
  24599. });
  24600. Object.defineProperty(Xbox360Pad.prototype, "buttonRB", {
  24601. get: function () {
  24602. return this._buttonRB;
  24603. },
  24604. set: function (value) {
  24605. this._buttonRB = this._setButtonValue(value, this._buttonRB, 7 /* RB */);
  24606. },
  24607. enumerable: true,
  24608. configurable: true
  24609. });
  24610. Object.defineProperty(Xbox360Pad.prototype, "buttonLeftStick", {
  24611. get: function () {
  24612. return this._buttonLeftStick;
  24613. },
  24614. set: function (value) {
  24615. this._buttonLeftStick = this._setButtonValue(value, this._buttonLeftStick, 8 /* LeftStick */);
  24616. },
  24617. enumerable: true,
  24618. configurable: true
  24619. });
  24620. Object.defineProperty(Xbox360Pad.prototype, "buttonRightStick", {
  24621. get: function () {
  24622. return this._buttonRightStick;
  24623. },
  24624. set: function (value) {
  24625. this._buttonRightStick = this._setButtonValue(value, this._buttonRightStick, 9 /* RightStick */);
  24626. },
  24627. enumerable: true,
  24628. configurable: true
  24629. });
  24630. Object.defineProperty(Xbox360Pad.prototype, "dPadUp", {
  24631. get: function () {
  24632. return this._dPadUp;
  24633. },
  24634. set: function (value) {
  24635. this._dPadUp = this._setDPadValue(value, this._dPadUp, 0 /* Up */);
  24636. },
  24637. enumerable: true,
  24638. configurable: true
  24639. });
  24640. Object.defineProperty(Xbox360Pad.prototype, "dPadDown", {
  24641. get: function () {
  24642. return this._dPadDown;
  24643. },
  24644. set: function (value) {
  24645. this._dPadDown = this._setDPadValue(value, this._dPadDown, 1 /* Down */);
  24646. },
  24647. enumerable: true,
  24648. configurable: true
  24649. });
  24650. Object.defineProperty(Xbox360Pad.prototype, "dPadLeft", {
  24651. get: function () {
  24652. return this._dPadLeft;
  24653. },
  24654. set: function (value) {
  24655. this._dPadLeft = this._setDPadValue(value, this._dPadLeft, 2 /* Left */);
  24656. },
  24657. enumerable: true,
  24658. configurable: true
  24659. });
  24660. Object.defineProperty(Xbox360Pad.prototype, "dPadRight", {
  24661. get: function () {
  24662. return this._dPadRight;
  24663. },
  24664. set: function (value) {
  24665. this._dPadRight = this._setDPadValue(value, this._dPadRight, 3 /* Right */);
  24666. },
  24667. enumerable: true,
  24668. configurable: true
  24669. });
  24670. Xbox360Pad.prototype.update = function () {
  24671. _super.prototype.update.call(this);
  24672. this.buttonA = this.browserGamepad.buttons[0].value;
  24673. this.buttonB = this.browserGamepad.buttons[1].value;
  24674. this.buttonX = this.browserGamepad.buttons[2].value;
  24675. this.buttonY = this.browserGamepad.buttons[3].value;
  24676. this.buttonLB = this.browserGamepad.buttons[4].value;
  24677. this.buttonRB = this.browserGamepad.buttons[5].value;
  24678. this.leftTrigger = this.browserGamepad.buttons[6].value;
  24679. this.rightTrigger = this.browserGamepad.buttons[7].value;
  24680. this.buttonBack = this.browserGamepad.buttons[8].value;
  24681. this.buttonStart = this.browserGamepad.buttons[9].value;
  24682. this.buttonLeftStick = this.browserGamepad.buttons[10].value;
  24683. this.buttonRightStick = this.browserGamepad.buttons[11].value;
  24684. this.dPadUp = this.browserGamepad.buttons[12].value;
  24685. this.dPadDown = this.browserGamepad.buttons[13].value;
  24686. this.dPadLeft = this.browserGamepad.buttons[14].value;
  24687. this.dPadRight = this.browserGamepad.buttons[15].value;
  24688. };
  24689. return Xbox360Pad;
  24690. })(Gamepad);
  24691. BABYLON.Xbox360Pad = Xbox360Pad;
  24692. })(BABYLON || (BABYLON = {}));
  24693. //# sourceMappingURL=babylon.gamepads.js.map
  24694. var BABYLON;
  24695. (function (BABYLON) {
  24696. // We're mainly based on the logic defined into the FreeCamera code
  24697. var GamepadCamera = (function (_super) {
  24698. __extends(GamepadCamera, _super);
  24699. function GamepadCamera(name, position, scene) {
  24700. var _this = this;
  24701. _super.call(this, name, position, scene);
  24702. this.angularSensibility = 200;
  24703. this.moveSensibility = 75;
  24704. this._gamepads = new BABYLON.Gamepads(function (gamepad) {
  24705. _this._onNewGameConnected(gamepad);
  24706. });
  24707. }
  24708. GamepadCamera.prototype._onNewGameConnected = function (gamepad) {
  24709. // Only the first gamepad can control the camera
  24710. if (gamepad.index === 0) {
  24711. this._gamepad = gamepad;
  24712. }
  24713. };
  24714. GamepadCamera.prototype._checkInputs = function () {
  24715. if (!this._gamepad) {
  24716. return;
  24717. }
  24718. var LSValues = this._gamepad.leftStick;
  24719. var normalizedLX = LSValues.x / this.moveSensibility;
  24720. var normalizedLY = LSValues.y / this.moveSensibility;
  24721. LSValues.x = Math.abs(normalizedLX) > 0.005 ? 0 + normalizedLX : 0;
  24722. LSValues.y = Math.abs(normalizedLY) > 0.005 ? 0 + normalizedLY : 0;
  24723. var RSValues = this._gamepad.rightStick;
  24724. var normalizedRX = RSValues.x / this.angularSensibility;
  24725. var normalizedRY = RSValues.y / this.angularSensibility;
  24726. RSValues.x = Math.abs(normalizedRX) > 0.001 ? 0 + normalizedRX : 0;
  24727. RSValues.y = Math.abs(normalizedRY) > 0.001 ? 0 + normalizedRY : 0;
  24728. ;
  24729. var cameraTransform = BABYLON.Matrix.RotationYawPitchRoll(this.rotation.y, this.rotation.x, 0);
  24730. var deltaTransform = BABYLON.Vector3.TransformCoordinates(new BABYLON.Vector3(LSValues.x, 0, -LSValues.y), cameraTransform);
  24731. this.cameraDirection = this.cameraDirection.add(deltaTransform);
  24732. this.cameraRotation = this.cameraRotation.add(new BABYLON.Vector2(RSValues.y, RSValues.x));
  24733. };
  24734. GamepadCamera.prototype.dispose = function () {
  24735. this._gamepads.dispose();
  24736. _super.prototype.dispose.call(this);
  24737. };
  24738. return GamepadCamera;
  24739. })(BABYLON.FreeCamera);
  24740. BABYLON.GamepadCamera = GamepadCamera;
  24741. })(BABYLON || (BABYLON = {}));
  24742. //# sourceMappingURL=babylon.gamepadCamera.js.map
  24743. var BABYLON;
  24744. (function (BABYLON) {
  24745. var LinesMesh = (function (_super) {
  24746. __extends(LinesMesh, _super);
  24747. function LinesMesh(name, scene, updatable) {
  24748. if (updatable === void 0) { updatable = false; }
  24749. _super.call(this, name, scene);
  24750. this.color = new BABYLON.Color3(1, 1, 1);
  24751. this.alpha = 1;
  24752. this._indices = new Array();
  24753. this._colorShader = new BABYLON.ShaderMaterial("colorShader", scene, "color", {
  24754. attributes: ["position"],
  24755. uniforms: ["worldViewProjection", "color"],
  24756. needAlphaBlending: true
  24757. });
  24758. }
  24759. Object.defineProperty(LinesMesh.prototype, "material", {
  24760. get: function () {
  24761. return this._colorShader;
  24762. },
  24763. enumerable: true,
  24764. configurable: true
  24765. });
  24766. Object.defineProperty(LinesMesh.prototype, "isPickable", {
  24767. get: function () {
  24768. return false;
  24769. },
  24770. enumerable: true,
  24771. configurable: true
  24772. });
  24773. Object.defineProperty(LinesMesh.prototype, "checkCollisions", {
  24774. get: function () {
  24775. return false;
  24776. },
  24777. enumerable: true,
  24778. configurable: true
  24779. });
  24780. LinesMesh.prototype._bind = function (subMesh, effect, fillMode) {
  24781. var engine = this.getScene().getEngine();
  24782. var indexToBind = this._geometry.getIndexBuffer();
  24783. // VBOs
  24784. engine.bindBuffers(this._geometry.getVertexBuffer(BABYLON.VertexBuffer.PositionKind).getBuffer(), indexToBind, [3], 3 * 4, this._colorShader.getEffect());
  24785. // Color
  24786. this._colorShader.setColor4("color", this.color.toColor4(this.alpha));
  24787. };
  24788. LinesMesh.prototype._draw = function (subMesh, fillMode, instancesCount) {
  24789. if (!this._geometry || !this._geometry.getVertexBuffers() || !this._geometry.getIndexBuffer()) {
  24790. return;
  24791. }
  24792. var engine = this.getScene().getEngine();
  24793. // Draw order
  24794. engine.draw(false, subMesh.indexStart, subMesh.indexCount);
  24795. };
  24796. LinesMesh.prototype.intersects = function (ray, fastCheck) {
  24797. return null;
  24798. };
  24799. LinesMesh.prototype.dispose = function (doNotRecurse) {
  24800. this._colorShader.dispose();
  24801. _super.prototype.dispose.call(this, doNotRecurse);
  24802. };
  24803. return LinesMesh;
  24804. })(BABYLON.Mesh);
  24805. BABYLON.LinesMesh = LinesMesh;
  24806. })(BABYLON || (BABYLON = {}));
  24807. //# sourceMappingURL=babylon.linesMesh.js.mapvar BABYLON;
  24808. (function (BABYLON) {
  24809. var OutlineRenderer = (function () {
  24810. function OutlineRenderer(scene) {
  24811. this._scene = scene;
  24812. }
  24813. OutlineRenderer.prototype.render = function (subMesh, batch, useOverlay) {
  24814. var _this = this;
  24815. if (useOverlay === void 0) { useOverlay = false; }
  24816. var scene = this._scene;
  24817. var engine = this._scene.getEngine();
  24818. var hardwareInstancedRendering = (engine.getCaps().instancedArrays !== null) && (batch.visibleInstances[subMesh._id] !== null) && (batch.visibleInstances[subMesh._id] !== undefined);
  24819. if (!this.isReady(subMesh, hardwareInstancedRendering)) {
  24820. return;
  24821. }
  24822. var mesh = subMesh.getRenderingMesh();
  24823. var material = subMesh.getMaterial();
  24824. engine.enableEffect(this._effect);
  24825. this._effect.setFloat("offset", useOverlay ? 0 : mesh.outlineWidth);
  24826. this._effect.setColor4("color", useOverlay ? mesh.overlayColor : mesh.outlineColor, useOverlay ? mesh.overlayAlpha : 1.0);
  24827. this._effect.setMatrix("viewProjection", scene.getTransformMatrix());
  24828. // Bones
  24829. if (mesh.useBones) {
  24830. this._effect.setMatrices("mBones", mesh.skeleton.getTransformMatrices());
  24831. }
  24832. mesh._bind(subMesh, this._effect, BABYLON.Material.TriangleFillMode);
  24833. // Alpha test
  24834. if (material && material.needAlphaTesting()) {
  24835. var alphaTexture = material.getAlphaTestTexture();
  24836. this._effect.setTexture("diffuseSampler", alphaTexture);
  24837. this._effect.setMatrix("diffuseMatrix", alphaTexture.getTextureMatrix());
  24838. }
  24839. mesh._processRendering(subMesh, this._effect, BABYLON.Material.TriangleFillMode, batch, hardwareInstancedRendering, function (isInstance, world) {
  24840. _this._effect.setMatrix("world", world);
  24841. });
  24842. };
  24843. OutlineRenderer.prototype.isReady = function (subMesh, useInstances) {
  24844. var defines = [];
  24845. var attribs = [BABYLON.VertexBuffer.PositionKind, BABYLON.VertexBuffer.NormalKind];
  24846. var mesh = subMesh.getMesh();
  24847. var material = subMesh.getMaterial();
  24848. // Alpha test
  24849. if (material && material.needAlphaTesting()) {
  24850. defines.push("#define ALPHATEST");
  24851. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  24852. attribs.push(BABYLON.VertexBuffer.UVKind);
  24853. defines.push("#define UV1");
  24854. }
  24855. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  24856. attribs.push(BABYLON.VertexBuffer.UV2Kind);
  24857. defines.push("#define UV2");
  24858. }
  24859. }
  24860. // Bones
  24861. if (mesh.useBones) {
  24862. attribs.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  24863. attribs.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  24864. defines.push("#define BONES");
  24865. defines.push("#define BonesPerMesh " + (mesh.skeleton.bones.length + 1));
  24866. }
  24867. // Instances
  24868. if (useInstances) {
  24869. defines.push("#define INSTANCES");
  24870. attribs.push("world0");
  24871. attribs.push("world1");
  24872. attribs.push("world2");
  24873. attribs.push("world3");
  24874. }
  24875. // Get correct effect
  24876. var join = defines.join("\n");
  24877. if (this._cachedDefines !== join) {
  24878. this._cachedDefines = join;
  24879. this._effect = this._scene.getEngine().createEffect("outline", attribs, ["world", "mBones", "viewProjection", "diffuseMatrix", "offset", "color"], ["diffuseSampler"], join);
  24880. }
  24881. return this._effect.isReady();
  24882. };
  24883. return OutlineRenderer;
  24884. })();
  24885. BABYLON.OutlineRenderer = OutlineRenderer;
  24886. })(BABYLON || (BABYLON = {}));
  24887. //# sourceMappingURL=babylon.outlineRenderer.js.mapvar BABYLON;
  24888. (function (BABYLON) {
  24889. var MeshAssetTask = (function () {
  24890. function MeshAssetTask(name, meshesNames, rootUrl, sceneFilename) {
  24891. this.name = name;
  24892. this.meshesNames = meshesNames;
  24893. this.rootUrl = rootUrl;
  24894. this.sceneFilename = sceneFilename;
  24895. this.isCompleted = false;
  24896. }
  24897. MeshAssetTask.prototype.run = function (scene, onSuccess, onError) {
  24898. var _this = this;
  24899. BABYLON.SceneLoader.ImportMesh(this.meshesNames, this.rootUrl, this.sceneFilename, scene, function (meshes, particleSystems, skeletons) {
  24900. _this.loadedMeshes = meshes;
  24901. _this.loadedParticleSystems = particleSystems;
  24902. _this.loadedSkeletons = skeletons;
  24903. _this.isCompleted = true;
  24904. if (_this.onSuccess) {
  24905. _this.onSuccess(_this);
  24906. }
  24907. onSuccess();
  24908. }, null, function () {
  24909. if (_this.onError) {
  24910. _this.onError(_this);
  24911. }
  24912. onError();
  24913. });
  24914. };
  24915. return MeshAssetTask;
  24916. })();
  24917. BABYLON.MeshAssetTask = MeshAssetTask;
  24918. var TextFileAssetTask = (function () {
  24919. function TextFileAssetTask(name, url) {
  24920. this.name = name;
  24921. this.url = url;
  24922. this.isCompleted = false;
  24923. }
  24924. TextFileAssetTask.prototype.run = function (scene, onSuccess, onError) {
  24925. var _this = this;
  24926. BABYLON.Tools.LoadFile(this.url, function (data) {
  24927. _this.text = data;
  24928. _this.isCompleted = true;
  24929. if (_this.onSuccess) {
  24930. _this.onSuccess(_this);
  24931. }
  24932. onSuccess();
  24933. }, null, scene.database, false, function () {
  24934. if (_this.onError) {
  24935. _this.onError(_this);
  24936. }
  24937. onError();
  24938. });
  24939. };
  24940. return TextFileAssetTask;
  24941. })();
  24942. BABYLON.TextFileAssetTask = TextFileAssetTask;
  24943. var BinaryFileAssetTask = (function () {
  24944. function BinaryFileAssetTask(name, url) {
  24945. this.name = name;
  24946. this.url = url;
  24947. this.isCompleted = false;
  24948. }
  24949. BinaryFileAssetTask.prototype.run = function (scene, onSuccess, onError) {
  24950. var _this = this;
  24951. BABYLON.Tools.LoadFile(this.url, function (data) {
  24952. _this.data = data;
  24953. _this.isCompleted = true;
  24954. if (_this.onSuccess) {
  24955. _this.onSuccess(_this);
  24956. }
  24957. onSuccess();
  24958. }, null, scene.database, true, function () {
  24959. if (_this.onError) {
  24960. _this.onError(_this);
  24961. }
  24962. onError();
  24963. });
  24964. };
  24965. return BinaryFileAssetTask;
  24966. })();
  24967. BABYLON.BinaryFileAssetTask = BinaryFileAssetTask;
  24968. var ImageAssetTask = (function () {
  24969. function ImageAssetTask(name, url) {
  24970. this.name = name;
  24971. this.url = url;
  24972. this.isCompleted = false;
  24973. }
  24974. ImageAssetTask.prototype.run = function (scene, onSuccess, onError) {
  24975. var _this = this;
  24976. var img = new Image();
  24977. img.onload = function () {
  24978. _this.image = img;
  24979. _this.isCompleted = true;
  24980. if (_this.onSuccess) {
  24981. _this.onSuccess(_this);
  24982. }
  24983. onSuccess();
  24984. };
  24985. img.onerror = function () {
  24986. if (_this.onError) {
  24987. _this.onError(_this);
  24988. }
  24989. onError();
  24990. };
  24991. img.src = this.url;
  24992. };
  24993. return ImageAssetTask;
  24994. })();
  24995. BABYLON.ImageAssetTask = ImageAssetTask;
  24996. var TextureAssetTask = (function () {
  24997. function TextureAssetTask(name, url, noMipmap, invertY, samplingMode) {
  24998. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  24999. this.name = name;
  25000. this.url = url;
  25001. this.noMipmap = noMipmap;
  25002. this.invertY = invertY;
  25003. this.samplingMode = samplingMode;
  25004. this.isCompleted = false;
  25005. }
  25006. TextureAssetTask.prototype.run = function (scene, onSuccess, onError) {
  25007. var _this = this;
  25008. var onload = function () {
  25009. _this.isCompleted = true;
  25010. if (_this.onSuccess) {
  25011. _this.onSuccess(_this);
  25012. }
  25013. onSuccess();
  25014. };
  25015. var onerror = function () {
  25016. if (_this.onError) {
  25017. _this.onError(_this);
  25018. }
  25019. onError();
  25020. };
  25021. this.texture = new BABYLON.Texture(this.url, scene, this.noMipmap, this.invertY, this.samplingMode, onload, onError);
  25022. };
  25023. return TextureAssetTask;
  25024. })();
  25025. BABYLON.TextureAssetTask = TextureAssetTask;
  25026. var AssetsManager = (function () {
  25027. function AssetsManager(scene) {
  25028. this._tasks = new Array();
  25029. this._waitingTasksCount = 0;
  25030. this.useDefaultLoadingScreen = true;
  25031. this._scene = scene;
  25032. }
  25033. AssetsManager.prototype.addMeshTask = function (taskName, meshesNames, rootUrl, sceneFilename) {
  25034. var task = new MeshAssetTask(taskName, meshesNames, rootUrl, sceneFilename);
  25035. this._tasks.push(task);
  25036. return task;
  25037. };
  25038. AssetsManager.prototype.addTextFileTask = function (taskName, url) {
  25039. var task = new TextFileAssetTask(taskName, url);
  25040. this._tasks.push(task);
  25041. return task;
  25042. };
  25043. AssetsManager.prototype.addBinaryFileTask = function (taskName, url) {
  25044. var task = new BinaryFileAssetTask(taskName, url);
  25045. this._tasks.push(task);
  25046. return task;
  25047. };
  25048. AssetsManager.prototype.addImageTask = function (taskName, url) {
  25049. var task = new ImageAssetTask(taskName, url);
  25050. this._tasks.push(task);
  25051. return task;
  25052. };
  25053. AssetsManager.prototype.addTextureTask = function (taskName, url, noMipmap, invertY, samplingMode) {
  25054. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  25055. var task = new TextureAssetTask(taskName, url, noMipmap, invertY, samplingMode);
  25056. this._tasks.push(task);
  25057. return task;
  25058. };
  25059. AssetsManager.prototype._decreaseWaitingTasksCount = function () {
  25060. this._waitingTasksCount--;
  25061. if (this._waitingTasksCount === 0) {
  25062. if (this.onFinish) {
  25063. this.onFinish(this._tasks);
  25064. }
  25065. this._scene.getEngine().hideLoadingUI();
  25066. }
  25067. };
  25068. AssetsManager.prototype._runTask = function (task) {
  25069. var _this = this;
  25070. task.run(this._scene, function () {
  25071. if (_this.onTaskSuccess) {
  25072. _this.onTaskSuccess(task);
  25073. }
  25074. _this._decreaseWaitingTasksCount();
  25075. }, function () {
  25076. if (_this.onTaskError) {
  25077. _this.onTaskError(task);
  25078. }
  25079. _this._decreaseWaitingTasksCount();
  25080. });
  25081. };
  25082. AssetsManager.prototype.reset = function () {
  25083. this._tasks = new Array();
  25084. return this;
  25085. };
  25086. AssetsManager.prototype.load = function () {
  25087. this._waitingTasksCount = this._tasks.length;
  25088. if (this._waitingTasksCount === 0) {
  25089. if (this.onFinish) {
  25090. this.onFinish(this._tasks);
  25091. }
  25092. return this;
  25093. }
  25094. if (this.useDefaultLoadingScreen) {
  25095. this._scene.getEngine().displayLoadingUI();
  25096. }
  25097. for (var index = 0; index < this._tasks.length; index++) {
  25098. var task = this._tasks[index];
  25099. this._runTask(task);
  25100. }
  25101. return this;
  25102. };
  25103. return AssetsManager;
  25104. })();
  25105. BABYLON.AssetsManager = AssetsManager;
  25106. })(BABYLON || (BABYLON = {}));
  25107. //# sourceMappingURL=babylon.assetsManager.js.map
  25108. var BABYLON;
  25109. (function (BABYLON) {
  25110. var VRDeviceOrientationCamera = (function (_super) {
  25111. __extends(VRDeviceOrientationCamera, _super);
  25112. function VRDeviceOrientationCamera(name, position, scene) {
  25113. _super.call(this, name, position, scene);
  25114. this._alpha = 0;
  25115. this._beta = 0;
  25116. this._gamma = 0;
  25117. }
  25118. VRDeviceOrientationCamera.prototype._onOrientationEvent = function (evt) {
  25119. this._alpha = +evt.alpha | 0;
  25120. this._beta = +evt.beta | 0;
  25121. this._gamma = +evt.gamma | 0;
  25122. if (this._gamma < 0) {
  25123. this._gamma = 90 + this._gamma;
  25124. }
  25125. else {
  25126. // Incline it in the correct angle.
  25127. this._gamma = 270 - this._gamma;
  25128. }
  25129. this.rotation.x = this._gamma / 180.0 * Math.PI;
  25130. this.rotation.y = -this._alpha / 180.0 * Math.PI;
  25131. this.rotation.z = this._beta / 180.0 * Math.PI;
  25132. };
  25133. return VRDeviceOrientationCamera;
  25134. })(BABYLON.OculusCamera);
  25135. BABYLON.VRDeviceOrientationCamera = VRDeviceOrientationCamera;
  25136. })(BABYLON || (BABYLON = {}));
  25137. //# sourceMappingURL=babylon.vrDeviceOrientationCamera.js.map
  25138. var BABYLON;
  25139. (function (BABYLON) {
  25140. var WebVRCamera = (function (_super) {
  25141. __extends(WebVRCamera, _super);
  25142. function WebVRCamera(name, position, scene) {
  25143. _super.call(this, name, position, scene);
  25144. this._hmdDevice = null;
  25145. this._sensorDevice = null;
  25146. this._cacheState = null;
  25147. this._cacheQuaternion = new BABYLON.Quaternion();
  25148. this._cacheRotation = BABYLON.Vector3.Zero();
  25149. this._vrEnabled = false;
  25150. this._getWebVRDevices = this._getWebVRDevices.bind(this);
  25151. }
  25152. WebVRCamera.prototype._getWebVRDevices = function (devices) {
  25153. var size = devices.length;
  25154. var i = 0;
  25155. // Reset devices.
  25156. this._sensorDevice = null;
  25157. this._hmdDevice = null;
  25158. while (i < size && this._hmdDevice === null) {
  25159. if (devices[i] instanceof HMDVRDevice) {
  25160. this._hmdDevice = devices[i];
  25161. }
  25162. i++;
  25163. }
  25164. i = 0;
  25165. while (i < size && this._sensorDevice === null) {
  25166. if (devices[i] instanceof PositionSensorVRDevice && (!this._hmdDevice || devices[i].hardwareUnitId === this._hmdDevice.hardwareUnitId)) {
  25167. this._sensorDevice = devices[i];
  25168. }
  25169. i++;
  25170. }
  25171. this._vrEnabled = this._sensorDevice && this._hmdDevice ? true : false;
  25172. };
  25173. WebVRCamera.prototype._update = function () {
  25174. if (this._vrEnabled) {
  25175. this._cacheState = this._sensorDevice.getState();
  25176. this._cacheQuaternion.copyFromFloats(this._cacheState.orientation.x, this._cacheState.orientation.y, this._cacheState.orientation.z, this._cacheState.orientation.w);
  25177. this._cacheQuaternion.toEulerAnglesToRef(this._cacheRotation);
  25178. this.rotation.x = -this._cacheRotation.z;
  25179. this.rotation.y = -this._cacheRotation.y;
  25180. this.rotation.z = this._cacheRotation.x;
  25181. }
  25182. _super.prototype._update.call(this);
  25183. };
  25184. WebVRCamera.prototype.attachControl = function (element, noPreventDefault) {
  25185. _super.prototype.attachControl.call(this, element, noPreventDefault);
  25186. if (navigator.getVRDevices) {
  25187. navigator.getVRDevices().then(this._getWebVRDevices);
  25188. }
  25189. else if (navigator.mozGetVRDevices) {
  25190. navigator.mozGetVRDevices(this._getWebVRDevices);
  25191. }
  25192. };
  25193. WebVRCamera.prototype.detachControl = function (element) {
  25194. _super.prototype.detachControl.call(this, element);
  25195. this._vrEnabled = false;
  25196. };
  25197. return WebVRCamera;
  25198. })(BABYLON.OculusCamera);
  25199. BABYLON.WebVRCamera = WebVRCamera;
  25200. })(BABYLON || (BABYLON = {}));
  25201. //# sourceMappingURL=babylon.webVRCamera.js.map
  25202. var BABYLON;
  25203. (function (BABYLON) {
  25204. // Standard optimizations
  25205. var SceneOptimization = (function () {
  25206. function SceneOptimization(priority) {
  25207. if (priority === void 0) { priority = 0; }
  25208. this.priority = priority;
  25209. this.apply = function (scene) {
  25210. return true; // Return true if everything that can be done was applied
  25211. };
  25212. }
  25213. return SceneOptimization;
  25214. })();
  25215. BABYLON.SceneOptimization = SceneOptimization;
  25216. var TextureOptimization = (function (_super) {
  25217. __extends(TextureOptimization, _super);
  25218. function TextureOptimization(priority, maximumSize) {
  25219. var _this = this;
  25220. if (priority === void 0) { priority = 0; }
  25221. if (maximumSize === void 0) { maximumSize = 1024; }
  25222. _super.call(this, priority);
  25223. this.priority = priority;
  25224. this.maximumSize = maximumSize;
  25225. this.apply = function (scene) {
  25226. var allDone = true;
  25227. for (var index = 0; index < scene.textures.length; index++) {
  25228. var texture = scene.textures[index];
  25229. if (!texture.canRescale) {
  25230. continue;
  25231. }
  25232. var currentSize = texture.getSize();
  25233. var maxDimension = Math.max(currentSize.width, currentSize.height);
  25234. if (maxDimension > _this.maximumSize) {
  25235. texture.scale(0.5);
  25236. allDone = false;
  25237. }
  25238. }
  25239. return allDone;
  25240. };
  25241. }
  25242. return TextureOptimization;
  25243. })(SceneOptimization);
  25244. BABYLON.TextureOptimization = TextureOptimization;
  25245. var HardwareScalingOptimization = (function (_super) {
  25246. __extends(HardwareScalingOptimization, _super);
  25247. function HardwareScalingOptimization(priority, maximumScale) {
  25248. var _this = this;
  25249. if (priority === void 0) { priority = 0; }
  25250. if (maximumScale === void 0) { maximumScale = 2; }
  25251. _super.call(this, priority);
  25252. this.priority = priority;
  25253. this.maximumScale = maximumScale;
  25254. this._currentScale = 1;
  25255. this.apply = function (scene) {
  25256. _this._currentScale++;
  25257. scene.getEngine().setHardwareScalingLevel(_this._currentScale);
  25258. return _this._currentScale >= _this.maximumScale;
  25259. };
  25260. }
  25261. return HardwareScalingOptimization;
  25262. })(SceneOptimization);
  25263. BABYLON.HardwareScalingOptimization = HardwareScalingOptimization;
  25264. var ShadowsOptimization = (function (_super) {
  25265. __extends(ShadowsOptimization, _super);
  25266. function ShadowsOptimization() {
  25267. _super.apply(this, arguments);
  25268. this.apply = function (scene) {
  25269. scene.shadowsEnabled = false;
  25270. return true;
  25271. };
  25272. }
  25273. return ShadowsOptimization;
  25274. })(SceneOptimization);
  25275. BABYLON.ShadowsOptimization = ShadowsOptimization;
  25276. var PostProcessesOptimization = (function (_super) {
  25277. __extends(PostProcessesOptimization, _super);
  25278. function PostProcessesOptimization() {
  25279. _super.apply(this, arguments);
  25280. this.apply = function (scene) {
  25281. scene.postProcessesEnabled = false;
  25282. return true;
  25283. };
  25284. }
  25285. return PostProcessesOptimization;
  25286. })(SceneOptimization);
  25287. BABYLON.PostProcessesOptimization = PostProcessesOptimization;
  25288. var LensFlaresOptimization = (function (_super) {
  25289. __extends(LensFlaresOptimization, _super);
  25290. function LensFlaresOptimization() {
  25291. _super.apply(this, arguments);
  25292. this.apply = function (scene) {
  25293. scene.lensFlaresEnabled = false;
  25294. return true;
  25295. };
  25296. }
  25297. return LensFlaresOptimization;
  25298. })(SceneOptimization);
  25299. BABYLON.LensFlaresOptimization = LensFlaresOptimization;
  25300. var ParticlesOptimization = (function (_super) {
  25301. __extends(ParticlesOptimization, _super);
  25302. function ParticlesOptimization() {
  25303. _super.apply(this, arguments);
  25304. this.apply = function (scene) {
  25305. scene.particlesEnabled = false;
  25306. return true;
  25307. };
  25308. }
  25309. return ParticlesOptimization;
  25310. })(SceneOptimization);
  25311. BABYLON.ParticlesOptimization = ParticlesOptimization;
  25312. var RenderTargetsOptimization = (function (_super) {
  25313. __extends(RenderTargetsOptimization, _super);
  25314. function RenderTargetsOptimization() {
  25315. _super.apply(this, arguments);
  25316. this.apply = function (scene) {
  25317. scene.renderTargetsEnabled = false;
  25318. return true;
  25319. };
  25320. }
  25321. return RenderTargetsOptimization;
  25322. })(SceneOptimization);
  25323. BABYLON.RenderTargetsOptimization = RenderTargetsOptimization;
  25324. var MergeMeshesOptimization = (function (_super) {
  25325. __extends(MergeMeshesOptimization, _super);
  25326. function MergeMeshesOptimization() {
  25327. var _this = this;
  25328. _super.apply(this, arguments);
  25329. this._canBeMerged = function (abstractMesh) {
  25330. if (!(abstractMesh instanceof BABYLON.Mesh)) {
  25331. return false;
  25332. }
  25333. var mesh = abstractMesh;
  25334. if (!mesh.isVisible || !mesh.isEnabled()) {
  25335. return false;
  25336. }
  25337. if (mesh.instances.length > 0) {
  25338. return false;
  25339. }
  25340. if (mesh.skeleton || mesh.hasLODLevels) {
  25341. return false;
  25342. }
  25343. return true;
  25344. };
  25345. this.apply = function (scene) {
  25346. var globalPool = scene.meshes.slice(0);
  25347. var globalLength = globalPool.length;
  25348. for (var index = 0; index < globalLength; index++) {
  25349. var currentPool = new Array();
  25350. var current = globalPool[index];
  25351. // Checks
  25352. if (!_this._canBeMerged(current)) {
  25353. continue;
  25354. }
  25355. currentPool.push(current);
  25356. for (var subIndex = index + 1; subIndex < globalLength; subIndex++) {
  25357. var otherMesh = globalPool[subIndex];
  25358. if (!_this._canBeMerged(otherMesh)) {
  25359. continue;
  25360. }
  25361. if (otherMesh.material !== current.material) {
  25362. continue;
  25363. }
  25364. if (otherMesh.checkCollisions !== current.checkCollisions) {
  25365. continue;
  25366. }
  25367. currentPool.push(otherMesh);
  25368. globalLength--;
  25369. globalPool.splice(subIndex, 1);
  25370. subIndex--;
  25371. }
  25372. if (currentPool.length < 2) {
  25373. continue;
  25374. }
  25375. // Merge meshes
  25376. BABYLON.Mesh.MergeMeshes(currentPool);
  25377. }
  25378. return true;
  25379. };
  25380. }
  25381. return MergeMeshesOptimization;
  25382. })(SceneOptimization);
  25383. BABYLON.MergeMeshesOptimization = MergeMeshesOptimization;
  25384. // Options
  25385. var SceneOptimizerOptions = (function () {
  25386. function SceneOptimizerOptions(targetFrameRate, trackerDuration) {
  25387. if (targetFrameRate === void 0) { targetFrameRate = 60; }
  25388. if (trackerDuration === void 0) { trackerDuration = 2000; }
  25389. this.targetFrameRate = targetFrameRate;
  25390. this.trackerDuration = trackerDuration;
  25391. this.optimizations = new Array();
  25392. }
  25393. SceneOptimizerOptions.LowDegradationAllowed = function (targetFrameRate) {
  25394. var result = new SceneOptimizerOptions(targetFrameRate);
  25395. var priority = 0;
  25396. result.optimizations.push(new MergeMeshesOptimization(priority));
  25397. result.optimizations.push(new ShadowsOptimization(priority));
  25398. result.optimizations.push(new LensFlaresOptimization(priority));
  25399. // Next priority
  25400. priority++;
  25401. result.optimizations.push(new PostProcessesOptimization(priority));
  25402. result.optimizations.push(new ParticlesOptimization(priority));
  25403. // Next priority
  25404. priority++;
  25405. result.optimizations.push(new TextureOptimization(priority, 1024));
  25406. return result;
  25407. };
  25408. SceneOptimizerOptions.ModerateDegradationAllowed = function (targetFrameRate) {
  25409. var result = new SceneOptimizerOptions(targetFrameRate);
  25410. var priority = 0;
  25411. result.optimizations.push(new MergeMeshesOptimization(priority));
  25412. result.optimizations.push(new ShadowsOptimization(priority));
  25413. result.optimizations.push(new LensFlaresOptimization(priority));
  25414. // Next priority
  25415. priority++;
  25416. result.optimizations.push(new PostProcessesOptimization(priority));
  25417. result.optimizations.push(new ParticlesOptimization(priority));
  25418. // Next priority
  25419. priority++;
  25420. result.optimizations.push(new TextureOptimization(priority, 512));
  25421. // Next priority
  25422. priority++;
  25423. result.optimizations.push(new RenderTargetsOptimization(priority));
  25424. // Next priority
  25425. priority++;
  25426. result.optimizations.push(new HardwareScalingOptimization(priority, 2));
  25427. return result;
  25428. };
  25429. SceneOptimizerOptions.HighDegradationAllowed = function (targetFrameRate) {
  25430. var result = new SceneOptimizerOptions(targetFrameRate);
  25431. var priority = 0;
  25432. result.optimizations.push(new MergeMeshesOptimization(priority));
  25433. result.optimizations.push(new ShadowsOptimization(priority));
  25434. result.optimizations.push(new LensFlaresOptimization(priority));
  25435. // Next priority
  25436. priority++;
  25437. result.optimizations.push(new PostProcessesOptimization(priority));
  25438. result.optimizations.push(new ParticlesOptimization(priority));
  25439. // Next priority
  25440. priority++;
  25441. result.optimizations.push(new TextureOptimization(priority, 256));
  25442. // Next priority
  25443. priority++;
  25444. result.optimizations.push(new RenderTargetsOptimization(priority));
  25445. // Next priority
  25446. priority++;
  25447. result.optimizations.push(new HardwareScalingOptimization(priority, 4));
  25448. return result;
  25449. };
  25450. return SceneOptimizerOptions;
  25451. })();
  25452. BABYLON.SceneOptimizerOptions = SceneOptimizerOptions;
  25453. // Scene optimizer tool
  25454. var SceneOptimizer = (function () {
  25455. function SceneOptimizer() {
  25456. }
  25457. SceneOptimizer._CheckCurrentState = function (scene, options, currentPriorityLevel, onSuccess, onFailure) {
  25458. // TODO: add an epsilon
  25459. if (scene.getEngine().getFps() >= options.targetFrameRate) {
  25460. if (onSuccess) {
  25461. onSuccess();
  25462. }
  25463. return;
  25464. }
  25465. // Apply current level of optimizations
  25466. var allDone = true;
  25467. var noOptimizationApplied = true;
  25468. for (var index = 0; index < options.optimizations.length; index++) {
  25469. var optimization = options.optimizations[index];
  25470. if (optimization.priority === currentPriorityLevel) {
  25471. noOptimizationApplied = false;
  25472. allDone = allDone && optimization.apply(scene);
  25473. }
  25474. }
  25475. // If no optimization was applied, this is a failure :(
  25476. if (noOptimizationApplied) {
  25477. if (onFailure) {
  25478. onFailure();
  25479. }
  25480. return;
  25481. }
  25482. // If all optimizations were done, move to next level
  25483. if (allDone) {
  25484. currentPriorityLevel++;
  25485. }
  25486. // Let's the system running for a specific amount of time before checking FPS
  25487. scene.executeWhenReady(function () {
  25488. setTimeout(function () {
  25489. SceneOptimizer._CheckCurrentState(scene, options, currentPriorityLevel, onSuccess, onFailure);
  25490. }, options.trackerDuration);
  25491. });
  25492. };
  25493. SceneOptimizer.OptimizeAsync = function (scene, options, onSuccess, onFailure) {
  25494. if (!options) {
  25495. options = SceneOptimizerOptions.ModerateDegradationAllowed();
  25496. }
  25497. // Let's the system running for a specific amount of time before checking FPS
  25498. scene.executeWhenReady(function () {
  25499. setTimeout(function () {
  25500. SceneOptimizer._CheckCurrentState(scene, options, 0, onSuccess, onFailure);
  25501. }, options.trackerDuration);
  25502. });
  25503. };
  25504. return SceneOptimizer;
  25505. })();
  25506. BABYLON.SceneOptimizer = SceneOptimizer;
  25507. })(BABYLON || (BABYLON = {}));
  25508. //# sourceMappingURL=babylon.sceneOptimizer.js.mapvar BABYLON;
  25509. (function (BABYLON) {
  25510. var Internals;
  25511. (function (Internals) {
  25512. var MeshLODLevel = (function () {
  25513. function MeshLODLevel(distance, mesh) {
  25514. this.distance = distance;
  25515. this.mesh = mesh;
  25516. }
  25517. return MeshLODLevel;
  25518. })();
  25519. Internals.MeshLODLevel = MeshLODLevel;
  25520. })(Internals = BABYLON.Internals || (BABYLON.Internals = {}));
  25521. })(BABYLON || (BABYLON = {}));
  25522. //# sourceMappingURL=babylon.meshLODLevel.js.mapvar BABYLON;
  25523. (function (BABYLON) {
  25524. var AudioEngine = (function () {
  25525. function AudioEngine() {
  25526. this.audioContext = null;
  25527. this.canUseWebAudio = false;
  25528. this.WarnedWebAudioUnsupported = false;
  25529. try {
  25530. if (typeof AudioContext !== 'undefined') {
  25531. this.audioContext = new AudioContext();
  25532. this.canUseWebAudio = true;
  25533. }
  25534. else if (typeof webkitAudioContext !== 'undefined') {
  25535. this.audioContext = new webkitAudioContext();
  25536. this.canUseWebAudio = true;
  25537. }
  25538. }
  25539. catch (e) {
  25540. this.canUseWebAudio = false;
  25541. BABYLON.Tools.Error("Web Audio: " + e.message);
  25542. }
  25543. // create a global volume gain node
  25544. if (this.canUseWebAudio) {
  25545. this.masterGain = this.audioContext.createGain();
  25546. this.masterGain.gain.value = 1;
  25547. this.masterGain.connect(this.audioContext.destination);
  25548. }
  25549. }
  25550. AudioEngine.prototype.dispose = function () {
  25551. if (this.canUseWebAudio) {
  25552. if (this._connectedAnalyser) {
  25553. this._connectedAnalyser.stopDebugCanvas();
  25554. this._connectedAnalyser.dispose();
  25555. this.masterGain.disconnect();
  25556. this.masterGain.connect(this.audioContext.destination);
  25557. this._connectedAnalyser = null;
  25558. }
  25559. this.masterGain.gain.value = 1;
  25560. }
  25561. this.WarnedWebAudioUnsupported = false;
  25562. };
  25563. AudioEngine.prototype.getGlobalVolume = function () {
  25564. if (this.canUseWebAudio) {
  25565. return this.masterGain.gain.value;
  25566. }
  25567. else {
  25568. return -1;
  25569. }
  25570. };
  25571. AudioEngine.prototype.setGlobalVolume = function (newVolume) {
  25572. if (this.canUseWebAudio) {
  25573. this.masterGain.gain.value = newVolume;
  25574. }
  25575. };
  25576. AudioEngine.prototype.connectToAnalyser = function (analyser) {
  25577. if (this._connectedAnalyser) {
  25578. this._connectedAnalyser.stopDebugCanvas();
  25579. }
  25580. this._connectedAnalyser = analyser;
  25581. if (this.canUseWebAudio) {
  25582. this.masterGain.disconnect();
  25583. this._connectedAnalyser.connectAudioNodes(this.masterGain, this.audioContext.destination);
  25584. }
  25585. };
  25586. return AudioEngine;
  25587. })();
  25588. BABYLON.AudioEngine = AudioEngine;
  25589. })(BABYLON || (BABYLON = {}));
  25590. //# sourceMappingURL=babylon.audioengine.js.mapvar BABYLON;
  25591. (function (BABYLON) {
  25592. var Sound = (function () {
  25593. /**
  25594. * Create a sound and attach it to a scene
  25595. * @param name Name of your sound
  25596. * @param urlOrArrayBuffer Url to the sound to load async or ArrayBuffer
  25597. * @param readyToPlayCallback Provide a callback function if you'd like to load your code once the sound is ready to be played
  25598. * @param options Objects to provide with the current available options: autoplay, loop, volume, spatialSound, maxDistance, rolloffFactor, refDistance, distanceModel, panningModel
  25599. */
  25600. function Sound(name, urlOrArrayBuffer, scene, readyToPlayCallback, options) {
  25601. var _this = this;
  25602. this.autoplay = false;
  25603. this.loop = false;
  25604. this.useCustomAttenuation = false;
  25605. this.spatialSound = false;
  25606. this.refDistance = 1;
  25607. this.rolloffFactor = 1;
  25608. this.maxDistance = 100;
  25609. this.distanceModel = "linear";
  25610. this.panningModel = "HRTF";
  25611. this._playbackRate = 1;
  25612. this._startTime = 0;
  25613. this._startOffset = 0;
  25614. this._position = BABYLON.Vector3.Zero();
  25615. this._localDirection = new BABYLON.Vector3(1, 0, 0);
  25616. this._volume = 1;
  25617. this._isLoaded = false;
  25618. this._isReadyToPlay = false;
  25619. this._isPlaying = false;
  25620. this._isDirectional = false;
  25621. // Used if you'd like to create a directional sound.
  25622. // If not set, the sound will be omnidirectional
  25623. this._coneInnerAngle = 360;
  25624. this._coneOuterAngle = 360;
  25625. this._coneOuterGain = 0;
  25626. this.name = name;
  25627. this._scene = scene;
  25628. this._readyToPlayCallback = readyToPlayCallback;
  25629. // Default custom attenuation function is a linear attenuation
  25630. this._customAttenuationFunction = function (currentVolume, currentDistance, maxDistance, refDistance, rolloffFactor) {
  25631. if (currentDistance < maxDistance) {
  25632. return currentVolume * (1 - currentDistance / maxDistance);
  25633. }
  25634. else {
  25635. return 0;
  25636. }
  25637. };
  25638. if (options) {
  25639. this.autoplay = options.autoplay || false;
  25640. this.loop = options.loop || false;
  25641. // if volume === 0, we need another way to check this option
  25642. if (options.volume !== undefined) {
  25643. this._volume = options.volume;
  25644. }
  25645. this.spatialSound = options.spatialSound || false;
  25646. this.maxDistance = options.maxDistance || 100;
  25647. this.useCustomAttenuation = options.useCustomAttenuation || false;
  25648. this.rolloffFactor = options.rolloffFactor || 1;
  25649. this.refDistance = options.refDistance || 1;
  25650. this.distanceModel = options.distanceModel || "linear";
  25651. this.panningModel = options.panningModel || "HRTF";
  25652. this._playbackRate = options.playbackRate || 1;
  25653. }
  25654. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  25655. this._soundGain = BABYLON.Engine.audioEngine.audioContext.createGain();
  25656. this._soundGain.gain.value = this._volume;
  25657. this._inputAudioNode = this._soundGain;
  25658. this._ouputAudioNode = this._soundGain;
  25659. if (this.spatialSound) {
  25660. this._createSpatialParameters();
  25661. }
  25662. this._scene.mainSoundTrack.AddSound(this);
  25663. // if no parameter is passed, you need to call setAudioBuffer yourself to prepare the sound
  25664. if (urlOrArrayBuffer) {
  25665. // If it's an URL
  25666. if (typeof (urlOrArrayBuffer) === "string") {
  25667. BABYLON.Tools.LoadFile(urlOrArrayBuffer, function (data) {
  25668. _this._soundLoaded(data);
  25669. }, null, null, true);
  25670. }
  25671. else {
  25672. if (urlOrArrayBuffer instanceof ArrayBuffer) {
  25673. this._soundLoaded(urlOrArrayBuffer);
  25674. }
  25675. else {
  25676. BABYLON.Tools.Error("Parameter must be a URL to the sound or an ArrayBuffer of the sound.");
  25677. }
  25678. }
  25679. }
  25680. }
  25681. else {
  25682. if (!BABYLON.Engine.audioEngine.WarnedWebAudioUnsupported) {
  25683. BABYLON.Tools.Error("Web Audio is not supported by your browser.");
  25684. BABYLON.Engine.audioEngine.WarnedWebAudioUnsupported = true;
  25685. }
  25686. }
  25687. }
  25688. Sound.prototype.dispose = function () {
  25689. if (BABYLON.Engine.audioEngine.canUseWebAudio && this._isReadyToPlay) {
  25690. if (this._isPlaying) {
  25691. this.stop();
  25692. }
  25693. this._isReadyToPlay = false;
  25694. if (this.soundTrackId === -1) {
  25695. this._scene.mainSoundTrack.RemoveSound(this);
  25696. }
  25697. else {
  25698. this._scene.soundTracks[this.soundTrackId].RemoveSound(this);
  25699. }
  25700. this._soundGain.disconnect();
  25701. this._soundSource.disconnect();
  25702. if (this._soundPanner) {
  25703. this._soundPanner.disconnect();
  25704. this._soundPanner = null;
  25705. }
  25706. this._audioBuffer = null;
  25707. this._soundGain = null;
  25708. this._soundSource = null;
  25709. if (this._connectedMesh) {
  25710. this._connectedMesh.unregisterAfterWorldMatrixUpdate(this._registerFunc);
  25711. this._connectedMesh = null;
  25712. }
  25713. }
  25714. };
  25715. Sound.prototype._soundLoaded = function (audioData) {
  25716. var _this = this;
  25717. this._isLoaded = true;
  25718. BABYLON.Engine.audioEngine.audioContext.decodeAudioData(audioData, function (buffer) {
  25719. _this._audioBuffer = buffer;
  25720. _this._isReadyToPlay = true;
  25721. if (_this.autoplay) {
  25722. _this.play();
  25723. }
  25724. if (_this._readyToPlayCallback) {
  25725. _this._readyToPlayCallback();
  25726. }
  25727. }, function (error) {
  25728. BABYLON.Tools.Error("Error while decoding audio data: " + error.err);
  25729. });
  25730. };
  25731. Sound.prototype.setAudioBuffer = function (audioBuffer) {
  25732. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  25733. this._audioBuffer = audioBuffer;
  25734. this._isReadyToPlay = true;
  25735. }
  25736. };
  25737. Sound.prototype.updateOptions = function (options) {
  25738. if (options) {
  25739. this.loop = options.loop || this.loop;
  25740. this.maxDistance = options.maxDistance || this.maxDistance;
  25741. this.useCustomAttenuation = options.useCustomAttenuation || this.useCustomAttenuation;
  25742. this.rolloffFactor = options.rolloffFactor || this.rolloffFactor;
  25743. this.refDistance = options.refDistance || this.refDistance;
  25744. this.distanceModel = options.distanceModel || this.distanceModel;
  25745. this.panningModel = options.panningModel || this.panningModel;
  25746. this._playbackRate = options.playbackRate || this._playbackRate;
  25747. }
  25748. };
  25749. Sound.prototype._createSpatialParameters = function () {
  25750. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  25751. this._soundPanner = BABYLON.Engine.audioEngine.audioContext.createPanner();
  25752. if (this.useCustomAttenuation) {
  25753. // Tricks to disable in a way embedded Web Audio attenuation
  25754. this._soundPanner.distanceModel = "linear";
  25755. this._soundPanner.maxDistance = Number.MAX_VALUE;
  25756. this._soundPanner.refDistance = 1;
  25757. this._soundPanner.rolloffFactor = 1;
  25758. this._soundPanner.panningModel = "HRTF";
  25759. }
  25760. else {
  25761. this._soundPanner.distanceModel = this.distanceModel;
  25762. this._soundPanner.maxDistance = this.maxDistance;
  25763. this._soundPanner.refDistance = this.refDistance;
  25764. this._soundPanner.rolloffFactor = this.rolloffFactor;
  25765. this._soundPanner.panningModel = this.panningModel;
  25766. }
  25767. this._soundPanner.connect(this._ouputAudioNode);
  25768. this._inputAudioNode = this._soundPanner;
  25769. }
  25770. };
  25771. Sound.prototype.connectToSoundTrackAudioNode = function (soundTrackAudioNode) {
  25772. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  25773. this._ouputAudioNode.disconnect();
  25774. this._ouputAudioNode.connect(soundTrackAudioNode);
  25775. }
  25776. };
  25777. /**
  25778. * Transform this sound into a directional source
  25779. * @param coneInnerAngle Size of the inner cone in degree
  25780. * @param coneOuterAngle Size of the outer cone in degree
  25781. * @param coneOuterGain Volume of the sound outside the outer cone (between 0.0 and 1.0)
  25782. */
  25783. Sound.prototype.setDirectionalCone = function (coneInnerAngle, coneOuterAngle, coneOuterGain) {
  25784. if (coneOuterAngle < coneInnerAngle) {
  25785. BABYLON.Tools.Error("setDirectionalCone(): outer angle of the cone must be superior or equal to the inner angle.");
  25786. return;
  25787. }
  25788. this._coneInnerAngle = coneInnerAngle;
  25789. this._coneOuterAngle = coneOuterAngle;
  25790. this._coneOuterGain = coneOuterGain;
  25791. this._isDirectional = true;
  25792. if (this._isPlaying && this.loop) {
  25793. this.stop();
  25794. this.play();
  25795. }
  25796. };
  25797. Sound.prototype.setPosition = function (newPosition) {
  25798. this._position = newPosition;
  25799. if (this._isPlaying && this.spatialSound) {
  25800. this._soundPanner.setPosition(this._position.x, this._position.y, this._position.z);
  25801. }
  25802. };
  25803. Sound.prototype.setLocalDirectionToMesh = function (newLocalDirection) {
  25804. this._localDirection = newLocalDirection;
  25805. if (this._connectedMesh && this._isPlaying) {
  25806. this._updateDirection();
  25807. }
  25808. };
  25809. Sound.prototype._updateDirection = function () {
  25810. var mat = this._connectedMesh.getWorldMatrix();
  25811. var direction = BABYLON.Vector3.TransformNormal(this._localDirection, mat);
  25812. direction.normalize();
  25813. this._soundPanner.setOrientation(direction.x, direction.y, direction.z);
  25814. };
  25815. Sound.prototype.updateDistanceFromListener = function () {
  25816. if (this._connectedMesh && this.useCustomAttenuation) {
  25817. var distance = this._connectedMesh.getDistanceToCamera(this._scene.activeCamera);
  25818. this._soundGain.gain.value = this._customAttenuationFunction(this._volume, distance, this.maxDistance, this.refDistance, this.rolloffFactor);
  25819. }
  25820. };
  25821. Sound.prototype.setAttenuationFunction = function (callback) {
  25822. this._customAttenuationFunction = callback;
  25823. };
  25824. /**
  25825. * Play the sound
  25826. * @param time (optional) Start the sound after X seconds. Start immediately (0) by default.
  25827. */
  25828. Sound.prototype.play = function (time) {
  25829. if (this._isReadyToPlay) {
  25830. try {
  25831. var startTime = time ? BABYLON.Engine.audioEngine.audioContext.currentTime + time : 0;
  25832. if (!this._soundSource) {
  25833. if (this.spatialSound) {
  25834. this._soundPanner.setPosition(this._position.x, this._position.y, this._position.z);
  25835. if (this._isDirectional) {
  25836. this._soundPanner.coneInnerAngle = this._coneInnerAngle;
  25837. this._soundPanner.coneOuterAngle = this._coneOuterAngle;
  25838. this._soundPanner.coneOuterGain = this._coneOuterGain;
  25839. if (this._connectedMesh) {
  25840. this._updateDirection();
  25841. }
  25842. else {
  25843. this._soundPanner.setOrientation(this._localDirection.x, this._localDirection.y, this._localDirection.z);
  25844. }
  25845. }
  25846. }
  25847. }
  25848. this._soundSource = BABYLON.Engine.audioEngine.audioContext.createBufferSource();
  25849. this._soundSource.buffer = this._audioBuffer;
  25850. this._soundSource.connect(this._inputAudioNode);
  25851. this._soundSource.loop = this.loop;
  25852. this._soundSource.playbackRate.value = this._playbackRate;
  25853. this._startTime = startTime;
  25854. if (this.onended) {
  25855. this._soundSource.onended = this.onended;
  25856. }
  25857. this._soundSource.start(startTime, this._startOffset % this._soundSource.buffer.duration);
  25858. this._isPlaying = true;
  25859. }
  25860. catch (ex) {
  25861. BABYLON.Tools.Error("Error while trying to play audio: " + this.name + ", " + ex.message);
  25862. }
  25863. }
  25864. };
  25865. /**
  25866. * Stop the sound
  25867. * @param time (optional) Stop the sound after X seconds. Stop immediately (0) by default.
  25868. */
  25869. Sound.prototype.stop = function (time) {
  25870. if (this._isPlaying) {
  25871. var stopTime = time ? BABYLON.Engine.audioEngine.audioContext.currentTime + time : 0;
  25872. this._soundSource.stop(stopTime);
  25873. this._isPlaying = false;
  25874. }
  25875. };
  25876. Sound.prototype.pause = function () {
  25877. if (this._isPlaying) {
  25878. this._soundSource.stop(0);
  25879. this._startOffset += BABYLON.Engine.audioEngine.audioContext.currentTime - this._startTime;
  25880. }
  25881. };
  25882. Sound.prototype.setVolume = function (newVolume, time) {
  25883. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  25884. if (time) {
  25885. this._soundGain.gain.linearRampToValueAtTime(this._volume, BABYLON.Engine.audioEngine.audioContext.currentTime);
  25886. this._soundGain.gain.linearRampToValueAtTime(newVolume, time);
  25887. }
  25888. else {
  25889. this._soundGain.gain.value = newVolume;
  25890. }
  25891. }
  25892. this._volume = newVolume;
  25893. };
  25894. Sound.prototype.setPlaybackRate = function (newPlaybackRate) {
  25895. this._playbackRate = newPlaybackRate;
  25896. if (this._isPlaying) {
  25897. this._soundSource.playbackRate.value = this._playbackRate;
  25898. }
  25899. };
  25900. Sound.prototype.getVolume = function () {
  25901. return this._volume;
  25902. };
  25903. Sound.prototype.attachToMesh = function (meshToConnectTo) {
  25904. var _this = this;
  25905. this._connectedMesh = meshToConnectTo;
  25906. if (!this.spatialSound) {
  25907. this._createSpatialParameters();
  25908. this.spatialSound = true;
  25909. if (this._isPlaying && this.loop) {
  25910. this.stop();
  25911. this.play();
  25912. }
  25913. }
  25914. this._onRegisterAfterWorldMatrixUpdate(this._connectedMesh);
  25915. this._registerFunc = function (connectedMesh) { return _this._onRegisterAfterWorldMatrixUpdate(connectedMesh); };
  25916. meshToConnectTo.registerAfterWorldMatrixUpdate(this._registerFunc);
  25917. };
  25918. Sound.prototype._onRegisterAfterWorldMatrixUpdate = function (connectedMesh) {
  25919. this.setPosition(connectedMesh.getBoundingInfo().boundingSphere.centerWorld);
  25920. if (this._isDirectional && this._isPlaying) {
  25921. this._updateDirection();
  25922. }
  25923. };
  25924. return Sound;
  25925. })();
  25926. BABYLON.Sound = Sound;
  25927. })(BABYLON || (BABYLON = {}));
  25928. //# sourceMappingURL=babylon.sound.js.mapvar BABYLON;
  25929. (function (BABYLON) {
  25930. var SoundTrack = (function () {
  25931. function SoundTrack(scene, options) {
  25932. this.id = -1;
  25933. this._isMainTrack = false;
  25934. this._scene = scene;
  25935. this._audioEngine = BABYLON.Engine.audioEngine;
  25936. this.soundCollection = new Array();
  25937. if (this._audioEngine.canUseWebAudio) {
  25938. this._trackGain = this._audioEngine.audioContext.createGain();
  25939. this._trackGain.connect(this._audioEngine.masterGain);
  25940. if (options) {
  25941. if (options.volume) {
  25942. this._trackGain.gain.value = options.volume;
  25943. }
  25944. if (options.mainTrack) {
  25945. this._isMainTrack = options.mainTrack;
  25946. }
  25947. }
  25948. }
  25949. if (!this._isMainTrack) {
  25950. this._scene.soundTracks.push(this);
  25951. this.id = this._scene.soundTracks.length - 1;
  25952. }
  25953. }
  25954. SoundTrack.prototype.dispose = function () {
  25955. if (this._audioEngine.canUseWebAudio) {
  25956. if (this._connectedAnalyser) {
  25957. this._connectedAnalyser.stopDebugCanvas();
  25958. }
  25959. while (this.soundCollection.length) {
  25960. this.soundCollection[0].dispose();
  25961. }
  25962. this._trackGain.disconnect();
  25963. this._trackGain = null;
  25964. }
  25965. };
  25966. SoundTrack.prototype.AddSound = function (sound) {
  25967. sound.connectToSoundTrackAudioNode(this._trackGain);
  25968. if (sound.soundTrackId) {
  25969. if (sound.soundTrackId === -1) {
  25970. this._scene.mainSoundTrack.RemoveSound(sound);
  25971. }
  25972. else {
  25973. this._scene.soundTracks[sound.soundTrackId].RemoveSound(sound);
  25974. }
  25975. }
  25976. this.soundCollection.push(sound);
  25977. sound.soundTrackId = this.id;
  25978. };
  25979. SoundTrack.prototype.RemoveSound = function (sound) {
  25980. var index = this.soundCollection.indexOf(sound);
  25981. if (index !== -1) {
  25982. this.soundCollection.splice(index, 1);
  25983. }
  25984. };
  25985. SoundTrack.prototype.setVolume = function (newVolume) {
  25986. if (this._audioEngine.canUseWebAudio) {
  25987. this._trackGain.gain.value = newVolume;
  25988. }
  25989. };
  25990. SoundTrack.prototype.connectToAnalyser = function (analyser) {
  25991. if (this._connectedAnalyser) {
  25992. this._connectedAnalyser.stopDebugCanvas();
  25993. }
  25994. this._connectedAnalyser = analyser;
  25995. if (this._audioEngine.canUseWebAudio) {
  25996. this._trackGain.disconnect();
  25997. this._connectedAnalyser.connectAudioNodes(this._trackGain, this._audioEngine.masterGain);
  25998. }
  25999. };
  26000. return SoundTrack;
  26001. })();
  26002. BABYLON.SoundTrack = SoundTrack;
  26003. })(BABYLON || (BABYLON = {}));
  26004. //# sourceMappingURL=babylon.soundtrack.js.mapvar BABYLON;
  26005. (function (BABYLON) {
  26006. var DebugLayer = (function () {
  26007. function DebugLayer(scene) {
  26008. var _this = this;
  26009. this._enabled = false;
  26010. this._labelsEnabled = false;
  26011. this._displayStatistics = true;
  26012. this._displayTree = false;
  26013. this._displayLogs = false;
  26014. this._identityMatrix = BABYLON.Matrix.Identity();
  26015. this.axisRatio = 0.02;
  26016. this.accentColor = "orange";
  26017. this._scene = scene;
  26018. this._syncPositions = function () {
  26019. var engine = _this._scene.getEngine();
  26020. var canvasRect = engine.getRenderingCanvasClientRect();
  26021. if (_this._showUI) {
  26022. _this._statsDiv.style.left = (canvasRect.width - 410) + "px";
  26023. _this._statsDiv.style.top = (canvasRect.height - 290) + "px";
  26024. _this._statsDiv.style.width = "400px";
  26025. _this._statsDiv.style.height = "auto";
  26026. _this._statsSubsetDiv.style.maxHeight = "240px";
  26027. _this._optionsDiv.style.left = "0px";
  26028. _this._optionsDiv.style.top = "10px";
  26029. _this._optionsDiv.style.width = "200px";
  26030. _this._optionsDiv.style.height = "auto";
  26031. _this._optionsSubsetDiv.style.maxHeight = (canvasRect.height - 225) + "px";
  26032. _this._logDiv.style.left = "0px";
  26033. _this._logDiv.style.top = (canvasRect.height - 170) + "px";
  26034. _this._logDiv.style.width = "600px";
  26035. _this._logDiv.style.height = "160px";
  26036. _this._treeDiv.style.left = (canvasRect.width - 310) + "px";
  26037. _this._treeDiv.style.top = "10px";
  26038. _this._treeDiv.style.width = "300px";
  26039. _this._treeDiv.style.height = "auto";
  26040. _this._treeSubsetDiv.style.maxHeight = (canvasRect.height - 340) + "px";
  26041. }
  26042. _this._globalDiv.style.left = canvasRect.left + "px";
  26043. _this._globalDiv.style.top = canvasRect.top + "px";
  26044. _this._drawingCanvas.style.left = "0px";
  26045. _this._drawingCanvas.style.top = "0px";
  26046. _this._drawingCanvas.style.width = engine.getRenderWidth() + "px";
  26047. _this._drawingCanvas.style.height = engine.getRenderHeight() + "px";
  26048. var devicePixelRatio = window.devicePixelRatio || 1;
  26049. var context = _this._drawingContext;
  26050. var backingStoreRatio = context.webkitBackingStorePixelRatio || context.mozBackingStorePixelRatio || context.msBackingStorePixelRatio || context.oBackingStorePixelRatio || context.backingStorePixelRatio || 1;
  26051. _this._ratio = devicePixelRatio / backingStoreRatio;
  26052. _this._drawingCanvas.width = engine.getRenderWidth() * _this._ratio;
  26053. _this._drawingCanvas.height = engine.getRenderHeight() * _this._ratio;
  26054. };
  26055. this._onCanvasClick = function (evt) {
  26056. _this._clickPosition = {
  26057. x: evt.clientX * _this._ratio,
  26058. y: evt.clientY * _this._ratio
  26059. };
  26060. };
  26061. this._syncData = function () {
  26062. if (_this._showUI) {
  26063. if (_this._displayStatistics) {
  26064. _this._displayStats();
  26065. _this._statsDiv.style.display = "";
  26066. }
  26067. else {
  26068. _this._statsDiv.style.display = "none";
  26069. }
  26070. if (_this._displayLogs) {
  26071. _this._logDiv.style.display = "";
  26072. }
  26073. else {
  26074. _this._logDiv.style.display = "none";
  26075. }
  26076. if (_this._displayTree) {
  26077. _this._treeDiv.style.display = "";
  26078. if (_this._needToRefreshMeshesTree) {
  26079. _this._needToRefreshMeshesTree = false;
  26080. _this._refreshMeshesTreeContent();
  26081. }
  26082. }
  26083. else {
  26084. _this._treeDiv.style.display = "none";
  26085. }
  26086. }
  26087. if (_this._labelsEnabled || !_this._showUI) {
  26088. _this._drawingContext.clearRect(0, 0, _this._drawingCanvas.width, _this._drawingCanvas.height);
  26089. var engine = _this._scene.getEngine();
  26090. var viewport = _this._scene.activeCamera.viewport;
  26091. var globalViewport = viewport.toGlobal(engine);
  26092. // Meshes
  26093. var meshes = _this._scene.getActiveMeshes();
  26094. for (var index = 0; index < meshes.length; index++) {
  26095. var mesh = meshes.data[index];
  26096. var position = mesh.getBoundingInfo().boundingSphere.center;
  26097. var projectedPosition = BABYLON.Vector3.Project(position, mesh.getWorldMatrix(), _this._scene.getTransformMatrix(), globalViewport);
  26098. if (mesh.renderOverlay || _this.shouldDisplayAxis && _this.shouldDisplayAxis(mesh)) {
  26099. _this._renderAxis(projectedPosition, mesh, globalViewport);
  26100. }
  26101. if (!_this.shouldDisplayLabel || _this.shouldDisplayLabel(mesh)) {
  26102. _this._renderLabel(mesh.name, projectedPosition, 12, function () {
  26103. mesh.renderOverlay = !mesh.renderOverlay;
  26104. }, function () {
  26105. return mesh.renderOverlay ? 'red' : 'black';
  26106. });
  26107. }
  26108. }
  26109. // Cameras
  26110. var cameras = _this._scene.cameras;
  26111. for (index = 0; index < cameras.length; index++) {
  26112. var camera = cameras[index];
  26113. if (camera === _this._scene.activeCamera) {
  26114. continue;
  26115. }
  26116. projectedPosition = BABYLON.Vector3.Project(BABYLON.Vector3.Zero(), camera.getWorldMatrix(), _this._scene.getTransformMatrix(), globalViewport);
  26117. if (!_this.shouldDisplayLabel || _this.shouldDisplayLabel(camera)) {
  26118. _this._renderLabel(camera.name, projectedPosition, 12, function () {
  26119. _this._scene.activeCamera.detachControl(engine.getRenderingCanvas());
  26120. _this._scene.activeCamera = camera;
  26121. _this._scene.activeCamera.attachControl(engine.getRenderingCanvas());
  26122. }, function () {
  26123. return "purple";
  26124. });
  26125. }
  26126. }
  26127. // Lights
  26128. var lights = _this._scene.lights;
  26129. for (index = 0; index < lights.length; index++) {
  26130. var light = lights[index];
  26131. if (light.position) {
  26132. projectedPosition = BABYLON.Vector3.Project(light.getAbsolutePosition(), _this._identityMatrix, _this._scene.getTransformMatrix(), globalViewport);
  26133. if (!_this.shouldDisplayLabel || _this.shouldDisplayLabel(light)) {
  26134. _this._renderLabel(light.name, projectedPosition, -20, function () {
  26135. light.setEnabled(!light.isEnabled());
  26136. }, function () {
  26137. return light.isEnabled() ? "orange" : "gray";
  26138. });
  26139. }
  26140. }
  26141. }
  26142. }
  26143. _this._clickPosition = undefined;
  26144. };
  26145. }
  26146. DebugLayer.prototype._refreshMeshesTreeContent = function () {
  26147. while (this._treeSubsetDiv.hasChildNodes()) {
  26148. this._treeSubsetDiv.removeChild(this._treeSubsetDiv.lastChild);
  26149. }
  26150. // Add meshes
  26151. var sortedArray = this._scene.meshes.slice(0, this._scene.meshes.length);
  26152. sortedArray.sort(function (a, b) {
  26153. if (a.name === b.name) {
  26154. return 0;
  26155. }
  26156. return (a.name > b.name) ? 1 : -1;
  26157. });
  26158. for (var index = 0; index < sortedArray.length; index++) {
  26159. var mesh = sortedArray[index];
  26160. if (!mesh.isEnabled()) {
  26161. continue;
  26162. }
  26163. this._generateAdvancedCheckBox(this._treeSubsetDiv, mesh.name, mesh.getTotalVertices() + " verts", mesh.isVisible, function (element, m) {
  26164. m.isVisible = element.checked;
  26165. }, mesh);
  26166. }
  26167. };
  26168. DebugLayer.prototype._renderSingleAxis = function (zero, unit, unitText, label, color) {
  26169. this._drawingContext.beginPath();
  26170. this._drawingContext.moveTo(zero.x, zero.y);
  26171. this._drawingContext.lineTo(unit.x, unit.y);
  26172. this._drawingContext.strokeStyle = color;
  26173. this._drawingContext.lineWidth = 4;
  26174. this._drawingContext.stroke();
  26175. this._drawingContext.font = "normal 14px Segoe UI";
  26176. this._drawingContext.fillStyle = color;
  26177. this._drawingContext.fillText(label, unitText.x, unitText.y);
  26178. };
  26179. DebugLayer.prototype._renderAxis = function (projectedPosition, mesh, globalViewport) {
  26180. var position = mesh.getBoundingInfo().boundingSphere.center;
  26181. var worldMatrix = mesh.getWorldMatrix();
  26182. var unprojectedVector = BABYLON.Vector3.UnprojectFromTransform(projectedPosition.add(new BABYLON.Vector3(this._drawingCanvas.width * this.axisRatio, 0, 0)), globalViewport.width, globalViewport.height, worldMatrix, this._scene.getTransformMatrix());
  26183. var unit = (unprojectedVector.subtract(position)).length();
  26184. var xAxis = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(unit, 0, 0)), worldMatrix, this._scene.getTransformMatrix(), globalViewport);
  26185. var xAxisText = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(unit * 1.5, 0, 0)), worldMatrix, this._scene.getTransformMatrix(), globalViewport);
  26186. this._renderSingleAxis(projectedPosition, xAxis, xAxisText, "x", "#FF0000");
  26187. var yAxis = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(0, unit, 0)), worldMatrix, this._scene.getTransformMatrix(), globalViewport);
  26188. var yAxisText = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(0, unit * 1.5, 0)), worldMatrix, this._scene.getTransformMatrix(), globalViewport);
  26189. this._renderSingleAxis(projectedPosition, yAxis, yAxisText, "y", "#00FF00");
  26190. var zAxis = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(0, 0, unit)), worldMatrix, this._scene.getTransformMatrix(), globalViewport);
  26191. var zAxisText = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(0, 0, unit * 1.5)), worldMatrix, this._scene.getTransformMatrix(), globalViewport);
  26192. this._renderSingleAxis(projectedPosition, zAxis, zAxisText, "z", "#0000FF");
  26193. };
  26194. DebugLayer.prototype._renderLabel = function (text, projectedPosition, labelOffset, onClick, getFillStyle) {
  26195. if (projectedPosition.z > 0 && projectedPosition.z < 1.0) {
  26196. this._drawingContext.font = "normal 12px Segoe UI";
  26197. var textMetrics = this._drawingContext.measureText(text);
  26198. var centerX = projectedPosition.x - textMetrics.width / 2;
  26199. var centerY = projectedPosition.y;
  26200. if (this._isClickInsideRect(centerX - 5, centerY - labelOffset - 12, textMetrics.width + 10, 17)) {
  26201. onClick();
  26202. }
  26203. this._drawingContext.beginPath();
  26204. this._drawingContext.rect(centerX - 5, centerY - labelOffset - 12, textMetrics.width + 10, 17);
  26205. this._drawingContext.fillStyle = getFillStyle();
  26206. this._drawingContext.globalAlpha = 0.5;
  26207. this._drawingContext.fill();
  26208. this._drawingContext.globalAlpha = 1.0;
  26209. this._drawingContext.strokeStyle = '#FFFFFF';
  26210. this._drawingContext.lineWidth = 1;
  26211. this._drawingContext.stroke();
  26212. this._drawingContext.fillStyle = "#FFFFFF";
  26213. this._drawingContext.fillText(text, centerX, centerY - labelOffset);
  26214. this._drawingContext.beginPath();
  26215. this._drawingContext.arc(projectedPosition.x, centerY, 5, 0, 2 * Math.PI, false);
  26216. this._drawingContext.fill();
  26217. }
  26218. };
  26219. DebugLayer.prototype._isClickInsideRect = function (x, y, width, height) {
  26220. if (!this._clickPosition) {
  26221. return false;
  26222. }
  26223. if (this._clickPosition.x < x || this._clickPosition.x > x + width) {
  26224. return false;
  26225. }
  26226. if (this._clickPosition.y < y || this._clickPosition.y > y + height) {
  26227. return false;
  26228. }
  26229. return true;
  26230. };
  26231. DebugLayer.prototype.isVisible = function () {
  26232. return this._enabled;
  26233. };
  26234. DebugLayer.prototype.hide = function () {
  26235. if (!this._enabled) {
  26236. return;
  26237. }
  26238. this._enabled = false;
  26239. var engine = this._scene.getEngine();
  26240. this._scene.unregisterAfterRender(this._syncData);
  26241. document.body.removeChild(this._globalDiv);
  26242. window.removeEventListener("resize", this._syncPositions);
  26243. this._scene.forceShowBoundingBoxes = false;
  26244. this._scene.forceWireframe = false;
  26245. BABYLON.StandardMaterial.DiffuseTextureEnabled = true;
  26246. BABYLON.StandardMaterial.AmbientTextureEnabled = true;
  26247. BABYLON.StandardMaterial.SpecularTextureEnabled = true;
  26248. BABYLON.StandardMaterial.EmissiveTextureEnabled = true;
  26249. BABYLON.StandardMaterial.BumpTextureEnabled = true;
  26250. BABYLON.StandardMaterial.OpacityTextureEnabled = true;
  26251. BABYLON.StandardMaterial.ReflectionTextureEnabled = true;
  26252. this._scene.shadowsEnabled = true;
  26253. this._scene.particlesEnabled = true;
  26254. this._scene.postProcessesEnabled = true;
  26255. this._scene.collisionsEnabled = true;
  26256. this._scene.lightsEnabled = true;
  26257. this._scene.texturesEnabled = true;
  26258. this._scene.lensFlaresEnabled = true;
  26259. this._scene.proceduralTexturesEnabled = true;
  26260. this._scene.renderTargetsEnabled = true;
  26261. engine.getRenderingCanvas().removeEventListener("click", this._onCanvasClick);
  26262. };
  26263. DebugLayer.prototype.show = function (showUI) {
  26264. if (showUI === void 0) { showUI = true; }
  26265. if (this._enabled) {
  26266. return;
  26267. }
  26268. this._enabled = true;
  26269. this._showUI = showUI;
  26270. var engine = this._scene.getEngine();
  26271. this._globalDiv = document.createElement("div");
  26272. document.body.appendChild(this._globalDiv);
  26273. this._generateDOMelements();
  26274. window.addEventListener("resize", this._syncPositions);
  26275. engine.getRenderingCanvas().addEventListener("click", this._onCanvasClick);
  26276. this._syncPositions();
  26277. this._scene.registerAfterRender(this._syncData);
  26278. };
  26279. DebugLayer.prototype._clearLabels = function () {
  26280. this._drawingContext.clearRect(0, 0, this._drawingCanvas.width, this._drawingCanvas.height);
  26281. for (var index = 0; index < this._scene.meshes.length; index++) {
  26282. var mesh = this._scene.meshes[index];
  26283. mesh.renderOverlay = false;
  26284. }
  26285. };
  26286. DebugLayer.prototype._generateheader = function (root, text) {
  26287. var header = document.createElement("div");
  26288. header.innerHTML = text + "&nbsp;";
  26289. header.style.textAlign = "right";
  26290. header.style.width = "100%";
  26291. header.style.color = "white";
  26292. header.style.backgroundColor = "Black";
  26293. header.style.padding = "5px 5px 4px 0px";
  26294. header.style.marginLeft = "-5px";
  26295. header.style.fontWeight = "bold";
  26296. root.appendChild(header);
  26297. };
  26298. DebugLayer.prototype._generateTexBox = function (root, title, color) {
  26299. var label = document.createElement("label");
  26300. label.innerHTML = title;
  26301. label.style.color = color;
  26302. root.appendChild(label);
  26303. root.appendChild(document.createElement("br"));
  26304. };
  26305. DebugLayer.prototype._generateAdvancedCheckBox = function (root, leftTitle, rightTitle, initialState, task, tag) {
  26306. if (tag === void 0) { tag = null; }
  26307. var label = document.createElement("label");
  26308. var boundingBoxesCheckbox = document.createElement("input");
  26309. boundingBoxesCheckbox.type = "checkbox";
  26310. boundingBoxesCheckbox.checked = initialState;
  26311. boundingBoxesCheckbox.addEventListener("change", function (evt) {
  26312. task(evt.target, tag);
  26313. });
  26314. label.appendChild(boundingBoxesCheckbox);
  26315. var container = document.createElement("span");
  26316. var leftPart = document.createElement("span");
  26317. var rightPart = document.createElement("span");
  26318. rightPart.style.cssFloat = "right";
  26319. leftPart.innerHTML = leftTitle;
  26320. rightPart.innerHTML = rightTitle;
  26321. rightPart.style.fontSize = "12px";
  26322. rightPart.style.maxWidth = "200px";
  26323. container.appendChild(leftPart);
  26324. container.appendChild(rightPart);
  26325. label.appendChild(container);
  26326. root.appendChild(label);
  26327. root.appendChild(document.createElement("br"));
  26328. };
  26329. DebugLayer.prototype._generateCheckBox = function (root, title, initialState, task, tag) {
  26330. if (tag === void 0) { tag = null; }
  26331. var label = document.createElement("label");
  26332. var boundingBoxesCheckbox = document.createElement("input");
  26333. boundingBoxesCheckbox.type = "checkbox";
  26334. boundingBoxesCheckbox.checked = initialState;
  26335. boundingBoxesCheckbox.addEventListener("change", function (evt) {
  26336. task(evt.target, tag);
  26337. });
  26338. label.appendChild(boundingBoxesCheckbox);
  26339. label.appendChild(document.createTextNode(title));
  26340. root.appendChild(label);
  26341. root.appendChild(document.createElement("br"));
  26342. };
  26343. DebugLayer.prototype._generateRadio = function (root, title, name, initialState, task, tag) {
  26344. if (tag === void 0) { tag = null; }
  26345. var label = document.createElement("label");
  26346. var boundingBoxesRadio = document.createElement("input");
  26347. boundingBoxesRadio.type = "radio";
  26348. boundingBoxesRadio.name = name;
  26349. boundingBoxesRadio.checked = initialState;
  26350. boundingBoxesRadio.addEventListener("change", function (evt) {
  26351. task(evt.target, tag);
  26352. });
  26353. label.appendChild(boundingBoxesRadio);
  26354. label.appendChild(document.createTextNode(title));
  26355. root.appendChild(label);
  26356. root.appendChild(document.createElement("br"));
  26357. };
  26358. DebugLayer.prototype._generateDOMelements = function () {
  26359. var _this = this;
  26360. this._globalDiv.id = "DebugLayer";
  26361. this._globalDiv.style.position = "absolute";
  26362. this._globalDiv.style.fontFamily = "Segoe UI, Arial";
  26363. this._globalDiv.style.fontSize = "14px";
  26364. this._globalDiv.style.color = "white";
  26365. // Drawing canvas
  26366. this._drawingCanvas = document.createElement("canvas");
  26367. this._drawingCanvas.id = "DebugLayerDrawingCanvas";
  26368. this._drawingCanvas.style.position = "absolute";
  26369. this._drawingCanvas.style.pointerEvents = "none";
  26370. this._drawingContext = this._drawingCanvas.getContext("2d");
  26371. this._globalDiv.appendChild(this._drawingCanvas);
  26372. if (this._showUI) {
  26373. var background = "rgba(128, 128, 128, 0.4)";
  26374. var border = "rgb(180, 180, 180) solid 1px";
  26375. // Stats
  26376. this._statsDiv = document.createElement("div");
  26377. this._statsDiv.id = "DebugLayerStats";
  26378. this._statsDiv.style.border = border;
  26379. this._statsDiv.style.position = "absolute";
  26380. this._statsDiv.style.background = background;
  26381. this._statsDiv.style.padding = "0px 0px 0px 5px";
  26382. this._generateheader(this._statsDiv, "STATISTICS");
  26383. this._statsSubsetDiv = document.createElement("div");
  26384. this._statsSubsetDiv.style.paddingTop = "5px";
  26385. this._statsSubsetDiv.style.paddingBottom = "5px";
  26386. this._statsSubsetDiv.style.overflowY = "auto";
  26387. this._statsDiv.appendChild(this._statsSubsetDiv);
  26388. // Tree
  26389. this._treeDiv = document.createElement("div");
  26390. this._treeDiv.id = "DebugLayerTree";
  26391. this._treeDiv.style.border = border;
  26392. this._treeDiv.style.position = "absolute";
  26393. this._treeDiv.style.background = background;
  26394. this._treeDiv.style.padding = "0px 0px 0px 5px";
  26395. this._treeDiv.style.display = "none";
  26396. this._generateheader(this._treeDiv, "MESHES TREE");
  26397. this._treeSubsetDiv = document.createElement("div");
  26398. this._treeSubsetDiv.style.paddingTop = "5px";
  26399. this._treeSubsetDiv.style.paddingRight = "5px";
  26400. this._treeSubsetDiv.style.overflowY = "auto";
  26401. this._treeSubsetDiv.style.maxHeight = "300px";
  26402. this._treeDiv.appendChild(this._treeSubsetDiv);
  26403. this._needToRefreshMeshesTree = true;
  26404. // Logs
  26405. this._logDiv = document.createElement("div");
  26406. this._logDiv.style.border = border;
  26407. this._logDiv.id = "DebugLayerLogs";
  26408. this._logDiv.style.position = "absolute";
  26409. this._logDiv.style.background = background;
  26410. this._logDiv.style.padding = "0px 0px 0px 5px";
  26411. this._logDiv.style.display = "none";
  26412. this._generateheader(this._logDiv, "LOGS");
  26413. this._logSubsetDiv = document.createElement("div");
  26414. this._logSubsetDiv.style.height = "127px";
  26415. this._logSubsetDiv.style.paddingTop = "5px";
  26416. this._logSubsetDiv.style.overflowY = "auto";
  26417. this._logSubsetDiv.style.fontSize = "12px";
  26418. this._logSubsetDiv.style.fontFamily = "consolas";
  26419. this._logSubsetDiv.innerHTML = BABYLON.Tools.LogCache;
  26420. this._logDiv.appendChild(this._logSubsetDiv);
  26421. BABYLON.Tools.OnNewCacheEntry = function (entry) {
  26422. _this._logSubsetDiv.innerHTML = entry + _this._logSubsetDiv.innerHTML;
  26423. };
  26424. // Options
  26425. this._optionsDiv = document.createElement("div");
  26426. this._optionsDiv.id = "DebugLayerOptions";
  26427. this._optionsDiv.style.border = border;
  26428. this._optionsDiv.style.position = "absolute";
  26429. this._optionsDiv.style.background = background;
  26430. this._optionsDiv.style.padding = "0px 0px 0px 5px";
  26431. this._optionsDiv.style.overflowY = "auto";
  26432. this._generateheader(this._optionsDiv, "OPTIONS");
  26433. this._optionsSubsetDiv = document.createElement("div");
  26434. this._optionsSubsetDiv.style.paddingTop = "5px";
  26435. this._optionsSubsetDiv.style.paddingBottom = "5px";
  26436. this._optionsSubsetDiv.style.overflowY = "auto";
  26437. this._optionsSubsetDiv.style.maxHeight = "200px";
  26438. this._optionsDiv.appendChild(this._optionsSubsetDiv);
  26439. this._generateTexBox(this._optionsSubsetDiv, "<b>Windows:</b>", this.accentColor);
  26440. this._generateCheckBox(this._optionsSubsetDiv, "Statistics", this._displayStatistics, function (element) {
  26441. _this._displayStatistics = element.checked;
  26442. });
  26443. this._generateCheckBox(this._optionsSubsetDiv, "Logs", this._displayLogs, function (element) {
  26444. _this._displayLogs = element.checked;
  26445. });
  26446. this._generateCheckBox(this._optionsSubsetDiv, "Meshes tree", this._displayTree, function (element) {
  26447. _this._displayTree = element.checked;
  26448. _this._needToRefreshMeshesTree = true;
  26449. });
  26450. this._optionsSubsetDiv.appendChild(document.createElement("br"));
  26451. this._generateTexBox(this._optionsSubsetDiv, "<b>General:</b>", this.accentColor);
  26452. this._generateCheckBox(this._optionsSubsetDiv, "Bounding boxes", this._scene.forceShowBoundingBoxes, function (element) {
  26453. _this._scene.forceShowBoundingBoxes = element.checked;
  26454. });
  26455. this._generateCheckBox(this._optionsSubsetDiv, "Clickable labels", this._labelsEnabled, function (element) {
  26456. _this._labelsEnabled = element.checked;
  26457. if (!_this._labelsEnabled) {
  26458. _this._clearLabels();
  26459. }
  26460. });
  26461. this._generateCheckBox(this._optionsSubsetDiv, "Generate user marks (F12)", BABYLON.Tools.PerformanceLogLevel === BABYLON.Tools.PerformanceUserMarkLogLevel, function (element) {
  26462. if (element.checked) {
  26463. BABYLON.Tools.PerformanceLogLevel = BABYLON.Tools.PerformanceUserMarkLogLevel;
  26464. }
  26465. else {
  26466. BABYLON.Tools.PerformanceLogLevel = BABYLON.Tools.PerformanceNoneLogLevel;
  26467. }
  26468. });
  26469. ;
  26470. this._optionsSubsetDiv.appendChild(document.createElement("br"));
  26471. this._generateTexBox(this._optionsSubsetDiv, "<b>Rendering mode:</b>", this.accentColor);
  26472. this._generateRadio(this._optionsSubsetDiv, "Solid", "renderMode", !this._scene.forceWireframe && !this._scene.forcePointsCloud, function (element) {
  26473. if (element.checked) {
  26474. _this._scene.forceWireframe = false;
  26475. _this._scene.forcePointsCloud = false;
  26476. }
  26477. });
  26478. this._generateRadio(this._optionsSubsetDiv, "Wireframe", "renderMode", this._scene.forceWireframe, function (element) {
  26479. if (element.checked) {
  26480. _this._scene.forceWireframe = true;
  26481. _this._scene.forcePointsCloud = false;
  26482. }
  26483. });
  26484. this._generateRadio(this._optionsSubsetDiv, "Point", "renderMode", this._scene.forcePointsCloud, function (element) {
  26485. if (element.checked) {
  26486. _this._scene.forceWireframe = false;
  26487. _this._scene.forcePointsCloud = true;
  26488. }
  26489. });
  26490. this._optionsSubsetDiv.appendChild(document.createElement("br"));
  26491. this._generateTexBox(this._optionsSubsetDiv, "<b>Texture channels:</b>", this.accentColor);
  26492. this._generateCheckBox(this._optionsSubsetDiv, "Diffuse", BABYLON.StandardMaterial.DiffuseTextureEnabled, function (element) {
  26493. BABYLON.StandardMaterial.DiffuseTextureEnabled = element.checked;
  26494. });
  26495. this._generateCheckBox(this._optionsSubsetDiv, "Ambient", BABYLON.StandardMaterial.AmbientTextureEnabled, function (element) {
  26496. BABYLON.StandardMaterial.AmbientTextureEnabled = element.checked;
  26497. });
  26498. this._generateCheckBox(this._optionsSubsetDiv, "Specular", BABYLON.StandardMaterial.SpecularTextureEnabled, function (element) {
  26499. BABYLON.StandardMaterial.SpecularTextureEnabled = element.checked;
  26500. });
  26501. this._generateCheckBox(this._optionsSubsetDiv, "Emissive", BABYLON.StandardMaterial.EmissiveTextureEnabled, function (element) {
  26502. BABYLON.StandardMaterial.EmissiveTextureEnabled = element.checked;
  26503. });
  26504. this._generateCheckBox(this._optionsSubsetDiv, "Bump", BABYLON.StandardMaterial.BumpTextureEnabled, function (element) {
  26505. BABYLON.StandardMaterial.BumpTextureEnabled = element.checked;
  26506. });
  26507. this._generateCheckBox(this._optionsSubsetDiv, "Opacity", BABYLON.StandardMaterial.OpacityTextureEnabled, function (element) {
  26508. BABYLON.StandardMaterial.OpacityTextureEnabled = element.checked;
  26509. });
  26510. this._generateCheckBox(this._optionsSubsetDiv, "Reflection", BABYLON.StandardMaterial.ReflectionTextureEnabled, function (element) {
  26511. BABYLON.StandardMaterial.ReflectionTextureEnabled = element.checked;
  26512. });
  26513. this._generateCheckBox(this._optionsSubsetDiv, "Fresnel", BABYLON.StandardMaterial.FresnelEnabled, function (element) {
  26514. BABYLON.StandardMaterial.FresnelEnabled = element.checked;
  26515. });
  26516. this._optionsSubsetDiv.appendChild(document.createElement("br"));
  26517. this._generateTexBox(this._optionsSubsetDiv, "<b>Options:</b>", this.accentColor);
  26518. this._generateCheckBox(this._optionsSubsetDiv, "Animations", this._scene.animationsEnabled, function (element) {
  26519. _this._scene.animationsEnabled = element.checked;
  26520. });
  26521. this._generateCheckBox(this._optionsSubsetDiv, "Collisions", this._scene.collisionsEnabled, function (element) {
  26522. _this._scene.collisionsEnabled = element.checked;
  26523. });
  26524. this._generateCheckBox(this._optionsSubsetDiv, "Fog", this._scene.fogEnabled, function (element) {
  26525. _this._scene.fogEnabled = element.checked;
  26526. });
  26527. this._generateCheckBox(this._optionsSubsetDiv, "Lens flares", this._scene.lensFlaresEnabled, function (element) {
  26528. _this._scene.lensFlaresEnabled = element.checked;
  26529. });
  26530. this._generateCheckBox(this._optionsSubsetDiv, "Lights", this._scene.lightsEnabled, function (element) {
  26531. _this._scene.lightsEnabled = element.checked;
  26532. });
  26533. this._generateCheckBox(this._optionsSubsetDiv, "Particles", this._scene.particlesEnabled, function (element) {
  26534. _this._scene.particlesEnabled = element.checked;
  26535. });
  26536. this._generateCheckBox(this._optionsSubsetDiv, "Post-processes", this._scene.postProcessesEnabled, function (element) {
  26537. _this._scene.postProcessesEnabled = element.checked;
  26538. });
  26539. this._generateCheckBox(this._optionsSubsetDiv, "Procedural textures", this._scene.proceduralTexturesEnabled, function (element) {
  26540. _this._scene.proceduralTexturesEnabled = element.checked;
  26541. });
  26542. this._generateCheckBox(this._optionsSubsetDiv, "Render targets", this._scene.renderTargetsEnabled, function (element) {
  26543. _this._scene.renderTargetsEnabled = element.checked;
  26544. });
  26545. this._generateCheckBox(this._optionsSubsetDiv, "Shadows", this._scene.shadowsEnabled, function (element) {
  26546. _this._scene.shadowsEnabled = element.checked;
  26547. });
  26548. this._generateCheckBox(this._optionsSubsetDiv, "Skeletons", this._scene.skeletonsEnabled, function (element) {
  26549. _this._scene.skeletonsEnabled = element.checked;
  26550. });
  26551. this._generateCheckBox(this._optionsSubsetDiv, "Textures", this._scene.texturesEnabled, function (element) {
  26552. _this._scene.texturesEnabled = element.checked;
  26553. });
  26554. this._globalDiv.appendChild(this._statsDiv);
  26555. this._globalDiv.appendChild(this._logDiv);
  26556. this._globalDiv.appendChild(this._optionsDiv);
  26557. this._globalDiv.appendChild(this._treeDiv);
  26558. }
  26559. };
  26560. DebugLayer.prototype._displayStats = function () {
  26561. var scene = this._scene;
  26562. var engine = scene.getEngine();
  26563. var glInfo = engine.getGlInfo();
  26564. this._statsSubsetDiv.innerHTML = "Babylon.js v" + BABYLON.Engine.Version + " - <b>" + BABYLON.Tools.Format(engine.getFps(), 0) + " fps</b><br><br>" + "<div style='column-count: 2;-moz-column-count:2;-webkit-column-count:2'>" + "<b>Count</b><br>" + "Total meshes: " + scene.meshes.length + "<br>" + "Total vertices: " + scene.getTotalVertices() + "<br>" + "Total materials: " + scene.materials.length + "<br>" + "Total textures: " + scene.textures.length + "<br>" + "Active meshes: " + scene.getActiveMeshes().length + "<br>" + "Active vertices: " + scene.getActiveVertices() + "<br>" + "Active bones: " + scene.getActiveBones() + "<br>" + "Active particles: " + scene.getActiveParticles() + "<br>" + "<b>Draw calls: " + engine.drawCalls + "</b><br><br>" + "<b>Duration</b><br>" + "Meshes selection:</i> " + BABYLON.Tools.Format(scene.getEvaluateActiveMeshesDuration()) + " ms<br>" + "Render Targets: " + BABYLON.Tools.Format(scene.getRenderTargetsDuration()) + " ms<br>" + "Particles: " + BABYLON.Tools.Format(scene.getParticlesDuration()) + " ms<br>" + "Sprites: " + BABYLON.Tools.Format(scene.getSpritesDuration()) + " ms<br><br>" + "Render: <b>" + BABYLON.Tools.Format(scene.getRenderDuration()) + " ms</b><br>" + "Frame: " + BABYLON.Tools.Format(scene.getLastFrameDuration()) + " ms<br>" + "Potential FPS: " + BABYLON.Tools.Format(1000.0 / scene.getLastFrameDuration(), 0) + "<br><br>" + "</div>" + "<div style='column-count: 2;-moz-column-count:2;-webkit-column-count:2'>" + "<b>Extensions</b><br>" + "Std derivatives: " + (engine.getCaps().standardDerivatives ? "Yes" : "No") + "<br>" + "Compressed textures: " + (engine.getCaps().s3tc ? "Yes" : "No") + "<br>" + "Hardware instances: " + (engine.getCaps().instancedArrays ? "Yes" : "No") + "<br>" + "Texture float: " + (engine.getCaps().textureFloat ? "Yes" : "No") + "<br>" + "32bits indices: " + (engine.getCaps().uintIndices ? "Yes" : "No") + "<br>" + "<b>Caps.</b><br>" + "Max textures units: " + engine.getCaps().maxTexturesImageUnits + "<br>" + "Max textures size: " + engine.getCaps().maxTextureSize + "<br>" + "Max anisotropy: " + engine.getCaps().maxAnisotropy + "<br><br><br>" + "</div><br>" + "<b>Info</b><br>" + glInfo.version + "<br>" + glInfo.renderer + "<br>";
  26565. if (this.customStatsFunction) {
  26566. this._statsSubsetDiv.innerHTML += this._statsSubsetDiv.innerHTML;
  26567. }
  26568. };
  26569. return DebugLayer;
  26570. })();
  26571. BABYLON.DebugLayer = DebugLayer;
  26572. })(BABYLON || (BABYLON = {}));
  26573. //# sourceMappingURL=babylon.debugLayer.js.map
  26574. var BABYLON;
  26575. (function (BABYLON) {
  26576. var RawTexture = (function (_super) {
  26577. __extends(RawTexture, _super);
  26578. function RawTexture(data, width, height, format, scene, generateMipMaps, invertY, samplingMode) {
  26579. if (generateMipMaps === void 0) { generateMipMaps = true; }
  26580. if (invertY === void 0) { invertY = false; }
  26581. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  26582. _super.call(this, null, scene, !generateMipMaps, invertY);
  26583. this._texture = scene.getEngine().createRawTexture(data, width, height, format, generateMipMaps, invertY, samplingMode);
  26584. this.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  26585. this.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  26586. }
  26587. // Statics
  26588. RawTexture.CreateLuminanceTexture = function (data, width, height, scene, generateMipMaps, invertY, samplingMode) {
  26589. if (generateMipMaps === void 0) { generateMipMaps = true; }
  26590. if (invertY === void 0) { invertY = false; }
  26591. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  26592. return new RawTexture(data, width, height, BABYLON.Engine.TEXTUREFORMAT_LUMINANCE, scene, generateMipMaps, invertY, samplingMode);
  26593. };
  26594. RawTexture.CreateLuminanceAlphaTexture = function (data, width, height, scene, generateMipMaps, invertY, samplingMode) {
  26595. if (generateMipMaps === void 0) { generateMipMaps = true; }
  26596. if (invertY === void 0) { invertY = false; }
  26597. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  26598. return new RawTexture(data, width, height, BABYLON.Engine.TEXTUREFORMAT_LUMINANCE_ALPHA, scene, generateMipMaps, invertY, samplingMode);
  26599. };
  26600. RawTexture.CreateAlphaTexture = function (data, width, height, scene, generateMipMaps, invertY, samplingMode) {
  26601. if (generateMipMaps === void 0) { generateMipMaps = true; }
  26602. if (invertY === void 0) { invertY = false; }
  26603. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  26604. return new RawTexture(data, width, height, BABYLON.Engine.TEXTUREFORMAT_ALPHA, scene, generateMipMaps, invertY, samplingMode);
  26605. };
  26606. RawTexture.CreateRGBTexture = function (data, width, height, scene, generateMipMaps, invertY, samplingMode) {
  26607. if (generateMipMaps === void 0) { generateMipMaps = true; }
  26608. if (invertY === void 0) { invertY = false; }
  26609. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  26610. return new RawTexture(data, width, height, BABYLON.Engine.TEXTUREFORMAT_RGB, scene, generateMipMaps, invertY, samplingMode);
  26611. };
  26612. RawTexture.CreateRGBATexture = function (data, width, height, scene, generateMipMaps, invertY, samplingMode) {
  26613. if (generateMipMaps === void 0) { generateMipMaps = true; }
  26614. if (invertY === void 0) { invertY = false; }
  26615. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  26616. return new RawTexture(data, width, height, BABYLON.Engine.TEXTUREFORMAT_RGBA, scene, generateMipMaps, invertY, samplingMode);
  26617. };
  26618. return RawTexture;
  26619. })(BABYLON.Texture);
  26620. BABYLON.RawTexture = RawTexture;
  26621. })(BABYLON || (BABYLON = {}));
  26622. //# sourceMappingURL=babylon.rawTexture.js.map
  26623. var BABYLON;
  26624. (function (BABYLON) {
  26625. var IndexedVector2 = (function (_super) {
  26626. __extends(IndexedVector2, _super);
  26627. function IndexedVector2(original, index) {
  26628. _super.call(this, original.x, original.y);
  26629. this.index = index;
  26630. }
  26631. return IndexedVector2;
  26632. })(BABYLON.Vector2);
  26633. var PolygonPoints = (function () {
  26634. function PolygonPoints() {
  26635. this.elements = new Array();
  26636. }
  26637. PolygonPoints.prototype.add = function (originalPoints) {
  26638. var _this = this;
  26639. var result = new Array();
  26640. originalPoints.forEach(function (point) {
  26641. if (result.length === 0 || !(BABYLON.Tools.WithinEpsilon(point.x, result[0].x, 0.00001) && BABYLON.Tools.WithinEpsilon(point.y, result[0].y, 0.00001))) {
  26642. var newPoint = new IndexedVector2(point, _this.elements.length);
  26643. result.push(newPoint);
  26644. _this.elements.push(newPoint);
  26645. }
  26646. });
  26647. return result;
  26648. };
  26649. PolygonPoints.prototype.computeBounds = function () {
  26650. var lmin = new BABYLON.Vector2(this.elements[0].x, this.elements[0].y);
  26651. var lmax = new BABYLON.Vector2(this.elements[0].x, this.elements[0].y);
  26652. this.elements.forEach(function (point) {
  26653. // x
  26654. if (point.x < lmin.x) {
  26655. lmin.x = point.x;
  26656. }
  26657. else if (point.x > lmax.x) {
  26658. lmax.x = point.x;
  26659. }
  26660. // y
  26661. if (point.y < lmin.y) {
  26662. lmin.y = point.y;
  26663. }
  26664. else if (point.y > lmax.y) {
  26665. lmax.y = point.y;
  26666. }
  26667. });
  26668. return {
  26669. min: lmin,
  26670. max: lmax,
  26671. width: lmax.x - lmin.x,
  26672. height: lmax.y - lmin.y
  26673. };
  26674. };
  26675. return PolygonPoints;
  26676. })();
  26677. var Polygon = (function () {
  26678. function Polygon() {
  26679. }
  26680. Polygon.Rectangle = function (xmin, ymin, xmax, ymax) {
  26681. return [
  26682. new BABYLON.Vector2(xmin, ymin),
  26683. new BABYLON.Vector2(xmax, ymin),
  26684. new BABYLON.Vector2(xmax, ymax),
  26685. new BABYLON.Vector2(xmin, ymax)
  26686. ];
  26687. };
  26688. Polygon.Circle = function (radius, cx, cy, numberOfSides) {
  26689. if (cx === void 0) { cx = 0; }
  26690. if (cy === void 0) { cy = 0; }
  26691. if (numberOfSides === void 0) { numberOfSides = 32; }
  26692. var result = new Array();
  26693. var angle = 0;
  26694. var increment = (Math.PI * 2) / numberOfSides;
  26695. for (var i = 0; i < numberOfSides; i++) {
  26696. result.push(new BABYLON.Vector2(cx + Math.cos(angle) * radius, cy + Math.sin(angle) * radius));
  26697. angle -= increment;
  26698. }
  26699. return result;
  26700. };
  26701. Polygon.Parse = function (input) {
  26702. var floats = input.split(/[^-+eE\.\d]+/).map(parseFloat).filter(function (val) { return (!isNaN(val)); });
  26703. var i, result = [];
  26704. for (i = 0; i < (floats.length & 0x7FFFFFFE); i += 2) {
  26705. result.push(new poly2tri.Point(floats[i], floats[i + 1]));
  26706. }
  26707. return result;
  26708. };
  26709. Polygon.StartingAt = function (x, y) {
  26710. return BABYLON.Path2.StartingAt(x, y);
  26711. };
  26712. return Polygon;
  26713. })();
  26714. BABYLON.Polygon = Polygon;
  26715. var PolygonMeshBuilder = (function () {
  26716. function PolygonMeshBuilder(name, contours, scene) {
  26717. this._points = new PolygonPoints();
  26718. if (!("poly2tri" in window)) {
  26719. throw "PolygonMeshBuilder cannot be used because poly2tri is not referenced";
  26720. }
  26721. this._name = name;
  26722. this._scene = scene;
  26723. var points;
  26724. if (contours instanceof BABYLON.Path2) {
  26725. points = contours.getPoints();
  26726. }
  26727. else {
  26728. points = contours;
  26729. }
  26730. this._swctx = new poly2tri.SweepContext(this._points.add(points));
  26731. }
  26732. PolygonMeshBuilder.prototype.addHole = function (hole) {
  26733. this._swctx.addHole(this._points.add(hole));
  26734. return this;
  26735. };
  26736. PolygonMeshBuilder.prototype.build = function (updatable) {
  26737. if (updatable === void 0) { updatable = false; }
  26738. var result = new BABYLON.Mesh(this._name, this._scene);
  26739. var normals = [];
  26740. var positions = [];
  26741. var uvs = [];
  26742. var bounds = this._points.computeBounds();
  26743. this._points.elements.forEach(function (p) {
  26744. normals.push(0, 1.0, 0);
  26745. positions.push(p.x, 0, p.y);
  26746. uvs.push((p.x - bounds.min.x) / bounds.width, (p.y - bounds.min.y) / bounds.height);
  26747. });
  26748. var indices = [];
  26749. this._swctx.triangulate();
  26750. this._swctx.getTriangles().forEach(function (triangle) {
  26751. triangle.getPoints().forEach(function (point) {
  26752. indices.push(point.index);
  26753. });
  26754. });
  26755. result.setVerticesData(positions, BABYLON.VertexBuffer.PositionKind, updatable);
  26756. result.setVerticesData(normals, BABYLON.VertexBuffer.NormalKind, updatable);
  26757. result.setVerticesData(uvs, BABYLON.VertexBuffer.UVKind, updatable);
  26758. result.setIndices(indices);
  26759. return result;
  26760. };
  26761. return PolygonMeshBuilder;
  26762. })();
  26763. BABYLON.PolygonMeshBuilder = PolygonMeshBuilder;
  26764. })(BABYLON || (BABYLON = {}));
  26765. //# sourceMappingURL=babylon.polygonMesh.js.mapvar BABYLON;
  26766. (function (BABYLON) {
  26767. var SimplificationSettings = (function () {
  26768. function SimplificationSettings(quality, distance) {
  26769. this.quality = quality;
  26770. this.distance = distance;
  26771. }
  26772. return SimplificationSettings;
  26773. })();
  26774. BABYLON.SimplificationSettings = SimplificationSettings;
  26775. /**
  26776. * The implemented types of simplification.
  26777. * At the moment only Quadratic Error Decimation is implemented.
  26778. */
  26779. (function (SimplificationType) {
  26780. SimplificationType[SimplificationType["QUADRATIC"] = 0] = "QUADRATIC";
  26781. })(BABYLON.SimplificationType || (BABYLON.SimplificationType = {}));
  26782. var SimplificationType = BABYLON.SimplificationType;
  26783. var DecimationTriangle = (function () {
  26784. function DecimationTriangle(vertices) {
  26785. this.vertices = vertices;
  26786. this.error = new Array(4);
  26787. this.deleted = false;
  26788. this.isDirty = false;
  26789. this.borderFactor = 0;
  26790. }
  26791. return DecimationTriangle;
  26792. })();
  26793. BABYLON.DecimationTriangle = DecimationTriangle;
  26794. var DecimationVertex = (function () {
  26795. function DecimationVertex(position, normal, uv, id) {
  26796. this.position = position;
  26797. this.normal = normal;
  26798. this.uv = uv;
  26799. this.id = id;
  26800. this.isBorder = true;
  26801. this.q = new QuadraticMatrix();
  26802. this.triangleCount = 0;
  26803. this.triangleStart = 0;
  26804. }
  26805. return DecimationVertex;
  26806. })();
  26807. BABYLON.DecimationVertex = DecimationVertex;
  26808. var QuadraticMatrix = (function () {
  26809. function QuadraticMatrix(data) {
  26810. this.data = new Array(10);
  26811. for (var i = 0; i < 10; ++i) {
  26812. if (data && data[i]) {
  26813. this.data[i] = data[i];
  26814. }
  26815. else {
  26816. this.data[i] = 0;
  26817. }
  26818. }
  26819. }
  26820. QuadraticMatrix.prototype.det = function (a11, a12, a13, a21, a22, a23, a31, a32, a33) {
  26821. var det = this.data[a11] * this.data[a22] * this.data[a33] + this.data[a13] * this.data[a21] * this.data[a32] + this.data[a12] * this.data[a23] * this.data[a31] - this.data[a13] * this.data[a22] * this.data[a31] - this.data[a11] * this.data[a23] * this.data[a32] - this.data[a12] * this.data[a21] * this.data[a33];
  26822. return det;
  26823. };
  26824. QuadraticMatrix.prototype.addInPlace = function (matrix) {
  26825. for (var i = 0; i < 10; ++i) {
  26826. this.data[i] += matrix.data[i];
  26827. }
  26828. };
  26829. QuadraticMatrix.prototype.addArrayInPlace = function (data) {
  26830. for (var i = 0; i < 10; ++i) {
  26831. this.data[i] += data[i];
  26832. }
  26833. };
  26834. QuadraticMatrix.prototype.add = function (matrix) {
  26835. var m = new QuadraticMatrix();
  26836. for (var i = 0; i < 10; ++i) {
  26837. m.data[i] = this.data[i] + matrix.data[i];
  26838. }
  26839. return m;
  26840. };
  26841. QuadraticMatrix.FromData = function (a, b, c, d) {
  26842. return new QuadraticMatrix(QuadraticMatrix.DataFromNumbers(a, b, c, d));
  26843. };
  26844. //returning an array to avoid garbage collection
  26845. QuadraticMatrix.DataFromNumbers = function (a, b, c, d) {
  26846. return [a * a, a * b, a * c, a * d, b * b, b * c, b * d, c * c, c * d, d * d];
  26847. };
  26848. return QuadraticMatrix;
  26849. })();
  26850. BABYLON.QuadraticMatrix = QuadraticMatrix;
  26851. var Reference = (function () {
  26852. function Reference(vertexId, triangleId) {
  26853. this.vertexId = vertexId;
  26854. this.triangleId = triangleId;
  26855. }
  26856. return Reference;
  26857. })();
  26858. BABYLON.Reference = Reference;
  26859. /**
  26860. * An implementation of the Quadratic Error simplification algorithm.
  26861. * Original paper : http://www1.cs.columbia.edu/~cs4162/html05s/garland97.pdf
  26862. * Ported mostly from QSlim and http://voxels.blogspot.de/2014/05/quadric-mesh-simplification-with-source.html to babylon JS
  26863. * @author RaananW
  26864. */
  26865. var QuadraticErrorSimplification = (function () {
  26866. function QuadraticErrorSimplification(_mesh) {
  26867. this._mesh = _mesh;
  26868. this.initialised = false;
  26869. this.syncIterations = 5000;
  26870. this.aggressiveness = 7;
  26871. this.decimationIterations = 100;
  26872. }
  26873. QuadraticErrorSimplification.prototype.simplify = function (settings, successCallback) {
  26874. var _this = this;
  26875. this.initWithMesh(this._mesh, function () {
  26876. _this.runDecimation(settings, successCallback);
  26877. });
  26878. };
  26879. QuadraticErrorSimplification.prototype.runDecimation = function (settings, successCallback) {
  26880. var _this = this;
  26881. var targetCount = ~~(this.triangles.length * settings.quality);
  26882. var deletedTriangles = 0;
  26883. var triangleCount = this.triangles.length;
  26884. var iterationFunction = function (iteration, callback) {
  26885. setTimeout(function () {
  26886. if (iteration % 5 === 0) {
  26887. _this.updateMesh(iteration === 0);
  26888. }
  26889. for (var i = 0; i < _this.triangles.length; ++i) {
  26890. _this.triangles[i].isDirty = false;
  26891. }
  26892. var threshold = 0.000000001 * Math.pow((iteration + 3), _this.aggressiveness);
  26893. var trianglesIterator = function (i) {
  26894. var tIdx = ~~(((_this.triangles.length / 2) + i) % _this.triangles.length);
  26895. var t = _this.triangles[tIdx];
  26896. if (!t)
  26897. return;
  26898. if (t.error[3] > threshold || t.deleted || t.isDirty) {
  26899. return;
  26900. }
  26901. for (var j = 0; j < 3; ++j) {
  26902. if (t.error[j] < threshold) {
  26903. var deleted0 = [];
  26904. var deleted1 = [];
  26905. var i0 = t.vertices[j];
  26906. var i1 = t.vertices[(j + 1) % 3];
  26907. var v0 = _this.vertices[i0];
  26908. var v1 = _this.vertices[i1];
  26909. if (v0.isBorder !== v1.isBorder)
  26910. continue;
  26911. var p = BABYLON.Vector3.Zero();
  26912. var n = BABYLON.Vector3.Zero();
  26913. var uv = BABYLON.Vector2.Zero();
  26914. var color = new BABYLON.Color4(0, 0, 0, 1);
  26915. _this.calculateError(v0, v1, p, n, uv, color);
  26916. var delTr = [];
  26917. if (_this.isFlipped(v0, i1, p, deleted0, t.borderFactor, delTr))
  26918. continue;
  26919. if (_this.isFlipped(v1, i0, p, deleted1, t.borderFactor, delTr))
  26920. continue;
  26921. if (delTr.length == 2 || delTr[0] === delTr[1]) {
  26922. continue;
  26923. }
  26924. v0.normal = n;
  26925. if (v0.uv)
  26926. v0.uv = uv;
  26927. else if (v0.color)
  26928. v0.color = color;
  26929. v0.q = v1.q.add(v0.q);
  26930. if (deleted0.indexOf(true) < 0 || deleted1.indexOf(true) < 0)
  26931. continue;
  26932. if (p.equals(v0.position))
  26933. continue;
  26934. v0.position = p;
  26935. var tStart = _this.references.length;
  26936. deletedTriangles = _this.updateTriangles(v0.id, v0, deleted0, deletedTriangles);
  26937. deletedTriangles = _this.updateTriangles(v0.id, v1, deleted1, deletedTriangles);
  26938. var tCount = _this.references.length - tStart;
  26939. if (tCount <= v0.triangleCount) {
  26940. if (tCount) {
  26941. for (var c = 0; c < tCount; c++) {
  26942. _this.references[v0.triangleStart + c] = _this.references[tStart + c];
  26943. }
  26944. }
  26945. }
  26946. else {
  26947. v0.triangleStart = tStart;
  26948. }
  26949. v0.triangleCount = tCount;
  26950. break;
  26951. }
  26952. }
  26953. };
  26954. BABYLON.AsyncLoop.SyncAsyncForLoop(_this.triangles.length, _this.syncIterations, trianglesIterator, callback, function () {
  26955. return (triangleCount - deletedTriangles <= targetCount);
  26956. });
  26957. }, 0);
  26958. };
  26959. BABYLON.AsyncLoop.Run(this.decimationIterations, function (loop) {
  26960. if (triangleCount - deletedTriangles <= targetCount)
  26961. loop.breakLoop();
  26962. else {
  26963. iterationFunction(loop.index, function () {
  26964. loop.executeNext();
  26965. });
  26966. }
  26967. }, function () {
  26968. setTimeout(function () {
  26969. successCallback(_this.reconstructMesh());
  26970. }, 0);
  26971. });
  26972. };
  26973. QuadraticErrorSimplification.prototype.initWithMesh = function (mesh, callback) {
  26974. var _this = this;
  26975. if (!mesh)
  26976. return;
  26977. this.vertices = [];
  26978. this.triangles = [];
  26979. this._mesh = mesh;
  26980. //It is assumed that a mesh has positions, normals and either uvs or colors.
  26981. var positionData = this._mesh.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  26982. var normalData = this._mesh.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  26983. var uvs = this._mesh.getVerticesData(BABYLON.VertexBuffer.UVKind);
  26984. var colorsData = this._mesh.getVerticesData(BABYLON.VertexBuffer.ColorKind);
  26985. var indices = mesh.getIndices();
  26986. var vertexInit = function (i) {
  26987. var vertex = new DecimationVertex(BABYLON.Vector3.FromArray(positionData, i * 3), BABYLON.Vector3.FromArray(normalData, i * 3), null, i);
  26988. if (_this._mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  26989. vertex.uv = BABYLON.Vector2.FromArray(uvs, i * 2);
  26990. }
  26991. else if (_this._mesh.isVerticesDataPresent(BABYLON.VertexBuffer.ColorKind)) {
  26992. vertex.color = BABYLON.Color4.FromArray(colorsData, i * 4);
  26993. }
  26994. _this.vertices.push(vertex);
  26995. };
  26996. var totalVertices = mesh.getTotalVertices();
  26997. BABYLON.AsyncLoop.SyncAsyncForLoop(totalVertices, this.syncIterations, vertexInit, function () {
  26998. var indicesInit = function (i) {
  26999. var pos = i * 3;
  27000. var i0 = indices[pos + 0];
  27001. var i1 = indices[pos + 1];
  27002. var i2 = indices[pos + 2];
  27003. var triangle = new DecimationTriangle([_this.vertices[i0].id, _this.vertices[i1].id, _this.vertices[i2].id]);
  27004. _this.triangles.push(triangle);
  27005. };
  27006. BABYLON.AsyncLoop.SyncAsyncForLoop(indices.length / 3, _this.syncIterations, indicesInit, function () {
  27007. _this.init(callback);
  27008. });
  27009. });
  27010. };
  27011. QuadraticErrorSimplification.prototype.init = function (callback) {
  27012. var _this = this;
  27013. var triangleInit1 = function (i) {
  27014. var t = _this.triangles[i];
  27015. t.normal = BABYLON.Vector3.Cross(_this.vertices[t.vertices[1]].position.subtract(_this.vertices[t.vertices[0]].position), _this.vertices[t.vertices[2]].position.subtract(_this.vertices[t.vertices[0]].position)).normalize();
  27016. for (var j = 0; j < 3; j++) {
  27017. _this.vertices[t.vertices[j]].q.addArrayInPlace(QuadraticMatrix.DataFromNumbers(t.normal.x, t.normal.y, t.normal.z, -(BABYLON.Vector3.Dot(t.normal, _this.vertices[t.vertices[0]].position))));
  27018. }
  27019. };
  27020. BABYLON.AsyncLoop.SyncAsyncForLoop(this.triangles.length, this.syncIterations, triangleInit1, function () {
  27021. var triangleInit2 = function (i) {
  27022. var t = _this.triangles[i];
  27023. for (var j = 0; j < 3; ++j) {
  27024. t.error[j] = _this.calculateError(_this.vertices[t.vertices[j]], _this.vertices[t.vertices[(j + 1) % 3]]);
  27025. }
  27026. t.error[3] = Math.min(t.error[0], t.error[1], t.error[2]);
  27027. };
  27028. BABYLON.AsyncLoop.SyncAsyncForLoop(_this.triangles.length, _this.syncIterations, triangleInit2, function () {
  27029. _this.initialised = true;
  27030. callback();
  27031. });
  27032. });
  27033. };
  27034. QuadraticErrorSimplification.prototype.reconstructMesh = function () {
  27035. var newTriangles = [];
  27036. var i;
  27037. for (i = 0; i < this.vertices.length; ++i) {
  27038. this.vertices[i].triangleCount = 0;
  27039. }
  27040. var t;
  27041. var j;
  27042. for (i = 0; i < this.triangles.length; ++i) {
  27043. if (!this.triangles[i].deleted) {
  27044. t = this.triangles[i];
  27045. for (j = 0; j < 3; ++j) {
  27046. this.vertices[t.vertices[j]].triangleCount = 1;
  27047. }
  27048. newTriangles.push(t);
  27049. }
  27050. }
  27051. var newVerticesOrder = [];
  27052. //compact vertices, get the IDs of the vertices used.
  27053. var dst = 0;
  27054. for (i = 0; i < this.vertices.length; ++i) {
  27055. if (this.vertices[i].triangleCount) {
  27056. this.vertices[i].triangleStart = dst;
  27057. this.vertices[dst].position = this.vertices[i].position;
  27058. this.vertices[dst].normal = this.vertices[i].normal;
  27059. this.vertices[dst].uv = this.vertices[i].uv;
  27060. this.vertices[dst].color = this.vertices[i].color;
  27061. newVerticesOrder.push(i);
  27062. dst++;
  27063. }
  27064. }
  27065. for (i = 0; i < newTriangles.length; ++i) {
  27066. t = newTriangles[i];
  27067. for (j = 0; j < 3; ++j) {
  27068. t.vertices[j] = this.vertices[t.vertices[j]].triangleStart;
  27069. }
  27070. }
  27071. this.vertices = this.vertices.slice(0, dst);
  27072. var newPositionData = [];
  27073. var newNormalData = [];
  27074. var newUVsData = [];
  27075. var newColorsData = [];
  27076. for (i = 0; i < newVerticesOrder.length; ++i) {
  27077. newPositionData.push(this.vertices[i].position.x);
  27078. newPositionData.push(this.vertices[i].position.y);
  27079. newPositionData.push(this.vertices[i].position.z);
  27080. newNormalData.push(this.vertices[i].normal.x);
  27081. newNormalData.push(this.vertices[i].normal.y);
  27082. newNormalData.push(this.vertices[i].normal.z);
  27083. if (this.vertices[i].uv) {
  27084. newUVsData.push(this.vertices[i].uv.x);
  27085. newUVsData.push(this.vertices[i].uv.y);
  27086. }
  27087. else if (this.vertices[i].color) {
  27088. newColorsData.push(this.vertices[i].color.r);
  27089. newColorsData.push(this.vertices[i].color.g);
  27090. newColorsData.push(this.vertices[i].color.b);
  27091. newColorsData.push(this.vertices[i].color.a);
  27092. }
  27093. }
  27094. var newIndicesArray = [];
  27095. for (i = 0; i < newTriangles.length; ++i) {
  27096. newIndicesArray.push(newTriangles[i].vertices[0]);
  27097. newIndicesArray.push(newTriangles[i].vertices[1]);
  27098. newIndicesArray.push(newTriangles[i].vertices[2]);
  27099. }
  27100. //not cloning, to avoid geometry problems. Creating a whole new mesh.
  27101. var newMesh = new BABYLON.Mesh(this._mesh.name + "Decimated", this._mesh.getScene());
  27102. newMesh.material = this._mesh.material;
  27103. newMesh.parent = this._mesh.parent;
  27104. newMesh.setIndices(newIndicesArray);
  27105. newMesh.setVerticesData(BABYLON.VertexBuffer.PositionKind, newPositionData);
  27106. newMesh.setVerticesData(BABYLON.VertexBuffer.NormalKind, newNormalData);
  27107. if (newUVsData.length > 0)
  27108. newMesh.setVerticesData(BABYLON.VertexBuffer.UVKind, newUVsData);
  27109. if (newColorsData.length > 0)
  27110. newMesh.setVerticesData(BABYLON.VertexBuffer.ColorKind, newColorsData);
  27111. //preparing the skeleton support
  27112. if (this._mesh.skeleton) {
  27113. }
  27114. return newMesh;
  27115. };
  27116. QuadraticErrorSimplification.prototype.isFlipped = function (vertex1, index2, point, deletedArray, borderFactor, delTr) {
  27117. for (var i = 0; i < vertex1.triangleCount; ++i) {
  27118. var t = this.triangles[this.references[vertex1.triangleStart + i].triangleId];
  27119. if (t.deleted)
  27120. continue;
  27121. var s = this.references[vertex1.triangleStart + i].vertexId;
  27122. var id1 = t.vertices[(s + 1) % 3];
  27123. var id2 = t.vertices[(s + 2) % 3];
  27124. if ((id1 === index2 || id2 === index2) && borderFactor < 2) {
  27125. deletedArray[i] = true;
  27126. delTr.push(t);
  27127. continue;
  27128. }
  27129. var d1 = this.vertices[id1].position.subtract(point);
  27130. d1 = d1.normalize();
  27131. var d2 = this.vertices[id2].position.subtract(point);
  27132. d2 = d2.normalize();
  27133. if (Math.abs(BABYLON.Vector3.Dot(d1, d2)) > 0.999)
  27134. return true;
  27135. var normal = BABYLON.Vector3.Cross(d1, d2).normalize();
  27136. deletedArray[i] = false;
  27137. if (BABYLON.Vector3.Dot(normal, t.normal) < 0.2)
  27138. return true;
  27139. }
  27140. return false;
  27141. };
  27142. QuadraticErrorSimplification.prototype.updateTriangles = function (vertexId, vertex, deletedArray, deletedTriangles) {
  27143. var newDeleted = deletedTriangles;
  27144. for (var i = 0; i < vertex.triangleCount; ++i) {
  27145. var ref = this.references[vertex.triangleStart + i];
  27146. var t = this.triangles[ref.triangleId];
  27147. if (t.deleted)
  27148. continue;
  27149. if (deletedArray[i]) {
  27150. t.deleted = true;
  27151. newDeleted++;
  27152. continue;
  27153. }
  27154. t.vertices[ref.vertexId] = vertexId;
  27155. t.isDirty = true;
  27156. t.error[0] = this.calculateError(this.vertices[t.vertices[0]], this.vertices[t.vertices[1]]) + (t.borderFactor / 2);
  27157. t.error[1] = this.calculateError(this.vertices[t.vertices[1]], this.vertices[t.vertices[2]]) + (t.borderFactor / 2);
  27158. t.error[2] = this.calculateError(this.vertices[t.vertices[2]], this.vertices[t.vertices[0]]) + (t.borderFactor / 2);
  27159. t.error[3] = Math.min(t.error[0], t.error[1], t.error[2]);
  27160. this.references.push(ref);
  27161. }
  27162. return newDeleted;
  27163. };
  27164. QuadraticErrorSimplification.prototype.identifyBorder = function () {
  27165. for (var i = 0; i < this.vertices.length; ++i) {
  27166. var vCount = [];
  27167. var vId = [];
  27168. var v = this.vertices[i];
  27169. var j;
  27170. for (j = 0; j < v.triangleCount; ++j) {
  27171. var triangle = this.triangles[this.references[v.triangleStart + j].triangleId];
  27172. for (var ii = 0; ii < 3; ii++) {
  27173. var ofs = 0;
  27174. var id = triangle.vertices[ii];
  27175. while (ofs < vCount.length) {
  27176. if (vId[ofs] === id)
  27177. break;
  27178. ++ofs;
  27179. }
  27180. if (ofs === vCount.length) {
  27181. vCount.push(1);
  27182. vId.push(id);
  27183. }
  27184. else {
  27185. vCount[ofs]++;
  27186. }
  27187. }
  27188. }
  27189. for (j = 0; j < vCount.length; ++j) {
  27190. if (vCount[j] === 1) {
  27191. this.vertices[vId[j]].isBorder = true;
  27192. }
  27193. else {
  27194. this.vertices[vId[j]].isBorder = false;
  27195. }
  27196. }
  27197. }
  27198. };
  27199. QuadraticErrorSimplification.prototype.updateMesh = function (identifyBorders) {
  27200. if (identifyBorders === void 0) { identifyBorders = false; }
  27201. var i;
  27202. if (!identifyBorders) {
  27203. var newTrianglesVector = [];
  27204. for (i = 0; i < this.triangles.length; ++i) {
  27205. if (!this.triangles[i].deleted) {
  27206. newTrianglesVector.push(this.triangles[i]);
  27207. }
  27208. }
  27209. this.triangles = newTrianglesVector;
  27210. }
  27211. for (i = 0; i < this.vertices.length; ++i) {
  27212. this.vertices[i].triangleCount = 0;
  27213. this.vertices[i].triangleStart = 0;
  27214. }
  27215. var t;
  27216. var j;
  27217. var v;
  27218. for (i = 0; i < this.triangles.length; ++i) {
  27219. t = this.triangles[i];
  27220. for (j = 0; j < 3; ++j) {
  27221. v = this.vertices[t.vertices[j]];
  27222. v.triangleCount++;
  27223. }
  27224. }
  27225. var tStart = 0;
  27226. for (i = 0; i < this.vertices.length; ++i) {
  27227. this.vertices[i].triangleStart = tStart;
  27228. tStart += this.vertices[i].triangleCount;
  27229. this.vertices[i].triangleCount = 0;
  27230. }
  27231. var newReferences = new Array(this.triangles.length * 3);
  27232. for (i = 0; i < this.triangles.length; ++i) {
  27233. t = this.triangles[i];
  27234. for (j = 0; j < 3; ++j) {
  27235. v = this.vertices[t.vertices[j]];
  27236. newReferences[v.triangleStart + v.triangleCount] = new Reference(j, i);
  27237. v.triangleCount++;
  27238. }
  27239. }
  27240. this.references = newReferences;
  27241. if (identifyBorders) {
  27242. this.identifyBorder();
  27243. }
  27244. };
  27245. QuadraticErrorSimplification.prototype.vertexError = function (q, point) {
  27246. var x = point.x;
  27247. var y = point.y;
  27248. var z = point.z;
  27249. return q.data[0] * x * x + 2 * q.data[1] * x * y + 2 * q.data[2] * x * z + 2 * q.data[3] * x + q.data[4] * y * y + 2 * q.data[5] * y * z + 2 * q.data[6] * y + q.data[7] * z * z + 2 * q.data[8] * z + q.data[9];
  27250. };
  27251. QuadraticErrorSimplification.prototype.calculateError = function (vertex1, vertex2, pointResult, normalResult, uvResult, colorResult) {
  27252. var q = vertex1.q.add(vertex2.q);
  27253. var border = vertex1.isBorder && vertex2.isBorder;
  27254. var error = 0;
  27255. var qDet = q.det(0, 1, 2, 1, 4, 5, 2, 5, 7);
  27256. if (qDet !== 0 && !border) {
  27257. if (!pointResult) {
  27258. pointResult = BABYLON.Vector3.Zero();
  27259. }
  27260. pointResult.x = -1 / qDet * (q.det(1, 2, 3, 4, 5, 6, 5, 7, 8));
  27261. pointResult.y = 1 / qDet * (q.det(0, 2, 3, 1, 5, 6, 2, 7, 8));
  27262. pointResult.z = -1 / qDet * (q.det(0, 1, 3, 1, 4, 6, 2, 5, 8));
  27263. error = this.vertexError(q, pointResult);
  27264. //TODO this should be correctly calculated
  27265. if (normalResult) {
  27266. normalResult.copyFrom(vertex1.normal);
  27267. if (vertex1.uv)
  27268. uvResult.copyFrom(vertex1.uv);
  27269. else if (vertex1.color)
  27270. colorResult.copyFrom(vertex1.color);
  27271. }
  27272. }
  27273. else {
  27274. var p3 = (vertex1.position.add(vertex2.position)).divide(new BABYLON.Vector3(2, 2, 2));
  27275. //var norm3 = (vertex1.normal.add(vertex2.normal)).divide(new Vector3(2, 2, 2)).normalize();
  27276. var error1 = this.vertexError(q, vertex1.position);
  27277. var error2 = this.vertexError(q, vertex2.position);
  27278. var error3 = this.vertexError(q, p3);
  27279. error = Math.min(error1, error2, error3);
  27280. if (error === error1) {
  27281. if (pointResult) {
  27282. pointResult.copyFrom(vertex1.position);
  27283. normalResult.copyFrom(vertex1.normal);
  27284. if (vertex1.uv)
  27285. uvResult.copyFrom(vertex1.uv);
  27286. else if (vertex1.color)
  27287. colorResult.copyFrom(vertex1.color);
  27288. }
  27289. }
  27290. else if (error === error2) {
  27291. if (pointResult) {
  27292. pointResult.copyFrom(vertex2.position);
  27293. normalResult.copyFrom(vertex2.normal);
  27294. if (vertex2.uv)
  27295. uvResult.copyFrom(vertex2.uv);
  27296. else if (vertex2.color)
  27297. colorResult.copyFrom(vertex2.color);
  27298. }
  27299. }
  27300. else {
  27301. if (pointResult) {
  27302. pointResult.copyFrom(p3);
  27303. normalResult.copyFrom(vertex1.normal);
  27304. if (vertex1.uv)
  27305. uvResult.copyFrom(vertex1.uv);
  27306. else if (vertex1.color)
  27307. colorResult.copyFrom(vertex1.color);
  27308. }
  27309. }
  27310. }
  27311. return error;
  27312. };
  27313. return QuadraticErrorSimplification;
  27314. })();
  27315. BABYLON.QuadraticErrorSimplification = QuadraticErrorSimplification;
  27316. })(BABYLON || (BABYLON = {}));
  27317. //# sourceMappingURL=babylon.meshSimplification.js.mapvar BABYLON;
  27318. (function (BABYLON) {
  27319. var Analyser = (function () {
  27320. function Analyser(scene) {
  27321. this.SMOOTHING = 0.75;
  27322. this.FFT_SIZE = 512;
  27323. this.BARGRAPHAMPLITUDE = 256;
  27324. this.DEBUGCANVASPOS = { x: 20, y: 20 };
  27325. this.DEBUGCANVASSIZE = { width: 320, height: 200 };
  27326. this._scene = scene;
  27327. this._audioEngine = BABYLON.Engine.audioEngine;
  27328. if (this._audioEngine.canUseWebAudio) {
  27329. this._webAudioAnalyser = this._audioEngine.audioContext.createAnalyser();
  27330. this._webAudioAnalyser.minDecibels = -140;
  27331. this._webAudioAnalyser.maxDecibels = 0;
  27332. this._byteFreqs = new Uint8Array(this._webAudioAnalyser.frequencyBinCount);
  27333. this._byteTime = new Uint8Array(this._webAudioAnalyser.frequencyBinCount);
  27334. this._floatFreqs = new Float32Array(this._webAudioAnalyser.frequencyBinCount);
  27335. }
  27336. }
  27337. Analyser.prototype.getFrequencyBinCount = function () {
  27338. if (this._audioEngine.canUseWebAudio) {
  27339. return this._webAudioAnalyser.frequencyBinCount;
  27340. }
  27341. else {
  27342. return 0;
  27343. }
  27344. };
  27345. Analyser.prototype.getByteFrequencyData = function () {
  27346. if (this._audioEngine.canUseWebAudio) {
  27347. this._webAudioAnalyser.smoothingTimeConstant = this.SMOOTHING;
  27348. this._webAudioAnalyser.fftSize = this.FFT_SIZE;
  27349. this._webAudioAnalyser.getByteFrequencyData(this._byteFreqs);
  27350. }
  27351. return this._byteFreqs;
  27352. };
  27353. Analyser.prototype.getByteTimeDomainData = function () {
  27354. if (this._audioEngine.canUseWebAudio) {
  27355. this._webAudioAnalyser.smoothingTimeConstant = this.SMOOTHING;
  27356. this._webAudioAnalyser.fftSize = this.FFT_SIZE;
  27357. this._webAudioAnalyser.getByteTimeDomainData(this._byteTime);
  27358. }
  27359. return this._byteTime;
  27360. };
  27361. Analyser.prototype.getFloatFrequencyData = function () {
  27362. if (this._audioEngine.canUseWebAudio) {
  27363. this._webAudioAnalyser.smoothingTimeConstant = this.SMOOTHING;
  27364. this._webAudioAnalyser.fftSize = this.FFT_SIZE;
  27365. this._webAudioAnalyser.getFloatFrequencyData(this._floatFreqs);
  27366. }
  27367. return this._floatFreqs;
  27368. };
  27369. Analyser.prototype.drawDebugCanvas = function () {
  27370. var _this = this;
  27371. if (this._audioEngine.canUseWebAudio) {
  27372. if (!this._debugCanvas) {
  27373. this._debugCanvas = document.createElement("canvas");
  27374. this._debugCanvas.width = this.DEBUGCANVASSIZE.width;
  27375. this._debugCanvas.height = this.DEBUGCANVASSIZE.height;
  27376. this._debugCanvas.style.position = "absolute";
  27377. this._debugCanvas.style.top = this.DEBUGCANVASPOS.y + "px";
  27378. this._debugCanvas.style.left = this.DEBUGCANVASPOS.x + "px";
  27379. this._debugCanvasContext = this._debugCanvas.getContext("2d");
  27380. document.body.appendChild(this._debugCanvas);
  27381. this._registerFunc = function () {
  27382. _this.drawDebugCanvas();
  27383. };
  27384. this._scene.registerBeforeRender(this._registerFunc);
  27385. }
  27386. if (this._registerFunc) {
  27387. var workingArray = this.getByteFrequencyData();
  27388. this._debugCanvasContext.fillStyle = 'rgb(0, 0, 0)';
  27389. this._debugCanvasContext.fillRect(0, 0, this.DEBUGCANVASSIZE.width, this.DEBUGCANVASSIZE.height);
  27390. for (var i = 0; i < this.getFrequencyBinCount(); i++) {
  27391. var value = workingArray[i];
  27392. var percent = value / this.BARGRAPHAMPLITUDE;
  27393. var height = this.DEBUGCANVASSIZE.height * percent;
  27394. var offset = this.DEBUGCANVASSIZE.height - height - 1;
  27395. var barWidth = this.DEBUGCANVASSIZE.width / this.getFrequencyBinCount();
  27396. var hue = i / this.getFrequencyBinCount() * 360;
  27397. this._debugCanvasContext.fillStyle = 'hsl(' + hue + ', 100%, 50%)';
  27398. this._debugCanvasContext.fillRect(i * barWidth, offset, barWidth, height);
  27399. }
  27400. }
  27401. }
  27402. };
  27403. Analyser.prototype.stopDebugCanvas = function () {
  27404. if (this._debugCanvas) {
  27405. this._scene.unregisterBeforeRender(this._registerFunc);
  27406. this._registerFunc = null;
  27407. document.body.removeChild(this._debugCanvas);
  27408. this._debugCanvas = null;
  27409. this._debugCanvasContext = null;
  27410. }
  27411. };
  27412. Analyser.prototype.connectAudioNodes = function (inputAudioNode, outputAudioNode) {
  27413. if (this._audioEngine.canUseWebAudio) {
  27414. inputAudioNode.connect(this._webAudioAnalyser);
  27415. this._webAudioAnalyser.connect(outputAudioNode);
  27416. }
  27417. };
  27418. Analyser.prototype.dispose = function () {
  27419. if (this._audioEngine.canUseWebAudio) {
  27420. this._webAudioAnalyser.disconnect();
  27421. }
  27422. };
  27423. return Analyser;
  27424. })();
  27425. BABYLON.Analyser = Analyser;
  27426. })(BABYLON || (BABYLON = {}));
  27427. //# sourceMappingURL=babylon.analyser.js.mapvar BABYLON;
  27428. (function (BABYLON) {
  27429. var DepthRenderer = (function () {
  27430. function DepthRenderer(scene, type) {
  27431. var _this = this;
  27432. if (type === void 0) { type = BABYLON.Engine.TEXTURETYPE_FLOAT; }
  27433. this._viewMatrix = BABYLON.Matrix.Zero();
  27434. this._projectionMatrix = BABYLON.Matrix.Zero();
  27435. this._transformMatrix = BABYLON.Matrix.Zero();
  27436. this._worldViewProjection = BABYLON.Matrix.Zero();
  27437. this._scene = scene;
  27438. var engine = scene.getEngine();
  27439. // Render target
  27440. this._depthMap = new BABYLON.RenderTargetTexture("depthMap", { width: engine.getRenderWidth(), height: engine.getRenderHeight() }, this._scene, false, true, type);
  27441. this._depthMap.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  27442. this._depthMap.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  27443. this._depthMap.refreshRate = 1;
  27444. this._depthMap.renderParticles = false;
  27445. this._depthMap.renderList = null;
  27446. // Custom render function
  27447. var renderSubMesh = function (subMesh) {
  27448. var mesh = subMesh.getRenderingMesh();
  27449. var scene = _this._scene;
  27450. var engine = scene.getEngine();
  27451. // Culling
  27452. engine.setState(subMesh.getMaterial().backFaceCulling);
  27453. // Managing instances
  27454. var batch = mesh._getInstancesRenderList(subMesh._id);
  27455. if (batch.mustReturn) {
  27456. return;
  27457. }
  27458. var hardwareInstancedRendering = (engine.getCaps().instancedArrays !== null) && (batch.visibleInstances[subMesh._id] !== null);
  27459. if (_this.isReady(subMesh, hardwareInstancedRendering)) {
  27460. engine.enableEffect(_this._effect);
  27461. mesh._bind(subMesh, _this._effect, BABYLON.Material.TriangleFillMode);
  27462. var material = subMesh.getMaterial();
  27463. _this._effect.setMatrix("viewProjection", scene.getTransformMatrix());
  27464. _this._effect.setFloat("far", scene.activeCamera.maxZ);
  27465. // Alpha test
  27466. if (material && material.needAlphaTesting()) {
  27467. var alphaTexture = material.getAlphaTestTexture();
  27468. _this._effect.setTexture("diffuseSampler", alphaTexture);
  27469. _this._effect.setMatrix("diffuseMatrix", alphaTexture.getTextureMatrix());
  27470. }
  27471. // Bones
  27472. if (mesh.useBones) {
  27473. _this._effect.setMatrices("mBones", mesh.skeleton.getTransformMatrices());
  27474. }
  27475. // Draw
  27476. mesh._processRendering(subMesh, _this._effect, BABYLON.Material.TriangleFillMode, batch, hardwareInstancedRendering, function (isInstance, world) { return _this._effect.setMatrix("world", world); });
  27477. }
  27478. };
  27479. this._depthMap.customRenderFunction = function (opaqueSubMeshes, alphaTestSubMeshes) {
  27480. var index;
  27481. for (index = 0; index < opaqueSubMeshes.length; index++) {
  27482. renderSubMesh(opaqueSubMeshes.data[index]);
  27483. }
  27484. for (index = 0; index < alphaTestSubMeshes.length; index++) {
  27485. renderSubMesh(alphaTestSubMeshes.data[index]);
  27486. }
  27487. };
  27488. }
  27489. DepthRenderer.prototype.isReady = function (subMesh, useInstances) {
  27490. var defines = [];
  27491. var attribs = [BABYLON.VertexBuffer.PositionKind];
  27492. var mesh = subMesh.getMesh();
  27493. var scene = mesh.getScene();
  27494. var material = subMesh.getMaterial();
  27495. // Alpha test
  27496. if (material && material.needAlphaTesting()) {
  27497. defines.push("#define ALPHATEST");
  27498. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  27499. attribs.push(BABYLON.VertexBuffer.UVKind);
  27500. defines.push("#define UV1");
  27501. }
  27502. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  27503. attribs.push(BABYLON.VertexBuffer.UV2Kind);
  27504. defines.push("#define UV2");
  27505. }
  27506. }
  27507. // Bones
  27508. if (mesh.useBones) {
  27509. attribs.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  27510. attribs.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  27511. defines.push("#define BONES");
  27512. defines.push("#define BonesPerMesh " + (mesh.skeleton.bones.length + 1));
  27513. }
  27514. // Instances
  27515. if (useInstances) {
  27516. defines.push("#define INSTANCES");
  27517. attribs.push("world0");
  27518. attribs.push("world1");
  27519. attribs.push("world2");
  27520. attribs.push("world3");
  27521. }
  27522. // Get correct effect
  27523. var join = defines.join("\n");
  27524. if (this._cachedDefines !== join) {
  27525. this._cachedDefines = join;
  27526. this._effect = this._scene.getEngine().createEffect("depth", attribs, ["world", "mBones", "viewProjection", "diffuseMatrix", "far"], ["diffuseSampler"], join);
  27527. }
  27528. return this._effect.isReady();
  27529. };
  27530. DepthRenderer.prototype.getDepthMap = function () {
  27531. return this._depthMap;
  27532. };
  27533. // Methods
  27534. DepthRenderer.prototype.dispose = function () {
  27535. this._depthMap.dispose();
  27536. };
  27537. return DepthRenderer;
  27538. })();
  27539. BABYLON.DepthRenderer = DepthRenderer;
  27540. })(BABYLON || (BABYLON = {}));
  27541. //# sourceMappingURL=babylon.depthRenderer.js.map
  27542. var BABYLON;
  27543. (function (BABYLON) {
  27544. var SSAORenderingPipeline = (function (_super) {
  27545. __extends(SSAORenderingPipeline, _super);
  27546. /**
  27547. * @constructor
  27548. * @param {string} name - The rendering pipeline name
  27549. * @param {BABYLON.Scene} scene - The scene linked to this pipeline
  27550. * @param {number} ratio - The size of the postprocesses (0.5 means that your postprocess will have a width = canvas.width 0.5 and a height = canvas.height 0.5)
  27551. * @param {BABYLON.Camera[]} cameras - The array of cameras that the rendering pipeline will be attached to
  27552. */
  27553. function SSAORenderingPipeline(name, scene, ratio, cameras) {
  27554. var _this = this;
  27555. if (ratio === void 0) { ratio = 1.0; }
  27556. _super.call(this, scene.getEngine(), name);
  27557. // Members
  27558. /**
  27559. * The PassPostProcess id in the pipeline that contains the original scene color
  27560. * @type {string}
  27561. */
  27562. this.SSAOOriginalSceneColorEffect = "SSAOOriginalSceneColorEffect";
  27563. /**
  27564. * The SSAO PostProcess id in the pipeline
  27565. * @type {string}
  27566. */
  27567. this.SSAORenderEffect = "SSAORenderEffect";
  27568. /**
  27569. * The horizontal blur PostProcess id in the pipeline
  27570. * @type {string}
  27571. */
  27572. this.SSAOBlurHRenderEffect = "SSAOBlurHRenderEffect";
  27573. /**
  27574. * The vertical blur PostProcess id in the pipeline
  27575. * @type {string}
  27576. */
  27577. this.SSAOBlurVRenderEffect = "SSAOBlurVRenderEffect";
  27578. /**
  27579. * The PostProcess id in the pipeline that combines the SSAO-Blur output with the original scene color (SSAOOriginalSceneColorEffect)
  27580. * @type {string}
  27581. */
  27582. this.SSAOCombineRenderEffect = "SSAOCombineRenderEffect";
  27583. this._firstUpdate = true;
  27584. this._scene = scene;
  27585. // Set up assets
  27586. this._createRandomTexture();
  27587. this._depthTexture = scene.enableDepthRenderer().getDepthMap(); // Force depth renderer "on"
  27588. this._originalColorPostProcess = new BABYLON.PassPostProcess("SSAOOriginalSceneColor", 1.0, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, scene.getEngine(), false);
  27589. this._createSSAOPostProcess(ratio);
  27590. this._blurHPostProcess = new BABYLON.BlurPostProcess("SSAOBlurH", new BABYLON.Vector2(2.0, 0.0), 1.3, ratio, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, scene.getEngine(), false);
  27591. this._blurVPostProcess = new BABYLON.BlurPostProcess("SSAOBlurV", new BABYLON.Vector2(0.0, 2.0), 1.3, ratio, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, scene.getEngine(), false);
  27592. this._createSSAOCombinePostProcess();
  27593. // Set up pipeline
  27594. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), this.SSAOOriginalSceneColorEffect, function () {
  27595. return _this._originalColorPostProcess;
  27596. }, true));
  27597. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), this.SSAORenderEffect, function () {
  27598. return _this._ssaoPostProcess;
  27599. }, true));
  27600. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), this.SSAOBlurHRenderEffect, function () {
  27601. return _this._blurHPostProcess;
  27602. }, true));
  27603. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), this.SSAOBlurVRenderEffect, function () {
  27604. return _this._blurVPostProcess;
  27605. }, true));
  27606. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), this.SSAOCombineRenderEffect, function () {
  27607. return _this._ssaoCombinePostProcess;
  27608. }, true));
  27609. // Finish
  27610. scene.postProcessRenderPipelineManager.addPipeline(this);
  27611. if (cameras)
  27612. scene.postProcessRenderPipelineManager.attachCamerasToRenderPipeline(name, cameras);
  27613. }
  27614. // Public Methods
  27615. /**
  27616. * Returns the horizontal blur PostProcess
  27617. * @return {BABYLON.BlurPostProcess} The horizontal blur post-process
  27618. */
  27619. SSAORenderingPipeline.prototype.getBlurHPostProcess = function () {
  27620. return this._blurHPostProcess;
  27621. };
  27622. /**
  27623. * Returns the vertical blur PostProcess
  27624. * @return {BABYLON.BlurPostProcess} The vertical blur post-process
  27625. */
  27626. SSAORenderingPipeline.prototype.getBlurVPostProcess = function () {
  27627. return this._blurVPostProcess;
  27628. };
  27629. /**
  27630. * Removes the internal pipeline assets and detatches the pipeline from the scene cameras
  27631. */
  27632. SSAORenderingPipeline.prototype.dispose = function () {
  27633. this._scene.postProcessRenderPipelineManager.detachCamerasFromRenderPipeline(this._name, this._scene.cameras);
  27634. this._originalColorPostProcess = undefined;
  27635. this._ssaoPostProcess = undefined;
  27636. this._blurHPostProcess = undefined;
  27637. this._blurVPostProcess = undefined;
  27638. this._ssaoCombinePostProcess = undefined;
  27639. this._randomTexture.dispose();
  27640. };
  27641. // Private Methods
  27642. SSAORenderingPipeline.prototype._createSSAOPostProcess = function (ratio) {
  27643. var _this = this;
  27644. var sampleSphere = [
  27645. 0.5381,
  27646. 0.1856,
  27647. -0.4319,
  27648. 0.1379,
  27649. 0.2486,
  27650. 0.4430,
  27651. 0.3371,
  27652. 0.5679,
  27653. -0.0057,
  27654. -0.6999,
  27655. -0.0451,
  27656. -0.0019,
  27657. 0.0689,
  27658. -0.1598,
  27659. -0.8547,
  27660. 0.0560,
  27661. 0.0069,
  27662. -0.1843,
  27663. -0.0146,
  27664. 0.1402,
  27665. 0.0762,
  27666. 0.0100,
  27667. -0.1924,
  27668. -0.0344,
  27669. -0.3577,
  27670. -0.5301,
  27671. -0.4358,
  27672. -0.3169,
  27673. 0.1063,
  27674. 0.0158,
  27675. 0.0103,
  27676. -0.5869,
  27677. 0.0046,
  27678. -0.0897,
  27679. -0.4940,
  27680. 0.3287,
  27681. 0.7119,
  27682. -0.0154,
  27683. -0.0918,
  27684. -0.0533,
  27685. 0.0596,
  27686. -0.5411,
  27687. 0.0352,
  27688. -0.0631,
  27689. 0.5460,
  27690. -0.4776,
  27691. 0.2847,
  27692. -0.0271
  27693. ];
  27694. var samplesFactor = 1.0 / 16.0;
  27695. this._ssaoPostProcess = new BABYLON.PostProcess("ssao", "ssao", ["sampleSphere", "samplesFactor", "randTextureTiles"], ["randomSampler"], ratio, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, this._scene.getEngine(), false);
  27696. this._ssaoPostProcess.onApply = function (effect) {
  27697. if (_this._firstUpdate) {
  27698. effect.setArray3("sampleSphere", sampleSphere);
  27699. effect.setFloat("samplesFactor", samplesFactor);
  27700. effect.setFloat("randTextureTiles", 4.0 / ratio);
  27701. _this._firstUpdate = false;
  27702. }
  27703. effect.setTexture("textureSampler", _this._depthTexture);
  27704. effect.setTexture("randomSampler", _this._randomTexture);
  27705. };
  27706. };
  27707. SSAORenderingPipeline.prototype._createSSAOCombinePostProcess = function () {
  27708. var _this = this;
  27709. this._ssaoCombinePostProcess = new BABYLON.PostProcess("ssaoCombine", "ssaoCombine", [], ["originalColor"], 1.0, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, this._scene.getEngine(), false);
  27710. this._ssaoCombinePostProcess.onApply = function (effect) {
  27711. effect.setTextureFromPostProcess("originalColor", _this._originalColorPostProcess);
  27712. };
  27713. };
  27714. SSAORenderingPipeline.prototype._createRandomTexture = function () {
  27715. var size = 512;
  27716. this._randomTexture = new BABYLON.DynamicTexture("SSAORandomTexture", size, this._scene, false, BABYLON.Texture.BILINEAR_SAMPLINGMODE);
  27717. this._randomTexture.wrapU = BABYLON.Texture.WRAP_ADDRESSMODE;
  27718. this._randomTexture.wrapV = BABYLON.Texture.WRAP_ADDRESSMODE;
  27719. var context = this._randomTexture.getContext();
  27720. var rand = function (min, max) {
  27721. return Math.random() * (max - min) + min;
  27722. };
  27723. for (var x = 0; x < size; x++) {
  27724. for (var y = 0; y < size; y++) {
  27725. var randVector = BABYLON.Vector3.Zero();
  27726. randVector.x = Math.floor(rand(0.0, 1.0) * 255);
  27727. randVector.y = Math.floor(rand(0.0, 1.0) * 255);
  27728. randVector.z = Math.floor(rand(0.0, 1.0) * 255);
  27729. context.fillStyle = 'rgb(' + randVector.x + ', ' + randVector.y + ', ' + randVector.z + ')';
  27730. context.fillRect(x, y, 1, 1);
  27731. }
  27732. }
  27733. this._randomTexture.update(false);
  27734. };
  27735. return SSAORenderingPipeline;
  27736. })(BABYLON.PostProcessRenderPipeline);
  27737. BABYLON.SSAORenderingPipeline = SSAORenderingPipeline;
  27738. })(BABYLON || (BABYLON = {}));
  27739. //# sourceMappingURL=babylon.ssaoRenderingPipeline.js.map
  27740. var BABYLON;
  27741. (function (BABYLON) {
  27742. var VolumetricLightScatteringPostProcess = (function (_super) {
  27743. __extends(VolumetricLightScatteringPostProcess, _super);
  27744. /**
  27745. * @constructor
  27746. * @param {string} name - The post-process name
  27747. * @param {number} ratio - The size of the postprocesses (0.5 means that your postprocess will have a width = canvas.width 0.5 and a height = canvas.height 0.5)
  27748. * @param {BABYLON.Camera} camera - The camera that the post-process will be attached to
  27749. * @param {BABYLON.Mesh} mesh - The mesh used to create the light scattering
  27750. * @param {number} samplingMode - The post-process filtering mode
  27751. * @param {BABYLON.Engine} engine - The babylon engine
  27752. * @param {boolean} reusable - If the post-process is reusable
  27753. */
  27754. function VolumetricLightScatteringPostProcess(name, ratio, camera, mesh, samplingMode, engine, reusable) {
  27755. var _this = this;
  27756. _super.call(this, name, "volumetricLightScattering", ["lightPositionOnScreen"], ["lightScatteringSampler"], ratio, camera, samplingMode, engine, reusable);
  27757. this._screenCoordinates = BABYLON.Vector2.Zero();
  27758. /**
  27759. * Set if the post-process should use a custom position for the light source (true) or the internal mesh position (false)
  27760. * @type {boolean}
  27761. */
  27762. this.useCustomLightPosition = false;
  27763. /**
  27764. * If the post-process should inverse the light scattering direction
  27765. * @type {boolean}
  27766. */
  27767. this.invert = true;
  27768. var scene = camera.getScene();
  27769. this._viewPort = new BABYLON.Viewport(0, 0, 1, 1).toGlobal(scene.getEngine());
  27770. // Configure mesh
  27771. this.mesh = (mesh !== null) ? mesh : VolumetricLightScatteringPostProcess.CreateDefaultMesh("VolumetricLightScatteringMesh", scene);
  27772. // Configure
  27773. this._createPass(scene);
  27774. this.onApply = function (effect) {
  27775. _this._updateScreenCoordinates(scene);
  27776. effect.setTexture("lightScatteringSampler", _this._godRaysRTT);
  27777. effect.setVector2("lightPositionOnScreen", _this._screenCoordinates);
  27778. };
  27779. }
  27780. VolumetricLightScatteringPostProcess.prototype.isReady = function (subMesh, useInstances) {
  27781. var mesh = subMesh.getMesh();
  27782. var defines = [];
  27783. var attribs = [BABYLON.VertexBuffer.PositionKind];
  27784. var material = subMesh.getMaterial();
  27785. // Render this.mesh as default
  27786. if (mesh === this.mesh) {
  27787. defines.push("#define BASIC_RENDER");
  27788. }
  27789. // Alpha test
  27790. if (material) {
  27791. if (material.needAlphaTesting() || mesh === this.mesh)
  27792. defines.push("#define ALPHATEST");
  27793. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  27794. attribs.push(BABYLON.VertexBuffer.UVKind);
  27795. defines.push("#define UV1");
  27796. }
  27797. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  27798. attribs.push(BABYLON.VertexBuffer.UV2Kind);
  27799. defines.push("#define UV2");
  27800. }
  27801. }
  27802. // Bones
  27803. if (mesh.useBones) {
  27804. attribs.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  27805. attribs.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  27806. defines.push("#define BONES");
  27807. defines.push("#define BonesPerMesh " + (mesh.skeleton.bones.length + 1));
  27808. }
  27809. // Instances
  27810. if (useInstances) {
  27811. defines.push("#define INSTANCES");
  27812. attribs.push("world0");
  27813. attribs.push("world1");
  27814. attribs.push("world2");
  27815. attribs.push("world3");
  27816. }
  27817. // Get correct effect
  27818. var join = defines.join("\n");
  27819. if (this._cachedDefines !== join) {
  27820. this._cachedDefines = join;
  27821. this._godRaysPass = mesh.getScene().getEngine().createEffect({ vertexElement: "depth", fragmentElement: "volumetricLightScatteringPass" }, attribs, ["world", "mBones", "viewProjection", "diffuseMatrix", "far"], ["diffuseSampler"], join);
  27822. }
  27823. return this._godRaysPass.isReady();
  27824. };
  27825. /**
  27826. * Sets the new light position for light scattering effect
  27827. * @param {BABYLON.Vector3} The new custom light position
  27828. */
  27829. VolumetricLightScatteringPostProcess.prototype.setLightPosition = function (position) {
  27830. this._customLightPosition = position;
  27831. };
  27832. /**
  27833. * Returns the light position for light scattering effect
  27834. * @return {BABYLON.Vector3} The custom light position
  27835. */
  27836. VolumetricLightScatteringPostProcess.prototype.getLightPosition = function () {
  27837. return this._customLightPosition;
  27838. };
  27839. /**
  27840. * Disposes the internal assets and detaches the post-process from the camera
  27841. */
  27842. VolumetricLightScatteringPostProcess.prototype.dispose = function (camera) {
  27843. this._godRaysRTT.dispose();
  27844. _super.prototype.dispose.call(this, camera);
  27845. };
  27846. /**
  27847. * Returns the render target texture used by the post-process
  27848. * @return {BABYLON.RenderTargetTexture} The render target texture used by the post-process
  27849. */
  27850. VolumetricLightScatteringPostProcess.prototype.getPass = function () {
  27851. return this._godRaysRTT;
  27852. };
  27853. // Private methods
  27854. VolumetricLightScatteringPostProcess.prototype._createPass = function (scene) {
  27855. var _this = this;
  27856. var engine = scene.getEngine();
  27857. this._godRaysRTT = new BABYLON.RenderTargetTexture("volumetricLightScatteringMap", { width: engine.getRenderWidth(), height: engine.getRenderHeight() }, scene, false, true, BABYLON.Engine.TEXTURETYPE_UNSIGNED_INT);
  27858. this._godRaysRTT.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  27859. this._godRaysRTT.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  27860. this._godRaysRTT.renderList = null;
  27861. this._godRaysRTT.renderParticles = false;
  27862. scene.customRenderTargets.push(this._godRaysRTT);
  27863. // Custom render function for submeshes
  27864. var renderSubMesh = function (subMesh) {
  27865. var mesh = subMesh.getRenderingMesh();
  27866. var scene = mesh.getScene();
  27867. var engine = scene.getEngine();
  27868. // Culling
  27869. engine.setState(subMesh.getMaterial().backFaceCulling);
  27870. // Managing instances
  27871. var batch = mesh._getInstancesRenderList(subMesh._id);
  27872. if (batch.mustReturn) {
  27873. return;
  27874. }
  27875. var hardwareInstancedRendering = (engine.getCaps().instancedArrays !== null) && (batch.visibleInstances[subMesh._id] !== null);
  27876. if (_this.isReady(subMesh, hardwareInstancedRendering)) {
  27877. engine.enableEffect(_this._godRaysPass);
  27878. mesh._bind(subMesh, _this._godRaysPass, BABYLON.Material.TriangleFillMode);
  27879. var material = subMesh.getMaterial();
  27880. _this._godRaysPass.setMatrix("viewProjection", scene.getTransformMatrix());
  27881. // Alpha test
  27882. if (material && (mesh === _this.mesh || material.needAlphaTesting())) {
  27883. var alphaTexture = material.getAlphaTestTexture();
  27884. _this._godRaysPass.setTexture("diffuseSampler", alphaTexture);
  27885. _this._godRaysPass.setMatrix("diffuseMatrix", alphaTexture.getTextureMatrix());
  27886. }
  27887. // Bones
  27888. if (mesh.useBones) {
  27889. _this._godRaysPass.setMatrices("mBones", mesh.skeleton.getTransformMatrices());
  27890. }
  27891. // Draw
  27892. mesh._processRendering(subMesh, _this._godRaysPass, BABYLON.Material.TriangleFillMode, batch, hardwareInstancedRendering, function (isInstance, world) { return _this._godRaysPass.setMatrix("world", world); });
  27893. }
  27894. };
  27895. // Render target texture callbacks
  27896. var savedSceneClearColor;
  27897. var sceneClearColor = new BABYLON.Color3(0.0, 0.0, 0.0);
  27898. this._godRaysRTT.onBeforeRender = function () {
  27899. savedSceneClearColor = scene.clearColor;
  27900. scene.clearColor = sceneClearColor;
  27901. };
  27902. this._godRaysRTT.onAfterRender = function () {
  27903. scene.clearColor = savedSceneClearColor;
  27904. };
  27905. this._godRaysRTT.customRenderFunction = function (opaqueSubMeshes, alphaTestSubMeshes) {
  27906. var index;
  27907. for (index = 0; index < opaqueSubMeshes.length; index++) {
  27908. renderSubMesh(opaqueSubMeshes.data[index]);
  27909. }
  27910. for (index = 0; index < alphaTestSubMeshes.length; index++) {
  27911. renderSubMesh(alphaTestSubMeshes.data[index]);
  27912. }
  27913. };
  27914. };
  27915. VolumetricLightScatteringPostProcess.prototype._updateScreenCoordinates = function (scene) {
  27916. var transform = scene.getTransformMatrix();
  27917. var pos = BABYLON.Vector3.Project(this.useCustomLightPosition ? this._customLightPosition : this.mesh.position, BABYLON.Matrix.Identity(), transform, this._viewPort);
  27918. this._screenCoordinates.x = pos.x / this._viewPort.width;
  27919. this._screenCoordinates.y = pos.y / this._viewPort.height;
  27920. if (this.invert)
  27921. this._screenCoordinates.y = 1.0 - this._screenCoordinates.y;
  27922. };
  27923. // Static methods
  27924. /**
  27925. * Creates a default mesh for the Volumeric Light Scattering post-process
  27926. * @param {string} The mesh name
  27927. * @param {BABYLON.Scene} The scene where to create the mesh
  27928. * @return {BABYLON.Mesh} the default mesh
  27929. */
  27930. VolumetricLightScatteringPostProcess.CreateDefaultMesh = function (name, scene) {
  27931. var mesh = BABYLON.Mesh.CreatePlane(name, 1, scene);
  27932. mesh.billboardMode = BABYLON.AbstractMesh.BILLBOARDMODE_ALL;
  27933. mesh.material = new BABYLON.StandardMaterial(name + "Material", scene);
  27934. return mesh;
  27935. };
  27936. return VolumetricLightScatteringPostProcess;
  27937. })(BABYLON.PostProcess);
  27938. BABYLON.VolumetricLightScatteringPostProcess = VolumetricLightScatteringPostProcess;
  27939. })(BABYLON || (BABYLON = {}));
  27940. //# sourceMappingURL=babylon.volumetricLightScatteringPostProcess.js.map