babylon.max.js 1.8 MB

123456789101112131415161718192021222324252627282930313233343536373839404142434445464748495051525354555657585960616263646566676869707172737475767778798081828384858687888990919293949596979899100101102103104105106107108109110111112113114115116117118119120121122123124125126127128129130131132133134135136137138139140141142143144145146147148149150151152153154155156157158159160161162163164165166167168169170171172173174175176177178179180181182183184185186187188189190191192193194195196197198199200201202203204205206207208209210211212213214215216217218219220221222223224225226227228229230231232233234235236237238239240241242243244245246247248249250251252253254255256257258259260261262263264265266267268269270271272273274275276277278279280281282283284285286287288289290291292293294295296297298299300301302303304305306307308309310311312313314315316317318319320321322323324325326327328329330331332333334335336337338339340341342343344345346347348349350351352353354355356357358359360361362363364365366367368369370371372373374375376377378379380381382383384385386387388389390391392393394395396397398399400401402403404405406407408409410411412413414415416417418419420421422423424425426427428429430431432433434435436437438439440441442443444445446447448449450451452453454455456457458459460461462463464465466467468469470471472473474475476477478479480481482483484485486487488489490491492493494495496497498499500501502503504505506507508509510511512513514515516517518519520521522523524525526527528529530531532533534535536537538539540541542543544545546547548549550551552553554555556557558559560561562563564565566567568569570571572573574575576577578579580581582583584585586587588589590591592593594595596597598599600601602603604605606607608609610611612613614615616617618619620621622623624625626627628629630631632633634635636637638639640641642643644645646647648649650651652653654655656657658659660661662663664665666667668669670671672673674675676677678679680681682683684685686687688689690691692693694695696697698699700701702703704705706707708709710711712713714715716717718719720721722723724725726727728729730731732733734735736737738739740741742743744745746747748749750751752753754755756757758759760761762763764765766767768769770771772773774775776777778779780781782783784785786787788789790791792793794795796797798799800801802803804805806807808809810811812813814815816817818819820821822823824825826827828829830831832833834835836837838839840841842843844845846847848849850851852853854855856857858859860861862863864865866867868869870871872873874875876877878879880881882883884885886887888889890891892893894895896897898899900901902903904905906907908909910911912913914915916917918919920921922923924925926927928929930931932933934935936937938939940941942943944945946947948949950951952953954955956957958959960961962963964965966967968969970971972973974975976977978979980981982983984985986987988989990991992993994995996997998999100010011002100310041005100610071008100910101011101210131014101510161017101810191020102110221023102410251026102710281029103010311032103310341035103610371038103910401041104210431044104510461047104810491050105110521053105410551056105710581059106010611062106310641065106610671068106910701071107210731074107510761077107810791080108110821083108410851086108710881089109010911092109310941095109610971098109911001101110211031104110511061107110811091110111111121113111411151116111711181119112011211122112311241125112611271128112911301131113211331134113511361137113811391140114111421143114411451146114711481149115011511152115311541155115611571158115911601161116211631164116511661167116811691170117111721173117411751176117711781179118011811182118311841185118611871188118911901191119211931194119511961197119811991200120112021203120412051206120712081209121012111212121312141215121612171218121912201221122212231224122512261227122812291230123112321233123412351236123712381239124012411242124312441245124612471248124912501251125212531254125512561257125812591260126112621263126412651266126712681269127012711272127312741275127612771278127912801281128212831284128512861287128812891290129112921293129412951296129712981299130013011302130313041305130613071308130913101311131213131314131513161317131813191320132113221323132413251326132713281329133013311332133313341335133613371338133913401341134213431344134513461347134813491350135113521353135413551356135713581359136013611362136313641365136613671368136913701371137213731374137513761377137813791380138113821383138413851386138713881389139013911392139313941395139613971398139914001401140214031404140514061407140814091410141114121413141414151416141714181419142014211422142314241425142614271428142914301431143214331434143514361437143814391440144114421443144414451446144714481449145014511452145314541455145614571458145914601461146214631464146514661467146814691470147114721473147414751476147714781479148014811482148314841485148614871488148914901491149214931494149514961497149814991500150115021503150415051506150715081509151015111512151315141515151615171518151915201521152215231524152515261527152815291530153115321533153415351536153715381539154015411542154315441545154615471548154915501551155215531554155515561557155815591560156115621563156415651566156715681569157015711572157315741575157615771578157915801581158215831584158515861587158815891590159115921593159415951596159715981599160016011602160316041605160616071608160916101611161216131614161516161617161816191620162116221623162416251626162716281629163016311632163316341635163616371638163916401641164216431644164516461647164816491650165116521653165416551656165716581659166016611662166316641665166616671668166916701671167216731674167516761677167816791680168116821683168416851686168716881689169016911692169316941695169616971698169917001701170217031704170517061707170817091710171117121713171417151716171717181719172017211722172317241725172617271728172917301731173217331734173517361737173817391740174117421743174417451746174717481749175017511752175317541755175617571758175917601761176217631764176517661767176817691770177117721773177417751776177717781779178017811782178317841785178617871788178917901791179217931794179517961797179817991800180118021803180418051806180718081809181018111812181318141815181618171818181918201821182218231824182518261827182818291830183118321833183418351836183718381839184018411842184318441845184618471848184918501851185218531854185518561857185818591860186118621863186418651866186718681869187018711872187318741875187618771878187918801881188218831884188518861887188818891890189118921893189418951896189718981899190019011902190319041905190619071908190919101911191219131914191519161917191819191920192119221923192419251926192719281929193019311932193319341935193619371938193919401941194219431944194519461947194819491950195119521953195419551956195719581959196019611962196319641965196619671968196919701971197219731974197519761977197819791980198119821983198419851986198719881989199019911992199319941995199619971998199920002001200220032004200520062007200820092010201120122013201420152016201720182019202020212022202320242025202620272028202920302031203220332034203520362037203820392040204120422043204420452046204720482049205020512052205320542055205620572058205920602061206220632064206520662067206820692070207120722073207420752076207720782079208020812082208320842085208620872088208920902091209220932094209520962097209820992100210121022103210421052106210721082109211021112112211321142115211621172118211921202121212221232124212521262127212821292130213121322133213421352136213721382139214021412142214321442145214621472148214921502151215221532154215521562157215821592160216121622163216421652166216721682169217021712172217321742175217621772178217921802181218221832184218521862187218821892190219121922193219421952196219721982199220022012202220322042205220622072208220922102211221222132214221522162217221822192220222122222223222422252226222722282229223022312232223322342235223622372238223922402241224222432244224522462247224822492250225122522253225422552256225722582259226022612262226322642265226622672268226922702271227222732274227522762277227822792280228122822283228422852286228722882289229022912292229322942295229622972298229923002301230223032304230523062307230823092310231123122313231423152316231723182319232023212322232323242325232623272328232923302331233223332334233523362337233823392340234123422343234423452346234723482349235023512352235323542355235623572358235923602361236223632364236523662367236823692370237123722373237423752376237723782379238023812382238323842385238623872388238923902391239223932394239523962397239823992400240124022403240424052406240724082409241024112412241324142415241624172418241924202421242224232424242524262427242824292430243124322433243424352436243724382439244024412442244324442445244624472448244924502451245224532454245524562457245824592460246124622463246424652466246724682469247024712472247324742475247624772478247924802481248224832484248524862487248824892490249124922493249424952496249724982499250025012502250325042505250625072508250925102511251225132514251525162517251825192520252125222523252425252526252725282529253025312532253325342535253625372538253925402541254225432544254525462547254825492550255125522553255425552556255725582559256025612562256325642565256625672568256925702571257225732574257525762577257825792580258125822583258425852586258725882589259025912592259325942595259625972598259926002601260226032604260526062607260826092610261126122613261426152616261726182619262026212622262326242625262626272628262926302631263226332634263526362637263826392640264126422643264426452646264726482649265026512652265326542655265626572658265926602661266226632664266526662667266826692670267126722673267426752676267726782679268026812682268326842685268626872688268926902691269226932694269526962697269826992700270127022703270427052706270727082709271027112712271327142715271627172718271927202721272227232724272527262727272827292730273127322733273427352736273727382739274027412742274327442745274627472748274927502751275227532754275527562757275827592760276127622763276427652766276727682769277027712772277327742775277627772778277927802781278227832784278527862787278827892790279127922793279427952796279727982799280028012802280328042805280628072808280928102811281228132814281528162817281828192820282128222823282428252826282728282829283028312832283328342835283628372838283928402841284228432844284528462847284828492850285128522853285428552856285728582859286028612862286328642865286628672868286928702871287228732874287528762877287828792880288128822883288428852886288728882889289028912892289328942895289628972898289929002901290229032904290529062907290829092910291129122913291429152916291729182919292029212922292329242925292629272928292929302931293229332934293529362937293829392940294129422943294429452946294729482949295029512952295329542955295629572958295929602961296229632964296529662967296829692970297129722973297429752976297729782979298029812982298329842985298629872988298929902991299229932994299529962997299829993000300130023003300430053006300730083009301030113012301330143015301630173018301930203021302230233024302530263027302830293030303130323033303430353036303730383039304030413042304330443045304630473048304930503051305230533054305530563057305830593060306130623063306430653066306730683069307030713072307330743075307630773078307930803081308230833084308530863087308830893090309130923093309430953096309730983099310031013102310331043105310631073108310931103111311231133114311531163117311831193120312131223123312431253126312731283129313031313132313331343135313631373138313931403141314231433144314531463147314831493150315131523153315431553156315731583159316031613162316331643165316631673168316931703171317231733174317531763177317831793180318131823183318431853186318731883189319031913192319331943195319631973198319932003201320232033204320532063207320832093210321132123213321432153216321732183219322032213222322332243225322632273228322932303231323232333234323532363237323832393240324132423243324432453246324732483249325032513252325332543255325632573258325932603261326232633264326532663267326832693270327132723273327432753276327732783279328032813282328332843285328632873288328932903291329232933294329532963297329832993300330133023303330433053306330733083309331033113312331333143315331633173318331933203321332233233324332533263327332833293330333133323333333433353336333733383339334033413342334333443345334633473348334933503351335233533354335533563357335833593360336133623363336433653366336733683369337033713372337333743375337633773378337933803381338233833384338533863387338833893390339133923393339433953396339733983399340034013402340334043405340634073408340934103411341234133414341534163417341834193420342134223423342434253426342734283429343034313432343334343435343634373438343934403441344234433444344534463447344834493450345134523453345434553456345734583459346034613462346334643465346634673468346934703471347234733474347534763477347834793480348134823483348434853486348734883489349034913492349334943495349634973498349935003501350235033504350535063507350835093510351135123513351435153516351735183519352035213522352335243525352635273528352935303531353235333534353535363537353835393540354135423543354435453546354735483549355035513552355335543555355635573558355935603561356235633564356535663567356835693570357135723573357435753576357735783579358035813582358335843585358635873588358935903591359235933594359535963597359835993600360136023603360436053606360736083609361036113612361336143615361636173618361936203621362236233624362536263627362836293630363136323633363436353636363736383639364036413642364336443645364636473648364936503651365236533654365536563657365836593660366136623663366436653666366736683669367036713672367336743675367636773678367936803681368236833684368536863687368836893690369136923693369436953696369736983699370037013702370337043705370637073708370937103711371237133714371537163717371837193720372137223723372437253726372737283729373037313732373337343735373637373738373937403741374237433744374537463747374837493750375137523753375437553756375737583759376037613762376337643765376637673768376937703771377237733774377537763777377837793780378137823783378437853786378737883789379037913792379337943795379637973798379938003801380238033804380538063807380838093810381138123813381438153816381738183819382038213822382338243825382638273828382938303831383238333834383538363837383838393840384138423843384438453846384738483849385038513852385338543855385638573858385938603861386238633864386538663867386838693870387138723873387438753876387738783879388038813882388338843885388638873888388938903891389238933894389538963897389838993900390139023903390439053906390739083909391039113912391339143915391639173918391939203921392239233924392539263927392839293930393139323933393439353936393739383939394039413942394339443945394639473948394939503951395239533954395539563957395839593960396139623963396439653966396739683969397039713972397339743975397639773978397939803981398239833984398539863987398839893990399139923993399439953996399739983999400040014002400340044005400640074008400940104011401240134014401540164017401840194020402140224023402440254026402740284029403040314032403340344035403640374038403940404041404240434044404540464047404840494050405140524053405440554056405740584059406040614062406340644065406640674068406940704071407240734074407540764077407840794080408140824083408440854086408740884089409040914092409340944095409640974098409941004101410241034104410541064107410841094110411141124113411441154116411741184119412041214122412341244125412641274128412941304131413241334134413541364137413841394140414141424143414441454146414741484149415041514152415341544155415641574158415941604161416241634164416541664167416841694170417141724173417441754176417741784179418041814182418341844185418641874188418941904191419241934194419541964197419841994200420142024203420442054206420742084209421042114212421342144215421642174218421942204221422242234224422542264227422842294230423142324233423442354236423742384239424042414242424342444245424642474248424942504251425242534254425542564257425842594260426142624263426442654266426742684269427042714272427342744275427642774278427942804281428242834284428542864287428842894290429142924293429442954296429742984299430043014302430343044305430643074308430943104311431243134314431543164317431843194320432143224323432443254326432743284329433043314332433343344335433643374338433943404341434243434344434543464347434843494350435143524353435443554356435743584359436043614362436343644365436643674368436943704371437243734374437543764377437843794380438143824383438443854386438743884389439043914392439343944395439643974398439944004401440244034404440544064407440844094410441144124413441444154416441744184419442044214422442344244425442644274428442944304431443244334434443544364437443844394440444144424443444444454446444744484449445044514452445344544455445644574458445944604461446244634464446544664467446844694470447144724473447444754476447744784479448044814482448344844485448644874488448944904491449244934494449544964497449844994500450145024503450445054506450745084509451045114512451345144515451645174518451945204521452245234524452545264527452845294530453145324533453445354536453745384539454045414542454345444545454645474548454945504551455245534554455545564557455845594560456145624563456445654566456745684569457045714572457345744575457645774578457945804581458245834584458545864587458845894590459145924593459445954596459745984599460046014602460346044605460646074608460946104611461246134614461546164617461846194620462146224623462446254626462746284629463046314632463346344635463646374638463946404641464246434644464546464647464846494650465146524653465446554656465746584659466046614662466346644665466646674668466946704671467246734674467546764677467846794680468146824683468446854686468746884689469046914692469346944695469646974698469947004701470247034704470547064707470847094710471147124713471447154716471747184719472047214722472347244725472647274728472947304731473247334734473547364737473847394740474147424743474447454746474747484749475047514752475347544755475647574758475947604761476247634764476547664767476847694770477147724773477447754776477747784779478047814782478347844785478647874788478947904791479247934794479547964797479847994800480148024803480448054806480748084809481048114812481348144815481648174818481948204821482248234824482548264827482848294830483148324833483448354836483748384839484048414842484348444845484648474848484948504851485248534854485548564857485848594860486148624863486448654866486748684869487048714872487348744875487648774878487948804881488248834884488548864887488848894890489148924893489448954896489748984899490049014902490349044905490649074908490949104911491249134914491549164917491849194920492149224923492449254926492749284929493049314932493349344935493649374938493949404941494249434944494549464947494849494950495149524953495449554956495749584959496049614962496349644965496649674968496949704971497249734974497549764977497849794980498149824983498449854986498749884989499049914992499349944995499649974998499950005001500250035004500550065007500850095010501150125013501450155016501750185019502050215022502350245025502650275028502950305031503250335034503550365037503850395040504150425043504450455046504750485049505050515052505350545055505650575058505950605061506250635064506550665067506850695070507150725073507450755076507750785079508050815082508350845085508650875088508950905091509250935094509550965097509850995100510151025103510451055106510751085109511051115112511351145115511651175118511951205121512251235124512551265127512851295130513151325133513451355136513751385139514051415142514351445145514651475148514951505151515251535154515551565157515851595160516151625163516451655166516751685169517051715172517351745175517651775178517951805181518251835184518551865187518851895190519151925193519451955196519751985199520052015202520352045205520652075208520952105211521252135214521552165217521852195220522152225223522452255226522752285229523052315232523352345235523652375238523952405241524252435244524552465247524852495250525152525253525452555256525752585259526052615262526352645265526652675268526952705271527252735274527552765277527852795280528152825283528452855286528752885289529052915292529352945295529652975298529953005301530253035304530553065307530853095310531153125313531453155316531753185319532053215322532353245325532653275328532953305331533253335334533553365337533853395340534153425343534453455346534753485349535053515352535353545355535653575358535953605361536253635364536553665367536853695370537153725373537453755376537753785379538053815382538353845385538653875388538953905391539253935394539553965397539853995400540154025403540454055406540754085409541054115412541354145415541654175418541954205421542254235424542554265427542854295430543154325433543454355436543754385439544054415442544354445445544654475448544954505451545254535454545554565457545854595460546154625463546454655466546754685469547054715472547354745475547654775478547954805481548254835484548554865487548854895490549154925493549454955496549754985499550055015502550355045505550655075508550955105511551255135514551555165517551855195520552155225523552455255526552755285529553055315532553355345535553655375538553955405541554255435544554555465547554855495550555155525553555455555556555755585559556055615562556355645565556655675568556955705571557255735574557555765577557855795580558155825583558455855586558755885589559055915592559355945595559655975598559956005601560256035604560556065607560856095610561156125613561456155616561756185619562056215622562356245625562656275628562956305631563256335634563556365637563856395640564156425643564456455646564756485649565056515652565356545655565656575658565956605661566256635664566556665667566856695670567156725673567456755676567756785679568056815682568356845685568656875688568956905691569256935694569556965697569856995700570157025703570457055706570757085709571057115712571357145715571657175718571957205721572257235724572557265727572857295730573157325733573457355736573757385739574057415742574357445745574657475748574957505751575257535754575557565757575857595760576157625763576457655766576757685769577057715772577357745775577657775778577957805781578257835784578557865787578857895790579157925793579457955796579757985799580058015802580358045805580658075808580958105811581258135814581558165817581858195820582158225823582458255826582758285829583058315832583358345835583658375838583958405841584258435844584558465847584858495850585158525853585458555856585758585859586058615862586358645865586658675868586958705871587258735874587558765877587858795880588158825883588458855886588758885889589058915892589358945895589658975898589959005901590259035904590559065907590859095910591159125913591459155916591759185919592059215922592359245925592659275928592959305931593259335934593559365937593859395940594159425943594459455946594759485949595059515952595359545955595659575958595959605961596259635964596559665967596859695970597159725973597459755976597759785979598059815982598359845985598659875988598959905991599259935994599559965997599859996000600160026003600460056006600760086009601060116012601360146015601660176018601960206021602260236024602560266027602860296030603160326033603460356036603760386039604060416042604360446045604660476048604960506051605260536054605560566057605860596060606160626063606460656066606760686069607060716072607360746075607660776078607960806081608260836084608560866087608860896090609160926093609460956096609760986099610061016102610361046105610661076108610961106111611261136114611561166117611861196120612161226123612461256126612761286129613061316132613361346135613661376138613961406141614261436144614561466147614861496150615161526153615461556156615761586159616061616162616361646165616661676168616961706171617261736174617561766177617861796180618161826183618461856186618761886189619061916192619361946195619661976198619962006201620262036204620562066207620862096210621162126213621462156216621762186219622062216222622362246225622662276228622962306231623262336234623562366237623862396240624162426243624462456246624762486249625062516252625362546255625662576258625962606261626262636264626562666267626862696270627162726273627462756276627762786279628062816282628362846285628662876288628962906291629262936294629562966297629862996300630163026303630463056306630763086309631063116312631363146315631663176318631963206321632263236324632563266327632863296330633163326333633463356336633763386339634063416342634363446345634663476348634963506351635263536354635563566357635863596360636163626363636463656366636763686369637063716372637363746375637663776378637963806381638263836384638563866387638863896390639163926393639463956396639763986399640064016402640364046405640664076408640964106411641264136414641564166417641864196420642164226423642464256426642764286429643064316432643364346435643664376438643964406441644264436444644564466447644864496450645164526453645464556456645764586459646064616462646364646465646664676468646964706471647264736474647564766477647864796480648164826483648464856486648764886489649064916492649364946495649664976498649965006501650265036504650565066507650865096510651165126513651465156516651765186519652065216522652365246525652665276528652965306531653265336534653565366537653865396540654165426543654465456546654765486549655065516552655365546555655665576558655965606561656265636564656565666567656865696570657165726573657465756576657765786579658065816582658365846585658665876588658965906591659265936594659565966597659865996600660166026603660466056606660766086609661066116612661366146615661666176618661966206621662266236624662566266627662866296630663166326633663466356636663766386639664066416642664366446645664666476648664966506651665266536654665566566657665866596660666166626663666466656666666766686669667066716672667366746675667666776678667966806681668266836684668566866687668866896690669166926693669466956696669766986699670067016702670367046705670667076708670967106711671267136714671567166717671867196720672167226723672467256726672767286729673067316732673367346735673667376738673967406741674267436744674567466747674867496750675167526753675467556756675767586759676067616762676367646765676667676768676967706771677267736774677567766777677867796780678167826783678467856786678767886789679067916792679367946795679667976798679968006801680268036804680568066807680868096810681168126813681468156816681768186819682068216822682368246825682668276828682968306831683268336834683568366837683868396840684168426843684468456846684768486849685068516852685368546855685668576858685968606861686268636864686568666867686868696870687168726873687468756876687768786879688068816882688368846885688668876888688968906891689268936894689568966897689868996900690169026903690469056906690769086909691069116912691369146915691669176918691969206921692269236924692569266927692869296930693169326933693469356936693769386939694069416942694369446945694669476948694969506951695269536954695569566957695869596960696169626963696469656966696769686969697069716972697369746975697669776978697969806981698269836984698569866987698869896990699169926993699469956996699769986999700070017002700370047005700670077008700970107011701270137014701570167017701870197020702170227023702470257026702770287029703070317032703370347035703670377038703970407041704270437044704570467047704870497050705170527053705470557056705770587059706070617062706370647065706670677068706970707071707270737074707570767077707870797080708170827083708470857086708770887089709070917092709370947095709670977098709971007101710271037104710571067107710871097110711171127113711471157116711771187119712071217122712371247125712671277128712971307131713271337134713571367137713871397140714171427143714471457146714771487149715071517152715371547155715671577158715971607161716271637164716571667167716871697170717171727173717471757176717771787179718071817182718371847185718671877188718971907191719271937194719571967197719871997200720172027203720472057206720772087209721072117212721372147215721672177218721972207221722272237224722572267227722872297230723172327233723472357236723772387239724072417242724372447245724672477248724972507251725272537254725572567257725872597260726172627263726472657266726772687269727072717272727372747275727672777278727972807281728272837284728572867287728872897290729172927293729472957296729772987299730073017302730373047305730673077308730973107311731273137314731573167317731873197320732173227323732473257326732773287329733073317332733373347335733673377338733973407341734273437344734573467347734873497350735173527353735473557356735773587359736073617362736373647365736673677368736973707371737273737374737573767377737873797380738173827383738473857386738773887389739073917392739373947395739673977398739974007401740274037404740574067407740874097410741174127413741474157416741774187419742074217422742374247425742674277428742974307431743274337434743574367437743874397440744174427443744474457446744774487449745074517452745374547455745674577458745974607461746274637464746574667467746874697470747174727473747474757476747774787479748074817482748374847485748674877488748974907491749274937494749574967497749874997500750175027503750475057506750775087509751075117512751375147515751675177518751975207521752275237524752575267527752875297530753175327533753475357536753775387539754075417542754375447545754675477548754975507551755275537554755575567557755875597560756175627563756475657566756775687569757075717572757375747575757675777578757975807581758275837584758575867587758875897590759175927593759475957596759775987599760076017602760376047605760676077608760976107611761276137614761576167617761876197620762176227623762476257626762776287629763076317632763376347635763676377638763976407641764276437644764576467647764876497650765176527653765476557656765776587659766076617662766376647665766676677668766976707671767276737674767576767677767876797680768176827683768476857686768776887689769076917692769376947695769676977698769977007701770277037704770577067707770877097710771177127713771477157716771777187719772077217722772377247725772677277728772977307731773277337734773577367737773877397740774177427743774477457746774777487749775077517752775377547755775677577758775977607761776277637764776577667767776877697770777177727773777477757776777777787779778077817782778377847785778677877788778977907791779277937794779577967797779877997800780178027803780478057806780778087809781078117812781378147815781678177818781978207821782278237824782578267827782878297830783178327833783478357836783778387839784078417842784378447845784678477848784978507851785278537854785578567857785878597860786178627863786478657866786778687869787078717872787378747875787678777878787978807881788278837884788578867887788878897890789178927893789478957896789778987899790079017902790379047905790679077908790979107911791279137914791579167917791879197920792179227923792479257926792779287929793079317932793379347935793679377938793979407941794279437944794579467947794879497950795179527953795479557956795779587959796079617962796379647965796679677968796979707971797279737974797579767977797879797980798179827983798479857986798779887989799079917992799379947995799679977998799980008001800280038004800580068007800880098010801180128013801480158016801780188019802080218022802380248025802680278028802980308031803280338034803580368037803880398040804180428043804480458046804780488049805080518052805380548055805680578058805980608061806280638064806580668067806880698070807180728073807480758076807780788079808080818082808380848085808680878088808980908091809280938094809580968097809880998100810181028103810481058106810781088109811081118112811381148115811681178118811981208121812281238124812581268127812881298130813181328133813481358136813781388139814081418142814381448145814681478148814981508151815281538154815581568157815881598160816181628163816481658166816781688169817081718172817381748175817681778178817981808181818281838184818581868187818881898190819181928193819481958196819781988199820082018202820382048205820682078208820982108211821282138214821582168217821882198220822182228223822482258226822782288229823082318232823382348235823682378238823982408241824282438244824582468247824882498250825182528253825482558256825782588259826082618262826382648265826682678268826982708271827282738274827582768277827882798280828182828283828482858286828782888289829082918292829382948295829682978298829983008301830283038304830583068307830883098310831183128313831483158316831783188319832083218322832383248325832683278328832983308331833283338334833583368337833883398340834183428343834483458346834783488349835083518352835383548355835683578358835983608361836283638364836583668367836883698370837183728373837483758376837783788379838083818382838383848385838683878388838983908391839283938394839583968397839883998400840184028403840484058406840784088409841084118412841384148415841684178418841984208421842284238424842584268427842884298430843184328433843484358436843784388439844084418442844384448445844684478448844984508451845284538454845584568457845884598460846184628463846484658466846784688469847084718472847384748475847684778478847984808481848284838484848584868487848884898490849184928493849484958496849784988499850085018502850385048505850685078508850985108511851285138514851585168517851885198520852185228523852485258526852785288529853085318532853385348535853685378538853985408541854285438544854585468547854885498550855185528553855485558556855785588559856085618562856385648565856685678568856985708571857285738574857585768577857885798580858185828583858485858586858785888589859085918592859385948595859685978598859986008601860286038604860586068607860886098610861186128613861486158616861786188619862086218622862386248625862686278628862986308631863286338634863586368637863886398640864186428643864486458646864786488649865086518652865386548655865686578658865986608661866286638664866586668667866886698670867186728673867486758676867786788679868086818682868386848685868686878688868986908691869286938694869586968697869886998700870187028703870487058706870787088709871087118712871387148715871687178718871987208721872287238724872587268727872887298730873187328733873487358736873787388739874087418742874387448745874687478748874987508751875287538754875587568757875887598760876187628763876487658766876787688769877087718772877387748775877687778778877987808781878287838784878587868787878887898790879187928793879487958796879787988799880088018802880388048805880688078808880988108811881288138814881588168817881888198820882188228823882488258826882788288829883088318832883388348835883688378838883988408841884288438844884588468847884888498850885188528853885488558856885788588859886088618862886388648865886688678868886988708871887288738874887588768877887888798880888188828883888488858886888788888889889088918892889388948895889688978898889989008901890289038904890589068907890889098910891189128913891489158916891789188919892089218922892389248925892689278928892989308931893289338934893589368937893889398940894189428943894489458946894789488949895089518952895389548955895689578958895989608961896289638964896589668967896889698970897189728973897489758976897789788979898089818982898389848985898689878988898989908991899289938994899589968997899889999000900190029003900490059006900790089009901090119012901390149015901690179018901990209021902290239024902590269027902890299030903190329033903490359036903790389039904090419042904390449045904690479048904990509051905290539054905590569057905890599060906190629063906490659066906790689069907090719072907390749075907690779078907990809081908290839084908590869087908890899090909190929093909490959096909790989099910091019102910391049105910691079108910991109111911291139114911591169117911891199120912191229123912491259126912791289129913091319132913391349135913691379138913991409141914291439144914591469147914891499150915191529153915491559156915791589159916091619162916391649165916691679168916991709171917291739174917591769177917891799180918191829183918491859186918791889189919091919192919391949195919691979198919992009201920292039204920592069207920892099210921192129213921492159216921792189219922092219222922392249225922692279228922992309231923292339234923592369237923892399240924192429243924492459246924792489249925092519252925392549255925692579258925992609261926292639264926592669267926892699270927192729273927492759276927792789279928092819282928392849285928692879288928992909291929292939294929592969297929892999300930193029303930493059306930793089309931093119312931393149315931693179318931993209321932293239324932593269327932893299330933193329333933493359336933793389339934093419342934393449345934693479348934993509351935293539354935593569357935893599360936193629363936493659366936793689369937093719372937393749375937693779378937993809381938293839384938593869387938893899390939193929393939493959396939793989399940094019402940394049405940694079408940994109411941294139414941594169417941894199420942194229423942494259426942794289429943094319432943394349435943694379438943994409441944294439444944594469447944894499450945194529453945494559456945794589459946094619462946394649465946694679468946994709471947294739474947594769477947894799480948194829483948494859486948794889489949094919492949394949495949694979498949995009501950295039504950595069507950895099510951195129513951495159516951795189519952095219522952395249525952695279528952995309531953295339534953595369537953895399540954195429543954495459546954795489549955095519552955395549555955695579558955995609561956295639564956595669567956895699570957195729573957495759576957795789579958095819582958395849585958695879588958995909591959295939594959595969597959895999600960196029603960496059606960796089609961096119612961396149615961696179618961996209621962296239624962596269627962896299630963196329633963496359636963796389639964096419642964396449645964696479648964996509651965296539654965596569657965896599660966196629663966496659666966796689669967096719672967396749675967696779678967996809681968296839684968596869687968896899690969196929693969496959696969796989699970097019702970397049705970697079708970997109711971297139714971597169717971897199720972197229723972497259726972797289729973097319732973397349735973697379738973997409741974297439744974597469747974897499750975197529753975497559756975797589759976097619762976397649765976697679768976997709771977297739774977597769777977897799780978197829783978497859786978797889789979097919792979397949795979697979798979998009801980298039804980598069807980898099810981198129813981498159816981798189819982098219822982398249825982698279828982998309831983298339834983598369837983898399840984198429843984498459846984798489849985098519852985398549855985698579858985998609861986298639864986598669867986898699870987198729873987498759876987798789879988098819882988398849885988698879888988998909891989298939894989598969897989898999900990199029903990499059906990799089909991099119912991399149915991699179918991999209921992299239924992599269927992899299930993199329933993499359936993799389939994099419942994399449945994699479948994999509951995299539954995599569957995899599960996199629963996499659966996799689969997099719972997399749975997699779978997999809981998299839984998599869987998899899990999199929993999499959996999799989999100001000110002100031000410005100061000710008100091001010011100121001310014100151001610017100181001910020100211002210023100241002510026100271002810029100301003110032100331003410035100361003710038100391004010041100421004310044100451004610047100481004910050100511005210053100541005510056100571005810059100601006110062100631006410065100661006710068100691007010071100721007310074100751007610077100781007910080100811008210083100841008510086100871008810089100901009110092100931009410095100961009710098100991010010101101021010310104101051010610107101081010910110101111011210113101141011510116101171011810119101201012110122101231012410125101261012710128101291013010131101321013310134101351013610137101381013910140101411014210143101441014510146101471014810149101501015110152101531015410155101561015710158101591016010161101621016310164101651016610167101681016910170101711017210173101741017510176101771017810179101801018110182101831018410185101861018710188101891019010191101921019310194101951019610197101981019910200102011020210203102041020510206102071020810209102101021110212102131021410215102161021710218102191022010221102221022310224102251022610227102281022910230102311023210233102341023510236102371023810239102401024110242102431024410245102461024710248102491025010251102521025310254102551025610257102581025910260102611026210263102641026510266102671026810269102701027110272102731027410275102761027710278102791028010281102821028310284102851028610287102881028910290102911029210293102941029510296102971029810299103001030110302103031030410305103061030710308103091031010311103121031310314103151031610317103181031910320103211032210323103241032510326103271032810329103301033110332103331033410335103361033710338103391034010341103421034310344103451034610347103481034910350103511035210353103541035510356103571035810359103601036110362103631036410365103661036710368103691037010371103721037310374103751037610377103781037910380103811038210383103841038510386103871038810389103901039110392103931039410395103961039710398103991040010401104021040310404104051040610407104081040910410104111041210413104141041510416104171041810419104201042110422104231042410425104261042710428104291043010431104321043310434104351043610437104381043910440104411044210443104441044510446104471044810449104501045110452104531045410455104561045710458104591046010461104621046310464104651046610467104681046910470104711047210473104741047510476104771047810479104801048110482104831048410485104861048710488104891049010491104921049310494104951049610497104981049910500105011050210503105041050510506105071050810509105101051110512105131051410515105161051710518105191052010521105221052310524105251052610527105281052910530105311053210533105341053510536105371053810539105401054110542105431054410545105461054710548105491055010551105521055310554105551055610557105581055910560105611056210563105641056510566105671056810569105701057110572105731057410575105761057710578105791058010581105821058310584105851058610587105881058910590105911059210593105941059510596105971059810599106001060110602106031060410605106061060710608106091061010611106121061310614106151061610617106181061910620106211062210623106241062510626106271062810629106301063110632106331063410635106361063710638106391064010641106421064310644106451064610647106481064910650106511065210653106541065510656106571065810659106601066110662106631066410665106661066710668106691067010671106721067310674106751067610677106781067910680106811068210683106841068510686106871068810689106901069110692106931069410695106961069710698106991070010701107021070310704107051070610707107081070910710107111071210713107141071510716107171071810719107201072110722107231072410725107261072710728107291073010731107321073310734107351073610737107381073910740107411074210743107441074510746107471074810749107501075110752107531075410755107561075710758107591076010761107621076310764107651076610767107681076910770107711077210773107741077510776107771077810779107801078110782107831078410785107861078710788107891079010791107921079310794107951079610797107981079910800108011080210803108041080510806108071080810809108101081110812108131081410815108161081710818108191082010821108221082310824108251082610827108281082910830108311083210833108341083510836108371083810839108401084110842108431084410845108461084710848108491085010851108521085310854108551085610857108581085910860108611086210863108641086510866108671086810869108701087110872108731087410875108761087710878108791088010881108821088310884108851088610887108881088910890108911089210893108941089510896108971089810899109001090110902109031090410905109061090710908109091091010911109121091310914109151091610917109181091910920109211092210923109241092510926109271092810929109301093110932109331093410935109361093710938109391094010941109421094310944109451094610947109481094910950109511095210953109541095510956109571095810959109601096110962109631096410965109661096710968109691097010971109721097310974109751097610977109781097910980109811098210983109841098510986109871098810989109901099110992109931099410995109961099710998109991100011001110021100311004110051100611007110081100911010110111101211013110141101511016110171101811019110201102111022110231102411025110261102711028110291103011031110321103311034110351103611037110381103911040110411104211043110441104511046110471104811049110501105111052110531105411055110561105711058110591106011061110621106311064110651106611067110681106911070110711107211073110741107511076110771107811079110801108111082110831108411085110861108711088110891109011091110921109311094110951109611097110981109911100111011110211103111041110511106111071110811109111101111111112111131111411115111161111711118111191112011121111221112311124111251112611127111281112911130111311113211133111341113511136111371113811139111401114111142111431114411145111461114711148111491115011151111521115311154111551115611157111581115911160111611116211163111641116511166111671116811169111701117111172111731117411175111761117711178111791118011181111821118311184111851118611187111881118911190111911119211193111941119511196111971119811199112001120111202112031120411205112061120711208112091121011211112121121311214112151121611217112181121911220112211122211223112241122511226112271122811229112301123111232112331123411235112361123711238112391124011241112421124311244112451124611247112481124911250112511125211253112541125511256112571125811259112601126111262112631126411265112661126711268112691127011271112721127311274112751127611277112781127911280112811128211283112841128511286112871128811289112901129111292112931129411295112961129711298112991130011301113021130311304113051130611307113081130911310113111131211313113141131511316113171131811319113201132111322113231132411325113261132711328113291133011331113321133311334113351133611337113381133911340113411134211343113441134511346113471134811349113501135111352113531135411355113561135711358113591136011361113621136311364113651136611367113681136911370113711137211373113741137511376113771137811379113801138111382113831138411385113861138711388113891139011391113921139311394113951139611397113981139911400114011140211403114041140511406114071140811409114101141111412114131141411415114161141711418114191142011421114221142311424114251142611427114281142911430114311143211433114341143511436114371143811439114401144111442114431144411445114461144711448114491145011451114521145311454114551145611457114581145911460114611146211463114641146511466114671146811469114701147111472114731147411475114761147711478114791148011481114821148311484114851148611487114881148911490114911149211493114941149511496114971149811499115001150111502115031150411505115061150711508115091151011511115121151311514115151151611517115181151911520115211152211523115241152511526115271152811529115301153111532115331153411535115361153711538115391154011541115421154311544115451154611547115481154911550115511155211553115541155511556115571155811559115601156111562115631156411565115661156711568115691157011571115721157311574115751157611577115781157911580115811158211583115841158511586115871158811589115901159111592115931159411595115961159711598115991160011601116021160311604116051160611607116081160911610116111161211613116141161511616116171161811619116201162111622116231162411625116261162711628116291163011631116321163311634116351163611637116381163911640116411164211643116441164511646116471164811649116501165111652116531165411655116561165711658116591166011661116621166311664116651166611667116681166911670116711167211673116741167511676116771167811679116801168111682116831168411685116861168711688116891169011691116921169311694116951169611697116981169911700117011170211703117041170511706117071170811709117101171111712117131171411715117161171711718117191172011721117221172311724117251172611727117281172911730117311173211733117341173511736117371173811739117401174111742117431174411745117461174711748117491175011751117521175311754117551175611757117581175911760117611176211763117641176511766117671176811769117701177111772117731177411775117761177711778117791178011781117821178311784117851178611787117881178911790117911179211793117941179511796117971179811799118001180111802118031180411805118061180711808118091181011811118121181311814118151181611817118181181911820118211182211823118241182511826118271182811829118301183111832118331183411835118361183711838118391184011841118421184311844118451184611847118481184911850118511185211853118541185511856118571185811859118601186111862118631186411865118661186711868118691187011871118721187311874118751187611877118781187911880118811188211883118841188511886118871188811889118901189111892118931189411895118961189711898118991190011901119021190311904119051190611907119081190911910119111191211913119141191511916119171191811919119201192111922119231192411925119261192711928119291193011931119321193311934119351193611937119381193911940119411194211943119441194511946119471194811949119501195111952119531195411955119561195711958119591196011961119621196311964119651196611967119681196911970119711197211973119741197511976119771197811979119801198111982119831198411985119861198711988119891199011991119921199311994119951199611997119981199912000120011200212003120041200512006120071200812009120101201112012120131201412015120161201712018120191202012021120221202312024120251202612027120281202912030120311203212033120341203512036120371203812039120401204112042120431204412045120461204712048120491205012051120521205312054120551205612057120581205912060120611206212063120641206512066120671206812069120701207112072120731207412075120761207712078120791208012081120821208312084120851208612087120881208912090120911209212093120941209512096120971209812099121001210112102121031210412105121061210712108121091211012111121121211312114121151211612117121181211912120121211212212123121241212512126121271212812129121301213112132121331213412135121361213712138121391214012141121421214312144121451214612147121481214912150121511215212153121541215512156121571215812159121601216112162121631216412165121661216712168121691217012171121721217312174121751217612177121781217912180121811218212183121841218512186121871218812189121901219112192121931219412195121961219712198121991220012201122021220312204122051220612207122081220912210122111221212213122141221512216122171221812219122201222112222122231222412225122261222712228122291223012231122321223312234122351223612237122381223912240122411224212243122441224512246122471224812249122501225112252122531225412255122561225712258122591226012261122621226312264122651226612267122681226912270122711227212273122741227512276122771227812279122801228112282122831228412285122861228712288122891229012291122921229312294122951229612297122981229912300123011230212303123041230512306123071230812309123101231112312123131231412315123161231712318123191232012321123221232312324123251232612327123281232912330123311233212333123341233512336123371233812339123401234112342123431234412345123461234712348123491235012351123521235312354123551235612357123581235912360123611236212363123641236512366123671236812369123701237112372123731237412375123761237712378123791238012381123821238312384123851238612387123881238912390123911239212393123941239512396123971239812399124001240112402124031240412405124061240712408124091241012411124121241312414124151241612417124181241912420124211242212423124241242512426124271242812429124301243112432124331243412435124361243712438124391244012441124421244312444124451244612447124481244912450124511245212453124541245512456124571245812459124601246112462124631246412465124661246712468124691247012471124721247312474124751247612477124781247912480124811248212483124841248512486124871248812489124901249112492124931249412495124961249712498124991250012501125021250312504125051250612507125081250912510125111251212513125141251512516125171251812519125201252112522125231252412525125261252712528125291253012531125321253312534125351253612537125381253912540125411254212543125441254512546125471254812549125501255112552125531255412555125561255712558125591256012561125621256312564125651256612567125681256912570125711257212573125741257512576125771257812579125801258112582125831258412585125861258712588125891259012591125921259312594125951259612597125981259912600126011260212603126041260512606126071260812609126101261112612126131261412615126161261712618126191262012621126221262312624126251262612627126281262912630126311263212633126341263512636126371263812639126401264112642126431264412645126461264712648126491265012651126521265312654126551265612657126581265912660126611266212663126641266512666126671266812669126701267112672126731267412675126761267712678126791268012681126821268312684126851268612687126881268912690126911269212693126941269512696126971269812699127001270112702127031270412705127061270712708127091271012711127121271312714127151271612717127181271912720127211272212723127241272512726127271272812729127301273112732127331273412735127361273712738127391274012741127421274312744127451274612747127481274912750127511275212753127541275512756127571275812759127601276112762127631276412765127661276712768127691277012771127721277312774127751277612777127781277912780127811278212783127841278512786127871278812789127901279112792127931279412795127961279712798127991280012801128021280312804128051280612807128081280912810128111281212813128141281512816128171281812819128201282112822128231282412825128261282712828128291283012831128321283312834128351283612837128381283912840128411284212843128441284512846128471284812849128501285112852128531285412855128561285712858128591286012861128621286312864128651286612867128681286912870128711287212873128741287512876128771287812879128801288112882128831288412885128861288712888128891289012891128921289312894128951289612897128981289912900129011290212903129041290512906129071290812909129101291112912129131291412915129161291712918129191292012921129221292312924129251292612927129281292912930129311293212933129341293512936129371293812939129401294112942129431294412945129461294712948129491295012951129521295312954129551295612957129581295912960129611296212963129641296512966129671296812969129701297112972129731297412975129761297712978129791298012981129821298312984129851298612987129881298912990129911299212993129941299512996129971299812999130001300113002130031300413005130061300713008130091301013011130121301313014130151301613017130181301913020130211302213023130241302513026130271302813029130301303113032130331303413035130361303713038130391304013041130421304313044130451304613047130481304913050130511305213053130541305513056130571305813059130601306113062130631306413065130661306713068130691307013071130721307313074130751307613077130781307913080130811308213083130841308513086130871308813089130901309113092130931309413095130961309713098130991310013101131021310313104131051310613107131081310913110131111311213113131141311513116131171311813119131201312113122131231312413125131261312713128131291313013131131321313313134131351313613137131381313913140131411314213143131441314513146131471314813149131501315113152131531315413155131561315713158131591316013161131621316313164131651316613167131681316913170131711317213173131741317513176131771317813179131801318113182131831318413185131861318713188131891319013191131921319313194131951319613197131981319913200132011320213203132041320513206132071320813209132101321113212132131321413215132161321713218132191322013221132221322313224132251322613227132281322913230132311323213233132341323513236132371323813239132401324113242132431324413245132461324713248132491325013251132521325313254132551325613257132581325913260132611326213263132641326513266132671326813269132701327113272132731327413275132761327713278132791328013281132821328313284132851328613287132881328913290132911329213293132941329513296132971329813299133001330113302133031330413305133061330713308133091331013311133121331313314133151331613317133181331913320133211332213323133241332513326133271332813329133301333113332133331333413335133361333713338133391334013341133421334313344133451334613347133481334913350133511335213353133541335513356133571335813359133601336113362133631336413365133661336713368133691337013371133721337313374133751337613377133781337913380133811338213383133841338513386133871338813389133901339113392133931339413395133961339713398133991340013401134021340313404134051340613407134081340913410134111341213413134141341513416134171341813419134201342113422134231342413425134261342713428134291343013431134321343313434134351343613437134381343913440134411344213443134441344513446134471344813449134501345113452134531345413455134561345713458134591346013461134621346313464134651346613467134681346913470134711347213473134741347513476134771347813479134801348113482134831348413485134861348713488134891349013491134921349313494134951349613497134981349913500135011350213503135041350513506135071350813509135101351113512135131351413515135161351713518135191352013521135221352313524135251352613527135281352913530135311353213533135341353513536135371353813539135401354113542135431354413545135461354713548135491355013551135521355313554135551355613557135581355913560135611356213563135641356513566135671356813569135701357113572135731357413575135761357713578135791358013581135821358313584135851358613587135881358913590135911359213593135941359513596135971359813599136001360113602136031360413605136061360713608136091361013611136121361313614136151361613617136181361913620136211362213623136241362513626136271362813629136301363113632136331363413635136361363713638136391364013641136421364313644136451364613647136481364913650136511365213653136541365513656136571365813659136601366113662136631366413665136661366713668136691367013671136721367313674136751367613677136781367913680136811368213683136841368513686136871368813689136901369113692136931369413695136961369713698136991370013701137021370313704137051370613707137081370913710137111371213713137141371513716137171371813719137201372113722137231372413725137261372713728137291373013731137321373313734137351373613737137381373913740137411374213743137441374513746137471374813749137501375113752137531375413755137561375713758137591376013761137621376313764137651376613767137681376913770137711377213773137741377513776137771377813779137801378113782137831378413785137861378713788137891379013791137921379313794137951379613797137981379913800138011380213803138041380513806138071380813809138101381113812138131381413815138161381713818138191382013821138221382313824138251382613827138281382913830138311383213833138341383513836138371383813839138401384113842138431384413845138461384713848138491385013851138521385313854138551385613857138581385913860138611386213863138641386513866138671386813869138701387113872138731387413875138761387713878138791388013881138821388313884138851388613887138881388913890138911389213893138941389513896138971389813899139001390113902139031390413905139061390713908139091391013911139121391313914139151391613917139181391913920139211392213923139241392513926139271392813929139301393113932139331393413935139361393713938139391394013941139421394313944139451394613947139481394913950139511395213953139541395513956139571395813959139601396113962139631396413965139661396713968139691397013971139721397313974139751397613977139781397913980139811398213983139841398513986139871398813989139901399113992139931399413995139961399713998139991400014001140021400314004140051400614007140081400914010140111401214013140141401514016140171401814019140201402114022140231402414025140261402714028140291403014031140321403314034140351403614037140381403914040140411404214043140441404514046140471404814049140501405114052140531405414055140561405714058140591406014061140621406314064140651406614067140681406914070140711407214073140741407514076140771407814079140801408114082140831408414085140861408714088140891409014091140921409314094140951409614097140981409914100141011410214103141041410514106141071410814109141101411114112141131411414115141161411714118141191412014121141221412314124141251412614127141281412914130141311413214133141341413514136141371413814139141401414114142141431414414145141461414714148141491415014151141521415314154141551415614157141581415914160141611416214163141641416514166141671416814169141701417114172141731417414175141761417714178141791418014181141821418314184141851418614187141881418914190141911419214193141941419514196141971419814199142001420114202142031420414205142061420714208142091421014211142121421314214142151421614217142181421914220142211422214223142241422514226142271422814229142301423114232142331423414235142361423714238142391424014241142421424314244142451424614247142481424914250142511425214253142541425514256142571425814259142601426114262142631426414265142661426714268142691427014271142721427314274142751427614277142781427914280142811428214283142841428514286142871428814289142901429114292142931429414295142961429714298142991430014301143021430314304143051430614307143081430914310143111431214313143141431514316143171431814319143201432114322143231432414325143261432714328143291433014331143321433314334143351433614337143381433914340143411434214343143441434514346143471434814349143501435114352143531435414355143561435714358143591436014361143621436314364143651436614367143681436914370143711437214373143741437514376143771437814379143801438114382143831438414385143861438714388143891439014391143921439314394143951439614397143981439914400144011440214403144041440514406144071440814409144101441114412144131441414415144161441714418144191442014421144221442314424144251442614427144281442914430144311443214433144341443514436144371443814439144401444114442144431444414445144461444714448144491445014451144521445314454144551445614457144581445914460144611446214463144641446514466144671446814469144701447114472144731447414475144761447714478144791448014481144821448314484144851448614487144881448914490144911449214493144941449514496144971449814499145001450114502145031450414505145061450714508145091451014511145121451314514145151451614517145181451914520145211452214523145241452514526145271452814529145301453114532145331453414535145361453714538145391454014541145421454314544145451454614547145481454914550145511455214553145541455514556145571455814559145601456114562145631456414565145661456714568145691457014571145721457314574145751457614577145781457914580145811458214583145841458514586145871458814589145901459114592145931459414595145961459714598145991460014601146021460314604146051460614607146081460914610146111461214613146141461514616146171461814619146201462114622146231462414625146261462714628146291463014631146321463314634146351463614637146381463914640146411464214643146441464514646146471464814649146501465114652146531465414655146561465714658146591466014661146621466314664146651466614667146681466914670146711467214673146741467514676146771467814679146801468114682146831468414685146861468714688146891469014691146921469314694146951469614697146981469914700147011470214703147041470514706147071470814709147101471114712147131471414715147161471714718147191472014721147221472314724147251472614727147281472914730147311473214733147341473514736147371473814739147401474114742147431474414745147461474714748147491475014751147521475314754147551475614757147581475914760147611476214763147641476514766147671476814769147701477114772147731477414775147761477714778147791478014781147821478314784147851478614787147881478914790147911479214793147941479514796147971479814799148001480114802148031480414805148061480714808148091481014811148121481314814148151481614817148181481914820148211482214823148241482514826148271482814829148301483114832148331483414835148361483714838148391484014841148421484314844148451484614847148481484914850148511485214853148541485514856148571485814859148601486114862148631486414865148661486714868148691487014871148721487314874148751487614877148781487914880148811488214883148841488514886148871488814889148901489114892148931489414895148961489714898148991490014901149021490314904149051490614907149081490914910149111491214913149141491514916149171491814919149201492114922149231492414925149261492714928149291493014931149321493314934149351493614937149381493914940149411494214943149441494514946149471494814949149501495114952149531495414955149561495714958149591496014961149621496314964149651496614967149681496914970149711497214973149741497514976149771497814979149801498114982149831498414985149861498714988149891499014991149921499314994149951499614997149981499915000150011500215003150041500515006150071500815009150101501115012150131501415015150161501715018150191502015021150221502315024150251502615027150281502915030150311503215033150341503515036150371503815039150401504115042150431504415045150461504715048150491505015051150521505315054150551505615057150581505915060150611506215063150641506515066150671506815069150701507115072150731507415075150761507715078150791508015081150821508315084150851508615087150881508915090150911509215093150941509515096150971509815099151001510115102151031510415105151061510715108151091511015111151121511315114151151511615117151181511915120151211512215123151241512515126151271512815129151301513115132151331513415135151361513715138151391514015141151421514315144151451514615147151481514915150151511515215153151541515515156151571515815159151601516115162151631516415165151661516715168151691517015171151721517315174151751517615177151781517915180151811518215183151841518515186151871518815189151901519115192151931519415195151961519715198151991520015201152021520315204152051520615207152081520915210152111521215213152141521515216152171521815219152201522115222152231522415225152261522715228152291523015231152321523315234152351523615237152381523915240152411524215243152441524515246152471524815249152501525115252152531525415255152561525715258152591526015261152621526315264152651526615267152681526915270152711527215273152741527515276152771527815279152801528115282152831528415285152861528715288152891529015291152921529315294152951529615297152981529915300153011530215303153041530515306153071530815309153101531115312153131531415315153161531715318153191532015321153221532315324153251532615327153281532915330153311533215333153341533515336153371533815339153401534115342153431534415345153461534715348153491535015351153521535315354153551535615357153581535915360153611536215363153641536515366153671536815369153701537115372153731537415375153761537715378153791538015381153821538315384153851538615387153881538915390153911539215393153941539515396153971539815399154001540115402154031540415405154061540715408154091541015411154121541315414154151541615417154181541915420154211542215423154241542515426154271542815429154301543115432154331543415435154361543715438154391544015441154421544315444154451544615447154481544915450154511545215453154541545515456154571545815459154601546115462154631546415465154661546715468154691547015471154721547315474154751547615477154781547915480154811548215483154841548515486154871548815489154901549115492154931549415495154961549715498154991550015501155021550315504155051550615507155081550915510155111551215513155141551515516155171551815519155201552115522155231552415525155261552715528155291553015531155321553315534155351553615537155381553915540155411554215543155441554515546155471554815549155501555115552155531555415555155561555715558155591556015561155621556315564155651556615567155681556915570155711557215573155741557515576155771557815579155801558115582155831558415585155861558715588155891559015591155921559315594155951559615597155981559915600156011560215603156041560515606156071560815609156101561115612156131561415615156161561715618156191562015621156221562315624156251562615627156281562915630156311563215633156341563515636156371563815639156401564115642156431564415645156461564715648156491565015651156521565315654156551565615657156581565915660156611566215663156641566515666156671566815669156701567115672156731567415675156761567715678156791568015681156821568315684156851568615687156881568915690156911569215693156941569515696156971569815699157001570115702157031570415705157061570715708157091571015711157121571315714157151571615717157181571915720157211572215723157241572515726157271572815729157301573115732157331573415735157361573715738157391574015741157421574315744157451574615747157481574915750157511575215753157541575515756157571575815759157601576115762157631576415765157661576715768157691577015771157721577315774157751577615777157781577915780157811578215783157841578515786157871578815789157901579115792157931579415795157961579715798157991580015801158021580315804158051580615807158081580915810158111581215813158141581515816158171581815819158201582115822158231582415825158261582715828158291583015831158321583315834158351583615837158381583915840158411584215843158441584515846158471584815849158501585115852158531585415855158561585715858158591586015861158621586315864158651586615867158681586915870158711587215873158741587515876158771587815879158801588115882158831588415885158861588715888158891589015891158921589315894158951589615897158981589915900159011590215903159041590515906159071590815909159101591115912159131591415915159161591715918159191592015921159221592315924159251592615927159281592915930159311593215933159341593515936159371593815939159401594115942159431594415945159461594715948159491595015951159521595315954159551595615957159581595915960159611596215963159641596515966159671596815969159701597115972159731597415975159761597715978159791598015981159821598315984159851598615987159881598915990159911599215993159941599515996159971599815999160001600116002160031600416005160061600716008160091601016011160121601316014160151601616017160181601916020160211602216023160241602516026160271602816029160301603116032160331603416035160361603716038160391604016041160421604316044160451604616047160481604916050160511605216053160541605516056160571605816059160601606116062160631606416065160661606716068160691607016071160721607316074160751607616077160781607916080160811608216083160841608516086160871608816089160901609116092160931609416095160961609716098160991610016101161021610316104161051610616107161081610916110161111611216113161141611516116161171611816119161201612116122161231612416125161261612716128161291613016131161321613316134161351613616137161381613916140161411614216143161441614516146161471614816149161501615116152161531615416155161561615716158161591616016161161621616316164161651616616167161681616916170161711617216173161741617516176161771617816179161801618116182161831618416185161861618716188161891619016191161921619316194161951619616197161981619916200162011620216203162041620516206162071620816209162101621116212162131621416215162161621716218162191622016221162221622316224162251622616227162281622916230162311623216233162341623516236162371623816239162401624116242162431624416245162461624716248162491625016251162521625316254162551625616257162581625916260162611626216263162641626516266162671626816269162701627116272162731627416275162761627716278162791628016281162821628316284162851628616287162881628916290162911629216293162941629516296162971629816299163001630116302163031630416305163061630716308163091631016311163121631316314163151631616317163181631916320163211632216323163241632516326163271632816329163301633116332163331633416335163361633716338163391634016341163421634316344163451634616347163481634916350163511635216353163541635516356163571635816359163601636116362163631636416365163661636716368163691637016371163721637316374163751637616377163781637916380163811638216383163841638516386163871638816389163901639116392163931639416395163961639716398163991640016401164021640316404164051640616407164081640916410164111641216413164141641516416164171641816419164201642116422164231642416425164261642716428164291643016431164321643316434164351643616437164381643916440164411644216443164441644516446164471644816449164501645116452164531645416455164561645716458164591646016461164621646316464164651646616467164681646916470164711647216473164741647516476164771647816479164801648116482164831648416485164861648716488164891649016491164921649316494164951649616497164981649916500165011650216503165041650516506165071650816509165101651116512165131651416515165161651716518165191652016521165221652316524165251652616527165281652916530165311653216533165341653516536165371653816539165401654116542165431654416545165461654716548165491655016551165521655316554165551655616557165581655916560165611656216563165641656516566165671656816569165701657116572165731657416575165761657716578165791658016581165821658316584165851658616587165881658916590165911659216593165941659516596165971659816599166001660116602166031660416605166061660716608166091661016611166121661316614166151661616617166181661916620166211662216623166241662516626166271662816629166301663116632166331663416635166361663716638166391664016641166421664316644166451664616647166481664916650166511665216653166541665516656166571665816659166601666116662166631666416665166661666716668166691667016671166721667316674166751667616677166781667916680166811668216683166841668516686166871668816689166901669116692166931669416695166961669716698166991670016701167021670316704167051670616707167081670916710167111671216713167141671516716167171671816719167201672116722167231672416725167261672716728167291673016731167321673316734167351673616737167381673916740167411674216743167441674516746167471674816749167501675116752167531675416755167561675716758167591676016761167621676316764167651676616767167681676916770167711677216773167741677516776167771677816779167801678116782167831678416785167861678716788167891679016791167921679316794167951679616797167981679916800168011680216803168041680516806168071680816809168101681116812168131681416815168161681716818168191682016821168221682316824168251682616827168281682916830168311683216833168341683516836168371683816839168401684116842168431684416845168461684716848168491685016851168521685316854168551685616857168581685916860168611686216863168641686516866168671686816869168701687116872168731687416875168761687716878168791688016881168821688316884168851688616887168881688916890168911689216893168941689516896168971689816899169001690116902169031690416905169061690716908169091691016911169121691316914169151691616917169181691916920169211692216923169241692516926169271692816929169301693116932169331693416935169361693716938169391694016941169421694316944169451694616947169481694916950169511695216953169541695516956169571695816959169601696116962169631696416965169661696716968169691697016971169721697316974169751697616977169781697916980169811698216983169841698516986169871698816989169901699116992169931699416995169961699716998169991700017001170021700317004170051700617007170081700917010170111701217013170141701517016170171701817019170201702117022170231702417025170261702717028170291703017031170321703317034170351703617037170381703917040170411704217043170441704517046170471704817049170501705117052170531705417055170561705717058170591706017061170621706317064170651706617067170681706917070170711707217073170741707517076170771707817079170801708117082170831708417085170861708717088170891709017091170921709317094170951709617097170981709917100171011710217103171041710517106171071710817109171101711117112171131711417115171161711717118171191712017121171221712317124171251712617127171281712917130171311713217133171341713517136171371713817139171401714117142171431714417145171461714717148171491715017151171521715317154171551715617157171581715917160171611716217163171641716517166171671716817169171701717117172171731717417175171761717717178171791718017181171821718317184171851718617187171881718917190171911719217193171941719517196171971719817199172001720117202172031720417205172061720717208172091721017211172121721317214172151721617217172181721917220172211722217223172241722517226172271722817229172301723117232172331723417235172361723717238172391724017241172421724317244172451724617247172481724917250172511725217253172541725517256172571725817259172601726117262172631726417265172661726717268172691727017271172721727317274172751727617277172781727917280172811728217283172841728517286172871728817289172901729117292172931729417295172961729717298172991730017301173021730317304173051730617307173081730917310173111731217313173141731517316173171731817319173201732117322173231732417325173261732717328173291733017331173321733317334173351733617337173381733917340173411734217343173441734517346173471734817349173501735117352173531735417355173561735717358173591736017361173621736317364173651736617367173681736917370173711737217373173741737517376173771737817379173801738117382173831738417385173861738717388173891739017391173921739317394173951739617397173981739917400174011740217403174041740517406174071740817409174101741117412174131741417415174161741717418174191742017421174221742317424174251742617427174281742917430174311743217433174341743517436174371743817439174401744117442174431744417445174461744717448174491745017451174521745317454174551745617457174581745917460174611746217463174641746517466174671746817469174701747117472174731747417475174761747717478174791748017481174821748317484174851748617487174881748917490174911749217493174941749517496174971749817499175001750117502175031750417505175061750717508175091751017511175121751317514175151751617517175181751917520175211752217523175241752517526175271752817529175301753117532175331753417535175361753717538175391754017541175421754317544175451754617547175481754917550175511755217553175541755517556175571755817559175601756117562175631756417565175661756717568175691757017571175721757317574175751757617577175781757917580175811758217583175841758517586175871758817589175901759117592175931759417595175961759717598175991760017601176021760317604176051760617607176081760917610176111761217613176141761517616176171761817619176201762117622176231762417625176261762717628176291763017631176321763317634176351763617637176381763917640176411764217643176441764517646176471764817649176501765117652176531765417655176561765717658176591766017661176621766317664176651766617667176681766917670176711767217673176741767517676176771767817679176801768117682176831768417685176861768717688176891769017691176921769317694176951769617697176981769917700177011770217703177041770517706177071770817709177101771117712177131771417715177161771717718177191772017721177221772317724177251772617727177281772917730177311773217733177341773517736177371773817739177401774117742177431774417745177461774717748177491775017751177521775317754177551775617757177581775917760177611776217763177641776517766177671776817769177701777117772177731777417775177761777717778177791778017781177821778317784177851778617787177881778917790177911779217793177941779517796177971779817799178001780117802178031780417805178061780717808178091781017811178121781317814178151781617817178181781917820178211782217823178241782517826178271782817829178301783117832178331783417835178361783717838178391784017841178421784317844178451784617847178481784917850178511785217853178541785517856178571785817859178601786117862178631786417865178661786717868178691787017871178721787317874178751787617877178781787917880178811788217883178841788517886178871788817889178901789117892178931789417895178961789717898178991790017901179021790317904179051790617907179081790917910179111791217913179141791517916179171791817919179201792117922179231792417925179261792717928179291793017931179321793317934179351793617937179381793917940179411794217943179441794517946179471794817949179501795117952179531795417955179561795717958179591796017961179621796317964179651796617967179681796917970179711797217973179741797517976179771797817979179801798117982179831798417985179861798717988179891799017991179921799317994179951799617997179981799918000180011800218003180041800518006180071800818009180101801118012180131801418015180161801718018180191802018021180221802318024180251802618027180281802918030180311803218033180341803518036180371803818039180401804118042180431804418045180461804718048180491805018051180521805318054180551805618057180581805918060180611806218063180641806518066180671806818069180701807118072180731807418075180761807718078180791808018081180821808318084180851808618087180881808918090180911809218093180941809518096180971809818099181001810118102181031810418105181061810718108181091811018111181121811318114181151811618117181181811918120181211812218123181241812518126181271812818129181301813118132181331813418135181361813718138181391814018141181421814318144181451814618147181481814918150181511815218153181541815518156181571815818159181601816118162181631816418165181661816718168181691817018171181721817318174181751817618177181781817918180181811818218183181841818518186181871818818189181901819118192181931819418195181961819718198181991820018201182021820318204182051820618207182081820918210182111821218213182141821518216182171821818219182201822118222182231822418225182261822718228182291823018231182321823318234182351823618237182381823918240182411824218243182441824518246182471824818249182501825118252182531825418255182561825718258182591826018261182621826318264182651826618267182681826918270182711827218273182741827518276182771827818279182801828118282182831828418285182861828718288182891829018291182921829318294182951829618297182981829918300183011830218303183041830518306183071830818309183101831118312183131831418315183161831718318183191832018321183221832318324183251832618327183281832918330183311833218333183341833518336183371833818339183401834118342183431834418345183461834718348183491835018351183521835318354183551835618357183581835918360183611836218363183641836518366183671836818369183701837118372183731837418375183761837718378183791838018381183821838318384183851838618387183881838918390183911839218393183941839518396183971839818399184001840118402184031840418405184061840718408184091841018411184121841318414184151841618417184181841918420184211842218423184241842518426184271842818429184301843118432184331843418435184361843718438184391844018441184421844318444184451844618447184481844918450184511845218453184541845518456184571845818459184601846118462184631846418465184661846718468184691847018471184721847318474184751847618477184781847918480184811848218483184841848518486184871848818489184901849118492184931849418495184961849718498184991850018501185021850318504185051850618507185081850918510185111851218513185141851518516185171851818519185201852118522185231852418525185261852718528185291853018531185321853318534185351853618537185381853918540185411854218543185441854518546185471854818549185501855118552185531855418555185561855718558185591856018561185621856318564185651856618567185681856918570185711857218573185741857518576185771857818579185801858118582185831858418585185861858718588185891859018591185921859318594185951859618597185981859918600186011860218603186041860518606186071860818609186101861118612186131861418615186161861718618186191862018621186221862318624186251862618627186281862918630186311863218633186341863518636186371863818639186401864118642186431864418645186461864718648186491865018651186521865318654186551865618657186581865918660186611866218663186641866518666186671866818669186701867118672186731867418675186761867718678186791868018681186821868318684186851868618687186881868918690186911869218693186941869518696186971869818699187001870118702187031870418705187061870718708187091871018711187121871318714187151871618717187181871918720187211872218723187241872518726187271872818729187301873118732187331873418735187361873718738187391874018741187421874318744187451874618747187481874918750187511875218753187541875518756187571875818759187601876118762187631876418765187661876718768187691877018771187721877318774187751877618777187781877918780187811878218783187841878518786187871878818789187901879118792187931879418795187961879718798187991880018801188021880318804188051880618807188081880918810188111881218813188141881518816188171881818819188201882118822188231882418825188261882718828188291883018831188321883318834188351883618837188381883918840188411884218843188441884518846188471884818849188501885118852188531885418855188561885718858188591886018861188621886318864188651886618867188681886918870188711887218873188741887518876188771887818879188801888118882188831888418885188861888718888188891889018891188921889318894188951889618897188981889918900189011890218903189041890518906189071890818909189101891118912189131891418915189161891718918189191892018921189221892318924189251892618927189281892918930189311893218933189341893518936189371893818939189401894118942189431894418945189461894718948189491895018951189521895318954189551895618957189581895918960189611896218963189641896518966189671896818969189701897118972189731897418975189761897718978189791898018981189821898318984189851898618987189881898918990189911899218993189941899518996189971899818999190001900119002190031900419005190061900719008190091901019011190121901319014190151901619017190181901919020190211902219023190241902519026190271902819029190301903119032190331903419035190361903719038190391904019041190421904319044190451904619047190481904919050190511905219053190541905519056190571905819059190601906119062190631906419065190661906719068190691907019071190721907319074190751907619077190781907919080190811908219083190841908519086190871908819089190901909119092190931909419095190961909719098190991910019101191021910319104191051910619107191081910919110191111911219113191141911519116191171911819119191201912119122191231912419125191261912719128191291913019131191321913319134191351913619137191381913919140191411914219143191441914519146191471914819149191501915119152191531915419155191561915719158191591916019161191621916319164191651916619167191681916919170191711917219173191741917519176191771917819179191801918119182191831918419185191861918719188191891919019191191921919319194191951919619197191981919919200192011920219203192041920519206192071920819209192101921119212192131921419215192161921719218192191922019221192221922319224192251922619227192281922919230192311923219233192341923519236192371923819239192401924119242192431924419245192461924719248192491925019251192521925319254192551925619257192581925919260192611926219263192641926519266192671926819269192701927119272192731927419275192761927719278192791928019281192821928319284192851928619287192881928919290192911929219293192941929519296192971929819299193001930119302193031930419305193061930719308193091931019311193121931319314193151931619317193181931919320193211932219323193241932519326193271932819329193301933119332193331933419335193361933719338193391934019341193421934319344193451934619347193481934919350193511935219353193541935519356193571935819359193601936119362193631936419365193661936719368193691937019371193721937319374193751937619377193781937919380193811938219383193841938519386193871938819389193901939119392193931939419395193961939719398193991940019401194021940319404194051940619407194081940919410194111941219413194141941519416194171941819419194201942119422194231942419425194261942719428194291943019431194321943319434194351943619437194381943919440194411944219443194441944519446194471944819449194501945119452194531945419455194561945719458194591946019461194621946319464194651946619467194681946919470194711947219473194741947519476194771947819479194801948119482194831948419485194861948719488194891949019491194921949319494194951949619497194981949919500195011950219503195041950519506195071950819509195101951119512195131951419515195161951719518195191952019521195221952319524195251952619527195281952919530195311953219533195341953519536195371953819539195401954119542195431954419545195461954719548195491955019551195521955319554195551955619557195581955919560195611956219563195641956519566195671956819569195701957119572195731957419575195761957719578195791958019581195821958319584195851958619587195881958919590195911959219593195941959519596195971959819599196001960119602196031960419605196061960719608196091961019611196121961319614196151961619617196181961919620196211962219623196241962519626196271962819629196301963119632196331963419635196361963719638196391964019641196421964319644196451964619647196481964919650196511965219653196541965519656196571965819659196601966119662196631966419665196661966719668196691967019671196721967319674196751967619677196781967919680196811968219683196841968519686196871968819689196901969119692196931969419695196961969719698196991970019701197021970319704197051970619707197081970919710197111971219713197141971519716197171971819719197201972119722197231972419725197261972719728197291973019731197321973319734197351973619737197381973919740197411974219743197441974519746197471974819749197501975119752197531975419755197561975719758197591976019761197621976319764197651976619767197681976919770197711977219773197741977519776197771977819779197801978119782197831978419785197861978719788197891979019791197921979319794197951979619797197981979919800198011980219803198041980519806198071980819809198101981119812198131981419815198161981719818198191982019821198221982319824198251982619827198281982919830198311983219833198341983519836198371983819839198401984119842198431984419845198461984719848198491985019851198521985319854198551985619857198581985919860198611986219863198641986519866198671986819869198701987119872198731987419875198761987719878198791988019881198821988319884198851988619887198881988919890198911989219893198941989519896198971989819899199001990119902199031990419905199061990719908199091991019911199121991319914199151991619917199181991919920199211992219923199241992519926199271992819929199301993119932199331993419935199361993719938199391994019941199421994319944199451994619947199481994919950199511995219953199541995519956199571995819959199601996119962199631996419965199661996719968199691997019971199721997319974199751997619977199781997919980199811998219983199841998519986199871998819989199901999119992199931999419995199961999719998199992000020001200022000320004200052000620007200082000920010200112001220013200142001520016200172001820019200202002120022200232002420025200262002720028200292003020031200322003320034200352003620037200382003920040200412004220043200442004520046200472004820049200502005120052200532005420055200562005720058200592006020061200622006320064200652006620067200682006920070200712007220073200742007520076200772007820079200802008120082200832008420085200862008720088200892009020091200922009320094200952009620097200982009920100201012010220103201042010520106201072010820109201102011120112201132011420115201162011720118201192012020121201222012320124201252012620127201282012920130201312013220133201342013520136201372013820139201402014120142201432014420145201462014720148201492015020151201522015320154201552015620157201582015920160201612016220163201642016520166201672016820169201702017120172201732017420175201762017720178201792018020181201822018320184201852018620187201882018920190201912019220193201942019520196201972019820199202002020120202202032020420205202062020720208202092021020211202122021320214202152021620217202182021920220202212022220223202242022520226202272022820229202302023120232202332023420235202362023720238202392024020241202422024320244202452024620247202482024920250202512025220253202542025520256202572025820259202602026120262202632026420265202662026720268202692027020271202722027320274202752027620277202782027920280202812028220283202842028520286202872028820289202902029120292202932029420295202962029720298202992030020301203022030320304203052030620307203082030920310203112031220313203142031520316203172031820319203202032120322203232032420325203262032720328203292033020331203322033320334203352033620337203382033920340203412034220343203442034520346203472034820349203502035120352203532035420355203562035720358203592036020361203622036320364203652036620367203682036920370203712037220373203742037520376203772037820379203802038120382203832038420385203862038720388203892039020391203922039320394203952039620397203982039920400204012040220403204042040520406204072040820409204102041120412204132041420415204162041720418204192042020421204222042320424204252042620427204282042920430204312043220433204342043520436204372043820439204402044120442204432044420445204462044720448204492045020451204522045320454204552045620457204582045920460204612046220463204642046520466204672046820469204702047120472204732047420475204762047720478204792048020481204822048320484204852048620487204882048920490204912049220493204942049520496204972049820499205002050120502205032050420505205062050720508205092051020511205122051320514205152051620517205182051920520205212052220523205242052520526205272052820529205302053120532205332053420535205362053720538205392054020541205422054320544205452054620547205482054920550205512055220553205542055520556205572055820559205602056120562205632056420565205662056720568205692057020571205722057320574205752057620577205782057920580205812058220583205842058520586205872058820589205902059120592205932059420595205962059720598205992060020601206022060320604206052060620607206082060920610206112061220613206142061520616206172061820619206202062120622206232062420625206262062720628206292063020631206322063320634206352063620637206382063920640206412064220643206442064520646206472064820649206502065120652206532065420655206562065720658206592066020661206622066320664206652066620667206682066920670206712067220673206742067520676206772067820679206802068120682206832068420685206862068720688206892069020691206922069320694206952069620697206982069920700207012070220703207042070520706207072070820709207102071120712207132071420715207162071720718207192072020721207222072320724207252072620727207282072920730207312073220733207342073520736207372073820739207402074120742207432074420745207462074720748207492075020751207522075320754207552075620757207582075920760207612076220763207642076520766207672076820769207702077120772207732077420775207762077720778207792078020781207822078320784207852078620787207882078920790207912079220793207942079520796207972079820799208002080120802208032080420805208062080720808208092081020811208122081320814208152081620817208182081920820208212082220823208242082520826208272082820829208302083120832208332083420835208362083720838208392084020841208422084320844208452084620847208482084920850208512085220853208542085520856208572085820859208602086120862208632086420865208662086720868208692087020871208722087320874208752087620877208782087920880208812088220883208842088520886208872088820889208902089120892208932089420895208962089720898208992090020901209022090320904209052090620907209082090920910209112091220913209142091520916209172091820919209202092120922209232092420925209262092720928209292093020931209322093320934209352093620937209382093920940209412094220943209442094520946209472094820949209502095120952209532095420955209562095720958209592096020961209622096320964209652096620967209682096920970209712097220973209742097520976209772097820979209802098120982209832098420985209862098720988209892099020991209922099320994209952099620997209982099921000210012100221003210042100521006210072100821009210102101121012210132101421015210162101721018210192102021021210222102321024210252102621027210282102921030210312103221033210342103521036210372103821039210402104121042210432104421045210462104721048210492105021051210522105321054210552105621057210582105921060210612106221063210642106521066210672106821069210702107121072210732107421075210762107721078210792108021081210822108321084210852108621087210882108921090210912109221093210942109521096210972109821099211002110121102211032110421105211062110721108211092111021111211122111321114211152111621117211182111921120211212112221123211242112521126211272112821129211302113121132211332113421135211362113721138211392114021141211422114321144211452114621147211482114921150211512115221153211542115521156211572115821159211602116121162211632116421165211662116721168211692117021171211722117321174211752117621177211782117921180211812118221183211842118521186211872118821189211902119121192211932119421195211962119721198211992120021201212022120321204212052120621207212082120921210212112121221213212142121521216212172121821219212202122121222212232122421225212262122721228212292123021231212322123321234212352123621237212382123921240212412124221243212442124521246212472124821249212502125121252212532125421255212562125721258212592126021261212622126321264212652126621267212682126921270212712127221273212742127521276212772127821279212802128121282212832128421285212862128721288212892129021291212922129321294212952129621297212982129921300213012130221303213042130521306213072130821309213102131121312213132131421315213162131721318213192132021321213222132321324213252132621327213282132921330213312133221333213342133521336213372133821339213402134121342213432134421345213462134721348213492135021351213522135321354213552135621357213582135921360213612136221363213642136521366213672136821369213702137121372213732137421375213762137721378213792138021381213822138321384213852138621387213882138921390213912139221393213942139521396213972139821399214002140121402214032140421405214062140721408214092141021411214122141321414214152141621417214182141921420214212142221423214242142521426214272142821429214302143121432214332143421435214362143721438214392144021441214422144321444214452144621447214482144921450214512145221453214542145521456214572145821459214602146121462214632146421465214662146721468214692147021471214722147321474214752147621477214782147921480214812148221483214842148521486214872148821489214902149121492214932149421495214962149721498214992150021501215022150321504215052150621507215082150921510215112151221513215142151521516215172151821519215202152121522215232152421525215262152721528215292153021531215322153321534215352153621537215382153921540215412154221543215442154521546215472154821549215502155121552215532155421555215562155721558215592156021561215622156321564215652156621567215682156921570215712157221573215742157521576215772157821579215802158121582215832158421585215862158721588215892159021591215922159321594215952159621597215982159921600216012160221603216042160521606216072160821609216102161121612216132161421615216162161721618216192162021621216222162321624216252162621627216282162921630216312163221633216342163521636216372163821639216402164121642216432164421645216462164721648216492165021651216522165321654216552165621657216582165921660216612166221663216642166521666216672166821669216702167121672216732167421675216762167721678216792168021681216822168321684216852168621687216882168921690216912169221693216942169521696216972169821699217002170121702217032170421705217062170721708217092171021711217122171321714217152171621717217182171921720217212172221723217242172521726217272172821729217302173121732217332173421735217362173721738217392174021741217422174321744217452174621747217482174921750217512175221753217542175521756217572175821759217602176121762217632176421765217662176721768217692177021771217722177321774217752177621777217782177921780217812178221783217842178521786217872178821789217902179121792217932179421795217962179721798217992180021801218022180321804218052180621807218082180921810218112181221813218142181521816218172181821819218202182121822218232182421825218262182721828218292183021831218322183321834218352183621837218382183921840218412184221843218442184521846218472184821849218502185121852218532185421855218562185721858218592186021861218622186321864218652186621867218682186921870218712187221873218742187521876218772187821879218802188121882218832188421885218862188721888218892189021891218922189321894218952189621897218982189921900219012190221903219042190521906219072190821909219102191121912219132191421915219162191721918219192192021921219222192321924219252192621927219282192921930219312193221933219342193521936219372193821939219402194121942219432194421945219462194721948219492195021951219522195321954219552195621957219582195921960219612196221963219642196521966219672196821969219702197121972219732197421975219762197721978219792198021981219822198321984219852198621987219882198921990219912199221993219942199521996219972199821999220002200122002220032200422005220062200722008220092201022011220122201322014220152201622017220182201922020220212202222023220242202522026220272202822029220302203122032220332203422035220362203722038220392204022041220422204322044220452204622047220482204922050220512205222053220542205522056220572205822059220602206122062220632206422065220662206722068220692207022071220722207322074220752207622077220782207922080220812208222083220842208522086220872208822089220902209122092220932209422095220962209722098220992210022101221022210322104221052210622107221082210922110221112211222113221142211522116221172211822119221202212122122221232212422125221262212722128221292213022131221322213322134221352213622137221382213922140221412214222143221442214522146221472214822149221502215122152221532215422155221562215722158221592216022161221622216322164221652216622167221682216922170221712217222173221742217522176221772217822179221802218122182221832218422185221862218722188221892219022191221922219322194221952219622197221982219922200222012220222203222042220522206222072220822209222102221122212222132221422215222162221722218222192222022221222222222322224222252222622227222282222922230222312223222233222342223522236222372223822239222402224122242222432224422245222462224722248222492225022251222522225322254222552225622257222582225922260222612226222263222642226522266222672226822269222702227122272222732227422275222762227722278222792228022281222822228322284222852228622287222882228922290222912229222293222942229522296222972229822299223002230122302223032230422305223062230722308223092231022311223122231322314223152231622317223182231922320223212232222323223242232522326223272232822329223302233122332223332233422335223362233722338223392234022341223422234322344223452234622347223482234922350223512235222353223542235522356223572235822359223602236122362223632236422365223662236722368223692237022371223722237322374223752237622377223782237922380223812238222383223842238522386223872238822389223902239122392223932239422395223962239722398223992240022401224022240322404224052240622407224082240922410224112241222413224142241522416224172241822419224202242122422224232242422425224262242722428224292243022431224322243322434224352243622437224382243922440224412244222443224442244522446224472244822449224502245122452224532245422455224562245722458224592246022461224622246322464224652246622467224682246922470224712247222473224742247522476224772247822479224802248122482224832248422485224862248722488224892249022491224922249322494224952249622497224982249922500225012250222503225042250522506225072250822509225102251122512225132251422515225162251722518225192252022521225222252322524225252252622527225282252922530225312253222533225342253522536225372253822539225402254122542225432254422545225462254722548225492255022551225522255322554225552255622557225582255922560225612256222563225642256522566225672256822569225702257122572225732257422575225762257722578225792258022581225822258322584225852258622587225882258922590225912259222593225942259522596225972259822599226002260122602226032260422605226062260722608226092261022611226122261322614226152261622617226182261922620226212262222623226242262522626226272262822629226302263122632226332263422635226362263722638226392264022641226422264322644226452264622647226482264922650226512265222653226542265522656226572265822659226602266122662226632266422665226662266722668226692267022671226722267322674226752267622677226782267922680226812268222683226842268522686226872268822689226902269122692226932269422695226962269722698226992270022701227022270322704227052270622707227082270922710227112271222713227142271522716227172271822719227202272122722227232272422725227262272722728227292273022731227322273322734227352273622737227382273922740227412274222743227442274522746227472274822749227502275122752227532275422755227562275722758227592276022761227622276322764227652276622767227682276922770227712277222773227742277522776227772277822779227802278122782227832278422785227862278722788227892279022791227922279322794227952279622797227982279922800228012280222803228042280522806228072280822809228102281122812228132281422815228162281722818228192282022821228222282322824228252282622827228282282922830228312283222833228342283522836228372283822839228402284122842228432284422845228462284722848228492285022851228522285322854228552285622857228582285922860228612286222863228642286522866228672286822869228702287122872228732287422875228762287722878228792288022881228822288322884228852288622887228882288922890228912289222893228942289522896228972289822899229002290122902229032290422905229062290722908229092291022911229122291322914229152291622917229182291922920229212292222923229242292522926229272292822929229302293122932229332293422935229362293722938229392294022941229422294322944229452294622947229482294922950229512295222953229542295522956229572295822959229602296122962229632296422965229662296722968229692297022971229722297322974229752297622977229782297922980229812298222983229842298522986229872298822989229902299122992229932299422995229962299722998229992300023001230022300323004230052300623007230082300923010230112301223013230142301523016230172301823019230202302123022230232302423025230262302723028230292303023031230322303323034230352303623037230382303923040230412304223043230442304523046230472304823049230502305123052230532305423055230562305723058230592306023061230622306323064230652306623067230682306923070230712307223073230742307523076230772307823079230802308123082230832308423085230862308723088230892309023091230922309323094230952309623097230982309923100231012310223103231042310523106231072310823109231102311123112231132311423115231162311723118231192312023121231222312323124231252312623127231282312923130231312313223133231342313523136231372313823139231402314123142231432314423145231462314723148231492315023151231522315323154231552315623157231582315923160231612316223163231642316523166231672316823169231702317123172231732317423175231762317723178231792318023181231822318323184231852318623187231882318923190231912319223193231942319523196231972319823199232002320123202232032320423205232062320723208232092321023211232122321323214232152321623217232182321923220232212322223223232242322523226232272322823229232302323123232232332323423235232362323723238232392324023241232422324323244232452324623247232482324923250232512325223253232542325523256232572325823259232602326123262232632326423265232662326723268232692327023271232722327323274232752327623277232782327923280232812328223283232842328523286232872328823289232902329123292232932329423295232962329723298232992330023301233022330323304233052330623307233082330923310233112331223313233142331523316233172331823319233202332123322233232332423325233262332723328233292333023331233322333323334233352333623337233382333923340233412334223343233442334523346233472334823349233502335123352233532335423355233562335723358233592336023361233622336323364233652336623367233682336923370233712337223373233742337523376233772337823379233802338123382233832338423385233862338723388233892339023391233922339323394233952339623397233982339923400234012340223403234042340523406234072340823409234102341123412234132341423415234162341723418234192342023421234222342323424234252342623427234282342923430234312343223433234342343523436234372343823439234402344123442234432344423445234462344723448234492345023451234522345323454234552345623457234582345923460234612346223463234642346523466234672346823469234702347123472234732347423475234762347723478234792348023481234822348323484234852348623487234882348923490234912349223493234942349523496234972349823499235002350123502235032350423505235062350723508235092351023511235122351323514235152351623517235182351923520235212352223523235242352523526235272352823529235302353123532235332353423535235362353723538235392354023541235422354323544235452354623547235482354923550235512355223553235542355523556235572355823559235602356123562235632356423565235662356723568235692357023571235722357323574235752357623577235782357923580235812358223583235842358523586235872358823589235902359123592235932359423595235962359723598235992360023601236022360323604236052360623607236082360923610236112361223613236142361523616236172361823619236202362123622236232362423625236262362723628236292363023631236322363323634236352363623637236382363923640236412364223643236442364523646236472364823649236502365123652236532365423655236562365723658236592366023661236622366323664236652366623667236682366923670236712367223673236742367523676236772367823679236802368123682236832368423685236862368723688236892369023691236922369323694236952369623697236982369923700237012370223703237042370523706237072370823709237102371123712237132371423715237162371723718237192372023721237222372323724237252372623727237282372923730237312373223733237342373523736237372373823739237402374123742237432374423745237462374723748237492375023751237522375323754237552375623757237582375923760237612376223763237642376523766237672376823769237702377123772237732377423775237762377723778237792378023781237822378323784237852378623787237882378923790237912379223793237942379523796237972379823799238002380123802238032380423805238062380723808238092381023811238122381323814238152381623817238182381923820238212382223823238242382523826238272382823829238302383123832238332383423835238362383723838238392384023841238422384323844238452384623847238482384923850238512385223853238542385523856238572385823859238602386123862238632386423865238662386723868238692387023871238722387323874238752387623877238782387923880238812388223883238842388523886238872388823889238902389123892238932389423895238962389723898238992390023901239022390323904239052390623907239082390923910239112391223913239142391523916239172391823919239202392123922239232392423925239262392723928239292393023931239322393323934239352393623937239382393923940239412394223943239442394523946239472394823949239502395123952239532395423955239562395723958239592396023961239622396323964239652396623967239682396923970239712397223973239742397523976239772397823979239802398123982239832398423985239862398723988239892399023991239922399323994239952399623997239982399924000240012400224003240042400524006240072400824009240102401124012240132401424015240162401724018240192402024021240222402324024240252402624027240282402924030240312403224033240342403524036240372403824039240402404124042240432404424045240462404724048240492405024051240522405324054240552405624057240582405924060240612406224063240642406524066240672406824069240702407124072240732407424075240762407724078240792408024081240822408324084240852408624087240882408924090240912409224093240942409524096240972409824099241002410124102241032410424105241062410724108241092411024111241122411324114241152411624117241182411924120241212412224123241242412524126241272412824129241302413124132241332413424135241362413724138241392414024141241422414324144241452414624147241482414924150241512415224153241542415524156241572415824159241602416124162241632416424165241662416724168241692417024171241722417324174241752417624177241782417924180241812418224183241842418524186241872418824189241902419124192241932419424195241962419724198241992420024201242022420324204242052420624207242082420924210242112421224213242142421524216242172421824219242202422124222242232422424225242262422724228242292423024231242322423324234242352423624237242382423924240242412424224243242442424524246242472424824249242502425124252242532425424255242562425724258242592426024261242622426324264242652426624267242682426924270242712427224273242742427524276242772427824279242802428124282242832428424285242862428724288242892429024291242922429324294242952429624297242982429924300243012430224303243042430524306243072430824309243102431124312243132431424315243162431724318243192432024321243222432324324243252432624327243282432924330243312433224333243342433524336243372433824339243402434124342243432434424345243462434724348243492435024351243522435324354243552435624357243582435924360243612436224363243642436524366243672436824369243702437124372243732437424375243762437724378243792438024381243822438324384243852438624387243882438924390243912439224393243942439524396243972439824399244002440124402244032440424405244062440724408244092441024411244122441324414244152441624417244182441924420244212442224423244242442524426244272442824429244302443124432244332443424435244362443724438244392444024441244422444324444244452444624447244482444924450244512445224453244542445524456244572445824459244602446124462244632446424465244662446724468244692447024471244722447324474244752447624477244782447924480244812448224483244842448524486244872448824489244902449124492244932449424495244962449724498244992450024501245022450324504245052450624507245082450924510245112451224513245142451524516245172451824519245202452124522245232452424525245262452724528245292453024531245322453324534245352453624537245382453924540245412454224543245442454524546245472454824549245502455124552245532455424555245562455724558245592456024561245622456324564245652456624567245682456924570245712457224573245742457524576245772457824579245802458124582245832458424585245862458724588245892459024591245922459324594245952459624597245982459924600246012460224603246042460524606246072460824609246102461124612246132461424615246162461724618246192462024621246222462324624246252462624627246282462924630246312463224633246342463524636246372463824639246402464124642246432464424645246462464724648246492465024651246522465324654246552465624657246582465924660246612466224663246642466524666246672466824669246702467124672246732467424675246762467724678246792468024681246822468324684246852468624687246882468924690246912469224693246942469524696246972469824699247002470124702247032470424705247062470724708247092471024711247122471324714247152471624717247182471924720247212472224723247242472524726247272472824729247302473124732247332473424735247362473724738247392474024741247422474324744247452474624747247482474924750247512475224753247542475524756247572475824759247602476124762247632476424765247662476724768247692477024771247722477324774247752477624777247782477924780247812478224783247842478524786247872478824789247902479124792247932479424795247962479724798247992480024801248022480324804248052480624807248082480924810248112481224813248142481524816248172481824819248202482124822248232482424825248262482724828248292483024831248322483324834248352483624837248382483924840248412484224843248442484524846248472484824849248502485124852248532485424855248562485724858248592486024861248622486324864248652486624867248682486924870248712487224873248742487524876248772487824879248802488124882248832488424885248862488724888248892489024891248922489324894248952489624897248982489924900249012490224903249042490524906249072490824909249102491124912249132491424915249162491724918249192492024921249222492324924249252492624927249282492924930249312493224933249342493524936249372493824939249402494124942249432494424945249462494724948249492495024951249522495324954249552495624957249582495924960249612496224963249642496524966249672496824969249702497124972249732497424975249762497724978249792498024981249822498324984249852498624987249882498924990249912499224993249942499524996249972499824999250002500125002250032500425005250062500725008250092501025011250122501325014250152501625017250182501925020250212502225023250242502525026250272502825029250302503125032250332503425035250362503725038250392504025041250422504325044250452504625047250482504925050250512505225053250542505525056250572505825059250602506125062250632506425065250662506725068250692507025071250722507325074250752507625077250782507925080250812508225083250842508525086250872508825089250902509125092250932509425095250962509725098250992510025101251022510325104251052510625107251082510925110251112511225113251142511525116251172511825119251202512125122251232512425125251262512725128251292513025131251322513325134251352513625137251382513925140251412514225143251442514525146251472514825149251502515125152251532515425155251562515725158251592516025161251622516325164251652516625167251682516925170251712517225173251742517525176251772517825179251802518125182251832518425185251862518725188251892519025191251922519325194251952519625197251982519925200252012520225203252042520525206252072520825209252102521125212252132521425215252162521725218252192522025221252222522325224252252522625227252282522925230252312523225233252342523525236252372523825239252402524125242252432524425245252462524725248252492525025251252522525325254252552525625257252582525925260252612526225263252642526525266252672526825269252702527125272252732527425275252762527725278252792528025281252822528325284252852528625287252882528925290252912529225293252942529525296252972529825299253002530125302253032530425305253062530725308253092531025311253122531325314253152531625317253182531925320253212532225323253242532525326253272532825329253302533125332253332533425335253362533725338253392534025341253422534325344253452534625347253482534925350253512535225353253542535525356253572535825359253602536125362253632536425365253662536725368253692537025371253722537325374253752537625377253782537925380253812538225383253842538525386253872538825389253902539125392253932539425395253962539725398253992540025401254022540325404254052540625407254082540925410254112541225413254142541525416254172541825419254202542125422254232542425425254262542725428254292543025431254322543325434254352543625437254382543925440254412544225443254442544525446254472544825449254502545125452254532545425455254562545725458254592546025461254622546325464254652546625467254682546925470254712547225473254742547525476254772547825479254802548125482254832548425485254862548725488254892549025491254922549325494254952549625497254982549925500255012550225503255042550525506255072550825509255102551125512255132551425515255162551725518255192552025521255222552325524255252552625527255282552925530255312553225533255342553525536255372553825539255402554125542255432554425545255462554725548255492555025551255522555325554255552555625557255582555925560255612556225563255642556525566255672556825569255702557125572255732557425575255762557725578255792558025581255822558325584255852558625587255882558925590255912559225593255942559525596255972559825599256002560125602256032560425605256062560725608256092561025611256122561325614256152561625617256182561925620256212562225623256242562525626256272562825629256302563125632256332563425635256362563725638256392564025641256422564325644256452564625647256482564925650256512565225653256542565525656256572565825659256602566125662256632566425665256662566725668256692567025671256722567325674256752567625677256782567925680256812568225683256842568525686256872568825689256902569125692256932569425695256962569725698256992570025701257022570325704257052570625707257082570925710257112571225713257142571525716257172571825719257202572125722257232572425725257262572725728257292573025731257322573325734257352573625737257382573925740257412574225743257442574525746257472574825749257502575125752257532575425755257562575725758257592576025761257622576325764257652576625767257682576925770257712577225773257742577525776257772577825779257802578125782257832578425785257862578725788257892579025791257922579325794257952579625797257982579925800258012580225803258042580525806258072580825809258102581125812258132581425815258162581725818258192582025821258222582325824258252582625827258282582925830258312583225833258342583525836258372583825839258402584125842258432584425845258462584725848258492585025851258522585325854258552585625857258582585925860258612586225863258642586525866258672586825869258702587125872258732587425875258762587725878258792588025881258822588325884258852588625887258882588925890258912589225893258942589525896258972589825899259002590125902259032590425905259062590725908259092591025911259122591325914259152591625917259182591925920259212592225923259242592525926259272592825929259302593125932259332593425935259362593725938259392594025941259422594325944259452594625947259482594925950259512595225953259542595525956259572595825959259602596125962259632596425965259662596725968259692597025971259722597325974259752597625977259782597925980259812598225983259842598525986259872598825989259902599125992259932599425995259962599725998259992600026001260022600326004260052600626007260082600926010260112601226013260142601526016260172601826019260202602126022260232602426025260262602726028260292603026031260322603326034260352603626037260382603926040260412604226043260442604526046260472604826049260502605126052260532605426055260562605726058260592606026061260622606326064260652606626067260682606926070260712607226073260742607526076260772607826079260802608126082260832608426085260862608726088260892609026091260922609326094260952609626097260982609926100261012610226103261042610526106261072610826109261102611126112261132611426115261162611726118261192612026121261222612326124261252612626127261282612926130261312613226133261342613526136261372613826139261402614126142261432614426145261462614726148261492615026151261522615326154261552615626157261582615926160261612616226163261642616526166261672616826169261702617126172261732617426175261762617726178261792618026181261822618326184261852618626187261882618926190261912619226193261942619526196261972619826199262002620126202262032620426205262062620726208262092621026211262122621326214262152621626217262182621926220262212622226223262242622526226262272622826229262302623126232262332623426235262362623726238262392624026241262422624326244262452624626247262482624926250262512625226253262542625526256262572625826259262602626126262262632626426265262662626726268262692627026271262722627326274262752627626277262782627926280262812628226283262842628526286262872628826289262902629126292262932629426295262962629726298262992630026301263022630326304263052630626307263082630926310263112631226313263142631526316263172631826319263202632126322263232632426325263262632726328263292633026331263322633326334263352633626337263382633926340263412634226343263442634526346263472634826349263502635126352263532635426355263562635726358263592636026361263622636326364263652636626367263682636926370263712637226373263742637526376263772637826379263802638126382263832638426385263862638726388263892639026391263922639326394263952639626397263982639926400264012640226403264042640526406264072640826409264102641126412264132641426415264162641726418264192642026421264222642326424264252642626427264282642926430264312643226433264342643526436264372643826439264402644126442264432644426445264462644726448264492645026451264522645326454264552645626457264582645926460264612646226463264642646526466264672646826469264702647126472264732647426475264762647726478264792648026481264822648326484264852648626487264882648926490264912649226493264942649526496264972649826499265002650126502265032650426505265062650726508265092651026511265122651326514265152651626517265182651926520265212652226523265242652526526265272652826529265302653126532265332653426535265362653726538265392654026541265422654326544265452654626547265482654926550265512655226553265542655526556265572655826559265602656126562265632656426565265662656726568265692657026571265722657326574265752657626577265782657926580265812658226583265842658526586265872658826589265902659126592265932659426595265962659726598265992660026601266022660326604266052660626607266082660926610266112661226613266142661526616266172661826619266202662126622266232662426625266262662726628266292663026631266322663326634266352663626637266382663926640266412664226643266442664526646266472664826649266502665126652266532665426655266562665726658266592666026661266622666326664266652666626667266682666926670266712667226673266742667526676266772667826679266802668126682266832668426685266862668726688266892669026691266922669326694266952669626697266982669926700267012670226703267042670526706267072670826709267102671126712267132671426715267162671726718267192672026721267222672326724267252672626727267282672926730267312673226733267342673526736267372673826739267402674126742267432674426745267462674726748267492675026751267522675326754267552675626757267582675926760267612676226763267642676526766267672676826769267702677126772267732677426775267762677726778267792678026781267822678326784267852678626787267882678926790267912679226793267942679526796267972679826799268002680126802268032680426805268062680726808268092681026811268122681326814268152681626817268182681926820268212682226823268242682526826268272682826829268302683126832268332683426835268362683726838268392684026841268422684326844268452684626847268482684926850268512685226853268542685526856268572685826859268602686126862268632686426865268662686726868268692687026871268722687326874268752687626877268782687926880268812688226883268842688526886268872688826889268902689126892268932689426895268962689726898268992690026901269022690326904269052690626907269082690926910269112691226913269142691526916269172691826919269202692126922269232692426925269262692726928269292693026931269322693326934269352693626937269382693926940269412694226943269442694526946269472694826949269502695126952269532695426955269562695726958269592696026961269622696326964269652696626967269682696926970269712697226973269742697526976269772697826979269802698126982269832698426985269862698726988269892699026991269922699326994269952699626997269982699927000270012700227003270042700527006270072700827009270102701127012270132701427015270162701727018270192702027021270222702327024270252702627027270282702927030270312703227033270342703527036270372703827039270402704127042270432704427045270462704727048270492705027051270522705327054270552705627057270582705927060270612706227063270642706527066270672706827069270702707127072270732707427075270762707727078270792708027081270822708327084270852708627087270882708927090270912709227093270942709527096270972709827099271002710127102271032710427105271062710727108271092711027111271122711327114271152711627117271182711927120271212712227123271242712527126271272712827129271302713127132271332713427135271362713727138271392714027141271422714327144271452714627147271482714927150271512715227153271542715527156271572715827159271602716127162271632716427165271662716727168271692717027171271722717327174271752717627177271782717927180271812718227183271842718527186271872718827189271902719127192271932719427195271962719727198271992720027201272022720327204272052720627207272082720927210272112721227213272142721527216272172721827219272202722127222272232722427225272262722727228272292723027231272322723327234272352723627237272382723927240272412724227243272442724527246272472724827249272502725127252272532725427255272562725727258272592726027261272622726327264272652726627267272682726927270272712727227273272742727527276272772727827279272802728127282272832728427285272862728727288272892729027291272922729327294272952729627297272982729927300273012730227303273042730527306273072730827309273102731127312273132731427315273162731727318273192732027321273222732327324273252732627327273282732927330273312733227333273342733527336273372733827339273402734127342273432734427345273462734727348273492735027351273522735327354273552735627357273582735927360273612736227363273642736527366273672736827369273702737127372273732737427375273762737727378273792738027381273822738327384273852738627387273882738927390273912739227393273942739527396273972739827399274002740127402274032740427405274062740727408274092741027411274122741327414274152741627417274182741927420274212742227423274242742527426274272742827429274302743127432274332743427435274362743727438274392744027441274422744327444274452744627447274482744927450274512745227453274542745527456274572745827459274602746127462274632746427465274662746727468274692747027471274722747327474274752747627477274782747927480274812748227483274842748527486274872748827489274902749127492274932749427495274962749727498274992750027501275022750327504275052750627507275082750927510275112751227513275142751527516275172751827519275202752127522275232752427525275262752727528275292753027531275322753327534275352753627537275382753927540275412754227543275442754527546275472754827549275502755127552275532755427555275562755727558275592756027561275622756327564275652756627567275682756927570275712757227573275742757527576275772757827579275802758127582275832758427585275862758727588275892759027591275922759327594275952759627597275982759927600276012760227603276042760527606276072760827609276102761127612276132761427615276162761727618276192762027621276222762327624276252762627627276282762927630276312763227633276342763527636276372763827639276402764127642276432764427645276462764727648276492765027651276522765327654276552765627657276582765927660276612766227663276642766527666276672766827669276702767127672276732767427675276762767727678276792768027681276822768327684276852768627687276882768927690276912769227693276942769527696276972769827699277002770127702277032770427705277062770727708277092771027711277122771327714277152771627717277182771927720277212772227723277242772527726277272772827729277302773127732277332773427735277362773727738277392774027741277422774327744277452774627747277482774927750277512775227753277542775527756277572775827759277602776127762277632776427765277662776727768277692777027771277722777327774277752777627777277782777927780277812778227783277842778527786277872778827789277902779127792277932779427795277962779727798277992780027801278022780327804278052780627807278082780927810278112781227813278142781527816278172781827819278202782127822278232782427825278262782727828278292783027831278322783327834278352783627837278382783927840278412784227843278442784527846278472784827849278502785127852278532785427855278562785727858278592786027861278622786327864278652786627867278682786927870278712787227873278742787527876278772787827879278802788127882278832788427885278862788727888278892789027891278922789327894278952789627897278982789927900279012790227903279042790527906279072790827909279102791127912279132791427915279162791727918279192792027921279222792327924279252792627927279282792927930279312793227933279342793527936279372793827939279402794127942279432794427945279462794727948279492795027951279522795327954279552795627957279582795927960279612796227963279642796527966279672796827969279702797127972279732797427975279762797727978279792798027981279822798327984279852798627987279882798927990279912799227993279942799527996279972799827999280002800128002280032800428005280062800728008280092801028011280122801328014280152801628017280182801928020280212802228023280242802528026280272802828029280302803128032280332803428035280362803728038280392804028041280422804328044280452804628047280482804928050280512805228053280542805528056280572805828059280602806128062280632806428065280662806728068280692807028071280722807328074280752807628077280782807928080280812808228083280842808528086280872808828089280902809128092280932809428095280962809728098280992810028101281022810328104281052810628107281082810928110281112811228113281142811528116281172811828119281202812128122281232812428125281262812728128281292813028131281322813328134281352813628137281382813928140281412814228143281442814528146281472814828149281502815128152281532815428155281562815728158281592816028161281622816328164281652816628167281682816928170281712817228173281742817528176281772817828179281802818128182281832818428185281862818728188281892819028191281922819328194281952819628197281982819928200282012820228203282042820528206282072820828209282102821128212282132821428215282162821728218282192822028221282222822328224282252822628227282282822928230282312823228233282342823528236282372823828239282402824128242282432824428245282462824728248282492825028251282522825328254282552825628257282582825928260282612826228263282642826528266282672826828269282702827128272282732827428275282762827728278282792828028281282822828328284282852828628287282882828928290282912829228293282942829528296282972829828299283002830128302283032830428305283062830728308283092831028311283122831328314283152831628317283182831928320283212832228323283242832528326283272832828329283302833128332283332833428335283362833728338283392834028341283422834328344283452834628347283482834928350283512835228353283542835528356283572835828359283602836128362283632836428365283662836728368283692837028371283722837328374283752837628377283782837928380283812838228383283842838528386283872838828389283902839128392283932839428395283962839728398283992840028401284022840328404284052840628407284082840928410284112841228413284142841528416284172841828419284202842128422284232842428425284262842728428284292843028431284322843328434284352843628437284382843928440284412844228443284442844528446284472844828449284502845128452284532845428455284562845728458284592846028461284622846328464284652846628467284682846928470284712847228473284742847528476284772847828479284802848128482284832848428485284862848728488284892849028491284922849328494284952849628497284982849928500285012850228503285042850528506285072850828509285102851128512285132851428515285162851728518285192852028521285222852328524285252852628527285282852928530285312853228533285342853528536285372853828539285402854128542285432854428545285462854728548285492855028551285522855328554285552855628557285582855928560285612856228563285642856528566285672856828569285702857128572285732857428575285762857728578285792858028581285822858328584285852858628587285882858928590285912859228593285942859528596285972859828599286002860128602286032860428605286062860728608286092861028611286122861328614286152861628617286182861928620286212862228623286242862528626286272862828629286302863128632286332863428635286362863728638286392864028641286422864328644286452864628647286482864928650286512865228653286542865528656286572865828659286602866128662286632866428665286662866728668286692867028671286722867328674286752867628677286782867928680286812868228683286842868528686286872868828689286902869128692286932869428695286962869728698286992870028701287022870328704287052870628707287082870928710287112871228713287142871528716287172871828719287202872128722287232872428725287262872728728287292873028731287322873328734287352873628737287382873928740287412874228743287442874528746287472874828749287502875128752287532875428755287562875728758287592876028761287622876328764287652876628767287682876928770287712877228773287742877528776287772877828779287802878128782287832878428785287862878728788287892879028791287922879328794287952879628797287982879928800288012880228803288042880528806288072880828809288102881128812288132881428815288162881728818288192882028821288222882328824288252882628827288282882928830288312883228833288342883528836288372883828839288402884128842288432884428845288462884728848288492885028851288522885328854288552885628857288582885928860288612886228863288642886528866288672886828869288702887128872288732887428875288762887728878288792888028881288822888328884288852888628887288882888928890288912889228893288942889528896288972889828899289002890128902289032890428905289062890728908289092891028911289122891328914289152891628917289182891928920289212892228923289242892528926289272892828929289302893128932289332893428935289362893728938289392894028941289422894328944289452894628947289482894928950289512895228953289542895528956289572895828959289602896128962289632896428965289662896728968289692897028971289722897328974289752897628977289782897928980289812898228983289842898528986289872898828989289902899128992289932899428995289962899728998289992900029001290022900329004290052900629007290082900929010290112901229013290142901529016290172901829019290202902129022290232902429025290262902729028290292903029031290322903329034290352903629037290382903929040290412904229043290442904529046290472904829049290502905129052290532905429055290562905729058290592906029061290622906329064290652906629067290682906929070290712907229073290742907529076290772907829079290802908129082290832908429085290862908729088290892909029091290922909329094290952909629097290982909929100291012910229103291042910529106291072910829109291102911129112291132911429115291162911729118291192912029121291222912329124291252912629127291282912929130291312913229133291342913529136291372913829139291402914129142291432914429145291462914729148291492915029151291522915329154291552915629157291582915929160291612916229163291642916529166291672916829169291702917129172291732917429175291762917729178291792918029181291822918329184291852918629187291882918929190291912919229193291942919529196291972919829199292002920129202292032920429205292062920729208292092921029211292122921329214292152921629217292182921929220292212922229223292242922529226292272922829229292302923129232292332923429235292362923729238292392924029241292422924329244292452924629247292482924929250292512925229253292542925529256292572925829259292602926129262292632926429265292662926729268292692927029271292722927329274292752927629277292782927929280292812928229283292842928529286292872928829289292902929129292292932929429295292962929729298292992930029301293022930329304293052930629307293082930929310293112931229313293142931529316293172931829319293202932129322293232932429325293262932729328293292933029331293322933329334293352933629337293382933929340293412934229343293442934529346293472934829349293502935129352293532935429355293562935729358293592936029361293622936329364293652936629367293682936929370293712937229373293742937529376293772937829379293802938129382293832938429385293862938729388293892939029391293922939329394293952939629397293982939929400294012940229403294042940529406294072940829409294102941129412294132941429415294162941729418294192942029421294222942329424294252942629427294282942929430294312943229433294342943529436294372943829439294402944129442294432944429445294462944729448294492945029451294522945329454294552945629457294582945929460294612946229463294642946529466294672946829469294702947129472294732947429475294762947729478294792948029481294822948329484294852948629487294882948929490294912949229493294942949529496294972949829499295002950129502295032950429505295062950729508295092951029511295122951329514295152951629517295182951929520295212952229523295242952529526295272952829529295302953129532295332953429535295362953729538295392954029541295422954329544295452954629547295482954929550295512955229553295542955529556295572955829559295602956129562295632956429565295662956729568295692957029571295722957329574295752957629577295782957929580295812958229583295842958529586295872958829589295902959129592295932959429595295962959729598295992960029601296022960329604296052960629607296082960929610296112961229613296142961529616296172961829619296202962129622296232962429625296262962729628296292963029631296322963329634296352963629637296382963929640296412964229643296442964529646296472964829649296502965129652296532965429655296562965729658296592966029661296622966329664296652966629667296682966929670296712967229673296742967529676296772967829679296802968129682296832968429685296862968729688296892969029691296922969329694296952969629697296982969929700297012970229703297042970529706297072970829709297102971129712297132971429715297162971729718297192972029721297222972329724297252972629727297282972929730297312973229733297342973529736297372973829739297402974129742297432974429745297462974729748297492975029751297522975329754297552975629757297582975929760297612976229763297642976529766297672976829769297702977129772297732977429775297762977729778297792978029781297822978329784297852978629787297882978929790297912979229793297942979529796297972979829799298002980129802298032980429805298062980729808298092981029811298122981329814298152981629817298182981929820298212982229823298242982529826298272982829829298302983129832298332983429835298362983729838298392984029841298422984329844298452984629847298482984929850298512985229853298542985529856298572985829859298602986129862298632986429865298662986729868298692987029871298722987329874298752987629877298782987929880298812988229883298842988529886298872988829889298902989129892298932989429895298962989729898298992990029901299022990329904299052990629907299082990929910299112991229913299142991529916299172991829919299202992129922299232992429925299262992729928299292993029931299322993329934299352993629937299382993929940299412994229943299442994529946299472994829949299502995129952299532995429955299562995729958299592996029961299622996329964299652996629967299682996929970299712997229973299742997529976299772997829979299802998129982299832998429985299862998729988299892999029991299922999329994299952999629997299982999930000300013000230003300043000530006300073000830009300103001130012300133001430015300163001730018300193002030021300223002330024300253002630027300283002930030300313003230033300343003530036300373003830039300403004130042300433004430045300463004730048300493005030051300523005330054300553005630057300583005930060300613006230063300643006530066300673006830069300703007130072300733007430075300763007730078300793008030081300823008330084300853008630087300883008930090300913009230093300943009530096300973009830099301003010130102301033010430105301063010730108301093011030111301123011330114301153011630117301183011930120301213012230123301243012530126301273012830129301303013130132301333013430135301363013730138301393014030141301423014330144301453014630147301483014930150301513015230153301543015530156301573015830159301603016130162301633016430165301663016730168301693017030171301723017330174301753017630177301783017930180301813018230183301843018530186301873018830189301903019130192301933019430195301963019730198301993020030201302023020330204302053020630207302083020930210302113021230213302143021530216302173021830219302203022130222302233022430225302263022730228302293023030231302323023330234302353023630237302383023930240302413024230243302443024530246302473024830249302503025130252302533025430255302563025730258302593026030261302623026330264302653026630267302683026930270302713027230273302743027530276302773027830279302803028130282302833028430285302863028730288302893029030291302923029330294302953029630297302983029930300303013030230303303043030530306303073030830309303103031130312303133031430315303163031730318303193032030321303223032330324303253032630327303283032930330303313033230333303343033530336303373033830339303403034130342303433034430345303463034730348303493035030351303523035330354303553035630357303583035930360303613036230363303643036530366303673036830369303703037130372303733037430375303763037730378303793038030381303823038330384303853038630387303883038930390303913039230393303943039530396303973039830399304003040130402304033040430405304063040730408304093041030411304123041330414304153041630417304183041930420304213042230423304243042530426304273042830429304303043130432304333043430435304363043730438304393044030441304423044330444304453044630447304483044930450304513045230453304543045530456304573045830459304603046130462304633046430465304663046730468304693047030471304723047330474304753047630477304783047930480304813048230483304843048530486304873048830489304903049130492304933049430495304963049730498304993050030501305023050330504305053050630507305083050930510305113051230513305143051530516305173051830519305203052130522305233052430525305263052730528305293053030531305323053330534305353053630537305383053930540305413054230543305443054530546305473054830549305503055130552305533055430555305563055730558305593056030561305623056330564305653056630567305683056930570305713057230573305743057530576305773057830579305803058130582305833058430585305863058730588305893059030591305923059330594305953059630597305983059930600306013060230603306043060530606306073060830609306103061130612306133061430615306163061730618306193062030621306223062330624306253062630627306283062930630306313063230633306343063530636306373063830639306403064130642306433064430645306463064730648306493065030651306523065330654306553065630657306583065930660306613066230663306643066530666306673066830669306703067130672306733067430675306763067730678306793068030681306823068330684306853068630687306883068930690306913069230693306943069530696306973069830699307003070130702307033070430705307063070730708307093071030711307123071330714307153071630717307183071930720307213072230723307243072530726307273072830729307303073130732307333073430735307363073730738307393074030741307423074330744307453074630747307483074930750307513075230753307543075530756307573075830759307603076130762307633076430765307663076730768307693077030771307723077330774307753077630777307783077930780307813078230783307843078530786307873078830789307903079130792307933079430795307963079730798307993080030801308023080330804308053080630807308083080930810308113081230813308143081530816308173081830819308203082130822308233082430825308263082730828308293083030831308323083330834308353083630837308383083930840308413084230843308443084530846308473084830849308503085130852308533085430855308563085730858308593086030861308623086330864308653086630867308683086930870308713087230873308743087530876308773087830879308803088130882308833088430885308863088730888308893089030891308923089330894308953089630897308983089930900309013090230903309043090530906309073090830909309103091130912309133091430915309163091730918309193092030921309223092330924309253092630927309283092930930309313093230933309343093530936309373093830939309403094130942309433094430945309463094730948309493095030951309523095330954309553095630957309583095930960309613096230963309643096530966309673096830969309703097130972309733097430975309763097730978309793098030981309823098330984309853098630987309883098930990309913099230993309943099530996309973099830999310003100131002310033100431005310063100731008310093101031011310123101331014310153101631017310183101931020310213102231023310243102531026310273102831029310303103131032310333103431035310363103731038310393104031041310423104331044310453104631047310483104931050310513105231053310543105531056310573105831059310603106131062310633106431065310663106731068310693107031071310723107331074310753107631077310783107931080310813108231083310843108531086310873108831089310903109131092310933109431095310963109731098310993110031101311023110331104311053110631107311083110931110311113111231113311143111531116311173111831119311203112131122311233112431125311263112731128311293113031131311323113331134311353113631137311383113931140311413114231143311443114531146311473114831149311503115131152311533115431155311563115731158311593116031161311623116331164311653116631167311683116931170311713117231173311743117531176311773117831179311803118131182311833118431185311863118731188311893119031191311923119331194311953119631197311983119931200312013120231203312043120531206312073120831209312103121131212312133121431215312163121731218312193122031221312223122331224312253122631227312283122931230312313123231233312343123531236312373123831239312403124131242312433124431245312463124731248312493125031251312523125331254312553125631257312583125931260312613126231263312643126531266312673126831269312703127131272312733127431275312763127731278312793128031281312823128331284312853128631287312883128931290312913129231293312943129531296312973129831299313003130131302313033130431305313063130731308313093131031311313123131331314313153131631317313183131931320313213132231323313243132531326313273132831329313303133131332313333133431335313363133731338313393134031341313423134331344313453134631347313483134931350313513135231353313543135531356313573135831359313603136131362313633136431365313663136731368313693137031371313723137331374313753137631377313783137931380313813138231383313843138531386313873138831389313903139131392313933139431395313963139731398313993140031401314023140331404314053140631407314083140931410314113141231413314143141531416314173141831419314203142131422314233142431425314263142731428314293143031431314323143331434314353143631437314383143931440314413144231443314443144531446314473144831449314503145131452314533145431455314563145731458314593146031461314623146331464314653146631467314683146931470314713147231473314743147531476314773147831479314803148131482314833148431485314863148731488314893149031491314923149331494314953149631497314983149931500315013150231503315043150531506315073150831509315103151131512315133151431515315163151731518315193152031521315223152331524315253152631527315283152931530315313153231533315343153531536315373153831539315403154131542315433154431545315463154731548315493155031551315523155331554315553155631557315583155931560315613156231563315643156531566315673156831569315703157131572315733157431575315763157731578315793158031581315823158331584315853158631587315883158931590315913159231593315943159531596315973159831599316003160131602316033160431605316063160731608316093161031611316123161331614316153161631617316183161931620316213162231623316243162531626316273162831629316303163131632316333163431635316363163731638316393164031641316423164331644316453164631647316483164931650316513165231653316543165531656316573165831659316603166131662316633166431665316663166731668316693167031671316723167331674316753167631677316783167931680316813168231683316843168531686316873168831689316903169131692316933169431695316963169731698316993170031701317023170331704317053170631707317083170931710317113171231713317143171531716317173171831719317203172131722317233172431725317263172731728317293173031731317323173331734317353173631737317383173931740317413174231743317443174531746317473174831749317503175131752317533175431755317563175731758317593176031761317623176331764317653176631767317683176931770317713177231773317743177531776317773177831779317803178131782317833178431785317863178731788317893179031791317923179331794317953179631797317983179931800318013180231803318043180531806318073180831809318103181131812318133181431815318163181731818318193182031821318223182331824318253182631827318283182931830318313183231833318343183531836318373183831839318403184131842318433184431845318463184731848318493185031851318523185331854318553185631857318583185931860318613186231863318643186531866318673186831869318703187131872318733187431875318763187731878318793188031881318823188331884318853188631887318883188931890318913189231893318943189531896318973189831899319003190131902319033190431905319063190731908319093191031911319123191331914319153191631917319183191931920319213192231923319243192531926319273192831929319303193131932319333193431935319363193731938319393194031941319423194331944319453194631947319483194931950319513195231953319543195531956319573195831959319603196131962319633196431965319663196731968319693197031971319723197331974319753197631977319783197931980319813198231983319843198531986319873198831989319903199131992319933199431995319963199731998319993200032001320023200332004320053200632007320083200932010320113201232013320143201532016320173201832019320203202132022320233202432025320263202732028320293203032031320323203332034320353203632037320383203932040320413204232043320443204532046320473204832049320503205132052320533205432055320563205732058320593206032061320623206332064320653206632067320683206932070320713207232073320743207532076320773207832079320803208132082320833208432085320863208732088320893209032091320923209332094320953209632097320983209932100321013210232103321043210532106321073210832109321103211132112321133211432115321163211732118321193212032121321223212332124321253212632127321283212932130321313213232133321343213532136321373213832139321403214132142321433214432145321463214732148321493215032151321523215332154321553215632157321583215932160321613216232163321643216532166321673216832169321703217132172321733217432175321763217732178321793218032181321823218332184321853218632187321883218932190321913219232193321943219532196321973219832199322003220132202322033220432205322063220732208322093221032211322123221332214322153221632217322183221932220322213222232223322243222532226322273222832229322303223132232322333223432235322363223732238322393224032241322423224332244322453224632247322483224932250322513225232253322543225532256322573225832259322603226132262322633226432265322663226732268322693227032271322723227332274322753227632277322783227932280322813228232283322843228532286322873228832289322903229132292322933229432295322963229732298322993230032301323023230332304323053230632307323083230932310323113231232313323143231532316323173231832319323203232132322323233232432325323263232732328323293233032331323323233332334323353233632337323383233932340323413234232343323443234532346323473234832349323503235132352323533235432355323563235732358323593236032361323623236332364323653236632367323683236932370323713237232373323743237532376323773237832379323803238132382323833238432385323863238732388323893239032391323923239332394323953239632397323983239932400324013240232403324043240532406324073240832409324103241132412324133241432415324163241732418324193242032421324223242332424324253242632427324283242932430324313243232433324343243532436324373243832439324403244132442324433244432445324463244732448324493245032451324523245332454324553245632457324583245932460324613246232463324643246532466324673246832469324703247132472324733247432475324763247732478324793248032481324823248332484324853248632487324883248932490324913249232493324943249532496324973249832499325003250132502325033250432505325063250732508325093251032511325123251332514325153251632517325183251932520325213252232523325243252532526325273252832529325303253132532325333253432535325363253732538325393254032541325423254332544325453254632547325483254932550325513255232553325543255532556325573255832559325603256132562325633256432565325663256732568325693257032571325723257332574325753257632577325783257932580325813258232583325843258532586325873258832589325903259132592325933259432595325963259732598325993260032601326023260332604326053260632607326083260932610326113261232613326143261532616326173261832619326203262132622326233262432625326263262732628326293263032631326323263332634326353263632637326383263932640326413264232643326443264532646326473264832649326503265132652326533265432655326563265732658326593266032661326623266332664326653266632667326683266932670326713267232673326743267532676326773267832679326803268132682326833268432685326863268732688326893269032691326923269332694326953269632697326983269932700327013270232703327043270532706327073270832709327103271132712327133271432715327163271732718327193272032721327223272332724327253272632727327283272932730327313273232733327343273532736327373273832739327403274132742327433274432745327463274732748327493275032751327523275332754327553275632757327583275932760327613276232763327643276532766327673276832769327703277132772327733277432775327763277732778327793278032781327823278332784327853278632787327883278932790327913279232793327943279532796327973279832799328003280132802328033280432805328063280732808328093281032811328123281332814328153281632817328183281932820328213282232823328243282532826328273282832829328303283132832328333283432835328363283732838328393284032841328423284332844328453284632847328483284932850328513285232853328543285532856328573285832859328603286132862328633286432865328663286732868328693287032871328723287332874328753287632877328783287932880328813288232883328843288532886328873288832889328903289132892328933289432895328963289732898328993290032901329023290332904329053290632907329083290932910329113291232913329143291532916329173291832919329203292132922329233292432925329263292732928329293293032931329323293332934329353293632937329383293932940329413294232943329443294532946329473294832949329503295132952329533295432955329563295732958329593296032961329623296332964329653296632967329683296932970329713297232973329743297532976329773297832979329803298132982329833298432985329863298732988329893299032991329923299332994329953299632997329983299933000330013300233003330043300533006330073300833009330103301133012330133301433015330163301733018330193302033021330223302333024330253302633027330283302933030330313303233033330343303533036330373303833039330403304133042330433304433045330463304733048330493305033051330523305333054330553305633057330583305933060330613306233063330643306533066330673306833069330703307133072330733307433075330763307733078330793308033081330823308333084330853308633087330883308933090330913309233093330943309533096330973309833099331003310133102331033310433105331063310733108331093311033111331123311333114331153311633117331183311933120331213312233123331243312533126331273312833129331303313133132331333313433135331363313733138331393314033141331423314333144331453314633147331483314933150331513315233153331543315533156331573315833159331603316133162331633316433165331663316733168331693317033171331723317333174331753317633177331783317933180331813318233183331843318533186331873318833189331903319133192331933319433195331963319733198331993320033201332023320333204332053320633207332083320933210332113321233213332143321533216332173321833219332203322133222332233322433225332263322733228332293323033231332323323333234332353323633237332383323933240332413324233243332443324533246332473324833249332503325133252332533325433255332563325733258332593326033261332623326333264332653326633267332683326933270332713327233273332743327533276332773327833279332803328133282332833328433285332863328733288332893329033291332923329333294332953329633297332983329933300333013330233303333043330533306333073330833309333103331133312333133331433315333163331733318333193332033321333223332333324333253332633327333283332933330333313333233333333343333533336333373333833339333403334133342333433334433345333463334733348333493335033351333523335333354333553335633357333583335933360333613336233363333643336533366333673336833369333703337133372333733337433375333763337733378333793338033381333823338333384333853338633387333883338933390333913339233393333943339533396333973339833399334003340133402334033340433405334063340733408334093341033411334123341333414334153341633417334183341933420334213342233423334243342533426334273342833429334303343133432334333343433435334363343733438334393344033441334423344333444334453344633447334483344933450334513345233453334543345533456334573345833459334603346133462334633346433465334663346733468334693347033471334723347333474334753347633477334783347933480334813348233483334843348533486334873348833489334903349133492334933349433495334963349733498334993350033501335023350333504335053350633507335083350933510335113351233513335143351533516335173351833519335203352133522335233352433525335263352733528335293353033531335323353333534335353353633537335383353933540335413354233543335443354533546335473354833549335503355133552335533355433555335563355733558335593356033561335623356333564335653356633567335683356933570335713357233573335743357533576335773357833579335803358133582335833358433585335863358733588335893359033591335923359333594335953359633597335983359933600336013360233603336043360533606336073360833609336103361133612336133361433615336163361733618336193362033621336223362333624336253362633627336283362933630336313363233633336343363533636336373363833639336403364133642336433364433645336463364733648336493365033651336523365333654336553365633657336583365933660336613366233663336643366533666336673366833669336703367133672336733367433675336763367733678336793368033681336823368333684336853368633687336883368933690336913369233693336943369533696336973369833699337003370133702337033370433705337063370733708337093371033711337123371333714337153371633717337183371933720337213372233723337243372533726337273372833729337303373133732337333373433735337363373733738337393374033741337423374333744337453374633747337483374933750337513375233753337543375533756337573375833759337603376133762337633376433765337663376733768337693377033771337723377333774337753377633777337783377933780337813378233783337843378533786337873378833789337903379133792337933379433795337963379733798337993380033801338023380333804338053380633807338083380933810338113381233813338143381533816338173381833819338203382133822338233382433825338263382733828338293383033831338323383333834338353383633837338383383933840338413384233843338443384533846338473384833849338503385133852338533385433855338563385733858338593386033861338623386333864338653386633867338683386933870338713387233873338743387533876338773387833879338803388133882338833388433885338863388733888338893389033891338923389333894338953389633897338983389933900339013390233903339043390533906339073390833909339103391133912339133391433915339163391733918339193392033921339223392333924339253392633927339283392933930339313393233933339343393533936339373393833939339403394133942339433394433945339463394733948339493395033951339523395333954339553395633957339583395933960339613396233963339643396533966339673396833969339703397133972339733397433975339763397733978339793398033981339823398333984339853398633987339883398933990339913399233993339943399533996339973399833999340003400134002340033400434005340063400734008340093401034011340123401334014340153401634017340183401934020340213402234023340243402534026340273402834029340303403134032340333403434035340363403734038340393404034041340423404334044340453404634047340483404934050340513405234053340543405534056340573405834059340603406134062340633406434065340663406734068340693407034071340723407334074340753407634077340783407934080340813408234083340843408534086340873408834089340903409134092340933409434095340963409734098340993410034101341023410334104341053410634107341083410934110341113411234113341143411534116341173411834119341203412134122341233412434125341263412734128341293413034131341323413334134341353413634137341383413934140341413414234143341443414534146341473414834149341503415134152341533415434155341563415734158341593416034161341623416334164341653416634167341683416934170341713417234173341743417534176341773417834179341803418134182341833418434185341863418734188341893419034191341923419334194341953419634197341983419934200342013420234203342043420534206342073420834209342103421134212342133421434215342163421734218342193422034221342223422334224342253422634227342283422934230342313423234233342343423534236342373423834239342403424134242342433424434245342463424734248342493425034251342523425334254342553425634257342583425934260342613426234263342643426534266342673426834269342703427134272342733427434275342763427734278342793428034281342823428334284342853428634287342883428934290342913429234293342943429534296342973429834299343003430134302343033430434305343063430734308343093431034311343123431334314343153431634317343183431934320343213432234323343243432534326343273432834329343303433134332343333433434335343363433734338343393434034341343423434334344343453434634347343483434934350343513435234353343543435534356343573435834359343603436134362343633436434365343663436734368343693437034371343723437334374343753437634377343783437934380343813438234383343843438534386343873438834389343903439134392343933439434395343963439734398343993440034401344023440334404344053440634407344083440934410344113441234413344143441534416344173441834419344203442134422344233442434425344263442734428344293443034431344323443334434344353443634437344383443934440344413444234443344443444534446344473444834449344503445134452344533445434455344563445734458344593446034461344623446334464344653446634467344683446934470344713447234473344743447534476344773447834479344803448134482344833448434485344863448734488344893449034491344923449334494344953449634497344983449934500345013450234503345043450534506345073450834509345103451134512345133451434515345163451734518345193452034521345223452334524345253452634527345283452934530345313453234533345343453534536345373453834539345403454134542345433454434545345463454734548345493455034551345523455334554345553455634557345583455934560345613456234563345643456534566345673456834569345703457134572345733457434575345763457734578345793458034581345823458334584345853458634587345883458934590345913459234593345943459534596345973459834599346003460134602346033460434605346063460734608346093461034611346123461334614346153461634617346183461934620346213462234623346243462534626346273462834629346303463134632346333463434635346363463734638346393464034641346423464334644346453464634647346483464934650346513465234653346543465534656346573465834659346603466134662346633466434665346663466734668346693467034671346723467334674346753467634677346783467934680346813468234683346843468534686346873468834689346903469134692346933469434695346963469734698346993470034701347023470334704347053470634707347083470934710347113471234713347143471534716347173471834719347203472134722347233472434725347263472734728347293473034731347323473334734347353473634737347383473934740347413474234743347443474534746347473474834749347503475134752347533475434755347563475734758347593476034761347623476334764347653476634767347683476934770347713477234773347743477534776347773477834779347803478134782347833478434785347863478734788347893479034791347923479334794347953479634797347983479934800348013480234803348043480534806348073480834809348103481134812348133481434815348163481734818348193482034821348223482334824348253482634827348283482934830348313483234833348343483534836348373483834839348403484134842348433484434845348463484734848348493485034851348523485334854348553485634857348583485934860348613486234863348643486534866348673486834869348703487134872348733487434875348763487734878348793488034881348823488334884348853488634887348883488934890348913489234893348943489534896348973489834899349003490134902349033490434905349063490734908349093491034911349123491334914349153491634917349183491934920349213492234923349243492534926349273492834929349303493134932349333493434935349363493734938349393494034941349423494334944349453494634947349483494934950349513495234953349543495534956349573495834959349603496134962349633496434965349663496734968349693497034971349723497334974349753497634977349783497934980349813498234983349843498534986349873498834989349903499134992349933499434995349963499734998349993500035001350023500335004350053500635007350083500935010350113501235013350143501535016350173501835019350203502135022350233502435025350263502735028350293503035031350323503335034350353503635037350383503935040350413504235043350443504535046350473504835049350503505135052350533505435055350563505735058350593506035061350623506335064350653506635067350683506935070350713507235073350743507535076350773507835079350803508135082350833508435085350863508735088350893509035091350923509335094350953509635097350983509935100351013510235103351043510535106351073510835109351103511135112351133511435115351163511735118351193512035121351223512335124351253512635127351283512935130351313513235133351343513535136351373513835139351403514135142351433514435145351463514735148351493515035151351523515335154351553515635157351583515935160351613516235163351643516535166351673516835169351703517135172351733517435175351763517735178351793518035181351823518335184351853518635187351883518935190351913519235193351943519535196351973519835199352003520135202352033520435205352063520735208352093521035211352123521335214352153521635217352183521935220352213522235223352243522535226352273522835229352303523135232352333523435235352363523735238352393524035241352423524335244352453524635247352483524935250352513525235253352543525535256352573525835259352603526135262352633526435265352663526735268352693527035271352723527335274352753527635277352783527935280352813528235283352843528535286352873528835289352903529135292352933529435295352963529735298352993530035301353023530335304353053530635307353083530935310353113531235313353143531535316353173531835319353203532135322353233532435325353263532735328353293533035331353323533335334353353533635337353383533935340353413534235343353443534535346353473534835349353503535135352353533535435355353563535735358353593536035361353623536335364353653536635367353683536935370353713537235373353743537535376353773537835379353803538135382353833538435385353863538735388353893539035391353923539335394353953539635397353983539935400354013540235403354043540535406354073540835409354103541135412354133541435415354163541735418354193542035421354223542335424354253542635427354283542935430354313543235433354343543535436354373543835439354403544135442354433544435445354463544735448354493545035451354523545335454354553545635457354583545935460354613546235463354643546535466354673546835469354703547135472354733547435475354763547735478354793548035481354823548335484354853548635487354883548935490354913549235493354943549535496354973549835499355003550135502355033550435505355063550735508355093551035511355123551335514355153551635517355183551935520355213552235523355243552535526355273552835529355303553135532355333553435535355363553735538355393554035541355423554335544355453554635547355483554935550355513555235553355543555535556355573555835559355603556135562355633556435565355663556735568355693557035571355723557335574355753557635577355783557935580355813558235583355843558535586355873558835589355903559135592355933559435595355963559735598355993560035601356023560335604356053560635607356083560935610356113561235613356143561535616356173561835619356203562135622356233562435625356263562735628356293563035631356323563335634356353563635637356383563935640356413564235643356443564535646356473564835649356503565135652356533565435655356563565735658356593566035661356623566335664356653566635667356683566935670356713567235673356743567535676356773567835679356803568135682356833568435685356863568735688356893569035691356923569335694356953569635697356983569935700357013570235703357043570535706357073570835709357103571135712357133571435715357163571735718357193572035721357223572335724357253572635727357283572935730357313573235733357343573535736357373573835739357403574135742357433574435745357463574735748357493575035751357523575335754357553575635757357583575935760357613576235763357643576535766357673576835769357703577135772357733577435775357763577735778357793578035781357823578335784357853578635787357883578935790357913579235793357943579535796357973579835799358003580135802358033580435805358063580735808358093581035811358123581335814358153581635817358183581935820358213582235823358243582535826358273582835829358303583135832358333583435835358363583735838358393584035841358423584335844358453584635847358483584935850358513585235853358543585535856358573585835859358603586135862358633586435865358663586735868358693587035871358723587335874358753587635877358783587935880358813588235883358843588535886358873588835889358903589135892358933589435895358963589735898358993590035901359023590335904359053590635907359083590935910359113591235913359143591535916359173591835919359203592135922359233592435925359263592735928359293593035931359323593335934359353593635937359383593935940359413594235943359443594535946359473594835949359503595135952359533595435955359563595735958359593596035961359623596335964359653596635967359683596935970359713597235973359743597535976359773597835979359803598135982359833598435985359863598735988359893599035991359923599335994359953599635997359983599936000360013600236003360043600536006360073600836009360103601136012360133601436015360163601736018360193602036021360223602336024360253602636027360283602936030360313603236033360343603536036360373603836039360403604136042360433604436045360463604736048360493605036051360523605336054360553605636057360583605936060360613606236063360643606536066360673606836069360703607136072360733607436075360763607736078360793608036081360823608336084360853608636087360883608936090360913609236093360943609536096360973609836099361003610136102361033610436105361063610736108361093611036111361123611336114361153611636117361183611936120361213612236123361243612536126361273612836129361303613136132361333613436135361363613736138361393614036141361423614336144361453614636147361483614936150361513615236153361543615536156361573615836159361603616136162361633616436165361663616736168361693617036171361723617336174361753617636177361783617936180361813618236183361843618536186361873618836189361903619136192361933619436195361963619736198361993620036201362023620336204362053620636207362083620936210362113621236213362143621536216362173621836219362203622136222362233622436225362263622736228362293623036231362323623336234362353623636237362383623936240362413624236243362443624536246362473624836249362503625136252362533625436255362563625736258362593626036261362623626336264362653626636267362683626936270362713627236273362743627536276362773627836279362803628136282362833628436285
  1. var __extends = (this && this.__extends) || function (d, b) {
  2. for (var p in b) if (b.hasOwnProperty(p)) d[p] = b[p];
  3. function __() { this.constructor = d; }
  4. __.prototype = b.prototype;
  5. d.prototype = new __();
  6. };
  7. var BABYLON;
  8. (function (BABYLON) {
  9. var Color3 = (function () {
  10. function Color3(r, g, b) {
  11. if (r === void 0) { r = 0; }
  12. if (g === void 0) { g = 0; }
  13. if (b === void 0) { b = 0; }
  14. this.r = r;
  15. this.g = g;
  16. this.b = b;
  17. }
  18. Color3.prototype.toString = function () {
  19. return "{R: " + this.r + " G:" + this.g + " B:" + this.b + "}";
  20. };
  21. // Operators
  22. Color3.prototype.toArray = function (array, index) {
  23. if (index === undefined) {
  24. index = 0;
  25. }
  26. array[index] = this.r;
  27. array[index + 1] = this.g;
  28. array[index + 2] = this.b;
  29. return this;
  30. };
  31. Color3.prototype.toColor4 = function (alpha) {
  32. if (alpha === void 0) { alpha = 1; }
  33. return new Color4(this.r, this.g, this.b, alpha);
  34. };
  35. Color3.prototype.asArray = function () {
  36. var result = [];
  37. this.toArray(result, 0);
  38. return result;
  39. };
  40. Color3.prototype.toLuminance = function () {
  41. return this.r * 0.3 + this.g * 0.59 + this.b * 0.11;
  42. };
  43. Color3.prototype.multiply = function (otherColor) {
  44. return new Color3(this.r * otherColor.r, this.g * otherColor.g, this.b * otherColor.b);
  45. };
  46. Color3.prototype.multiplyToRef = function (otherColor, result) {
  47. result.r = this.r * otherColor.r;
  48. result.g = this.g * otherColor.g;
  49. result.b = this.b * otherColor.b;
  50. return this;
  51. };
  52. Color3.prototype.equals = function (otherColor) {
  53. return otherColor && this.r === otherColor.r && this.g === otherColor.g && this.b === otherColor.b;
  54. };
  55. Color3.prototype.equalsFloats = function (r, g, b) {
  56. return this.r === r && this.g === g && this.b === b;
  57. };
  58. Color3.prototype.scale = function (scale) {
  59. return new Color3(this.r * scale, this.g * scale, this.b * scale);
  60. };
  61. Color3.prototype.scaleToRef = function (scale, result) {
  62. result.r = this.r * scale;
  63. result.g = this.g * scale;
  64. result.b = this.b * scale;
  65. return this;
  66. };
  67. Color3.prototype.add = function (otherColor) {
  68. return new Color3(this.r + otherColor.r, this.g + otherColor.g, this.b + otherColor.b);
  69. };
  70. Color3.prototype.addToRef = function (otherColor, result) {
  71. result.r = this.r + otherColor.r;
  72. result.g = this.g + otherColor.g;
  73. result.b = this.b + otherColor.b;
  74. return this;
  75. };
  76. Color3.prototype.subtract = function (otherColor) {
  77. return new Color3(this.r - otherColor.r, this.g - otherColor.g, this.b - otherColor.b);
  78. };
  79. Color3.prototype.subtractToRef = function (otherColor, result) {
  80. result.r = this.r - otherColor.r;
  81. result.g = this.g - otherColor.g;
  82. result.b = this.b - otherColor.b;
  83. return this;
  84. };
  85. Color3.prototype.clone = function () {
  86. return new Color3(this.r, this.g, this.b);
  87. };
  88. Color3.prototype.copyFrom = function (source) {
  89. this.r = source.r;
  90. this.g = source.g;
  91. this.b = source.b;
  92. return this;
  93. };
  94. Color3.prototype.copyFromFloats = function (r, g, b) {
  95. this.r = r;
  96. this.g = g;
  97. this.b = b;
  98. return this;
  99. };
  100. Color3.prototype.toHexString = function () {
  101. var intR = (this.r * 255) | 0;
  102. var intG = (this.g * 255) | 0;
  103. var intB = (this.b * 255) | 0;
  104. return "#" + BABYLON.Tools.ToHex(intR) + BABYLON.Tools.ToHex(intG) + BABYLON.Tools.ToHex(intB);
  105. };
  106. // Statics
  107. Color3.FromHexString = function (hex) {
  108. if (hex.substring(0, 1) !== "#" || hex.length !== 7) {
  109. BABYLON.Tools.Warn("Color3.FromHexString must be called with a string like #FFFFFF");
  110. return new Color3(0, 0, 0);
  111. }
  112. var r = parseInt(hex.substring(1, 3), 16);
  113. var g = parseInt(hex.substring(3, 5), 16);
  114. var b = parseInt(hex.substring(5, 7), 16);
  115. return Color3.FromInts(r, g, b);
  116. };
  117. Color3.FromArray = function (array, offset) {
  118. if (offset === void 0) { offset = 0; }
  119. return new Color3(array[offset], array[offset + 1], array[offset + 2]);
  120. };
  121. Color3.FromInts = function (r, g, b) {
  122. return new Color3(r / 255.0, g / 255.0, b / 255.0);
  123. };
  124. Color3.Lerp = function (start, end, amount) {
  125. var r = start.r + ((end.r - start.r) * amount);
  126. var g = start.g + ((end.g - start.g) * amount);
  127. var b = start.b + ((end.b - start.b) * amount);
  128. return new Color3(r, g, b);
  129. };
  130. Color3.Red = function () { return new Color3(1, 0, 0); };
  131. Color3.Green = function () { return new Color3(0, 1, 0); };
  132. Color3.Blue = function () { return new Color3(0, 0, 1); };
  133. Color3.Black = function () { return new Color3(0, 0, 0); };
  134. Color3.White = function () { return new Color3(1, 1, 1); };
  135. Color3.Purple = function () { return new Color3(0.5, 0, 0.5); };
  136. Color3.Magenta = function () { return new Color3(1, 0, 1); };
  137. Color3.Yellow = function () { return new Color3(1, 1, 0); };
  138. Color3.Gray = function () { return new Color3(0.5, 0.5, 0.5); };
  139. return Color3;
  140. })();
  141. BABYLON.Color3 = Color3;
  142. var Color4 = (function () {
  143. function Color4(r, g, b, a) {
  144. this.r = r;
  145. this.g = g;
  146. this.b = b;
  147. this.a = a;
  148. }
  149. // Operators
  150. Color4.prototype.addInPlace = function (right) {
  151. this.r += right.r;
  152. this.g += right.g;
  153. this.b += right.b;
  154. this.a += right.a;
  155. return this;
  156. };
  157. Color4.prototype.asArray = function () {
  158. var result = [];
  159. this.toArray(result, 0);
  160. return result;
  161. };
  162. Color4.prototype.toArray = function (array, index) {
  163. if (index === undefined) {
  164. index = 0;
  165. }
  166. array[index] = this.r;
  167. array[index + 1] = this.g;
  168. array[index + 2] = this.b;
  169. array[index + 3] = this.a;
  170. return this;
  171. };
  172. Color4.prototype.add = function (right) {
  173. return new Color4(this.r + right.r, this.g + right.g, this.b + right.b, this.a + right.a);
  174. };
  175. Color4.prototype.subtract = function (right) {
  176. return new Color4(this.r - right.r, this.g - right.g, this.b - right.b, this.a - right.a);
  177. };
  178. Color4.prototype.subtractToRef = function (right, result) {
  179. result.r = this.r - right.r;
  180. result.g = this.g - right.g;
  181. result.b = this.b - right.b;
  182. result.a = this.a - right.a;
  183. return this;
  184. };
  185. Color4.prototype.scale = function (scale) {
  186. return new Color4(this.r * scale, this.g * scale, this.b * scale, this.a * scale);
  187. };
  188. Color4.prototype.scaleToRef = function (scale, result) {
  189. result.r = this.r * scale;
  190. result.g = this.g * scale;
  191. result.b = this.b * scale;
  192. result.a = this.a * scale;
  193. return this;
  194. };
  195. Color4.prototype.toString = function () {
  196. return "{R: " + this.r + " G:" + this.g + " B:" + this.b + " A:" + this.a + "}";
  197. };
  198. Color4.prototype.clone = function () {
  199. return new Color4(this.r, this.g, this.b, this.a);
  200. };
  201. Color4.prototype.copyFrom = function (source) {
  202. this.r = source.r;
  203. this.g = source.g;
  204. this.b = source.b;
  205. this.a = source.a;
  206. return this;
  207. };
  208. Color4.prototype.toHexString = function () {
  209. var intR = (this.r * 255) | 0;
  210. var intG = (this.g * 255) | 0;
  211. var intB = (this.b * 255) | 0;
  212. var intA = (this.a * 255) | 0;
  213. return "#" + BABYLON.Tools.ToHex(intR) + BABYLON.Tools.ToHex(intG) + BABYLON.Tools.ToHex(intB) + BABYLON.Tools.ToHex(intA);
  214. };
  215. // Statics
  216. Color4.FromHexString = function (hex) {
  217. if (hex.substring(0, 1) !== "#" || hex.length !== 9) {
  218. BABYLON.Tools.Warn("Color4.FromHexString must be called with a string like #FFFFFFFF");
  219. return new Color4(0, 0, 0, 0);
  220. }
  221. var r = parseInt(hex.substring(1, 3), 16);
  222. var g = parseInt(hex.substring(3, 5), 16);
  223. var b = parseInt(hex.substring(5, 7), 16);
  224. var a = parseInt(hex.substring(7, 9), 16);
  225. return Color4.FromInts(r, g, b, a);
  226. };
  227. Color4.Lerp = function (left, right, amount) {
  228. var result = new Color4(0, 0, 0, 0);
  229. Color4.LerpToRef(left, right, amount, result);
  230. return result;
  231. };
  232. Color4.LerpToRef = function (left, right, amount, result) {
  233. result.r = left.r + (right.r - left.r) * amount;
  234. result.g = left.g + (right.g - left.g) * amount;
  235. result.b = left.b + (right.b - left.b) * amount;
  236. result.a = left.a + (right.a - left.a) * amount;
  237. };
  238. Color4.FromArray = function (array, offset) {
  239. if (offset === void 0) { offset = 0; }
  240. return new Color4(array[offset], array[offset + 1], array[offset + 2], array[offset + 3]);
  241. };
  242. Color4.FromInts = function (r, g, b, a) {
  243. return new Color4(r / 255.0, g / 255.0, b / 255.0, a / 255.0);
  244. };
  245. return Color4;
  246. })();
  247. BABYLON.Color4 = Color4;
  248. var Vector2 = (function () {
  249. function Vector2(x, y) {
  250. this.x = x;
  251. this.y = y;
  252. }
  253. Vector2.prototype.toString = function () {
  254. return "{X: " + this.x + " Y:" + this.y + "}";
  255. };
  256. // Operators
  257. Vector2.prototype.toArray = function (array, index) {
  258. if (index === void 0) { index = 0; }
  259. array[index] = this.x;
  260. array[index + 1] = this.y;
  261. return this;
  262. };
  263. Vector2.prototype.asArray = function () {
  264. var result = [];
  265. this.toArray(result, 0);
  266. return result;
  267. };
  268. Vector2.prototype.copyFrom = function (source) {
  269. this.x = source.x;
  270. this.y = source.y;
  271. return this;
  272. };
  273. Vector2.prototype.copyFromFloats = function (x, y) {
  274. this.x = x;
  275. this.y = y;
  276. return this;
  277. };
  278. Vector2.prototype.add = function (otherVector) {
  279. return new Vector2(this.x + otherVector.x, this.y + otherVector.y);
  280. };
  281. Vector2.prototype.addVector3 = function (otherVector) {
  282. return new Vector2(this.x + otherVector.x, this.y + otherVector.y);
  283. };
  284. Vector2.prototype.subtract = function (otherVector) {
  285. return new Vector2(this.x - otherVector.x, this.y - otherVector.y);
  286. };
  287. Vector2.prototype.subtractInPlace = function (otherVector) {
  288. this.x -= otherVector.x;
  289. this.y -= otherVector.y;
  290. return this;
  291. };
  292. Vector2.prototype.multiplyInPlace = function (otherVector) {
  293. this.x *= otherVector.x;
  294. this.y *= otherVector.y;
  295. return this;
  296. };
  297. Vector2.prototype.multiply = function (otherVector) {
  298. return new Vector2(this.x * otherVector.x, this.y * otherVector.y);
  299. };
  300. Vector2.prototype.multiplyToRef = function (otherVector, result) {
  301. result.x = this.x * otherVector.x;
  302. result.y = this.y * otherVector.y;
  303. return this;
  304. };
  305. Vector2.prototype.multiplyByFloats = function (x, y) {
  306. return new Vector2(this.x * x, this.y * y);
  307. };
  308. Vector2.prototype.divide = function (otherVector) {
  309. return new Vector2(this.x / otherVector.x, this.y / otherVector.y);
  310. };
  311. Vector2.prototype.divideToRef = function (otherVector, result) {
  312. result.x = this.x / otherVector.x;
  313. result.y = this.y / otherVector.y;
  314. return this;
  315. };
  316. Vector2.prototype.negate = function () {
  317. return new Vector2(-this.x, -this.y);
  318. };
  319. Vector2.prototype.scaleInPlace = function (scale) {
  320. this.x *= scale;
  321. this.y *= scale;
  322. return this;
  323. };
  324. Vector2.prototype.scale = function (scale) {
  325. return new Vector2(this.x * scale, this.y * scale);
  326. };
  327. Vector2.prototype.equals = function (otherVector) {
  328. return otherVector && this.x === otherVector.x && this.y === otherVector.y;
  329. };
  330. Vector2.prototype.equalsWithEpsilon = function (otherVector, epsilon) {
  331. if (epsilon === void 0) { epsilon = BABYLON.Engine.Epsilon; }
  332. return otherVector && BABYLON.Tools.WithinEpsilon(this.x, otherVector.x, epsilon) && BABYLON.Tools.WithinEpsilon(this.y, otherVector.y, epsilon);
  333. };
  334. // Properties
  335. Vector2.prototype.length = function () {
  336. return Math.sqrt(this.x * this.x + this.y * this.y);
  337. };
  338. Vector2.prototype.lengthSquared = function () {
  339. return (this.x * this.x + this.y * this.y);
  340. };
  341. // Methods
  342. Vector2.prototype.normalize = function () {
  343. var len = this.length();
  344. if (len === 0)
  345. return this;
  346. var num = 1.0 / len;
  347. this.x *= num;
  348. this.y *= num;
  349. return this;
  350. };
  351. Vector2.prototype.clone = function () {
  352. return new Vector2(this.x, this.y);
  353. };
  354. // Statics
  355. Vector2.Zero = function () {
  356. return new Vector2(0, 0);
  357. };
  358. Vector2.FromArray = function (array, offset) {
  359. if (offset === void 0) { offset = 0; }
  360. return new Vector2(array[offset], array[offset + 1]);
  361. };
  362. Vector2.FromArrayToRef = function (array, offset, result) {
  363. result.x = array[offset];
  364. result.y = array[offset + 1];
  365. };
  366. Vector2.CatmullRom = function (value1, value2, value3, value4, amount) {
  367. var squared = amount * amount;
  368. var cubed = amount * squared;
  369. var x = 0.5 * ((((2.0 * value2.x) + ((-value1.x + value3.x) * amount)) +
  370. (((((2.0 * value1.x) - (5.0 * value2.x)) + (4.0 * value3.x)) - value4.x) * squared)) +
  371. ((((-value1.x + (3.0 * value2.x)) - (3.0 * value3.x)) + value4.x) * cubed));
  372. var y = 0.5 * ((((2.0 * value2.y) + ((-value1.y + value3.y) * amount)) +
  373. (((((2.0 * value1.y) - (5.0 * value2.y)) + (4.0 * value3.y)) - value4.y) * squared)) +
  374. ((((-value1.y + (3.0 * value2.y)) - (3.0 * value3.y)) + value4.y) * cubed));
  375. return new Vector2(x, y);
  376. };
  377. Vector2.Clamp = function (value, min, max) {
  378. var x = value.x;
  379. x = (x > max.x) ? max.x : x;
  380. x = (x < min.x) ? min.x : x;
  381. var y = value.y;
  382. y = (y > max.y) ? max.y : y;
  383. y = (y < min.y) ? min.y : y;
  384. return new Vector2(x, y);
  385. };
  386. Vector2.Hermite = function (value1, tangent1, value2, tangent2, amount) {
  387. var squared = amount * amount;
  388. var cubed = amount * squared;
  389. var part1 = ((2.0 * cubed) - (3.0 * squared)) + 1.0;
  390. var part2 = (-2.0 * cubed) + (3.0 * squared);
  391. var part3 = (cubed - (2.0 * squared)) + amount;
  392. var part4 = cubed - squared;
  393. var x = (((value1.x * part1) + (value2.x * part2)) + (tangent1.x * part3)) + (tangent2.x * part4);
  394. var y = (((value1.y * part1) + (value2.y * part2)) + (tangent1.y * part3)) + (tangent2.y * part4);
  395. return new Vector2(x, y);
  396. };
  397. Vector2.Lerp = function (start, end, amount) {
  398. var x = start.x + ((end.x - start.x) * amount);
  399. var y = start.y + ((end.y - start.y) * amount);
  400. return new Vector2(x, y);
  401. };
  402. Vector2.Dot = function (left, right) {
  403. return left.x * right.x + left.y * right.y;
  404. };
  405. Vector2.Normalize = function (vector) {
  406. var newVector = vector.clone();
  407. newVector.normalize();
  408. return newVector;
  409. };
  410. Vector2.Minimize = function (left, right) {
  411. var x = (left.x < right.x) ? left.x : right.x;
  412. var y = (left.y < right.y) ? left.y : right.y;
  413. return new Vector2(x, y);
  414. };
  415. Vector2.Maximize = function (left, right) {
  416. var x = (left.x > right.x) ? left.x : right.x;
  417. var y = (left.y > right.y) ? left.y : right.y;
  418. return new Vector2(x, y);
  419. };
  420. Vector2.Transform = function (vector, transformation) {
  421. var x = (vector.x * transformation.m[0]) + (vector.y * transformation.m[4]);
  422. var y = (vector.x * transformation.m[1]) + (vector.y * transformation.m[5]);
  423. return new Vector2(x, y);
  424. };
  425. Vector2.Distance = function (value1, value2) {
  426. return Math.sqrt(Vector2.DistanceSquared(value1, value2));
  427. };
  428. Vector2.DistanceSquared = function (value1, value2) {
  429. var x = value1.x - value2.x;
  430. var y = value1.y - value2.y;
  431. return (x * x) + (y * y);
  432. };
  433. return Vector2;
  434. })();
  435. BABYLON.Vector2 = Vector2;
  436. var Vector3 = (function () {
  437. function Vector3(x, y, z) {
  438. this.x = x;
  439. this.y = y;
  440. this.z = z;
  441. }
  442. Vector3.prototype.toString = function () {
  443. return "{X: " + this.x + " Y:" + this.y + " Z:" + this.z + "}";
  444. };
  445. // Operators
  446. Vector3.prototype.asArray = function () {
  447. var result = [];
  448. this.toArray(result, 0);
  449. return result;
  450. };
  451. Vector3.prototype.toArray = function (array, index) {
  452. if (index === void 0) { index = 0; }
  453. array[index] = this.x;
  454. array[index + 1] = this.y;
  455. array[index + 2] = this.z;
  456. return this;
  457. };
  458. Vector3.prototype.toQuaternion = function () {
  459. var result = new Quaternion(0, 0, 0, 1);
  460. var cosxPlusz = Math.cos((this.x + this.z) * 0.5);
  461. var sinxPlusz = Math.sin((this.x + this.z) * 0.5);
  462. var coszMinusx = Math.cos((this.z - this.x) * 0.5);
  463. var sinzMinusx = Math.sin((this.z - this.x) * 0.5);
  464. var cosy = Math.cos(this.y * 0.5);
  465. var siny = Math.sin(this.y * 0.5);
  466. result.x = coszMinusx * siny;
  467. result.y = -sinzMinusx * siny;
  468. result.z = sinxPlusz * cosy;
  469. result.w = cosxPlusz * cosy;
  470. return result;
  471. };
  472. Vector3.prototype.addInPlace = function (otherVector) {
  473. this.x += otherVector.x;
  474. this.y += otherVector.y;
  475. this.z += otherVector.z;
  476. return this;
  477. };
  478. Vector3.prototype.add = function (otherVector) {
  479. return new Vector3(this.x + otherVector.x, this.y + otherVector.y, this.z + otherVector.z);
  480. };
  481. Vector3.prototype.addToRef = function (otherVector, result) {
  482. result.x = this.x + otherVector.x;
  483. result.y = this.y + otherVector.y;
  484. result.z = this.z + otherVector.z;
  485. return this;
  486. };
  487. Vector3.prototype.subtractInPlace = function (otherVector) {
  488. this.x -= otherVector.x;
  489. this.y -= otherVector.y;
  490. this.z -= otherVector.z;
  491. return this;
  492. };
  493. Vector3.prototype.subtract = function (otherVector) {
  494. return new Vector3(this.x - otherVector.x, this.y - otherVector.y, this.z - otherVector.z);
  495. };
  496. Vector3.prototype.subtractToRef = function (otherVector, result) {
  497. result.x = this.x - otherVector.x;
  498. result.y = this.y - otherVector.y;
  499. result.z = this.z - otherVector.z;
  500. return this;
  501. };
  502. Vector3.prototype.subtractFromFloats = function (x, y, z) {
  503. return new Vector3(this.x - x, this.y - y, this.z - z);
  504. };
  505. Vector3.prototype.subtractFromFloatsToRef = function (x, y, z, result) {
  506. result.x = this.x - x;
  507. result.y = this.y - y;
  508. result.z = this.z - z;
  509. return this;
  510. };
  511. Vector3.prototype.negate = function () {
  512. return new Vector3(-this.x, -this.y, -this.z);
  513. };
  514. Vector3.prototype.scaleInPlace = function (scale) {
  515. this.x *= scale;
  516. this.y *= scale;
  517. this.z *= scale;
  518. return this;
  519. };
  520. Vector3.prototype.scale = function (scale) {
  521. return new Vector3(this.x * scale, this.y * scale, this.z * scale);
  522. };
  523. Vector3.prototype.scaleToRef = function (scale, result) {
  524. result.x = this.x * scale;
  525. result.y = this.y * scale;
  526. result.z = this.z * scale;
  527. };
  528. Vector3.prototype.equals = function (otherVector) {
  529. return otherVector && this.x === otherVector.x && this.y === otherVector.y && this.z === otherVector.z;
  530. };
  531. Vector3.prototype.equalsWithEpsilon = function (otherVector, epsilon) {
  532. if (epsilon === void 0) { epsilon = BABYLON.Engine.Epsilon; }
  533. return otherVector && BABYLON.Tools.WithinEpsilon(this.x, otherVector.x, epsilon) && BABYLON.Tools.WithinEpsilon(this.y, otherVector.y, epsilon) && BABYLON.Tools.WithinEpsilon(this.z, otherVector.z, epsilon);
  534. };
  535. Vector3.prototype.equalsToFloats = function (x, y, z) {
  536. return this.x === x && this.y === y && this.z === z;
  537. };
  538. Vector3.prototype.multiplyInPlace = function (otherVector) {
  539. this.x *= otherVector.x;
  540. this.y *= otherVector.y;
  541. this.z *= otherVector.z;
  542. return this;
  543. };
  544. Vector3.prototype.multiply = function (otherVector) {
  545. return new Vector3(this.x * otherVector.x, this.y * otherVector.y, this.z * otherVector.z);
  546. };
  547. Vector3.prototype.multiplyToRef = function (otherVector, result) {
  548. result.x = this.x * otherVector.x;
  549. result.y = this.y * otherVector.y;
  550. result.z = this.z * otherVector.z;
  551. return this;
  552. };
  553. Vector3.prototype.multiplyByFloats = function (x, y, z) {
  554. return new Vector3(this.x * x, this.y * y, this.z * z);
  555. };
  556. Vector3.prototype.divide = function (otherVector) {
  557. return new Vector3(this.x / otherVector.x, this.y / otherVector.y, this.z / otherVector.z);
  558. };
  559. Vector3.prototype.divideToRef = function (otherVector, result) {
  560. result.x = this.x / otherVector.x;
  561. result.y = this.y / otherVector.y;
  562. result.z = this.z / otherVector.z;
  563. return this;
  564. };
  565. Vector3.prototype.MinimizeInPlace = function (other) {
  566. if (other.x < this.x)
  567. this.x = other.x;
  568. if (other.y < this.y)
  569. this.y = other.y;
  570. if (other.z < this.z)
  571. this.z = other.z;
  572. return this;
  573. };
  574. Vector3.prototype.MaximizeInPlace = function (other) {
  575. if (other.x > this.x)
  576. this.x = other.x;
  577. if (other.y > this.y)
  578. this.y = other.y;
  579. if (other.z > this.z)
  580. this.z = other.z;
  581. return this;
  582. };
  583. // Properties
  584. Vector3.prototype.length = function () {
  585. return Math.sqrt(this.x * this.x + this.y * this.y + this.z * this.z);
  586. };
  587. Vector3.prototype.lengthSquared = function () {
  588. return (this.x * this.x + this.y * this.y + this.z * this.z);
  589. };
  590. // Methods
  591. Vector3.prototype.normalize = function () {
  592. var len = this.length();
  593. if (len === 0 || len === 1.0)
  594. return this;
  595. var num = 1.0 / len;
  596. this.x *= num;
  597. this.y *= num;
  598. this.z *= num;
  599. return this;
  600. };
  601. Vector3.prototype.clone = function () {
  602. return new Vector3(this.x, this.y, this.z);
  603. };
  604. Vector3.prototype.copyFrom = function (source) {
  605. this.x = source.x;
  606. this.y = source.y;
  607. this.z = source.z;
  608. return this;
  609. };
  610. Vector3.prototype.copyFromFloats = function (x, y, z) {
  611. this.x = x;
  612. this.y = y;
  613. this.z = z;
  614. return this;
  615. };
  616. // Statics
  617. Vector3.GetClipFactor = function (vector0, vector1, axis, size) {
  618. var d0 = Vector3.Dot(vector0, axis) - size;
  619. var d1 = Vector3.Dot(vector1, axis) - size;
  620. var s = d0 / (d0 - d1);
  621. return s;
  622. };
  623. Vector3.FromArray = function (array, offset) {
  624. if (!offset) {
  625. offset = 0;
  626. }
  627. return new Vector3(array[offset], array[offset + 1], array[offset + 2]);
  628. };
  629. Vector3.FromFloatArray = function (array, offset) {
  630. if (!offset) {
  631. offset = 0;
  632. }
  633. return new Vector3(array[offset], array[offset + 1], array[offset + 2]);
  634. };
  635. Vector3.FromArrayToRef = function (array, offset, result) {
  636. result.x = array[offset];
  637. result.y = array[offset + 1];
  638. result.z = array[offset + 2];
  639. };
  640. Vector3.FromFloatArrayToRef = function (array, offset, result) {
  641. result.x = array[offset];
  642. result.y = array[offset + 1];
  643. result.z = array[offset + 2];
  644. };
  645. Vector3.FromFloatsToRef = function (x, y, z, result) {
  646. result.x = x;
  647. result.y = y;
  648. result.z = z;
  649. };
  650. Vector3.Zero = function () {
  651. return new Vector3(0, 0, 0);
  652. };
  653. Vector3.Up = function () {
  654. return new Vector3(0, 1.0, 0);
  655. };
  656. Vector3.TransformCoordinates = function (vector, transformation) {
  657. var result = Vector3.Zero();
  658. Vector3.TransformCoordinatesToRef(vector, transformation, result);
  659. return result;
  660. };
  661. Vector3.TransformCoordinatesToRef = function (vector, transformation, result) {
  662. var x = (vector.x * transformation.m[0]) + (vector.y * transformation.m[4]) + (vector.z * transformation.m[8]) + transformation.m[12];
  663. var y = (vector.x * transformation.m[1]) + (vector.y * transformation.m[5]) + (vector.z * transformation.m[9]) + transformation.m[13];
  664. var z = (vector.x * transformation.m[2]) + (vector.y * transformation.m[6]) + (vector.z * transformation.m[10]) + transformation.m[14];
  665. var w = (vector.x * transformation.m[3]) + (vector.y * transformation.m[7]) + (vector.z * transformation.m[11]) + transformation.m[15];
  666. result.x = x / w;
  667. result.y = y / w;
  668. result.z = z / w;
  669. };
  670. Vector3.TransformCoordinatesFromFloatsToRef = function (x, y, z, transformation, result) {
  671. var rx = (x * transformation.m[0]) + (y * transformation.m[4]) + (z * transformation.m[8]) + transformation.m[12];
  672. var ry = (x * transformation.m[1]) + (y * transformation.m[5]) + (z * transformation.m[9]) + transformation.m[13];
  673. var rz = (x * transformation.m[2]) + (y * transformation.m[6]) + (z * transformation.m[10]) + transformation.m[14];
  674. var rw = (x * transformation.m[3]) + (y * transformation.m[7]) + (z * transformation.m[11]) + transformation.m[15];
  675. result.x = rx / rw;
  676. result.y = ry / rw;
  677. result.z = rz / rw;
  678. };
  679. Vector3.TransformNormal = function (vector, transformation) {
  680. var result = Vector3.Zero();
  681. Vector3.TransformNormalToRef(vector, transformation, result);
  682. return result;
  683. };
  684. Vector3.TransformNormalToRef = function (vector, transformation, result) {
  685. result.x = (vector.x * transformation.m[0]) + (vector.y * transformation.m[4]) + (vector.z * transformation.m[8]);
  686. result.y = (vector.x * transformation.m[1]) + (vector.y * transformation.m[5]) + (vector.z * transformation.m[9]);
  687. result.z = (vector.x * transformation.m[2]) + (vector.y * transformation.m[6]) + (vector.z * transformation.m[10]);
  688. };
  689. Vector3.TransformNormalFromFloatsToRef = function (x, y, z, transformation, result) {
  690. result.x = (x * transformation.m[0]) + (y * transformation.m[4]) + (z * transformation.m[8]);
  691. result.y = (x * transformation.m[1]) + (y * transformation.m[5]) + (z * transformation.m[9]);
  692. result.z = (x * transformation.m[2]) + (y * transformation.m[6]) + (z * transformation.m[10]);
  693. };
  694. Vector3.CatmullRom = function (value1, value2, value3, value4, amount) {
  695. var squared = amount * amount;
  696. var cubed = amount * squared;
  697. var x = 0.5 * ((((2.0 * value2.x) + ((-value1.x + value3.x) * amount)) +
  698. (((((2.0 * value1.x) - (5.0 * value2.x)) + (4.0 * value3.x)) - value4.x) * squared)) +
  699. ((((-value1.x + (3.0 * value2.x)) - (3.0 * value3.x)) + value4.x) * cubed));
  700. var y = 0.5 * ((((2.0 * value2.y) + ((-value1.y + value3.y) * amount)) +
  701. (((((2.0 * value1.y) - (5.0 * value2.y)) + (4.0 * value3.y)) - value4.y) * squared)) +
  702. ((((-value1.y + (3.0 * value2.y)) - (3.0 * value3.y)) + value4.y) * cubed));
  703. var z = 0.5 * ((((2.0 * value2.z) + ((-value1.z + value3.z) * amount)) +
  704. (((((2.0 * value1.z) - (5.0 * value2.z)) + (4.0 * value3.z)) - value4.z) * squared)) +
  705. ((((-value1.z + (3.0 * value2.z)) - (3.0 * value3.z)) + value4.z) * cubed));
  706. return new Vector3(x, y, z);
  707. };
  708. Vector3.Clamp = function (value, min, max) {
  709. var x = value.x;
  710. x = (x > max.x) ? max.x : x;
  711. x = (x < min.x) ? min.x : x;
  712. var y = value.y;
  713. y = (y > max.y) ? max.y : y;
  714. y = (y < min.y) ? min.y : y;
  715. var z = value.z;
  716. z = (z > max.z) ? max.z : z;
  717. z = (z < min.z) ? min.z : z;
  718. return new Vector3(x, y, z);
  719. };
  720. Vector3.Hermite = function (value1, tangent1, value2, tangent2, amount) {
  721. var squared = amount * amount;
  722. var cubed = amount * squared;
  723. var part1 = ((2.0 * cubed) - (3.0 * squared)) + 1.0;
  724. var part2 = (-2.0 * cubed) + (3.0 * squared);
  725. var part3 = (cubed - (2.0 * squared)) + amount;
  726. var part4 = cubed - squared;
  727. var x = (((value1.x * part1) + (value2.x * part2)) + (tangent1.x * part3)) + (tangent2.x * part4);
  728. var y = (((value1.y * part1) + (value2.y * part2)) + (tangent1.y * part3)) + (tangent2.y * part4);
  729. var z = (((value1.z * part1) + (value2.z * part2)) + (tangent1.z * part3)) + (tangent2.z * part4);
  730. return new Vector3(x, y, z);
  731. };
  732. Vector3.Lerp = function (start, end, amount) {
  733. var x = start.x + ((end.x - start.x) * amount);
  734. var y = start.y + ((end.y - start.y) * amount);
  735. var z = start.z + ((end.z - start.z) * amount);
  736. return new Vector3(x, y, z);
  737. };
  738. Vector3.Dot = function (left, right) {
  739. return (left.x * right.x + left.y * right.y + left.z * right.z);
  740. };
  741. Vector3.Cross = function (left, right) {
  742. var result = Vector3.Zero();
  743. Vector3.CrossToRef(left, right, result);
  744. return result;
  745. };
  746. Vector3.CrossToRef = function (left, right, result) {
  747. result.x = left.y * right.z - left.z * right.y;
  748. result.y = left.z * right.x - left.x * right.z;
  749. result.z = left.x * right.y - left.y * right.x;
  750. };
  751. Vector3.Normalize = function (vector) {
  752. var result = Vector3.Zero();
  753. Vector3.NormalizeToRef(vector, result);
  754. return result;
  755. };
  756. Vector3.NormalizeToRef = function (vector, result) {
  757. result.copyFrom(vector);
  758. result.normalize();
  759. };
  760. Vector3.Project = function (vector, world, transform, viewport) {
  761. var cw = viewport.width;
  762. var ch = viewport.height;
  763. var cx = viewport.x;
  764. var cy = viewport.y;
  765. var viewportMatrix = Matrix.FromValues(cw / 2.0, 0, 0, 0, 0, -ch / 2.0, 0, 0, 0, 0, 1, 0, cx + cw / 2.0, ch / 2.0 + cy, 0, 1);
  766. var finalMatrix = world.multiply(transform).multiply(viewportMatrix);
  767. return Vector3.TransformCoordinates(vector, finalMatrix);
  768. };
  769. Vector3.UnprojectFromTransform = function (source, viewportWidth, viewportHeight, world, transform) {
  770. var matrix = world.multiply(transform);
  771. matrix.invert();
  772. source.x = source.x / viewportWidth * 2 - 1;
  773. source.y = -(source.y / viewportHeight * 2 - 1);
  774. var vector = Vector3.TransformCoordinates(source, matrix);
  775. var num = source.x * matrix.m[3] + source.y * matrix.m[7] + source.z * matrix.m[11] + matrix.m[15];
  776. if (BABYLON.Tools.WithinEpsilon(num, 1.0)) {
  777. vector = vector.scale(1.0 / num);
  778. }
  779. return vector;
  780. };
  781. Vector3.Unproject = function (source, viewportWidth, viewportHeight, world, view, projection) {
  782. var matrix = world.multiply(view).multiply(projection);
  783. matrix.invert();
  784. var screenSource = new Vector3(source.x / viewportWidth * 2 - 1, -(source.y / viewportHeight * 2 - 1), source.z);
  785. var vector = Vector3.TransformCoordinates(screenSource, matrix);
  786. var num = screenSource.x * matrix.m[3] + screenSource.y * matrix.m[7] + screenSource.z * matrix.m[11] + matrix.m[15];
  787. if (BABYLON.Tools.WithinEpsilon(num, 1.0)) {
  788. vector = vector.scale(1.0 / num);
  789. }
  790. return vector;
  791. };
  792. Vector3.Minimize = function (left, right) {
  793. var min = left.clone();
  794. min.MinimizeInPlace(right);
  795. return min;
  796. };
  797. Vector3.Maximize = function (left, right) {
  798. var max = left.clone();
  799. max.MaximizeInPlace(right);
  800. return max;
  801. };
  802. Vector3.Distance = function (value1, value2) {
  803. return Math.sqrt(Vector3.DistanceSquared(value1, value2));
  804. };
  805. Vector3.DistanceSquared = function (value1, value2) {
  806. var x = value1.x - value2.x;
  807. var y = value1.y - value2.y;
  808. var z = value1.z - value2.z;
  809. return (x * x) + (y * y) + (z * z);
  810. };
  811. Vector3.Center = function (value1, value2) {
  812. var center = value1.add(value2);
  813. center.scaleInPlace(0.5);
  814. return center;
  815. };
  816. /**
  817. * Given three orthogonal left-handed oriented Vector3 axis in space (target system),
  818. * RotationFromAxis() returns the rotation Euler angles (ex : rotation.x, rotation.y, rotation.z) to apply
  819. * to something in order to rotate it from its local system to the given target system.
  820. */
  821. Vector3.RotationFromAxis = function (axis1, axis2, axis3) {
  822. var rotation = Vector3.Zero();
  823. Vector3.RotationFromAxisToRef(axis1, axis2, axis3, rotation);
  824. return rotation;
  825. };
  826. /**
  827. * The same than RotationFromAxis but updates the passed ref Vector3 parameter.
  828. */
  829. Vector3.RotationFromAxisToRef = function (axis1, axis2, axis3, ref) {
  830. var u = Vector3.Normalize(axis1);
  831. var w = Vector3.Normalize(axis3);
  832. // world axis
  833. var X = Axis.X;
  834. var Y = Axis.Y;
  835. // equation unknowns and vars
  836. var yaw = 0.0;
  837. var pitch = 0.0;
  838. var roll = 0.0;
  839. var x = 0.0;
  840. var y = 0.0;
  841. var z = 0.0;
  842. var t = 0.0;
  843. var sign = -1.0;
  844. var nbRevert = 0;
  845. var cross;
  846. var dot = 0.0;
  847. // step 1 : rotation around w
  848. // Rv3(u) = u1, and u1 belongs to plane xOz
  849. // Rv3(w) = w1 = w invariant
  850. var u1;
  851. var v1;
  852. if (BABYLON.Tools.WithinEpsilon(w.z, 0, BABYLON.Engine.Epsilon)) {
  853. z = 1.0;
  854. }
  855. else if (BABYLON.Tools.WithinEpsilon(w.x, 0, BABYLON.Engine.Epsilon)) {
  856. x = 1.0;
  857. }
  858. else {
  859. t = w.z / w.x;
  860. x = -t * Math.sqrt(1 / (1 + t * t));
  861. z = Math.sqrt(1 / (1 + t * t));
  862. }
  863. u1 = new Vector3(x, y, z);
  864. u1.normalize();
  865. v1 = Vector3.Cross(w, u1); // v1 image of v through rotation around w
  866. v1.normalize();
  867. cross = Vector3.Cross(u, u1); // returns same direction as w (=local z) if positive angle : cross(source, image)
  868. cross.normalize();
  869. if (Vector3.Dot(w, cross) < 0) {
  870. sign = 1.0;
  871. }
  872. dot = Vector3.Dot(u, u1);
  873. dot = (Math.min(1.0, Math.max(-1.0, dot))); // to force dot to be in the range [-1, 1]
  874. roll = Math.acos(dot) * sign;
  875. if (Vector3.Dot(u1, X) < 0) {
  876. roll = Math.PI + roll;
  877. u1 = u1.scaleInPlace(-1);
  878. v1 = v1.scaleInPlace(-1);
  879. nbRevert++;
  880. }
  881. // step 2 : rotate around u1
  882. // Ru1(w1) = Ru1(w) = w2, and w2 belongs to plane xOz
  883. // u1 is yet in xOz and invariant by Ru1, so after this step u1 and w2 will be in xOz
  884. var w2;
  885. var v2;
  886. x = 0.0;
  887. y = 0.0;
  888. z = 0.0;
  889. sign = -1;
  890. if (BABYLON.Tools.WithinEpsilon(w.z, 0, BABYLON.Engine.Epsilon)) {
  891. x = 1.0;
  892. }
  893. else {
  894. t = u1.z / u1.x;
  895. x = -t * Math.sqrt(1 / (1 + t * t));
  896. z = Math.sqrt(1 / (1 + t * t));
  897. }
  898. w2 = new Vector3(x, y, z);
  899. w2.normalize();
  900. v2 = Vector3.Cross(w2, u1); // v2 image of v1 through rotation around u1
  901. v2.normalize();
  902. cross = Vector3.Cross(w, w2); // returns same direction as u1 (=local x) if positive angle : cross(source, image)
  903. cross.normalize();
  904. if (Vector3.Dot(u1, cross) < 0) {
  905. sign = 1.0;
  906. }
  907. dot = Vector3.Dot(w, w2);
  908. dot = (Math.min(1.0, Math.max(-1.0, dot))); // to force dot to be in the range [-1, 1]
  909. pitch = Math.acos(dot) * sign;
  910. if (Vector3.Dot(v2, Y) < 0) {
  911. pitch = Math.PI + pitch;
  912. v2 = v2.scaleInPlace(-1);
  913. w2 = w2.scaleInPlace(-1);
  914. nbRevert++;
  915. }
  916. // step 3 : rotate around v2
  917. // Rv2(u1) = X, same as Rv2(w2) = Z, with X=(1,0,0) and Z=(0,0,1)
  918. sign = -1;
  919. cross = Vector3.Cross(X, u1); // returns same direction as Y if positive angle : cross(source, image)
  920. cross.normalize();
  921. if (Vector3.Dot(cross, Y) < 0) {
  922. sign = 1.0;
  923. }
  924. dot = Vector3.Dot(u1, X);
  925. dot = (Math.min(1.0, Math.max(-1.0, dot))); // to force dot to be in the range [-1, 1]
  926. yaw = -Math.acos(dot) * sign; // negative : plane zOx oriented clockwise
  927. if (dot < 0 && nbRevert < 2) {
  928. yaw = Math.PI + yaw;
  929. }
  930. ref.x = pitch;
  931. ref.y = yaw;
  932. ref.z = roll;
  933. };
  934. return Vector3;
  935. })();
  936. BABYLON.Vector3 = Vector3;
  937. //Vector4 class created for EulerAngle class conversion to Quaternion
  938. var Vector4 = (function () {
  939. function Vector4(x, y, z, w) {
  940. this.x = x;
  941. this.y = y;
  942. this.z = z;
  943. this.w = w;
  944. }
  945. Vector4.prototype.toString = function () {
  946. return "{X: " + this.x + " Y:" + this.y + " Z:" + this.z + "W:" + this.w + "}";
  947. };
  948. // Operators
  949. Vector4.prototype.asArray = function () {
  950. var result = [];
  951. this.toArray(result, 0);
  952. return result;
  953. };
  954. Vector4.prototype.toArray = function (array, index) {
  955. if (index === undefined) {
  956. index = 0;
  957. }
  958. array[index] = this.x;
  959. array[index + 1] = this.y;
  960. array[index + 2] = this.z;
  961. array[index + 3] = this.w;
  962. return this;
  963. };
  964. Vector4.prototype.addInPlace = function (otherVector) {
  965. this.x += otherVector.x;
  966. this.y += otherVector.y;
  967. this.z += otherVector.z;
  968. this.w += otherVector.w;
  969. return this;
  970. };
  971. Vector4.prototype.add = function (otherVector) {
  972. return new Vector4(this.x + otherVector.x, this.y + otherVector.y, this.z + otherVector.z, this.w + otherVector.w);
  973. };
  974. Vector4.prototype.addToRef = function (otherVector, result) {
  975. result.x = this.x + otherVector.x;
  976. result.y = this.y + otherVector.y;
  977. result.z = this.z + otherVector.z;
  978. result.w = this.w + otherVector.w;
  979. return this;
  980. };
  981. Vector4.prototype.subtractInPlace = function (otherVector) {
  982. this.x -= otherVector.x;
  983. this.y -= otherVector.y;
  984. this.z -= otherVector.z;
  985. this.w -= otherVector.w;
  986. return this;
  987. };
  988. Vector4.prototype.subtract = function (otherVector) {
  989. return new Vector4(this.x - otherVector.x, this.y - otherVector.y, this.z - otherVector.z, this.w - otherVector.w);
  990. };
  991. Vector4.prototype.subtractToRef = function (otherVector, result) {
  992. result.x = this.x - otherVector.x;
  993. result.y = this.y - otherVector.y;
  994. result.z = this.z - otherVector.z;
  995. result.w = this.w - otherVector.w;
  996. return this;
  997. };
  998. Vector4.prototype.subtractFromFloats = function (x, y, z, w) {
  999. return new Vector4(this.x - x, this.y - y, this.z - z, this.w - w);
  1000. };
  1001. Vector4.prototype.subtractFromFloatsToRef = function (x, y, z, w, result) {
  1002. result.x = this.x - x;
  1003. result.y = this.y - y;
  1004. result.z = this.z - z;
  1005. result.w = this.w - w;
  1006. return this;
  1007. };
  1008. Vector4.prototype.negate = function () {
  1009. return new Vector4(-this.x, -this.y, -this.z, -this.w);
  1010. };
  1011. Vector4.prototype.scaleInPlace = function (scale) {
  1012. this.x *= scale;
  1013. this.y *= scale;
  1014. this.z *= scale;
  1015. this.w *= scale;
  1016. return this;
  1017. };
  1018. Vector4.prototype.scale = function (scale) {
  1019. return new Vector4(this.x * scale, this.y * scale, this.z * scale, this.w * scale);
  1020. };
  1021. Vector4.prototype.scaleToRef = function (scale, result) {
  1022. result.x = this.x * scale;
  1023. result.y = this.y * scale;
  1024. result.z = this.z * scale;
  1025. result.w = this.w * scale;
  1026. };
  1027. Vector4.prototype.equals = function (otherVector) {
  1028. return otherVector && this.x === otherVector.x && this.y === otherVector.y && this.z === otherVector.z && this.w === otherVector.w;
  1029. };
  1030. Vector4.prototype.equalsWithEpsilon = function (otherVector, epsilon) {
  1031. if (epsilon === void 0) { epsilon = BABYLON.Engine.Epsilon; }
  1032. return otherVector
  1033. && BABYLON.Tools.WithinEpsilon(this.x, otherVector.x, epsilon)
  1034. && BABYLON.Tools.WithinEpsilon(this.y, otherVector.y, epsilon)
  1035. && BABYLON.Tools.WithinEpsilon(this.z, otherVector.z, epsilon)
  1036. && BABYLON.Tools.WithinEpsilon(this.w, otherVector.w, epsilon);
  1037. };
  1038. Vector4.prototype.equalsToFloats = function (x, y, z, w) {
  1039. return this.x === x && this.y === y && this.z === z && this.w === w;
  1040. };
  1041. Vector4.prototype.multiplyInPlace = function (otherVector) {
  1042. this.x *= otherVector.x;
  1043. this.y *= otherVector.y;
  1044. this.z *= otherVector.z;
  1045. this.w *= otherVector.w;
  1046. return this;
  1047. };
  1048. Vector4.prototype.multiply = function (otherVector) {
  1049. return new Vector4(this.x * otherVector.x, this.y * otherVector.y, this.z * otherVector.z, this.w * otherVector.w);
  1050. };
  1051. Vector4.prototype.multiplyToRef = function (otherVector, result) {
  1052. result.x = this.x * otherVector.x;
  1053. result.y = this.y * otherVector.y;
  1054. result.z = this.z * otherVector.z;
  1055. result.w = this.w * otherVector.w;
  1056. return this;
  1057. };
  1058. Vector4.prototype.multiplyByFloats = function (x, y, z, w) {
  1059. return new Vector4(this.x * x, this.y * y, this.z * z, this.w * w);
  1060. };
  1061. Vector4.prototype.divide = function (otherVector) {
  1062. return new Vector4(this.x / otherVector.x, this.y / otherVector.y, this.z / otherVector.z, this.w / otherVector.w);
  1063. };
  1064. Vector4.prototype.divideToRef = function (otherVector, result) {
  1065. result.x = this.x / otherVector.x;
  1066. result.y = this.y / otherVector.y;
  1067. result.z = this.z / otherVector.z;
  1068. result.w = this.w / otherVector.w;
  1069. return this;
  1070. };
  1071. Vector4.prototype.MinimizeInPlace = function (other) {
  1072. if (other.x < this.x)
  1073. this.x = other.x;
  1074. if (other.y < this.y)
  1075. this.y = other.y;
  1076. if (other.z < this.z)
  1077. this.z = other.z;
  1078. if (other.w < this.w)
  1079. this.w = other.w;
  1080. return this;
  1081. };
  1082. Vector4.prototype.MaximizeInPlace = function (other) {
  1083. if (other.x > this.x)
  1084. this.x = other.x;
  1085. if (other.y > this.y)
  1086. this.y = other.y;
  1087. if (other.z > this.z)
  1088. this.z = other.z;
  1089. if (other.w > this.w)
  1090. this.w = other.w;
  1091. return this;
  1092. };
  1093. // Properties
  1094. Vector4.prototype.length = function () {
  1095. return Math.sqrt(this.x * this.x + this.y * this.y + this.z * this.z + this.w * this.w);
  1096. };
  1097. Vector4.prototype.lengthSquared = function () {
  1098. return (this.x * this.x + this.y * this.y + this.z * this.z + this.w * this.w);
  1099. };
  1100. // Methods
  1101. Vector4.prototype.normalize = function () {
  1102. var len = this.length();
  1103. if (len === 0)
  1104. return this;
  1105. var num = 1.0 / len;
  1106. this.x *= num;
  1107. this.y *= num;
  1108. this.z *= num;
  1109. this.w *= num;
  1110. return this;
  1111. };
  1112. Vector4.prototype.clone = function () {
  1113. return new Vector4(this.x, this.y, this.z, this.w);
  1114. };
  1115. Vector4.prototype.copyFrom = function (source) {
  1116. this.x = source.x;
  1117. this.y = source.y;
  1118. this.z = source.z;
  1119. this.w = source.w;
  1120. return this;
  1121. };
  1122. Vector4.prototype.copyFromFloats = function (x, y, z, w) {
  1123. this.x = x;
  1124. this.y = y;
  1125. this.z = z;
  1126. this.w = w;
  1127. return this;
  1128. };
  1129. // Statics
  1130. Vector4.FromArray = function (array, offset) {
  1131. if (!offset) {
  1132. offset = 0;
  1133. }
  1134. return new Vector4(array[offset], array[offset + 1], array[offset + 2], array[offset + 3]);
  1135. };
  1136. Vector4.FromArrayToRef = function (array, offset, result) {
  1137. result.x = array[offset];
  1138. result.y = array[offset + 1];
  1139. result.z = array[offset + 2];
  1140. result.w = array[offset + 3];
  1141. };
  1142. Vector4.FromFloatArrayToRef = function (array, offset, result) {
  1143. result.x = array[offset];
  1144. result.y = array[offset + 1];
  1145. result.z = array[offset + 2];
  1146. result.w = array[offset + 3];
  1147. };
  1148. Vector4.FromFloatsToRef = function (x, y, z, w, result) {
  1149. result.x = x;
  1150. result.y = y;
  1151. result.z = z;
  1152. result.w = w;
  1153. };
  1154. Vector4.Zero = function () {
  1155. return new Vector4(0, 0, 0, 0);
  1156. };
  1157. Vector4.Normalize = function (vector) {
  1158. var result = Vector4.Zero();
  1159. Vector4.NormalizeToRef(vector, result);
  1160. return result;
  1161. };
  1162. Vector4.NormalizeToRef = function (vector, result) {
  1163. result.copyFrom(vector);
  1164. result.normalize();
  1165. };
  1166. Vector4.Minimize = function (left, right) {
  1167. var min = left.clone();
  1168. min.MinimizeInPlace(right);
  1169. return min;
  1170. };
  1171. Vector4.Maximize = function (left, right) {
  1172. var max = left.clone();
  1173. max.MaximizeInPlace(right);
  1174. return max;
  1175. };
  1176. Vector4.Distance = function (value1, value2) {
  1177. return Math.sqrt(Vector4.DistanceSquared(value1, value2));
  1178. };
  1179. Vector4.DistanceSquared = function (value1, value2) {
  1180. var x = value1.x - value2.x;
  1181. var y = value1.y - value2.y;
  1182. var z = value1.z - value2.z;
  1183. var w = value1.w - value2.w;
  1184. return (x * x) + (y * y) + (z * z) + (w * w);
  1185. };
  1186. Vector4.Center = function (value1, value2) {
  1187. var center = value1.add(value2);
  1188. center.scaleInPlace(0.5);
  1189. return center;
  1190. };
  1191. return Vector4;
  1192. })();
  1193. BABYLON.Vector4 = Vector4;
  1194. var Quaternion = (function () {
  1195. function Quaternion(x, y, z, w) {
  1196. if (x === void 0) { x = 0; }
  1197. if (y === void 0) { y = 0; }
  1198. if (z === void 0) { z = 0; }
  1199. if (w === void 0) { w = 1; }
  1200. this.x = x;
  1201. this.y = y;
  1202. this.z = z;
  1203. this.w = w;
  1204. }
  1205. Quaternion.prototype.toString = function () {
  1206. return "{X: " + this.x + " Y:" + this.y + " Z:" + this.z + " W:" + this.w + "}";
  1207. };
  1208. Quaternion.prototype.asArray = function () {
  1209. return [this.x, this.y, this.z, this.w];
  1210. };
  1211. Quaternion.prototype.equals = function (otherQuaternion) {
  1212. return otherQuaternion && this.x === otherQuaternion.x && this.y === otherQuaternion.y && this.z === otherQuaternion.z && this.w === otherQuaternion.w;
  1213. };
  1214. Quaternion.prototype.clone = function () {
  1215. return new Quaternion(this.x, this.y, this.z, this.w);
  1216. };
  1217. Quaternion.prototype.copyFrom = function (other) {
  1218. this.x = other.x;
  1219. this.y = other.y;
  1220. this.z = other.z;
  1221. this.w = other.w;
  1222. return this;
  1223. };
  1224. Quaternion.prototype.copyFromFloats = function (x, y, z, w) {
  1225. this.x = x;
  1226. this.y = y;
  1227. this.z = z;
  1228. this.w = w;
  1229. return this;
  1230. };
  1231. Quaternion.prototype.add = function (other) {
  1232. return new Quaternion(this.x + other.x, this.y + other.y, this.z + other.z, this.w + other.w);
  1233. };
  1234. Quaternion.prototype.subtract = function (other) {
  1235. return new Quaternion(this.x - other.x, this.y - other.y, this.z - other.z, this.w - other.w);
  1236. };
  1237. Quaternion.prototype.scale = function (value) {
  1238. return new Quaternion(this.x * value, this.y * value, this.z * value, this.w * value);
  1239. };
  1240. Quaternion.prototype.multiply = function (q1) {
  1241. var result = new Quaternion(0, 0, 0, 1.0);
  1242. this.multiplyToRef(q1, result);
  1243. return result;
  1244. };
  1245. Quaternion.prototype.multiplyToRef = function (q1, result) {
  1246. var x = this.x * q1.w + this.y * q1.z - this.z * q1.y + this.w * q1.x;
  1247. var y = -this.x * q1.z + this.y * q1.w + this.z * q1.x + this.w * q1.y;
  1248. var z = this.x * q1.y - this.y * q1.x + this.z * q1.w + this.w * q1.z;
  1249. var w = -this.x * q1.x - this.y * q1.y - this.z * q1.z + this.w * q1.w;
  1250. result.copyFromFloats(x, y, z, w);
  1251. return this;
  1252. };
  1253. Quaternion.prototype.multiplyInPlace = function (q1) {
  1254. this.multiplyToRef(q1, this);
  1255. return this;
  1256. };
  1257. Quaternion.prototype.length = function () {
  1258. return Math.sqrt((this.x * this.x) + (this.y * this.y) + (this.z * this.z) + (this.w * this.w));
  1259. };
  1260. Quaternion.prototype.normalize = function () {
  1261. var length = 1.0 / this.length();
  1262. this.x *= length;
  1263. this.y *= length;
  1264. this.z *= length;
  1265. this.w *= length;
  1266. return this;
  1267. };
  1268. Quaternion.prototype.toEulerAngles = function () {
  1269. var result = Vector3.Zero();
  1270. this.toEulerAnglesToRef(result);
  1271. return result;
  1272. };
  1273. Quaternion.prototype.toEulerAnglesToRef = function (result) {
  1274. //result is an EulerAngles in the in the z-x-z convention
  1275. var qx = this.x;
  1276. var qy = this.y;
  1277. var qz = this.z;
  1278. var qw = this.w;
  1279. var qxy = qx * qy;
  1280. var qxz = qx * qz;
  1281. var qwy = qw * qy;
  1282. var qwz = qw * qz;
  1283. var qwx = qw * qx;
  1284. var qyz = qy * qz;
  1285. var sqx = qx * qx;
  1286. var sqy = qy * qy;
  1287. var determinant = sqx + sqy;
  1288. if (determinant !== 0.000 && determinant !== 1.000) {
  1289. result.x = Math.atan2(qxz + qwy, qwx - qyz);
  1290. result.y = Math.acos(1 - 2 * determinant);
  1291. result.z = Math.atan2(qxz - qwy, qwx + qyz);
  1292. }
  1293. else {
  1294. if (determinant === 0.0) {
  1295. result.x = 0.0;
  1296. result.y = 0.0;
  1297. result.z = Math.atan2(qxy - qwz, 0.5 - sqy - qz * qz); //actually, degeneracy gives us choice with x+z=Math.atan2(qxy-qwz,0.5-sqy-qz*qz)
  1298. }
  1299. else {
  1300. result.x = Math.atan2(qxy - qwz, 0.5 - sqy - qz * qz); //actually, degeneracy gives us choice with x-z=Math.atan2(qxy-qwz,0.5-sqy-qz*qz)
  1301. result.y = Math.PI;
  1302. result.z = 0.0;
  1303. }
  1304. }
  1305. return this;
  1306. };
  1307. Quaternion.prototype.toRotationMatrix = function (result) {
  1308. var xx = this.x * this.x;
  1309. var yy = this.y * this.y;
  1310. var zz = this.z * this.z;
  1311. var xy = this.x * this.y;
  1312. var zw = this.z * this.w;
  1313. var zx = this.z * this.x;
  1314. var yw = this.y * this.w;
  1315. var yz = this.y * this.z;
  1316. var xw = this.x * this.w;
  1317. result.m[0] = 1.0 - (2.0 * (yy + zz));
  1318. result.m[1] = 2.0 * (xy + zw);
  1319. result.m[2] = 2.0 * (zx - yw);
  1320. result.m[3] = 0;
  1321. result.m[4] = 2.0 * (xy - zw);
  1322. result.m[5] = 1.0 - (2.0 * (zz + xx));
  1323. result.m[6] = 2.0 * (yz + xw);
  1324. result.m[7] = 0;
  1325. result.m[8] = 2.0 * (zx + yw);
  1326. result.m[9] = 2.0 * (yz - xw);
  1327. result.m[10] = 1.0 - (2.0 * (yy + xx));
  1328. result.m[11] = 0;
  1329. result.m[12] = 0;
  1330. result.m[13] = 0;
  1331. result.m[14] = 0;
  1332. result.m[15] = 1.0;
  1333. return this;
  1334. };
  1335. Quaternion.prototype.fromRotationMatrix = function (matrix) {
  1336. Quaternion.FromRotationMatrixToRef(matrix, this);
  1337. return this;
  1338. };
  1339. // Statics
  1340. Quaternion.FromRotationMatrix = function (matrix) {
  1341. var result = new Quaternion();
  1342. Quaternion.FromRotationMatrixToRef(matrix, result);
  1343. return result;
  1344. };
  1345. Quaternion.FromRotationMatrixToRef = function (matrix, result) {
  1346. var data = matrix.m;
  1347. var m11 = data[0], m12 = data[4], m13 = data[8];
  1348. var m21 = data[1], m22 = data[5], m23 = data[9];
  1349. var m31 = data[2], m32 = data[6], m33 = data[10];
  1350. var trace = m11 + m22 + m33;
  1351. var s;
  1352. if (trace > 0) {
  1353. s = 0.5 / Math.sqrt(trace + 1.0);
  1354. result.w = 0.25 / s;
  1355. result.x = (m32 - m23) * s;
  1356. result.y = (m13 - m31) * s;
  1357. result.z = (m21 - m12) * s;
  1358. }
  1359. else if (m11 > m22 && m11 > m33) {
  1360. s = 2.0 * Math.sqrt(1.0 + m11 - m22 - m33);
  1361. result.w = (m32 - m23) / s;
  1362. result.x = 0.25 * s;
  1363. result.y = (m12 + m21) / s;
  1364. result.z = (m13 + m31) / s;
  1365. }
  1366. else if (m22 > m33) {
  1367. s = 2.0 * Math.sqrt(1.0 + m22 - m11 - m33);
  1368. result.w = (m13 - m31) / s;
  1369. result.x = (m12 + m21) / s;
  1370. result.y = 0.25 * s;
  1371. result.z = (m23 + m32) / s;
  1372. }
  1373. else {
  1374. s = 2.0 * Math.sqrt(1.0 + m33 - m11 - m22);
  1375. result.w = (m21 - m12) / s;
  1376. result.x = (m13 + m31) / s;
  1377. result.y = (m23 + m32) / s;
  1378. result.z = 0.25 * s;
  1379. }
  1380. };
  1381. Quaternion.Inverse = function (q) {
  1382. return new Quaternion(-q.x, -q.y, -q.z, q.w);
  1383. };
  1384. Quaternion.Identity = function () {
  1385. return new Quaternion(0, 0, 0, 1);
  1386. };
  1387. Quaternion.RotationAxis = function (axis, angle) {
  1388. var result = new Quaternion();
  1389. var sin = Math.sin(angle / 2);
  1390. axis.normalize();
  1391. result.w = Math.cos(angle / 2);
  1392. result.x = axis.x * sin;
  1393. result.y = axis.y * sin;
  1394. result.z = axis.z * sin;
  1395. return result;
  1396. };
  1397. Quaternion.FromArray = function (array, offset) {
  1398. if (!offset) {
  1399. offset = 0;
  1400. }
  1401. return new Quaternion(array[offset], array[offset + 1], array[offset + 2], array[offset + 3]);
  1402. };
  1403. Quaternion.RotationYawPitchRoll = function (yaw, pitch, roll) {
  1404. var result = new Quaternion();
  1405. Quaternion.RotationYawPitchRollToRef(yaw, pitch, roll, result);
  1406. return result;
  1407. };
  1408. Quaternion.RotationYawPitchRollToRef = function (yaw, pitch, roll, result) {
  1409. // Produces a quaternion from Euler angles in the z-y-x orientation (Tait-Bryan angles)
  1410. var halfRoll = roll * 0.5;
  1411. var halfPitch = pitch * 0.5;
  1412. var halfYaw = yaw * 0.5;
  1413. var sinRoll = Math.sin(halfRoll);
  1414. var cosRoll = Math.cos(halfRoll);
  1415. var sinPitch = Math.sin(halfPitch);
  1416. var cosPitch = Math.cos(halfPitch);
  1417. var sinYaw = Math.sin(halfYaw);
  1418. var cosYaw = Math.cos(halfYaw);
  1419. result.x = (cosYaw * sinPitch * cosRoll) + (sinYaw * cosPitch * sinRoll);
  1420. result.y = (sinYaw * cosPitch * cosRoll) - (cosYaw * sinPitch * sinRoll);
  1421. result.z = (cosYaw * cosPitch * sinRoll) - (sinYaw * sinPitch * cosRoll);
  1422. result.w = (cosYaw * cosPitch * cosRoll) + (sinYaw * sinPitch * sinRoll);
  1423. };
  1424. Quaternion.RotationAlphaBetaGamma = function (alpha, beta, gamma) {
  1425. var result = new Quaternion();
  1426. Quaternion.RotationAlphaBetaGammaToRef(alpha, beta, gamma, result);
  1427. return result;
  1428. };
  1429. Quaternion.RotationAlphaBetaGammaToRef = function (alpha, beta, gamma, result) {
  1430. // Produces a quaternion from Euler angles in the z-x-z orientation
  1431. var halfGammaPlusAlpha = (gamma + alpha) * 0.5;
  1432. var halfGammaMinusAlpha = (gamma - alpha) * 0.5;
  1433. var halfBeta = beta * 0.5;
  1434. result.x = Math.cos(halfGammaMinusAlpha) * Math.sin(halfBeta);
  1435. result.y = Math.sin(halfGammaMinusAlpha) * Math.sin(halfBeta);
  1436. result.z = Math.sin(halfGammaPlusAlpha) * Math.cos(halfBeta);
  1437. result.w = Math.cos(halfGammaPlusAlpha) * Math.cos(halfBeta);
  1438. };
  1439. Quaternion.Slerp = function (left, right, amount) {
  1440. var num2;
  1441. var num3;
  1442. var num = amount;
  1443. var num4 = (((left.x * right.x) + (left.y * right.y)) + (left.z * right.z)) + (left.w * right.w);
  1444. var flag = false;
  1445. if (num4 < 0) {
  1446. flag = true;
  1447. num4 = -num4;
  1448. }
  1449. if (num4 > 0.999999) {
  1450. num3 = 1 - num;
  1451. num2 = flag ? -num : num;
  1452. }
  1453. else {
  1454. var num5 = Math.acos(num4);
  1455. var num6 = (1.0 / Math.sin(num5));
  1456. num3 = (Math.sin((1.0 - num) * num5)) * num6;
  1457. num2 = flag ? ((-Math.sin(num * num5)) * num6) : ((Math.sin(num * num5)) * num6);
  1458. }
  1459. return new Quaternion((num3 * left.x) + (num2 * right.x), (num3 * left.y) + (num2 * right.y), (num3 * left.z) + (num2 * right.z), (num3 * left.w) + (num2 * right.w));
  1460. };
  1461. return Quaternion;
  1462. })();
  1463. BABYLON.Quaternion = Quaternion;
  1464. var Matrix = (function () {
  1465. function Matrix() {
  1466. this.m = new Float32Array(16);
  1467. }
  1468. // Properties
  1469. Matrix.prototype.isIdentity = function () {
  1470. if (this.m[0] !== 1.0 || this.m[5] !== 1.0 || this.m[10] !== 1.0 || this.m[15] !== 1.0)
  1471. return false;
  1472. if (this.m[1] !== 0.0 || this.m[2] !== 0.0 || this.m[3] !== 0.0 ||
  1473. this.m[4] !== 0.0 || this.m[6] !== 0.0 || this.m[7] !== 0.0 ||
  1474. this.m[8] !== 0.0 || this.m[9] !== 0.0 || this.m[11] !== 0.0 ||
  1475. this.m[12] !== 0.0 || this.m[13] !== 0.0 || this.m[14] !== 0.0)
  1476. return false;
  1477. return true;
  1478. };
  1479. Matrix.prototype.determinant = function () {
  1480. var temp1 = (this.m[10] * this.m[15]) - (this.m[11] * this.m[14]);
  1481. var temp2 = (this.m[9] * this.m[15]) - (this.m[11] * this.m[13]);
  1482. var temp3 = (this.m[9] * this.m[14]) - (this.m[10] * this.m[13]);
  1483. var temp4 = (this.m[8] * this.m[15]) - (this.m[11] * this.m[12]);
  1484. var temp5 = (this.m[8] * this.m[14]) - (this.m[10] * this.m[12]);
  1485. var temp6 = (this.m[8] * this.m[13]) - (this.m[9] * this.m[12]);
  1486. return ((((this.m[0] * (((this.m[5] * temp1) - (this.m[6] * temp2)) + (this.m[7] * temp3))) - (this.m[1] * (((this.m[4] * temp1) -
  1487. (this.m[6] * temp4)) + (this.m[7] * temp5)))) + (this.m[2] * (((this.m[4] * temp2) - (this.m[5] * temp4)) + (this.m[7] * temp6)))) -
  1488. (this.m[3] * (((this.m[4] * temp3) - (this.m[5] * temp5)) + (this.m[6] * temp6))));
  1489. };
  1490. // Methods
  1491. Matrix.prototype.toArray = function () {
  1492. return this.m;
  1493. };
  1494. Matrix.prototype.asArray = function () {
  1495. return this.toArray();
  1496. };
  1497. Matrix.prototype.invert = function () {
  1498. this.invertToRef(this);
  1499. return this;
  1500. };
  1501. Matrix.prototype.reset = function () {
  1502. for (var index = 0; index < 16; index++) {
  1503. this.m[index] = 0;
  1504. }
  1505. return this;
  1506. };
  1507. Matrix.prototype.add = function (other) {
  1508. var result = new Matrix();
  1509. this.addToRef(other, result);
  1510. return result;
  1511. };
  1512. Matrix.prototype.addToRef = function (other, result) {
  1513. for (var index = 0; index < 16; index++) {
  1514. result.m[index] = this.m[index] + other.m[index];
  1515. }
  1516. return this;
  1517. };
  1518. Matrix.prototype.addToSelf = function (other) {
  1519. for (var index = 0; index < 16; index++) {
  1520. this.m[index] += other.m[index];
  1521. }
  1522. return this;
  1523. };
  1524. Matrix.prototype.invertToRef = function (other) {
  1525. var l1 = this.m[0];
  1526. var l2 = this.m[1];
  1527. var l3 = this.m[2];
  1528. var l4 = this.m[3];
  1529. var l5 = this.m[4];
  1530. var l6 = this.m[5];
  1531. var l7 = this.m[6];
  1532. var l8 = this.m[7];
  1533. var l9 = this.m[8];
  1534. var l10 = this.m[9];
  1535. var l11 = this.m[10];
  1536. var l12 = this.m[11];
  1537. var l13 = this.m[12];
  1538. var l14 = this.m[13];
  1539. var l15 = this.m[14];
  1540. var l16 = this.m[15];
  1541. var l17 = (l11 * l16) - (l12 * l15);
  1542. var l18 = (l10 * l16) - (l12 * l14);
  1543. var l19 = (l10 * l15) - (l11 * l14);
  1544. var l20 = (l9 * l16) - (l12 * l13);
  1545. var l21 = (l9 * l15) - (l11 * l13);
  1546. var l22 = (l9 * l14) - (l10 * l13);
  1547. var l23 = ((l6 * l17) - (l7 * l18)) + (l8 * l19);
  1548. var l24 = -(((l5 * l17) - (l7 * l20)) + (l8 * l21));
  1549. var l25 = ((l5 * l18) - (l6 * l20)) + (l8 * l22);
  1550. var l26 = -(((l5 * l19) - (l6 * l21)) + (l7 * l22));
  1551. var l27 = 1.0 / ((((l1 * l23) + (l2 * l24)) + (l3 * l25)) + (l4 * l26));
  1552. var l28 = (l7 * l16) - (l8 * l15);
  1553. var l29 = (l6 * l16) - (l8 * l14);
  1554. var l30 = (l6 * l15) - (l7 * l14);
  1555. var l31 = (l5 * l16) - (l8 * l13);
  1556. var l32 = (l5 * l15) - (l7 * l13);
  1557. var l33 = (l5 * l14) - (l6 * l13);
  1558. var l34 = (l7 * l12) - (l8 * l11);
  1559. var l35 = (l6 * l12) - (l8 * l10);
  1560. var l36 = (l6 * l11) - (l7 * l10);
  1561. var l37 = (l5 * l12) - (l8 * l9);
  1562. var l38 = (l5 * l11) - (l7 * l9);
  1563. var l39 = (l5 * l10) - (l6 * l9);
  1564. other.m[0] = l23 * l27;
  1565. other.m[4] = l24 * l27;
  1566. other.m[8] = l25 * l27;
  1567. other.m[12] = l26 * l27;
  1568. other.m[1] = -(((l2 * l17) - (l3 * l18)) + (l4 * l19)) * l27;
  1569. other.m[5] = (((l1 * l17) - (l3 * l20)) + (l4 * l21)) * l27;
  1570. other.m[9] = -(((l1 * l18) - (l2 * l20)) + (l4 * l22)) * l27;
  1571. other.m[13] = (((l1 * l19) - (l2 * l21)) + (l3 * l22)) * l27;
  1572. other.m[2] = (((l2 * l28) - (l3 * l29)) + (l4 * l30)) * l27;
  1573. other.m[6] = -(((l1 * l28) - (l3 * l31)) + (l4 * l32)) * l27;
  1574. other.m[10] = (((l1 * l29) - (l2 * l31)) + (l4 * l33)) * l27;
  1575. other.m[14] = -(((l1 * l30) - (l2 * l32)) + (l3 * l33)) * l27;
  1576. other.m[3] = -(((l2 * l34) - (l3 * l35)) + (l4 * l36)) * l27;
  1577. other.m[7] = (((l1 * l34) - (l3 * l37)) + (l4 * l38)) * l27;
  1578. other.m[11] = -(((l1 * l35) - (l2 * l37)) + (l4 * l39)) * l27;
  1579. other.m[15] = (((l1 * l36) - (l2 * l38)) + (l3 * l39)) * l27;
  1580. return this;
  1581. };
  1582. Matrix.prototype.setTranslation = function (vector3) {
  1583. this.m[12] = vector3.x;
  1584. this.m[13] = vector3.y;
  1585. this.m[14] = vector3.z;
  1586. return this;
  1587. };
  1588. Matrix.prototype.multiply = function (other) {
  1589. var result = new Matrix();
  1590. this.multiplyToRef(other, result);
  1591. return result;
  1592. };
  1593. Matrix.prototype.copyFrom = function (other) {
  1594. for (var index = 0; index < 16; index++) {
  1595. this.m[index] = other.m[index];
  1596. }
  1597. return this;
  1598. };
  1599. Matrix.prototype.copyToArray = function (array, offset) {
  1600. if (offset === void 0) { offset = 0; }
  1601. for (var index = 0; index < 16; index++) {
  1602. array[offset + index] = this.m[index];
  1603. }
  1604. return this;
  1605. };
  1606. Matrix.prototype.multiplyToRef = function (other, result) {
  1607. this.multiplyToArray(other, result.m, 0);
  1608. return this;
  1609. };
  1610. Matrix.prototype.multiplyToArray = function (other, result, offset) {
  1611. var tm0 = this.m[0];
  1612. var tm1 = this.m[1];
  1613. var tm2 = this.m[2];
  1614. var tm3 = this.m[3];
  1615. var tm4 = this.m[4];
  1616. var tm5 = this.m[5];
  1617. var tm6 = this.m[6];
  1618. var tm7 = this.m[7];
  1619. var tm8 = this.m[8];
  1620. var tm9 = this.m[9];
  1621. var tm10 = this.m[10];
  1622. var tm11 = this.m[11];
  1623. var tm12 = this.m[12];
  1624. var tm13 = this.m[13];
  1625. var tm14 = this.m[14];
  1626. var tm15 = this.m[15];
  1627. var om0 = other.m[0];
  1628. var om1 = other.m[1];
  1629. var om2 = other.m[2];
  1630. var om3 = other.m[3];
  1631. var om4 = other.m[4];
  1632. var om5 = other.m[5];
  1633. var om6 = other.m[6];
  1634. var om7 = other.m[7];
  1635. var om8 = other.m[8];
  1636. var om9 = other.m[9];
  1637. var om10 = other.m[10];
  1638. var om11 = other.m[11];
  1639. var om12 = other.m[12];
  1640. var om13 = other.m[13];
  1641. var om14 = other.m[14];
  1642. var om15 = other.m[15];
  1643. result[offset] = tm0 * om0 + tm1 * om4 + tm2 * om8 + tm3 * om12;
  1644. result[offset + 1] = tm0 * om1 + tm1 * om5 + tm2 * om9 + tm3 * om13;
  1645. result[offset + 2] = tm0 * om2 + tm1 * om6 + tm2 * om10 + tm3 * om14;
  1646. result[offset + 3] = tm0 * om3 + tm1 * om7 + tm2 * om11 + tm3 * om15;
  1647. result[offset + 4] = tm4 * om0 + tm5 * om4 + tm6 * om8 + tm7 * om12;
  1648. result[offset + 5] = tm4 * om1 + tm5 * om5 + tm6 * om9 + tm7 * om13;
  1649. result[offset + 6] = tm4 * om2 + tm5 * om6 + tm6 * om10 + tm7 * om14;
  1650. result[offset + 7] = tm4 * om3 + tm5 * om7 + tm6 * om11 + tm7 * om15;
  1651. result[offset + 8] = tm8 * om0 + tm9 * om4 + tm10 * om8 + tm11 * om12;
  1652. result[offset + 9] = tm8 * om1 + tm9 * om5 + tm10 * om9 + tm11 * om13;
  1653. result[offset + 10] = tm8 * om2 + tm9 * om6 + tm10 * om10 + tm11 * om14;
  1654. result[offset + 11] = tm8 * om3 + tm9 * om7 + tm10 * om11 + tm11 * om15;
  1655. result[offset + 12] = tm12 * om0 + tm13 * om4 + tm14 * om8 + tm15 * om12;
  1656. result[offset + 13] = tm12 * om1 + tm13 * om5 + tm14 * om9 + tm15 * om13;
  1657. result[offset + 14] = tm12 * om2 + tm13 * om6 + tm14 * om10 + tm15 * om14;
  1658. result[offset + 15] = tm12 * om3 + tm13 * om7 + tm14 * om11 + tm15 * om15;
  1659. return this;
  1660. };
  1661. Matrix.prototype.equals = function (value) {
  1662. return value &&
  1663. (this.m[0] === value.m[0] && this.m[1] === value.m[1] && this.m[2] === value.m[2] && this.m[3] === value.m[3] &&
  1664. this.m[4] === value.m[4] && this.m[5] === value.m[5] && this.m[6] === value.m[6] && this.m[7] === value.m[7] &&
  1665. this.m[8] === value.m[8] && this.m[9] === value.m[9] && this.m[10] === value.m[10] && this.m[11] === value.m[11] &&
  1666. this.m[12] === value.m[12] && this.m[13] === value.m[13] && this.m[14] === value.m[14] && this.m[15] === value.m[15]);
  1667. };
  1668. Matrix.prototype.clone = function () {
  1669. return Matrix.FromValues(this.m[0], this.m[1], this.m[2], this.m[3], this.m[4], this.m[5], this.m[6], this.m[7], this.m[8], this.m[9], this.m[10], this.m[11], this.m[12], this.m[13], this.m[14], this.m[15]);
  1670. };
  1671. Matrix.prototype.decompose = function (scale, rotation, translation) {
  1672. translation.x = this.m[12];
  1673. translation.y = this.m[13];
  1674. translation.z = this.m[14];
  1675. var xs = BABYLON.Tools.Sign(this.m[0] * this.m[1] * this.m[2] * this.m[3]) < 0 ? -1 : 1;
  1676. var ys = BABYLON.Tools.Sign(this.m[4] * this.m[5] * this.m[6] * this.m[7]) < 0 ? -1 : 1;
  1677. var zs = BABYLON.Tools.Sign(this.m[8] * this.m[9] * this.m[10] * this.m[11]) < 0 ? -1 : 1;
  1678. scale.x = xs * Math.sqrt(this.m[0] * this.m[0] + this.m[1] * this.m[1] + this.m[2] * this.m[2]);
  1679. scale.y = ys * Math.sqrt(this.m[4] * this.m[4] + this.m[5] * this.m[5] + this.m[6] * this.m[6]);
  1680. scale.z = zs * Math.sqrt(this.m[8] * this.m[8] + this.m[9] * this.m[9] + this.m[10] * this.m[10]);
  1681. if (scale.x === 0 || scale.y === 0 || scale.z === 0) {
  1682. rotation.x = 0;
  1683. rotation.y = 0;
  1684. rotation.z = 0;
  1685. rotation.w = 1;
  1686. return false;
  1687. }
  1688. var rotationMatrix = Matrix.FromValues(this.m[0] / scale.x, this.m[1] / scale.x, this.m[2] / scale.x, 0, this.m[4] / scale.y, this.m[5] / scale.y, this.m[6] / scale.y, 0, this.m[8] / scale.z, this.m[9] / scale.z, this.m[10] / scale.z, 0, 0, 0, 0, 1);
  1689. Quaternion.FromRotationMatrixToRef(rotationMatrix, rotation);
  1690. return true;
  1691. };
  1692. // Statics
  1693. Matrix.FromArray = function (array, offset) {
  1694. var result = new Matrix();
  1695. if (!offset) {
  1696. offset = 0;
  1697. }
  1698. Matrix.FromArrayToRef(array, offset, result);
  1699. return result;
  1700. };
  1701. Matrix.FromArrayToRef = function (array, offset, result) {
  1702. for (var index = 0; index < 16; index++) {
  1703. result.m[index] = array[index + offset];
  1704. }
  1705. };
  1706. Matrix.FromFloat32ArrayToRefScaled = function (array, offset, scale, result) {
  1707. for (var index = 0; index < 16; index++) {
  1708. result.m[index] = array[index + offset] * scale;
  1709. }
  1710. };
  1711. Matrix.FromValuesToRef = function (initialM11, initialM12, initialM13, initialM14, initialM21, initialM22, initialM23, initialM24, initialM31, initialM32, initialM33, initialM34, initialM41, initialM42, initialM43, initialM44, result) {
  1712. result.m[0] = initialM11;
  1713. result.m[1] = initialM12;
  1714. result.m[2] = initialM13;
  1715. result.m[3] = initialM14;
  1716. result.m[4] = initialM21;
  1717. result.m[5] = initialM22;
  1718. result.m[6] = initialM23;
  1719. result.m[7] = initialM24;
  1720. result.m[8] = initialM31;
  1721. result.m[9] = initialM32;
  1722. result.m[10] = initialM33;
  1723. result.m[11] = initialM34;
  1724. result.m[12] = initialM41;
  1725. result.m[13] = initialM42;
  1726. result.m[14] = initialM43;
  1727. result.m[15] = initialM44;
  1728. };
  1729. Matrix.FromValues = function (initialM11, initialM12, initialM13, initialM14, initialM21, initialM22, initialM23, initialM24, initialM31, initialM32, initialM33, initialM34, initialM41, initialM42, initialM43, initialM44) {
  1730. var result = new Matrix();
  1731. result.m[0] = initialM11;
  1732. result.m[1] = initialM12;
  1733. result.m[2] = initialM13;
  1734. result.m[3] = initialM14;
  1735. result.m[4] = initialM21;
  1736. result.m[5] = initialM22;
  1737. result.m[6] = initialM23;
  1738. result.m[7] = initialM24;
  1739. result.m[8] = initialM31;
  1740. result.m[9] = initialM32;
  1741. result.m[10] = initialM33;
  1742. result.m[11] = initialM34;
  1743. result.m[12] = initialM41;
  1744. result.m[13] = initialM42;
  1745. result.m[14] = initialM43;
  1746. result.m[15] = initialM44;
  1747. return result;
  1748. };
  1749. Matrix.Compose = function (scale, rotation, translation) {
  1750. var result = Matrix.FromValues(scale.x, 0, 0, 0, 0, scale.y, 0, 0, 0, 0, scale.z, 0, 0, 0, 0, 1);
  1751. var rotationMatrix = Matrix.Identity();
  1752. rotation.toRotationMatrix(rotationMatrix);
  1753. result = result.multiply(rotationMatrix);
  1754. result.setTranslation(translation);
  1755. return result;
  1756. };
  1757. Matrix.Identity = function () {
  1758. return Matrix.FromValues(1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0);
  1759. };
  1760. Matrix.IdentityToRef = function (result) {
  1761. Matrix.FromValuesToRef(1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0, result);
  1762. };
  1763. Matrix.Zero = function () {
  1764. return Matrix.FromValues(0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0);
  1765. };
  1766. Matrix.RotationX = function (angle) {
  1767. var result = new Matrix();
  1768. Matrix.RotationXToRef(angle, result);
  1769. return result;
  1770. };
  1771. Matrix.Invert = function (source) {
  1772. var result = new Matrix();
  1773. source.invertToRef(result);
  1774. return result;
  1775. };
  1776. Matrix.RotationXToRef = function (angle, result) {
  1777. var s = Math.sin(angle);
  1778. var c = Math.cos(angle);
  1779. result.m[0] = 1.0;
  1780. result.m[15] = 1.0;
  1781. result.m[5] = c;
  1782. result.m[10] = c;
  1783. result.m[9] = -s;
  1784. result.m[6] = s;
  1785. result.m[1] = 0;
  1786. result.m[2] = 0;
  1787. result.m[3] = 0;
  1788. result.m[4] = 0;
  1789. result.m[7] = 0;
  1790. result.m[8] = 0;
  1791. result.m[11] = 0;
  1792. result.m[12] = 0;
  1793. result.m[13] = 0;
  1794. result.m[14] = 0;
  1795. };
  1796. Matrix.RotationY = function (angle) {
  1797. var result = new Matrix();
  1798. Matrix.RotationYToRef(angle, result);
  1799. return result;
  1800. };
  1801. Matrix.RotationYToRef = function (angle, result) {
  1802. var s = Math.sin(angle);
  1803. var c = Math.cos(angle);
  1804. result.m[5] = 1.0;
  1805. result.m[15] = 1.0;
  1806. result.m[0] = c;
  1807. result.m[2] = -s;
  1808. result.m[8] = s;
  1809. result.m[10] = c;
  1810. result.m[1] = 0;
  1811. result.m[3] = 0;
  1812. result.m[4] = 0;
  1813. result.m[6] = 0;
  1814. result.m[7] = 0;
  1815. result.m[9] = 0;
  1816. result.m[11] = 0;
  1817. result.m[12] = 0;
  1818. result.m[13] = 0;
  1819. result.m[14] = 0;
  1820. };
  1821. Matrix.RotationZ = function (angle) {
  1822. var result = new Matrix();
  1823. Matrix.RotationZToRef(angle, result);
  1824. return result;
  1825. };
  1826. Matrix.RotationZToRef = function (angle, result) {
  1827. var s = Math.sin(angle);
  1828. var c = Math.cos(angle);
  1829. result.m[10] = 1.0;
  1830. result.m[15] = 1.0;
  1831. result.m[0] = c;
  1832. result.m[1] = s;
  1833. result.m[4] = -s;
  1834. result.m[5] = c;
  1835. result.m[2] = 0;
  1836. result.m[3] = 0;
  1837. result.m[6] = 0;
  1838. result.m[7] = 0;
  1839. result.m[8] = 0;
  1840. result.m[9] = 0;
  1841. result.m[11] = 0;
  1842. result.m[12] = 0;
  1843. result.m[13] = 0;
  1844. result.m[14] = 0;
  1845. };
  1846. Matrix.RotationAxis = function (axis, angle) {
  1847. var result = Matrix.Zero();
  1848. Matrix.RotationAxisToRef(axis, angle, result);
  1849. return result;
  1850. };
  1851. Matrix.RotationAxisToRef = function (axis, angle, result) {
  1852. var s = Math.sin(-angle);
  1853. var c = Math.cos(-angle);
  1854. var c1 = 1 - c;
  1855. axis.normalize();
  1856. result.m[0] = (axis.x * axis.x) * c1 + c;
  1857. result.m[1] = (axis.x * axis.y) * c1 - (axis.z * s);
  1858. result.m[2] = (axis.x * axis.z) * c1 + (axis.y * s);
  1859. result.m[3] = 0.0;
  1860. result.m[4] = (axis.y * axis.x) * c1 + (axis.z * s);
  1861. result.m[5] = (axis.y * axis.y) * c1 + c;
  1862. result.m[6] = (axis.y * axis.z) * c1 - (axis.x * s);
  1863. result.m[7] = 0.0;
  1864. result.m[8] = (axis.z * axis.x) * c1 - (axis.y * s);
  1865. result.m[9] = (axis.z * axis.y) * c1 + (axis.x * s);
  1866. result.m[10] = (axis.z * axis.z) * c1 + c;
  1867. result.m[11] = 0.0;
  1868. result.m[15] = 1.0;
  1869. };
  1870. Matrix.RotationYawPitchRoll = function (yaw, pitch, roll) {
  1871. var result = new Matrix();
  1872. Matrix.RotationYawPitchRollToRef(yaw, pitch, roll, result);
  1873. return result;
  1874. };
  1875. Matrix.RotationYawPitchRollToRef = function (yaw, pitch, roll, result) {
  1876. Quaternion.RotationYawPitchRollToRef(yaw, pitch, roll, this._tempQuaternion);
  1877. this._tempQuaternion.toRotationMatrix(result);
  1878. };
  1879. Matrix.Scaling = function (x, y, z) {
  1880. var result = Matrix.Zero();
  1881. Matrix.ScalingToRef(x, y, z, result);
  1882. return result;
  1883. };
  1884. Matrix.ScalingToRef = function (x, y, z, result) {
  1885. result.m[0] = x;
  1886. result.m[1] = 0;
  1887. result.m[2] = 0;
  1888. result.m[3] = 0;
  1889. result.m[4] = 0;
  1890. result.m[5] = y;
  1891. result.m[6] = 0;
  1892. result.m[7] = 0;
  1893. result.m[8] = 0;
  1894. result.m[9] = 0;
  1895. result.m[10] = z;
  1896. result.m[11] = 0;
  1897. result.m[12] = 0;
  1898. result.m[13] = 0;
  1899. result.m[14] = 0;
  1900. result.m[15] = 1.0;
  1901. };
  1902. Matrix.Translation = function (x, y, z) {
  1903. var result = Matrix.Identity();
  1904. Matrix.TranslationToRef(x, y, z, result);
  1905. return result;
  1906. };
  1907. Matrix.TranslationToRef = function (x, y, z, result) {
  1908. Matrix.FromValuesToRef(1.0, 0, 0, 0, 0, 1.0, 0, 0, 0, 0, 1.0, 0, x, y, z, 1.0, result);
  1909. };
  1910. Matrix.LookAtLH = function (eye, target, up) {
  1911. var result = Matrix.Zero();
  1912. Matrix.LookAtLHToRef(eye, target, up, result);
  1913. return result;
  1914. };
  1915. Matrix.LookAtLHToRef = function (eye, target, up, result) {
  1916. // Z axis
  1917. target.subtractToRef(eye, this._zAxis);
  1918. this._zAxis.normalize();
  1919. // X axis
  1920. Vector3.CrossToRef(up, this._zAxis, this._xAxis);
  1921. if (this._xAxis.lengthSquared() === 0) {
  1922. this._xAxis.x = 1.0;
  1923. }
  1924. else {
  1925. this._xAxis.normalize();
  1926. }
  1927. // Y axis
  1928. Vector3.CrossToRef(this._zAxis, this._xAxis, this._yAxis);
  1929. this._yAxis.normalize();
  1930. // Eye angles
  1931. var ex = -Vector3.Dot(this._xAxis, eye);
  1932. var ey = -Vector3.Dot(this._yAxis, eye);
  1933. var ez = -Vector3.Dot(this._zAxis, eye);
  1934. return Matrix.FromValuesToRef(this._xAxis.x, this._yAxis.x, this._zAxis.x, 0, this._xAxis.y, this._yAxis.y, this._zAxis.y, 0, this._xAxis.z, this._yAxis.z, this._zAxis.z, 0, ex, ey, ez, 1, result);
  1935. };
  1936. Matrix.OrthoLH = function (width, height, znear, zfar) {
  1937. var matrix = Matrix.Zero();
  1938. Matrix.OrthoLHToRef(width, height, znear, zfar, matrix);
  1939. return matrix;
  1940. };
  1941. Matrix.OrthoLHToRef = function (width, height, znear, zfar, result) {
  1942. var hw = 2.0 / width;
  1943. var hh = 2.0 / height;
  1944. var id = 1.0 / (zfar - znear);
  1945. var nid = znear / (znear - zfar);
  1946. Matrix.FromValuesToRef(hw, 0, 0, 0, 0, hh, 0, 0, 0, 0, id, 0, 0, 0, nid, 1, result);
  1947. };
  1948. Matrix.OrthoOffCenterLH = function (left, right, bottom, top, znear, zfar) {
  1949. var matrix = Matrix.Zero();
  1950. Matrix.OrthoOffCenterLHToRef(left, right, bottom, top, znear, zfar, matrix);
  1951. return matrix;
  1952. };
  1953. Matrix.OrthoOffCenterLHToRef = function (left, right, bottom, top, znear, zfar, result) {
  1954. result.m[0] = 2.0 / (right - left);
  1955. result.m[1] = result.m[2] = result.m[3] = 0;
  1956. result.m[5] = 2.0 / (top - bottom);
  1957. result.m[4] = result.m[6] = result.m[7] = 0;
  1958. result.m[10] = -1.0 / (znear - zfar);
  1959. result.m[8] = result.m[9] = result.m[11] = 0;
  1960. result.m[12] = (left + right) / (left - right);
  1961. result.m[13] = (top + bottom) / (bottom - top);
  1962. result.m[14] = znear / (znear - zfar);
  1963. result.m[15] = 1.0;
  1964. };
  1965. Matrix.PerspectiveLH = function (width, height, znear, zfar) {
  1966. var matrix = Matrix.Zero();
  1967. matrix.m[0] = (2.0 * znear) / width;
  1968. matrix.m[1] = matrix.m[2] = matrix.m[3] = 0.0;
  1969. matrix.m[5] = (2.0 * znear) / height;
  1970. matrix.m[4] = matrix.m[6] = matrix.m[7] = 0.0;
  1971. matrix.m[10] = -zfar / (znear - zfar);
  1972. matrix.m[8] = matrix.m[9] = 0.0;
  1973. matrix.m[11] = 1.0;
  1974. matrix.m[12] = matrix.m[13] = matrix.m[15] = 0.0;
  1975. matrix.m[14] = (znear * zfar) / (znear - zfar);
  1976. return matrix;
  1977. };
  1978. Matrix.PerspectiveFovLH = function (fov, aspect, znear, zfar) {
  1979. var matrix = Matrix.Zero();
  1980. Matrix.PerspectiveFovLHToRef(fov, aspect, znear, zfar, matrix);
  1981. return matrix;
  1982. };
  1983. Matrix.PerspectiveFovLHToRef = function (fov, aspect, znear, zfar, result, fovMode) {
  1984. if (fovMode === void 0) { fovMode = BABYLON.Camera.FOVMODE_VERTICAL_FIXED; }
  1985. var tan = 1.0 / (Math.tan(fov * 0.5));
  1986. var v_fixed = (fovMode === BABYLON.Camera.FOVMODE_VERTICAL_FIXED);
  1987. if (v_fixed) {
  1988. result.m[0] = tan / aspect;
  1989. }
  1990. else {
  1991. result.m[0] = tan;
  1992. }
  1993. result.m[1] = result.m[2] = result.m[3] = 0.0;
  1994. if (v_fixed) {
  1995. result.m[5] = tan;
  1996. }
  1997. else {
  1998. result.m[5] = tan * aspect;
  1999. }
  2000. result.m[4] = result.m[6] = result.m[7] = 0.0;
  2001. result.m[8] = result.m[9] = 0.0;
  2002. result.m[10] = -zfar / (znear - zfar);
  2003. result.m[11] = 1.0;
  2004. result.m[12] = result.m[13] = result.m[15] = 0.0;
  2005. result.m[14] = (znear * zfar) / (znear - zfar);
  2006. };
  2007. Matrix.GetFinalMatrix = function (viewport, world, view, projection, zmin, zmax) {
  2008. var cw = viewport.width;
  2009. var ch = viewport.height;
  2010. var cx = viewport.x;
  2011. var cy = viewport.y;
  2012. var viewportMatrix = Matrix.FromValues(cw / 2.0, 0, 0, 0, 0, -ch / 2.0, 0, 0, 0, 0, zmax - zmin, 0, cx + cw / 2.0, ch / 2.0 + cy, zmin, 1);
  2013. return world.multiply(view).multiply(projection).multiply(viewportMatrix);
  2014. };
  2015. Matrix.GetAsMatrix2x2 = function (matrix) {
  2016. return new Float32Array([
  2017. matrix.m[0], matrix.m[1],
  2018. matrix.m[4], matrix.m[5]
  2019. ]);
  2020. };
  2021. Matrix.GetAsMatrix3x3 = function (matrix) {
  2022. return new Float32Array([
  2023. matrix.m[0], matrix.m[1], matrix.m[2],
  2024. matrix.m[4], matrix.m[5], matrix.m[6],
  2025. matrix.m[8], matrix.m[9], matrix.m[10]
  2026. ]);
  2027. };
  2028. Matrix.Transpose = function (matrix) {
  2029. var result = new Matrix();
  2030. result.m[0] = matrix.m[0];
  2031. result.m[1] = matrix.m[4];
  2032. result.m[2] = matrix.m[8];
  2033. result.m[3] = matrix.m[12];
  2034. result.m[4] = matrix.m[1];
  2035. result.m[5] = matrix.m[5];
  2036. result.m[6] = matrix.m[9];
  2037. result.m[7] = matrix.m[13];
  2038. result.m[8] = matrix.m[2];
  2039. result.m[9] = matrix.m[6];
  2040. result.m[10] = matrix.m[10];
  2041. result.m[11] = matrix.m[14];
  2042. result.m[12] = matrix.m[3];
  2043. result.m[13] = matrix.m[7];
  2044. result.m[14] = matrix.m[11];
  2045. result.m[15] = matrix.m[15];
  2046. return result;
  2047. };
  2048. Matrix.Reflection = function (plane) {
  2049. var matrix = new Matrix();
  2050. Matrix.ReflectionToRef(plane, matrix);
  2051. return matrix;
  2052. };
  2053. Matrix.ReflectionToRef = function (plane, result) {
  2054. plane.normalize();
  2055. var x = plane.normal.x;
  2056. var y = plane.normal.y;
  2057. var z = plane.normal.z;
  2058. var temp = -2 * x;
  2059. var temp2 = -2 * y;
  2060. var temp3 = -2 * z;
  2061. result.m[0] = (temp * x) + 1;
  2062. result.m[1] = temp2 * x;
  2063. result.m[2] = temp3 * x;
  2064. result.m[3] = 0.0;
  2065. result.m[4] = temp * y;
  2066. result.m[5] = (temp2 * y) + 1;
  2067. result.m[6] = temp3 * y;
  2068. result.m[7] = 0.0;
  2069. result.m[8] = temp * z;
  2070. result.m[9] = temp2 * z;
  2071. result.m[10] = (temp3 * z) + 1;
  2072. result.m[11] = 0.0;
  2073. result.m[12] = temp * plane.d;
  2074. result.m[13] = temp2 * plane.d;
  2075. result.m[14] = temp3 * plane.d;
  2076. result.m[15] = 1.0;
  2077. };
  2078. Matrix._tempQuaternion = new Quaternion();
  2079. Matrix._xAxis = Vector3.Zero();
  2080. Matrix._yAxis = Vector3.Zero();
  2081. Matrix._zAxis = Vector3.Zero();
  2082. return Matrix;
  2083. })();
  2084. BABYLON.Matrix = Matrix;
  2085. var Plane = (function () {
  2086. function Plane(a, b, c, d) {
  2087. this.normal = new Vector3(a, b, c);
  2088. this.d = d;
  2089. }
  2090. Plane.prototype.asArray = function () {
  2091. return [this.normal.x, this.normal.y, this.normal.z, this.d];
  2092. };
  2093. // Methods
  2094. Plane.prototype.clone = function () {
  2095. return new Plane(this.normal.x, this.normal.y, this.normal.z, this.d);
  2096. };
  2097. Plane.prototype.normalize = function () {
  2098. var norm = (Math.sqrt((this.normal.x * this.normal.x) + (this.normal.y * this.normal.y) + (this.normal.z * this.normal.z)));
  2099. var magnitude = 0;
  2100. if (norm !== 0) {
  2101. magnitude = 1.0 / norm;
  2102. }
  2103. this.normal.x *= magnitude;
  2104. this.normal.y *= magnitude;
  2105. this.normal.z *= magnitude;
  2106. this.d *= magnitude;
  2107. return this;
  2108. };
  2109. Plane.prototype.transform = function (transformation) {
  2110. var transposedMatrix = Matrix.Transpose(transformation);
  2111. var x = this.normal.x;
  2112. var y = this.normal.y;
  2113. var z = this.normal.z;
  2114. var d = this.d;
  2115. var normalX = (((x * transposedMatrix.m[0]) + (y * transposedMatrix.m[1])) + (z * transposedMatrix.m[2])) + (d * transposedMatrix.m[3]);
  2116. var normalY = (((x * transposedMatrix.m[4]) + (y * transposedMatrix.m[5])) + (z * transposedMatrix.m[6])) + (d * transposedMatrix.m[7]);
  2117. var normalZ = (((x * transposedMatrix.m[8]) + (y * transposedMatrix.m[9])) + (z * transposedMatrix.m[10])) + (d * transposedMatrix.m[11]);
  2118. var finalD = (((x * transposedMatrix.m[12]) + (y * transposedMatrix.m[13])) + (z * transposedMatrix.m[14])) + (d * transposedMatrix.m[15]);
  2119. return new Plane(normalX, normalY, normalZ, finalD);
  2120. };
  2121. Plane.prototype.dotCoordinate = function (point) {
  2122. return ((((this.normal.x * point.x) + (this.normal.y * point.y)) + (this.normal.z * point.z)) + this.d);
  2123. };
  2124. Plane.prototype.copyFromPoints = function (point1, point2, point3) {
  2125. var x1 = point2.x - point1.x;
  2126. var y1 = point2.y - point1.y;
  2127. var z1 = point2.z - point1.z;
  2128. var x2 = point3.x - point1.x;
  2129. var y2 = point3.y - point1.y;
  2130. var z2 = point3.z - point1.z;
  2131. var yz = (y1 * z2) - (z1 * y2);
  2132. var xz = (z1 * x2) - (x1 * z2);
  2133. var xy = (x1 * y2) - (y1 * x2);
  2134. var pyth = (Math.sqrt((yz * yz) + (xz * xz) + (xy * xy)));
  2135. var invPyth;
  2136. if (pyth !== 0) {
  2137. invPyth = 1.0 / pyth;
  2138. }
  2139. else {
  2140. invPyth = 0;
  2141. }
  2142. this.normal.x = yz * invPyth;
  2143. this.normal.y = xz * invPyth;
  2144. this.normal.z = xy * invPyth;
  2145. this.d = -((this.normal.x * point1.x) + (this.normal.y * point1.y) + (this.normal.z * point1.z));
  2146. return this;
  2147. };
  2148. Plane.prototype.isFrontFacingTo = function (direction, epsilon) {
  2149. var dot = Vector3.Dot(this.normal, direction);
  2150. return (dot <= epsilon);
  2151. };
  2152. Plane.prototype.signedDistanceTo = function (point) {
  2153. return Vector3.Dot(point, this.normal) + this.d;
  2154. };
  2155. // Statics
  2156. Plane.FromArray = function (array) {
  2157. return new Plane(array[0], array[1], array[2], array[3]);
  2158. };
  2159. Plane.FromPoints = function (point1, point2, point3) {
  2160. var result = new Plane(0, 0, 0, 0);
  2161. result.copyFromPoints(point1, point2, point3);
  2162. return result;
  2163. };
  2164. Plane.FromPositionAndNormal = function (origin, normal) {
  2165. var result = new Plane(0, 0, 0, 0);
  2166. normal.normalize();
  2167. result.normal = normal;
  2168. result.d = -(normal.x * origin.x + normal.y * origin.y + normal.z * origin.z);
  2169. return result;
  2170. };
  2171. Plane.SignedDistanceToPlaneFromPositionAndNormal = function (origin, normal, point) {
  2172. var d = -(normal.x * origin.x + normal.y * origin.y + normal.z * origin.z);
  2173. return Vector3.Dot(point, normal) + d;
  2174. };
  2175. return Plane;
  2176. })();
  2177. BABYLON.Plane = Plane;
  2178. var Viewport = (function () {
  2179. function Viewport(x, y, width, height) {
  2180. this.x = x;
  2181. this.y = y;
  2182. this.width = width;
  2183. this.height = height;
  2184. }
  2185. Viewport.prototype.toGlobal = function (engine) {
  2186. var width = engine.getRenderWidth();
  2187. var height = engine.getRenderHeight();
  2188. return new Viewport(this.x * width, this.y * height, this.width * width, this.height * height);
  2189. };
  2190. return Viewport;
  2191. })();
  2192. BABYLON.Viewport = Viewport;
  2193. var Frustum = (function () {
  2194. function Frustum() {
  2195. }
  2196. Frustum.GetPlanes = function (transform) {
  2197. var frustumPlanes = [];
  2198. for (var index = 0; index < 6; index++) {
  2199. frustumPlanes.push(new Plane(0, 0, 0, 0));
  2200. }
  2201. Frustum.GetPlanesToRef(transform, frustumPlanes);
  2202. return frustumPlanes;
  2203. };
  2204. Frustum.GetPlanesToRef = function (transform, frustumPlanes) {
  2205. // Near
  2206. frustumPlanes[0].normal.x = transform.m[3] + transform.m[2];
  2207. frustumPlanes[0].normal.y = transform.m[7] + transform.m[6];
  2208. frustumPlanes[0].normal.z = transform.m[11] + transform.m[10];
  2209. frustumPlanes[0].d = transform.m[15] + transform.m[14];
  2210. frustumPlanes[0].normalize();
  2211. // Far
  2212. frustumPlanes[1].normal.x = transform.m[3] - transform.m[2];
  2213. frustumPlanes[1].normal.y = transform.m[7] - transform.m[6];
  2214. frustumPlanes[1].normal.z = transform.m[11] - transform.m[10];
  2215. frustumPlanes[1].d = transform.m[15] - transform.m[14];
  2216. frustumPlanes[1].normalize();
  2217. // Left
  2218. frustumPlanes[2].normal.x = transform.m[3] + transform.m[0];
  2219. frustumPlanes[2].normal.y = transform.m[7] + transform.m[4];
  2220. frustumPlanes[2].normal.z = transform.m[11] + transform.m[8];
  2221. frustumPlanes[2].d = transform.m[15] + transform.m[12];
  2222. frustumPlanes[2].normalize();
  2223. // Right
  2224. frustumPlanes[3].normal.x = transform.m[3] - transform.m[0];
  2225. frustumPlanes[3].normal.y = transform.m[7] - transform.m[4];
  2226. frustumPlanes[3].normal.z = transform.m[11] - transform.m[8];
  2227. frustumPlanes[3].d = transform.m[15] - transform.m[12];
  2228. frustumPlanes[3].normalize();
  2229. // Top
  2230. frustumPlanes[4].normal.x = transform.m[3] - transform.m[1];
  2231. frustumPlanes[4].normal.y = transform.m[7] - transform.m[5];
  2232. frustumPlanes[4].normal.z = transform.m[11] - transform.m[9];
  2233. frustumPlanes[4].d = transform.m[15] - transform.m[13];
  2234. frustumPlanes[4].normalize();
  2235. // Bottom
  2236. frustumPlanes[5].normal.x = transform.m[3] + transform.m[1];
  2237. frustumPlanes[5].normal.y = transform.m[7] + transform.m[5];
  2238. frustumPlanes[5].normal.z = transform.m[11] + transform.m[9];
  2239. frustumPlanes[5].d = transform.m[15] + transform.m[13];
  2240. frustumPlanes[5].normalize();
  2241. };
  2242. return Frustum;
  2243. })();
  2244. BABYLON.Frustum = Frustum;
  2245. var Ray = (function () {
  2246. function Ray(origin, direction, length) {
  2247. if (length === void 0) { length = Number.MAX_VALUE; }
  2248. this.origin = origin;
  2249. this.direction = direction;
  2250. this.length = length;
  2251. }
  2252. // Methods
  2253. Ray.prototype.intersectsBoxMinMax = function (minimum, maximum) {
  2254. var d = 0.0;
  2255. var maxValue = Number.MAX_VALUE;
  2256. var inv;
  2257. var min;
  2258. var max;
  2259. var temp;
  2260. if (Math.abs(this.direction.x) < 0.0000001) {
  2261. if (this.origin.x < minimum.x || this.origin.x > maximum.x) {
  2262. return false;
  2263. }
  2264. }
  2265. else {
  2266. inv = 1.0 / this.direction.x;
  2267. min = (minimum.x - this.origin.x) * inv;
  2268. max = (maximum.x - this.origin.x) * inv;
  2269. if (max === -Infinity) {
  2270. max = Infinity;
  2271. }
  2272. if (min > max) {
  2273. temp = min;
  2274. min = max;
  2275. max = temp;
  2276. }
  2277. d = Math.max(min, d);
  2278. maxValue = Math.min(max, maxValue);
  2279. if (d > maxValue) {
  2280. return false;
  2281. }
  2282. }
  2283. if (Math.abs(this.direction.y) < 0.0000001) {
  2284. if (this.origin.y < minimum.y || this.origin.y > maximum.y) {
  2285. return false;
  2286. }
  2287. }
  2288. else {
  2289. inv = 1.0 / this.direction.y;
  2290. min = (minimum.y - this.origin.y) * inv;
  2291. max = (maximum.y - this.origin.y) * inv;
  2292. if (max === -Infinity) {
  2293. max = Infinity;
  2294. }
  2295. if (min > max) {
  2296. temp = min;
  2297. min = max;
  2298. max = temp;
  2299. }
  2300. d = Math.max(min, d);
  2301. maxValue = Math.min(max, maxValue);
  2302. if (d > maxValue) {
  2303. return false;
  2304. }
  2305. }
  2306. if (Math.abs(this.direction.z) < 0.0000001) {
  2307. if (this.origin.z < minimum.z || this.origin.z > maximum.z) {
  2308. return false;
  2309. }
  2310. }
  2311. else {
  2312. inv = 1.0 / this.direction.z;
  2313. min = (minimum.z - this.origin.z) * inv;
  2314. max = (maximum.z - this.origin.z) * inv;
  2315. if (max === -Infinity) {
  2316. max = Infinity;
  2317. }
  2318. if (min > max) {
  2319. temp = min;
  2320. min = max;
  2321. max = temp;
  2322. }
  2323. d = Math.max(min, d);
  2324. maxValue = Math.min(max, maxValue);
  2325. if (d > maxValue) {
  2326. return false;
  2327. }
  2328. }
  2329. return true;
  2330. };
  2331. Ray.prototype.intersectsBox = function (box) {
  2332. return this.intersectsBoxMinMax(box.minimum, box.maximum);
  2333. };
  2334. Ray.prototype.intersectsSphere = function (sphere) {
  2335. var x = sphere.center.x - this.origin.x;
  2336. var y = sphere.center.y - this.origin.y;
  2337. var z = sphere.center.z - this.origin.z;
  2338. var pyth = (x * x) + (y * y) + (z * z);
  2339. var rr = sphere.radius * sphere.radius;
  2340. if (pyth <= rr) {
  2341. return true;
  2342. }
  2343. var dot = (x * this.direction.x) + (y * this.direction.y) + (z * this.direction.z);
  2344. if (dot < 0.0) {
  2345. return false;
  2346. }
  2347. var temp = pyth - (dot * dot);
  2348. return temp <= rr;
  2349. };
  2350. Ray.prototype.intersectsTriangle = function (vertex0, vertex1, vertex2) {
  2351. if (!this._edge1) {
  2352. this._edge1 = Vector3.Zero();
  2353. this._edge2 = Vector3.Zero();
  2354. this._pvec = Vector3.Zero();
  2355. this._tvec = Vector3.Zero();
  2356. this._qvec = Vector3.Zero();
  2357. }
  2358. vertex1.subtractToRef(vertex0, this._edge1);
  2359. vertex2.subtractToRef(vertex0, this._edge2);
  2360. Vector3.CrossToRef(this.direction, this._edge2, this._pvec);
  2361. var det = Vector3.Dot(this._edge1, this._pvec);
  2362. if (det === 0) {
  2363. return null;
  2364. }
  2365. var invdet = 1 / det;
  2366. this.origin.subtractToRef(vertex0, this._tvec);
  2367. var bu = Vector3.Dot(this._tvec, this._pvec) * invdet;
  2368. if (bu < 0 || bu > 1.0) {
  2369. return null;
  2370. }
  2371. Vector3.CrossToRef(this._tvec, this._edge1, this._qvec);
  2372. var bv = Vector3.Dot(this.direction, this._qvec) * invdet;
  2373. if (bv < 0 || bu + bv > 1.0) {
  2374. return null;
  2375. }
  2376. //check if the distance is longer than the predefined length.
  2377. var distance = Vector3.Dot(this._edge2, this._qvec) * invdet;
  2378. if (distance > this.length) {
  2379. return null;
  2380. }
  2381. return new BABYLON.IntersectionInfo(bu, bv, distance);
  2382. };
  2383. // Statics
  2384. Ray.CreateNew = function (x, y, viewportWidth, viewportHeight, world, view, projection) {
  2385. var start = Vector3.Unproject(new Vector3(x, y, 0), viewportWidth, viewportHeight, world, view, projection);
  2386. var end = Vector3.Unproject(new Vector3(x, y, 1), viewportWidth, viewportHeight, world, view, projection);
  2387. var direction = end.subtract(start);
  2388. direction.normalize();
  2389. return new Ray(start, direction);
  2390. };
  2391. /**
  2392. * Function will create a new transformed ray starting from origin and ending at the end point. Ray's length will be set, and ray will be
  2393. * transformed to the given world matrix.
  2394. * @param origin The origin point
  2395. * @param end The end point
  2396. * @param world a matrix to transform the ray to. Default is the identity matrix.
  2397. */
  2398. Ray.CreateNewFromTo = function (origin, end, world) {
  2399. if (world === void 0) { world = Matrix.Identity(); }
  2400. var direction = end.subtract(origin);
  2401. var length = Math.sqrt((direction.x * direction.x) + (direction.y * direction.y) + (direction.z * direction.z));
  2402. direction.normalize();
  2403. return Ray.Transform(new Ray(origin, direction, length), world);
  2404. };
  2405. Ray.Transform = function (ray, matrix) {
  2406. var newOrigin = Vector3.TransformCoordinates(ray.origin, matrix);
  2407. var newDirection = Vector3.TransformNormal(ray.direction, matrix);
  2408. return new Ray(newOrigin, newDirection, ray.length);
  2409. };
  2410. return Ray;
  2411. })();
  2412. BABYLON.Ray = Ray;
  2413. (function (Space) {
  2414. Space[Space["LOCAL"] = 0] = "LOCAL";
  2415. Space[Space["WORLD"] = 1] = "WORLD";
  2416. })(BABYLON.Space || (BABYLON.Space = {}));
  2417. var Space = BABYLON.Space;
  2418. var Axis = (function () {
  2419. function Axis() {
  2420. }
  2421. Axis.X = new Vector3(1, 0, 0);
  2422. Axis.Y = new Vector3(0, 1, 0);
  2423. Axis.Z = new Vector3(0, 0, 1);
  2424. return Axis;
  2425. })();
  2426. BABYLON.Axis = Axis;
  2427. ;
  2428. var BezierCurve = (function () {
  2429. function BezierCurve() {
  2430. }
  2431. BezierCurve.interpolate = function (t, x1, y1, x2, y2) {
  2432. // Extract X (which is equal to time here)
  2433. var f0 = 1 - 3 * x2 + 3 * x1;
  2434. var f1 = 3 * x2 - 6 * x1;
  2435. var f2 = 3 * x1;
  2436. var refinedT = t;
  2437. for (var i = 0; i < 5; i++) {
  2438. var refinedT2 = refinedT * refinedT;
  2439. var refinedT3 = refinedT2 * refinedT;
  2440. var x = f0 * refinedT3 + f1 * refinedT2 + f2 * refinedT;
  2441. var slope = 1.0 / (3.0 * f0 * refinedT2 + 2.0 * f1 * refinedT + f2);
  2442. refinedT -= (x - t) * slope;
  2443. refinedT = Math.min(1, Math.max(0, refinedT));
  2444. }
  2445. // Resolve cubic bezier for the given x
  2446. return 3 * Math.pow(1 - refinedT, 2) * refinedT * y1 +
  2447. 3 * (1 - refinedT) * Math.pow(refinedT, 2) * y2 +
  2448. Math.pow(refinedT, 3);
  2449. };
  2450. return BezierCurve;
  2451. })();
  2452. BABYLON.BezierCurve = BezierCurve;
  2453. (function (Orientation) {
  2454. Orientation[Orientation["CW"] = 0] = "CW";
  2455. Orientation[Orientation["CCW"] = 1] = "CCW";
  2456. })(BABYLON.Orientation || (BABYLON.Orientation = {}));
  2457. var Orientation = BABYLON.Orientation;
  2458. var Angle = (function () {
  2459. function Angle(radians) {
  2460. var _this = this;
  2461. this.degrees = function () { return _this._radians * 180 / Math.PI; };
  2462. this.radians = function () { return _this._radians; };
  2463. this._radians = radians;
  2464. if (this._radians < 0)
  2465. this._radians += (2 * Math.PI);
  2466. }
  2467. Angle.BetweenTwoPoints = function (a, b) {
  2468. var delta = b.subtract(a);
  2469. var theta = Math.atan2(delta.y, delta.x);
  2470. return new Angle(theta);
  2471. };
  2472. Angle.FromRadians = function (radians) {
  2473. return new Angle(radians);
  2474. };
  2475. Angle.FromDegrees = function (degrees) {
  2476. return new Angle(degrees * Math.PI / 180);
  2477. };
  2478. return Angle;
  2479. })();
  2480. BABYLON.Angle = Angle;
  2481. var Arc2 = (function () {
  2482. function Arc2(startPoint, midPoint, endPoint) {
  2483. this.startPoint = startPoint;
  2484. this.midPoint = midPoint;
  2485. this.endPoint = endPoint;
  2486. var temp = Math.pow(midPoint.x, 2) + Math.pow(midPoint.y, 2);
  2487. var startToMid = (Math.pow(startPoint.x, 2) + Math.pow(startPoint.y, 2) - temp) / 2.;
  2488. var midToEnd = (temp - Math.pow(endPoint.x, 2) - Math.pow(endPoint.y, 2)) / 2.;
  2489. var det = (startPoint.x - midPoint.x) * (midPoint.y - endPoint.y) - (midPoint.x - endPoint.x) * (startPoint.y - midPoint.y);
  2490. this.centerPoint = new Vector2((startToMid * (midPoint.y - endPoint.y) - midToEnd * (startPoint.y - midPoint.y)) / det, ((startPoint.x - midPoint.x) * midToEnd - (midPoint.x - endPoint.x) * startToMid) / det);
  2491. this.radius = this.centerPoint.subtract(this.startPoint).length();
  2492. this.startAngle = Angle.BetweenTwoPoints(this.centerPoint, this.startPoint);
  2493. var a1 = this.startAngle.degrees();
  2494. var a2 = Angle.BetweenTwoPoints(this.centerPoint, this.midPoint).degrees();
  2495. var a3 = Angle.BetweenTwoPoints(this.centerPoint, this.endPoint).degrees();
  2496. // angles correction
  2497. if (a2 - a1 > +180.0)
  2498. a2 -= 360.0;
  2499. if (a2 - a1 < -180.0)
  2500. a2 += 360.0;
  2501. if (a3 - a2 > +180.0)
  2502. a3 -= 360.0;
  2503. if (a3 - a2 < -180.0)
  2504. a3 += 360.0;
  2505. this.orientation = (a2 - a1) < 0 ? Orientation.CW : Orientation.CCW;
  2506. this.angle = Angle.FromDegrees(this.orientation === Orientation.CW ? a1 - a3 : a3 - a1);
  2507. }
  2508. return Arc2;
  2509. })();
  2510. BABYLON.Arc2 = Arc2;
  2511. var PathCursor = (function () {
  2512. function PathCursor(path) {
  2513. this.path = path;
  2514. this._onchange = new Array();
  2515. this.value = 0;
  2516. this.animations = new Array();
  2517. }
  2518. PathCursor.prototype.getPoint = function () {
  2519. var point = this.path.getPointAtLengthPosition(this.value);
  2520. return new Vector3(point.x, 0, point.y);
  2521. };
  2522. PathCursor.prototype.moveAhead = function (step) {
  2523. if (step === void 0) { step = 0.002; }
  2524. this.move(step);
  2525. return this;
  2526. };
  2527. PathCursor.prototype.moveBack = function (step) {
  2528. if (step === void 0) { step = 0.002; }
  2529. this.move(-step);
  2530. return this;
  2531. };
  2532. PathCursor.prototype.move = function (step) {
  2533. if (Math.abs(step) > 1) {
  2534. throw "step size should be less than 1.";
  2535. }
  2536. this.value += step;
  2537. this.ensureLimits();
  2538. this.raiseOnChange();
  2539. return this;
  2540. };
  2541. PathCursor.prototype.ensureLimits = function () {
  2542. while (this.value > 1) {
  2543. this.value -= 1;
  2544. }
  2545. while (this.value < 0) {
  2546. this.value += 1;
  2547. }
  2548. return this;
  2549. };
  2550. // used by animation engine
  2551. PathCursor.prototype.markAsDirty = function (propertyName) {
  2552. this.ensureLimits();
  2553. this.raiseOnChange();
  2554. return this;
  2555. };
  2556. PathCursor.prototype.raiseOnChange = function () {
  2557. var _this = this;
  2558. this._onchange.forEach(function (f) { return f(_this); });
  2559. return this;
  2560. };
  2561. PathCursor.prototype.onchange = function (f) {
  2562. this._onchange.push(f);
  2563. return this;
  2564. };
  2565. return PathCursor;
  2566. })();
  2567. BABYLON.PathCursor = PathCursor;
  2568. var Path2 = (function () {
  2569. function Path2(x, y) {
  2570. this._points = new Array();
  2571. this._length = 0;
  2572. this.closed = false;
  2573. this._points.push(new Vector2(x, y));
  2574. }
  2575. Path2.prototype.addLineTo = function (x, y) {
  2576. if (closed) {
  2577. BABYLON.Tools.Error("cannot add lines to closed paths");
  2578. return this;
  2579. }
  2580. var newPoint = new Vector2(x, y);
  2581. var previousPoint = this._points[this._points.length - 1];
  2582. this._points.push(newPoint);
  2583. this._length += newPoint.subtract(previousPoint).length();
  2584. return this;
  2585. };
  2586. Path2.prototype.addArcTo = function (midX, midY, endX, endY, numberOfSegments) {
  2587. if (numberOfSegments === void 0) { numberOfSegments = 36; }
  2588. if (closed) {
  2589. BABYLON.Tools.Error("cannot add arcs to closed paths");
  2590. return this;
  2591. }
  2592. var startPoint = this._points[this._points.length - 1];
  2593. var midPoint = new Vector2(midX, midY);
  2594. var endPoint = new Vector2(endX, endY);
  2595. var arc = new Arc2(startPoint, midPoint, endPoint);
  2596. var increment = arc.angle.radians() / numberOfSegments;
  2597. if (arc.orientation === Orientation.CW)
  2598. increment *= -1;
  2599. var currentAngle = arc.startAngle.radians() + increment;
  2600. for (var i = 0; i < numberOfSegments; i++) {
  2601. var x = Math.cos(currentAngle) * arc.radius + arc.centerPoint.x;
  2602. var y = Math.sin(currentAngle) * arc.radius + arc.centerPoint.y;
  2603. this.addLineTo(x, y);
  2604. currentAngle += increment;
  2605. }
  2606. return this;
  2607. };
  2608. Path2.prototype.close = function () {
  2609. this.closed = true;
  2610. return this;
  2611. };
  2612. Path2.prototype.length = function () {
  2613. var result = this._length;
  2614. if (!this.closed) {
  2615. var lastPoint = this._points[this._points.length - 1];
  2616. var firstPoint = this._points[0];
  2617. result += (firstPoint.subtract(lastPoint).length());
  2618. }
  2619. return result;
  2620. };
  2621. Path2.prototype.getPoints = function () {
  2622. return this._points;
  2623. };
  2624. Path2.prototype.getPointAtLengthPosition = function (normalizedLengthPosition) {
  2625. if (normalizedLengthPosition < 0 || normalizedLengthPosition > 1) {
  2626. BABYLON.Tools.Error("normalized length position should be between 0 and 1.");
  2627. return Vector2.Zero();
  2628. }
  2629. var lengthPosition = normalizedLengthPosition * this.length();
  2630. var previousOffset = 0;
  2631. for (var i = 0; i < this._points.length; i++) {
  2632. var j = (i + 1) % this._points.length;
  2633. var a = this._points[i];
  2634. var b = this._points[j];
  2635. var bToA = b.subtract(a);
  2636. var nextOffset = (bToA.length() + previousOffset);
  2637. if (lengthPosition >= previousOffset && lengthPosition <= nextOffset) {
  2638. var dir = bToA.normalize();
  2639. var localOffset = lengthPosition - previousOffset;
  2640. return new Vector2(a.x + (dir.x * localOffset), a.y + (dir.y * localOffset));
  2641. }
  2642. previousOffset = nextOffset;
  2643. }
  2644. BABYLON.Tools.Error("internal error");
  2645. return Vector2.Zero();
  2646. };
  2647. Path2.StartingAt = function (x, y) {
  2648. return new Path2(x, y);
  2649. };
  2650. return Path2;
  2651. })();
  2652. BABYLON.Path2 = Path2;
  2653. var Path3D = (function () {
  2654. /**
  2655. * new Path3D(path, normal, raw)
  2656. * path : an array of Vector3, the curve axis of the Path3D
  2657. * normal (optional) : Vector3, the first wanted normal to the curve. Ex (0, 1, 0) for a vertical normal.
  2658. * raw (optional, default false) : boolean, if true the returned Path3D isn't normalized. Useful to depict path acceleration or speed.
  2659. */
  2660. function Path3D(path, firstNormal, raw) {
  2661. this.path = path;
  2662. this._curve = new Array();
  2663. this._distances = new Array();
  2664. this._tangents = new Array();
  2665. this._normals = new Array();
  2666. this._binormals = new Array();
  2667. for (var p = 0; p < path.length; p++) {
  2668. this._curve[p] = path[p].clone(); // hard copy
  2669. }
  2670. this._raw = raw || false;
  2671. this._compute(firstNormal);
  2672. }
  2673. Path3D.prototype.getCurve = function () {
  2674. return this._curve;
  2675. };
  2676. Path3D.prototype.getTangents = function () {
  2677. return this._tangents;
  2678. };
  2679. Path3D.prototype.getNormals = function () {
  2680. return this._normals;
  2681. };
  2682. Path3D.prototype.getBinormals = function () {
  2683. return this._binormals;
  2684. };
  2685. Path3D.prototype.getDistances = function () {
  2686. return this._distances;
  2687. };
  2688. Path3D.prototype.update = function (path, firstNormal) {
  2689. for (var p = 0; p < path.length; p++) {
  2690. this._curve[p].x = path[p].x;
  2691. this._curve[p].y = path[p].y;
  2692. this._curve[p].z = path[p].z;
  2693. }
  2694. this._compute(firstNormal);
  2695. return this;
  2696. };
  2697. // private function compute() : computes tangents, normals and binormals
  2698. Path3D.prototype._compute = function (firstNormal) {
  2699. var l = this._curve.length;
  2700. // first and last tangents
  2701. this._tangents[0] = this._getFirstNonNullVector(0);
  2702. if (!this._raw) {
  2703. this._tangents[0].normalize();
  2704. }
  2705. this._tangents[l - 1] = this._curve[l - 1].subtract(this._curve[l - 2]);
  2706. if (!this._raw) {
  2707. this._tangents[l - 1].normalize();
  2708. }
  2709. // normals and binormals at first point : arbitrary vector with _normalVector()
  2710. var tg0 = this._tangents[0];
  2711. var pp0 = this._normalVector(this._curve[0], tg0, firstNormal);
  2712. this._normals[0] = pp0;
  2713. if (!this._raw) {
  2714. this._normals[0].normalize();
  2715. }
  2716. this._binormals[0] = Vector3.Cross(tg0, this._normals[0]);
  2717. if (!this._raw) {
  2718. this._binormals[0].normalize();
  2719. }
  2720. this._distances[0] = 0;
  2721. // normals and binormals : next points
  2722. var prev; // previous vector (segment)
  2723. var cur; // current vector (segment)
  2724. var curTang; // current tangent
  2725. // previous normal
  2726. var prevBinor; // previous binormal
  2727. for (var i = 1; i < l; i++) {
  2728. // tangents
  2729. prev = this._getLastNonNullVector(i);
  2730. if (i < l - 1) {
  2731. cur = this._getFirstNonNullVector(i);
  2732. this._tangents[i] = prev.add(cur);
  2733. this._tangents[i].normalize();
  2734. }
  2735. this._distances[i] = this._distances[i - 1] + prev.length();
  2736. // normals and binormals
  2737. // http://www.cs.cmu.edu/afs/andrew/scs/cs/15-462/web/old/asst2camera.html
  2738. curTang = this._tangents[i];
  2739. prevBinor = this._binormals[i - 1];
  2740. this._normals[i] = Vector3.Cross(prevBinor, curTang);
  2741. if (!this._raw) {
  2742. this._normals[i].normalize();
  2743. }
  2744. this._binormals[i] = Vector3.Cross(curTang, this._normals[i]);
  2745. if (!this._raw) {
  2746. this._binormals[i].normalize();
  2747. }
  2748. }
  2749. };
  2750. // private function getFirstNonNullVector(index)
  2751. // returns the first non null vector from index : curve[index + N].subtract(curve[index])
  2752. Path3D.prototype._getFirstNonNullVector = function (index) {
  2753. var i = 1;
  2754. var nNVector = this._curve[index + i].subtract(this._curve[index]);
  2755. while (nNVector.length() === 0 && index + i + 1 < this._curve.length) {
  2756. i++;
  2757. nNVector = this._curve[index + i].subtract(this._curve[index]);
  2758. }
  2759. return nNVector;
  2760. };
  2761. // private function getLastNonNullVector(index)
  2762. // returns the last non null vector from index : curve[index].subtract(curve[index - N])
  2763. Path3D.prototype._getLastNonNullVector = function (index) {
  2764. var i = 1;
  2765. var nLVector = this._curve[index].subtract(this._curve[index - i]);
  2766. while (nLVector.length() === 0 && index > i + 1) {
  2767. i++;
  2768. nLVector = this._curve[index].subtract(this._curve[index - i]);
  2769. }
  2770. return nLVector;
  2771. };
  2772. // private function normalVector(v0, vt, va) :
  2773. // returns an arbitrary point in the plane defined by the point v0 and the vector vt orthogonal to this plane
  2774. // if va is passed, it returns the va projection on the plane orthogonal to vt at the point v0
  2775. Path3D.prototype._normalVector = function (v0, vt, va) {
  2776. var normal0;
  2777. if (va === undefined || va === null) {
  2778. var point;
  2779. if (!BABYLON.Tools.WithinEpsilon(vt.y, 1, BABYLON.Engine.Epsilon)) {
  2780. point = new Vector3(0, -1, 0);
  2781. }
  2782. else if (!BABYLON.Tools.WithinEpsilon(vt.x, 1, BABYLON.Engine.Epsilon)) {
  2783. point = new Vector3(1, 0, 0);
  2784. }
  2785. else if (!BABYLON.Tools.WithinEpsilon(vt.z, 1, BABYLON.Engine.Epsilon)) {
  2786. point = new Vector3(0, 0, 1);
  2787. }
  2788. normal0 = Vector3.Cross(vt, point);
  2789. }
  2790. else {
  2791. normal0 = Vector3.Cross(vt, va);
  2792. Vector3.CrossToRef(normal0, vt, normal0);
  2793. }
  2794. normal0.normalize();
  2795. return normal0;
  2796. };
  2797. return Path3D;
  2798. })();
  2799. BABYLON.Path3D = Path3D;
  2800. var Curve3 = (function () {
  2801. function Curve3(points) {
  2802. this._length = 0;
  2803. this._points = points;
  2804. this._length = this._computeLength(points);
  2805. }
  2806. // QuadraticBezier(origin_V3, control_V3, destination_V3, nbPoints)
  2807. Curve3.CreateQuadraticBezier = function (v0, v1, v2, nbPoints) {
  2808. nbPoints = nbPoints > 2 ? nbPoints : 3;
  2809. var bez = new Array();
  2810. var equation = function (t, val0, val1, val2) {
  2811. var res = (1 - t) * (1 - t) * val0 + 2 * t * (1 - t) * val1 + t * t * val2;
  2812. return res;
  2813. };
  2814. for (var i = 0; i <= nbPoints; i++) {
  2815. bez.push(new Vector3(equation(i / nbPoints, v0.x, v1.x, v2.x), equation(i / nbPoints, v0.y, v1.y, v2.y), equation(i / nbPoints, v0.z, v1.z, v2.z)));
  2816. }
  2817. return new Curve3(bez);
  2818. };
  2819. // CubicBezier(origin_V3, control1_V3, control2_V3, destination_V3, nbPoints)
  2820. Curve3.CreateCubicBezier = function (v0, v1, v2, v3, nbPoints) {
  2821. nbPoints = nbPoints > 3 ? nbPoints : 4;
  2822. var bez = new Array();
  2823. var equation = function (t, val0, val1, val2, val3) {
  2824. var res = (1 - t) * (1 - t) * (1 - t) * val0 + 3 * t * (1 - t) * (1 - t) * val1 + 3 * t * t * (1 - t) * val2 + t * t * t * val3;
  2825. return res;
  2826. };
  2827. for (var i = 0; i <= nbPoints; i++) {
  2828. bez.push(new Vector3(equation(i / nbPoints, v0.x, v1.x, v2.x, v3.x), equation(i / nbPoints, v0.y, v1.y, v2.y, v3.y), equation(i / nbPoints, v0.z, v1.z, v2.z, v3.z)));
  2829. }
  2830. return new Curve3(bez);
  2831. };
  2832. // HermiteSpline(origin_V3, originTangent_V3, destination_V3, destinationTangent_V3, nbPoints)
  2833. Curve3.CreateHermiteSpline = function (p1, t1, p2, t2, nbPoints) {
  2834. var hermite = new Array();
  2835. var step = 1 / nbPoints;
  2836. for (var i = 0; i <= nbPoints; i++) {
  2837. hermite.push(Vector3.Hermite(p1, t1, p2, t2, i * step));
  2838. }
  2839. return new Curve3(hermite);
  2840. };
  2841. Curve3.prototype.getPoints = function () {
  2842. return this._points;
  2843. };
  2844. Curve3.prototype.length = function () {
  2845. return this._length;
  2846. };
  2847. Curve3.prototype.continue = function (curve) {
  2848. var lastPoint = this._points[this._points.length - 1];
  2849. var continuedPoints = this._points.slice();
  2850. var curvePoints = curve.getPoints();
  2851. for (var i = 1; i < curvePoints.length; i++) {
  2852. continuedPoints.push(curvePoints[i].subtract(curvePoints[0]).add(lastPoint));
  2853. }
  2854. var continuedCurve = new Curve3(continuedPoints);
  2855. return continuedCurve;
  2856. };
  2857. Curve3.prototype._computeLength = function (path) {
  2858. var l = 0;
  2859. for (var i = 1; i < path.length; i++) {
  2860. l += (path[i].subtract(path[i - 1])).length();
  2861. }
  2862. return l;
  2863. };
  2864. return Curve3;
  2865. })();
  2866. BABYLON.Curve3 = Curve3;
  2867. // Vertex formats
  2868. var PositionNormalVertex = (function () {
  2869. function PositionNormalVertex(position, normal) {
  2870. if (position === void 0) { position = Vector3.Zero(); }
  2871. if (normal === void 0) { normal = Vector3.Up(); }
  2872. this.position = position;
  2873. this.normal = normal;
  2874. }
  2875. PositionNormalVertex.prototype.clone = function () {
  2876. return new PositionNormalVertex(this.position.clone(), this.normal.clone());
  2877. };
  2878. return PositionNormalVertex;
  2879. })();
  2880. BABYLON.PositionNormalVertex = PositionNormalVertex;
  2881. var PositionNormalTextureVertex = (function () {
  2882. function PositionNormalTextureVertex(position, normal, uv) {
  2883. if (position === void 0) { position = Vector3.Zero(); }
  2884. if (normal === void 0) { normal = Vector3.Up(); }
  2885. if (uv === void 0) { uv = Vector2.Zero(); }
  2886. this.position = position;
  2887. this.normal = normal;
  2888. this.uv = uv;
  2889. }
  2890. PositionNormalTextureVertex.prototype.clone = function () {
  2891. return new PositionNormalTextureVertex(this.position.clone(), this.normal.clone(), this.uv.clone());
  2892. };
  2893. return PositionNormalTextureVertex;
  2894. })();
  2895. BABYLON.PositionNormalTextureVertex = PositionNormalTextureVertex;
  2896. })(BABYLON || (BABYLON = {}));
  2897. var BABYLON;
  2898. (function (BABYLON) {
  2899. var Database = (function () {
  2900. function Database(urlToScene, callbackManifestChecked) {
  2901. // Handling various flavors of prefixed version of IndexedDB
  2902. this.idbFactory = (window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB);
  2903. this.callbackManifestChecked = callbackManifestChecked;
  2904. this.currentSceneUrl = Database.ReturnFullUrlLocation(urlToScene);
  2905. this.db = null;
  2906. this.enableSceneOffline = false;
  2907. this.enableTexturesOffline = false;
  2908. this.manifestVersionFound = 0;
  2909. this.mustUpdateRessources = false;
  2910. this.hasReachedQuota = false;
  2911. if (!Database.IDBStorageEnabled) {
  2912. this.callbackManifestChecked(true);
  2913. }
  2914. else {
  2915. this.checkManifestFile();
  2916. }
  2917. }
  2918. Database.prototype.checkManifestFile = function () {
  2919. var _this = this;
  2920. function noManifestFile() {
  2921. that.enableSceneOffline = false;
  2922. that.enableTexturesOffline = false;
  2923. that.callbackManifestChecked(false);
  2924. }
  2925. var that = this;
  2926. var manifestURL = this.currentSceneUrl + ".manifest";
  2927. var xhr = new XMLHttpRequest();
  2928. var manifestURLTimeStamped = manifestURL + (manifestURL.match(/\?/) == null ? "?" : "&") + (new Date()).getTime();
  2929. xhr.open("GET", manifestURLTimeStamped, true);
  2930. xhr.addEventListener("load", function () {
  2931. if (xhr.status === 200 || BABYLON.Tools.ValidateXHRData(xhr, 1)) {
  2932. try {
  2933. var manifestFile = JSON.parse(xhr.response);
  2934. _this.enableSceneOffline = manifestFile.enableSceneOffline;
  2935. _this.enableTexturesOffline = manifestFile.enableTexturesOffline;
  2936. if (manifestFile.version && !isNaN(parseInt(manifestFile.version))) {
  2937. _this.manifestVersionFound = manifestFile.version;
  2938. }
  2939. if (_this.callbackManifestChecked) {
  2940. _this.callbackManifestChecked(true);
  2941. }
  2942. }
  2943. catch (ex) {
  2944. noManifestFile();
  2945. }
  2946. }
  2947. else {
  2948. noManifestFile();
  2949. }
  2950. }, false);
  2951. xhr.addEventListener("error", function (event) {
  2952. noManifestFile();
  2953. }, false);
  2954. try {
  2955. xhr.send();
  2956. }
  2957. catch (ex) {
  2958. BABYLON.Tools.Error("Error on XHR send request.");
  2959. that.callbackManifestChecked(false);
  2960. }
  2961. };
  2962. Database.prototype.openAsync = function (successCallback, errorCallback) {
  2963. var _this = this;
  2964. function handleError() {
  2965. that.isSupported = false;
  2966. if (errorCallback)
  2967. errorCallback();
  2968. }
  2969. var that = this;
  2970. if (!this.idbFactory || !(this.enableSceneOffline || this.enableTexturesOffline)) {
  2971. // Your browser doesn't support IndexedDB
  2972. this.isSupported = false;
  2973. if (errorCallback)
  2974. errorCallback();
  2975. }
  2976. else {
  2977. // If the DB hasn't been opened or created yet
  2978. if (!this.db) {
  2979. this.hasReachedQuota = false;
  2980. this.isSupported = true;
  2981. var request = this.idbFactory.open("babylonjs", 1);
  2982. // Could occur if user is blocking the quota for the DB and/or doesn't grant access to IndexedDB
  2983. request.onerror = function (event) {
  2984. handleError();
  2985. };
  2986. // executes when a version change transaction cannot complete due to other active transactions
  2987. request.onblocked = function (event) {
  2988. BABYLON.Tools.Error("IDB request blocked. Please reload the page.");
  2989. handleError();
  2990. };
  2991. // DB has been opened successfully
  2992. request.onsuccess = function (event) {
  2993. _this.db = request.result;
  2994. successCallback();
  2995. };
  2996. // Initialization of the DB. Creating Scenes & Textures stores
  2997. request.onupgradeneeded = function (event) {
  2998. _this.db = (event.target).result;
  2999. try {
  3000. var scenesStore = _this.db.createObjectStore("scenes", { keyPath: "sceneUrl" });
  3001. var versionsStore = _this.db.createObjectStore("versions", { keyPath: "sceneUrl" });
  3002. var texturesStore = _this.db.createObjectStore("textures", { keyPath: "textureUrl" });
  3003. }
  3004. catch (ex) {
  3005. BABYLON.Tools.Error("Error while creating object stores. Exception: " + ex.message);
  3006. handleError();
  3007. }
  3008. };
  3009. }
  3010. else {
  3011. if (successCallback)
  3012. successCallback();
  3013. }
  3014. }
  3015. };
  3016. Database.prototype.loadImageFromDB = function (url, image) {
  3017. var _this = this;
  3018. var completeURL = Database.ReturnFullUrlLocation(url);
  3019. var saveAndLoadImage = function () {
  3020. if (!_this.hasReachedQuota && _this.db !== null) {
  3021. // the texture is not yet in the DB, let's try to save it
  3022. _this._saveImageIntoDBAsync(completeURL, image);
  3023. }
  3024. else {
  3025. image.src = url;
  3026. }
  3027. };
  3028. if (!this.mustUpdateRessources) {
  3029. this._loadImageFromDBAsync(completeURL, image, saveAndLoadImage);
  3030. }
  3031. else {
  3032. saveAndLoadImage();
  3033. }
  3034. };
  3035. Database.prototype._loadImageFromDBAsync = function (url, image, notInDBCallback) {
  3036. if (this.isSupported && this.db !== null) {
  3037. var texture;
  3038. var transaction = this.db.transaction(["textures"]);
  3039. transaction.onabort = function (event) {
  3040. image.src = url;
  3041. };
  3042. transaction.oncomplete = function (event) {
  3043. var blobTextureURL;
  3044. if (texture) {
  3045. var URL = window.URL || window.webkitURL;
  3046. blobTextureURL = URL.createObjectURL(texture.data, { oneTimeOnly: true });
  3047. image.onerror = function () {
  3048. BABYLON.Tools.Error("Error loading image from blob URL: " + blobTextureURL + " switching back to web url: " + url);
  3049. image.src = url;
  3050. };
  3051. image.src = blobTextureURL;
  3052. }
  3053. else {
  3054. notInDBCallback();
  3055. }
  3056. };
  3057. var getRequest = transaction.objectStore("textures").get(url);
  3058. getRequest.onsuccess = function (event) {
  3059. texture = (event.target).result;
  3060. };
  3061. getRequest.onerror = function (event) {
  3062. BABYLON.Tools.Error("Error loading texture " + url + " from DB.");
  3063. image.src = url;
  3064. };
  3065. }
  3066. else {
  3067. BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open.");
  3068. image.src = url;
  3069. }
  3070. };
  3071. Database.prototype._saveImageIntoDBAsync = function (url, image) {
  3072. var _this = this;
  3073. if (this.isSupported) {
  3074. // In case of error (type not supported or quota exceeded), we're at least sending back XHR data to allow texture loading later on
  3075. var generateBlobUrl = function () {
  3076. var blobTextureURL;
  3077. if (blob) {
  3078. var URL = window.URL || window.webkitURL;
  3079. try {
  3080. blobTextureURL = URL.createObjectURL(blob, { oneTimeOnly: true });
  3081. }
  3082. // Chrome is raising a type error if we're setting the oneTimeOnly parameter
  3083. catch (ex) {
  3084. blobTextureURL = URL.createObjectURL(blob);
  3085. }
  3086. }
  3087. image.src = blobTextureURL;
  3088. };
  3089. if (Database.IsUASupportingBlobStorage) {
  3090. var xhr = new XMLHttpRequest(), blob;
  3091. xhr.open("GET", url, true);
  3092. xhr.responseType = "blob";
  3093. xhr.addEventListener("load", function () {
  3094. if (xhr.status === 200) {
  3095. // Blob as response (XHR2)
  3096. blob = xhr.response;
  3097. var transaction = _this.db.transaction(["textures"], "readwrite");
  3098. // the transaction could abort because of a QuotaExceededError error
  3099. transaction.onabort = function (event) {
  3100. try {
  3101. //backwards compatibility with ts 1.0, srcElement doesn't have an "error" according to ts 1.3
  3102. if (event.srcElement['error'] && event.srcElement['error'].name === "QuotaExceededError") {
  3103. this.hasReachedQuota = true;
  3104. }
  3105. }
  3106. catch (ex) { }
  3107. generateBlobUrl();
  3108. };
  3109. transaction.oncomplete = function (event) {
  3110. generateBlobUrl();
  3111. };
  3112. var newTexture = { textureUrl: url, data: blob };
  3113. try {
  3114. // Put the blob into the dabase
  3115. var addRequest = transaction.objectStore("textures").put(newTexture);
  3116. addRequest.onsuccess = function (event) {
  3117. };
  3118. addRequest.onerror = function (event) {
  3119. generateBlobUrl();
  3120. };
  3121. }
  3122. catch (ex) {
  3123. // "DataCloneError" generated by Chrome when you try to inject blob into IndexedDB
  3124. if (ex.code === 25) {
  3125. Database.IsUASupportingBlobStorage = false;
  3126. }
  3127. image.src = url;
  3128. }
  3129. }
  3130. else {
  3131. image.src = url;
  3132. }
  3133. }, false);
  3134. xhr.addEventListener("error", function (event) {
  3135. BABYLON.Tools.Error("Error in XHR request in BABYLON.Database.");
  3136. image.src = url;
  3137. }, false);
  3138. xhr.send();
  3139. }
  3140. else {
  3141. image.src = url;
  3142. }
  3143. }
  3144. else {
  3145. BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open.");
  3146. image.src = url;
  3147. }
  3148. };
  3149. Database.prototype._checkVersionFromDB = function (url, versionLoaded) {
  3150. var _this = this;
  3151. var updateVersion = function (event) {
  3152. // the version is not yet in the DB or we need to update it
  3153. _this._saveVersionIntoDBAsync(url, versionLoaded);
  3154. };
  3155. this._loadVersionFromDBAsync(url, versionLoaded, updateVersion);
  3156. };
  3157. Database.prototype._loadVersionFromDBAsync = function (url, callback, updateInDBCallback) {
  3158. var _this = this;
  3159. if (this.isSupported) {
  3160. var version;
  3161. try {
  3162. var transaction = this.db.transaction(["versions"]);
  3163. transaction.oncomplete = function (event) {
  3164. if (version) {
  3165. // If the version in the JSON file is > than the version in DB
  3166. if (_this.manifestVersionFound > version.data) {
  3167. _this.mustUpdateRessources = true;
  3168. updateInDBCallback();
  3169. }
  3170. else {
  3171. callback(version.data);
  3172. }
  3173. }
  3174. else {
  3175. _this.mustUpdateRessources = true;
  3176. updateInDBCallback();
  3177. }
  3178. };
  3179. transaction.onabort = function (event) {
  3180. callback(-1);
  3181. };
  3182. var getRequest = transaction.objectStore("versions").get(url);
  3183. getRequest.onsuccess = function (event) {
  3184. version = (event.target).result;
  3185. };
  3186. getRequest.onerror = function (event) {
  3187. BABYLON.Tools.Error("Error loading version for scene " + url + " from DB.");
  3188. callback(-1);
  3189. };
  3190. }
  3191. catch (ex) {
  3192. BABYLON.Tools.Error("Error while accessing 'versions' object store (READ OP). Exception: " + ex.message);
  3193. callback(-1);
  3194. }
  3195. }
  3196. else {
  3197. BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open.");
  3198. callback(-1);
  3199. }
  3200. };
  3201. Database.prototype._saveVersionIntoDBAsync = function (url, callback) {
  3202. var _this = this;
  3203. if (this.isSupported && !this.hasReachedQuota) {
  3204. try {
  3205. // Open a transaction to the database
  3206. var transaction = this.db.transaction(["versions"], "readwrite");
  3207. // the transaction could abort because of a QuotaExceededError error
  3208. transaction.onabort = function (event) {
  3209. try {
  3210. if (event.srcElement['error'] && event.srcElement['error'].name === "QuotaExceededError") {
  3211. _this.hasReachedQuota = true;
  3212. }
  3213. }
  3214. catch (ex) { }
  3215. callback(-1);
  3216. };
  3217. transaction.oncomplete = function (event) {
  3218. callback(_this.manifestVersionFound);
  3219. };
  3220. var newVersion = { sceneUrl: url, data: this.manifestVersionFound };
  3221. // Put the scene into the database
  3222. var addRequest = transaction.objectStore("versions").put(newVersion);
  3223. addRequest.onsuccess = function (event) {
  3224. };
  3225. addRequest.onerror = function (event) {
  3226. BABYLON.Tools.Error("Error in DB add version request in BABYLON.Database.");
  3227. };
  3228. }
  3229. catch (ex) {
  3230. BABYLON.Tools.Error("Error while accessing 'versions' object store (WRITE OP). Exception: " + ex.message);
  3231. callback(-1);
  3232. }
  3233. }
  3234. else {
  3235. callback(-1);
  3236. }
  3237. };
  3238. Database.prototype.loadFileFromDB = function (url, sceneLoaded, progressCallBack, errorCallback, useArrayBuffer) {
  3239. var _this = this;
  3240. var completeUrl = Database.ReturnFullUrlLocation(url);
  3241. var saveAndLoadFile = function (event) {
  3242. // the scene is not yet in the DB, let's try to save it
  3243. _this._saveFileIntoDBAsync(completeUrl, sceneLoaded, progressCallBack);
  3244. };
  3245. this._checkVersionFromDB(completeUrl, function (version) {
  3246. if (version !== -1) {
  3247. if (!_this.mustUpdateRessources) {
  3248. _this._loadFileFromDBAsync(completeUrl, sceneLoaded, saveAndLoadFile, useArrayBuffer);
  3249. }
  3250. else {
  3251. _this._saveFileIntoDBAsync(completeUrl, sceneLoaded, progressCallBack, useArrayBuffer);
  3252. }
  3253. }
  3254. else {
  3255. errorCallback();
  3256. }
  3257. });
  3258. };
  3259. Database.prototype._loadFileFromDBAsync = function (url, callback, notInDBCallback, useArrayBuffer) {
  3260. if (this.isSupported) {
  3261. var targetStore;
  3262. if (url.indexOf(".babylon") !== -1) {
  3263. targetStore = "scenes";
  3264. }
  3265. else {
  3266. targetStore = "textures";
  3267. }
  3268. var file;
  3269. var transaction = this.db.transaction([targetStore]);
  3270. transaction.oncomplete = function (event) {
  3271. if (file) {
  3272. callback(file.data);
  3273. }
  3274. else {
  3275. notInDBCallback();
  3276. }
  3277. };
  3278. transaction.onabort = function (event) {
  3279. notInDBCallback();
  3280. };
  3281. var getRequest = transaction.objectStore(targetStore).get(url);
  3282. getRequest.onsuccess = function (event) {
  3283. file = (event.target).result;
  3284. };
  3285. getRequest.onerror = function (event) {
  3286. BABYLON.Tools.Error("Error loading file " + url + " from DB.");
  3287. notInDBCallback();
  3288. };
  3289. }
  3290. else {
  3291. BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open.");
  3292. callback();
  3293. }
  3294. };
  3295. Database.prototype._saveFileIntoDBAsync = function (url, callback, progressCallback, useArrayBuffer) {
  3296. var _this = this;
  3297. if (this.isSupported) {
  3298. var targetStore;
  3299. if (url.indexOf(".babylon") !== -1) {
  3300. targetStore = "scenes";
  3301. }
  3302. else {
  3303. targetStore = "textures";
  3304. }
  3305. // Create XHR
  3306. var xhr = new XMLHttpRequest(), fileData;
  3307. xhr.open("GET", url, true);
  3308. if (useArrayBuffer) {
  3309. xhr.responseType = "arraybuffer";
  3310. }
  3311. xhr.onprogress = progressCallback;
  3312. xhr.addEventListener("load", function () {
  3313. if (xhr.status === 200 || BABYLON.Tools.ValidateXHRData(xhr, !useArrayBuffer ? 1 : 6)) {
  3314. // Blob as response (XHR2)
  3315. //fileData = xhr.responseText;
  3316. fileData = !useArrayBuffer ? xhr.responseText : xhr.response;
  3317. if (!_this.hasReachedQuota) {
  3318. // Open a transaction to the database
  3319. var transaction = _this.db.transaction([targetStore], "readwrite");
  3320. // the transaction could abort because of a QuotaExceededError error
  3321. transaction.onabort = function (event) {
  3322. try {
  3323. //backwards compatibility with ts 1.0, srcElement doesn't have an "error" according to ts 1.3
  3324. if (event.srcElement['error'] && event.srcElement['error'].name === "QuotaExceededError") {
  3325. this.hasReachedQuota = true;
  3326. }
  3327. }
  3328. catch (ex) { }
  3329. callback(fileData);
  3330. };
  3331. transaction.oncomplete = function (event) {
  3332. callback(fileData);
  3333. };
  3334. var newFile;
  3335. if (targetStore === "scenes") {
  3336. newFile = { sceneUrl: url, data: fileData, version: _this.manifestVersionFound };
  3337. }
  3338. else {
  3339. newFile = { textureUrl: url, data: fileData };
  3340. }
  3341. try {
  3342. // Put the scene into the database
  3343. var addRequest = transaction.objectStore(targetStore).put(newFile);
  3344. addRequest.onsuccess = function (event) {
  3345. };
  3346. addRequest.onerror = function (event) {
  3347. BABYLON.Tools.Error("Error in DB add file request in BABYLON.Database.");
  3348. };
  3349. }
  3350. catch (ex) {
  3351. callback(fileData);
  3352. }
  3353. }
  3354. else {
  3355. callback(fileData);
  3356. }
  3357. }
  3358. else {
  3359. callback();
  3360. }
  3361. }, false);
  3362. xhr.addEventListener("error", function (event) {
  3363. BABYLON.Tools.Error("error on XHR request.");
  3364. callback();
  3365. }, false);
  3366. xhr.send();
  3367. }
  3368. else {
  3369. BABYLON.Tools.Error("Error: IndexedDB not supported by your browser or BabylonJS Database is not open.");
  3370. callback();
  3371. }
  3372. };
  3373. Database.IsUASupportingBlobStorage = true;
  3374. Database.IDBStorageEnabled = true;
  3375. Database.parseURL = function (url) {
  3376. var a = document.createElement('a');
  3377. a.href = url;
  3378. var urlWithoutHash = url.substring(0, url.lastIndexOf("#"));
  3379. var fileName = url.substring(urlWithoutHash.lastIndexOf("/") + 1, url.length);
  3380. var absLocation = url.substring(0, url.indexOf(fileName, 0));
  3381. return absLocation;
  3382. };
  3383. Database.ReturnFullUrlLocation = function (url) {
  3384. if (url.indexOf("http:/") === -1) {
  3385. return (Database.parseURL(window.location.href) + url);
  3386. }
  3387. else {
  3388. return url;
  3389. }
  3390. };
  3391. return Database;
  3392. })();
  3393. BABYLON.Database = Database;
  3394. })(BABYLON || (BABYLON = {}));
  3395. var BABYLON;
  3396. (function (BABYLON) {
  3397. var Internals;
  3398. (function (Internals) {
  3399. /*
  3400. * Based on jsTGALoader - Javascript loader for TGA file
  3401. * By Vincent Thibault
  3402. * @blog http://blog.robrowser.com/javascript-tga-loader.html
  3403. */
  3404. var TGATools = (function () {
  3405. function TGATools() {
  3406. }
  3407. TGATools.GetTGAHeader = function (data) {
  3408. var offset = 0;
  3409. var header = {
  3410. id_length: data[offset++],
  3411. colormap_type: data[offset++],
  3412. image_type: data[offset++],
  3413. colormap_index: data[offset++] | data[offset++] << 8,
  3414. colormap_length: data[offset++] | data[offset++] << 8,
  3415. colormap_size: data[offset++],
  3416. origin: [
  3417. data[offset++] | data[offset++] << 8,
  3418. data[offset++] | data[offset++] << 8
  3419. ],
  3420. width: data[offset++] | data[offset++] << 8,
  3421. height: data[offset++] | data[offset++] << 8,
  3422. pixel_size: data[offset++],
  3423. flags: data[offset++]
  3424. };
  3425. return header;
  3426. };
  3427. TGATools.UploadContent = function (gl, data) {
  3428. // Not enough data to contain header ?
  3429. if (data.length < 19) {
  3430. BABYLON.Tools.Error("Unable to load TGA file - Not enough data to contain header");
  3431. return;
  3432. }
  3433. // Read Header
  3434. var offset = 18;
  3435. var header = TGATools.GetTGAHeader(data);
  3436. // Assume it's a valid Targa file.
  3437. if (header.id_length + offset > data.length) {
  3438. BABYLON.Tools.Error("Unable to load TGA file - Not enough data");
  3439. return;
  3440. }
  3441. // Skip not needed data
  3442. offset += header.id_length;
  3443. var use_rle = false;
  3444. var use_pal = false;
  3445. var use_rgb = false;
  3446. var use_grey = false;
  3447. // Get some informations.
  3448. switch (header.image_type) {
  3449. case TGATools._TYPE_RLE_INDEXED:
  3450. use_rle = true;
  3451. case TGATools._TYPE_INDEXED:
  3452. use_pal = true;
  3453. break;
  3454. case TGATools._TYPE_RLE_RGB:
  3455. use_rle = true;
  3456. case TGATools._TYPE_RGB:
  3457. use_rgb = true;
  3458. break;
  3459. case TGATools._TYPE_RLE_GREY:
  3460. use_rle = true;
  3461. case TGATools._TYPE_GREY:
  3462. use_grey = true;
  3463. break;
  3464. }
  3465. var pixel_data;
  3466. var numAlphaBits = header.flags & 0xf;
  3467. var pixel_size = header.pixel_size >> 3;
  3468. var pixel_total = header.width * header.height * pixel_size;
  3469. // Read palettes
  3470. var palettes;
  3471. if (use_pal) {
  3472. palettes = data.subarray(offset, offset += header.colormap_length * (header.colormap_size >> 3));
  3473. }
  3474. // Read LRE
  3475. if (use_rle) {
  3476. pixel_data = new Uint8Array(pixel_total);
  3477. var c, count, i;
  3478. var localOffset = 0;
  3479. var pixels = new Uint8Array(pixel_size);
  3480. while (offset < pixel_total && localOffset < pixel_total) {
  3481. c = data[offset++];
  3482. count = (c & 0x7f) + 1;
  3483. // RLE pixels
  3484. if (c & 0x80) {
  3485. // Bind pixel tmp array
  3486. for (i = 0; i < pixel_size; ++i) {
  3487. pixels[i] = data[offset++];
  3488. }
  3489. // Copy pixel array
  3490. for (i = 0; i < count; ++i) {
  3491. pixel_data.set(pixels, localOffset + i * pixel_size);
  3492. }
  3493. localOffset += pixel_size * count;
  3494. }
  3495. else {
  3496. count *= pixel_size;
  3497. for (i = 0; i < count; ++i) {
  3498. pixel_data[localOffset + i] = data[offset++];
  3499. }
  3500. localOffset += count;
  3501. }
  3502. }
  3503. }
  3504. else {
  3505. pixel_data = data.subarray(offset, offset += (use_pal ? header.width * header.height : pixel_total));
  3506. }
  3507. // Load to texture
  3508. var x_start, y_start, x_step, y_step, y_end, x_end;
  3509. switch ((header.flags & TGATools._ORIGIN_MASK) >> TGATools._ORIGIN_SHIFT) {
  3510. default:
  3511. case TGATools._ORIGIN_UL:
  3512. x_start = 0;
  3513. x_step = 1;
  3514. x_end = header.width;
  3515. y_start = 0;
  3516. y_step = 1;
  3517. y_end = header.height;
  3518. break;
  3519. case TGATools._ORIGIN_BL:
  3520. x_start = 0;
  3521. x_step = 1;
  3522. x_end = header.width;
  3523. y_start = header.height - 1;
  3524. y_step = -1;
  3525. y_end = -1;
  3526. break;
  3527. case TGATools._ORIGIN_UR:
  3528. x_start = header.width - 1;
  3529. x_step = -1;
  3530. x_end = -1;
  3531. y_start = 0;
  3532. y_step = 1;
  3533. y_end = header.height;
  3534. break;
  3535. case TGATools._ORIGIN_BR:
  3536. x_start = header.width - 1;
  3537. x_step = -1;
  3538. x_end = -1;
  3539. y_start = header.height - 1;
  3540. y_step = -1;
  3541. y_end = -1;
  3542. break;
  3543. }
  3544. // Load the specify method
  3545. var func = '_getImageData' + (use_grey ? 'Grey' : '') + (header.pixel_size) + 'bits';
  3546. var imageData = TGATools[func](header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end);
  3547. gl.texImage2D(gl.TEXTURE_2D, 0, gl.RGBA, header.width, header.height, 0, gl.RGBA, gl.UNSIGNED_BYTE, imageData);
  3548. };
  3549. TGATools._getImageData8bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  3550. var image = pixel_data, colormap = palettes;
  3551. var width = header.width, height = header.height;
  3552. var color, i = 0, x, y;
  3553. var imageData = new Uint8Array(width * height * 4);
  3554. for (y = y_start; y !== y_end; y += y_step) {
  3555. for (x = x_start; x !== x_end; x += x_step, i++) {
  3556. color = image[i];
  3557. imageData[(x + width * y) * 4 + 3] = 255;
  3558. imageData[(x + width * y) * 4 + 2] = colormap[(color * 3) + 0];
  3559. imageData[(x + width * y) * 4 + 1] = colormap[(color * 3) + 1];
  3560. imageData[(x + width * y) * 4 + 0] = colormap[(color * 3) + 2];
  3561. }
  3562. }
  3563. return imageData;
  3564. };
  3565. TGATools._getImageData16bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  3566. var image = pixel_data;
  3567. var width = header.width, height = header.height;
  3568. var color, i = 0, x, y;
  3569. var imageData = new Uint8Array(width * height * 4);
  3570. for (y = y_start; y !== y_end; y += y_step) {
  3571. for (x = x_start; x !== x_end; x += x_step, i += 2) {
  3572. color = image[i + 0] + (image[i + 1] << 8); // Inversed ?
  3573. imageData[(x + width * y) * 4 + 0] = (color & 0x7C00) >> 7;
  3574. imageData[(x + width * y) * 4 + 1] = (color & 0x03E0) >> 2;
  3575. imageData[(x + width * y) * 4 + 2] = (color & 0x001F) >> 3;
  3576. imageData[(x + width * y) * 4 + 3] = (color & 0x8000) ? 0 : 255;
  3577. }
  3578. }
  3579. return imageData;
  3580. };
  3581. TGATools._getImageData24bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  3582. var image = pixel_data;
  3583. var width = header.width, height = header.height;
  3584. var i = 0, x, y;
  3585. var imageData = new Uint8Array(width * height * 4);
  3586. for (y = y_start; y !== y_end; y += y_step) {
  3587. for (x = x_start; x !== x_end; x += x_step, i += 3) {
  3588. imageData[(x + width * y) * 4 + 3] = 255;
  3589. imageData[(x + width * y) * 4 + 2] = image[i + 0];
  3590. imageData[(x + width * y) * 4 + 1] = image[i + 1];
  3591. imageData[(x + width * y) * 4 + 0] = image[i + 2];
  3592. }
  3593. }
  3594. return imageData;
  3595. };
  3596. TGATools._getImageData32bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  3597. var image = pixel_data;
  3598. var width = header.width, height = header.height;
  3599. var i = 0, x, y;
  3600. var imageData = new Uint8Array(width * height * 4);
  3601. for (y = y_start; y !== y_end; y += y_step) {
  3602. for (x = x_start; x !== x_end; x += x_step, i += 4) {
  3603. imageData[(x + width * y) * 4 + 2] = image[i + 0];
  3604. imageData[(x + width * y) * 4 + 1] = image[i + 1];
  3605. imageData[(x + width * y) * 4 + 0] = image[i + 2];
  3606. imageData[(x + width * y) * 4 + 3] = image[i + 3];
  3607. }
  3608. }
  3609. return imageData;
  3610. };
  3611. TGATools._getImageDataGrey8bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  3612. var image = pixel_data;
  3613. var width = header.width, height = header.height;
  3614. var color, i = 0, x, y;
  3615. var imageData = new Uint8Array(width * height * 4);
  3616. for (y = y_start; y !== y_end; y += y_step) {
  3617. for (x = x_start; x !== x_end; x += x_step, i++) {
  3618. color = image[i];
  3619. imageData[(x + width * y) * 4 + 0] = color;
  3620. imageData[(x + width * y) * 4 + 1] = color;
  3621. imageData[(x + width * y) * 4 + 2] = color;
  3622. imageData[(x + width * y) * 4 + 3] = 255;
  3623. }
  3624. }
  3625. return imageData;
  3626. };
  3627. TGATools._getImageDataGrey16bits = function (header, palettes, pixel_data, y_start, y_step, y_end, x_start, x_step, x_end) {
  3628. var image = pixel_data;
  3629. var width = header.width, height = header.height;
  3630. var i = 0, x, y;
  3631. var imageData = new Uint8Array(width * height * 4);
  3632. for (y = y_start; y !== y_end; y += y_step) {
  3633. for (x = x_start; x !== x_end; x += x_step, i += 2) {
  3634. imageData[(x + width * y) * 4 + 0] = image[i + 0];
  3635. imageData[(x + width * y) * 4 + 1] = image[i + 0];
  3636. imageData[(x + width * y) * 4 + 2] = image[i + 0];
  3637. imageData[(x + width * y) * 4 + 3] = image[i + 1];
  3638. }
  3639. }
  3640. return imageData;
  3641. };
  3642. TGATools._TYPE_NO_DATA = 0;
  3643. TGATools._TYPE_INDEXED = 1;
  3644. TGATools._TYPE_RGB = 2;
  3645. TGATools._TYPE_GREY = 3;
  3646. TGATools._TYPE_RLE_INDEXED = 9;
  3647. TGATools._TYPE_RLE_RGB = 10;
  3648. TGATools._TYPE_RLE_GREY = 11;
  3649. TGATools._ORIGIN_MASK = 0x30;
  3650. TGATools._ORIGIN_SHIFT = 0x04;
  3651. TGATools._ORIGIN_BL = 0x00;
  3652. TGATools._ORIGIN_BR = 0x01;
  3653. TGATools._ORIGIN_UL = 0x02;
  3654. TGATools._ORIGIN_UR = 0x03;
  3655. return TGATools;
  3656. })();
  3657. Internals.TGATools = TGATools;
  3658. })(Internals = BABYLON.Internals || (BABYLON.Internals = {}));
  3659. })(BABYLON || (BABYLON = {}));
  3660. var BABYLON;
  3661. (function (BABYLON) {
  3662. var SmartArray = (function () {
  3663. function SmartArray(capacity) {
  3664. this.length = 0;
  3665. this._duplicateId = 0;
  3666. this.data = new Array(capacity);
  3667. this._id = SmartArray._GlobalId++;
  3668. }
  3669. SmartArray.prototype.push = function (value) {
  3670. this.data[this.length++] = value;
  3671. if (this.length > this.data.length) {
  3672. this.data.length *= 2;
  3673. }
  3674. if (!value.__smartArrayFlags) {
  3675. value.__smartArrayFlags = {};
  3676. }
  3677. value.__smartArrayFlags[this._id] = this._duplicateId;
  3678. };
  3679. SmartArray.prototype.pushNoDuplicate = function (value) {
  3680. if (value.__smartArrayFlags && value.__smartArrayFlags[this._id] === this._duplicateId) {
  3681. return;
  3682. }
  3683. this.push(value);
  3684. };
  3685. SmartArray.prototype.sort = function (compareFn) {
  3686. this.data.sort(compareFn);
  3687. };
  3688. SmartArray.prototype.reset = function () {
  3689. this.length = 0;
  3690. this._duplicateId++;
  3691. };
  3692. SmartArray.prototype.concat = function (array) {
  3693. if (array.length === 0) {
  3694. return;
  3695. }
  3696. if (this.length + array.length > this.data.length) {
  3697. this.data.length = (this.length + array.length) * 2;
  3698. }
  3699. for (var index = 0; index < array.length; index++) {
  3700. this.data[this.length++] = (array.data || array)[index];
  3701. }
  3702. };
  3703. SmartArray.prototype.concatWithNoDuplicate = function (array) {
  3704. if (array.length === 0) {
  3705. return;
  3706. }
  3707. if (this.length + array.length > this.data.length) {
  3708. this.data.length = (this.length + array.length) * 2;
  3709. }
  3710. for (var index = 0; index < array.length; index++) {
  3711. var item = (array.data || array)[index];
  3712. this.pushNoDuplicate(item);
  3713. }
  3714. };
  3715. SmartArray.prototype.indexOf = function (value) {
  3716. var position = this.data.indexOf(value);
  3717. if (position >= this.length) {
  3718. return -1;
  3719. }
  3720. return position;
  3721. };
  3722. // Statics
  3723. SmartArray._GlobalId = 0;
  3724. return SmartArray;
  3725. })();
  3726. BABYLON.SmartArray = SmartArray;
  3727. })(BABYLON || (BABYLON = {}));
  3728. var BABYLON;
  3729. (function (BABYLON) {
  3730. var SmartCollection = (function () {
  3731. function SmartCollection(capacity) {
  3732. if (capacity === void 0) { capacity = 10; }
  3733. this.count = 0;
  3734. this._initialCapacity = capacity;
  3735. this.items = {};
  3736. this._keys = new Array(this._initialCapacity);
  3737. }
  3738. SmartCollection.prototype.add = function (key, item) {
  3739. if (this.items[key] != undefined) {
  3740. return -1;
  3741. }
  3742. this.items[key] = item;
  3743. //literal keys are always strings, but we keep source type of key in _keys array
  3744. this._keys[this.count++] = key;
  3745. if (this.count > this._keys.length) {
  3746. this._keys.length *= 2;
  3747. }
  3748. return this.count;
  3749. };
  3750. SmartCollection.prototype.remove = function (key) {
  3751. if (this.items[key] == undefined) {
  3752. return -1;
  3753. }
  3754. return this.removeItemOfIndex(this.indexOf(key));
  3755. };
  3756. SmartCollection.prototype.removeItemOfIndex = function (index) {
  3757. if (index < this.count && index > -1) {
  3758. delete this.items[this._keys[index]];
  3759. //here, shifting by hand is better optimised than .splice
  3760. while (index < this.count) {
  3761. this._keys[index] = this._keys[index + 1];
  3762. index++;
  3763. }
  3764. }
  3765. else {
  3766. return -1;
  3767. }
  3768. return --this.count;
  3769. };
  3770. SmartCollection.prototype.indexOf = function (key) {
  3771. for (var i = 0; i !== this.count; i++) {
  3772. if (this._keys[i] === key) {
  3773. return i;
  3774. }
  3775. }
  3776. return -1;
  3777. };
  3778. SmartCollection.prototype.item = function (key) {
  3779. return this.items[key];
  3780. };
  3781. SmartCollection.prototype.getAllKeys = function () {
  3782. if (this.count > 0) {
  3783. var keys = new Array(this.count);
  3784. for (var i = 0; i < this.count; i++) {
  3785. keys[i] = this._keys[i];
  3786. }
  3787. return keys;
  3788. }
  3789. else {
  3790. return undefined;
  3791. }
  3792. };
  3793. SmartCollection.prototype.getKeyByIndex = function (index) {
  3794. if (index < this.count && index > -1) {
  3795. return this._keys[index];
  3796. }
  3797. else {
  3798. return undefined;
  3799. }
  3800. };
  3801. SmartCollection.prototype.getItemByIndex = function (index) {
  3802. if (index < this.count && index > -1) {
  3803. return this.items[this._keys[index]];
  3804. }
  3805. else {
  3806. return undefined;
  3807. }
  3808. };
  3809. SmartCollection.prototype.empty = function () {
  3810. if (this.count > 0) {
  3811. this.count = 0;
  3812. this.items = {};
  3813. this._keys = new Array(this._initialCapacity);
  3814. }
  3815. };
  3816. SmartCollection.prototype.forEach = function (block) {
  3817. var key;
  3818. for (key in this.items) {
  3819. if (this.items.hasOwnProperty(key)) {
  3820. block(this.items[key]);
  3821. }
  3822. }
  3823. };
  3824. return SmartCollection;
  3825. })();
  3826. BABYLON.SmartCollection = SmartCollection;
  3827. })(BABYLON || (BABYLON = {}));
  3828. var BABYLON;
  3829. (function (BABYLON) {
  3830. // Screenshots
  3831. var screenshotCanvas;
  3832. var cloneValue = function (source, destinationObject) {
  3833. if (!source)
  3834. return null;
  3835. if (source instanceof BABYLON.Mesh) {
  3836. return null;
  3837. }
  3838. if (source instanceof BABYLON.SubMesh) {
  3839. return source.clone(destinationObject);
  3840. }
  3841. else if (source.clone) {
  3842. return source.clone();
  3843. }
  3844. return null;
  3845. };
  3846. var Tools = (function () {
  3847. function Tools() {
  3848. }
  3849. Tools.ToHex = function (i) {
  3850. var str = i.toString(16);
  3851. if (i <= 15) {
  3852. return ("0" + str).toUpperCase();
  3853. }
  3854. return str.toUpperCase();
  3855. };
  3856. Tools.SetImmediate = function (action) {
  3857. if (window.setImmediate) {
  3858. window.setImmediate(action);
  3859. }
  3860. else {
  3861. setTimeout(action, 1);
  3862. }
  3863. };
  3864. Tools.IsExponentOfTwo = function (value) {
  3865. var count = 1;
  3866. do {
  3867. count *= 2;
  3868. } while (count < value);
  3869. return count === value;
  3870. };
  3871. Tools.GetExponentOfTwo = function (value, max) {
  3872. var count = 1;
  3873. do {
  3874. count *= 2;
  3875. } while (count < value);
  3876. if (count > max)
  3877. count = max;
  3878. return count;
  3879. };
  3880. Tools.GetFilename = function (path) {
  3881. var index = path.lastIndexOf("/");
  3882. if (index < 0)
  3883. return path;
  3884. return path.substring(index + 1);
  3885. };
  3886. Tools.GetDOMTextContent = function (element) {
  3887. var result = "";
  3888. var child = element.firstChild;
  3889. while (child) {
  3890. if (child.nodeType === 3) {
  3891. result += child.textContent;
  3892. }
  3893. child = child.nextSibling;
  3894. }
  3895. return result;
  3896. };
  3897. Tools.ToDegrees = function (angle) {
  3898. return angle * 180 / Math.PI;
  3899. };
  3900. Tools.ToRadians = function (angle) {
  3901. return angle * Math.PI / 180;
  3902. };
  3903. Tools.ExtractMinAndMaxIndexed = function (positions, indices, indexStart, indexCount) {
  3904. var minimum = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  3905. var maximum = new BABYLON.Vector3(-Number.MAX_VALUE, -Number.MAX_VALUE, -Number.MAX_VALUE);
  3906. for (var index = indexStart; index < indexStart + indexCount; index++) {
  3907. var current = new BABYLON.Vector3(positions[indices[index] * 3], positions[indices[index] * 3 + 1], positions[indices[index] * 3 + 2]);
  3908. minimum = BABYLON.Vector3.Minimize(current, minimum);
  3909. maximum = BABYLON.Vector3.Maximize(current, maximum);
  3910. }
  3911. return {
  3912. minimum: minimum,
  3913. maximum: maximum
  3914. };
  3915. };
  3916. Tools.ExtractMinAndMax = function (positions, start, count) {
  3917. var minimum = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  3918. var maximum = new BABYLON.Vector3(-Number.MAX_VALUE, -Number.MAX_VALUE, -Number.MAX_VALUE);
  3919. for (var index = start; index < start + count; index++) {
  3920. var current = new BABYLON.Vector3(positions[index * 3], positions[index * 3 + 1], positions[index * 3 + 2]);
  3921. minimum = BABYLON.Vector3.Minimize(current, minimum);
  3922. maximum = BABYLON.Vector3.Maximize(current, maximum);
  3923. }
  3924. return {
  3925. minimum: minimum,
  3926. maximum: maximum
  3927. };
  3928. };
  3929. Tools.MakeArray = function (obj, allowsNullUndefined) {
  3930. if (allowsNullUndefined !== true && (obj === undefined || obj == null))
  3931. return undefined;
  3932. return Array.isArray(obj) ? obj : [obj];
  3933. };
  3934. // Misc.
  3935. Tools.GetPointerPrefix = function () {
  3936. var eventPrefix = "pointer";
  3937. // Check if hand.js is referenced or if the browser natively supports pointer events
  3938. if (!navigator.pointerEnabled) {
  3939. eventPrefix = "mouse";
  3940. }
  3941. return eventPrefix;
  3942. };
  3943. Tools.QueueNewFrame = function (func) {
  3944. if (window.requestAnimationFrame)
  3945. window.requestAnimationFrame(func);
  3946. else if (window.msRequestAnimationFrame)
  3947. window.msRequestAnimationFrame(func);
  3948. else if (window.webkitRequestAnimationFrame)
  3949. window.webkitRequestAnimationFrame(func);
  3950. else if (window.mozRequestAnimationFrame)
  3951. window.mozRequestAnimationFrame(func);
  3952. else if (window.oRequestAnimationFrame)
  3953. window.oRequestAnimationFrame(func);
  3954. else {
  3955. window.setTimeout(func, 16);
  3956. }
  3957. };
  3958. Tools.RequestFullscreen = function (element) {
  3959. if (element.requestFullscreen)
  3960. element.requestFullscreen();
  3961. else if (element.msRequestFullscreen)
  3962. element.msRequestFullscreen();
  3963. else if (element.webkitRequestFullscreen)
  3964. element.webkitRequestFullscreen();
  3965. else if (element.mozRequestFullScreen)
  3966. element.mozRequestFullScreen();
  3967. };
  3968. Tools.ExitFullscreen = function () {
  3969. if (document.exitFullscreen) {
  3970. document.exitFullscreen();
  3971. }
  3972. else if (document.mozCancelFullScreen) {
  3973. document.mozCancelFullScreen();
  3974. }
  3975. else if (document.webkitCancelFullScreen) {
  3976. document.webkitCancelFullScreen();
  3977. }
  3978. else if (document.msCancelFullScreen) {
  3979. document.msCancelFullScreen();
  3980. }
  3981. };
  3982. // External files
  3983. Tools.CleanUrl = function (url) {
  3984. url = url.replace(/#/mg, "%23");
  3985. return url;
  3986. };
  3987. Tools.LoadImage = function (url, onload, onerror, database) {
  3988. url = Tools.CleanUrl(url);
  3989. var img = new Image();
  3990. if (url.substr(0, 5) !== "data:")
  3991. img.crossOrigin = 'anonymous';
  3992. img.onload = function () {
  3993. onload(img);
  3994. };
  3995. img.onerror = function (err) {
  3996. Tools.Error("Error while trying to load texture: " + url);
  3997. img.src = "data:image/jpg;base64,/9j/4AAQSkZJRgABAQEAYABgAAD/4QBmRXhpZgAATU0AKgAAAAgABAEaAAUAAAABAAAAPgEbAAUAAAABAAAARgEoAAMAAAABAAIAAAExAAIAAAAQAAAATgAAAAAAAABgAAAAAQAAAGAAAAABcGFpbnQubmV0IDQuMC41AP/bAEMABAIDAwMCBAMDAwQEBAQFCQYFBQUFCwgIBgkNCw0NDQsMDA4QFBEODxMPDAwSGBITFRYXFxcOERkbGRYaFBYXFv/bAEMBBAQEBQUFCgYGChYPDA8WFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFhYWFv/AABEIAQABAAMBIgACEQEDEQH/xAAfAAABBQEBAQEBAQAAAAAAAAAAAQIDBAUGBwgJCgv/xAC1EAACAQMDAgQDBQUEBAAAAX0BAgMABBEFEiExQQYTUWEHInEUMoGRoQgjQrHBFVLR8CQzYnKCCQoWFxgZGiUmJygpKjQ1Njc4OTpDREVGR0hJSlNUVVZXWFlaY2RlZmdoaWpzdHV2d3h5eoOEhYaHiImKkpOUlZaXmJmaoqOkpaanqKmqsrO0tba3uLm6wsPExcbHyMnK0tPU1dbX2Nna4eLj5OXm5+jp6vHy8/T19vf4+fr/xAAfAQADAQEBAQEBAQEBAAAAAAAAAQIDBAUGBwgJCgv/xAC1EQACAQIEBAMEBwUEBAABAncAAQIDEQQFITEGEkFRB2FxEyIygQgUQpGhscEJIzNS8BVictEKFiQ04SXxFxgZGiYnKCkqNTY3ODk6Q0RFRkdISUpTVFVWV1hZWmNkZWZnaGlqc3R1dnd4eXqCg4SFhoeIiYqSk5SVlpeYmZqio6Slpqeoqaqys7S1tre4ubrCw8TFxsfIycrS09TV1tfY2dri4+Tl5ufo6ery8/T19vf4+fr/2gAMAwEAAhEDEQA/APH6KKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FCiiigD6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++gooooA+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gUKKKKAPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76CiiigD5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BQooooA+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/voKKKKAPl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FCiiigD6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++gooooA+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gUKKKKAPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76CiiigD5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BQooooA+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/voKKKKAPl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FCiiigD6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++gooooA+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gUKKKKAPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76Pl+iiivuj+BT6gooor4U/vo+X6KKK+6P4FPqCiiivhT++j5fooor7o/gU+oKKKK+FP76P//Z";
  3998. onload(img);
  3999. };
  4000. var noIndexedDB = function () {
  4001. img.src = url;
  4002. };
  4003. var loadFromIndexedDB = function () {
  4004. database.loadImageFromDB(url, img);
  4005. };
  4006. //ANY database to do!
  4007. if (database && database.enableTexturesOffline && BABYLON.Database.IsUASupportingBlobStorage) {
  4008. database.openAsync(loadFromIndexedDB, noIndexedDB);
  4009. }
  4010. else {
  4011. if (url.indexOf("file:") === -1) {
  4012. noIndexedDB();
  4013. }
  4014. else {
  4015. try {
  4016. var textureName = url.substring(5);
  4017. var blobURL;
  4018. try {
  4019. blobURL = URL.createObjectURL(BABYLON.FilesInput.FilesTextures[textureName], { oneTimeOnly: true });
  4020. }
  4021. catch (ex) {
  4022. // Chrome doesn't support oneTimeOnly parameter
  4023. blobURL = URL.createObjectURL(BABYLON.FilesInput.FilesTextures[textureName]);
  4024. }
  4025. img.src = blobURL;
  4026. }
  4027. catch (e) {
  4028. img.src = null;
  4029. }
  4030. }
  4031. }
  4032. return img;
  4033. };
  4034. //ANY
  4035. Tools.LoadFile = function (url, callback, progressCallBack, database, useArrayBuffer, onError) {
  4036. url = Tools.CleanUrl(url);
  4037. var noIndexedDB = function () {
  4038. var request = new XMLHttpRequest();
  4039. var loadUrl = Tools.BaseUrl + url;
  4040. request.open('GET', loadUrl, true);
  4041. if (useArrayBuffer) {
  4042. request.responseType = "arraybuffer";
  4043. }
  4044. request.onprogress = progressCallBack;
  4045. request.onreadystatechange = function () {
  4046. if (request.readyState === 4) {
  4047. if (request.status === 200 || Tools.ValidateXHRData(request, !useArrayBuffer ? 1 : 6)) {
  4048. callback(!useArrayBuffer ? request.responseText : request.response);
  4049. }
  4050. else {
  4051. if (onError) {
  4052. onError();
  4053. }
  4054. else {
  4055. throw new Error("Error status: " + request.status + " - Unable to load " + loadUrl);
  4056. }
  4057. }
  4058. }
  4059. };
  4060. request.send(null);
  4061. };
  4062. var loadFromIndexedDB = function () {
  4063. database.loadFileFromDB(url, callback, progressCallBack, noIndexedDB, useArrayBuffer);
  4064. };
  4065. if (url.indexOf("file:") !== -1) {
  4066. var fileName = url.substring(5);
  4067. Tools.ReadFile(BABYLON.FilesInput.FilesToLoad[fileName], callback, progressCallBack, true);
  4068. }
  4069. else {
  4070. // Caching all files
  4071. if (database && database.enableSceneOffline) {
  4072. database.openAsync(loadFromIndexedDB, noIndexedDB);
  4073. }
  4074. else {
  4075. noIndexedDB();
  4076. }
  4077. }
  4078. };
  4079. Tools.ReadFileAsDataURL = function (fileToLoad, callback, progressCallback) {
  4080. var reader = new FileReader();
  4081. reader.onload = function (e) {
  4082. //target doesn't have result from ts 1.3
  4083. callback(e.target['result']);
  4084. };
  4085. reader.onprogress = progressCallback;
  4086. reader.readAsDataURL(fileToLoad);
  4087. };
  4088. Tools.ReadFile = function (fileToLoad, callback, progressCallBack, useArrayBuffer) {
  4089. var reader = new FileReader();
  4090. reader.onerror = function (e) {
  4091. Tools.Log("Error while reading file: " + fileToLoad.name);
  4092. callback(JSON.stringify({ autoClear: true, clearColor: [1, 0, 0], ambientColor: [0, 0, 0], gravity: [0, -9.807, 0], meshes: [], cameras: [], lights: [] }));
  4093. };
  4094. reader.onload = function (e) {
  4095. //target doesn't have result from ts 1.3
  4096. callback(e.target['result']);
  4097. };
  4098. reader.onprogress = progressCallBack;
  4099. if (!useArrayBuffer) {
  4100. // Asynchronous read
  4101. reader.readAsText(fileToLoad);
  4102. }
  4103. else {
  4104. reader.readAsArrayBuffer(fileToLoad);
  4105. }
  4106. };
  4107. //returns a downloadable url to a file content.
  4108. Tools.FileAsURL = function (content) {
  4109. var fileBlob = new Blob([content]);
  4110. var url = window.URL || window.webkitURL;
  4111. var link = url.createObjectURL(fileBlob);
  4112. return link;
  4113. };
  4114. // Misc.
  4115. Tools.Clamp = function (value, min, max) {
  4116. if (min === void 0) { min = 0; }
  4117. if (max === void 0) { max = 1; }
  4118. return Math.min(max, Math.max(min, value));
  4119. };
  4120. // Returns -1 when value is a negative number and
  4121. // +1 when value is a positive number.
  4122. Tools.Sign = function (value) {
  4123. value = +value; // convert to a number
  4124. if (value === 0 || isNaN(value))
  4125. return value;
  4126. return value > 0 ? 1 : -1;
  4127. };
  4128. Tools.Format = function (value, decimals) {
  4129. if (decimals === void 0) { decimals = 2; }
  4130. return value.toFixed(decimals);
  4131. };
  4132. Tools.CheckExtends = function (v, min, max) {
  4133. if (v.x < min.x)
  4134. min.x = v.x;
  4135. if (v.y < min.y)
  4136. min.y = v.y;
  4137. if (v.z < min.z)
  4138. min.z = v.z;
  4139. if (v.x > max.x)
  4140. max.x = v.x;
  4141. if (v.y > max.y)
  4142. max.y = v.y;
  4143. if (v.z > max.z)
  4144. max.z = v.z;
  4145. };
  4146. Tools.WithinEpsilon = function (a, b, epsilon) {
  4147. if (epsilon === void 0) { epsilon = 1.401298E-45; }
  4148. var num = a - b;
  4149. return -epsilon <= num && num <= epsilon;
  4150. };
  4151. Tools.DeepCopy = function (source, destination, doNotCopyList, mustCopyList) {
  4152. for (var prop in source) {
  4153. if (prop[0] === "_" && (!mustCopyList || mustCopyList.indexOf(prop) === -1)) {
  4154. continue;
  4155. }
  4156. if (doNotCopyList && doNotCopyList.indexOf(prop) !== -1) {
  4157. continue;
  4158. }
  4159. var sourceValue = source[prop];
  4160. var typeOfSourceValue = typeof sourceValue;
  4161. if (typeOfSourceValue === "function") {
  4162. continue;
  4163. }
  4164. if (typeOfSourceValue === "object") {
  4165. if (sourceValue instanceof Array) {
  4166. destination[prop] = [];
  4167. if (sourceValue.length > 0) {
  4168. if (typeof sourceValue[0] == "object") {
  4169. for (var index = 0; index < sourceValue.length; index++) {
  4170. var clonedValue = cloneValue(sourceValue[index], destination);
  4171. if (destination[prop].indexOf(clonedValue) === -1) {
  4172. destination[prop].push(clonedValue);
  4173. }
  4174. }
  4175. }
  4176. else {
  4177. destination[prop] = sourceValue.slice(0);
  4178. }
  4179. }
  4180. }
  4181. else {
  4182. destination[prop] = cloneValue(sourceValue, destination);
  4183. }
  4184. }
  4185. else {
  4186. destination[prop] = sourceValue;
  4187. }
  4188. }
  4189. };
  4190. Tools.IsEmpty = function (obj) {
  4191. for (var i in obj) {
  4192. return false;
  4193. }
  4194. return true;
  4195. };
  4196. Tools.RegisterTopRootEvents = function (events) {
  4197. for (var index = 0; index < events.length; index++) {
  4198. var event = events[index];
  4199. window.addEventListener(event.name, event.handler, false);
  4200. try {
  4201. if (window.parent) {
  4202. window.parent.addEventListener(event.name, event.handler, false);
  4203. }
  4204. }
  4205. catch (e) {
  4206. }
  4207. }
  4208. };
  4209. Tools.UnregisterTopRootEvents = function (events) {
  4210. for (var index = 0; index < events.length; index++) {
  4211. var event = events[index];
  4212. window.removeEventListener(event.name, event.handler);
  4213. try {
  4214. if (window.parent) {
  4215. window.parent.removeEventListener(event.name, event.handler);
  4216. }
  4217. }
  4218. catch (e) {
  4219. }
  4220. }
  4221. };
  4222. Tools.DumpFramebuffer = function (width, height, engine, successCallback) {
  4223. // Read the contents of the framebuffer
  4224. var numberOfChannelsByLine = width * 4;
  4225. var halfHeight = height / 2;
  4226. //Reading datas from WebGL
  4227. var data = engine.readPixels(0, 0, width, height);
  4228. //To flip image on Y axis.
  4229. for (var i = 0; i < halfHeight; i++) {
  4230. for (var j = 0; j < numberOfChannelsByLine; j++) {
  4231. var currentCell = j + i * numberOfChannelsByLine;
  4232. var targetLine = height - i - 1;
  4233. var targetCell = j + targetLine * numberOfChannelsByLine;
  4234. var temp = data[currentCell];
  4235. data[currentCell] = data[targetCell];
  4236. data[targetCell] = temp;
  4237. }
  4238. }
  4239. // Create a 2D canvas to store the result
  4240. if (!screenshotCanvas) {
  4241. screenshotCanvas = document.createElement('canvas');
  4242. }
  4243. screenshotCanvas.width = width;
  4244. screenshotCanvas.height = height;
  4245. var context = screenshotCanvas.getContext('2d');
  4246. // Copy the pixels to a 2D canvas
  4247. var imageData = context.createImageData(width, height);
  4248. //cast is due to ts error in lib.d.ts, see here - https://github.com/Microsoft/TypeScript/issues/949
  4249. var castData = imageData.data;
  4250. castData.set(data);
  4251. context.putImageData(imageData, 0, 0);
  4252. var base64Image = screenshotCanvas.toDataURL();
  4253. if (successCallback) {
  4254. successCallback(base64Image);
  4255. }
  4256. else {
  4257. //Creating a link if the browser have the download attribute on the a tag, to automatically start download generated image.
  4258. if (("download" in document.createElement("a"))) {
  4259. var a = window.document.createElement("a");
  4260. a.href = base64Image;
  4261. var date = new Date();
  4262. var stringDate = date.getFullYear() + "-" + date.getMonth() + "-" + date.getDate() + "_" + date.getHours() + "-" + ('0' + date.getMinutes()).slice(-2);
  4263. a.setAttribute("download", "screenshot_" + stringDate + ".png");
  4264. window.document.body.appendChild(a);
  4265. a.addEventListener("click", function () {
  4266. a.parentElement.removeChild(a);
  4267. });
  4268. a.click();
  4269. }
  4270. else {
  4271. var newWindow = window.open("");
  4272. var img = newWindow.document.createElement("img");
  4273. img.src = base64Image;
  4274. newWindow.document.body.appendChild(img);
  4275. }
  4276. }
  4277. };
  4278. Tools.CreateScreenshot = function (engine, camera, size, successCallback) {
  4279. var width;
  4280. var height;
  4281. //If a precision value is specified
  4282. if (size.precision) {
  4283. width = Math.round(engine.getRenderWidth() * size.precision);
  4284. height = Math.round(width / engine.getAspectRatio(camera));
  4285. size = { width: width, height: height };
  4286. }
  4287. else if (size.width && size.height) {
  4288. width = size.width;
  4289. height = size.height;
  4290. }
  4291. else if (size.width && !size.height) {
  4292. width = size.width;
  4293. height = Math.round(width / engine.getAspectRatio(camera));
  4294. size = { width: width, height: height };
  4295. }
  4296. else if (size.height && !size.width) {
  4297. height = size.height;
  4298. width = Math.round(height * engine.getAspectRatio(camera));
  4299. size = { width: width, height: height };
  4300. }
  4301. else if (!isNaN(size)) {
  4302. height = size;
  4303. width = size;
  4304. }
  4305. else {
  4306. Tools.Error("Invalid 'size' parameter !");
  4307. return;
  4308. }
  4309. var scene = camera.getScene();
  4310. var previousCamera = null;
  4311. if (scene.activeCamera !== camera) {
  4312. previousCamera = scene.activeCamera;
  4313. scene.activeCamera = camera;
  4314. }
  4315. //At this point size can be a number, or an object (according to engine.prototype.createRenderTargetTexture method)
  4316. var texture = new BABYLON.RenderTargetTexture("screenShot", size, scene, false, false);
  4317. texture.renderList = scene.meshes;
  4318. texture.onAfterRender = function () {
  4319. Tools.DumpFramebuffer(width, height, engine, successCallback);
  4320. };
  4321. scene.incrementRenderId();
  4322. texture.render(true);
  4323. texture.dispose();
  4324. if (previousCamera) {
  4325. scene.activeCamera = previousCamera;
  4326. }
  4327. };
  4328. // XHR response validator for local file scenario
  4329. Tools.ValidateXHRData = function (xhr, dataType) {
  4330. // 1 for text (.babylon, manifest and shaders), 2 for TGA, 4 for DDS, 7 for all
  4331. if (dataType === void 0) { dataType = 7; }
  4332. try {
  4333. if (dataType & 1) {
  4334. if (xhr.responseText && xhr.responseText.length > 0) {
  4335. return true;
  4336. }
  4337. else if (dataType === 1) {
  4338. return false;
  4339. }
  4340. }
  4341. if (dataType & 2) {
  4342. // Check header width and height since there is no "TGA" magic number
  4343. var tgaHeader = BABYLON.Internals.TGATools.GetTGAHeader(xhr.response);
  4344. if (tgaHeader.width && tgaHeader.height && tgaHeader.width > 0 && tgaHeader.height > 0) {
  4345. return true;
  4346. }
  4347. else if (dataType === 2) {
  4348. return false;
  4349. }
  4350. }
  4351. if (dataType & 4) {
  4352. // Check for the "DDS" magic number
  4353. var ddsHeader = new Uint8Array(xhr.response, 0, 3);
  4354. if (ddsHeader[0] === 68 && ddsHeader[1] === 68 && ddsHeader[2] === 83) {
  4355. return true;
  4356. }
  4357. else {
  4358. return false;
  4359. }
  4360. }
  4361. }
  4362. catch (e) {
  4363. }
  4364. return false;
  4365. };
  4366. Object.defineProperty(Tools, "NoneLogLevel", {
  4367. get: function () {
  4368. return Tools._NoneLogLevel;
  4369. },
  4370. enumerable: true,
  4371. configurable: true
  4372. });
  4373. Object.defineProperty(Tools, "MessageLogLevel", {
  4374. get: function () {
  4375. return Tools._MessageLogLevel;
  4376. },
  4377. enumerable: true,
  4378. configurable: true
  4379. });
  4380. Object.defineProperty(Tools, "WarningLogLevel", {
  4381. get: function () {
  4382. return Tools._WarningLogLevel;
  4383. },
  4384. enumerable: true,
  4385. configurable: true
  4386. });
  4387. Object.defineProperty(Tools, "ErrorLogLevel", {
  4388. get: function () {
  4389. return Tools._ErrorLogLevel;
  4390. },
  4391. enumerable: true,
  4392. configurable: true
  4393. });
  4394. Object.defineProperty(Tools, "AllLogLevel", {
  4395. get: function () {
  4396. return Tools._MessageLogLevel | Tools._WarningLogLevel | Tools._ErrorLogLevel;
  4397. },
  4398. enumerable: true,
  4399. configurable: true
  4400. });
  4401. Tools._AddLogEntry = function (entry) {
  4402. Tools._LogCache = entry + Tools._LogCache;
  4403. if (Tools.OnNewCacheEntry) {
  4404. Tools.OnNewCacheEntry(entry);
  4405. }
  4406. };
  4407. Tools._FormatMessage = function (message) {
  4408. var padStr = function (i) { return (i < 10) ? "0" + i : "" + i; };
  4409. var date = new Date();
  4410. return "[" + padStr(date.getHours()) + ":" + padStr(date.getMinutes()) + ":" + padStr(date.getSeconds()) + "]: " + message;
  4411. };
  4412. Tools._LogDisabled = function (message) {
  4413. // nothing to do
  4414. };
  4415. Tools._LogEnabled = function (message) {
  4416. var formattedMessage = Tools._FormatMessage(message);
  4417. console.log("BJS - " + formattedMessage);
  4418. var entry = "<div style='color:white'>" + formattedMessage + "</div><br>";
  4419. Tools._AddLogEntry(entry);
  4420. };
  4421. Tools._WarnDisabled = function (message) {
  4422. // nothing to do
  4423. };
  4424. Tools._WarnEnabled = function (message) {
  4425. var formattedMessage = Tools._FormatMessage(message);
  4426. console.warn("BJS - " + formattedMessage);
  4427. var entry = "<div style='color:orange'>" + formattedMessage + "</div><br>";
  4428. Tools._AddLogEntry(entry);
  4429. };
  4430. Tools._ErrorDisabled = function (message) {
  4431. // nothing to do
  4432. };
  4433. Tools._ErrorEnabled = function (message) {
  4434. Tools.errorsCount++;
  4435. var formattedMessage = Tools._FormatMessage(message);
  4436. console.error("BJS - " + formattedMessage);
  4437. var entry = "<div style='color:red'>" + formattedMessage + "</div><br>";
  4438. Tools._AddLogEntry(entry);
  4439. };
  4440. Object.defineProperty(Tools, "LogCache", {
  4441. get: function () {
  4442. return Tools._LogCache;
  4443. },
  4444. enumerable: true,
  4445. configurable: true
  4446. });
  4447. Tools.ClearLogCache = function () {
  4448. Tools._LogCache = "";
  4449. Tools.errorsCount = 0;
  4450. };
  4451. Object.defineProperty(Tools, "LogLevels", {
  4452. set: function (level) {
  4453. if ((level & Tools.MessageLogLevel) === Tools.MessageLogLevel) {
  4454. Tools.Log = Tools._LogEnabled;
  4455. }
  4456. else {
  4457. Tools.Log = Tools._LogDisabled;
  4458. }
  4459. if ((level & Tools.WarningLogLevel) === Tools.WarningLogLevel) {
  4460. Tools.Warn = Tools._WarnEnabled;
  4461. }
  4462. else {
  4463. Tools.Warn = Tools._WarnDisabled;
  4464. }
  4465. if ((level & Tools.ErrorLogLevel) === Tools.ErrorLogLevel) {
  4466. Tools.Error = Tools._ErrorEnabled;
  4467. }
  4468. else {
  4469. Tools.Error = Tools._ErrorDisabled;
  4470. }
  4471. },
  4472. enumerable: true,
  4473. configurable: true
  4474. });
  4475. Object.defineProperty(Tools, "PerformanceNoneLogLevel", {
  4476. get: function () {
  4477. return Tools._PerformanceNoneLogLevel;
  4478. },
  4479. enumerable: true,
  4480. configurable: true
  4481. });
  4482. Object.defineProperty(Tools, "PerformanceUserMarkLogLevel", {
  4483. get: function () {
  4484. return Tools._PerformanceUserMarkLogLevel;
  4485. },
  4486. enumerable: true,
  4487. configurable: true
  4488. });
  4489. Object.defineProperty(Tools, "PerformanceConsoleLogLevel", {
  4490. get: function () {
  4491. return Tools._PerformanceConsoleLogLevel;
  4492. },
  4493. enumerable: true,
  4494. configurable: true
  4495. });
  4496. Object.defineProperty(Tools, "PerformanceLogLevel", {
  4497. set: function (level) {
  4498. if ((level & Tools.PerformanceUserMarkLogLevel) === Tools.PerformanceUserMarkLogLevel) {
  4499. Tools.StartPerformanceCounter = Tools._StartUserMark;
  4500. Tools.EndPerformanceCounter = Tools._EndUserMark;
  4501. return;
  4502. }
  4503. if ((level & Tools.PerformanceConsoleLogLevel) === Tools.PerformanceConsoleLogLevel) {
  4504. Tools.StartPerformanceCounter = Tools._StartPerformanceConsole;
  4505. Tools.EndPerformanceCounter = Tools._EndPerformanceConsole;
  4506. return;
  4507. }
  4508. Tools.StartPerformanceCounter = Tools._StartPerformanceCounterDisabled;
  4509. Tools.EndPerformanceCounter = Tools._EndPerformanceCounterDisabled;
  4510. },
  4511. enumerable: true,
  4512. configurable: true
  4513. });
  4514. Tools._StartPerformanceCounterDisabled = function (counterName, condition) {
  4515. };
  4516. Tools._EndPerformanceCounterDisabled = function (counterName, condition) {
  4517. };
  4518. Tools._StartUserMark = function (counterName, condition) {
  4519. if (condition === void 0) { condition = true; }
  4520. if (!condition || !Tools._performance.mark) {
  4521. return;
  4522. }
  4523. Tools._performance.mark(counterName + "-Begin");
  4524. };
  4525. Tools._EndUserMark = function (counterName, condition) {
  4526. if (condition === void 0) { condition = true; }
  4527. if (!condition || !Tools._performance.mark) {
  4528. return;
  4529. }
  4530. Tools._performance.mark(counterName + "-End");
  4531. Tools._performance.measure(counterName, counterName + "-Begin", counterName + "-End");
  4532. };
  4533. Tools._StartPerformanceConsole = function (counterName, condition) {
  4534. if (condition === void 0) { condition = true; }
  4535. if (!condition) {
  4536. return;
  4537. }
  4538. Tools._StartUserMark(counterName, condition);
  4539. if (console.time) {
  4540. console.time(counterName);
  4541. }
  4542. };
  4543. Tools._EndPerformanceConsole = function (counterName, condition) {
  4544. if (condition === void 0) { condition = true; }
  4545. if (!condition) {
  4546. return;
  4547. }
  4548. Tools._EndUserMark(counterName, condition);
  4549. if (console.time) {
  4550. console.timeEnd(counterName);
  4551. }
  4552. };
  4553. Object.defineProperty(Tools, "Now", {
  4554. get: function () {
  4555. if (window.performance && window.performance.now) {
  4556. return window.performance.now();
  4557. }
  4558. return new Date().getTime();
  4559. },
  4560. enumerable: true,
  4561. configurable: true
  4562. });
  4563. Tools.BaseUrl = "";
  4564. // Logs
  4565. Tools._NoneLogLevel = 0;
  4566. Tools._MessageLogLevel = 1;
  4567. Tools._WarningLogLevel = 2;
  4568. Tools._ErrorLogLevel = 4;
  4569. Tools._LogCache = "";
  4570. Tools.errorsCount = 0;
  4571. Tools.Log = Tools._LogEnabled;
  4572. Tools.Warn = Tools._WarnEnabled;
  4573. Tools.Error = Tools._ErrorEnabled;
  4574. // Performances
  4575. Tools._PerformanceNoneLogLevel = 0;
  4576. Tools._PerformanceUserMarkLogLevel = 1;
  4577. Tools._PerformanceConsoleLogLevel = 2;
  4578. Tools._performance = window.performance;
  4579. Tools.StartPerformanceCounter = Tools._StartPerformanceCounterDisabled;
  4580. Tools.EndPerformanceCounter = Tools._EndPerformanceCounterDisabled;
  4581. return Tools;
  4582. })();
  4583. BABYLON.Tools = Tools;
  4584. /**
  4585. * An implementation of a loop for asynchronous functions.
  4586. */
  4587. var AsyncLoop = (function () {
  4588. /**
  4589. * Constroctor.
  4590. * @param iterations the number of iterations.
  4591. * @param _fn the function to run each iteration
  4592. * @param _successCallback the callback that will be called upon succesful execution
  4593. * @param offset starting offset.
  4594. */
  4595. function AsyncLoop(iterations, _fn, _successCallback, offset) {
  4596. if (offset === void 0) { offset = 0; }
  4597. this.iterations = iterations;
  4598. this._fn = _fn;
  4599. this._successCallback = _successCallback;
  4600. this.index = offset - 1;
  4601. this._done = false;
  4602. }
  4603. /**
  4604. * Execute the next iteration. Must be called after the last iteration was finished.
  4605. */
  4606. AsyncLoop.prototype.executeNext = function () {
  4607. if (!this._done) {
  4608. if (this.index + 1 < this.iterations) {
  4609. ++this.index;
  4610. this._fn(this);
  4611. }
  4612. else {
  4613. this.breakLoop();
  4614. }
  4615. }
  4616. };
  4617. /**
  4618. * Break the loop and run the success callback.
  4619. */
  4620. AsyncLoop.prototype.breakLoop = function () {
  4621. this._done = true;
  4622. this._successCallback();
  4623. };
  4624. /**
  4625. * Helper function
  4626. */
  4627. AsyncLoop.Run = function (iterations, _fn, _successCallback, offset) {
  4628. if (offset === void 0) { offset = 0; }
  4629. var loop = new AsyncLoop(iterations, _fn, _successCallback, offset);
  4630. loop.executeNext();
  4631. return loop;
  4632. };
  4633. /**
  4634. * A for-loop that will run a given number of iterations synchronous and the rest async.
  4635. * @param iterations total number of iterations
  4636. * @param syncedIterations number of synchronous iterations in each async iteration.
  4637. * @param fn the function to call each iteration.
  4638. * @param callback a success call back that will be called when iterating stops.
  4639. * @param breakFunction a break condition (optional)
  4640. * @param timeout timeout settings for the setTimeout function. default - 0.
  4641. * @constructor
  4642. */
  4643. AsyncLoop.SyncAsyncForLoop = function (iterations, syncedIterations, fn, callback, breakFunction, timeout) {
  4644. if (timeout === void 0) { timeout = 0; }
  4645. AsyncLoop.Run(Math.ceil(iterations / syncedIterations), function (loop) {
  4646. if (breakFunction && breakFunction())
  4647. loop.breakLoop();
  4648. else {
  4649. setTimeout(function () {
  4650. for (var i = 0; i < syncedIterations; ++i) {
  4651. var iteration = (loop.index * syncedIterations) + i;
  4652. if (iteration >= iterations)
  4653. break;
  4654. fn(iteration);
  4655. if (breakFunction && breakFunction()) {
  4656. loop.breakLoop();
  4657. break;
  4658. }
  4659. }
  4660. loop.executeNext();
  4661. }, timeout);
  4662. }
  4663. }, callback);
  4664. };
  4665. return AsyncLoop;
  4666. })();
  4667. BABYLON.AsyncLoop = AsyncLoop;
  4668. })(BABYLON || (BABYLON = {}));
  4669. var BABYLON;
  4670. (function (BABYLON) {
  4671. var _DepthCullingState = (function () {
  4672. function _DepthCullingState() {
  4673. this._isDepthTestDirty = false;
  4674. this._isDepthMaskDirty = false;
  4675. this._isDepthFuncDirty = false;
  4676. this._isCullFaceDirty = false;
  4677. this._isCullDirty = false;
  4678. this._isZOffsetDirty = false;
  4679. }
  4680. Object.defineProperty(_DepthCullingState.prototype, "isDirty", {
  4681. get: function () {
  4682. return this._isDepthFuncDirty || this._isDepthTestDirty || this._isDepthMaskDirty || this._isCullFaceDirty || this._isCullDirty || this._isZOffsetDirty;
  4683. },
  4684. enumerable: true,
  4685. configurable: true
  4686. });
  4687. Object.defineProperty(_DepthCullingState.prototype, "zOffset", {
  4688. get: function () {
  4689. return this._zOffset;
  4690. },
  4691. set: function (value) {
  4692. if (this._zOffset === value) {
  4693. return;
  4694. }
  4695. this._zOffset = value;
  4696. this._isZOffsetDirty = true;
  4697. },
  4698. enumerable: true,
  4699. configurable: true
  4700. });
  4701. Object.defineProperty(_DepthCullingState.prototype, "cullFace", {
  4702. get: function () {
  4703. return this._cullFace;
  4704. },
  4705. set: function (value) {
  4706. if (this._cullFace === value) {
  4707. return;
  4708. }
  4709. this._cullFace = value;
  4710. this._isCullFaceDirty = true;
  4711. },
  4712. enumerable: true,
  4713. configurable: true
  4714. });
  4715. Object.defineProperty(_DepthCullingState.prototype, "cull", {
  4716. get: function () {
  4717. return this._cull;
  4718. },
  4719. set: function (value) {
  4720. if (this._cull === value) {
  4721. return;
  4722. }
  4723. this._cull = value;
  4724. this._isCullDirty = true;
  4725. },
  4726. enumerable: true,
  4727. configurable: true
  4728. });
  4729. Object.defineProperty(_DepthCullingState.prototype, "depthFunc", {
  4730. get: function () {
  4731. return this._depthFunc;
  4732. },
  4733. set: function (value) {
  4734. if (this._depthFunc === value) {
  4735. return;
  4736. }
  4737. this._depthFunc = value;
  4738. this._isDepthFuncDirty = true;
  4739. },
  4740. enumerable: true,
  4741. configurable: true
  4742. });
  4743. Object.defineProperty(_DepthCullingState.prototype, "depthMask", {
  4744. get: function () {
  4745. return this._depthMask;
  4746. },
  4747. set: function (value) {
  4748. if (this._depthMask === value) {
  4749. return;
  4750. }
  4751. this._depthMask = value;
  4752. this._isDepthMaskDirty = true;
  4753. },
  4754. enumerable: true,
  4755. configurable: true
  4756. });
  4757. Object.defineProperty(_DepthCullingState.prototype, "depthTest", {
  4758. get: function () {
  4759. return this._depthTest;
  4760. },
  4761. set: function (value) {
  4762. if (this._depthTest === value) {
  4763. return;
  4764. }
  4765. this._depthTest = value;
  4766. this._isDepthTestDirty = true;
  4767. },
  4768. enumerable: true,
  4769. configurable: true
  4770. });
  4771. _DepthCullingState.prototype.reset = function () {
  4772. this._depthMask = true;
  4773. this._depthTest = true;
  4774. this._depthFunc = null;
  4775. this._cull = null;
  4776. this._cullFace = null;
  4777. this._zOffset = 0;
  4778. this._isDepthTestDirty = true;
  4779. this._isDepthMaskDirty = true;
  4780. this._isDepthFuncDirty = false;
  4781. this._isCullFaceDirty = false;
  4782. this._isCullDirty = false;
  4783. this._isZOffsetDirty = false;
  4784. };
  4785. _DepthCullingState.prototype.apply = function (gl) {
  4786. if (!this.isDirty) {
  4787. return;
  4788. }
  4789. // Cull
  4790. if (this._isCullDirty) {
  4791. if (this.cull) {
  4792. gl.enable(gl.CULL_FACE);
  4793. }
  4794. else {
  4795. gl.disable(gl.CULL_FACE);
  4796. }
  4797. this._isCullDirty = false;
  4798. }
  4799. // Cull face
  4800. if (this._isCullFaceDirty) {
  4801. gl.cullFace(this.cullFace);
  4802. this._isCullFaceDirty = false;
  4803. }
  4804. // Depth mask
  4805. if (this._isDepthMaskDirty) {
  4806. gl.depthMask(this.depthMask);
  4807. this._isDepthMaskDirty = false;
  4808. }
  4809. // Depth test
  4810. if (this._isDepthTestDirty) {
  4811. if (this.depthTest) {
  4812. gl.enable(gl.DEPTH_TEST);
  4813. }
  4814. else {
  4815. gl.disable(gl.DEPTH_TEST);
  4816. }
  4817. this._isDepthTestDirty = false;
  4818. }
  4819. // Depth func
  4820. if (this._isDepthFuncDirty) {
  4821. gl.depthFunc(this.depthFunc);
  4822. this._isDepthFuncDirty = false;
  4823. }
  4824. // zOffset
  4825. if (this._isZOffsetDirty) {
  4826. if (this.zOffset) {
  4827. gl.enable(gl.POLYGON_OFFSET_FILL);
  4828. gl.polygonOffset(this.zOffset, 0);
  4829. }
  4830. else {
  4831. gl.disable(gl.POLYGON_OFFSET_FILL);
  4832. }
  4833. this._isZOffsetDirty = false;
  4834. }
  4835. };
  4836. return _DepthCullingState;
  4837. })();
  4838. BABYLON._DepthCullingState = _DepthCullingState;
  4839. var _AlphaState = (function () {
  4840. function _AlphaState() {
  4841. this._isAlphaBlendDirty = false;
  4842. this._isBlendFunctionParametersDirty = false;
  4843. this._alphaBlend = false;
  4844. this._blendFunctionParameters = new Array(4);
  4845. }
  4846. Object.defineProperty(_AlphaState.prototype, "isDirty", {
  4847. get: function () {
  4848. return this._isAlphaBlendDirty || this._isBlendFunctionParametersDirty;
  4849. },
  4850. enumerable: true,
  4851. configurable: true
  4852. });
  4853. Object.defineProperty(_AlphaState.prototype, "alphaBlend", {
  4854. get: function () {
  4855. return this._alphaBlend;
  4856. },
  4857. set: function (value) {
  4858. if (this._alphaBlend === value) {
  4859. return;
  4860. }
  4861. this._alphaBlend = value;
  4862. this._isAlphaBlendDirty = true;
  4863. },
  4864. enumerable: true,
  4865. configurable: true
  4866. });
  4867. _AlphaState.prototype.setAlphaBlendFunctionParameters = function (value0, value1, value2, value3) {
  4868. if (this._blendFunctionParameters[0] === value0 &&
  4869. this._blendFunctionParameters[1] === value1 &&
  4870. this._blendFunctionParameters[2] === value2 &&
  4871. this._blendFunctionParameters[3] === value3) {
  4872. return;
  4873. }
  4874. this._blendFunctionParameters[0] = value0;
  4875. this._blendFunctionParameters[1] = value1;
  4876. this._blendFunctionParameters[2] = value2;
  4877. this._blendFunctionParameters[3] = value3;
  4878. this._isBlendFunctionParametersDirty = true;
  4879. };
  4880. _AlphaState.prototype.reset = function () {
  4881. this._alphaBlend = false;
  4882. this._blendFunctionParameters[0] = null;
  4883. this._blendFunctionParameters[1] = null;
  4884. this._blendFunctionParameters[2] = null;
  4885. this._blendFunctionParameters[3] = null;
  4886. this._isAlphaBlendDirty = true;
  4887. this._isBlendFunctionParametersDirty = false;
  4888. };
  4889. _AlphaState.prototype.apply = function (gl) {
  4890. if (!this.isDirty) {
  4891. return;
  4892. }
  4893. // Alpha blend
  4894. if (this._isAlphaBlendDirty) {
  4895. if (this._alphaBlend) {
  4896. gl.enable(gl.BLEND);
  4897. }
  4898. else {
  4899. gl.disable(gl.BLEND);
  4900. }
  4901. this._isAlphaBlendDirty = false;
  4902. }
  4903. // Alpha function
  4904. if (this._isBlendFunctionParametersDirty) {
  4905. gl.blendFuncSeparate(this._blendFunctionParameters[0], this._blendFunctionParameters[1], this._blendFunctionParameters[2], this._blendFunctionParameters[3]);
  4906. this._isBlendFunctionParametersDirty = false;
  4907. }
  4908. };
  4909. return _AlphaState;
  4910. })();
  4911. BABYLON._AlphaState = _AlphaState;
  4912. var compileShader = function (gl, source, type, defines) {
  4913. var shader = gl.createShader(type === "vertex" ? gl.VERTEX_SHADER : gl.FRAGMENT_SHADER);
  4914. gl.shaderSource(shader, (defines ? defines + "\n" : "") + source);
  4915. gl.compileShader(shader);
  4916. if (!gl.getShaderParameter(shader, gl.COMPILE_STATUS)) {
  4917. throw new Error(gl.getShaderInfoLog(shader));
  4918. }
  4919. return shader;
  4920. };
  4921. var getWebGLTextureType = function (gl, type) {
  4922. var textureType = gl.UNSIGNED_BYTE;
  4923. if (type === Engine.TEXTURETYPE_FLOAT)
  4924. textureType = gl.FLOAT;
  4925. return textureType;
  4926. };
  4927. var getSamplingParameters = function (samplingMode, generateMipMaps, gl) {
  4928. var magFilter = gl.NEAREST;
  4929. var minFilter = gl.NEAREST;
  4930. if (samplingMode === BABYLON.Texture.BILINEAR_SAMPLINGMODE) {
  4931. magFilter = gl.LINEAR;
  4932. if (generateMipMaps) {
  4933. minFilter = gl.LINEAR_MIPMAP_NEAREST;
  4934. }
  4935. else {
  4936. minFilter = gl.LINEAR;
  4937. }
  4938. }
  4939. else if (samplingMode === BABYLON.Texture.TRILINEAR_SAMPLINGMODE) {
  4940. magFilter = gl.LINEAR;
  4941. if (generateMipMaps) {
  4942. minFilter = gl.LINEAR_MIPMAP_LINEAR;
  4943. }
  4944. else {
  4945. minFilter = gl.LINEAR;
  4946. }
  4947. }
  4948. else if (samplingMode === BABYLON.Texture.NEAREST_SAMPLINGMODE) {
  4949. magFilter = gl.NEAREST;
  4950. if (generateMipMaps) {
  4951. minFilter = gl.NEAREST_MIPMAP_LINEAR;
  4952. }
  4953. else {
  4954. minFilter = gl.NEAREST;
  4955. }
  4956. }
  4957. return {
  4958. min: minFilter,
  4959. mag: magFilter
  4960. };
  4961. };
  4962. var prepareWebGLTexture = function (texture, gl, scene, width, height, invertY, noMipmap, isCompressed, processFunction, samplingMode) {
  4963. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  4964. var engine = scene.getEngine();
  4965. var potWidth = BABYLON.Tools.GetExponentOfTwo(width, engine.getCaps().maxTextureSize);
  4966. var potHeight = BABYLON.Tools.GetExponentOfTwo(height, engine.getCaps().maxTextureSize);
  4967. gl.bindTexture(gl.TEXTURE_2D, texture);
  4968. gl.pixelStorei(gl.UNPACK_FLIP_Y_WEBGL, invertY === undefined ? 1 : (invertY ? 1 : 0));
  4969. texture._baseWidth = width;
  4970. texture._baseHeight = height;
  4971. texture._width = potWidth;
  4972. texture._height = potHeight;
  4973. texture.isReady = true;
  4974. processFunction(potWidth, potHeight);
  4975. var filters = getSamplingParameters(samplingMode, !noMipmap, gl);
  4976. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MAG_FILTER, filters.mag);
  4977. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MIN_FILTER, filters.min);
  4978. if (!noMipmap && !isCompressed) {
  4979. gl.generateMipmap(gl.TEXTURE_2D);
  4980. }
  4981. gl.bindTexture(gl.TEXTURE_2D, null);
  4982. engine.resetTextureCache();
  4983. scene._removePendingData(texture);
  4984. };
  4985. var partialLoad = function (url, index, loadedImages, scene, onfinish) {
  4986. var onload = function () {
  4987. loadedImages[index] = img;
  4988. loadedImages._internalCount++;
  4989. scene._removePendingData(img);
  4990. if (loadedImages._internalCount === 6) {
  4991. onfinish(loadedImages);
  4992. }
  4993. };
  4994. var onerror = function () {
  4995. scene._removePendingData(img);
  4996. };
  4997. var img = BABYLON.Tools.LoadImage(url, onload, onerror, scene.database);
  4998. scene._addPendingData(img);
  4999. };
  5000. var cascadeLoad = function (rootUrl, scene, onfinish, extensions) {
  5001. var loadedImages = [];
  5002. loadedImages._internalCount = 0;
  5003. for (var index = 0; index < 6; index++) {
  5004. partialLoad(rootUrl + extensions[index], index, loadedImages, scene, onfinish);
  5005. }
  5006. };
  5007. var EngineCapabilities = (function () {
  5008. function EngineCapabilities() {
  5009. }
  5010. return EngineCapabilities;
  5011. })();
  5012. BABYLON.EngineCapabilities = EngineCapabilities;
  5013. /**
  5014. * The engine class is responsible for interfacing with all lower-level APIs such as WebGL and Audio.
  5015. */
  5016. var Engine = (function () {
  5017. /**
  5018. * @constructor
  5019. * @param {HTMLCanvasElement} canvas - the canvas to be used for rendering
  5020. * @param {boolean} [antialias] - enable antialias
  5021. * @param options - further options to be sent to the getContext function
  5022. */
  5023. function Engine(canvas, antialias, options, adaptToDeviceRatio) {
  5024. var _this = this;
  5025. if (adaptToDeviceRatio === void 0) { adaptToDeviceRatio = true; }
  5026. // Public members
  5027. this.isFullscreen = false;
  5028. this.isPointerLock = false;
  5029. this.cullBackFaces = true;
  5030. this.renderEvenInBackground = true;
  5031. // To enable/disable IDB support and avoid XHR on .manifest
  5032. this.enableOfflineSupport = true;
  5033. this.scenes = new Array();
  5034. this._windowIsBackground = false;
  5035. this._drawCalls = 0;
  5036. this._renderingQueueLaunched = false;
  5037. this._activeRenderLoops = [];
  5038. // FPS
  5039. this.fpsRange = 60;
  5040. this.previousFramesDuration = [];
  5041. this.fps = 60;
  5042. this.deltaTime = 0;
  5043. // States
  5044. this._depthCullingState = new _DepthCullingState();
  5045. this._alphaState = new _AlphaState();
  5046. this._alphaMode = Engine.ALPHA_DISABLE;
  5047. // Cache
  5048. this._loadedTexturesCache = new Array();
  5049. this._maxTextureChannels = 16;
  5050. this._activeTexturesCache = new Array(this._maxTextureChannels);
  5051. this._compiledEffects = {};
  5052. this._uintIndicesCurrentlySet = false;
  5053. this._renderingCanvas = canvas;
  5054. options = options || {};
  5055. options.antialias = antialias;
  5056. if (options.preserveDrawingBuffer === undefined) {
  5057. options.preserveDrawingBuffer = false;
  5058. }
  5059. // GL
  5060. try {
  5061. this._gl = (canvas.getContext("webgl", options) || canvas.getContext("experimental-webgl", options));
  5062. }
  5063. catch (e) {
  5064. throw new Error("WebGL not supported");
  5065. }
  5066. if (!this._gl) {
  5067. throw new Error("WebGL not supported");
  5068. }
  5069. this._onBlur = function () {
  5070. _this._windowIsBackground = true;
  5071. };
  5072. this._onFocus = function () {
  5073. _this._windowIsBackground = false;
  5074. };
  5075. window.addEventListener("blur", this._onBlur);
  5076. window.addEventListener("focus", this._onFocus);
  5077. // Viewport
  5078. this._hardwareScalingLevel = adaptToDeviceRatio ? 1.0 / (window.devicePixelRatio || 1.0) : 1.0;
  5079. this.resize();
  5080. // Caps
  5081. this._caps = new EngineCapabilities();
  5082. this._caps.maxTexturesImageUnits = this._gl.getParameter(this._gl.MAX_TEXTURE_IMAGE_UNITS);
  5083. this._caps.maxTextureSize = this._gl.getParameter(this._gl.MAX_TEXTURE_SIZE);
  5084. this._caps.maxCubemapTextureSize = this._gl.getParameter(this._gl.MAX_CUBE_MAP_TEXTURE_SIZE);
  5085. this._caps.maxRenderTextureSize = this._gl.getParameter(this._gl.MAX_RENDERBUFFER_SIZE);
  5086. // Infos
  5087. this._glVersion = this._gl.getParameter(this._gl.VERSION);
  5088. var rendererInfo = this._gl.getExtension("WEBGL_debug_renderer_info");
  5089. if (rendererInfo != null) {
  5090. this._glRenderer = this._gl.getParameter(rendererInfo.UNMASKED_RENDERER_WEBGL);
  5091. this._glVendor = this._gl.getParameter(rendererInfo.UNMASKED_VENDOR_WEBGL);
  5092. }
  5093. if (!this._glVendor) {
  5094. this._glVendor = "Unknown vendor";
  5095. }
  5096. if (!this._glRenderer) {
  5097. this._glRenderer = "Unknown renderer";
  5098. }
  5099. // Extensions
  5100. this._caps.standardDerivatives = (this._gl.getExtension('OES_standard_derivatives') !== null);
  5101. this._caps.s3tc = this._gl.getExtension('WEBGL_compressed_texture_s3tc');
  5102. this._caps.textureFloat = (this._gl.getExtension('OES_texture_float') !== null);
  5103. this._caps.textureAnisotropicFilterExtension = this._gl.getExtension('EXT_texture_filter_anisotropic') || this._gl.getExtension('WEBKIT_EXT_texture_filter_anisotropic') || this._gl.getExtension('MOZ_EXT_texture_filter_anisotropic');
  5104. this._caps.maxAnisotropy = this._caps.textureAnisotropicFilterExtension ? this._gl.getParameter(this._caps.textureAnisotropicFilterExtension.MAX_TEXTURE_MAX_ANISOTROPY_EXT) : 0;
  5105. this._caps.instancedArrays = this._gl.getExtension('ANGLE_instanced_arrays');
  5106. this._caps.uintIndices = this._gl.getExtension('OES_element_index_uint') !== null;
  5107. this._caps.highPrecisionShaderSupported = true;
  5108. if (this._gl.getShaderPrecisionFormat) {
  5109. var highp = this._gl.getShaderPrecisionFormat(this._gl.FRAGMENT_SHADER, this._gl.HIGH_FLOAT);
  5110. this._caps.highPrecisionShaderSupported = highp.precision !== 0;
  5111. }
  5112. // Depth buffer
  5113. this.setDepthBuffer(true);
  5114. this.setDepthFunctionToLessOrEqual();
  5115. this.setDepthWrite(true);
  5116. // Fullscreen
  5117. this._onFullscreenChange = function () {
  5118. if (document.fullscreen !== undefined) {
  5119. _this.isFullscreen = document.fullscreen;
  5120. }
  5121. else if (document.mozFullScreen !== undefined) {
  5122. _this.isFullscreen = document.mozFullScreen;
  5123. }
  5124. else if (document.webkitIsFullScreen !== undefined) {
  5125. _this.isFullscreen = document.webkitIsFullScreen;
  5126. }
  5127. else if (document.msIsFullScreen !== undefined) {
  5128. _this.isFullscreen = document.msIsFullScreen;
  5129. }
  5130. // Pointer lock
  5131. if (_this.isFullscreen && _this._pointerLockRequested) {
  5132. canvas.requestPointerLock = canvas.requestPointerLock ||
  5133. canvas.msRequestPointerLock ||
  5134. canvas.mozRequestPointerLock ||
  5135. canvas.webkitRequestPointerLock;
  5136. if (canvas.requestPointerLock) {
  5137. canvas.requestPointerLock();
  5138. }
  5139. }
  5140. };
  5141. document.addEventListener("fullscreenchange", this._onFullscreenChange, false);
  5142. document.addEventListener("mozfullscreenchange", this._onFullscreenChange, false);
  5143. document.addEventListener("webkitfullscreenchange", this._onFullscreenChange, false);
  5144. document.addEventListener("msfullscreenchange", this._onFullscreenChange, false);
  5145. // Pointer lock
  5146. this._onPointerLockChange = function () {
  5147. _this.isPointerLock = (document.mozPointerLockElement === canvas ||
  5148. document.webkitPointerLockElement === canvas ||
  5149. document.msPointerLockElement === canvas ||
  5150. document.pointerLockElement === canvas);
  5151. };
  5152. document.addEventListener("pointerlockchange", this._onPointerLockChange, false);
  5153. document.addEventListener("mspointerlockchange", this._onPointerLockChange, false);
  5154. document.addEventListener("mozpointerlockchange", this._onPointerLockChange, false);
  5155. document.addEventListener("webkitpointerlockchange", this._onPointerLockChange, false);
  5156. if (BABYLON.AudioEngine && !Engine.audioEngine) {
  5157. Engine.audioEngine = new BABYLON.AudioEngine();
  5158. }
  5159. //default loading screen
  5160. this._loadingScreen = new BABYLON.DefaultLoadingScreen(this._renderingCanvas);
  5161. BABYLON.Tools.Log("Babylon.js engine (v" + Engine.Version + ") launched");
  5162. }
  5163. Object.defineProperty(Engine, "ALPHA_DISABLE", {
  5164. get: function () {
  5165. return Engine._ALPHA_DISABLE;
  5166. },
  5167. enumerable: true,
  5168. configurable: true
  5169. });
  5170. Object.defineProperty(Engine, "ALPHA_ONEONE", {
  5171. get: function () {
  5172. return Engine._ALPHA_ONEONE;
  5173. },
  5174. enumerable: true,
  5175. configurable: true
  5176. });
  5177. Object.defineProperty(Engine, "ALPHA_ADD", {
  5178. get: function () {
  5179. return Engine._ALPHA_ADD;
  5180. },
  5181. enumerable: true,
  5182. configurable: true
  5183. });
  5184. Object.defineProperty(Engine, "ALPHA_COMBINE", {
  5185. get: function () {
  5186. return Engine._ALPHA_COMBINE;
  5187. },
  5188. enumerable: true,
  5189. configurable: true
  5190. });
  5191. Object.defineProperty(Engine, "ALPHA_SUBTRACT", {
  5192. get: function () {
  5193. return Engine._ALPHA_SUBTRACT;
  5194. },
  5195. enumerable: true,
  5196. configurable: true
  5197. });
  5198. Object.defineProperty(Engine, "ALPHA_MULTIPLY", {
  5199. get: function () {
  5200. return Engine._ALPHA_MULTIPLY;
  5201. },
  5202. enumerable: true,
  5203. configurable: true
  5204. });
  5205. Object.defineProperty(Engine, "ALPHA_MAXIMIZED", {
  5206. get: function () {
  5207. return Engine._ALPHA_MAXIMIZED;
  5208. },
  5209. enumerable: true,
  5210. configurable: true
  5211. });
  5212. Object.defineProperty(Engine, "DELAYLOADSTATE_NONE", {
  5213. get: function () {
  5214. return Engine._DELAYLOADSTATE_NONE;
  5215. },
  5216. enumerable: true,
  5217. configurable: true
  5218. });
  5219. Object.defineProperty(Engine, "DELAYLOADSTATE_LOADED", {
  5220. get: function () {
  5221. return Engine._DELAYLOADSTATE_LOADED;
  5222. },
  5223. enumerable: true,
  5224. configurable: true
  5225. });
  5226. Object.defineProperty(Engine, "DELAYLOADSTATE_LOADING", {
  5227. get: function () {
  5228. return Engine._DELAYLOADSTATE_LOADING;
  5229. },
  5230. enumerable: true,
  5231. configurable: true
  5232. });
  5233. Object.defineProperty(Engine, "DELAYLOADSTATE_NOTLOADED", {
  5234. get: function () {
  5235. return Engine._DELAYLOADSTATE_NOTLOADED;
  5236. },
  5237. enumerable: true,
  5238. configurable: true
  5239. });
  5240. Object.defineProperty(Engine, "TEXTUREFORMAT_ALPHA", {
  5241. get: function () {
  5242. return Engine._TEXTUREFORMAT_ALPHA;
  5243. },
  5244. enumerable: true,
  5245. configurable: true
  5246. });
  5247. Object.defineProperty(Engine, "TEXTUREFORMAT_LUMINANCE", {
  5248. get: function () {
  5249. return Engine._TEXTUREFORMAT_LUMINANCE;
  5250. },
  5251. enumerable: true,
  5252. configurable: true
  5253. });
  5254. Object.defineProperty(Engine, "TEXTUREFORMAT_LUMINANCE_ALPHA", {
  5255. get: function () {
  5256. return Engine._TEXTUREFORMAT_LUMINANCE_ALPHA;
  5257. },
  5258. enumerable: true,
  5259. configurable: true
  5260. });
  5261. Object.defineProperty(Engine, "TEXTUREFORMAT_RGB", {
  5262. get: function () {
  5263. return Engine._TEXTUREFORMAT_RGB;
  5264. },
  5265. enumerable: true,
  5266. configurable: true
  5267. });
  5268. Object.defineProperty(Engine, "TEXTUREFORMAT_RGBA", {
  5269. get: function () {
  5270. return Engine._TEXTUREFORMAT_RGBA;
  5271. },
  5272. enumerable: true,
  5273. configurable: true
  5274. });
  5275. Object.defineProperty(Engine, "TEXTURETYPE_UNSIGNED_INT", {
  5276. get: function () {
  5277. return Engine._TEXTURETYPE_UNSIGNED_INT;
  5278. },
  5279. enumerable: true,
  5280. configurable: true
  5281. });
  5282. Object.defineProperty(Engine, "TEXTURETYPE_FLOAT", {
  5283. get: function () {
  5284. return Engine._TEXTURETYPE_FLOAT;
  5285. },
  5286. enumerable: true,
  5287. configurable: true
  5288. });
  5289. Object.defineProperty(Engine, "Version", {
  5290. get: function () {
  5291. return "2.3.0-alpha";
  5292. },
  5293. enumerable: true,
  5294. configurable: true
  5295. });
  5296. Engine.prototype._prepareWorkingCanvas = function () {
  5297. if (this._workingCanvas) {
  5298. return;
  5299. }
  5300. this._workingCanvas = document.createElement("canvas");
  5301. this._workingContext = this._workingCanvas.getContext("2d");
  5302. };
  5303. Engine.prototype.resetTextureCache = function () {
  5304. for (var index = 0; index < this._maxTextureChannels; index++) {
  5305. this._activeTexturesCache[index] = null;
  5306. }
  5307. };
  5308. Engine.prototype.getGlInfo = function () {
  5309. return {
  5310. vendor: this._glVendor,
  5311. renderer: this._glRenderer,
  5312. version: this._glVersion
  5313. };
  5314. };
  5315. Engine.prototype.getAspectRatio = function (camera) {
  5316. var viewport = camera.viewport;
  5317. return (this.getRenderWidth() * viewport.width) / (this.getRenderHeight() * viewport.height);
  5318. };
  5319. Engine.prototype.getRenderWidth = function () {
  5320. if (this._currentRenderTarget) {
  5321. return this._currentRenderTarget._width;
  5322. }
  5323. return this._renderingCanvas.width;
  5324. };
  5325. Engine.prototype.getRenderHeight = function () {
  5326. if (this._currentRenderTarget) {
  5327. return this._currentRenderTarget._height;
  5328. }
  5329. return this._renderingCanvas.height;
  5330. };
  5331. Engine.prototype.getRenderingCanvas = function () {
  5332. return this._renderingCanvas;
  5333. };
  5334. Engine.prototype.getRenderingCanvasClientRect = function () {
  5335. return this._renderingCanvas.getBoundingClientRect();
  5336. };
  5337. Engine.prototype.setHardwareScalingLevel = function (level) {
  5338. this._hardwareScalingLevel = level;
  5339. this.resize();
  5340. };
  5341. Engine.prototype.getHardwareScalingLevel = function () {
  5342. return this._hardwareScalingLevel;
  5343. };
  5344. Engine.prototype.getLoadedTexturesCache = function () {
  5345. return this._loadedTexturesCache;
  5346. };
  5347. Engine.prototype.getCaps = function () {
  5348. return this._caps;
  5349. };
  5350. Object.defineProperty(Engine.prototype, "drawCalls", {
  5351. get: function () {
  5352. return this._drawCalls;
  5353. },
  5354. enumerable: true,
  5355. configurable: true
  5356. });
  5357. // Methods
  5358. Engine.prototype.resetDrawCalls = function () {
  5359. this._drawCalls = 0;
  5360. };
  5361. Engine.prototype.setDepthFunctionToGreater = function () {
  5362. this._depthCullingState.depthFunc = this._gl.GREATER;
  5363. };
  5364. Engine.prototype.setDepthFunctionToGreaterOrEqual = function () {
  5365. this._depthCullingState.depthFunc = this._gl.GEQUAL;
  5366. };
  5367. Engine.prototype.setDepthFunctionToLess = function () {
  5368. this._depthCullingState.depthFunc = this._gl.LESS;
  5369. };
  5370. Engine.prototype.setDepthFunctionToLessOrEqual = function () {
  5371. this._depthCullingState.depthFunc = this._gl.LEQUAL;
  5372. };
  5373. /**
  5374. * stop executing a render loop function and remove it from the execution array
  5375. * @param {Function} [renderFunction] the function to be removed. If not provided all functions will be removed.
  5376. */
  5377. Engine.prototype.stopRenderLoop = function (renderFunction) {
  5378. if (!renderFunction) {
  5379. this._activeRenderLoops = [];
  5380. return;
  5381. }
  5382. var index = this._activeRenderLoops.indexOf(renderFunction);
  5383. if (index >= 0) {
  5384. this._activeRenderLoops.splice(index, 1);
  5385. }
  5386. };
  5387. Engine.prototype._renderLoop = function () {
  5388. var shouldRender = true;
  5389. if (!this.renderEvenInBackground && this._windowIsBackground) {
  5390. shouldRender = false;
  5391. }
  5392. if (shouldRender) {
  5393. // Start new frame
  5394. this.beginFrame();
  5395. for (var index = 0; index < this._activeRenderLoops.length; index++) {
  5396. var renderFunction = this._activeRenderLoops[index];
  5397. renderFunction();
  5398. }
  5399. // Present
  5400. this.endFrame();
  5401. }
  5402. if (this._activeRenderLoops.length > 0) {
  5403. // Register new frame
  5404. BABYLON.Tools.QueueNewFrame(this._bindedRenderFunction);
  5405. }
  5406. else {
  5407. this._renderingQueueLaunched = false;
  5408. }
  5409. };
  5410. /**
  5411. * Register and execute a render loop. The engine can have more than one render function.
  5412. * @param {Function} renderFunction - the function to continuesly execute starting the next render loop.
  5413. * @example
  5414. * engine.runRenderLoop(function () {
  5415. * scene.render()
  5416. * })
  5417. */
  5418. Engine.prototype.runRenderLoop = function (renderFunction) {
  5419. if (this._activeRenderLoops.indexOf(renderFunction) !== -1) {
  5420. return;
  5421. }
  5422. this._activeRenderLoops.push(renderFunction);
  5423. if (!this._renderingQueueLaunched) {
  5424. this._renderingQueueLaunched = true;
  5425. this._bindedRenderFunction = this._renderLoop.bind(this);
  5426. BABYLON.Tools.QueueNewFrame(this._bindedRenderFunction);
  5427. }
  5428. };
  5429. /**
  5430. * Toggle full screen mode.
  5431. * @param {boolean} requestPointerLock - should a pointer lock be requested from the user
  5432. */
  5433. Engine.prototype.switchFullscreen = function (requestPointerLock) {
  5434. if (this.isFullscreen) {
  5435. BABYLON.Tools.ExitFullscreen();
  5436. }
  5437. else {
  5438. this._pointerLockRequested = requestPointerLock;
  5439. BABYLON.Tools.RequestFullscreen(this._renderingCanvas);
  5440. }
  5441. };
  5442. Engine.prototype.clear = function (color, backBuffer, depthStencil) {
  5443. this.applyStates();
  5444. this._gl.clearColor(color.r, color.g, color.b, color.a !== undefined ? color.a : 1.0);
  5445. if (this._depthCullingState.depthMask) {
  5446. this._gl.clearDepth(1.0);
  5447. }
  5448. var mode = 0;
  5449. if (backBuffer)
  5450. mode |= this._gl.COLOR_BUFFER_BIT;
  5451. if (depthStencil && this._depthCullingState.depthMask)
  5452. mode |= this._gl.DEPTH_BUFFER_BIT;
  5453. this._gl.clear(mode);
  5454. };
  5455. /**
  5456. * Set the WebGL's viewport
  5457. * @param {BABYLON.Viewport} viewport - the viewport element to be used.
  5458. * @param {number} [requiredWidth] - the width required for rendering. If not provided the rendering canvas' width is used.
  5459. * @param {number} [requiredHeight] - the height required for rendering. If not provided the rendering canvas' height is used.
  5460. */
  5461. Engine.prototype.setViewport = function (viewport, requiredWidth, requiredHeight) {
  5462. var width = requiredWidth || (navigator.isCocoonJS ? window.innerWidth : this._renderingCanvas.width);
  5463. var height = requiredHeight || (navigator.isCocoonJS ? window.innerHeight : this._renderingCanvas.height);
  5464. var x = viewport.x || 0;
  5465. var y = viewport.y || 0;
  5466. this._cachedViewport = viewport;
  5467. this._gl.viewport(x * width, y * height, width * viewport.width, height * viewport.height);
  5468. };
  5469. Engine.prototype.setDirectViewport = function (x, y, width, height) {
  5470. this._cachedViewport = null;
  5471. this._gl.viewport(x, y, width, height);
  5472. };
  5473. Engine.prototype.beginFrame = function () {
  5474. this._measureFps();
  5475. };
  5476. Engine.prototype.endFrame = function () {
  5477. //this.flushFramebuffer();
  5478. };
  5479. /**
  5480. * resize the view according to the canvas' size.
  5481. * @example
  5482. * window.addEventListener("resize", function () {
  5483. * engine.resize();
  5484. * });
  5485. */
  5486. Engine.prototype.resize = function () {
  5487. var width = navigator.isCocoonJS ? window.innerWidth : this._renderingCanvas.clientWidth;
  5488. var height = navigator.isCocoonJS ? window.innerHeight : this._renderingCanvas.clientHeight;
  5489. this.setSize(width / this._hardwareScalingLevel, height / this._hardwareScalingLevel);
  5490. };
  5491. /**
  5492. * force a specific size of the canvas
  5493. * @param {number} width - the new canvas' width
  5494. * @param {number} height - the new canvas' height
  5495. */
  5496. Engine.prototype.setSize = function (width, height) {
  5497. this._renderingCanvas.width = width;
  5498. this._renderingCanvas.height = height;
  5499. for (var index = 0; index < this.scenes.length; index++) {
  5500. var scene = this.scenes[index];
  5501. for (var camIndex = 0; camIndex < scene.cameras.length; camIndex++) {
  5502. var cam = scene.cameras[camIndex];
  5503. cam._currentRenderId = 0;
  5504. }
  5505. }
  5506. };
  5507. Engine.prototype.bindFramebuffer = function (texture, faceIndex) {
  5508. this._currentRenderTarget = texture;
  5509. var gl = this._gl;
  5510. gl.bindFramebuffer(gl.FRAMEBUFFER, texture._framebuffer);
  5511. if (texture.isCube) {
  5512. gl.framebufferTexture2D(gl.FRAMEBUFFER, gl.COLOR_ATTACHMENT0, gl.TEXTURE_CUBE_MAP_POSITIVE_X + faceIndex, texture, 0);
  5513. }
  5514. else {
  5515. gl.framebufferTexture2D(gl.FRAMEBUFFER, gl.COLOR_ATTACHMENT0, gl.TEXTURE_2D, texture, 0);
  5516. }
  5517. this._gl.viewport(0, 0, texture._width, texture._height);
  5518. this.wipeCaches();
  5519. };
  5520. Engine.prototype.unBindFramebuffer = function (texture, disableGenerateMipMaps) {
  5521. if (disableGenerateMipMaps === void 0) { disableGenerateMipMaps = false; }
  5522. this._currentRenderTarget = null;
  5523. if (texture.generateMipMaps && !disableGenerateMipMaps) {
  5524. var gl = this._gl;
  5525. gl.bindTexture(gl.TEXTURE_2D, texture);
  5526. gl.generateMipmap(gl.TEXTURE_2D);
  5527. gl.bindTexture(gl.TEXTURE_2D, null);
  5528. }
  5529. this._gl.bindFramebuffer(this._gl.FRAMEBUFFER, null);
  5530. };
  5531. Engine.prototype.generateMipMapsForCubemap = function (texture) {
  5532. if (texture.generateMipMaps) {
  5533. var gl = this._gl;
  5534. gl.bindTexture(gl.TEXTURE_CUBE_MAP, texture);
  5535. gl.generateMipmap(gl.TEXTURE_CUBE_MAP);
  5536. gl.bindTexture(gl.TEXTURE_CUBE_MAP, null);
  5537. }
  5538. };
  5539. Engine.prototype.flushFramebuffer = function () {
  5540. this._gl.flush();
  5541. };
  5542. Engine.prototype.restoreDefaultFramebuffer = function () {
  5543. this._currentRenderTarget = null;
  5544. this._gl.bindFramebuffer(this._gl.FRAMEBUFFER, null);
  5545. this.setViewport(this._cachedViewport);
  5546. this.wipeCaches();
  5547. };
  5548. // VBOs
  5549. Engine.prototype._resetVertexBufferBinding = function () {
  5550. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, null);
  5551. this._cachedVertexBuffers = null;
  5552. };
  5553. Engine.prototype.createVertexBuffer = function (vertices) {
  5554. var vbo = this._gl.createBuffer();
  5555. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vbo);
  5556. if (vertices instanceof Float32Array) {
  5557. this._gl.bufferData(this._gl.ARRAY_BUFFER, vertices, this._gl.STATIC_DRAW);
  5558. }
  5559. else {
  5560. this._gl.bufferData(this._gl.ARRAY_BUFFER, new Float32Array(vertices), this._gl.STATIC_DRAW);
  5561. }
  5562. this._resetVertexBufferBinding();
  5563. vbo.references = 1;
  5564. return vbo;
  5565. };
  5566. Engine.prototype.createDynamicVertexBuffer = function (capacity) {
  5567. var vbo = this._gl.createBuffer();
  5568. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vbo);
  5569. this._gl.bufferData(this._gl.ARRAY_BUFFER, capacity, this._gl.DYNAMIC_DRAW);
  5570. this._resetVertexBufferBinding();
  5571. vbo.references = 1;
  5572. return vbo;
  5573. };
  5574. Engine.prototype.updateDynamicVertexBuffer = function (vertexBuffer, vertices, offset) {
  5575. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vertexBuffer);
  5576. if (offset === undefined) {
  5577. offset = 0;
  5578. }
  5579. if (vertices instanceof Float32Array) {
  5580. this._gl.bufferSubData(this._gl.ARRAY_BUFFER, offset, vertices);
  5581. }
  5582. else {
  5583. this._gl.bufferSubData(this._gl.ARRAY_BUFFER, offset, new Float32Array(vertices));
  5584. }
  5585. this._resetVertexBufferBinding();
  5586. };
  5587. Engine.prototype._resetIndexBufferBinding = function () {
  5588. this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, null);
  5589. this._cachedIndexBuffer = null;
  5590. };
  5591. Engine.prototype.createIndexBuffer = function (indices) {
  5592. var vbo = this._gl.createBuffer();
  5593. this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, vbo);
  5594. // Check for 32 bits indices
  5595. var arrayBuffer;
  5596. var need32Bits = false;
  5597. if (this._caps.uintIndices) {
  5598. for (var index = 0; index < indices.length; index++) {
  5599. if (indices[index] > 65535) {
  5600. need32Bits = true;
  5601. break;
  5602. }
  5603. }
  5604. arrayBuffer = need32Bits ? new Uint32Array(indices) : new Uint16Array(indices);
  5605. }
  5606. else {
  5607. arrayBuffer = new Uint16Array(indices);
  5608. }
  5609. this._gl.bufferData(this._gl.ELEMENT_ARRAY_BUFFER, arrayBuffer, this._gl.STATIC_DRAW);
  5610. this._resetIndexBufferBinding();
  5611. vbo.references = 1;
  5612. vbo.is32Bits = need32Bits;
  5613. return vbo;
  5614. };
  5615. Engine.prototype.bindBuffers = function (vertexBuffer, indexBuffer, vertexDeclaration, vertexStrideSize, effect) {
  5616. if (this._cachedVertexBuffers !== vertexBuffer || this._cachedEffectForVertexBuffers !== effect) {
  5617. this._cachedVertexBuffers = vertexBuffer;
  5618. this._cachedEffectForVertexBuffers = effect;
  5619. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vertexBuffer);
  5620. var offset = 0;
  5621. for (var index = 0; index < vertexDeclaration.length; index++) {
  5622. var order = effect.getAttributeLocation(index);
  5623. if (order >= 0) {
  5624. this._gl.vertexAttribPointer(order, vertexDeclaration[index], this._gl.FLOAT, false, vertexStrideSize, offset);
  5625. }
  5626. offset += vertexDeclaration[index] * 4;
  5627. }
  5628. }
  5629. if (this._cachedIndexBuffer !== indexBuffer) {
  5630. this._cachedIndexBuffer = indexBuffer;
  5631. this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, indexBuffer);
  5632. this._uintIndicesCurrentlySet = indexBuffer.is32Bits;
  5633. }
  5634. };
  5635. Engine.prototype.bindMultiBuffers = function (vertexBuffers, indexBuffer, effect) {
  5636. if (this._cachedVertexBuffers !== vertexBuffers || this._cachedEffectForVertexBuffers !== effect) {
  5637. this._cachedVertexBuffers = vertexBuffers;
  5638. this._cachedEffectForVertexBuffers = effect;
  5639. var attributes = effect.getAttributesNames();
  5640. for (var index = 0; index < attributes.length; index++) {
  5641. var order = effect.getAttributeLocation(index);
  5642. if (order >= 0) {
  5643. var vertexBuffer = vertexBuffers[attributes[index]];
  5644. if (!vertexBuffer) {
  5645. continue;
  5646. }
  5647. var stride = vertexBuffer.getStrideSize();
  5648. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, vertexBuffer.getBuffer());
  5649. this._gl.vertexAttribPointer(order, stride, this._gl.FLOAT, false, stride * 4, 0);
  5650. }
  5651. }
  5652. }
  5653. if (indexBuffer != null && this._cachedIndexBuffer !== indexBuffer) {
  5654. this._cachedIndexBuffer = indexBuffer;
  5655. this._gl.bindBuffer(this._gl.ELEMENT_ARRAY_BUFFER, indexBuffer);
  5656. this._uintIndicesCurrentlySet = indexBuffer.is32Bits;
  5657. }
  5658. };
  5659. Engine.prototype._releaseBuffer = function (buffer) {
  5660. buffer.references--;
  5661. if (buffer.references === 0) {
  5662. this._gl.deleteBuffer(buffer);
  5663. return true;
  5664. }
  5665. return false;
  5666. };
  5667. Engine.prototype.createInstancesBuffer = function (capacity) {
  5668. var buffer = this._gl.createBuffer();
  5669. buffer.capacity = capacity;
  5670. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, buffer);
  5671. this._gl.bufferData(this._gl.ARRAY_BUFFER, capacity, this._gl.DYNAMIC_DRAW);
  5672. return buffer;
  5673. };
  5674. Engine.prototype.deleteInstancesBuffer = function (buffer) {
  5675. this._gl.deleteBuffer(buffer);
  5676. };
  5677. Engine.prototype.updateAndBindInstancesBuffer = function (instancesBuffer, data, offsetLocations) {
  5678. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, instancesBuffer);
  5679. this._gl.bufferSubData(this._gl.ARRAY_BUFFER, 0, data);
  5680. for (var index = 0; index < 4; index++) {
  5681. var offsetLocation = offsetLocations[index];
  5682. this._gl.enableVertexAttribArray(offsetLocation);
  5683. this._gl.vertexAttribPointer(offsetLocation, 4, this._gl.FLOAT, false, 64, index * 16);
  5684. this._caps.instancedArrays.vertexAttribDivisorANGLE(offsetLocation, 1);
  5685. }
  5686. };
  5687. Engine.prototype.unBindInstancesBuffer = function (instancesBuffer, offsetLocations) {
  5688. this._gl.bindBuffer(this._gl.ARRAY_BUFFER, instancesBuffer);
  5689. for (var index = 0; index < 4; index++) {
  5690. var offsetLocation = offsetLocations[index];
  5691. this._gl.disableVertexAttribArray(offsetLocation);
  5692. this._caps.instancedArrays.vertexAttribDivisorANGLE(offsetLocation, 0);
  5693. }
  5694. };
  5695. Engine.prototype.applyStates = function () {
  5696. this._depthCullingState.apply(this._gl);
  5697. this._alphaState.apply(this._gl);
  5698. };
  5699. Engine.prototype.draw = function (useTriangles, indexStart, indexCount, instancesCount) {
  5700. // Apply states
  5701. this.applyStates();
  5702. this._drawCalls++;
  5703. // Render
  5704. var indexFormat = this._uintIndicesCurrentlySet ? this._gl.UNSIGNED_INT : this._gl.UNSIGNED_SHORT;
  5705. var mult = this._uintIndicesCurrentlySet ? 4 : 2;
  5706. if (instancesCount) {
  5707. this._caps.instancedArrays.drawElementsInstancedANGLE(useTriangles ? this._gl.TRIANGLES : this._gl.LINES, indexCount, indexFormat, indexStart * mult, instancesCount);
  5708. return;
  5709. }
  5710. this._gl.drawElements(useTriangles ? this._gl.TRIANGLES : this._gl.LINES, indexCount, indexFormat, indexStart * mult);
  5711. };
  5712. Engine.prototype.drawPointClouds = function (verticesStart, verticesCount, instancesCount) {
  5713. // Apply states
  5714. this.applyStates();
  5715. this._drawCalls++;
  5716. if (instancesCount) {
  5717. this._caps.instancedArrays.drawArraysInstancedANGLE(this._gl.POINTS, verticesStart, verticesCount, instancesCount);
  5718. return;
  5719. }
  5720. this._gl.drawArrays(this._gl.POINTS, verticesStart, verticesCount);
  5721. };
  5722. // Shaders
  5723. Engine.prototype._releaseEffect = function (effect) {
  5724. if (this._compiledEffects[effect._key]) {
  5725. delete this._compiledEffects[effect._key];
  5726. if (effect.getProgram()) {
  5727. this._gl.deleteProgram(effect.getProgram());
  5728. }
  5729. }
  5730. };
  5731. Engine.prototype.createEffect = function (baseName, attributesNames, uniformsNames, samplers, defines, fallbacks, onCompiled, onError) {
  5732. var vertex = baseName.vertexElement || baseName.vertex || baseName;
  5733. var fragment = baseName.fragmentElement || baseName.fragment || baseName;
  5734. var name = vertex + "+" + fragment + "@" + defines;
  5735. if (this._compiledEffects[name]) {
  5736. return this._compiledEffects[name];
  5737. }
  5738. var effect = new BABYLON.Effect(baseName, attributesNames, uniformsNames, samplers, this, defines, fallbacks, onCompiled, onError);
  5739. effect._key = name;
  5740. this._compiledEffects[name] = effect;
  5741. return effect;
  5742. };
  5743. Engine.prototype.createEffectForParticles = function (fragmentName, uniformsNames, samplers, defines, fallbacks, onCompiled, onError) {
  5744. if (uniformsNames === void 0) { uniformsNames = []; }
  5745. if (samplers === void 0) { samplers = []; }
  5746. if (defines === void 0) { defines = ""; }
  5747. return this.createEffect({
  5748. vertex: "particles",
  5749. fragmentElement: fragmentName
  5750. }, ["position", "color", "options"], ["view", "projection"].concat(uniformsNames), ["diffuseSampler"].concat(samplers), defines, fallbacks, onCompiled, onError);
  5751. };
  5752. Engine.prototype.createShaderProgram = function (vertexCode, fragmentCode, defines) {
  5753. var vertexShader = compileShader(this._gl, vertexCode, "vertex", defines);
  5754. var fragmentShader = compileShader(this._gl, fragmentCode, "fragment", defines);
  5755. var shaderProgram = this._gl.createProgram();
  5756. this._gl.attachShader(shaderProgram, vertexShader);
  5757. this._gl.attachShader(shaderProgram, fragmentShader);
  5758. this._gl.linkProgram(shaderProgram);
  5759. var linked = this._gl.getProgramParameter(shaderProgram, this._gl.LINK_STATUS);
  5760. if (!linked) {
  5761. var error = this._gl.getProgramInfoLog(shaderProgram);
  5762. if (error) {
  5763. throw new Error(error);
  5764. }
  5765. }
  5766. this._gl.deleteShader(vertexShader);
  5767. this._gl.deleteShader(fragmentShader);
  5768. return shaderProgram;
  5769. };
  5770. Engine.prototype.getUniforms = function (shaderProgram, uniformsNames) {
  5771. var results = [];
  5772. for (var index = 0; index < uniformsNames.length; index++) {
  5773. results.push(this._gl.getUniformLocation(shaderProgram, uniformsNames[index]));
  5774. }
  5775. return results;
  5776. };
  5777. Engine.prototype.getAttributes = function (shaderProgram, attributesNames) {
  5778. var results = [];
  5779. for (var index = 0; index < attributesNames.length; index++) {
  5780. try {
  5781. results.push(this._gl.getAttribLocation(shaderProgram, attributesNames[index]));
  5782. }
  5783. catch (e) {
  5784. results.push(-1);
  5785. }
  5786. }
  5787. return results;
  5788. };
  5789. Engine.prototype.enableEffect = function (effect) {
  5790. if (!effect || !effect.getAttributesCount() || this._currentEffect === effect) {
  5791. if (effect && effect.onBind) {
  5792. effect.onBind(effect);
  5793. }
  5794. return;
  5795. }
  5796. this._vertexAttribArrays = this._vertexAttribArrays || [];
  5797. // Use program
  5798. this._gl.useProgram(effect.getProgram());
  5799. for (var i in this._vertexAttribArrays) {
  5800. if (i > this._gl.VERTEX_ATTRIB_ARRAY_ENABLED || !this._vertexAttribArrays[i]) {
  5801. continue;
  5802. }
  5803. this._vertexAttribArrays[i] = false;
  5804. this._gl.disableVertexAttribArray(i);
  5805. }
  5806. var attributesCount = effect.getAttributesCount();
  5807. for (var index = 0; index < attributesCount; index++) {
  5808. // Attributes
  5809. var order = effect.getAttributeLocation(index);
  5810. if (order >= 0) {
  5811. this._vertexAttribArrays[order] = true;
  5812. this._gl.enableVertexAttribArray(order);
  5813. }
  5814. }
  5815. this._currentEffect = effect;
  5816. if (effect.onBind) {
  5817. effect.onBind(effect);
  5818. }
  5819. };
  5820. Engine.prototype.setArray = function (uniform, array) {
  5821. if (!uniform)
  5822. return;
  5823. this._gl.uniform1fv(uniform, array);
  5824. };
  5825. Engine.prototype.setArray2 = function (uniform, array) {
  5826. if (!uniform || array.length % 2 !== 0)
  5827. return;
  5828. this._gl.uniform2fv(uniform, array);
  5829. };
  5830. Engine.prototype.setArray3 = function (uniform, array) {
  5831. if (!uniform || array.length % 3 !== 0)
  5832. return;
  5833. this._gl.uniform3fv(uniform, array);
  5834. };
  5835. Engine.prototype.setArray4 = function (uniform, array) {
  5836. if (!uniform || array.length % 4 !== 0)
  5837. return;
  5838. this._gl.uniform4fv(uniform, array);
  5839. };
  5840. Engine.prototype.setMatrices = function (uniform, matrices) {
  5841. if (!uniform)
  5842. return;
  5843. this._gl.uniformMatrix4fv(uniform, false, matrices);
  5844. };
  5845. Engine.prototype.setMatrix = function (uniform, matrix) {
  5846. if (!uniform)
  5847. return;
  5848. this._gl.uniformMatrix4fv(uniform, false, matrix.toArray());
  5849. };
  5850. Engine.prototype.setMatrix3x3 = function (uniform, matrix) {
  5851. if (!uniform)
  5852. return;
  5853. this._gl.uniformMatrix3fv(uniform, false, matrix);
  5854. };
  5855. Engine.prototype.setMatrix2x2 = function (uniform, matrix) {
  5856. if (!uniform)
  5857. return;
  5858. this._gl.uniformMatrix2fv(uniform, false, matrix);
  5859. };
  5860. Engine.prototype.setFloat = function (uniform, value) {
  5861. if (!uniform)
  5862. return;
  5863. this._gl.uniform1f(uniform, value);
  5864. };
  5865. Engine.prototype.setFloat2 = function (uniform, x, y) {
  5866. if (!uniform)
  5867. return;
  5868. this._gl.uniform2f(uniform, x, y);
  5869. };
  5870. Engine.prototype.setFloat3 = function (uniform, x, y, z) {
  5871. if (!uniform)
  5872. return;
  5873. this._gl.uniform3f(uniform, x, y, z);
  5874. };
  5875. Engine.prototype.setBool = function (uniform, bool) {
  5876. if (!uniform)
  5877. return;
  5878. this._gl.uniform1i(uniform, bool);
  5879. };
  5880. Engine.prototype.setFloat4 = function (uniform, x, y, z, w) {
  5881. if (!uniform)
  5882. return;
  5883. this._gl.uniform4f(uniform, x, y, z, w);
  5884. };
  5885. Engine.prototype.setColor3 = function (uniform, color3) {
  5886. if (!uniform)
  5887. return;
  5888. this._gl.uniform3f(uniform, color3.r, color3.g, color3.b);
  5889. };
  5890. Engine.prototype.setColor4 = function (uniform, color3, alpha) {
  5891. if (!uniform)
  5892. return;
  5893. this._gl.uniform4f(uniform, color3.r, color3.g, color3.b, alpha);
  5894. };
  5895. // States
  5896. Engine.prototype.setState = function (culling, zOffset, force, reverseSide) {
  5897. if (zOffset === void 0) { zOffset = 0; }
  5898. if (reverseSide === void 0) { reverseSide = false; }
  5899. // Culling
  5900. var showSide = reverseSide ? this._gl.FRONT : this._gl.BACK;
  5901. var hideSide = reverseSide ? this._gl.BACK : this._gl.FRONT;
  5902. var cullFace = this.cullBackFaces ? showSide : hideSide;
  5903. if (this._depthCullingState.cull !== culling || force || this._depthCullingState.cullFace !== cullFace) {
  5904. if (culling) {
  5905. this._depthCullingState.cullFace = cullFace;
  5906. this._depthCullingState.cull = true;
  5907. }
  5908. else {
  5909. this._depthCullingState.cull = false;
  5910. }
  5911. }
  5912. // Z offset
  5913. this._depthCullingState.zOffset = zOffset;
  5914. };
  5915. Engine.prototype.setDepthBuffer = function (enable) {
  5916. this._depthCullingState.depthTest = enable;
  5917. };
  5918. Engine.prototype.getDepthWrite = function () {
  5919. return this._depthCullingState.depthMask;
  5920. };
  5921. Engine.prototype.setDepthWrite = function (enable) {
  5922. this._depthCullingState.depthMask = enable;
  5923. };
  5924. Engine.prototype.setColorWrite = function (enable) {
  5925. this._gl.colorMask(enable, enable, enable, enable);
  5926. };
  5927. Engine.prototype.setAlphaMode = function (mode) {
  5928. if (this._alphaMode === mode) {
  5929. return;
  5930. }
  5931. switch (mode) {
  5932. case Engine.ALPHA_DISABLE:
  5933. this.setDepthWrite(true);
  5934. this._alphaState.alphaBlend = false;
  5935. break;
  5936. case Engine.ALPHA_COMBINE:
  5937. this.setDepthWrite(false);
  5938. this._alphaState.setAlphaBlendFunctionParameters(this._gl.SRC_ALPHA, this._gl.ONE_MINUS_SRC_ALPHA, this._gl.ONE, this._gl.ONE);
  5939. this._alphaState.alphaBlend = true;
  5940. break;
  5941. case Engine.ALPHA_ONEONE:
  5942. this.setDepthWrite(false);
  5943. this._alphaState.setAlphaBlendFunctionParameters(this._gl.ONE, this._gl.ONE, this._gl.ZERO, this._gl.ONE);
  5944. this._alphaState.alphaBlend = true;
  5945. break;
  5946. case Engine.ALPHA_ADD:
  5947. this.setDepthWrite(false);
  5948. this._alphaState.setAlphaBlendFunctionParameters(this._gl.SRC_ALPHA, this._gl.ONE, this._gl.ZERO, this._gl.ONE);
  5949. this._alphaState.alphaBlend = true;
  5950. break;
  5951. case Engine.ALPHA_SUBTRACT:
  5952. this.setDepthWrite(false);
  5953. this._alphaState.setAlphaBlendFunctionParameters(this._gl.ZERO, this._gl.ONE_MINUS_SRC_COLOR, this._gl.ONE, this._gl.ONE);
  5954. this._alphaState.alphaBlend = true;
  5955. break;
  5956. case Engine.ALPHA_MULTIPLY:
  5957. this.setDepthWrite(false);
  5958. this._alphaState.setAlphaBlendFunctionParameters(this._gl.DST_COLOR, this._gl.ZERO, this._gl.ONE, this._gl.ONE);
  5959. this._alphaState.alphaBlend = true;
  5960. break;
  5961. case Engine.ALPHA_MAXIMIZED:
  5962. this.setDepthWrite(false);
  5963. this._alphaState.setAlphaBlendFunctionParameters(this._gl.SRC_ALPHA, this._gl.ONE_MINUS_SRC_COLOR, this._gl.ONE, this._gl.ONE);
  5964. this._alphaState.alphaBlend = true;
  5965. break;
  5966. }
  5967. this._alphaMode = mode;
  5968. };
  5969. Engine.prototype.getAlphaMode = function () {
  5970. return this._alphaMode;
  5971. };
  5972. Engine.prototype.setAlphaTesting = function (enable) {
  5973. this._alphaTest = enable;
  5974. };
  5975. Engine.prototype.getAlphaTesting = function () {
  5976. return this._alphaTest;
  5977. };
  5978. // Textures
  5979. Engine.prototype.wipeCaches = function () {
  5980. this.resetTextureCache();
  5981. this._currentEffect = null;
  5982. this._depthCullingState.reset();
  5983. this._alphaState.reset();
  5984. this._cachedVertexBuffers = null;
  5985. this._cachedIndexBuffer = null;
  5986. this._cachedEffectForVertexBuffers = null;
  5987. };
  5988. Engine.prototype.setSamplingMode = function (texture, samplingMode) {
  5989. var gl = this._gl;
  5990. gl.bindTexture(gl.TEXTURE_2D, texture);
  5991. var magFilter = gl.NEAREST;
  5992. var minFilter = gl.NEAREST;
  5993. if (samplingMode === BABYLON.Texture.BILINEAR_SAMPLINGMODE) {
  5994. magFilter = gl.LINEAR;
  5995. minFilter = gl.LINEAR;
  5996. }
  5997. else if (samplingMode === BABYLON.Texture.TRILINEAR_SAMPLINGMODE) {
  5998. magFilter = gl.LINEAR;
  5999. minFilter = gl.LINEAR_MIPMAP_LINEAR;
  6000. }
  6001. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MAG_FILTER, magFilter);
  6002. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MIN_FILTER, minFilter);
  6003. gl.bindTexture(gl.TEXTURE_2D, null);
  6004. texture.samplingMode = samplingMode;
  6005. };
  6006. Engine.prototype.createTexture = function (url, noMipmap, invertY, scene, samplingMode, onLoad, onError, buffer) {
  6007. var _this = this;
  6008. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  6009. if (onLoad === void 0) { onLoad = null; }
  6010. if (onError === void 0) { onError = null; }
  6011. if (buffer === void 0) { buffer = null; }
  6012. var texture = this._gl.createTexture();
  6013. var extension;
  6014. var fromData = false;
  6015. if (url.substr(0, 5) === "data:") {
  6016. fromData = true;
  6017. }
  6018. if (!fromData)
  6019. extension = url.substr(url.length - 4, 4).toLowerCase();
  6020. else {
  6021. var oldUrl = url;
  6022. fromData = oldUrl.split(':');
  6023. url = oldUrl;
  6024. extension = fromData[1].substr(fromData[1].length - 4, 4).toLowerCase();
  6025. }
  6026. var isDDS = this.getCaps().s3tc && (extension === ".dds");
  6027. var isTGA = (extension === ".tga");
  6028. scene._addPendingData(texture);
  6029. texture.url = url;
  6030. texture.noMipmap = noMipmap;
  6031. texture.references = 1;
  6032. texture.samplingMode = samplingMode;
  6033. this._loadedTexturesCache.push(texture);
  6034. var onerror = function () {
  6035. scene._removePendingData(texture);
  6036. if (onError) {
  6037. onError();
  6038. }
  6039. };
  6040. var callback;
  6041. if (isTGA) {
  6042. callback = function (arrayBuffer) {
  6043. var data = new Uint8Array(arrayBuffer);
  6044. var header = BABYLON.Internals.TGATools.GetTGAHeader(data);
  6045. prepareWebGLTexture(texture, _this._gl, scene, header.width, header.height, invertY, noMipmap, false, function () {
  6046. BABYLON.Internals.TGATools.UploadContent(_this._gl, data);
  6047. if (onLoad) {
  6048. onLoad();
  6049. }
  6050. }, samplingMode);
  6051. };
  6052. if (!(fromData instanceof Array))
  6053. BABYLON.Tools.LoadFile(url, function (arrayBuffer) {
  6054. callback(arrayBuffer);
  6055. }, onerror, scene.database, true);
  6056. else
  6057. callback(buffer);
  6058. }
  6059. else if (isDDS) {
  6060. callback = function (data) {
  6061. var info = BABYLON.Internals.DDSTools.GetDDSInfo(data);
  6062. var loadMipmap = (info.isRGB || info.isLuminance || info.mipmapCount > 1) && !noMipmap && ((info.width >> (info.mipmapCount - 1)) === 1);
  6063. prepareWebGLTexture(texture, _this._gl, scene, info.width, info.height, invertY, !loadMipmap, info.isFourCC, function () {
  6064. BABYLON.Internals.DDSTools.UploadDDSLevels(_this._gl, _this.getCaps().s3tc, data, info, loadMipmap, 1);
  6065. if (onLoad) {
  6066. onLoad();
  6067. }
  6068. }, samplingMode);
  6069. };
  6070. if (!(fromData instanceof Array))
  6071. BABYLON.Tools.LoadFile(url, function (data) {
  6072. callback(data);
  6073. }, onerror, scene.database, true);
  6074. else
  6075. callback(buffer);
  6076. }
  6077. else {
  6078. var onload = function (img) {
  6079. prepareWebGLTexture(texture, _this._gl, scene, img.width, img.height, invertY, noMipmap, false, function (potWidth, potHeight) {
  6080. var isPot = (img.width === potWidth && img.height === potHeight);
  6081. if (!isPot) {
  6082. _this._prepareWorkingCanvas();
  6083. _this._workingCanvas.width = potWidth;
  6084. _this._workingCanvas.height = potHeight;
  6085. if (samplingMode === BABYLON.Texture.NEAREST_SAMPLINGMODE) {
  6086. _this._workingContext.imageSmoothingEnabled = false;
  6087. _this._workingContext.mozImageSmoothingEnabled = false;
  6088. _this._workingContext.oImageSmoothingEnabled = false;
  6089. _this._workingContext.webkitImageSmoothingEnabled = false;
  6090. _this._workingContext.msImageSmoothingEnabled = false;
  6091. }
  6092. _this._workingContext.drawImage(img, 0, 0, img.width, img.height, 0, 0, potWidth, potHeight);
  6093. if (samplingMode === BABYLON.Texture.NEAREST_SAMPLINGMODE) {
  6094. _this._workingContext.imageSmoothingEnabled = true;
  6095. _this._workingContext.mozImageSmoothingEnabled = true;
  6096. _this._workingContext.oImageSmoothingEnabled = true;
  6097. _this._workingContext.webkitImageSmoothingEnabled = true;
  6098. _this._workingContext.msImageSmoothingEnabled = true;
  6099. }
  6100. }
  6101. _this._gl.texImage2D(_this._gl.TEXTURE_2D, 0, _this._gl.RGBA, _this._gl.RGBA, _this._gl.UNSIGNED_BYTE, isPot ? img : _this._workingCanvas);
  6102. if (onLoad) {
  6103. onLoad();
  6104. }
  6105. }, samplingMode);
  6106. };
  6107. if (!(fromData instanceof Array))
  6108. BABYLON.Tools.LoadImage(url, onload, onerror, scene.database);
  6109. else
  6110. BABYLON.Tools.LoadImage(buffer, onload, onerror, scene.database);
  6111. }
  6112. return texture;
  6113. };
  6114. Engine.prototype.updateRawTexture = function (texture, data, format, invertY, compression) {
  6115. if (compression === void 0) { compression = null; }
  6116. var internalFormat = this._gl.RGBA;
  6117. switch (format) {
  6118. case Engine.TEXTUREFORMAT_ALPHA:
  6119. internalFormat = this._gl.ALPHA;
  6120. break;
  6121. case Engine.TEXTUREFORMAT_LUMINANCE:
  6122. internalFormat = this._gl.LUMINANCE;
  6123. break;
  6124. case Engine.TEXTUREFORMAT_LUMINANCE_ALPHA:
  6125. internalFormat = this._gl.LUMINANCE_ALPHA;
  6126. break;
  6127. case Engine.TEXTUREFORMAT_RGB:
  6128. internalFormat = this._gl.RGB;
  6129. break;
  6130. case Engine.TEXTUREFORMAT_RGBA:
  6131. internalFormat = this._gl.RGBA;
  6132. break;
  6133. }
  6134. this._gl.bindTexture(this._gl.TEXTURE_2D, texture);
  6135. this._gl.pixelStorei(this._gl.UNPACK_FLIP_Y_WEBGL, invertY === undefined ? 1 : (invertY ? 1 : 0));
  6136. if (compression) {
  6137. this._gl.compressedTexImage2D(this._gl.TEXTURE_2D, 0, this.getCaps().s3tc[compression], texture._width, texture._height, 0, data);
  6138. }
  6139. else {
  6140. this._gl.texImage2D(this._gl.TEXTURE_2D, 0, internalFormat, texture._width, texture._height, 0, internalFormat, this._gl.UNSIGNED_BYTE, data);
  6141. }
  6142. if (texture.generateMipMaps) {
  6143. this._gl.generateMipmap(this._gl.TEXTURE_2D);
  6144. }
  6145. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  6146. this.resetTextureCache();
  6147. texture.isReady = true;
  6148. };
  6149. Engine.prototype.createRawTexture = function (data, width, height, format, generateMipMaps, invertY, samplingMode, compression) {
  6150. if (compression === void 0) { compression = null; }
  6151. var texture = this._gl.createTexture();
  6152. texture._baseWidth = width;
  6153. texture._baseHeight = height;
  6154. texture._width = width;
  6155. texture._height = height;
  6156. texture.references = 1;
  6157. this.updateRawTexture(texture, data, format, invertY, compression);
  6158. this._gl.bindTexture(this._gl.TEXTURE_2D, texture);
  6159. // Filters
  6160. var filters = getSamplingParameters(samplingMode, generateMipMaps, this._gl);
  6161. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, filters.mag);
  6162. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, filters.min);
  6163. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  6164. texture.samplingMode = samplingMode;
  6165. this._loadedTexturesCache.push(texture);
  6166. return texture;
  6167. };
  6168. Engine.prototype.createDynamicTexture = function (width, height, generateMipMaps, samplingMode, forceExponantOfTwo) {
  6169. if (forceExponantOfTwo === void 0) { forceExponantOfTwo = true; }
  6170. var texture = this._gl.createTexture();
  6171. texture._baseWidth = width;
  6172. texture._baseHeight = height;
  6173. if (forceExponantOfTwo) {
  6174. width = BABYLON.Tools.GetExponentOfTwo(width, this._caps.maxTextureSize);
  6175. height = BABYLON.Tools.GetExponentOfTwo(height, this._caps.maxTextureSize);
  6176. }
  6177. this.resetTextureCache();
  6178. texture._width = width;
  6179. texture._height = height;
  6180. texture.isReady = false;
  6181. texture.generateMipMaps = generateMipMaps;
  6182. texture.references = 1;
  6183. texture.samplingMode = samplingMode;
  6184. this.updateTextureSamplingMode(samplingMode, texture);
  6185. this._loadedTexturesCache.push(texture);
  6186. return texture;
  6187. };
  6188. Engine.prototype.updateTextureSamplingMode = function (samplingMode, texture) {
  6189. var filters = getSamplingParameters(samplingMode, texture.generateMipMaps, this._gl);
  6190. this._gl.bindTexture(this._gl.TEXTURE_2D, texture);
  6191. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MAG_FILTER, filters.mag);
  6192. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_MIN_FILTER, filters.min);
  6193. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  6194. };
  6195. Engine.prototype.updateDynamicTexture = function (texture, canvas, invertY) {
  6196. this._gl.bindTexture(this._gl.TEXTURE_2D, texture);
  6197. this._gl.pixelStorei(this._gl.UNPACK_FLIP_Y_WEBGL, invertY ? 1 : 0);
  6198. this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.RGBA, this._gl.RGBA, this._gl.UNSIGNED_BYTE, canvas);
  6199. if (texture.generateMipMaps) {
  6200. this._gl.generateMipmap(this._gl.TEXTURE_2D);
  6201. }
  6202. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  6203. this.resetTextureCache();
  6204. texture.isReady = true;
  6205. };
  6206. Engine.prototype.updateVideoTexture = function (texture, video, invertY) {
  6207. if (texture._isDisabled) {
  6208. return;
  6209. }
  6210. this._gl.bindTexture(this._gl.TEXTURE_2D, texture);
  6211. this._gl.pixelStorei(this._gl.UNPACK_FLIP_Y_WEBGL, invertY ? 0 : 1); // Video are upside down by default
  6212. try {
  6213. // Testing video texture support
  6214. if (this._videoTextureSupported === undefined) {
  6215. this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.RGBA, this._gl.RGBA, this._gl.UNSIGNED_BYTE, video);
  6216. if (this._gl.getError() !== 0) {
  6217. this._videoTextureSupported = false;
  6218. }
  6219. else {
  6220. this._videoTextureSupported = true;
  6221. }
  6222. }
  6223. // Copy video through the current working canvas if video texture is not supported
  6224. if (!this._videoTextureSupported) {
  6225. if (!texture._workingCanvas) {
  6226. texture._workingCanvas = document.createElement("canvas");
  6227. texture._workingContext = texture._workingCanvas.getContext("2d");
  6228. texture._workingCanvas.width = texture._width;
  6229. texture._workingCanvas.height = texture._height;
  6230. }
  6231. texture._workingContext.drawImage(video, 0, 0, video.videoWidth, video.videoHeight, 0, 0, texture._width, texture._height);
  6232. this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.RGBA, this._gl.RGBA, this._gl.UNSIGNED_BYTE, texture._workingCanvas);
  6233. }
  6234. else {
  6235. this._gl.texImage2D(this._gl.TEXTURE_2D, 0, this._gl.RGBA, this._gl.RGBA, this._gl.UNSIGNED_BYTE, video);
  6236. }
  6237. if (texture.generateMipMaps) {
  6238. this._gl.generateMipmap(this._gl.TEXTURE_2D);
  6239. }
  6240. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  6241. this.resetTextureCache();
  6242. texture.isReady = true;
  6243. }
  6244. catch (ex) {
  6245. // Something unexpected
  6246. // Let's disable the texture
  6247. texture._isDisabled = true;
  6248. }
  6249. };
  6250. Engine.prototype.createRenderTargetTexture = function (size, options) {
  6251. // old version had a "generateMipMaps" arg instead of options.
  6252. // if options.generateMipMaps is undefined, consider that options itself if the generateMipmaps value
  6253. // in the same way, generateDepthBuffer is defaulted to true
  6254. var generateMipMaps = false;
  6255. var generateDepthBuffer = true;
  6256. var type = Engine.TEXTURETYPE_UNSIGNED_INT;
  6257. var samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE;
  6258. if (options !== undefined) {
  6259. generateMipMaps = options.generateMipMaps === undefined ? options : options.generateMipMaps;
  6260. generateDepthBuffer = options.generateDepthBuffer === undefined ? true : options.generateDepthBuffer;
  6261. type = options.type === undefined ? type : options.type;
  6262. if (options.samplingMode !== undefined) {
  6263. samplingMode = options.samplingMode;
  6264. }
  6265. if (type === Engine.TEXTURETYPE_FLOAT) {
  6266. // if floating point (gl.FLOAT) then force to NEAREST_SAMPLINGMODE
  6267. samplingMode = BABYLON.Texture.NEAREST_SAMPLINGMODE;
  6268. }
  6269. }
  6270. var gl = this._gl;
  6271. var texture = gl.createTexture();
  6272. gl.bindTexture(gl.TEXTURE_2D, texture);
  6273. var width = size.width || size;
  6274. var height = size.height || size;
  6275. var filters = getSamplingParameters(samplingMode, generateMipMaps, gl);
  6276. if (type === Engine.TEXTURETYPE_FLOAT && !this._caps.textureFloat) {
  6277. type = Engine.TEXTURETYPE_UNSIGNED_INT;
  6278. BABYLON.Tools.Warn("Float textures are not supported. Render target forced to TEXTURETYPE_UNSIGNED_BYTE type");
  6279. }
  6280. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MAG_FILTER, filters.mag);
  6281. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MIN_FILTER, filters.min);
  6282. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_WRAP_S, gl.CLAMP_TO_EDGE);
  6283. gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_WRAP_T, gl.CLAMP_TO_EDGE);
  6284. gl.texImage2D(gl.TEXTURE_2D, 0, gl.RGBA, width, height, 0, gl.RGBA, getWebGLTextureType(gl, type), null);
  6285. var depthBuffer;
  6286. // Create the depth buffer
  6287. if (generateDepthBuffer) {
  6288. depthBuffer = gl.createRenderbuffer();
  6289. gl.bindRenderbuffer(gl.RENDERBUFFER, depthBuffer);
  6290. gl.renderbufferStorage(gl.RENDERBUFFER, gl.DEPTH_COMPONENT16, width, height);
  6291. }
  6292. // Create the framebuffer
  6293. var framebuffer = gl.createFramebuffer();
  6294. gl.bindFramebuffer(gl.FRAMEBUFFER, framebuffer);
  6295. if (generateDepthBuffer) {
  6296. gl.framebufferRenderbuffer(gl.FRAMEBUFFER, gl.DEPTH_ATTACHMENT, gl.RENDERBUFFER, depthBuffer);
  6297. }
  6298. if (generateMipMaps) {
  6299. this._gl.generateMipmap(this._gl.TEXTURE_2D);
  6300. }
  6301. // Unbind
  6302. gl.bindTexture(gl.TEXTURE_2D, null);
  6303. gl.bindRenderbuffer(gl.RENDERBUFFER, null);
  6304. gl.bindFramebuffer(gl.FRAMEBUFFER, null);
  6305. texture._framebuffer = framebuffer;
  6306. if (generateDepthBuffer) {
  6307. texture._depthBuffer = depthBuffer;
  6308. }
  6309. texture._width = width;
  6310. texture._height = height;
  6311. texture.isReady = true;
  6312. texture.generateMipMaps = generateMipMaps;
  6313. texture.references = 1;
  6314. texture.samplingMode = samplingMode;
  6315. this.resetTextureCache();
  6316. this._loadedTexturesCache.push(texture);
  6317. return texture;
  6318. };
  6319. Engine.prototype.createRenderTargetCubeTexture = function (size, options) {
  6320. var gl = this._gl;
  6321. var texture = gl.createTexture();
  6322. var generateMipMaps = true;
  6323. var samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE;
  6324. if (options !== undefined) {
  6325. generateMipMaps = options.generateMipMaps === undefined ? options : options.generateMipMaps;
  6326. if (options.samplingMode !== undefined) {
  6327. samplingMode = options.samplingMode;
  6328. }
  6329. }
  6330. texture.isCube = true;
  6331. texture.references = 1;
  6332. texture.generateMipMaps = generateMipMaps;
  6333. texture.references = 1;
  6334. texture.samplingMode = samplingMode;
  6335. var filters = getSamplingParameters(samplingMode, generateMipMaps, gl);
  6336. gl.bindTexture(gl.TEXTURE_CUBE_MAP, texture);
  6337. for (var face = 0; face < 6; face++) {
  6338. gl.texImage2D((gl.TEXTURE_CUBE_MAP_POSITIVE_X + face), 0, gl.RGBA, size, size, 0, gl.RGBA, gl.UNSIGNED_BYTE, null);
  6339. }
  6340. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MAG_FILTER, filters.mag);
  6341. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MIN_FILTER, filters.min);
  6342. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_S, gl.CLAMP_TO_EDGE);
  6343. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_T, gl.CLAMP_TO_EDGE);
  6344. // Create the depth buffer
  6345. var depthBuffer = gl.createRenderbuffer();
  6346. gl.bindRenderbuffer(gl.RENDERBUFFER, depthBuffer);
  6347. gl.renderbufferStorage(gl.RENDERBUFFER, gl.DEPTH_COMPONENT16, size, size);
  6348. // Create the framebuffer
  6349. var framebuffer = gl.createFramebuffer();
  6350. gl.bindFramebuffer(gl.FRAMEBUFFER, framebuffer);
  6351. gl.framebufferRenderbuffer(gl.FRAMEBUFFER, gl.DEPTH_ATTACHMENT, gl.RENDERBUFFER, depthBuffer);
  6352. // Unbind
  6353. gl.bindTexture(gl.TEXTURE_CUBE_MAP, null);
  6354. gl.bindRenderbuffer(gl.RENDERBUFFER, null);
  6355. gl.bindFramebuffer(gl.FRAMEBUFFER, null);
  6356. texture._framebuffer = framebuffer;
  6357. texture._depthBuffer = depthBuffer;
  6358. this.resetTextureCache();
  6359. texture._width = size;
  6360. texture._height = size;
  6361. texture.isReady = true;
  6362. return texture;
  6363. };
  6364. Engine.prototype.createCubeTexture = function (rootUrl, scene, extensions, noMipmap) {
  6365. var _this = this;
  6366. var gl = this._gl;
  6367. var texture = gl.createTexture();
  6368. texture.isCube = true;
  6369. texture.url = rootUrl;
  6370. texture.references = 1;
  6371. var extension = rootUrl.substr(rootUrl.length - 4, 4).toLowerCase();
  6372. var isDDS = this.getCaps().s3tc && (extension === ".dds");
  6373. if (isDDS) {
  6374. BABYLON.Tools.LoadFile(rootUrl, function (data) {
  6375. var info = BABYLON.Internals.DDSTools.GetDDSInfo(data);
  6376. var loadMipmap = (info.isRGB || info.isLuminance || info.mipmapCount > 1) && !noMipmap;
  6377. gl.bindTexture(gl.TEXTURE_CUBE_MAP, texture);
  6378. gl.pixelStorei(gl.UNPACK_FLIP_Y_WEBGL, 1);
  6379. BABYLON.Internals.DDSTools.UploadDDSLevels(_this._gl, _this.getCaps().s3tc, data, info, loadMipmap, 6);
  6380. if (!noMipmap && !info.isFourCC && info.mipmapCount === 1) {
  6381. gl.generateMipmap(gl.TEXTURE_CUBE_MAP);
  6382. }
  6383. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MAG_FILTER, gl.LINEAR);
  6384. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MIN_FILTER, loadMipmap ? gl.LINEAR_MIPMAP_LINEAR : gl.LINEAR);
  6385. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_S, gl.CLAMP_TO_EDGE);
  6386. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_T, gl.CLAMP_TO_EDGE);
  6387. gl.bindTexture(gl.TEXTURE_CUBE_MAP, null);
  6388. _this.resetTextureCache();
  6389. texture._width = info.width;
  6390. texture._height = info.height;
  6391. texture.isReady = true;
  6392. }, null, null, true);
  6393. }
  6394. else {
  6395. cascadeLoad(rootUrl, scene, function (imgs) {
  6396. var width = BABYLON.Tools.GetExponentOfTwo(imgs[0].width, _this._caps.maxCubemapTextureSize);
  6397. var height = width;
  6398. _this._prepareWorkingCanvas();
  6399. _this._workingCanvas.width = width;
  6400. _this._workingCanvas.height = height;
  6401. var faces = [
  6402. gl.TEXTURE_CUBE_MAP_POSITIVE_X, gl.TEXTURE_CUBE_MAP_POSITIVE_Y, gl.TEXTURE_CUBE_MAP_POSITIVE_Z,
  6403. gl.TEXTURE_CUBE_MAP_NEGATIVE_X, gl.TEXTURE_CUBE_MAP_NEGATIVE_Y, gl.TEXTURE_CUBE_MAP_NEGATIVE_Z
  6404. ];
  6405. gl.bindTexture(gl.TEXTURE_CUBE_MAP, texture);
  6406. gl.pixelStorei(gl.UNPACK_FLIP_Y_WEBGL, 0);
  6407. for (var index = 0; index < faces.length; index++) {
  6408. _this._workingContext.drawImage(imgs[index], 0, 0, imgs[index].width, imgs[index].height, 0, 0, width, height);
  6409. gl.texImage2D(faces[index], 0, gl.RGBA, gl.RGBA, gl.UNSIGNED_BYTE, _this._workingCanvas);
  6410. }
  6411. if (!noMipmap) {
  6412. gl.generateMipmap(gl.TEXTURE_CUBE_MAP);
  6413. }
  6414. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MAG_FILTER, gl.LINEAR);
  6415. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_MIN_FILTER, noMipmap ? gl.LINEAR : gl.LINEAR_MIPMAP_LINEAR);
  6416. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_S, gl.CLAMP_TO_EDGE);
  6417. gl.texParameteri(gl.TEXTURE_CUBE_MAP, gl.TEXTURE_WRAP_T, gl.CLAMP_TO_EDGE);
  6418. gl.bindTexture(gl.TEXTURE_CUBE_MAP, null);
  6419. _this.resetTextureCache();
  6420. texture._width = width;
  6421. texture._height = height;
  6422. texture.isReady = true;
  6423. }, extensions);
  6424. }
  6425. return texture;
  6426. };
  6427. Engine.prototype._releaseTexture = function (texture) {
  6428. var gl = this._gl;
  6429. if (texture._framebuffer) {
  6430. gl.deleteFramebuffer(texture._framebuffer);
  6431. }
  6432. if (texture._depthBuffer) {
  6433. gl.deleteRenderbuffer(texture._depthBuffer);
  6434. }
  6435. gl.deleteTexture(texture);
  6436. // Unbind channels
  6437. for (var channel = 0; channel < this._caps.maxTexturesImageUnits; channel++) {
  6438. this._gl.activeTexture(this._gl["TEXTURE" + channel]);
  6439. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  6440. this._gl.bindTexture(this._gl.TEXTURE_CUBE_MAP, null);
  6441. this._activeTexturesCache[channel] = null;
  6442. }
  6443. var index = this._loadedTexturesCache.indexOf(texture);
  6444. if (index !== -1) {
  6445. this._loadedTexturesCache.splice(index, 1);
  6446. }
  6447. };
  6448. Engine.prototype.bindSamplers = function (effect) {
  6449. this._gl.useProgram(effect.getProgram());
  6450. var samplers = effect.getSamplers();
  6451. for (var index = 0; index < samplers.length; index++) {
  6452. var uniform = effect.getUniform(samplers[index]);
  6453. this._gl.uniform1i(uniform, index);
  6454. }
  6455. this._currentEffect = null;
  6456. };
  6457. Engine.prototype._bindTexture = function (channel, texture) {
  6458. this._gl.activeTexture(this._gl["TEXTURE" + channel]);
  6459. this._gl.bindTexture(this._gl.TEXTURE_2D, texture);
  6460. this._activeTexturesCache[channel] = null;
  6461. };
  6462. Engine.prototype.setTextureFromPostProcess = function (channel, postProcess) {
  6463. this._bindTexture(channel, postProcess._textures.data[postProcess._currentRenderTextureInd]);
  6464. };
  6465. Engine.prototype.setTexture = function (channel, texture) {
  6466. if (channel < 0) {
  6467. return;
  6468. }
  6469. // Not ready?
  6470. if (!texture || !texture.isReady()) {
  6471. if (this._activeTexturesCache[channel] != null) {
  6472. this._gl.activeTexture(this._gl["TEXTURE" + channel]);
  6473. this._gl.bindTexture(this._gl.TEXTURE_2D, null);
  6474. this._gl.bindTexture(this._gl.TEXTURE_CUBE_MAP, null);
  6475. this._activeTexturesCache[channel] = null;
  6476. }
  6477. return;
  6478. }
  6479. // Video
  6480. if (texture instanceof BABYLON.VideoTexture) {
  6481. if (texture.update()) {
  6482. this._activeTexturesCache[channel] = null;
  6483. }
  6484. }
  6485. else if (texture.delayLoadState === Engine.DELAYLOADSTATE_NOTLOADED) {
  6486. texture.delayLoad();
  6487. return;
  6488. }
  6489. if (this._activeTexturesCache[channel] === texture) {
  6490. return;
  6491. }
  6492. this._activeTexturesCache[channel] = texture;
  6493. var internalTexture = texture.getInternalTexture();
  6494. this._gl.activeTexture(this._gl["TEXTURE" + channel]);
  6495. if (internalTexture.isCube) {
  6496. this._gl.bindTexture(this._gl.TEXTURE_CUBE_MAP, internalTexture);
  6497. if (internalTexture._cachedCoordinatesMode !== texture.coordinatesMode) {
  6498. internalTexture._cachedCoordinatesMode = texture.coordinatesMode;
  6499. // CUBIC_MODE and SKYBOX_MODE both require CLAMP_TO_EDGE. All other modes use REPEAT.
  6500. var textureWrapMode = (texture.coordinatesMode !== BABYLON.Texture.CUBIC_MODE && texture.coordinatesMode !== BABYLON.Texture.SKYBOX_MODE) ? this._gl.REPEAT : this._gl.CLAMP_TO_EDGE;
  6501. this._gl.texParameteri(this._gl.TEXTURE_CUBE_MAP, this._gl.TEXTURE_WRAP_S, textureWrapMode);
  6502. this._gl.texParameteri(this._gl.TEXTURE_CUBE_MAP, this._gl.TEXTURE_WRAP_T, textureWrapMode);
  6503. }
  6504. this._setAnisotropicLevel(this._gl.TEXTURE_CUBE_MAP, texture);
  6505. }
  6506. else {
  6507. this._gl.bindTexture(this._gl.TEXTURE_2D, internalTexture);
  6508. if (internalTexture._cachedWrapU !== texture.wrapU) {
  6509. internalTexture._cachedWrapU = texture.wrapU;
  6510. switch (texture.wrapU) {
  6511. case BABYLON.Texture.WRAP_ADDRESSMODE:
  6512. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.REPEAT);
  6513. break;
  6514. case BABYLON.Texture.CLAMP_ADDRESSMODE:
  6515. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.CLAMP_TO_EDGE);
  6516. break;
  6517. case BABYLON.Texture.MIRROR_ADDRESSMODE:
  6518. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_S, this._gl.MIRRORED_REPEAT);
  6519. break;
  6520. }
  6521. }
  6522. if (internalTexture._cachedWrapV !== texture.wrapV) {
  6523. internalTexture._cachedWrapV = texture.wrapV;
  6524. switch (texture.wrapV) {
  6525. case BABYLON.Texture.WRAP_ADDRESSMODE:
  6526. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.REPEAT);
  6527. break;
  6528. case BABYLON.Texture.CLAMP_ADDRESSMODE:
  6529. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.CLAMP_TO_EDGE);
  6530. break;
  6531. case BABYLON.Texture.MIRROR_ADDRESSMODE:
  6532. this._gl.texParameteri(this._gl.TEXTURE_2D, this._gl.TEXTURE_WRAP_T, this._gl.MIRRORED_REPEAT);
  6533. break;
  6534. }
  6535. }
  6536. this._setAnisotropicLevel(this._gl.TEXTURE_2D, texture);
  6537. }
  6538. };
  6539. Engine.prototype._setAnisotropicLevel = function (key, texture) {
  6540. var anisotropicFilterExtension = this._caps.textureAnisotropicFilterExtension;
  6541. var value = texture.anisotropicFilteringLevel;
  6542. if (texture.getInternalTexture().samplingMode === BABYLON.Texture.NEAREST_SAMPLINGMODE) {
  6543. value = 1;
  6544. }
  6545. if (anisotropicFilterExtension && texture._cachedAnisotropicFilteringLevel !== value) {
  6546. this._gl.texParameterf(key, anisotropicFilterExtension.TEXTURE_MAX_ANISOTROPY_EXT, Math.min(value, this._caps.maxAnisotropy));
  6547. texture._cachedAnisotropicFilteringLevel = value;
  6548. }
  6549. };
  6550. Engine.prototype.readPixels = function (x, y, width, height) {
  6551. var data = new Uint8Array(height * width * 4);
  6552. this._gl.readPixels(x, y, width, height, this._gl.RGBA, this._gl.UNSIGNED_BYTE, data);
  6553. return data;
  6554. };
  6555. Engine.prototype.releaseInternalTexture = function (texture) {
  6556. if (!texture) {
  6557. return;
  6558. }
  6559. texture.references--;
  6560. // Final reference ?
  6561. if (texture.references === 0) {
  6562. var texturesCache = this.getLoadedTexturesCache();
  6563. var index = texturesCache.indexOf(texture);
  6564. if (index > -1) {
  6565. texturesCache.splice(index, 1);
  6566. }
  6567. this._releaseTexture(texture);
  6568. }
  6569. };
  6570. // Dispose
  6571. Engine.prototype.dispose = function () {
  6572. this.hideLoadingUI();
  6573. this.stopRenderLoop();
  6574. // Release scenes
  6575. while (this.scenes.length) {
  6576. this.scenes[0].dispose();
  6577. }
  6578. // Release audio engine
  6579. Engine.audioEngine.dispose();
  6580. // Release effects
  6581. for (var name in this._compiledEffects) {
  6582. this._gl.deleteProgram(this._compiledEffects[name]._program);
  6583. }
  6584. // Unbind
  6585. for (var i in this._vertexAttribArrays) {
  6586. if (i > this._gl.VERTEX_ATTRIB_ARRAY_ENABLED || !this._vertexAttribArrays[i]) {
  6587. continue;
  6588. }
  6589. this._gl.disableVertexAttribArray(i);
  6590. }
  6591. this._gl = null;
  6592. // Events
  6593. window.removeEventListener("blur", this._onBlur);
  6594. window.removeEventListener("focus", this._onFocus);
  6595. document.removeEventListener("fullscreenchange", this._onFullscreenChange);
  6596. document.removeEventListener("mozfullscreenchange", this._onFullscreenChange);
  6597. document.removeEventListener("webkitfullscreenchange", this._onFullscreenChange);
  6598. document.removeEventListener("msfullscreenchange", this._onFullscreenChange);
  6599. document.removeEventListener("pointerlockchange", this._onPointerLockChange);
  6600. document.removeEventListener("mspointerlockchange", this._onPointerLockChange);
  6601. document.removeEventListener("mozpointerlockchange", this._onPointerLockChange);
  6602. document.removeEventListener("webkitpointerlockchange", this._onPointerLockChange);
  6603. };
  6604. // Loading screen
  6605. Engine.prototype.displayLoadingUI = function () {
  6606. this._loadingScreen.displayLoadingUI();
  6607. };
  6608. Engine.prototype.hideLoadingUI = function () {
  6609. this._loadingScreen.hideLoadingUI();
  6610. };
  6611. Object.defineProperty(Engine.prototype, "loadingScreen", {
  6612. get: function () {
  6613. return this._loadingScreen;
  6614. },
  6615. set: function (loadingScreen) {
  6616. this._loadingScreen = loadingScreen;
  6617. },
  6618. enumerable: true,
  6619. configurable: true
  6620. });
  6621. Object.defineProperty(Engine.prototype, "loadingUIText", {
  6622. set: function (text) {
  6623. this._loadingScreen.loadingUIText = text;
  6624. },
  6625. enumerable: true,
  6626. configurable: true
  6627. });
  6628. Object.defineProperty(Engine.prototype, "loadingUIBackgroundColor", {
  6629. set: function (color) {
  6630. this._loadingScreen.loadingUIBackgroundColor = color;
  6631. },
  6632. enumerable: true,
  6633. configurable: true
  6634. });
  6635. // FPS
  6636. Engine.prototype.getFps = function () {
  6637. return this.fps;
  6638. };
  6639. Engine.prototype.getDeltaTime = function () {
  6640. return this.deltaTime;
  6641. };
  6642. Engine.prototype._measureFps = function () {
  6643. this.previousFramesDuration.push(BABYLON.Tools.Now);
  6644. var length = this.previousFramesDuration.length;
  6645. if (length >= 2) {
  6646. this.deltaTime = this.previousFramesDuration[length - 1] - this.previousFramesDuration[length - 2];
  6647. }
  6648. if (length >= this.fpsRange) {
  6649. if (length > this.fpsRange) {
  6650. this.previousFramesDuration.splice(0, 1);
  6651. length = this.previousFramesDuration.length;
  6652. }
  6653. var sum = 0;
  6654. for (var id = 0; id < length - 1; id++) {
  6655. sum += this.previousFramesDuration[id + 1] - this.previousFramesDuration[id];
  6656. }
  6657. this.fps = 1000.0 / (sum / (length - 1));
  6658. }
  6659. };
  6660. // Statics
  6661. Engine.isSupported = function () {
  6662. try {
  6663. // Avoid creating an unsized context for CocoonJS, since size determined on first creation. Is not resizable
  6664. if (navigator.isCocoonJS) {
  6665. return true;
  6666. }
  6667. var tempcanvas = document.createElement("canvas");
  6668. var gl = tempcanvas.getContext("webgl") || tempcanvas.getContext("experimental-webgl");
  6669. return gl != null && !!window.WebGLRenderingContext;
  6670. }
  6671. catch (e) {
  6672. return false;
  6673. }
  6674. };
  6675. // Const statics
  6676. Engine._ALPHA_DISABLE = 0;
  6677. Engine._ALPHA_ADD = 1;
  6678. Engine._ALPHA_COMBINE = 2;
  6679. Engine._ALPHA_SUBTRACT = 3;
  6680. Engine._ALPHA_MULTIPLY = 4;
  6681. Engine._ALPHA_MAXIMIZED = 5;
  6682. Engine._ALPHA_ONEONE = 6;
  6683. Engine._DELAYLOADSTATE_NONE = 0;
  6684. Engine._DELAYLOADSTATE_LOADED = 1;
  6685. Engine._DELAYLOADSTATE_LOADING = 2;
  6686. Engine._DELAYLOADSTATE_NOTLOADED = 4;
  6687. Engine._TEXTUREFORMAT_ALPHA = 0;
  6688. Engine._TEXTUREFORMAT_LUMINANCE = 1;
  6689. Engine._TEXTUREFORMAT_LUMINANCE_ALPHA = 2;
  6690. Engine._TEXTUREFORMAT_RGB = 4;
  6691. Engine._TEXTUREFORMAT_RGBA = 5;
  6692. Engine._TEXTURETYPE_UNSIGNED_INT = 0;
  6693. Engine._TEXTURETYPE_FLOAT = 1;
  6694. // Updatable statics so stick with vars here
  6695. Engine.Epsilon = 0.001;
  6696. Engine.CollisionsEpsilon = 0.001;
  6697. Engine.CodeRepository = "src/";
  6698. Engine.ShadersRepository = "src/Shaders/";
  6699. return Engine;
  6700. })();
  6701. BABYLON.Engine = Engine;
  6702. })(BABYLON || (BABYLON = {}));
  6703. var BABYLON;
  6704. (function (BABYLON) {
  6705. /**
  6706. * Node is the basic class for all scene objects (Mesh, Light Camera).
  6707. */
  6708. var Node = (function () {
  6709. /**
  6710. * @constructor
  6711. * @param {string} name - the name and id to be given to this node
  6712. * @param {BABYLON.Scene} the scene this node will be added to
  6713. */
  6714. function Node(name, scene) {
  6715. this.state = "";
  6716. this.animations = new Array();
  6717. this._childrenFlag = -1;
  6718. this._isEnabled = true;
  6719. this._isReady = true;
  6720. this._currentRenderId = -1;
  6721. this._parentRenderId = -1;
  6722. this.name = name;
  6723. this.id = name;
  6724. this._scene = scene;
  6725. this._initCache();
  6726. }
  6727. Node.prototype.getScene = function () {
  6728. return this._scene;
  6729. };
  6730. Node.prototype.getEngine = function () {
  6731. return this._scene.getEngine();
  6732. };
  6733. // override it in derived class
  6734. Node.prototype.getWorldMatrix = function () {
  6735. return BABYLON.Matrix.Identity();
  6736. };
  6737. // override it in derived class if you add new variables to the cache
  6738. // and call the parent class method
  6739. Node.prototype._initCache = function () {
  6740. this._cache = {};
  6741. this._cache.parent = undefined;
  6742. };
  6743. Node.prototype.updateCache = function (force) {
  6744. if (!force && this.isSynchronized())
  6745. return;
  6746. this._cache.parent = this.parent;
  6747. this._updateCache();
  6748. };
  6749. // override it in derived class if you add new variables to the cache
  6750. // and call the parent class method if !ignoreParentClass
  6751. Node.prototype._updateCache = function (ignoreParentClass) {
  6752. };
  6753. // override it in derived class if you add new variables to the cache
  6754. Node.prototype._isSynchronized = function () {
  6755. return true;
  6756. };
  6757. Node.prototype._markSyncedWithParent = function () {
  6758. this._parentRenderId = this.parent._currentRenderId;
  6759. };
  6760. Node.prototype.isSynchronizedWithParent = function () {
  6761. if (!this.parent) {
  6762. return true;
  6763. }
  6764. if (this._parentRenderId !== this.parent._currentRenderId) {
  6765. return false;
  6766. }
  6767. return this.parent.isSynchronized();
  6768. };
  6769. Node.prototype.isSynchronized = function (updateCache) {
  6770. var check = this.hasNewParent();
  6771. check = check || !this.isSynchronizedWithParent();
  6772. check = check || !this._isSynchronized();
  6773. if (updateCache)
  6774. this.updateCache(true);
  6775. return !check;
  6776. };
  6777. Node.prototype.hasNewParent = function (update) {
  6778. if (this._cache.parent === this.parent)
  6779. return false;
  6780. if (update)
  6781. this._cache.parent = this.parent;
  6782. return true;
  6783. };
  6784. /**
  6785. * Is this node ready to be used/rendered
  6786. * @return {boolean} is it ready
  6787. */
  6788. Node.prototype.isReady = function () {
  6789. return this._isReady;
  6790. };
  6791. /**
  6792. * Is this node enabled.
  6793. * If the node has a parent and is enabled, the parent will be inspected as well.
  6794. * @return {boolean} whether this node (and its parent) is enabled.
  6795. * @see setEnabled
  6796. */
  6797. Node.prototype.isEnabled = function () {
  6798. if (!this._isEnabled) {
  6799. return false;
  6800. }
  6801. if (this.parent) {
  6802. return this.parent.isEnabled();
  6803. }
  6804. return true;
  6805. };
  6806. /**
  6807. * Set the enabled state of this node.
  6808. * @param {boolean} value - the new enabled state
  6809. * @see isEnabled
  6810. */
  6811. Node.prototype.setEnabled = function (value) {
  6812. this._isEnabled = value;
  6813. };
  6814. /**
  6815. * Is this node a descendant of the given node.
  6816. * The function will iterate up the hierarchy until the ancestor was found or no more parents defined.
  6817. * @param {BABYLON.Node} ancestor - The parent node to inspect
  6818. * @see parent
  6819. */
  6820. Node.prototype.isDescendantOf = function (ancestor) {
  6821. if (this.parent) {
  6822. if (this.parent === ancestor) {
  6823. return true;
  6824. }
  6825. return this.parent.isDescendantOf(ancestor);
  6826. }
  6827. return false;
  6828. };
  6829. Node.prototype._getDescendants = function (list, results) {
  6830. for (var index = 0; index < list.length; index++) {
  6831. var item = list[index];
  6832. if (item.isDescendantOf(this)) {
  6833. results.push(item);
  6834. }
  6835. }
  6836. };
  6837. /**
  6838. * Will return all nodes that have this node as parent.
  6839. * @return {BABYLON.Node[]} all children nodes of all types.
  6840. */
  6841. Node.prototype.getDescendants = function () {
  6842. var results = [];
  6843. this._getDescendants(this._scene.meshes, results);
  6844. this._getDescendants(this._scene.lights, results);
  6845. this._getDescendants(this._scene.cameras, results);
  6846. return results;
  6847. };
  6848. Node.prototype._setReady = function (state) {
  6849. if (state == this._isReady) {
  6850. return;
  6851. }
  6852. if (!state) {
  6853. this._isReady = false;
  6854. return;
  6855. }
  6856. this._isReady = true;
  6857. if (this.onReady) {
  6858. this.onReady(this);
  6859. }
  6860. };
  6861. return Node;
  6862. })();
  6863. BABYLON.Node = Node;
  6864. })(BABYLON || (BABYLON = {}));
  6865. var BABYLON;
  6866. (function (BABYLON) {
  6867. var FilesInput = (function () {
  6868. /// Register to core BabylonJS object: engine, scene, rendering canvas, callback function when the scene will be loaded,
  6869. /// loading progress callback and optionnal addionnal logic to call in the rendering loop
  6870. function FilesInput(p_engine, p_scene, p_canvas, p_sceneLoadedCallback, p_progressCallback, p_additionnalRenderLoopLogicCallback, p_textureLoadingCallback, p_startingProcessingFilesCallback) {
  6871. this._engine = p_engine;
  6872. this._canvas = p_canvas;
  6873. this._currentScene = p_scene;
  6874. this._sceneLoadedCallback = p_sceneLoadedCallback;
  6875. this._progressCallback = p_progressCallback;
  6876. this._additionnalRenderLoopLogicCallback = p_additionnalRenderLoopLogicCallback;
  6877. this._textureLoadingCallback = p_textureLoadingCallback;
  6878. this._startingProcessingFilesCallback = p_startingProcessingFilesCallback;
  6879. }
  6880. FilesInput.prototype.monitorElementForDragNDrop = function (p_elementToMonitor) {
  6881. var _this = this;
  6882. if (p_elementToMonitor) {
  6883. this._elementToMonitor = p_elementToMonitor;
  6884. this._elementToMonitor.addEventListener("dragenter", function (e) { _this.drag(e); }, false);
  6885. this._elementToMonitor.addEventListener("dragover", function (e) { _this.drag(e); }, false);
  6886. this._elementToMonitor.addEventListener("drop", function (e) { _this.drop(e); }, false);
  6887. }
  6888. };
  6889. FilesInput.prototype.renderFunction = function () {
  6890. if (this._additionnalRenderLoopLogicCallback) {
  6891. this._additionnalRenderLoopLogicCallback();
  6892. }
  6893. if (this._currentScene) {
  6894. if (this._textureLoadingCallback) {
  6895. var remaining = this._currentScene.getWaitingItemsCount();
  6896. if (remaining > 0) {
  6897. this._textureLoadingCallback(remaining);
  6898. }
  6899. }
  6900. this._currentScene.render();
  6901. }
  6902. };
  6903. FilesInput.prototype.drag = function (e) {
  6904. e.stopPropagation();
  6905. e.preventDefault();
  6906. };
  6907. FilesInput.prototype.drop = function (eventDrop) {
  6908. eventDrop.stopPropagation();
  6909. eventDrop.preventDefault();
  6910. this.loadFiles(eventDrop);
  6911. };
  6912. FilesInput.prototype.loadFiles = function (event) {
  6913. if (this._startingProcessingFilesCallback)
  6914. this._startingProcessingFilesCallback();
  6915. // Handling data transfer via drag'n'drop
  6916. if (event && event.dataTransfer && event.dataTransfer.files) {
  6917. this._filesToLoad = event.dataTransfer.files;
  6918. }
  6919. // Handling files from input files
  6920. if (event && event.target && event.target.files) {
  6921. this._filesToLoad = event.target.files;
  6922. }
  6923. if (this._filesToLoad && this._filesToLoad.length > 0) {
  6924. for (var i = 0; i < this._filesToLoad.length; i++) {
  6925. switch (this._filesToLoad[i].type) {
  6926. case "image/jpeg":
  6927. case "image/png":
  6928. case "image/bmp":
  6929. FilesInput.FilesTextures[this._filesToLoad[i].name] = this._filesToLoad[i];
  6930. break;
  6931. case "image/targa":
  6932. case "image/vnd.ms-dds":
  6933. case "audio/wav":
  6934. case "audio/x-wav":
  6935. case "audio/mp3":
  6936. case "audio/mpeg":
  6937. case "audio/mpeg3":
  6938. case "audio/x-mpeg-3":
  6939. case "audio/ogg":
  6940. FilesInput.FilesToLoad[this._filesToLoad[i].name] = this._filesToLoad[i];
  6941. break;
  6942. default:
  6943. if ((this._filesToLoad[i].name.indexOf(".babylon") !== -1 || this._filesToLoad[i].name.indexOf(".stl") !== -1 ||
  6944. this._filesToLoad[i].name.indexOf(".obj") !== -1 || this._filesToLoad[i].name.indexOf(".mtl") !== -1)
  6945. && this._filesToLoad[i].name.indexOf(".manifest") === -1
  6946. && this._filesToLoad[i].name.indexOf(".incremental") === -1 && this._filesToLoad[i].name.indexOf(".babylonmeshdata") === -1
  6947. && this._filesToLoad[i].name.indexOf(".babylongeometrydata") === -1 && this._filesToLoad[i].name.indexOf(".babylonbinarymeshdata") === -1 &&
  6948. this._filesToLoad[i].name.indexOf(".binary.babylon") === -1) {
  6949. this._sceneFileToLoad = this._filesToLoad[i];
  6950. }
  6951. break;
  6952. }
  6953. }
  6954. this.reload();
  6955. }
  6956. };
  6957. FilesInput.prototype.reload = function () {
  6958. var _this = this;
  6959. var that = this;
  6960. // If a ".babylon" file has been provided
  6961. if (this._sceneFileToLoad) {
  6962. if (this._currentScene) {
  6963. if (BABYLON.Tools.errorsCount > 0) {
  6964. BABYLON.Tools.ClearLogCache();
  6965. BABYLON.Tools.Log("Babylon.js engine (v" + BABYLON.Engine.Version + ") launched");
  6966. }
  6967. this._engine.stopRenderLoop();
  6968. this._currentScene.dispose();
  6969. }
  6970. BABYLON.SceneLoader.Load("file:", this._sceneFileToLoad, this._engine, function (newScene) {
  6971. that._currentScene = newScene;
  6972. // Wait for textures and shaders to be ready
  6973. that._currentScene.executeWhenReady(function () {
  6974. // Attach camera to canvas inputs
  6975. if (!that._currentScene.activeCamera || that._currentScene.lights.length === 0) {
  6976. that._currentScene.createDefaultCameraOrLight();
  6977. }
  6978. that._currentScene.activeCamera.attachControl(that._canvas);
  6979. if (that._sceneLoadedCallback) {
  6980. that._sceneLoadedCallback(_this._sceneFileToLoad, that._currentScene);
  6981. }
  6982. that._engine.runRenderLoop(function () { that.renderFunction(); });
  6983. });
  6984. }, function (progress) {
  6985. if (_this._progressCallback) {
  6986. _this._progressCallback(progress);
  6987. }
  6988. });
  6989. }
  6990. else {
  6991. BABYLON.Tools.Error("Please provide a valid .babylon file.");
  6992. }
  6993. };
  6994. FilesInput.FilesTextures = new Array();
  6995. FilesInput.FilesToLoad = new Array();
  6996. return FilesInput;
  6997. })();
  6998. BABYLON.FilesInput = FilesInput;
  6999. })(BABYLON || (BABYLON = {}));
  7000. var BABYLON;
  7001. (function (BABYLON) {
  7002. var IntersectionInfo = (function () {
  7003. function IntersectionInfo(bu, bv, distance) {
  7004. this.bu = bu;
  7005. this.bv = bv;
  7006. this.distance = distance;
  7007. this.faceId = 0;
  7008. this.subMeshId = 0;
  7009. }
  7010. return IntersectionInfo;
  7011. })();
  7012. BABYLON.IntersectionInfo = IntersectionInfo;
  7013. var PickingInfo = (function () {
  7014. function PickingInfo() {
  7015. this.hit = false;
  7016. this.distance = 0;
  7017. this.pickedPoint = null;
  7018. this.pickedMesh = null;
  7019. this.bu = 0;
  7020. this.bv = 0;
  7021. this.faceId = -1;
  7022. this.subMeshId = 0;
  7023. this.pickedSprite = null;
  7024. }
  7025. // Methods
  7026. PickingInfo.prototype.getNormal = function (useWorldCoordinates, useVerticesNormals) {
  7027. if (useWorldCoordinates === void 0) { useWorldCoordinates = false; }
  7028. if (useVerticesNormals === void 0) { useVerticesNormals = true; }
  7029. if (!this.pickedMesh || !this.pickedMesh.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) {
  7030. return null;
  7031. }
  7032. var indices = this.pickedMesh.getIndices();
  7033. var result;
  7034. if (useVerticesNormals) {
  7035. var normals = this.pickedMesh.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  7036. var normal0 = BABYLON.Vector3.FromArray(normals, indices[this.faceId * 3] * 3);
  7037. var normal1 = BABYLON.Vector3.FromArray(normals, indices[this.faceId * 3 + 1] * 3);
  7038. var normal2 = BABYLON.Vector3.FromArray(normals, indices[this.faceId * 3 + 2] * 3);
  7039. normal0 = normal0.scale(this.bu);
  7040. normal1 = normal1.scale(this.bv);
  7041. normal2 = normal2.scale(1.0 - this.bu - this.bv);
  7042. result = new BABYLON.Vector3(normal0.x + normal1.x + normal2.x, normal0.y + normal1.y + normal2.y, normal0.z + normal1.z + normal2.z);
  7043. }
  7044. else {
  7045. var positions = this.pickedMesh.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  7046. var vertex1 = BABYLON.Vector3.FromArray(positions, indices[this.faceId * 3] * 3);
  7047. var vertex2 = BABYLON.Vector3.FromArray(positions, indices[this.faceId * 3 + 1] * 3);
  7048. var vertex3 = BABYLON.Vector3.FromArray(positions, indices[this.faceId * 3 + 2] * 3);
  7049. var p1p2 = vertex1.subtract(vertex2);
  7050. var p3p2 = vertex3.subtract(vertex2);
  7051. result = BABYLON.Vector3.Cross(p1p2, p3p2);
  7052. }
  7053. if (useWorldCoordinates) {
  7054. result = BABYLON.Vector3.TransformNormal(result, this.pickedMesh.getWorldMatrix());
  7055. }
  7056. return BABYLON.Vector3.Normalize(result);
  7057. };
  7058. PickingInfo.prototype.getTextureCoordinates = function () {
  7059. if (!this.pickedMesh || !this.pickedMesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  7060. return null;
  7061. }
  7062. var indices = this.pickedMesh.getIndices();
  7063. var uvs = this.pickedMesh.getVerticesData(BABYLON.VertexBuffer.UVKind);
  7064. var uv0 = BABYLON.Vector2.FromArray(uvs, indices[this.faceId * 3] * 2);
  7065. var uv1 = BABYLON.Vector2.FromArray(uvs, indices[this.faceId * 3 + 1] * 2);
  7066. var uv2 = BABYLON.Vector2.FromArray(uvs, indices[this.faceId * 3 + 2] * 2);
  7067. uv0 = uv0.scale(1.0 - this.bu - this.bv);
  7068. uv1 = uv1.scale(this.bu);
  7069. uv2 = uv2.scale(this.bv);
  7070. return new BABYLON.Vector2(uv0.x + uv1.x + uv2.x, uv0.y + uv1.y + uv2.y);
  7071. };
  7072. return PickingInfo;
  7073. })();
  7074. BABYLON.PickingInfo = PickingInfo;
  7075. })(BABYLON || (BABYLON = {}));
  7076. var BABYLON;
  7077. (function (BABYLON) {
  7078. var BoundingSphere = (function () {
  7079. function BoundingSphere(minimum, maximum) {
  7080. this.minimum = minimum;
  7081. this.maximum = maximum;
  7082. this._tempRadiusVector = BABYLON.Vector3.Zero();
  7083. var distance = BABYLON.Vector3.Distance(minimum, maximum);
  7084. this.center = BABYLON.Vector3.Lerp(minimum, maximum, 0.5);
  7085. this.radius = distance * 0.5;
  7086. this.centerWorld = BABYLON.Vector3.Zero();
  7087. this._update(BABYLON.Matrix.Identity());
  7088. }
  7089. // Methods
  7090. BoundingSphere.prototype._update = function (world) {
  7091. BABYLON.Vector3.TransformCoordinatesToRef(this.center, world, this.centerWorld);
  7092. BABYLON.Vector3.TransformNormalFromFloatsToRef(1.0, 1.0, 1.0, world, this._tempRadiusVector);
  7093. this.radiusWorld = Math.max(Math.abs(this._tempRadiusVector.x), Math.abs(this._tempRadiusVector.y), Math.abs(this._tempRadiusVector.z)) * this.radius;
  7094. };
  7095. BoundingSphere.prototype.isInFrustum = function (frustumPlanes) {
  7096. for (var i = 0; i < 6; i++) {
  7097. if (frustumPlanes[i].dotCoordinate(this.centerWorld) <= -this.radiusWorld)
  7098. return false;
  7099. }
  7100. return true;
  7101. };
  7102. BoundingSphere.prototype.intersectsPoint = function (point) {
  7103. var x = this.centerWorld.x - point.x;
  7104. var y = this.centerWorld.y - point.y;
  7105. var z = this.centerWorld.z - point.z;
  7106. var distance = Math.sqrt((x * x) + (y * y) + (z * z));
  7107. if (Math.abs(this.radiusWorld - distance) < BABYLON.Engine.Epsilon)
  7108. return false;
  7109. return true;
  7110. };
  7111. // Statics
  7112. BoundingSphere.Intersects = function (sphere0, sphere1) {
  7113. var x = sphere0.centerWorld.x - sphere1.centerWorld.x;
  7114. var y = sphere0.centerWorld.y - sphere1.centerWorld.y;
  7115. var z = sphere0.centerWorld.z - sphere1.centerWorld.z;
  7116. var distance = Math.sqrt((x * x) + (y * y) + (z * z));
  7117. if (sphere0.radiusWorld + sphere1.radiusWorld < distance)
  7118. return false;
  7119. return true;
  7120. };
  7121. return BoundingSphere;
  7122. })();
  7123. BABYLON.BoundingSphere = BoundingSphere;
  7124. })(BABYLON || (BABYLON = {}));
  7125. var BABYLON;
  7126. (function (BABYLON) {
  7127. var BoundingBox = (function () {
  7128. function BoundingBox(minimum, maximum) {
  7129. this.minimum = minimum;
  7130. this.maximum = maximum;
  7131. this.vectors = new Array();
  7132. this.vectorsWorld = new Array();
  7133. // Bounding vectors
  7134. this.vectors.push(this.minimum.clone());
  7135. this.vectors.push(this.maximum.clone());
  7136. this.vectors.push(this.minimum.clone());
  7137. this.vectors[2].x = this.maximum.x;
  7138. this.vectors.push(this.minimum.clone());
  7139. this.vectors[3].y = this.maximum.y;
  7140. this.vectors.push(this.minimum.clone());
  7141. this.vectors[4].z = this.maximum.z;
  7142. this.vectors.push(this.maximum.clone());
  7143. this.vectors[5].z = this.minimum.z;
  7144. this.vectors.push(this.maximum.clone());
  7145. this.vectors[6].x = this.minimum.x;
  7146. this.vectors.push(this.maximum.clone());
  7147. this.vectors[7].y = this.minimum.y;
  7148. // OBB
  7149. this.center = this.maximum.add(this.minimum).scale(0.5);
  7150. this.extendSize = this.maximum.subtract(this.minimum).scale(0.5);
  7151. this.directions = [BABYLON.Vector3.Zero(), BABYLON.Vector3.Zero(), BABYLON.Vector3.Zero()];
  7152. // World
  7153. for (var index = 0; index < this.vectors.length; index++) {
  7154. this.vectorsWorld[index] = BABYLON.Vector3.Zero();
  7155. }
  7156. this.minimumWorld = BABYLON.Vector3.Zero();
  7157. this.maximumWorld = BABYLON.Vector3.Zero();
  7158. this._update(BABYLON.Matrix.Identity());
  7159. }
  7160. // Methods
  7161. BoundingBox.prototype.getWorldMatrix = function () {
  7162. return this._worldMatrix;
  7163. };
  7164. BoundingBox.prototype._update = function (world) {
  7165. BABYLON.Vector3.FromFloatsToRef(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE, this.minimumWorld);
  7166. BABYLON.Vector3.FromFloatsToRef(-Number.MAX_VALUE, -Number.MAX_VALUE, -Number.MAX_VALUE, this.maximumWorld);
  7167. for (var index = 0; index < this.vectors.length; index++) {
  7168. var v = this.vectorsWorld[index];
  7169. BABYLON.Vector3.TransformCoordinatesToRef(this.vectors[index], world, v);
  7170. if (v.x < this.minimumWorld.x)
  7171. this.minimumWorld.x = v.x;
  7172. if (v.y < this.minimumWorld.y)
  7173. this.minimumWorld.y = v.y;
  7174. if (v.z < this.minimumWorld.z)
  7175. this.minimumWorld.z = v.z;
  7176. if (v.x > this.maximumWorld.x)
  7177. this.maximumWorld.x = v.x;
  7178. if (v.y > this.maximumWorld.y)
  7179. this.maximumWorld.y = v.y;
  7180. if (v.z > this.maximumWorld.z)
  7181. this.maximumWorld.z = v.z;
  7182. }
  7183. // OBB
  7184. this.maximumWorld.addToRef(this.minimumWorld, this.center);
  7185. this.center.scaleInPlace(0.5);
  7186. BABYLON.Vector3.FromFloatArrayToRef(world.m, 0, this.directions[0]);
  7187. BABYLON.Vector3.FromFloatArrayToRef(world.m, 4, this.directions[1]);
  7188. BABYLON.Vector3.FromFloatArrayToRef(world.m, 8, this.directions[2]);
  7189. this._worldMatrix = world;
  7190. };
  7191. BoundingBox.prototype.isInFrustum = function (frustumPlanes) {
  7192. return BoundingBox.IsInFrustum(this.vectorsWorld, frustumPlanes);
  7193. };
  7194. BoundingBox.prototype.isCompletelyInFrustum = function (frustumPlanes) {
  7195. return BoundingBox.IsCompletelyInFrustum(this.vectorsWorld, frustumPlanes);
  7196. };
  7197. BoundingBox.prototype.intersectsPoint = function (point) {
  7198. var delta = -BABYLON.Engine.Epsilon;
  7199. if (this.maximumWorld.x - point.x < delta || delta > point.x - this.minimumWorld.x)
  7200. return false;
  7201. if (this.maximumWorld.y - point.y < delta || delta > point.y - this.minimumWorld.y)
  7202. return false;
  7203. if (this.maximumWorld.z - point.z < delta || delta > point.z - this.minimumWorld.z)
  7204. return false;
  7205. return true;
  7206. };
  7207. BoundingBox.prototype.intersectsSphere = function (sphere) {
  7208. return BoundingBox.IntersectsSphere(this.minimumWorld, this.maximumWorld, sphere.centerWorld, sphere.radiusWorld);
  7209. };
  7210. BoundingBox.prototype.intersectsMinMax = function (min, max) {
  7211. if (this.maximumWorld.x < min.x || this.minimumWorld.x > max.x)
  7212. return false;
  7213. if (this.maximumWorld.y < min.y || this.minimumWorld.y > max.y)
  7214. return false;
  7215. if (this.maximumWorld.z < min.z || this.minimumWorld.z > max.z)
  7216. return false;
  7217. return true;
  7218. };
  7219. // Statics
  7220. BoundingBox.Intersects = function (box0, box1) {
  7221. if (box0.maximumWorld.x < box1.minimumWorld.x || box0.minimumWorld.x > box1.maximumWorld.x)
  7222. return false;
  7223. if (box0.maximumWorld.y < box1.minimumWorld.y || box0.minimumWorld.y > box1.maximumWorld.y)
  7224. return false;
  7225. if (box0.maximumWorld.z < box1.minimumWorld.z || box0.minimumWorld.z > box1.maximumWorld.z)
  7226. return false;
  7227. return true;
  7228. };
  7229. BoundingBox.IntersectsSphere = function (minPoint, maxPoint, sphereCenter, sphereRadius) {
  7230. var vector = BABYLON.Vector3.Clamp(sphereCenter, minPoint, maxPoint);
  7231. var num = BABYLON.Vector3.DistanceSquared(sphereCenter, vector);
  7232. return (num <= (sphereRadius * sphereRadius));
  7233. };
  7234. BoundingBox.IsCompletelyInFrustum = function (boundingVectors, frustumPlanes) {
  7235. for (var p = 0; p < 6; p++) {
  7236. for (var i = 0; i < 8; i++) {
  7237. if (frustumPlanes[p].dotCoordinate(boundingVectors[i]) < 0) {
  7238. return false;
  7239. }
  7240. }
  7241. }
  7242. return true;
  7243. };
  7244. BoundingBox.IsInFrustum = function (boundingVectors, frustumPlanes) {
  7245. for (var p = 0; p < 6; p++) {
  7246. var inCount = 8;
  7247. for (var i = 0; i < 8; i++) {
  7248. if (frustumPlanes[p].dotCoordinate(boundingVectors[i]) < 0) {
  7249. --inCount;
  7250. }
  7251. else {
  7252. break;
  7253. }
  7254. }
  7255. if (inCount === 0)
  7256. return false;
  7257. }
  7258. return true;
  7259. };
  7260. return BoundingBox;
  7261. })();
  7262. BABYLON.BoundingBox = BoundingBox;
  7263. })(BABYLON || (BABYLON = {}));
  7264. var BABYLON;
  7265. (function (BABYLON) {
  7266. var computeBoxExtents = function (axis, box) {
  7267. var p = BABYLON.Vector3.Dot(box.center, axis);
  7268. var r0 = Math.abs(BABYLON.Vector3.Dot(box.directions[0], axis)) * box.extendSize.x;
  7269. var r1 = Math.abs(BABYLON.Vector3.Dot(box.directions[1], axis)) * box.extendSize.y;
  7270. var r2 = Math.abs(BABYLON.Vector3.Dot(box.directions[2], axis)) * box.extendSize.z;
  7271. var r = r0 + r1 + r2;
  7272. return {
  7273. min: p - r,
  7274. max: p + r
  7275. };
  7276. };
  7277. var extentsOverlap = function (min0, max0, min1, max1) { return !(min0 > max1 || min1 > max0); };
  7278. var axisOverlap = function (axis, box0, box1) {
  7279. var result0 = computeBoxExtents(axis, box0);
  7280. var result1 = computeBoxExtents(axis, box1);
  7281. return extentsOverlap(result0.min, result0.max, result1.min, result1.max);
  7282. };
  7283. var BoundingInfo = (function () {
  7284. function BoundingInfo(minimum, maximum) {
  7285. this.minimum = minimum;
  7286. this.maximum = maximum;
  7287. this.boundingBox = new BABYLON.BoundingBox(minimum, maximum);
  7288. this.boundingSphere = new BABYLON.BoundingSphere(minimum, maximum);
  7289. }
  7290. // Methods
  7291. BoundingInfo.prototype._update = function (world) {
  7292. this.boundingBox._update(world);
  7293. this.boundingSphere._update(world);
  7294. };
  7295. BoundingInfo.prototype.isInFrustum = function (frustumPlanes) {
  7296. if (!this.boundingSphere.isInFrustum(frustumPlanes))
  7297. return false;
  7298. return this.boundingBox.isInFrustum(frustumPlanes);
  7299. };
  7300. BoundingInfo.prototype.isCompletelyInFrustum = function (frustumPlanes) {
  7301. return this.boundingBox.isCompletelyInFrustum(frustumPlanes);
  7302. };
  7303. BoundingInfo.prototype._checkCollision = function (collider) {
  7304. return collider._canDoCollision(this.boundingSphere.centerWorld, this.boundingSphere.radiusWorld, this.boundingBox.minimumWorld, this.boundingBox.maximumWorld);
  7305. };
  7306. BoundingInfo.prototype.intersectsPoint = function (point) {
  7307. if (!this.boundingSphere.centerWorld) {
  7308. return false;
  7309. }
  7310. if (!this.boundingSphere.intersectsPoint(point)) {
  7311. return false;
  7312. }
  7313. if (!this.boundingBox.intersectsPoint(point)) {
  7314. return false;
  7315. }
  7316. return true;
  7317. };
  7318. BoundingInfo.prototype.intersects = function (boundingInfo, precise) {
  7319. if (!this.boundingSphere.centerWorld || !boundingInfo.boundingSphere.centerWorld) {
  7320. return false;
  7321. }
  7322. if (!BABYLON.BoundingSphere.Intersects(this.boundingSphere, boundingInfo.boundingSphere)) {
  7323. return false;
  7324. }
  7325. if (!BABYLON.BoundingBox.Intersects(this.boundingBox, boundingInfo.boundingBox)) {
  7326. return false;
  7327. }
  7328. if (!precise) {
  7329. return true;
  7330. }
  7331. var box0 = this.boundingBox;
  7332. var box1 = boundingInfo.boundingBox;
  7333. if (!axisOverlap(box0.directions[0], box0, box1))
  7334. return false;
  7335. if (!axisOverlap(box0.directions[1], box0, box1))
  7336. return false;
  7337. if (!axisOverlap(box0.directions[2], box0, box1))
  7338. return false;
  7339. if (!axisOverlap(box1.directions[0], box0, box1))
  7340. return false;
  7341. if (!axisOverlap(box1.directions[1], box0, box1))
  7342. return false;
  7343. if (!axisOverlap(box1.directions[2], box0, box1))
  7344. return false;
  7345. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[0], box1.directions[0]), box0, box1))
  7346. return false;
  7347. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[0], box1.directions[1]), box0, box1))
  7348. return false;
  7349. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[0], box1.directions[2]), box0, box1))
  7350. return false;
  7351. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[1], box1.directions[0]), box0, box1))
  7352. return false;
  7353. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[1], box1.directions[1]), box0, box1))
  7354. return false;
  7355. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[1], box1.directions[2]), box0, box1))
  7356. return false;
  7357. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[2], box1.directions[0]), box0, box1))
  7358. return false;
  7359. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[2], box1.directions[1]), box0, box1))
  7360. return false;
  7361. if (!axisOverlap(BABYLON.Vector3.Cross(box0.directions[2], box1.directions[2]), box0, box1))
  7362. return false;
  7363. return true;
  7364. };
  7365. return BoundingInfo;
  7366. })();
  7367. BABYLON.BoundingInfo = BoundingInfo;
  7368. })(BABYLON || (BABYLON = {}));
  7369. var BABYLON;
  7370. (function (BABYLON) {
  7371. var AbstractMesh = (function (_super) {
  7372. __extends(AbstractMesh, _super);
  7373. function AbstractMesh(name, scene) {
  7374. var _this = this;
  7375. _super.call(this, name, scene);
  7376. // Properties
  7377. this.definedFacingForward = true; // orientation for POV movement & rotation
  7378. this.position = new BABYLON.Vector3(0, 0, 0);
  7379. this.rotation = new BABYLON.Vector3(0, 0, 0);
  7380. this.scaling = new BABYLON.Vector3(1, 1, 1);
  7381. this.billboardMode = AbstractMesh.BILLBOARDMODE_NONE;
  7382. this.visibility = 1.0;
  7383. this.alphaIndex = Number.MAX_VALUE;
  7384. this.infiniteDistance = false;
  7385. this.isVisible = true;
  7386. this.isPickable = true;
  7387. this.showBoundingBox = false;
  7388. this.showSubMeshesBoundingBox = false;
  7389. this.onDispose = null;
  7390. this.isBlocker = false;
  7391. this.renderingGroupId = 0;
  7392. this.receiveShadows = false;
  7393. this.renderOutline = false;
  7394. this.outlineColor = BABYLON.Color3.Red();
  7395. this.outlineWidth = 0.02;
  7396. this.renderOverlay = false;
  7397. this.overlayColor = BABYLON.Color3.Red();
  7398. this.overlayAlpha = 0.5;
  7399. this.hasVertexAlpha = false;
  7400. this.useVertexColors = true;
  7401. this.applyFog = true;
  7402. this.computeBonesUsingShaders = true;
  7403. this.scalingDeterminant = 1;
  7404. this.useOctreeForRenderingSelection = true;
  7405. this.useOctreeForPicking = true;
  7406. this.useOctreeForCollisions = true;
  7407. this.layerMask = 0x0FFFFFFF;
  7408. this.alwaysSelectAsActiveMesh = false;
  7409. // Physics
  7410. this._physicImpostor = BABYLON.PhysicsEngine.NoImpostor;
  7411. // Collisions
  7412. this._checkCollisions = false;
  7413. this.ellipsoid = new BABYLON.Vector3(0.5, 1, 0.5);
  7414. this.ellipsoidOffset = new BABYLON.Vector3(0, 0, 0);
  7415. this._collider = new BABYLON.Collider();
  7416. this._oldPositionForCollisions = new BABYLON.Vector3(0, 0, 0);
  7417. this._diffPositionForCollisions = new BABYLON.Vector3(0, 0, 0);
  7418. this._newPositionForCollisions = new BABYLON.Vector3(0, 0, 0);
  7419. // Edges
  7420. this.edgesWidth = 1;
  7421. this.edgesColor = new BABYLON.Color4(1, 0, 0, 1);
  7422. // Cache
  7423. this._localScaling = BABYLON.Matrix.Zero();
  7424. this._localRotation = BABYLON.Matrix.Zero();
  7425. this._localTranslation = BABYLON.Matrix.Zero();
  7426. this._localBillboard = BABYLON.Matrix.Zero();
  7427. this._localPivotScaling = BABYLON.Matrix.Zero();
  7428. this._localPivotScalingRotation = BABYLON.Matrix.Zero();
  7429. this._localWorld = BABYLON.Matrix.Zero();
  7430. this._worldMatrix = BABYLON.Matrix.Zero();
  7431. this._rotateYByPI = BABYLON.Matrix.RotationY(Math.PI);
  7432. this._absolutePosition = BABYLON.Vector3.Zero();
  7433. this._collisionsTransformMatrix = BABYLON.Matrix.Zero();
  7434. this._collisionsScalingMatrix = BABYLON.Matrix.Zero();
  7435. this._isDirty = false;
  7436. this._pivotMatrix = BABYLON.Matrix.Identity();
  7437. this._isDisposed = false;
  7438. this._renderId = 0;
  7439. this._intersectionsInProgress = new Array();
  7440. this._onAfterWorldMatrixUpdate = new Array();
  7441. this._isWorldMatrixFrozen = false;
  7442. this._onCollisionPositionChange = function (collisionId, newPosition, collidedMesh) {
  7443. if (collidedMesh === void 0) { collidedMesh = null; }
  7444. //TODO move this to the collision coordinator!
  7445. if (_this.getScene().workerCollisions)
  7446. newPosition.multiplyInPlace(_this._collider.radius);
  7447. newPosition.subtractToRef(_this._oldPositionForCollisions, _this._diffPositionForCollisions);
  7448. if (_this._diffPositionForCollisions.length() > BABYLON.Engine.CollisionsEpsilon) {
  7449. _this.position.addInPlace(_this._diffPositionForCollisions);
  7450. }
  7451. if (_this.onCollide && collidedMesh) {
  7452. _this.onCollide(collidedMesh);
  7453. }
  7454. };
  7455. scene.addMesh(this);
  7456. }
  7457. Object.defineProperty(AbstractMesh, "BILLBOARDMODE_NONE", {
  7458. get: function () {
  7459. return AbstractMesh._BILLBOARDMODE_NONE;
  7460. },
  7461. enumerable: true,
  7462. configurable: true
  7463. });
  7464. Object.defineProperty(AbstractMesh, "BILLBOARDMODE_X", {
  7465. get: function () {
  7466. return AbstractMesh._BILLBOARDMODE_X;
  7467. },
  7468. enumerable: true,
  7469. configurable: true
  7470. });
  7471. Object.defineProperty(AbstractMesh, "BILLBOARDMODE_Y", {
  7472. get: function () {
  7473. return AbstractMesh._BILLBOARDMODE_Y;
  7474. },
  7475. enumerable: true,
  7476. configurable: true
  7477. });
  7478. Object.defineProperty(AbstractMesh, "BILLBOARDMODE_Z", {
  7479. get: function () {
  7480. return AbstractMesh._BILLBOARDMODE_Z;
  7481. },
  7482. enumerable: true,
  7483. configurable: true
  7484. });
  7485. Object.defineProperty(AbstractMesh, "BILLBOARDMODE_ALL", {
  7486. get: function () {
  7487. return AbstractMesh._BILLBOARDMODE_ALL;
  7488. },
  7489. enumerable: true,
  7490. configurable: true
  7491. });
  7492. // Methods
  7493. AbstractMesh.prototype.disableEdgesRendering = function () {
  7494. if (this._edgesRenderer !== undefined) {
  7495. this._edgesRenderer.dispose();
  7496. this._edgesRenderer = undefined;
  7497. }
  7498. };
  7499. AbstractMesh.prototype.enableEdgesRendering = function (epsilon, checkVerticesInsteadOfIndices) {
  7500. if (epsilon === void 0) { epsilon = 0.95; }
  7501. if (checkVerticesInsteadOfIndices === void 0) { checkVerticesInsteadOfIndices = false; }
  7502. this.disableEdgesRendering();
  7503. this._edgesRenderer = new BABYLON.EdgesRenderer(this, epsilon, checkVerticesInsteadOfIndices);
  7504. };
  7505. Object.defineProperty(AbstractMesh.prototype, "isBlocked", {
  7506. get: function () {
  7507. return false;
  7508. },
  7509. enumerable: true,
  7510. configurable: true
  7511. });
  7512. AbstractMesh.prototype.getLOD = function (camera) {
  7513. return this;
  7514. };
  7515. AbstractMesh.prototype.getTotalVertices = function () {
  7516. return 0;
  7517. };
  7518. AbstractMesh.prototype.getIndices = function () {
  7519. return null;
  7520. };
  7521. AbstractMesh.prototype.getVerticesData = function (kind) {
  7522. return null;
  7523. };
  7524. AbstractMesh.prototype.isVerticesDataPresent = function (kind) {
  7525. return false;
  7526. };
  7527. AbstractMesh.prototype.getBoundingInfo = function () {
  7528. if (this._masterMesh) {
  7529. return this._masterMesh.getBoundingInfo();
  7530. }
  7531. if (!this._boundingInfo) {
  7532. this._updateBoundingInfo();
  7533. }
  7534. return this._boundingInfo;
  7535. };
  7536. Object.defineProperty(AbstractMesh.prototype, "useBones", {
  7537. get: function () {
  7538. return this.skeleton && this.getScene().skeletonsEnabled && this.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind) && this.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind);
  7539. },
  7540. enumerable: true,
  7541. configurable: true
  7542. });
  7543. AbstractMesh.prototype._preActivate = function () {
  7544. };
  7545. AbstractMesh.prototype._activate = function (renderId) {
  7546. this._renderId = renderId;
  7547. };
  7548. AbstractMesh.prototype.getWorldMatrix = function () {
  7549. if (this._masterMesh) {
  7550. return this._masterMesh.getWorldMatrix();
  7551. }
  7552. if (this._currentRenderId !== this.getScene().getRenderId()) {
  7553. this.computeWorldMatrix();
  7554. }
  7555. return this._worldMatrix;
  7556. };
  7557. Object.defineProperty(AbstractMesh.prototype, "worldMatrixFromCache", {
  7558. get: function () {
  7559. return this._worldMatrix;
  7560. },
  7561. enumerable: true,
  7562. configurable: true
  7563. });
  7564. Object.defineProperty(AbstractMesh.prototype, "absolutePosition", {
  7565. get: function () {
  7566. return this._absolutePosition;
  7567. },
  7568. enumerable: true,
  7569. configurable: true
  7570. });
  7571. AbstractMesh.prototype.freezeWorldMatrix = function () {
  7572. this._isWorldMatrixFrozen = false; // no guarantee world is not already frozen, switch off temporarily
  7573. this.computeWorldMatrix(true);
  7574. this._isWorldMatrixFrozen = true;
  7575. };
  7576. AbstractMesh.prototype.unfreezeWorldMatrix = function () {
  7577. this._isWorldMatrixFrozen = false;
  7578. this.computeWorldMatrix(true);
  7579. };
  7580. Object.defineProperty(AbstractMesh.prototype, "isWorldMatrixFrozen", {
  7581. get: function () {
  7582. return this._isWorldMatrixFrozen;
  7583. },
  7584. enumerable: true,
  7585. configurable: true
  7586. });
  7587. AbstractMesh.prototype.rotate = function (axis, amount, space) {
  7588. axis.normalize();
  7589. if (!this.rotationQuaternion) {
  7590. this.rotationQuaternion = BABYLON.Quaternion.RotationYawPitchRoll(this.rotation.y, this.rotation.x, this.rotation.z);
  7591. this.rotation = BABYLON.Vector3.Zero();
  7592. }
  7593. var rotationQuaternion;
  7594. if (!space || space === BABYLON.Space.LOCAL) {
  7595. rotationQuaternion = BABYLON.Quaternion.RotationAxis(axis, amount);
  7596. this.rotationQuaternion = this.rotationQuaternion.multiply(rotationQuaternion);
  7597. }
  7598. else {
  7599. if (this.parent) {
  7600. var invertParentWorldMatrix = this.parent.getWorldMatrix().clone();
  7601. invertParentWorldMatrix.invert();
  7602. axis = BABYLON.Vector3.TransformNormal(axis, invertParentWorldMatrix);
  7603. }
  7604. rotationQuaternion = BABYLON.Quaternion.RotationAxis(axis, amount);
  7605. this.rotationQuaternion = rotationQuaternion.multiply(this.rotationQuaternion);
  7606. }
  7607. };
  7608. AbstractMesh.prototype.translate = function (axis, distance, space) {
  7609. var displacementVector = axis.scale(distance);
  7610. if (!space || space === BABYLON.Space.LOCAL) {
  7611. var tempV3 = this.getPositionExpressedInLocalSpace().add(displacementVector);
  7612. this.setPositionWithLocalVector(tempV3);
  7613. }
  7614. else {
  7615. this.setAbsolutePosition(this.getAbsolutePosition().add(displacementVector));
  7616. }
  7617. };
  7618. AbstractMesh.prototype.getAbsolutePosition = function () {
  7619. this.computeWorldMatrix();
  7620. return this._absolutePosition;
  7621. };
  7622. AbstractMesh.prototype.setAbsolutePosition = function (absolutePosition) {
  7623. if (!absolutePosition) {
  7624. return;
  7625. }
  7626. var absolutePositionX;
  7627. var absolutePositionY;
  7628. var absolutePositionZ;
  7629. if (absolutePosition.x === undefined) {
  7630. if (arguments.length < 3) {
  7631. return;
  7632. }
  7633. absolutePositionX = arguments[0];
  7634. absolutePositionY = arguments[1];
  7635. absolutePositionZ = arguments[2];
  7636. }
  7637. else {
  7638. absolutePositionX = absolutePosition.x;
  7639. absolutePositionY = absolutePosition.y;
  7640. absolutePositionZ = absolutePosition.z;
  7641. }
  7642. if (this.parent) {
  7643. var invertParentWorldMatrix = this.parent.getWorldMatrix().clone();
  7644. invertParentWorldMatrix.invert();
  7645. var worldPosition = new BABYLON.Vector3(absolutePositionX, absolutePositionY, absolutePositionZ);
  7646. this.position = BABYLON.Vector3.TransformCoordinates(worldPosition, invertParentWorldMatrix);
  7647. }
  7648. else {
  7649. this.position.x = absolutePositionX;
  7650. this.position.y = absolutePositionY;
  7651. this.position.z = absolutePositionZ;
  7652. }
  7653. };
  7654. // ================================== Point of View Movement =================================
  7655. /**
  7656. * Perform relative position change from the point of view of behind the front of the mesh.
  7657. * This is performed taking into account the meshes current rotation, so you do not have to care.
  7658. * Supports definition of mesh facing forward or backward.
  7659. * @param {number} amountRight
  7660. * @param {number} amountUp
  7661. * @param {number} amountForward
  7662. */
  7663. AbstractMesh.prototype.movePOV = function (amountRight, amountUp, amountForward) {
  7664. this.position.addInPlace(this.calcMovePOV(amountRight, amountUp, amountForward));
  7665. };
  7666. /**
  7667. * Calculate relative position change from the point of view of behind the front of the mesh.
  7668. * This is performed taking into account the meshes current rotation, so you do not have to care.
  7669. * Supports definition of mesh facing forward or backward.
  7670. * @param {number} amountRight
  7671. * @param {number} amountUp
  7672. * @param {number} amountForward
  7673. */
  7674. AbstractMesh.prototype.calcMovePOV = function (amountRight, amountUp, amountForward) {
  7675. var rotMatrix = new BABYLON.Matrix();
  7676. var rotQuaternion = (this.rotationQuaternion) ? this.rotationQuaternion : BABYLON.Quaternion.RotationYawPitchRoll(this.rotation.y, this.rotation.x, this.rotation.z);
  7677. rotQuaternion.toRotationMatrix(rotMatrix);
  7678. var translationDelta = BABYLON.Vector3.Zero();
  7679. var defForwardMult = this.definedFacingForward ? -1 : 1;
  7680. BABYLON.Vector3.TransformCoordinatesFromFloatsToRef(amountRight * defForwardMult, amountUp, amountForward * defForwardMult, rotMatrix, translationDelta);
  7681. return translationDelta;
  7682. };
  7683. // ================================== Point of View Rotation =================================
  7684. /**
  7685. * Perform relative rotation change from the point of view of behind the front of the mesh.
  7686. * Supports definition of mesh facing forward or backward.
  7687. * @param {number} flipBack
  7688. * @param {number} twirlClockwise
  7689. * @param {number} tiltRight
  7690. */
  7691. AbstractMesh.prototype.rotatePOV = function (flipBack, twirlClockwise, tiltRight) {
  7692. this.rotation.addInPlace(this.calcRotatePOV(flipBack, twirlClockwise, tiltRight));
  7693. };
  7694. /**
  7695. * Calculate relative rotation change from the point of view of behind the front of the mesh.
  7696. * Supports definition of mesh facing forward or backward.
  7697. * @param {number} flipBack
  7698. * @param {number} twirlClockwise
  7699. * @param {number} tiltRight
  7700. */
  7701. AbstractMesh.prototype.calcRotatePOV = function (flipBack, twirlClockwise, tiltRight) {
  7702. var defForwardMult = this.definedFacingForward ? 1 : -1;
  7703. return new BABYLON.Vector3(flipBack * defForwardMult, twirlClockwise, tiltRight * defForwardMult);
  7704. };
  7705. AbstractMesh.prototype.setPivotMatrix = function (matrix) {
  7706. this._pivotMatrix = matrix;
  7707. this._cache.pivotMatrixUpdated = true;
  7708. };
  7709. AbstractMesh.prototype.getPivotMatrix = function () {
  7710. return this._pivotMatrix;
  7711. };
  7712. AbstractMesh.prototype._isSynchronized = function () {
  7713. if (this._isDirty) {
  7714. return false;
  7715. }
  7716. if (this.billboardMode !== AbstractMesh.BILLBOARDMODE_NONE)
  7717. return false;
  7718. if (this._cache.pivotMatrixUpdated) {
  7719. return false;
  7720. }
  7721. if (this.infiniteDistance) {
  7722. return false;
  7723. }
  7724. if (!this._cache.position.equals(this.position))
  7725. return false;
  7726. if (this.rotationQuaternion) {
  7727. if (!this._cache.rotationQuaternion.equals(this.rotationQuaternion))
  7728. return false;
  7729. }
  7730. else {
  7731. if (!this._cache.rotation.equals(this.rotation))
  7732. return false;
  7733. }
  7734. if (!this._cache.scaling.equals(this.scaling))
  7735. return false;
  7736. return true;
  7737. };
  7738. AbstractMesh.prototype._initCache = function () {
  7739. _super.prototype._initCache.call(this);
  7740. this._cache.localMatrixUpdated = false;
  7741. this._cache.position = BABYLON.Vector3.Zero();
  7742. this._cache.scaling = BABYLON.Vector3.Zero();
  7743. this._cache.rotation = BABYLON.Vector3.Zero();
  7744. this._cache.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 0);
  7745. };
  7746. AbstractMesh.prototype.markAsDirty = function (property) {
  7747. if (property === "rotation") {
  7748. this.rotationQuaternion = null;
  7749. }
  7750. this._currentRenderId = Number.MAX_VALUE;
  7751. this._isDirty = true;
  7752. };
  7753. AbstractMesh.prototype._updateBoundingInfo = function () {
  7754. this._boundingInfo = this._boundingInfo || new BABYLON.BoundingInfo(this.absolutePosition, this.absolutePosition);
  7755. this._boundingInfo._update(this.worldMatrixFromCache);
  7756. this._updateSubMeshesBoundingInfo(this.worldMatrixFromCache);
  7757. };
  7758. AbstractMesh.prototype._updateSubMeshesBoundingInfo = function (matrix) {
  7759. if (!this.subMeshes) {
  7760. return;
  7761. }
  7762. for (var subIndex = 0; subIndex < this.subMeshes.length; subIndex++) {
  7763. var subMesh = this.subMeshes[subIndex];
  7764. subMesh.updateBoundingInfo(matrix);
  7765. }
  7766. };
  7767. AbstractMesh.prototype.computeWorldMatrix = function (force) {
  7768. if (this._isWorldMatrixFrozen) {
  7769. return this._worldMatrix;
  7770. }
  7771. if (!force && (this._currentRenderId === this.getScene().getRenderId() || this.isSynchronized(true))) {
  7772. return this._worldMatrix;
  7773. }
  7774. this._cache.position.copyFrom(this.position);
  7775. this._cache.scaling.copyFrom(this.scaling);
  7776. this._cache.pivotMatrixUpdated = false;
  7777. this._currentRenderId = this.getScene().getRenderId();
  7778. this._isDirty = false;
  7779. // Scaling
  7780. BABYLON.Matrix.ScalingToRef(this.scaling.x * this.scalingDeterminant, this.scaling.y * this.scalingDeterminant, this.scaling.z * this.scalingDeterminant, this._localScaling);
  7781. // Rotation
  7782. if (this.rotationQuaternion) {
  7783. this.rotationQuaternion.toRotationMatrix(this._localRotation);
  7784. this._cache.rotationQuaternion.copyFrom(this.rotationQuaternion);
  7785. }
  7786. else {
  7787. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._localRotation);
  7788. this._cache.rotation.copyFrom(this.rotation);
  7789. }
  7790. // Translation
  7791. if (this.infiniteDistance && !this.parent) {
  7792. var camera = this.getScene().activeCamera;
  7793. if (camera) {
  7794. var cameraWorldMatrix = camera.getWorldMatrix();
  7795. var cameraGlobalPosition = new BABYLON.Vector3(cameraWorldMatrix.m[12], cameraWorldMatrix.m[13], cameraWorldMatrix.m[14]);
  7796. BABYLON.Matrix.TranslationToRef(this.position.x + cameraGlobalPosition.x, this.position.y + cameraGlobalPosition.y, this.position.z + cameraGlobalPosition.z, this._localTranslation);
  7797. }
  7798. }
  7799. else {
  7800. BABYLON.Matrix.TranslationToRef(this.position.x, this.position.y, this.position.z, this._localTranslation);
  7801. }
  7802. // Composing transformations
  7803. this._pivotMatrix.multiplyToRef(this._localScaling, this._localPivotScaling);
  7804. this._localPivotScaling.multiplyToRef(this._localRotation, this._localPivotScalingRotation);
  7805. // Billboarding
  7806. if (this.billboardMode !== AbstractMesh.BILLBOARDMODE_NONE && this.getScene().activeCamera) {
  7807. var localPosition = this.position.clone();
  7808. var zero = this.getScene().activeCamera.globalPosition.clone();
  7809. if (this.parent && this.parent.position) {
  7810. localPosition.addInPlace(this.parent.position);
  7811. BABYLON.Matrix.TranslationToRef(localPosition.x, localPosition.y, localPosition.z, this._localTranslation);
  7812. }
  7813. if ((this.billboardMode & AbstractMesh.BILLBOARDMODE_ALL) !== AbstractMesh.BILLBOARDMODE_ALL) {
  7814. if (this.billboardMode & AbstractMesh.BILLBOARDMODE_X)
  7815. zero.x = localPosition.x + BABYLON.Engine.Epsilon;
  7816. if (this.billboardMode & AbstractMesh.BILLBOARDMODE_Y)
  7817. zero.y = localPosition.y + 0.001;
  7818. if (this.billboardMode & AbstractMesh.BILLBOARDMODE_Z)
  7819. zero.z = localPosition.z + 0.001;
  7820. }
  7821. BABYLON.Matrix.LookAtLHToRef(localPosition, zero, BABYLON.Vector3.Up(), this._localBillboard);
  7822. this._localBillboard.m[12] = this._localBillboard.m[13] = this._localBillboard.m[14] = 0;
  7823. this._localBillboard.invert();
  7824. this._localPivotScalingRotation.multiplyToRef(this._localBillboard, this._localWorld);
  7825. this._rotateYByPI.multiplyToRef(this._localWorld, this._localPivotScalingRotation);
  7826. }
  7827. // Local world
  7828. this._localPivotScalingRotation.multiplyToRef(this._localTranslation, this._localWorld);
  7829. // Parent
  7830. if (this.parent && this.parent.getWorldMatrix && this.billboardMode === AbstractMesh.BILLBOARDMODE_NONE) {
  7831. this._markSyncedWithParent();
  7832. if (this._meshToBoneReferal) {
  7833. if (!this._localMeshReferalTransform) {
  7834. this._localMeshReferalTransform = BABYLON.Matrix.Zero();
  7835. }
  7836. this._localWorld.multiplyToRef(this.parent.getWorldMatrix(), this._localMeshReferalTransform);
  7837. this._localMeshReferalTransform.multiplyToRef(this._meshToBoneReferal.getWorldMatrix(), this._worldMatrix);
  7838. }
  7839. else {
  7840. this._localWorld.multiplyToRef(this.parent.getWorldMatrix(), this._worldMatrix);
  7841. }
  7842. }
  7843. else {
  7844. this._worldMatrix.copyFrom(this._localWorld);
  7845. }
  7846. // Bounding info
  7847. this._updateBoundingInfo();
  7848. // Absolute position
  7849. this._absolutePosition.copyFromFloats(this._worldMatrix.m[12], this._worldMatrix.m[13], this._worldMatrix.m[14]);
  7850. // Callbacks
  7851. for (var callbackIndex = 0; callbackIndex < this._onAfterWorldMatrixUpdate.length; callbackIndex++) {
  7852. this._onAfterWorldMatrixUpdate[callbackIndex](this);
  7853. }
  7854. return this._worldMatrix;
  7855. };
  7856. /**
  7857. * If you'd like to be callbacked after the mesh position, rotation or scaling has been updated
  7858. * @param func: callback function to add
  7859. */
  7860. AbstractMesh.prototype.registerAfterWorldMatrixUpdate = function (func) {
  7861. this._onAfterWorldMatrixUpdate.push(func);
  7862. };
  7863. AbstractMesh.prototype.unregisterAfterWorldMatrixUpdate = function (func) {
  7864. var index = this._onAfterWorldMatrixUpdate.indexOf(func);
  7865. if (index > -1) {
  7866. this._onAfterWorldMatrixUpdate.splice(index, 1);
  7867. }
  7868. };
  7869. AbstractMesh.prototype.setPositionWithLocalVector = function (vector3) {
  7870. this.computeWorldMatrix();
  7871. this.position = BABYLON.Vector3.TransformNormal(vector3, this._localWorld);
  7872. };
  7873. AbstractMesh.prototype.getPositionExpressedInLocalSpace = function () {
  7874. this.computeWorldMatrix();
  7875. var invLocalWorldMatrix = this._localWorld.clone();
  7876. invLocalWorldMatrix.invert();
  7877. return BABYLON.Vector3.TransformNormal(this.position, invLocalWorldMatrix);
  7878. };
  7879. AbstractMesh.prototype.locallyTranslate = function (vector3) {
  7880. this.computeWorldMatrix(true);
  7881. this.position = BABYLON.Vector3.TransformCoordinates(vector3, this._localWorld);
  7882. };
  7883. AbstractMesh.prototype.lookAt = function (targetPoint, yawCor, pitchCor, rollCor) {
  7884. /// <summary>Orients a mesh towards a target point. Mesh must be drawn facing user.</summary>
  7885. /// <param name="targetPoint" type="Vector3">The position (must be in same space as current mesh) to look at</param>
  7886. /// <param name="yawCor" type="Number">optional yaw (y-axis) correction in radians</param>
  7887. /// <param name="pitchCor" type="Number">optional pitch (x-axis) correction in radians</param>
  7888. /// <param name="rollCor" type="Number">optional roll (z-axis) correction in radians</param>
  7889. /// <returns>Mesh oriented towards targetMesh</returns>
  7890. yawCor = yawCor || 0; // default to zero if undefined
  7891. pitchCor = pitchCor || 0;
  7892. rollCor = rollCor || 0;
  7893. var dv = targetPoint.subtract(this.position);
  7894. var yaw = -Math.atan2(dv.z, dv.x) - Math.PI / 2;
  7895. var len = Math.sqrt(dv.x * dv.x + dv.z * dv.z);
  7896. var pitch = Math.atan2(dv.y, len);
  7897. this.rotationQuaternion = BABYLON.Quaternion.RotationYawPitchRoll(yaw + yawCor, pitch + pitchCor, rollCor);
  7898. };
  7899. AbstractMesh.prototype.attachToBone = function (bone, affectedMesh) {
  7900. this._meshToBoneReferal = affectedMesh;
  7901. this.parent = bone;
  7902. if (bone.getWorldMatrix().determinant() < 0) {
  7903. this.scalingDeterminant *= -1;
  7904. }
  7905. };
  7906. AbstractMesh.prototype.detachFromBone = function () {
  7907. if (this.parent.getWorldMatrix().determinant() < 0) {
  7908. this.scalingDeterminant *= -1;
  7909. }
  7910. this._meshToBoneReferal = null;
  7911. this.parent = null;
  7912. };
  7913. AbstractMesh.prototype.isInFrustum = function (frustumPlanes) {
  7914. return this._boundingInfo.isInFrustum(frustumPlanes);
  7915. };
  7916. AbstractMesh.prototype.isCompletelyInFrustum = function (camera) {
  7917. if (!camera) {
  7918. camera = this.getScene().activeCamera;
  7919. }
  7920. var transformMatrix = camera.getViewMatrix().multiply(camera.getProjectionMatrix());
  7921. if (!this._boundingInfo.isCompletelyInFrustum(BABYLON.Frustum.GetPlanes(transformMatrix))) {
  7922. return false;
  7923. }
  7924. return true;
  7925. };
  7926. AbstractMesh.prototype.intersectsMesh = function (mesh, precise) {
  7927. if (!this._boundingInfo || !mesh._boundingInfo) {
  7928. return false;
  7929. }
  7930. return this._boundingInfo.intersects(mesh._boundingInfo, precise);
  7931. };
  7932. AbstractMesh.prototype.intersectsPoint = function (point) {
  7933. if (!this._boundingInfo) {
  7934. return false;
  7935. }
  7936. return this._boundingInfo.intersectsPoint(point);
  7937. };
  7938. // Physics
  7939. AbstractMesh.prototype.setPhysicsState = function (impostor, options) {
  7940. var physicsEngine = this.getScene().getPhysicsEngine();
  7941. if (!physicsEngine) {
  7942. return null;
  7943. }
  7944. impostor = impostor || BABYLON.PhysicsEngine.NoImpostor;
  7945. if (impostor.impostor) {
  7946. // Old API
  7947. options = impostor;
  7948. impostor = impostor.impostor;
  7949. }
  7950. if (impostor === BABYLON.PhysicsEngine.NoImpostor) {
  7951. physicsEngine._unregisterMesh(this);
  7952. return null;
  7953. }
  7954. if (!options) {
  7955. options = { mass: 0, friction: 0.2, restitution: 0.2 };
  7956. }
  7957. else {
  7958. if (!options.mass && options.mass !== 0)
  7959. options.mass = 0;
  7960. if (!options.friction && options.friction !== 0)
  7961. options.friction = 0.2;
  7962. if (!options.restitution && options.restitution !== 0)
  7963. options.restitution = 0.2;
  7964. }
  7965. this._physicImpostor = impostor;
  7966. this._physicsMass = options.mass;
  7967. this._physicsFriction = options.friction;
  7968. this._physicRestitution = options.restitution;
  7969. return physicsEngine._registerMesh(this, impostor, options);
  7970. };
  7971. AbstractMesh.prototype.getPhysicsImpostor = function () {
  7972. if (!this._physicImpostor) {
  7973. return BABYLON.PhysicsEngine.NoImpostor;
  7974. }
  7975. return this._physicImpostor;
  7976. };
  7977. AbstractMesh.prototype.getPhysicsMass = function () {
  7978. if (!this._physicsMass) {
  7979. return 0;
  7980. }
  7981. return this._physicsMass;
  7982. };
  7983. AbstractMesh.prototype.getPhysicsFriction = function () {
  7984. if (!this._physicsFriction) {
  7985. return 0;
  7986. }
  7987. return this._physicsFriction;
  7988. };
  7989. AbstractMesh.prototype.getPhysicsRestitution = function () {
  7990. if (!this._physicRestitution) {
  7991. return 0;
  7992. }
  7993. return this._physicRestitution;
  7994. };
  7995. AbstractMesh.prototype.getPositionInCameraSpace = function (camera) {
  7996. if (!camera) {
  7997. camera = this.getScene().activeCamera;
  7998. }
  7999. return BABYLON.Vector3.TransformCoordinates(this.absolutePosition, camera.getViewMatrix());
  8000. };
  8001. AbstractMesh.prototype.getDistanceToCamera = function (camera) {
  8002. if (!camera) {
  8003. camera = this.getScene().activeCamera;
  8004. }
  8005. return this.absolutePosition.subtract(camera.position).length();
  8006. };
  8007. AbstractMesh.prototype.applyImpulse = function (force, contactPoint) {
  8008. if (!this._physicImpostor) {
  8009. return;
  8010. }
  8011. this.getScene().getPhysicsEngine()._applyImpulse(this, force, contactPoint);
  8012. };
  8013. AbstractMesh.prototype.setPhysicsLinkWith = function (otherMesh, pivot1, pivot2, options) {
  8014. if (!this._physicImpostor) {
  8015. return;
  8016. }
  8017. this.getScene().getPhysicsEngine()._createLink(this, otherMesh, pivot1, pivot2, options);
  8018. };
  8019. AbstractMesh.prototype.updatePhysicsBodyPosition = function () {
  8020. if (!this._physicImpostor) {
  8021. return;
  8022. }
  8023. this.getScene().getPhysicsEngine()._updateBodyPosition(this);
  8024. };
  8025. Object.defineProperty(AbstractMesh.prototype, "checkCollisions", {
  8026. // Collisions
  8027. get: function () {
  8028. return this._checkCollisions;
  8029. },
  8030. set: function (collisionEnabled) {
  8031. this._checkCollisions = collisionEnabled;
  8032. if (this.getScene().workerCollisions) {
  8033. this.getScene().collisionCoordinator.onMeshUpdated(this);
  8034. }
  8035. },
  8036. enumerable: true,
  8037. configurable: true
  8038. });
  8039. AbstractMesh.prototype.moveWithCollisions = function (velocity) {
  8040. var globalPosition = this.getAbsolutePosition();
  8041. globalPosition.subtractFromFloatsToRef(0, this.ellipsoid.y, 0, this._oldPositionForCollisions);
  8042. this._oldPositionForCollisions.addInPlace(this.ellipsoidOffset);
  8043. this._collider.radius = this.ellipsoid;
  8044. this.getScene().collisionCoordinator.getNewPosition(this._oldPositionForCollisions, velocity, this._collider, 3, this, this._onCollisionPositionChange, this.uniqueId);
  8045. };
  8046. // Submeshes octree
  8047. /**
  8048. * This function will create an octree to help select the right submeshes for rendering, picking and collisions
  8049. * Please note that you must have a decent number of submeshes to get performance improvements when using octree
  8050. */
  8051. AbstractMesh.prototype.createOrUpdateSubmeshesOctree = function (maxCapacity, maxDepth) {
  8052. if (maxCapacity === void 0) { maxCapacity = 64; }
  8053. if (maxDepth === void 0) { maxDepth = 2; }
  8054. if (!this._submeshesOctree) {
  8055. this._submeshesOctree = new BABYLON.Octree(BABYLON.Octree.CreationFuncForSubMeshes, maxCapacity, maxDepth);
  8056. }
  8057. this.computeWorldMatrix(true);
  8058. // Update octree
  8059. var bbox = this.getBoundingInfo().boundingBox;
  8060. this._submeshesOctree.update(bbox.minimumWorld, bbox.maximumWorld, this.subMeshes);
  8061. return this._submeshesOctree;
  8062. };
  8063. // Collisions
  8064. AbstractMesh.prototype._collideForSubMesh = function (subMesh, transformMatrix, collider) {
  8065. this._generatePointsArray();
  8066. // Transformation
  8067. if (!subMesh._lastColliderWorldVertices || !subMesh._lastColliderTransformMatrix.equals(transformMatrix)) {
  8068. subMesh._lastColliderTransformMatrix = transformMatrix.clone();
  8069. subMesh._lastColliderWorldVertices = [];
  8070. subMesh._trianglePlanes = [];
  8071. var start = subMesh.verticesStart;
  8072. var end = (subMesh.verticesStart + subMesh.verticesCount);
  8073. for (var i = start; i < end; i++) {
  8074. subMesh._lastColliderWorldVertices.push(BABYLON.Vector3.TransformCoordinates(this._positions[i], transformMatrix));
  8075. }
  8076. }
  8077. // Collide
  8078. collider._collide(subMesh._trianglePlanes, subMesh._lastColliderWorldVertices, this.getIndices(), subMesh.indexStart, subMesh.indexStart + subMesh.indexCount, subMesh.verticesStart, !!subMesh.getMaterial());
  8079. if (collider.collisionFound) {
  8080. collider.collidedMesh = this;
  8081. }
  8082. };
  8083. AbstractMesh.prototype._processCollisionsForSubMeshes = function (collider, transformMatrix) {
  8084. var subMeshes;
  8085. var len;
  8086. // Octrees
  8087. if (this._submeshesOctree && this.useOctreeForCollisions) {
  8088. var radius = collider.velocityWorldLength + Math.max(collider.radius.x, collider.radius.y, collider.radius.z);
  8089. var intersections = this._submeshesOctree.intersects(collider.basePointWorld, radius);
  8090. len = intersections.length;
  8091. subMeshes = intersections.data;
  8092. }
  8093. else {
  8094. subMeshes = this.subMeshes;
  8095. len = subMeshes.length;
  8096. }
  8097. for (var index = 0; index < len; index++) {
  8098. var subMesh = subMeshes[index];
  8099. // Bounding test
  8100. if (len > 1 && !subMesh._checkCollision(collider))
  8101. continue;
  8102. this._collideForSubMesh(subMesh, transformMatrix, collider);
  8103. }
  8104. };
  8105. AbstractMesh.prototype._checkCollision = function (collider) {
  8106. // Bounding box test
  8107. if (!this._boundingInfo._checkCollision(collider))
  8108. return;
  8109. // Transformation matrix
  8110. BABYLON.Matrix.ScalingToRef(1.0 / collider.radius.x, 1.0 / collider.radius.y, 1.0 / collider.radius.z, this._collisionsScalingMatrix);
  8111. this.worldMatrixFromCache.multiplyToRef(this._collisionsScalingMatrix, this._collisionsTransformMatrix);
  8112. this._processCollisionsForSubMeshes(collider, this._collisionsTransformMatrix);
  8113. };
  8114. // Picking
  8115. AbstractMesh.prototype._generatePointsArray = function () {
  8116. return false;
  8117. };
  8118. AbstractMesh.prototype.intersects = function (ray, fastCheck) {
  8119. var pickingInfo = new BABYLON.PickingInfo();
  8120. if (!this.subMeshes || !this._boundingInfo || !ray.intersectsSphere(this._boundingInfo.boundingSphere) || !ray.intersectsBox(this._boundingInfo.boundingBox)) {
  8121. return pickingInfo;
  8122. }
  8123. if (!this._generatePointsArray()) {
  8124. return pickingInfo;
  8125. }
  8126. var intersectInfo = null;
  8127. // Octrees
  8128. var subMeshes;
  8129. var len;
  8130. if (this._submeshesOctree && this.useOctreeForPicking) {
  8131. var worldRay = BABYLON.Ray.Transform(ray, this.getWorldMatrix());
  8132. var intersections = this._submeshesOctree.intersectsRay(worldRay);
  8133. len = intersections.length;
  8134. subMeshes = intersections.data;
  8135. }
  8136. else {
  8137. subMeshes = this.subMeshes;
  8138. len = subMeshes.length;
  8139. }
  8140. for (var index = 0; index < len; index++) {
  8141. var subMesh = subMeshes[index];
  8142. // Bounding test
  8143. if (len > 1 && !subMesh.canIntersects(ray))
  8144. continue;
  8145. var currentIntersectInfo = subMesh.intersects(ray, this._positions, this.getIndices(), fastCheck);
  8146. if (currentIntersectInfo) {
  8147. if (fastCheck || !intersectInfo || currentIntersectInfo.distance < intersectInfo.distance) {
  8148. intersectInfo = currentIntersectInfo;
  8149. intersectInfo.subMeshId = index;
  8150. if (fastCheck) {
  8151. break;
  8152. }
  8153. }
  8154. }
  8155. }
  8156. if (intersectInfo) {
  8157. // Get picked point
  8158. var world = this.getWorldMatrix();
  8159. var worldOrigin = BABYLON.Vector3.TransformCoordinates(ray.origin, world);
  8160. var direction = ray.direction.clone();
  8161. direction = direction.scale(intersectInfo.distance);
  8162. var worldDirection = BABYLON.Vector3.TransformNormal(direction, world);
  8163. var pickedPoint = worldOrigin.add(worldDirection);
  8164. // Return result
  8165. pickingInfo.hit = true;
  8166. pickingInfo.distance = BABYLON.Vector3.Distance(worldOrigin, pickedPoint);
  8167. pickingInfo.pickedPoint = pickedPoint;
  8168. pickingInfo.pickedMesh = this;
  8169. pickingInfo.bu = intersectInfo.bu;
  8170. pickingInfo.bv = intersectInfo.bv;
  8171. pickingInfo.faceId = intersectInfo.faceId;
  8172. pickingInfo.subMeshId = intersectInfo.subMeshId;
  8173. return pickingInfo;
  8174. }
  8175. return pickingInfo;
  8176. };
  8177. AbstractMesh.prototype.clone = function (name, newParent, doNotCloneChildren) {
  8178. return null;
  8179. };
  8180. AbstractMesh.prototype.releaseSubMeshes = function () {
  8181. if (this.subMeshes) {
  8182. while (this.subMeshes.length) {
  8183. this.subMeshes[0].dispose();
  8184. }
  8185. }
  8186. else {
  8187. this.subMeshes = new Array();
  8188. }
  8189. };
  8190. AbstractMesh.prototype.dispose = function (doNotRecurse) {
  8191. var index;
  8192. // Physics
  8193. if (this.getPhysicsImpostor() !== BABYLON.PhysicsEngine.NoImpostor) {
  8194. this.setPhysicsState(BABYLON.PhysicsEngine.NoImpostor);
  8195. }
  8196. // Intersections in progress
  8197. for (index = 0; index < this._intersectionsInProgress.length; index++) {
  8198. var other = this._intersectionsInProgress[index];
  8199. var pos = other._intersectionsInProgress.indexOf(this);
  8200. other._intersectionsInProgress.splice(pos, 1);
  8201. }
  8202. this._intersectionsInProgress = [];
  8203. // Edges
  8204. if (this._edgesRenderer) {
  8205. this._edgesRenderer.dispose();
  8206. this._edgesRenderer = null;
  8207. }
  8208. // SubMeshes
  8209. this.releaseSubMeshes();
  8210. // Remove from scene
  8211. this.getScene().removeMesh(this);
  8212. if (!doNotRecurse) {
  8213. // Particles
  8214. for (index = 0; index < this.getScene().particleSystems.length; index++) {
  8215. if (this.getScene().particleSystems[index].emitter === this) {
  8216. this.getScene().particleSystems[index].dispose();
  8217. index--;
  8218. }
  8219. }
  8220. // Children
  8221. var objects = this.getScene().meshes.slice(0);
  8222. for (index = 0; index < objects.length; index++) {
  8223. if (objects[index].parent === this) {
  8224. objects[index].dispose();
  8225. }
  8226. }
  8227. }
  8228. else {
  8229. for (index = 0; index < this.getScene().meshes.length; index++) {
  8230. var obj = this.getScene().meshes[index];
  8231. if (obj.parent === this) {
  8232. obj.parent = null;
  8233. obj.computeWorldMatrix(true);
  8234. }
  8235. }
  8236. }
  8237. this._onAfterWorldMatrixUpdate = [];
  8238. this._isDisposed = true;
  8239. // Callback
  8240. if (this.onDispose) {
  8241. this.onDispose();
  8242. }
  8243. };
  8244. // Statics
  8245. AbstractMesh._BILLBOARDMODE_NONE = 0;
  8246. AbstractMesh._BILLBOARDMODE_X = 1;
  8247. AbstractMesh._BILLBOARDMODE_Y = 2;
  8248. AbstractMesh._BILLBOARDMODE_Z = 4;
  8249. AbstractMesh._BILLBOARDMODE_ALL = 7;
  8250. return AbstractMesh;
  8251. })(BABYLON.Node);
  8252. BABYLON.AbstractMesh = AbstractMesh;
  8253. })(BABYLON || (BABYLON = {}));
  8254. var BABYLON;
  8255. (function (BABYLON) {
  8256. var Light = (function (_super) {
  8257. __extends(Light, _super);
  8258. function Light(name, scene) {
  8259. _super.call(this, name, scene);
  8260. this.diffuse = new BABYLON.Color3(1.0, 1.0, 1.0);
  8261. this.specular = new BABYLON.Color3(1.0, 1.0, 1.0);
  8262. this.intensity = 1.0;
  8263. this.range = Number.MAX_VALUE;
  8264. this.includeOnlyWithLayerMask = 0;
  8265. this.includedOnlyMeshes = new Array();
  8266. this.excludedMeshes = new Array();
  8267. this.excludeWithLayerMask = 0;
  8268. this._excludedMeshesIds = new Array();
  8269. this._includedOnlyMeshesIds = new Array();
  8270. scene.addLight(this);
  8271. }
  8272. Light.prototype.getShadowGenerator = function () {
  8273. return this._shadowGenerator;
  8274. };
  8275. Light.prototype.getAbsolutePosition = function () {
  8276. return BABYLON.Vector3.Zero();
  8277. };
  8278. Light.prototype.transferToEffect = function (effect, uniformName0, uniformName1) {
  8279. };
  8280. Light.prototype._getWorldMatrix = function () {
  8281. return BABYLON.Matrix.Identity();
  8282. };
  8283. Light.prototype.canAffectMesh = function (mesh) {
  8284. if (!mesh) {
  8285. return true;
  8286. }
  8287. if (this.includedOnlyMeshes.length > 0 && this.includedOnlyMeshes.indexOf(mesh) === -1) {
  8288. return false;
  8289. }
  8290. if (this.excludedMeshes.length > 0 && this.excludedMeshes.indexOf(mesh) !== -1) {
  8291. return false;
  8292. }
  8293. if (this.includeOnlyWithLayerMask !== 0 && (this.includeOnlyWithLayerMask & mesh.layerMask) === 0) {
  8294. return false;
  8295. }
  8296. if (this.excludeWithLayerMask !== 0 && this.excludeWithLayerMask & mesh.layerMask) {
  8297. return false;
  8298. }
  8299. return true;
  8300. };
  8301. Light.prototype.getWorldMatrix = function () {
  8302. this._currentRenderId = this.getScene().getRenderId();
  8303. var worldMatrix = this._getWorldMatrix();
  8304. if (this.parent && this.parent.getWorldMatrix) {
  8305. if (!this._parentedWorldMatrix) {
  8306. this._parentedWorldMatrix = BABYLON.Matrix.Identity();
  8307. }
  8308. worldMatrix.multiplyToRef(this.parent.getWorldMatrix(), this._parentedWorldMatrix);
  8309. this._markSyncedWithParent();
  8310. return this._parentedWorldMatrix;
  8311. }
  8312. return worldMatrix;
  8313. };
  8314. Light.prototype.dispose = function () {
  8315. if (this._shadowGenerator) {
  8316. this._shadowGenerator.dispose();
  8317. this._shadowGenerator = null;
  8318. }
  8319. // Remove from scene
  8320. this.getScene().removeLight(this);
  8321. };
  8322. return Light;
  8323. })(BABYLON.Node);
  8324. BABYLON.Light = Light;
  8325. })(BABYLON || (BABYLON = {}));
  8326. var BABYLON;
  8327. (function (BABYLON) {
  8328. var PointLight = (function (_super) {
  8329. __extends(PointLight, _super);
  8330. function PointLight(name, position, scene) {
  8331. _super.call(this, name, scene);
  8332. this.position = position;
  8333. }
  8334. PointLight.prototype.getAbsolutePosition = function () {
  8335. return this._transformedPosition ? this._transformedPosition : this.position;
  8336. };
  8337. PointLight.prototype.transferToEffect = function (effect, positionUniformName) {
  8338. if (this.parent && this.parent.getWorldMatrix) {
  8339. if (!this._transformedPosition) {
  8340. this._transformedPosition = BABYLON.Vector3.Zero();
  8341. }
  8342. BABYLON.Vector3.TransformCoordinatesToRef(this.position, this.parent.getWorldMatrix(), this._transformedPosition);
  8343. effect.setFloat4(positionUniformName, this._transformedPosition.x, this._transformedPosition.y, this._transformedPosition.z, 0);
  8344. return;
  8345. }
  8346. effect.setFloat4(positionUniformName, this.position.x, this.position.y, this.position.z, 0);
  8347. };
  8348. PointLight.prototype.getShadowGenerator = function () {
  8349. return null;
  8350. };
  8351. PointLight.prototype._getWorldMatrix = function () {
  8352. if (!this._worldMatrix) {
  8353. this._worldMatrix = BABYLON.Matrix.Identity();
  8354. }
  8355. BABYLON.Matrix.TranslationToRef(this.position.x, this.position.y, this.position.z, this._worldMatrix);
  8356. return this._worldMatrix;
  8357. };
  8358. return PointLight;
  8359. })(BABYLON.Light);
  8360. BABYLON.PointLight = PointLight;
  8361. })(BABYLON || (BABYLON = {}));
  8362. var BABYLON;
  8363. (function (BABYLON) {
  8364. var SpotLight = (function (_super) {
  8365. __extends(SpotLight, _super);
  8366. function SpotLight(name, position, direction, angle, exponent, scene) {
  8367. _super.call(this, name, scene);
  8368. this.position = position;
  8369. this.direction = direction;
  8370. this.angle = angle;
  8371. this.exponent = exponent;
  8372. }
  8373. SpotLight.prototype.getAbsolutePosition = function () {
  8374. return this.transformedPosition ? this.transformedPosition : this.position;
  8375. };
  8376. SpotLight.prototype.setShadowProjectionMatrix = function (matrix, viewMatrix, renderList) {
  8377. var activeCamera = this.getScene().activeCamera;
  8378. BABYLON.Matrix.PerspectiveFovLHToRef(this.angle, 1.0, activeCamera.minZ, activeCamera.maxZ, matrix);
  8379. };
  8380. SpotLight.prototype.supportsVSM = function () {
  8381. return true;
  8382. };
  8383. SpotLight.prototype.needRefreshPerFrame = function () {
  8384. return false;
  8385. };
  8386. SpotLight.prototype.setDirectionToTarget = function (target) {
  8387. this.direction = BABYLON.Vector3.Normalize(target.subtract(this.position));
  8388. return this.direction;
  8389. };
  8390. SpotLight.prototype.computeTransformedPosition = function () {
  8391. if (this.parent && this.parent.getWorldMatrix) {
  8392. if (!this.transformedPosition) {
  8393. this.transformedPosition = BABYLON.Vector3.Zero();
  8394. }
  8395. BABYLON.Vector3.TransformCoordinatesToRef(this.position, this.parent.getWorldMatrix(), this.transformedPosition);
  8396. return true;
  8397. }
  8398. return false;
  8399. };
  8400. SpotLight.prototype.transferToEffect = function (effect, positionUniformName, directionUniformName) {
  8401. var normalizeDirection;
  8402. if (this.parent && this.parent.getWorldMatrix) {
  8403. if (!this._transformedDirection) {
  8404. this._transformedDirection = BABYLON.Vector3.Zero();
  8405. }
  8406. this.computeTransformedPosition();
  8407. BABYLON.Vector3.TransformNormalToRef(this.direction, this.parent.getWorldMatrix(), this._transformedDirection);
  8408. effect.setFloat4(positionUniformName, this.transformedPosition.x, this.transformedPosition.y, this.transformedPosition.z, this.exponent);
  8409. normalizeDirection = BABYLON.Vector3.Normalize(this._transformedDirection);
  8410. }
  8411. else {
  8412. effect.setFloat4(positionUniformName, this.position.x, this.position.y, this.position.z, this.exponent);
  8413. normalizeDirection = BABYLON.Vector3.Normalize(this.direction);
  8414. }
  8415. effect.setFloat4(directionUniformName, normalizeDirection.x, normalizeDirection.y, normalizeDirection.z, Math.cos(this.angle * 0.5));
  8416. };
  8417. SpotLight.prototype._getWorldMatrix = function () {
  8418. if (!this._worldMatrix) {
  8419. this._worldMatrix = BABYLON.Matrix.Identity();
  8420. }
  8421. BABYLON.Matrix.TranslationToRef(this.position.x, this.position.y, this.position.z, this._worldMatrix);
  8422. return this._worldMatrix;
  8423. };
  8424. return SpotLight;
  8425. })(BABYLON.Light);
  8426. BABYLON.SpotLight = SpotLight;
  8427. })(BABYLON || (BABYLON = {}));
  8428. var BABYLON;
  8429. (function (BABYLON) {
  8430. var HemisphericLight = (function (_super) {
  8431. __extends(HemisphericLight, _super);
  8432. function HemisphericLight(name, direction, scene) {
  8433. _super.call(this, name, scene);
  8434. this.direction = direction;
  8435. this.groundColor = new BABYLON.Color3(0.0, 0.0, 0.0);
  8436. }
  8437. HemisphericLight.prototype.setDirectionToTarget = function (target) {
  8438. this.direction = BABYLON.Vector3.Normalize(target.subtract(BABYLON.Vector3.Zero()));
  8439. return this.direction;
  8440. };
  8441. HemisphericLight.prototype.getShadowGenerator = function () {
  8442. return null;
  8443. };
  8444. HemisphericLight.prototype.transferToEffect = function (effect, directionUniformName, groundColorUniformName) {
  8445. var normalizeDirection = BABYLON.Vector3.Normalize(this.direction);
  8446. effect.setFloat4(directionUniformName, normalizeDirection.x, normalizeDirection.y, normalizeDirection.z, 0);
  8447. effect.setColor3(groundColorUniformName, this.groundColor.scale(this.intensity));
  8448. };
  8449. HemisphericLight.prototype._getWorldMatrix = function () {
  8450. if (!this._worldMatrix) {
  8451. this._worldMatrix = BABYLON.Matrix.Identity();
  8452. }
  8453. return this._worldMatrix;
  8454. };
  8455. return HemisphericLight;
  8456. })(BABYLON.Light);
  8457. BABYLON.HemisphericLight = HemisphericLight;
  8458. })(BABYLON || (BABYLON = {}));
  8459. var BABYLON;
  8460. (function (BABYLON) {
  8461. var DirectionalLight = (function (_super) {
  8462. __extends(DirectionalLight, _super);
  8463. function DirectionalLight(name, direction, scene) {
  8464. _super.call(this, name, scene);
  8465. this.direction = direction;
  8466. this.shadowOrthoScale = 0.5;
  8467. this.autoUpdateExtends = true;
  8468. // Cache
  8469. this._orthoLeft = Number.MAX_VALUE;
  8470. this._orthoRight = Number.MIN_VALUE;
  8471. this._orthoTop = Number.MIN_VALUE;
  8472. this._orthoBottom = Number.MAX_VALUE;
  8473. this.position = direction.scale(-1);
  8474. }
  8475. DirectionalLight.prototype.getAbsolutePosition = function () {
  8476. return this.transformedPosition ? this.transformedPosition : this.position;
  8477. };
  8478. DirectionalLight.prototype.setDirectionToTarget = function (target) {
  8479. this.direction = BABYLON.Vector3.Normalize(target.subtract(this.position));
  8480. return this.direction;
  8481. };
  8482. DirectionalLight.prototype.setShadowProjectionMatrix = function (matrix, viewMatrix, renderList) {
  8483. var activeCamera = this.getScene().activeCamera;
  8484. // Check extends
  8485. if (this.autoUpdateExtends || this._orthoLeft === Number.MAX_VALUE) {
  8486. var tempVector3 = BABYLON.Vector3.Zero();
  8487. this._orthoLeft = Number.MAX_VALUE;
  8488. this._orthoRight = Number.MIN_VALUE;
  8489. this._orthoTop = Number.MIN_VALUE;
  8490. this._orthoBottom = Number.MAX_VALUE;
  8491. for (var meshIndex = 0; meshIndex < renderList.length; meshIndex++) {
  8492. var mesh = renderList[meshIndex];
  8493. if (!mesh) {
  8494. continue;
  8495. }
  8496. var boundingInfo = mesh.getBoundingInfo();
  8497. if (!boundingInfo) {
  8498. continue;
  8499. }
  8500. var boundingBox = boundingInfo.boundingBox;
  8501. for (var index = 0; index < boundingBox.vectorsWorld.length; index++) {
  8502. BABYLON.Vector3.TransformCoordinatesToRef(boundingBox.vectorsWorld[index], viewMatrix, tempVector3);
  8503. if (tempVector3.x < this._orthoLeft)
  8504. this._orthoLeft = tempVector3.x;
  8505. if (tempVector3.y < this._orthoBottom)
  8506. this._orthoBottom = tempVector3.y;
  8507. if (tempVector3.x > this._orthoRight)
  8508. this._orthoRight = tempVector3.x;
  8509. if (tempVector3.y > this._orthoTop)
  8510. this._orthoTop = tempVector3.y;
  8511. }
  8512. }
  8513. }
  8514. var xOffset = this._orthoRight - this._orthoLeft;
  8515. var yOffset = this._orthoTop - this._orthoBottom;
  8516. BABYLON.Matrix.OrthoOffCenterLHToRef(this._orthoLeft - xOffset * this.shadowOrthoScale, this._orthoRight + xOffset * this.shadowOrthoScale, this._orthoBottom - yOffset * this.shadowOrthoScale, this._orthoTop + yOffset * this.shadowOrthoScale, -activeCamera.maxZ, activeCamera.maxZ, matrix);
  8517. };
  8518. DirectionalLight.prototype.supportsVSM = function () {
  8519. return true;
  8520. };
  8521. DirectionalLight.prototype.needRefreshPerFrame = function () {
  8522. return true;
  8523. };
  8524. DirectionalLight.prototype.computeTransformedPosition = function () {
  8525. if (this.parent && this.parent.getWorldMatrix) {
  8526. if (!this.transformedPosition) {
  8527. this.transformedPosition = BABYLON.Vector3.Zero();
  8528. }
  8529. BABYLON.Vector3.TransformCoordinatesToRef(this.position, this.parent.getWorldMatrix(), this.transformedPosition);
  8530. return true;
  8531. }
  8532. return false;
  8533. };
  8534. DirectionalLight.prototype.transferToEffect = function (effect, directionUniformName) {
  8535. if (this.parent && this.parent.getWorldMatrix) {
  8536. if (!this._transformedDirection) {
  8537. this._transformedDirection = BABYLON.Vector3.Zero();
  8538. }
  8539. BABYLON.Vector3.TransformNormalToRef(this.direction, this.parent.getWorldMatrix(), this._transformedDirection);
  8540. effect.setFloat4(directionUniformName, this._transformedDirection.x, this._transformedDirection.y, this._transformedDirection.z, 1);
  8541. return;
  8542. }
  8543. effect.setFloat4(directionUniformName, this.direction.x, this.direction.y, this.direction.z, 1);
  8544. };
  8545. DirectionalLight.prototype._getWorldMatrix = function () {
  8546. if (!this._worldMatrix) {
  8547. this._worldMatrix = BABYLON.Matrix.Identity();
  8548. }
  8549. BABYLON.Matrix.TranslationToRef(this.position.x, this.position.y, this.position.z, this._worldMatrix);
  8550. return this._worldMatrix;
  8551. };
  8552. return DirectionalLight;
  8553. })(BABYLON.Light);
  8554. BABYLON.DirectionalLight = DirectionalLight;
  8555. })(BABYLON || (BABYLON = {}));
  8556. var BABYLON;
  8557. (function (BABYLON) {
  8558. var ShadowGenerator = (function () {
  8559. function ShadowGenerator(mapSize, light) {
  8560. var _this = this;
  8561. // Members
  8562. this._filter = ShadowGenerator.FILTER_NONE;
  8563. this.blurScale = 2;
  8564. this._blurBoxOffset = 0;
  8565. this._bias = 0.00005;
  8566. this._lightDirection = BABYLON.Vector3.Zero();
  8567. this._darkness = 0;
  8568. this._transparencyShadow = false;
  8569. this._viewMatrix = BABYLON.Matrix.Zero();
  8570. this._projectionMatrix = BABYLON.Matrix.Zero();
  8571. this._transformMatrix = BABYLON.Matrix.Zero();
  8572. this._worldViewProjection = BABYLON.Matrix.Zero();
  8573. this._light = light;
  8574. this._scene = light.getScene();
  8575. this._mapSize = mapSize;
  8576. light._shadowGenerator = this;
  8577. // Render target
  8578. this._shadowMap = new BABYLON.RenderTargetTexture(light.name + "_shadowMap", mapSize, this._scene, false);
  8579. this._shadowMap.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  8580. this._shadowMap.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  8581. this._shadowMap.anisotropicFilteringLevel = 1;
  8582. this._shadowMap.updateSamplingMode(BABYLON.Texture.NEAREST_SAMPLINGMODE);
  8583. this._shadowMap.renderParticles = false;
  8584. this._shadowMap.onAfterUnbind = function () {
  8585. if (!_this.useBlurVarianceShadowMap) {
  8586. return;
  8587. }
  8588. if (!_this._shadowMap2) {
  8589. _this._shadowMap2 = new BABYLON.RenderTargetTexture(light.name + "_shadowMap", mapSize, _this._scene, false);
  8590. _this._shadowMap2.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  8591. _this._shadowMap2.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  8592. _this._shadowMap2.updateSamplingMode(BABYLON.Texture.TRILINEAR_SAMPLINGMODE);
  8593. _this._downSamplePostprocess = new BABYLON.PassPostProcess("downScale", 1.0 / _this.blurScale, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, _this._scene.getEngine());
  8594. _this._downSamplePostprocess.onApply = function (effect) {
  8595. effect.setTexture("textureSampler", _this._shadowMap);
  8596. };
  8597. _this.blurBoxOffset = 1;
  8598. }
  8599. _this._scene.postProcessManager.directRender([_this._downSamplePostprocess, _this._boxBlurPostprocess], _this._shadowMap2.getInternalTexture());
  8600. };
  8601. // Custom render function
  8602. var renderSubMesh = function (subMesh) {
  8603. var mesh = subMesh.getRenderingMesh();
  8604. var scene = _this._scene;
  8605. var engine = scene.getEngine();
  8606. // Culling
  8607. engine.setState(subMesh.getMaterial().backFaceCulling);
  8608. // Managing instances
  8609. var batch = mesh._getInstancesRenderList(subMesh._id);
  8610. if (batch.mustReturn) {
  8611. return;
  8612. }
  8613. var hardwareInstancedRendering = (engine.getCaps().instancedArrays !== null) && (batch.visibleInstances[subMesh._id] !== null);
  8614. if (_this.isReady(subMesh, hardwareInstancedRendering)) {
  8615. engine.enableEffect(_this._effect);
  8616. mesh._bind(subMesh, _this._effect, BABYLON.Material.TriangleFillMode);
  8617. var material = subMesh.getMaterial();
  8618. _this._effect.setMatrix("viewProjection", _this.getTransformMatrix());
  8619. // Alpha test
  8620. if (material && material.needAlphaTesting()) {
  8621. var alphaTexture = material.getAlphaTestTexture();
  8622. _this._effect.setTexture("diffuseSampler", alphaTexture);
  8623. _this._effect.setMatrix("diffuseMatrix", alphaTexture.getTextureMatrix());
  8624. }
  8625. // Bones
  8626. if (mesh.useBones && mesh.computeBonesUsingShaders) {
  8627. _this._effect.setMatrices("mBones", mesh.skeleton.getTransformMatrices());
  8628. }
  8629. // Draw
  8630. mesh._processRendering(subMesh, _this._effect, BABYLON.Material.TriangleFillMode, batch, hardwareInstancedRendering, function (isInstance, world) { return _this._effect.setMatrix("world", world); });
  8631. }
  8632. else {
  8633. // Need to reset refresh rate of the shadowMap
  8634. _this._shadowMap.resetRefreshCounter();
  8635. }
  8636. };
  8637. this._shadowMap.customRenderFunction = function (opaqueSubMeshes, alphaTestSubMeshes, transparentSubMeshes) {
  8638. var index;
  8639. for (index = 0; index < opaqueSubMeshes.length; index++) {
  8640. renderSubMesh(opaqueSubMeshes.data[index]);
  8641. }
  8642. for (index = 0; index < alphaTestSubMeshes.length; index++) {
  8643. renderSubMesh(alphaTestSubMeshes.data[index]);
  8644. }
  8645. if (_this._transparencyShadow) {
  8646. for (index = 0; index < transparentSubMeshes.length; index++) {
  8647. renderSubMesh(transparentSubMeshes.data[index]);
  8648. }
  8649. }
  8650. };
  8651. this._shadowMap.onClear = function (engine) {
  8652. if (_this.useBlurVarianceShadowMap || _this.useVarianceShadowMap) {
  8653. engine.clear(new BABYLON.Color4(0, 0, 0, 0), true, true);
  8654. }
  8655. else {
  8656. engine.clear(new BABYLON.Color4(1.0, 1.0, 1.0, 1.0), true, true);
  8657. }
  8658. };
  8659. }
  8660. Object.defineProperty(ShadowGenerator, "FILTER_NONE", {
  8661. // Static
  8662. get: function () {
  8663. return ShadowGenerator._FILTER_NONE;
  8664. },
  8665. enumerable: true,
  8666. configurable: true
  8667. });
  8668. Object.defineProperty(ShadowGenerator, "FILTER_VARIANCESHADOWMAP", {
  8669. get: function () {
  8670. return ShadowGenerator._FILTER_VARIANCESHADOWMAP;
  8671. },
  8672. enumerable: true,
  8673. configurable: true
  8674. });
  8675. Object.defineProperty(ShadowGenerator, "FILTER_POISSONSAMPLING", {
  8676. get: function () {
  8677. return ShadowGenerator._FILTER_POISSONSAMPLING;
  8678. },
  8679. enumerable: true,
  8680. configurable: true
  8681. });
  8682. Object.defineProperty(ShadowGenerator, "FILTER_BLURVARIANCESHADOWMAP", {
  8683. get: function () {
  8684. return ShadowGenerator._FILTER_BLURVARIANCESHADOWMAP;
  8685. },
  8686. enumerable: true,
  8687. configurable: true
  8688. });
  8689. Object.defineProperty(ShadowGenerator.prototype, "bias", {
  8690. get: function () {
  8691. return this._bias;
  8692. },
  8693. set: function (bias) {
  8694. this._bias = bias;
  8695. },
  8696. enumerable: true,
  8697. configurable: true
  8698. });
  8699. Object.defineProperty(ShadowGenerator.prototype, "blurBoxOffset", {
  8700. get: function () {
  8701. return this._blurBoxOffset;
  8702. },
  8703. set: function (value) {
  8704. var _this = this;
  8705. if (this._blurBoxOffset === value) {
  8706. return;
  8707. }
  8708. this._blurBoxOffset = value;
  8709. if (this._boxBlurPostprocess) {
  8710. this._boxBlurPostprocess.dispose();
  8711. }
  8712. this._boxBlurPostprocess = new BABYLON.PostProcess("DepthBoxBlur", "depthBoxBlur", ["screenSize", "boxOffset"], [], 1.0 / this.blurScale, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, this._scene.getEngine(), false, "#define OFFSET " + value);
  8713. this._boxBlurPostprocess.onApply = function (effect) {
  8714. effect.setFloat2("screenSize", _this._mapSize / _this.blurScale, _this._mapSize / _this.blurScale);
  8715. };
  8716. },
  8717. enumerable: true,
  8718. configurable: true
  8719. });
  8720. Object.defineProperty(ShadowGenerator.prototype, "filter", {
  8721. get: function () {
  8722. return this._filter;
  8723. },
  8724. set: function (value) {
  8725. if (this._filter === value) {
  8726. return;
  8727. }
  8728. this._filter = value;
  8729. if (this.useVarianceShadowMap || this.useBlurVarianceShadowMap) {
  8730. this._shadowMap.anisotropicFilteringLevel = 16;
  8731. this._shadowMap.updateSamplingMode(BABYLON.Texture.BILINEAR_SAMPLINGMODE);
  8732. }
  8733. else {
  8734. this._shadowMap.anisotropicFilteringLevel = 1;
  8735. this._shadowMap.updateSamplingMode(BABYLON.Texture.NEAREST_SAMPLINGMODE);
  8736. }
  8737. },
  8738. enumerable: true,
  8739. configurable: true
  8740. });
  8741. Object.defineProperty(ShadowGenerator.prototype, "useVarianceShadowMap", {
  8742. get: function () {
  8743. return this.filter === ShadowGenerator.FILTER_VARIANCESHADOWMAP && this._light.supportsVSM();
  8744. },
  8745. set: function (value) {
  8746. this.filter = (value ? ShadowGenerator.FILTER_VARIANCESHADOWMAP : ShadowGenerator.FILTER_NONE);
  8747. },
  8748. enumerable: true,
  8749. configurable: true
  8750. });
  8751. Object.defineProperty(ShadowGenerator.prototype, "usePoissonSampling", {
  8752. get: function () {
  8753. return this.filter === ShadowGenerator.FILTER_POISSONSAMPLING ||
  8754. (!this._light.supportsVSM() && (this.filter === ShadowGenerator.FILTER_VARIANCESHADOWMAP ||
  8755. this.filter === ShadowGenerator.FILTER_BLURVARIANCESHADOWMAP));
  8756. },
  8757. set: function (value) {
  8758. this.filter = (value ? ShadowGenerator.FILTER_POISSONSAMPLING : ShadowGenerator.FILTER_NONE);
  8759. },
  8760. enumerable: true,
  8761. configurable: true
  8762. });
  8763. Object.defineProperty(ShadowGenerator.prototype, "useBlurVarianceShadowMap", {
  8764. get: function () {
  8765. return this.filter === ShadowGenerator.FILTER_BLURVARIANCESHADOWMAP && this._light.supportsVSM();
  8766. },
  8767. set: function (value) {
  8768. this.filter = (value ? ShadowGenerator.FILTER_BLURVARIANCESHADOWMAP : ShadowGenerator.FILTER_NONE);
  8769. },
  8770. enumerable: true,
  8771. configurable: true
  8772. });
  8773. ShadowGenerator.prototype.isReady = function (subMesh, useInstances) {
  8774. var defines = [];
  8775. if (this.useVarianceShadowMap || this.useBlurVarianceShadowMap) {
  8776. defines.push("#define VSM");
  8777. }
  8778. var attribs = [BABYLON.VertexBuffer.PositionKind];
  8779. var mesh = subMesh.getMesh();
  8780. var material = subMesh.getMaterial();
  8781. // Alpha test
  8782. if (material && material.needAlphaTesting()) {
  8783. defines.push("#define ALPHATEST");
  8784. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  8785. attribs.push(BABYLON.VertexBuffer.UVKind);
  8786. defines.push("#define UV1");
  8787. }
  8788. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  8789. attribs.push(BABYLON.VertexBuffer.UV2Kind);
  8790. defines.push("#define UV2");
  8791. }
  8792. }
  8793. // Bones
  8794. if (mesh.useBones && mesh.computeBonesUsingShaders) {
  8795. attribs.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  8796. attribs.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  8797. defines.push("#define BONES");
  8798. defines.push("#define BonesPerMesh " + (mesh.skeleton.bones.length + 1));
  8799. }
  8800. // Instances
  8801. if (useInstances) {
  8802. defines.push("#define INSTANCES");
  8803. attribs.push("world0");
  8804. attribs.push("world1");
  8805. attribs.push("world2");
  8806. attribs.push("world3");
  8807. }
  8808. // Get correct effect
  8809. var join = defines.join("\n");
  8810. if (this._cachedDefines !== join) {
  8811. this._cachedDefines = join;
  8812. this._effect = this._scene.getEngine().createEffect("shadowMap", attribs, ["world", "mBones", "viewProjection", "diffuseMatrix"], ["diffuseSampler"], join);
  8813. }
  8814. return this._effect.isReady();
  8815. };
  8816. ShadowGenerator.prototype.getShadowMap = function () {
  8817. return this._shadowMap;
  8818. };
  8819. ShadowGenerator.prototype.getShadowMapForRendering = function () {
  8820. if (this._shadowMap2) {
  8821. return this._shadowMap2;
  8822. }
  8823. return this._shadowMap;
  8824. };
  8825. ShadowGenerator.prototype.getLight = function () {
  8826. return this._light;
  8827. };
  8828. // Methods
  8829. ShadowGenerator.prototype.getTransformMatrix = function () {
  8830. var scene = this._scene;
  8831. if (this._currentRenderID === scene.getRenderId()) {
  8832. return this._transformMatrix;
  8833. }
  8834. this._currentRenderID = scene.getRenderId();
  8835. var lightPosition = this._light.position;
  8836. BABYLON.Vector3.NormalizeToRef(this._light.direction, this._lightDirection);
  8837. if (Math.abs(BABYLON.Vector3.Dot(this._lightDirection, BABYLON.Vector3.Up())) == 1.0) {
  8838. this._lightDirection.z = 0.0000000000001; // Need to avoid perfectly perpendicular light
  8839. }
  8840. if (this._light.computeTransformedPosition()) {
  8841. lightPosition = this._light.transformedPosition;
  8842. }
  8843. if (this._light.needRefreshPerFrame() || !this._cachedPosition || !this._cachedDirection || !lightPosition.equals(this._cachedPosition) || !this._lightDirection.equals(this._cachedDirection)) {
  8844. this._cachedPosition = lightPosition.clone();
  8845. this._cachedDirection = this._lightDirection.clone();
  8846. BABYLON.Matrix.LookAtLHToRef(lightPosition, this._light.position.add(this._lightDirection), BABYLON.Vector3.Up(), this._viewMatrix);
  8847. this._light.setShadowProjectionMatrix(this._projectionMatrix, this._viewMatrix, this.getShadowMap().renderList);
  8848. this._viewMatrix.multiplyToRef(this._projectionMatrix, this._transformMatrix);
  8849. }
  8850. return this._transformMatrix;
  8851. };
  8852. ShadowGenerator.prototype.getDarkness = function () {
  8853. return this._darkness;
  8854. };
  8855. ShadowGenerator.prototype.setDarkness = function (darkness) {
  8856. if (darkness >= 1.0)
  8857. this._darkness = 1.0;
  8858. else if (darkness <= 0.0)
  8859. this._darkness = 0.0;
  8860. else
  8861. this._darkness = darkness;
  8862. };
  8863. ShadowGenerator.prototype.setTransparencyShadow = function (hasShadow) {
  8864. this._transparencyShadow = hasShadow;
  8865. };
  8866. ShadowGenerator.prototype._packHalf = function (depth) {
  8867. var scale = depth * 255.0;
  8868. var fract = scale - Math.floor(scale);
  8869. return new BABYLON.Vector2(depth - fract / 255.0, fract);
  8870. };
  8871. ShadowGenerator.prototype.dispose = function () {
  8872. this._shadowMap.dispose();
  8873. if (this._shadowMap2) {
  8874. this._shadowMap2.dispose();
  8875. }
  8876. if (this._downSamplePostprocess) {
  8877. this._downSamplePostprocess.dispose();
  8878. }
  8879. if (this._boxBlurPostprocess) {
  8880. this._boxBlurPostprocess.dispose();
  8881. }
  8882. };
  8883. ShadowGenerator._FILTER_NONE = 0;
  8884. ShadowGenerator._FILTER_VARIANCESHADOWMAP = 1;
  8885. ShadowGenerator._FILTER_POISSONSAMPLING = 2;
  8886. ShadowGenerator._FILTER_BLURVARIANCESHADOWMAP = 3;
  8887. return ShadowGenerator;
  8888. })();
  8889. BABYLON.ShadowGenerator = ShadowGenerator;
  8890. })(BABYLON || (BABYLON = {}));
  8891. var BABYLON;
  8892. (function (BABYLON) {
  8893. var intersectBoxAASphere = function (boxMin, boxMax, sphereCenter, sphereRadius) {
  8894. if (boxMin.x > sphereCenter.x + sphereRadius)
  8895. return false;
  8896. if (sphereCenter.x - sphereRadius > boxMax.x)
  8897. return false;
  8898. if (boxMin.y > sphereCenter.y + sphereRadius)
  8899. return false;
  8900. if (sphereCenter.y - sphereRadius > boxMax.y)
  8901. return false;
  8902. if (boxMin.z > sphereCenter.z + sphereRadius)
  8903. return false;
  8904. if (sphereCenter.z - sphereRadius > boxMax.z)
  8905. return false;
  8906. return true;
  8907. };
  8908. var getLowestRoot = function (a, b, c, maxR) {
  8909. var determinant = b * b - 4.0 * a * c;
  8910. var result = { root: 0, found: false };
  8911. if (determinant < 0)
  8912. return result;
  8913. var sqrtD = Math.sqrt(determinant);
  8914. var r1 = (-b - sqrtD) / (2.0 * a);
  8915. var r2 = (-b + sqrtD) / (2.0 * a);
  8916. if (r1 > r2) {
  8917. var temp = r2;
  8918. r2 = r1;
  8919. r1 = temp;
  8920. }
  8921. if (r1 > 0 && r1 < maxR) {
  8922. result.root = r1;
  8923. result.found = true;
  8924. return result;
  8925. }
  8926. if (r2 > 0 && r2 < maxR) {
  8927. result.root = r2;
  8928. result.found = true;
  8929. return result;
  8930. }
  8931. return result;
  8932. };
  8933. var Collider = (function () {
  8934. function Collider() {
  8935. this.radius = new BABYLON.Vector3(1, 1, 1);
  8936. this.retry = 0;
  8937. this.basePointWorld = BABYLON.Vector3.Zero();
  8938. this.velocityWorld = BABYLON.Vector3.Zero();
  8939. this.normalizedVelocity = BABYLON.Vector3.Zero();
  8940. this._collisionPoint = BABYLON.Vector3.Zero();
  8941. this._planeIntersectionPoint = BABYLON.Vector3.Zero();
  8942. this._tempVector = BABYLON.Vector3.Zero();
  8943. this._tempVector2 = BABYLON.Vector3.Zero();
  8944. this._tempVector3 = BABYLON.Vector3.Zero();
  8945. this._tempVector4 = BABYLON.Vector3.Zero();
  8946. this._edge = BABYLON.Vector3.Zero();
  8947. this._baseToVertex = BABYLON.Vector3.Zero();
  8948. this._destinationPoint = BABYLON.Vector3.Zero();
  8949. this._slidePlaneNormal = BABYLON.Vector3.Zero();
  8950. this._displacementVector = BABYLON.Vector3.Zero();
  8951. }
  8952. // Methods
  8953. Collider.prototype._initialize = function (source, dir, e) {
  8954. this.velocity = dir;
  8955. BABYLON.Vector3.NormalizeToRef(dir, this.normalizedVelocity);
  8956. this.basePoint = source;
  8957. source.multiplyToRef(this.radius, this.basePointWorld);
  8958. dir.multiplyToRef(this.radius, this.velocityWorld);
  8959. this.velocityWorldLength = this.velocityWorld.length();
  8960. this.epsilon = e;
  8961. this.collisionFound = false;
  8962. };
  8963. Collider.prototype._checkPointInTriangle = function (point, pa, pb, pc, n) {
  8964. pa.subtractToRef(point, this._tempVector);
  8965. pb.subtractToRef(point, this._tempVector2);
  8966. BABYLON.Vector3.CrossToRef(this._tempVector, this._tempVector2, this._tempVector4);
  8967. var d = BABYLON.Vector3.Dot(this._tempVector4, n);
  8968. if (d < 0)
  8969. return false;
  8970. pc.subtractToRef(point, this._tempVector3);
  8971. BABYLON.Vector3.CrossToRef(this._tempVector2, this._tempVector3, this._tempVector4);
  8972. d = BABYLON.Vector3.Dot(this._tempVector4, n);
  8973. if (d < 0)
  8974. return false;
  8975. BABYLON.Vector3.CrossToRef(this._tempVector3, this._tempVector, this._tempVector4);
  8976. d = BABYLON.Vector3.Dot(this._tempVector4, n);
  8977. return d >= 0;
  8978. };
  8979. Collider.prototype._canDoCollision = function (sphereCenter, sphereRadius, vecMin, vecMax) {
  8980. var distance = BABYLON.Vector3.Distance(this.basePointWorld, sphereCenter);
  8981. var max = Math.max(this.radius.x, this.radius.y, this.radius.z);
  8982. if (distance > this.velocityWorldLength + max + sphereRadius) {
  8983. return false;
  8984. }
  8985. if (!intersectBoxAASphere(vecMin, vecMax, this.basePointWorld, this.velocityWorldLength + max))
  8986. return false;
  8987. return true;
  8988. };
  8989. Collider.prototype._testTriangle = function (faceIndex, trianglePlaneArray, p1, p2, p3, hasMaterial) {
  8990. var t0;
  8991. var embeddedInPlane = false;
  8992. //defensive programming, actually not needed.
  8993. if (!trianglePlaneArray) {
  8994. trianglePlaneArray = [];
  8995. }
  8996. if (!trianglePlaneArray[faceIndex]) {
  8997. trianglePlaneArray[faceIndex] = new BABYLON.Plane(0, 0, 0, 0);
  8998. trianglePlaneArray[faceIndex].copyFromPoints(p1, p2, p3);
  8999. }
  9000. var trianglePlane = trianglePlaneArray[faceIndex];
  9001. if ((!hasMaterial) && !trianglePlane.isFrontFacingTo(this.normalizedVelocity, 0))
  9002. return;
  9003. var signedDistToTrianglePlane = trianglePlane.signedDistanceTo(this.basePoint);
  9004. var normalDotVelocity = BABYLON.Vector3.Dot(trianglePlane.normal, this.velocity);
  9005. if (normalDotVelocity == 0) {
  9006. if (Math.abs(signedDistToTrianglePlane) >= 1.0)
  9007. return;
  9008. embeddedInPlane = true;
  9009. t0 = 0;
  9010. }
  9011. else {
  9012. t0 = (-1.0 - signedDistToTrianglePlane) / normalDotVelocity;
  9013. var t1 = (1.0 - signedDistToTrianglePlane) / normalDotVelocity;
  9014. if (t0 > t1) {
  9015. var temp = t1;
  9016. t1 = t0;
  9017. t0 = temp;
  9018. }
  9019. if (t0 > 1.0 || t1 < 0.0)
  9020. return;
  9021. if (t0 < 0)
  9022. t0 = 0;
  9023. if (t0 > 1.0)
  9024. t0 = 1.0;
  9025. }
  9026. this._collisionPoint.copyFromFloats(0, 0, 0);
  9027. var found = false;
  9028. var t = 1.0;
  9029. if (!embeddedInPlane) {
  9030. this.basePoint.subtractToRef(trianglePlane.normal, this._planeIntersectionPoint);
  9031. this.velocity.scaleToRef(t0, this._tempVector);
  9032. this._planeIntersectionPoint.addInPlace(this._tempVector);
  9033. if (this._checkPointInTriangle(this._planeIntersectionPoint, p1, p2, p3, trianglePlane.normal)) {
  9034. found = true;
  9035. t = t0;
  9036. this._collisionPoint.copyFrom(this._planeIntersectionPoint);
  9037. }
  9038. }
  9039. if (!found) {
  9040. var velocitySquaredLength = this.velocity.lengthSquared();
  9041. var a = velocitySquaredLength;
  9042. this.basePoint.subtractToRef(p1, this._tempVector);
  9043. var b = 2.0 * (BABYLON.Vector3.Dot(this.velocity, this._tempVector));
  9044. var c = this._tempVector.lengthSquared() - 1.0;
  9045. var lowestRoot = getLowestRoot(a, b, c, t);
  9046. if (lowestRoot.found) {
  9047. t = lowestRoot.root;
  9048. found = true;
  9049. this._collisionPoint.copyFrom(p1);
  9050. }
  9051. this.basePoint.subtractToRef(p2, this._tempVector);
  9052. b = 2.0 * (BABYLON.Vector3.Dot(this.velocity, this._tempVector));
  9053. c = this._tempVector.lengthSquared() - 1.0;
  9054. lowestRoot = getLowestRoot(a, b, c, t);
  9055. if (lowestRoot.found) {
  9056. t = lowestRoot.root;
  9057. found = true;
  9058. this._collisionPoint.copyFrom(p2);
  9059. }
  9060. this.basePoint.subtractToRef(p3, this._tempVector);
  9061. b = 2.0 * (BABYLON.Vector3.Dot(this.velocity, this._tempVector));
  9062. c = this._tempVector.lengthSquared() - 1.0;
  9063. lowestRoot = getLowestRoot(a, b, c, t);
  9064. if (lowestRoot.found) {
  9065. t = lowestRoot.root;
  9066. found = true;
  9067. this._collisionPoint.copyFrom(p3);
  9068. }
  9069. p2.subtractToRef(p1, this._edge);
  9070. p1.subtractToRef(this.basePoint, this._baseToVertex);
  9071. var edgeSquaredLength = this._edge.lengthSquared();
  9072. var edgeDotVelocity = BABYLON.Vector3.Dot(this._edge, this.velocity);
  9073. var edgeDotBaseToVertex = BABYLON.Vector3.Dot(this._edge, this._baseToVertex);
  9074. a = edgeSquaredLength * (-velocitySquaredLength) + edgeDotVelocity * edgeDotVelocity;
  9075. b = edgeSquaredLength * (2.0 * BABYLON.Vector3.Dot(this.velocity, this._baseToVertex)) - 2.0 * edgeDotVelocity * edgeDotBaseToVertex;
  9076. c = edgeSquaredLength * (1.0 - this._baseToVertex.lengthSquared()) + edgeDotBaseToVertex * edgeDotBaseToVertex;
  9077. lowestRoot = getLowestRoot(a, b, c, t);
  9078. if (lowestRoot.found) {
  9079. var f = (edgeDotVelocity * lowestRoot.root - edgeDotBaseToVertex) / edgeSquaredLength;
  9080. if (f >= 0.0 && f <= 1.0) {
  9081. t = lowestRoot.root;
  9082. found = true;
  9083. this._edge.scaleInPlace(f);
  9084. p1.addToRef(this._edge, this._collisionPoint);
  9085. }
  9086. }
  9087. p3.subtractToRef(p2, this._edge);
  9088. p2.subtractToRef(this.basePoint, this._baseToVertex);
  9089. edgeSquaredLength = this._edge.lengthSquared();
  9090. edgeDotVelocity = BABYLON.Vector3.Dot(this._edge, this.velocity);
  9091. edgeDotBaseToVertex = BABYLON.Vector3.Dot(this._edge, this._baseToVertex);
  9092. a = edgeSquaredLength * (-velocitySquaredLength) + edgeDotVelocity * edgeDotVelocity;
  9093. b = edgeSquaredLength * (2.0 * BABYLON.Vector3.Dot(this.velocity, this._baseToVertex)) - 2.0 * edgeDotVelocity * edgeDotBaseToVertex;
  9094. c = edgeSquaredLength * (1.0 - this._baseToVertex.lengthSquared()) + edgeDotBaseToVertex * edgeDotBaseToVertex;
  9095. lowestRoot = getLowestRoot(a, b, c, t);
  9096. if (lowestRoot.found) {
  9097. f = (edgeDotVelocity * lowestRoot.root - edgeDotBaseToVertex) / edgeSquaredLength;
  9098. if (f >= 0.0 && f <= 1.0) {
  9099. t = lowestRoot.root;
  9100. found = true;
  9101. this._edge.scaleInPlace(f);
  9102. p2.addToRef(this._edge, this._collisionPoint);
  9103. }
  9104. }
  9105. p1.subtractToRef(p3, this._edge);
  9106. p3.subtractToRef(this.basePoint, this._baseToVertex);
  9107. edgeSquaredLength = this._edge.lengthSquared();
  9108. edgeDotVelocity = BABYLON.Vector3.Dot(this._edge, this.velocity);
  9109. edgeDotBaseToVertex = BABYLON.Vector3.Dot(this._edge, this._baseToVertex);
  9110. a = edgeSquaredLength * (-velocitySquaredLength) + edgeDotVelocity * edgeDotVelocity;
  9111. b = edgeSquaredLength * (2.0 * BABYLON.Vector3.Dot(this.velocity, this._baseToVertex)) - 2.0 * edgeDotVelocity * edgeDotBaseToVertex;
  9112. c = edgeSquaredLength * (1.0 - this._baseToVertex.lengthSquared()) + edgeDotBaseToVertex * edgeDotBaseToVertex;
  9113. lowestRoot = getLowestRoot(a, b, c, t);
  9114. if (lowestRoot.found) {
  9115. f = (edgeDotVelocity * lowestRoot.root - edgeDotBaseToVertex) / edgeSquaredLength;
  9116. if (f >= 0.0 && f <= 1.0) {
  9117. t = lowestRoot.root;
  9118. found = true;
  9119. this._edge.scaleInPlace(f);
  9120. p3.addToRef(this._edge, this._collisionPoint);
  9121. }
  9122. }
  9123. }
  9124. if (found) {
  9125. var distToCollision = t * this.velocity.length();
  9126. if (!this.collisionFound || distToCollision < this.nearestDistance) {
  9127. if (!this.intersectionPoint) {
  9128. this.intersectionPoint = this._collisionPoint.clone();
  9129. }
  9130. else {
  9131. this.intersectionPoint.copyFrom(this._collisionPoint);
  9132. }
  9133. this.nearestDistance = distToCollision;
  9134. this.collisionFound = true;
  9135. }
  9136. }
  9137. };
  9138. Collider.prototype._collide = function (trianglePlaneArray, pts, indices, indexStart, indexEnd, decal, hasMaterial) {
  9139. for (var i = indexStart; i < indexEnd; i += 3) {
  9140. var p1 = pts[indices[i] - decal];
  9141. var p2 = pts[indices[i + 1] - decal];
  9142. var p3 = pts[indices[i + 2] - decal];
  9143. this._testTriangle(i, trianglePlaneArray, p3, p2, p1, hasMaterial);
  9144. }
  9145. };
  9146. Collider.prototype._getResponse = function (pos, vel) {
  9147. pos.addToRef(vel, this._destinationPoint);
  9148. vel.scaleInPlace((this.nearestDistance / vel.length()));
  9149. this.basePoint.addToRef(vel, pos);
  9150. pos.subtractToRef(this.intersectionPoint, this._slidePlaneNormal);
  9151. this._slidePlaneNormal.normalize();
  9152. this._slidePlaneNormal.scaleToRef(this.epsilon, this._displacementVector);
  9153. pos.addInPlace(this._displacementVector);
  9154. this.intersectionPoint.addInPlace(this._displacementVector);
  9155. this._slidePlaneNormal.scaleInPlace(BABYLON.Plane.SignedDistanceToPlaneFromPositionAndNormal(this.intersectionPoint, this._slidePlaneNormal, this._destinationPoint));
  9156. this._destinationPoint.subtractInPlace(this._slidePlaneNormal);
  9157. this._destinationPoint.subtractToRef(this.intersectionPoint, vel);
  9158. };
  9159. return Collider;
  9160. })();
  9161. BABYLON.Collider = Collider;
  9162. })(BABYLON || (BABYLON = {}));
  9163. var BABYLON;
  9164. (function (BABYLON) {
  9165. //WebWorker code will be inserted to this variable.
  9166. BABYLON.CollisionWorker = "";
  9167. (function (WorkerTaskType) {
  9168. WorkerTaskType[WorkerTaskType["INIT"] = 0] = "INIT";
  9169. WorkerTaskType[WorkerTaskType["UPDATE"] = 1] = "UPDATE";
  9170. WorkerTaskType[WorkerTaskType["COLLIDE"] = 2] = "COLLIDE";
  9171. })(BABYLON.WorkerTaskType || (BABYLON.WorkerTaskType = {}));
  9172. var WorkerTaskType = BABYLON.WorkerTaskType;
  9173. (function (WorkerReplyType) {
  9174. WorkerReplyType[WorkerReplyType["SUCCESS"] = 0] = "SUCCESS";
  9175. WorkerReplyType[WorkerReplyType["UNKNOWN_ERROR"] = 1] = "UNKNOWN_ERROR";
  9176. })(BABYLON.WorkerReplyType || (BABYLON.WorkerReplyType = {}));
  9177. var WorkerReplyType = BABYLON.WorkerReplyType;
  9178. var CollisionCoordinatorWorker = (function () {
  9179. function CollisionCoordinatorWorker() {
  9180. var _this = this;
  9181. this._scaledPosition = BABYLON.Vector3.Zero();
  9182. this._scaledVelocity = BABYLON.Vector3.Zero();
  9183. this.onMeshUpdated = function (mesh) {
  9184. _this._addUpdateMeshesList[mesh.uniqueId] = CollisionCoordinatorWorker.SerializeMesh(mesh);
  9185. };
  9186. this.onGeometryUpdated = function (geometry) {
  9187. _this._addUpdateGeometriesList[geometry.id] = CollisionCoordinatorWorker.SerializeGeometry(geometry);
  9188. };
  9189. this._afterRender = function () {
  9190. if (!_this._init)
  9191. return;
  9192. if (_this._toRemoveGeometryArray.length == 0 && _this._toRemoveMeshesArray.length == 0 && Object.keys(_this._addUpdateGeometriesList).length == 0 && Object.keys(_this._addUpdateMeshesList).length == 0) {
  9193. return;
  9194. }
  9195. //5 concurrent updates were sent to the web worker and were not yet processed. Abort next update.
  9196. //TODO make sure update runs as fast as possible to be able to update 60 FPS.
  9197. if (_this._runningUpdated > 4) {
  9198. return;
  9199. }
  9200. ++_this._runningUpdated;
  9201. var payload = {
  9202. updatedMeshes: _this._addUpdateMeshesList,
  9203. updatedGeometries: _this._addUpdateGeometriesList,
  9204. removedGeometries: _this._toRemoveGeometryArray,
  9205. removedMeshes: _this._toRemoveMeshesArray
  9206. };
  9207. var message = {
  9208. payload: payload,
  9209. taskType: WorkerTaskType.UPDATE
  9210. };
  9211. var serializable = [];
  9212. for (var id in payload.updatedGeometries) {
  9213. if (payload.updatedGeometries.hasOwnProperty(id)) {
  9214. //prepare transferables
  9215. serializable.push(message.payload.updatedGeometries[id].indices.buffer);
  9216. serializable.push(message.payload.updatedGeometries[id].normals.buffer);
  9217. serializable.push(message.payload.updatedGeometries[id].positions.buffer);
  9218. }
  9219. }
  9220. _this._worker.postMessage(message, serializable);
  9221. _this._addUpdateMeshesList = {};
  9222. _this._addUpdateGeometriesList = {};
  9223. _this._toRemoveGeometryArray = [];
  9224. _this._toRemoveMeshesArray = [];
  9225. };
  9226. this._onMessageFromWorker = function (e) {
  9227. var returnData = e.data;
  9228. if (returnData.error != WorkerReplyType.SUCCESS) {
  9229. //TODO what errors can be returned from the worker?
  9230. BABYLON.Tools.Warn("error returned from worker!");
  9231. return;
  9232. }
  9233. switch (returnData.taskType) {
  9234. case WorkerTaskType.INIT:
  9235. _this._init = true;
  9236. //Update the worked with ALL of the scene's current state
  9237. _this._scene.meshes.forEach(function (mesh) {
  9238. _this.onMeshAdded(mesh);
  9239. });
  9240. _this._scene.getGeometries().forEach(function (geometry) {
  9241. _this.onGeometryAdded(geometry);
  9242. });
  9243. break;
  9244. case WorkerTaskType.UPDATE:
  9245. _this._runningUpdated--;
  9246. break;
  9247. case WorkerTaskType.COLLIDE:
  9248. _this._runningCollisionTask = false;
  9249. var returnPayload = returnData.payload;
  9250. if (!_this._collisionsCallbackArray[returnPayload.collisionId])
  9251. return;
  9252. _this._collisionsCallbackArray[returnPayload.collisionId](returnPayload.collisionId, BABYLON.Vector3.FromArray(returnPayload.newPosition), _this._scene.getMeshByUniqueID(returnPayload.collidedMeshUniqueId));
  9253. //cleanup
  9254. _this._collisionsCallbackArray[returnPayload.collisionId] = undefined;
  9255. break;
  9256. }
  9257. };
  9258. this._collisionsCallbackArray = [];
  9259. this._init = false;
  9260. this._runningUpdated = 0;
  9261. this._runningCollisionTask = false;
  9262. this._addUpdateMeshesList = {};
  9263. this._addUpdateGeometriesList = {};
  9264. this._toRemoveGeometryArray = [];
  9265. this._toRemoveMeshesArray = [];
  9266. }
  9267. CollisionCoordinatorWorker.prototype.getNewPosition = function (position, velocity, collider, maximumRetry, excludedMesh, onNewPosition, collisionIndex) {
  9268. if (!this._init)
  9269. return;
  9270. if (this._collisionsCallbackArray[collisionIndex] || this._collisionsCallbackArray[collisionIndex + 100000])
  9271. return;
  9272. position.divideToRef(collider.radius, this._scaledPosition);
  9273. velocity.divideToRef(collider.radius, this._scaledVelocity);
  9274. this._collisionsCallbackArray[collisionIndex] = onNewPosition;
  9275. var payload = {
  9276. collider: {
  9277. position: this._scaledPosition.asArray(),
  9278. velocity: this._scaledVelocity.asArray(),
  9279. radius: collider.radius.asArray()
  9280. },
  9281. collisionId: collisionIndex,
  9282. excludedMeshUniqueId: excludedMesh ? excludedMesh.uniqueId : null,
  9283. maximumRetry: maximumRetry
  9284. };
  9285. var message = {
  9286. payload: payload,
  9287. taskType: WorkerTaskType.COLLIDE
  9288. };
  9289. this._worker.postMessage(message);
  9290. };
  9291. CollisionCoordinatorWorker.prototype.init = function (scene) {
  9292. this._scene = scene;
  9293. this._scene.registerAfterRender(this._afterRender);
  9294. var workerUrl = BABYLON.WorkerIncluded ? BABYLON.Engine.CodeRepository + "Collisions/babylon.collisionWorker.js" : URL.createObjectURL(new Blob([BABYLON.CollisionWorker], { type: 'application/javascript' }));
  9295. this._worker = new Worker(workerUrl);
  9296. this._worker.onmessage = this._onMessageFromWorker;
  9297. var message = {
  9298. payload: {},
  9299. taskType: WorkerTaskType.INIT
  9300. };
  9301. this._worker.postMessage(message);
  9302. };
  9303. CollisionCoordinatorWorker.prototype.destroy = function () {
  9304. this._scene.unregisterAfterRender(this._afterRender);
  9305. this._worker.terminate();
  9306. };
  9307. CollisionCoordinatorWorker.prototype.onMeshAdded = function (mesh) {
  9308. mesh.registerAfterWorldMatrixUpdate(this.onMeshUpdated);
  9309. this.onMeshUpdated(mesh);
  9310. };
  9311. CollisionCoordinatorWorker.prototype.onMeshRemoved = function (mesh) {
  9312. this._toRemoveMeshesArray.push(mesh.uniqueId);
  9313. };
  9314. CollisionCoordinatorWorker.prototype.onGeometryAdded = function (geometry) {
  9315. //TODO this will break if the user uses his own function. This should be an array of callbacks!
  9316. geometry.onGeometryUpdated = this.onGeometryUpdated;
  9317. this.onGeometryUpdated(geometry);
  9318. };
  9319. CollisionCoordinatorWorker.prototype.onGeometryDeleted = function (geometry) {
  9320. this._toRemoveGeometryArray.push(geometry.id);
  9321. };
  9322. CollisionCoordinatorWorker.SerializeMesh = function (mesh) {
  9323. var submeshes = [];
  9324. if (mesh.subMeshes) {
  9325. submeshes = mesh.subMeshes.map(function (sm, idx) {
  9326. return {
  9327. position: idx,
  9328. verticesStart: sm.verticesStart,
  9329. verticesCount: sm.verticesCount,
  9330. indexStart: sm.indexStart,
  9331. indexCount: sm.indexCount,
  9332. hasMaterial: !!sm.getMaterial(),
  9333. sphereCenter: sm.getBoundingInfo().boundingSphere.centerWorld.asArray(),
  9334. sphereRadius: sm.getBoundingInfo().boundingSphere.radiusWorld,
  9335. boxMinimum: sm.getBoundingInfo().boundingBox.minimumWorld.asArray(),
  9336. boxMaximum: sm.getBoundingInfo().boundingBox.maximumWorld.asArray()
  9337. };
  9338. });
  9339. }
  9340. var geometryId = null;
  9341. if (mesh instanceof BABYLON.Mesh) {
  9342. geometryId = mesh.geometry ? mesh.geometry.id : null;
  9343. }
  9344. else if (mesh instanceof BABYLON.InstancedMesh) {
  9345. geometryId = (mesh.sourceMesh && mesh.sourceMesh.geometry) ? mesh.sourceMesh.geometry.id : null;
  9346. }
  9347. return {
  9348. uniqueId: mesh.uniqueId,
  9349. id: mesh.id,
  9350. name: mesh.name,
  9351. geometryId: geometryId,
  9352. sphereCenter: mesh.getBoundingInfo().boundingSphere.centerWorld.asArray(),
  9353. sphereRadius: mesh.getBoundingInfo().boundingSphere.radiusWorld,
  9354. boxMinimum: mesh.getBoundingInfo().boundingBox.minimumWorld.asArray(),
  9355. boxMaximum: mesh.getBoundingInfo().boundingBox.maximumWorld.asArray(),
  9356. worldMatrixFromCache: mesh.worldMatrixFromCache.asArray(),
  9357. subMeshes: submeshes,
  9358. checkCollisions: mesh.checkCollisions
  9359. };
  9360. };
  9361. CollisionCoordinatorWorker.SerializeGeometry = function (geometry) {
  9362. return {
  9363. id: geometry.id,
  9364. positions: new Float32Array(geometry.getVerticesData(BABYLON.VertexBuffer.PositionKind) || []),
  9365. normals: new Float32Array(geometry.getVerticesData(BABYLON.VertexBuffer.NormalKind) || []),
  9366. indices: new Int32Array(geometry.getIndices() || []),
  9367. };
  9368. };
  9369. return CollisionCoordinatorWorker;
  9370. })();
  9371. BABYLON.CollisionCoordinatorWorker = CollisionCoordinatorWorker;
  9372. var CollisionCoordinatorLegacy = (function () {
  9373. function CollisionCoordinatorLegacy() {
  9374. this._scaledPosition = BABYLON.Vector3.Zero();
  9375. this._scaledVelocity = BABYLON.Vector3.Zero();
  9376. this._finalPosition = BABYLON.Vector3.Zero();
  9377. }
  9378. CollisionCoordinatorLegacy.prototype.getNewPosition = function (position, velocity, collider, maximumRetry, excludedMesh, onNewPosition, collisionIndex) {
  9379. position.divideToRef(collider.radius, this._scaledPosition);
  9380. velocity.divideToRef(collider.radius, this._scaledVelocity);
  9381. collider.collidedMesh = null;
  9382. collider.retry = 0;
  9383. collider.initialVelocity = this._scaledVelocity;
  9384. collider.initialPosition = this._scaledPosition;
  9385. this._collideWithWorld(this._scaledPosition, this._scaledVelocity, collider, maximumRetry, this._finalPosition, excludedMesh);
  9386. this._finalPosition.multiplyInPlace(collider.radius);
  9387. //run the callback
  9388. onNewPosition(collisionIndex, this._finalPosition, collider.collidedMesh);
  9389. };
  9390. CollisionCoordinatorLegacy.prototype.init = function (scene) {
  9391. this._scene = scene;
  9392. };
  9393. CollisionCoordinatorLegacy.prototype.destroy = function () {
  9394. //Legacy need no destruction method.
  9395. };
  9396. //No update in legacy mode
  9397. CollisionCoordinatorLegacy.prototype.onMeshAdded = function (mesh) { };
  9398. CollisionCoordinatorLegacy.prototype.onMeshUpdated = function (mesh) { };
  9399. CollisionCoordinatorLegacy.prototype.onMeshRemoved = function (mesh) { };
  9400. CollisionCoordinatorLegacy.prototype.onGeometryAdded = function (geometry) { };
  9401. CollisionCoordinatorLegacy.prototype.onGeometryUpdated = function (geometry) { };
  9402. CollisionCoordinatorLegacy.prototype.onGeometryDeleted = function (geometry) { };
  9403. CollisionCoordinatorLegacy.prototype._collideWithWorld = function (position, velocity, collider, maximumRetry, finalPosition, excludedMesh) {
  9404. if (excludedMesh === void 0) { excludedMesh = null; }
  9405. var closeDistance = BABYLON.Engine.CollisionsEpsilon * 10.0;
  9406. if (collider.retry >= maximumRetry) {
  9407. finalPosition.copyFrom(position);
  9408. return;
  9409. }
  9410. collider._initialize(position, velocity, closeDistance);
  9411. // Check all meshes
  9412. for (var index = 0; index < this._scene.meshes.length; index++) {
  9413. var mesh = this._scene.meshes[index];
  9414. if (mesh.isEnabled() && mesh.checkCollisions && mesh.subMeshes && mesh !== excludedMesh) {
  9415. mesh._checkCollision(collider);
  9416. }
  9417. }
  9418. if (!collider.collisionFound) {
  9419. position.addToRef(velocity, finalPosition);
  9420. return;
  9421. }
  9422. if (velocity.x !== 0 || velocity.y !== 0 || velocity.z !== 0) {
  9423. collider._getResponse(position, velocity);
  9424. }
  9425. if (velocity.length() <= closeDistance) {
  9426. finalPosition.copyFrom(position);
  9427. return;
  9428. }
  9429. collider.retry++;
  9430. this._collideWithWorld(position, velocity, collider, maximumRetry, finalPosition, excludedMesh);
  9431. };
  9432. return CollisionCoordinatorLegacy;
  9433. })();
  9434. BABYLON.CollisionCoordinatorLegacy = CollisionCoordinatorLegacy;
  9435. })(BABYLON || (BABYLON = {}));
  9436. var BABYLON;
  9437. (function (BABYLON) {
  9438. var VRCameraMetrics = (function () {
  9439. function VRCameraMetrics() {
  9440. this.compensateDistortion = true;
  9441. }
  9442. Object.defineProperty(VRCameraMetrics.prototype, "aspectRatio", {
  9443. get: function () {
  9444. return this.hResolution / (2 * this.vResolution);
  9445. },
  9446. enumerable: true,
  9447. configurable: true
  9448. });
  9449. Object.defineProperty(VRCameraMetrics.prototype, "aspectRatioFov", {
  9450. get: function () {
  9451. return (2 * Math.atan((this.postProcessScaleFactor * this.vScreenSize) / (2 * this.eyeToScreenDistance)));
  9452. },
  9453. enumerable: true,
  9454. configurable: true
  9455. });
  9456. Object.defineProperty(VRCameraMetrics.prototype, "leftHMatrix", {
  9457. get: function () {
  9458. var meters = (this.hScreenSize / 4) - (this.lensSeparationDistance / 2);
  9459. var h = (4 * meters) / this.hScreenSize;
  9460. return BABYLON.Matrix.Translation(h, 0, 0);
  9461. },
  9462. enumerable: true,
  9463. configurable: true
  9464. });
  9465. Object.defineProperty(VRCameraMetrics.prototype, "rightHMatrix", {
  9466. get: function () {
  9467. var meters = (this.hScreenSize / 4) - (this.lensSeparationDistance / 2);
  9468. var h = (4 * meters) / this.hScreenSize;
  9469. return BABYLON.Matrix.Translation(-h, 0, 0);
  9470. },
  9471. enumerable: true,
  9472. configurable: true
  9473. });
  9474. Object.defineProperty(VRCameraMetrics.prototype, "leftPreViewMatrix", {
  9475. get: function () {
  9476. return BABYLON.Matrix.Translation(0.5 * this.interpupillaryDistance, 0, 0);
  9477. },
  9478. enumerable: true,
  9479. configurable: true
  9480. });
  9481. Object.defineProperty(VRCameraMetrics.prototype, "rightPreViewMatrix", {
  9482. get: function () {
  9483. return BABYLON.Matrix.Translation(-0.5 * this.interpupillaryDistance, 0, 0);
  9484. },
  9485. enumerable: true,
  9486. configurable: true
  9487. });
  9488. VRCameraMetrics.GetDefault = function () {
  9489. var result = new VRCameraMetrics();
  9490. result.hResolution = 1280;
  9491. result.vResolution = 800;
  9492. result.hScreenSize = 0.149759993;
  9493. result.vScreenSize = 0.0935999975;
  9494. result.vScreenCenter = 0.0467999987,
  9495. result.eyeToScreenDistance = 0.0410000011;
  9496. result.lensSeparationDistance = 0.0635000020;
  9497. result.interpupillaryDistance = 0.0640000030;
  9498. result.distortionK = [1.0, 0.219999999, 0.239999995, 0.0];
  9499. result.chromaAbCorrection = [0.995999992, -0.00400000019, 1.01400006, 0.0];
  9500. result.postProcessScaleFactor = 1.714605507808412;
  9501. result.lensCenterOffset = 0.151976421;
  9502. return result;
  9503. };
  9504. return VRCameraMetrics;
  9505. })();
  9506. BABYLON.VRCameraMetrics = VRCameraMetrics;
  9507. var Camera = (function (_super) {
  9508. __extends(Camera, _super);
  9509. function Camera(name, position, scene) {
  9510. _super.call(this, name, scene);
  9511. this.position = position;
  9512. // Members
  9513. this.upVector = BABYLON.Vector3.Up();
  9514. this.orthoLeft = null;
  9515. this.orthoRight = null;
  9516. this.orthoBottom = null;
  9517. this.orthoTop = null;
  9518. this.fov = 0.8;
  9519. this.minZ = 1.0;
  9520. this.maxZ = 10000.0;
  9521. this.inertia = 0.9;
  9522. this.mode = Camera.PERSPECTIVE_CAMERA;
  9523. this.isIntermediate = false;
  9524. this.viewport = new BABYLON.Viewport(0, 0, 1.0, 1.0);
  9525. this.layerMask = 0x0FFFFFFF;
  9526. this.fovMode = Camera.FOVMODE_VERTICAL_FIXED;
  9527. // Camera rig members
  9528. this.cameraRigMode = Camera.RIG_MODE_NONE;
  9529. this._rigCameras = new Array();
  9530. // Cache
  9531. this._computedViewMatrix = BABYLON.Matrix.Identity();
  9532. this._projectionMatrix = new BABYLON.Matrix();
  9533. this._postProcesses = new Array();
  9534. this._postProcessesTakenIndices = [];
  9535. this._activeMeshes = new BABYLON.SmartArray(256);
  9536. this._globalPosition = BABYLON.Vector3.Zero();
  9537. scene.addCamera(this);
  9538. if (!scene.activeCamera) {
  9539. scene.activeCamera = this;
  9540. }
  9541. }
  9542. Object.defineProperty(Camera, "PERSPECTIVE_CAMERA", {
  9543. get: function () {
  9544. return Camera._PERSPECTIVE_CAMERA;
  9545. },
  9546. enumerable: true,
  9547. configurable: true
  9548. });
  9549. Object.defineProperty(Camera, "ORTHOGRAPHIC_CAMERA", {
  9550. get: function () {
  9551. return Camera._ORTHOGRAPHIC_CAMERA;
  9552. },
  9553. enumerable: true,
  9554. configurable: true
  9555. });
  9556. Object.defineProperty(Camera, "FOVMODE_VERTICAL_FIXED", {
  9557. get: function () {
  9558. return Camera._FOVMODE_VERTICAL_FIXED;
  9559. },
  9560. enumerable: true,
  9561. configurable: true
  9562. });
  9563. Object.defineProperty(Camera, "FOVMODE_HORIZONTAL_FIXED", {
  9564. get: function () {
  9565. return Camera._FOVMODE_HORIZONTAL_FIXED;
  9566. },
  9567. enumerable: true,
  9568. configurable: true
  9569. });
  9570. Object.defineProperty(Camera, "RIG_MODE_NONE", {
  9571. get: function () {
  9572. return Camera._RIG_MODE_NONE;
  9573. },
  9574. enumerable: true,
  9575. configurable: true
  9576. });
  9577. Object.defineProperty(Camera, "RIG_MODE_STEREOSCOPIC_ANAGLYPH", {
  9578. get: function () {
  9579. return Camera._RIG_MODE_STEREOSCOPIC_ANAGLYPH;
  9580. },
  9581. enumerable: true,
  9582. configurable: true
  9583. });
  9584. Object.defineProperty(Camera, "RIG_MODE_STEREOSCOPIC_SIDEBYSIDE_PARALLEL", {
  9585. get: function () {
  9586. return Camera._RIG_MODE_STEREOSCOPIC_SIDEBYSIDE_PARALLEL;
  9587. },
  9588. enumerable: true,
  9589. configurable: true
  9590. });
  9591. Object.defineProperty(Camera, "RIG_MODE_STEREOSCOPIC_SIDEBYSIDE_CROSSEYED", {
  9592. get: function () {
  9593. return Camera._RIG_MODE_STEREOSCOPIC_SIDEBYSIDE_CROSSEYED;
  9594. },
  9595. enumerable: true,
  9596. configurable: true
  9597. });
  9598. Object.defineProperty(Camera, "RIG_MODE_STEREOSCOPIC_OVERUNDER", {
  9599. get: function () {
  9600. return Camera._RIG_MODE_STEREOSCOPIC_OVERUNDER;
  9601. },
  9602. enumerable: true,
  9603. configurable: true
  9604. });
  9605. Object.defineProperty(Camera, "RIG_MODE_VR", {
  9606. get: function () {
  9607. return Camera._RIG_MODE_VR;
  9608. },
  9609. enumerable: true,
  9610. configurable: true
  9611. });
  9612. Object.defineProperty(Camera.prototype, "globalPosition", {
  9613. get: function () {
  9614. return this._globalPosition;
  9615. },
  9616. enumerable: true,
  9617. configurable: true
  9618. });
  9619. Camera.prototype.getActiveMeshes = function () {
  9620. return this._activeMeshes;
  9621. };
  9622. Camera.prototype.isActiveMesh = function (mesh) {
  9623. return (this._activeMeshes.indexOf(mesh) !== -1);
  9624. };
  9625. //Cache
  9626. Camera.prototype._initCache = function () {
  9627. _super.prototype._initCache.call(this);
  9628. this._cache.position = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  9629. this._cache.upVector = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  9630. this._cache.mode = undefined;
  9631. this._cache.minZ = undefined;
  9632. this._cache.maxZ = undefined;
  9633. this._cache.fov = undefined;
  9634. this._cache.aspectRatio = undefined;
  9635. this._cache.orthoLeft = undefined;
  9636. this._cache.orthoRight = undefined;
  9637. this._cache.orthoBottom = undefined;
  9638. this._cache.orthoTop = undefined;
  9639. this._cache.renderWidth = undefined;
  9640. this._cache.renderHeight = undefined;
  9641. };
  9642. Camera.prototype._updateCache = function (ignoreParentClass) {
  9643. if (!ignoreParentClass) {
  9644. _super.prototype._updateCache.call(this);
  9645. }
  9646. var engine = this.getEngine();
  9647. this._cache.position.copyFrom(this.position);
  9648. this._cache.upVector.copyFrom(this.upVector);
  9649. this._cache.mode = this.mode;
  9650. this._cache.minZ = this.minZ;
  9651. this._cache.maxZ = this.maxZ;
  9652. this._cache.fov = this.fov;
  9653. this._cache.aspectRatio = engine.getAspectRatio(this);
  9654. this._cache.orthoLeft = this.orthoLeft;
  9655. this._cache.orthoRight = this.orthoRight;
  9656. this._cache.orthoBottom = this.orthoBottom;
  9657. this._cache.orthoTop = this.orthoTop;
  9658. this._cache.renderWidth = engine.getRenderWidth();
  9659. this._cache.renderHeight = engine.getRenderHeight();
  9660. };
  9661. Camera.prototype._updateFromScene = function () {
  9662. this.updateCache();
  9663. this._update();
  9664. };
  9665. // Synchronized
  9666. Camera.prototype._isSynchronized = function () {
  9667. return this._isSynchronizedViewMatrix() && this._isSynchronizedProjectionMatrix();
  9668. };
  9669. Camera.prototype._isSynchronizedViewMatrix = function () {
  9670. if (!_super.prototype._isSynchronized.call(this))
  9671. return false;
  9672. return this._cache.position.equals(this.position)
  9673. && this._cache.upVector.equals(this.upVector)
  9674. && this.isSynchronizedWithParent();
  9675. };
  9676. Camera.prototype._isSynchronizedProjectionMatrix = function () {
  9677. var check = this._cache.mode === this.mode
  9678. && this._cache.minZ === this.minZ
  9679. && this._cache.maxZ === this.maxZ;
  9680. if (!check) {
  9681. return false;
  9682. }
  9683. var engine = this.getEngine();
  9684. if (this.mode === Camera.PERSPECTIVE_CAMERA) {
  9685. check = this._cache.fov === this.fov
  9686. && this._cache.aspectRatio === engine.getAspectRatio(this);
  9687. }
  9688. else {
  9689. check = this._cache.orthoLeft === this.orthoLeft
  9690. && this._cache.orthoRight === this.orthoRight
  9691. && this._cache.orthoBottom === this.orthoBottom
  9692. && this._cache.orthoTop === this.orthoTop
  9693. && this._cache.renderWidth === engine.getRenderWidth()
  9694. && this._cache.renderHeight === engine.getRenderHeight();
  9695. }
  9696. return check;
  9697. };
  9698. // Controls
  9699. Camera.prototype.attachControl = function (element) {
  9700. };
  9701. Camera.prototype.detachControl = function (element) {
  9702. };
  9703. Camera.prototype._update = function () {
  9704. if (this.cameraRigMode !== Camera.RIG_MODE_NONE) {
  9705. this._updateRigCameras();
  9706. }
  9707. this._checkInputs();
  9708. };
  9709. Camera.prototype._checkInputs = function () {
  9710. };
  9711. Camera.prototype.attachPostProcess = function (postProcess, insertAt) {
  9712. if (insertAt === void 0) { insertAt = null; }
  9713. if (!postProcess.isReusable() && this._postProcesses.indexOf(postProcess) > -1) {
  9714. BABYLON.Tools.Error("You're trying to reuse a post process not defined as reusable.");
  9715. return 0;
  9716. }
  9717. if (insertAt == null || insertAt < 0) {
  9718. this._postProcesses.push(postProcess);
  9719. this._postProcessesTakenIndices.push(this._postProcesses.length - 1);
  9720. return this._postProcesses.length - 1;
  9721. }
  9722. var add = 0;
  9723. var i;
  9724. var start;
  9725. if (this._postProcesses[insertAt]) {
  9726. start = this._postProcesses.length - 1;
  9727. for (i = start; i >= insertAt + 1; --i) {
  9728. this._postProcesses[i + 1] = this._postProcesses[i];
  9729. }
  9730. add = 1;
  9731. }
  9732. for (i = 0; i < this._postProcessesTakenIndices.length; ++i) {
  9733. if (this._postProcessesTakenIndices[i] < insertAt) {
  9734. continue;
  9735. }
  9736. start = this._postProcessesTakenIndices.length - 1;
  9737. for (var j = start; j >= i; --j) {
  9738. this._postProcessesTakenIndices[j + 1] = this._postProcessesTakenIndices[j] + add;
  9739. }
  9740. this._postProcessesTakenIndices[i] = insertAt;
  9741. break;
  9742. }
  9743. if (!add && this._postProcessesTakenIndices.indexOf(insertAt) === -1) {
  9744. this._postProcessesTakenIndices.push(insertAt);
  9745. }
  9746. var result = insertAt + add;
  9747. this._postProcesses[result] = postProcess;
  9748. return result;
  9749. };
  9750. Camera.prototype.detachPostProcess = function (postProcess, atIndices) {
  9751. if (atIndices === void 0) { atIndices = null; }
  9752. var result = [];
  9753. var i;
  9754. var index;
  9755. if (!atIndices) {
  9756. var length = this._postProcesses.length;
  9757. for (i = 0; i < length; i++) {
  9758. if (this._postProcesses[i] !== postProcess) {
  9759. continue;
  9760. }
  9761. delete this._postProcesses[i];
  9762. index = this._postProcessesTakenIndices.indexOf(i);
  9763. this._postProcessesTakenIndices.splice(index, 1);
  9764. }
  9765. }
  9766. else {
  9767. atIndices = (atIndices instanceof Array) ? atIndices : [atIndices];
  9768. for (i = 0; i < atIndices.length; i++) {
  9769. var foundPostProcess = this._postProcesses[atIndices[i]];
  9770. if (foundPostProcess !== postProcess) {
  9771. result.push(i);
  9772. continue;
  9773. }
  9774. delete this._postProcesses[atIndices[i]];
  9775. index = this._postProcessesTakenIndices.indexOf(atIndices[i]);
  9776. this._postProcessesTakenIndices.splice(index, 1);
  9777. }
  9778. }
  9779. return result;
  9780. };
  9781. Camera.prototype.getWorldMatrix = function () {
  9782. if (!this._worldMatrix) {
  9783. this._worldMatrix = BABYLON.Matrix.Identity();
  9784. }
  9785. var viewMatrix = this.getViewMatrix();
  9786. viewMatrix.invertToRef(this._worldMatrix);
  9787. return this._worldMatrix;
  9788. };
  9789. Camera.prototype._getViewMatrix = function () {
  9790. return BABYLON.Matrix.Identity();
  9791. };
  9792. Camera.prototype.getViewMatrix = function (force) {
  9793. this._computedViewMatrix = this._computeViewMatrix(force);
  9794. if (!force && this._isSynchronizedViewMatrix()) {
  9795. return this._computedViewMatrix;
  9796. }
  9797. if (!this.parent || !this.parent.getWorldMatrix) {
  9798. this._globalPosition.copyFrom(this.position);
  9799. }
  9800. else {
  9801. if (!this._worldMatrix) {
  9802. this._worldMatrix = BABYLON.Matrix.Identity();
  9803. }
  9804. this._computedViewMatrix.invertToRef(this._worldMatrix);
  9805. this._worldMatrix.multiplyToRef(this.parent.getWorldMatrix(), this._computedViewMatrix);
  9806. this._globalPosition.copyFromFloats(this._computedViewMatrix.m[12], this._computedViewMatrix.m[13], this._computedViewMatrix.m[14]);
  9807. this._computedViewMatrix.invert();
  9808. this._markSyncedWithParent();
  9809. }
  9810. this._currentRenderId = this.getScene().getRenderId();
  9811. return this._computedViewMatrix;
  9812. };
  9813. Camera.prototype._computeViewMatrix = function (force) {
  9814. if (!force && this._isSynchronizedViewMatrix()) {
  9815. return this._computedViewMatrix;
  9816. }
  9817. this._computedViewMatrix = this._getViewMatrix();
  9818. this._currentRenderId = this.getScene().getRenderId();
  9819. return this._computedViewMatrix;
  9820. };
  9821. Camera.prototype.getProjectionMatrix = function (force) {
  9822. if (!force && this._isSynchronizedProjectionMatrix()) {
  9823. return this._projectionMatrix;
  9824. }
  9825. var engine = this.getEngine();
  9826. if (this.mode === Camera.PERSPECTIVE_CAMERA) {
  9827. if (this.minZ <= 0) {
  9828. this.minZ = 0.1;
  9829. }
  9830. BABYLON.Matrix.PerspectiveFovLHToRef(this.fov, engine.getAspectRatio(this), this.minZ, this.maxZ, this._projectionMatrix, this.fovMode);
  9831. return this._projectionMatrix;
  9832. }
  9833. var halfWidth = engine.getRenderWidth() / 2.0;
  9834. var halfHeight = engine.getRenderHeight() / 2.0;
  9835. BABYLON.Matrix.OrthoOffCenterLHToRef(this.orthoLeft || -halfWidth, this.orthoRight || halfWidth, this.orthoBottom || -halfHeight, this.orthoTop || halfHeight, this.minZ, this.maxZ, this._projectionMatrix);
  9836. return this._projectionMatrix;
  9837. };
  9838. Camera.prototype.dispose = function () {
  9839. // Remove from scene
  9840. this.getScene().removeCamera(this);
  9841. while (this._rigCameras.length > 0) {
  9842. this._rigCameras.pop().dispose();
  9843. }
  9844. // Postprocesses
  9845. for (var i = 0; i < this._postProcessesTakenIndices.length; ++i) {
  9846. this._postProcesses[this._postProcessesTakenIndices[i]].dispose(this);
  9847. }
  9848. };
  9849. // ---- Camera rigs section ----
  9850. Camera.prototype.setCameraRigMode = function (mode, rigParams) {
  9851. while (this._rigCameras.length > 0) {
  9852. this._rigCameras.pop().dispose();
  9853. }
  9854. this.cameraRigMode = mode;
  9855. this._cameraRigParams = {};
  9856. switch (this.cameraRigMode) {
  9857. case Camera.RIG_MODE_STEREOSCOPIC_ANAGLYPH:
  9858. case Camera.RIG_MODE_STEREOSCOPIC_SIDEBYSIDE_PARALLEL:
  9859. case Camera.RIG_MODE_STEREOSCOPIC_SIDEBYSIDE_CROSSEYED:
  9860. case Camera.RIG_MODE_STEREOSCOPIC_OVERUNDER:
  9861. this._cameraRigParams.interaxialDistance = rigParams.interaxialDistance || 0.0637;
  9862. //we have to implement stereo camera calcultating left and right viewpoints from interaxialDistance and target,
  9863. //not from a given angle as it is now, but until that complete code rewriting provisional stereoHalfAngle value is introduced
  9864. this._cameraRigParams.stereoHalfAngle = BABYLON.Tools.ToRadians(this._cameraRigParams.interaxialDistance / 0.0637);
  9865. this._rigCameras.push(this.createRigCamera(this.name + "_L", 0));
  9866. this._rigCameras.push(this.createRigCamera(this.name + "_R", 1));
  9867. break;
  9868. }
  9869. var postProcesses = new Array();
  9870. switch (this.cameraRigMode) {
  9871. case Camera.RIG_MODE_STEREOSCOPIC_ANAGLYPH:
  9872. postProcesses.push(new BABYLON.PassPostProcess(this.name + "_passthru", 1.0, this._rigCameras[0]));
  9873. this._rigCameras[0].isIntermediate = true;
  9874. postProcesses.push(new BABYLON.AnaglyphPostProcess(this.name + "_anaglyph", 1.0, this._rigCameras[1]));
  9875. postProcesses[1].onApply = function (effect) {
  9876. effect.setTextureFromPostProcess("leftSampler", postProcesses[0]);
  9877. };
  9878. break;
  9879. case Camera.RIG_MODE_STEREOSCOPIC_SIDEBYSIDE_PARALLEL:
  9880. case Camera.RIG_MODE_STEREOSCOPIC_SIDEBYSIDE_CROSSEYED:
  9881. case Camera.RIG_MODE_STEREOSCOPIC_OVERUNDER:
  9882. var isStereoscopicHoriz = (this.cameraRigMode === Camera.RIG_MODE_STEREOSCOPIC_SIDEBYSIDE_PARALLEL || this.cameraRigMode === Camera.RIG_MODE_STEREOSCOPIC_SIDEBYSIDE_CROSSEYED);
  9883. var firstCamIndex = (this.cameraRigMode === Camera.RIG_MODE_STEREOSCOPIC_SIDEBYSIDE_CROSSEYED) ? 1 : 0;
  9884. var secondCamIndex = 1 - firstCamIndex;
  9885. postProcesses.push(new BABYLON.PassPostProcess(this.name + "_passthru", 1.0, this._rigCameras[firstCamIndex]));
  9886. this._rigCameras[firstCamIndex].isIntermediate = true;
  9887. postProcesses.push(new BABYLON.StereoscopicInterlacePostProcess(this.name + "_stereoInterlace", this._rigCameras[secondCamIndex], postProcesses[0], isStereoscopicHoriz));
  9888. break;
  9889. case Camera.RIG_MODE_VR:
  9890. this._rigCameras.push(this.createRigCamera(this.name + "_L", 0));
  9891. this._rigCameras.push(this.createRigCamera(this.name + "_R", 1));
  9892. var metrics = rigParams.vrCameraMetrics || VRCameraMetrics.GetDefault();
  9893. this._rigCameras[0]._cameraRigParams.vrMetrics = metrics;
  9894. this._rigCameras[0].viewport = new BABYLON.Viewport(0, 0, 0.5, 1.0);
  9895. this._rigCameras[0]._cameraRigParams.vrWorkMatrix = new BABYLON.Matrix();
  9896. this._rigCameras[0]._cameraRigParams.vrHMatrix = metrics.leftHMatrix;
  9897. this._rigCameras[0]._cameraRigParams.vrPreViewMatrix = metrics.leftPreViewMatrix;
  9898. this._rigCameras[0].getProjectionMatrix = this._rigCameras[0]._getVRProjectionMatrix;
  9899. if (metrics.compensateDistortion) {
  9900. postProcesses.push(new BABYLON.VRDistortionCorrectionPostProcess("VR_Distort_Compensation_Left", this._rigCameras[0], false, metrics));
  9901. }
  9902. this._rigCameras[1]._cameraRigParams.vrMetrics = this._rigCameras[0]._cameraRigParams.vrMetrics;
  9903. this._rigCameras[1].viewport = new BABYLON.Viewport(0.5, 0, 0.5, 1.0);
  9904. this._rigCameras[1]._cameraRigParams.vrWorkMatrix = new BABYLON.Matrix();
  9905. this._rigCameras[1]._cameraRigParams.vrHMatrix = metrics.rightHMatrix;
  9906. this._rigCameras[1]._cameraRigParams.vrPreViewMatrix = metrics.rightPreViewMatrix;
  9907. this._rigCameras[1].getProjectionMatrix = this._rigCameras[1]._getVRProjectionMatrix;
  9908. if (metrics.compensateDistortion) {
  9909. postProcesses.push(new BABYLON.VRDistortionCorrectionPostProcess("VR_Distort_Compensation_Right", this._rigCameras[1], true, metrics));
  9910. }
  9911. break;
  9912. }
  9913. this._update();
  9914. };
  9915. Camera.prototype._getVRProjectionMatrix = function () {
  9916. BABYLON.Matrix.PerspectiveFovLHToRef(this._cameraRigParams.vrMetrics.aspectRatioFov, this._cameraRigParams.vrMetrics.aspectRatio, this.minZ, this.maxZ, this._cameraRigParams.vrWorkMatrix);
  9917. this._cameraRigParams.vrWorkMatrix.multiplyToRef(this._cameraRigParams.vrHMatrix, this._projectionMatrix);
  9918. return this._projectionMatrix;
  9919. };
  9920. Camera.prototype.setCameraRigParameter = function (name, value) {
  9921. this._cameraRigParams[name] = value;
  9922. //provisionnally:
  9923. if (name === "interaxialDistance") {
  9924. this._cameraRigParams.stereoHalfAngle = BABYLON.Tools.ToRadians(value / 0.0637);
  9925. }
  9926. };
  9927. /**
  9928. * May needs to be overridden by children so sub has required properties to be copied
  9929. */
  9930. Camera.prototype.createRigCamera = function (name, cameraIndex) {
  9931. return null;
  9932. };
  9933. /**
  9934. * May needs to be overridden by children
  9935. */
  9936. Camera.prototype._updateRigCameras = function () {
  9937. for (var i = 0; i < this._rigCameras.length; i++) {
  9938. this._rigCameras[i].minZ = this.minZ;
  9939. this._rigCameras[i].maxZ = this.maxZ;
  9940. this._rigCameras[i].fov = this.fov;
  9941. }
  9942. // only update viewport when ANAGLYPH
  9943. if (this.cameraRigMode === Camera.RIG_MODE_STEREOSCOPIC_ANAGLYPH) {
  9944. this._rigCameras[0].viewport = this._rigCameras[1].viewport = this.viewport;
  9945. }
  9946. };
  9947. // Statics
  9948. Camera._PERSPECTIVE_CAMERA = 0;
  9949. Camera._ORTHOGRAPHIC_CAMERA = 1;
  9950. Camera._FOVMODE_VERTICAL_FIXED = 0;
  9951. Camera._FOVMODE_HORIZONTAL_FIXED = 1;
  9952. Camera._RIG_MODE_NONE = 0;
  9953. Camera._RIG_MODE_STEREOSCOPIC_ANAGLYPH = 10;
  9954. Camera._RIG_MODE_STEREOSCOPIC_SIDEBYSIDE_PARALLEL = 11;
  9955. Camera._RIG_MODE_STEREOSCOPIC_SIDEBYSIDE_CROSSEYED = 12;
  9956. Camera._RIG_MODE_STEREOSCOPIC_OVERUNDER = 13;
  9957. Camera._RIG_MODE_VR = 20;
  9958. return Camera;
  9959. })(BABYLON.Node);
  9960. BABYLON.Camera = Camera;
  9961. })(BABYLON || (BABYLON = {}));
  9962. var BABYLON;
  9963. (function (BABYLON) {
  9964. var TargetCamera = (function (_super) {
  9965. __extends(TargetCamera, _super);
  9966. function TargetCamera(name, position, scene) {
  9967. _super.call(this, name, position, scene);
  9968. this.cameraDirection = new BABYLON.Vector3(0, 0, 0);
  9969. this.cameraRotation = new BABYLON.Vector2(0, 0);
  9970. this.rotation = new BABYLON.Vector3(0, 0, 0);
  9971. this.speed = 2.0;
  9972. this.noRotationConstraint = false;
  9973. this.lockedTarget = null;
  9974. this._currentTarget = BABYLON.Vector3.Zero();
  9975. this._viewMatrix = BABYLON.Matrix.Zero();
  9976. this._camMatrix = BABYLON.Matrix.Zero();
  9977. this._cameraTransformMatrix = BABYLON.Matrix.Zero();
  9978. this._cameraRotationMatrix = BABYLON.Matrix.Zero();
  9979. this._referencePoint = new BABYLON.Vector3(0, 0, 1);
  9980. this._transformedReferencePoint = BABYLON.Vector3.Zero();
  9981. this._lookAtTemp = BABYLON.Matrix.Zero();
  9982. this._tempMatrix = BABYLON.Matrix.Zero();
  9983. }
  9984. TargetCamera.prototype.getFrontPosition = function (distance) {
  9985. var direction = this.getTarget().subtract(this.position);
  9986. direction.normalize();
  9987. direction.scaleInPlace(distance);
  9988. return this.globalPosition.add(direction);
  9989. };
  9990. TargetCamera.prototype._getLockedTargetPosition = function () {
  9991. if (!this.lockedTarget) {
  9992. return null;
  9993. }
  9994. return this.lockedTarget.position || this.lockedTarget;
  9995. };
  9996. // Cache
  9997. TargetCamera.prototype._initCache = function () {
  9998. _super.prototype._initCache.call(this);
  9999. this._cache.lockedTarget = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  10000. this._cache.rotation = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  10001. };
  10002. TargetCamera.prototype._updateCache = function (ignoreParentClass) {
  10003. if (!ignoreParentClass) {
  10004. _super.prototype._updateCache.call(this);
  10005. }
  10006. var lockedTargetPosition = this._getLockedTargetPosition();
  10007. if (!lockedTargetPosition) {
  10008. this._cache.lockedTarget = null;
  10009. }
  10010. else {
  10011. if (!this._cache.lockedTarget) {
  10012. this._cache.lockedTarget = lockedTargetPosition.clone();
  10013. }
  10014. else {
  10015. this._cache.lockedTarget.copyFrom(lockedTargetPosition);
  10016. }
  10017. }
  10018. this._cache.rotation.copyFrom(this.rotation);
  10019. };
  10020. // Synchronized
  10021. TargetCamera.prototype._isSynchronizedViewMatrix = function () {
  10022. if (!_super.prototype._isSynchronizedViewMatrix.call(this)) {
  10023. return false;
  10024. }
  10025. var lockedTargetPosition = this._getLockedTargetPosition();
  10026. return (this._cache.lockedTarget ? this._cache.lockedTarget.equals(lockedTargetPosition) : !lockedTargetPosition)
  10027. && this._cache.rotation.equals(this.rotation);
  10028. };
  10029. // Methods
  10030. TargetCamera.prototype._computeLocalCameraSpeed = function () {
  10031. var engine = this.getEngine();
  10032. return this.speed * ((engine.getDeltaTime() / (engine.getFps() * 10.0)));
  10033. };
  10034. // Target
  10035. TargetCamera.prototype.setTarget = function (target) {
  10036. this.upVector.normalize();
  10037. BABYLON.Matrix.LookAtLHToRef(this.position, target, this.upVector, this._camMatrix);
  10038. this._camMatrix.invert();
  10039. this.rotation.x = Math.atan(this._camMatrix.m[6] / this._camMatrix.m[10]);
  10040. var vDir = target.subtract(this.position);
  10041. if (vDir.x >= 0.0) {
  10042. this.rotation.y = (-Math.atan(vDir.z / vDir.x) + Math.PI / 2.0);
  10043. }
  10044. else {
  10045. this.rotation.y = (-Math.atan(vDir.z / vDir.x) - Math.PI / 2.0);
  10046. }
  10047. this.rotation.z = -Math.acos(BABYLON.Vector3.Dot(new BABYLON.Vector3(0, 1.0, 0), this.upVector));
  10048. if (isNaN(this.rotation.x)) {
  10049. this.rotation.x = 0;
  10050. }
  10051. if (isNaN(this.rotation.y)) {
  10052. this.rotation.y = 0;
  10053. }
  10054. if (isNaN(this.rotation.z)) {
  10055. this.rotation.z = 0;
  10056. }
  10057. };
  10058. TargetCamera.prototype.getTarget = function () {
  10059. return this._currentTarget;
  10060. };
  10061. TargetCamera.prototype._decideIfNeedsToMove = function () {
  10062. return Math.abs(this.cameraDirection.x) > 0 || Math.abs(this.cameraDirection.y) > 0 || Math.abs(this.cameraDirection.z) > 0;
  10063. };
  10064. TargetCamera.prototype._updatePosition = function () {
  10065. this.position.addInPlace(this.cameraDirection);
  10066. };
  10067. TargetCamera.prototype._checkInputs = function () {
  10068. var needToMove = this._decideIfNeedsToMove();
  10069. var needToRotate = Math.abs(this.cameraRotation.x) > 0 || Math.abs(this.cameraRotation.y) > 0;
  10070. // Move
  10071. if (needToMove) {
  10072. this._updatePosition();
  10073. }
  10074. // Rotate
  10075. if (needToRotate) {
  10076. this.rotation.x += this.cameraRotation.x;
  10077. this.rotation.y += this.cameraRotation.y;
  10078. if (!this.noRotationConstraint) {
  10079. var limit = (Math.PI / 2) * 0.95;
  10080. if (this.rotation.x > limit)
  10081. this.rotation.x = limit;
  10082. if (this.rotation.x < -limit)
  10083. this.rotation.x = -limit;
  10084. }
  10085. }
  10086. // Inertia
  10087. if (needToMove) {
  10088. if (Math.abs(this.cameraDirection.x) < BABYLON.Engine.Epsilon) {
  10089. this.cameraDirection.x = 0;
  10090. }
  10091. if (Math.abs(this.cameraDirection.y) < BABYLON.Engine.Epsilon) {
  10092. this.cameraDirection.y = 0;
  10093. }
  10094. if (Math.abs(this.cameraDirection.z) < BABYLON.Engine.Epsilon) {
  10095. this.cameraDirection.z = 0;
  10096. }
  10097. this.cameraDirection.scaleInPlace(this.inertia);
  10098. }
  10099. if (needToRotate) {
  10100. if (Math.abs(this.cameraRotation.x) < BABYLON.Engine.Epsilon) {
  10101. this.cameraRotation.x = 0;
  10102. }
  10103. if (Math.abs(this.cameraRotation.y) < BABYLON.Engine.Epsilon) {
  10104. this.cameraRotation.y = 0;
  10105. }
  10106. this.cameraRotation.scaleInPlace(this.inertia);
  10107. }
  10108. _super.prototype._checkInputs.call(this);
  10109. };
  10110. TargetCamera.prototype._getViewMatrix = function () {
  10111. if (!this.lockedTarget) {
  10112. // Compute
  10113. if (this.upVector.x !== 0 || this.upVector.y !== 1.0 || this.upVector.z !== 0) {
  10114. BABYLON.Matrix.LookAtLHToRef(BABYLON.Vector3.Zero(), this._referencePoint, this.upVector, this._lookAtTemp);
  10115. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._cameraRotationMatrix);
  10116. this._lookAtTemp.multiplyToRef(this._cameraRotationMatrix, this._tempMatrix);
  10117. this._lookAtTemp.invert();
  10118. this._tempMatrix.multiplyToRef(this._lookAtTemp, this._cameraRotationMatrix);
  10119. }
  10120. else {
  10121. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._cameraRotationMatrix);
  10122. }
  10123. BABYLON.Vector3.TransformCoordinatesToRef(this._referencePoint, this._cameraRotationMatrix, this._transformedReferencePoint);
  10124. // Computing target and final matrix
  10125. this.position.addToRef(this._transformedReferencePoint, this._currentTarget);
  10126. }
  10127. else {
  10128. this._currentTarget.copyFrom(this._getLockedTargetPosition());
  10129. }
  10130. BABYLON.Matrix.LookAtLHToRef(this.position, this._currentTarget, this.upVector, this._viewMatrix);
  10131. return this._viewMatrix;
  10132. };
  10133. TargetCamera.prototype._getVRViewMatrix = function () {
  10134. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, this.rotation.z, this._cameraRotationMatrix);
  10135. BABYLON.Vector3.TransformCoordinatesToRef(this._referencePoint, this._cameraRotationMatrix, this._transformedReferencePoint);
  10136. BABYLON.Vector3.TransformNormalToRef(this.upVector, this._cameraRotationMatrix, this._cameraRigParams.vrActualUp);
  10137. // Computing target and final matrix
  10138. this.position.addToRef(this._transformedReferencePoint, this._currentTarget);
  10139. BABYLON.Matrix.LookAtLHToRef(this.position, this._currentTarget, this._cameraRigParams.vrActualUp, this._cameraRigParams.vrWorkMatrix);
  10140. this._cameraRigParams.vrWorkMatrix.multiplyToRef(this._cameraRigParams.vrPreViewMatrix, this._viewMatrix);
  10141. return this._viewMatrix;
  10142. };
  10143. /**
  10144. * @override
  10145. * Override Camera.createRigCamera
  10146. */
  10147. TargetCamera.prototype.createRigCamera = function (name, cameraIndex) {
  10148. if (this.cameraRigMode !== BABYLON.Camera.RIG_MODE_NONE) {
  10149. var rigCamera = new TargetCamera(name, this.position.clone(), this.getScene());
  10150. if (this.cameraRigMode === BABYLON.Camera.RIG_MODE_VR) {
  10151. rigCamera._cameraRigParams = {};
  10152. rigCamera._cameraRigParams.vrActualUp = new BABYLON.Vector3(0, 0, 0);
  10153. rigCamera._getViewMatrix = rigCamera._getVRViewMatrix;
  10154. }
  10155. return rigCamera;
  10156. }
  10157. return null;
  10158. };
  10159. /**
  10160. * @override
  10161. * Override Camera._updateRigCameras
  10162. */
  10163. TargetCamera.prototype._updateRigCameras = function () {
  10164. switch (this.cameraRigMode) {
  10165. case BABYLON.Camera.RIG_MODE_STEREOSCOPIC_ANAGLYPH:
  10166. case BABYLON.Camera.RIG_MODE_STEREOSCOPIC_SIDEBYSIDE_PARALLEL:
  10167. case BABYLON.Camera.RIG_MODE_STEREOSCOPIC_SIDEBYSIDE_CROSSEYED:
  10168. case BABYLON.Camera.RIG_MODE_STEREOSCOPIC_OVERUNDER:
  10169. case BABYLON.Camera.RIG_MODE_VR:
  10170. var camLeft = this._rigCameras[0];
  10171. var camRight = this._rigCameras[1];
  10172. if (this.cameraRigMode === BABYLON.Camera.RIG_MODE_VR) {
  10173. camLeft.rotation.x = camRight.rotation.x = this.rotation.x;
  10174. camLeft.rotation.y = camRight.rotation.y = this.rotation.y;
  10175. camLeft.rotation.z = camRight.rotation.z = this.rotation.z;
  10176. camLeft.position.copyFrom(this.position);
  10177. camRight.position.copyFrom(this.position);
  10178. }
  10179. else {
  10180. //provisionnaly using _cameraRigParams.stereoHalfAngle instead of calculations based on _cameraRigParams.interaxialDistance:
  10181. this._getRigCamPosition(-this._cameraRigParams.stereoHalfAngle, camLeft.position);
  10182. this._getRigCamPosition(this._cameraRigParams.stereoHalfAngle, camRight.position);
  10183. camLeft.setTarget(this.getTarget());
  10184. camRight.setTarget(this.getTarget());
  10185. }
  10186. break;
  10187. }
  10188. _super.prototype._updateRigCameras.call(this);
  10189. };
  10190. TargetCamera.prototype._getRigCamPosition = function (halfSpace, result) {
  10191. if (!this._rigCamTransformMatrix) {
  10192. this._rigCamTransformMatrix = new BABYLON.Matrix();
  10193. }
  10194. var target = this.getTarget();
  10195. BABYLON.Matrix.Translation(-target.x, -target.y, -target.z).multiplyToRef(BABYLON.Matrix.RotationY(halfSpace), this._rigCamTransformMatrix);
  10196. this._rigCamTransformMatrix = this._rigCamTransformMatrix.multiply(BABYLON.Matrix.Translation(target.x, target.y, target.z));
  10197. BABYLON.Vector3.TransformCoordinatesToRef(this.position, this._rigCamTransformMatrix, result);
  10198. };
  10199. return TargetCamera;
  10200. })(BABYLON.Camera);
  10201. BABYLON.TargetCamera = TargetCamera;
  10202. })(BABYLON || (BABYLON = {}));
  10203. var BABYLON;
  10204. (function (BABYLON) {
  10205. var FreeCamera = (function (_super) {
  10206. __extends(FreeCamera, _super);
  10207. function FreeCamera(name, position, scene) {
  10208. var _this = this;
  10209. _super.call(this, name, position, scene);
  10210. this.ellipsoid = new BABYLON.Vector3(0.5, 1, 0.5);
  10211. this.keysUp = [38];
  10212. this.keysDown = [40];
  10213. this.keysLeft = [37];
  10214. this.keysRight = [39];
  10215. this.checkCollisions = false;
  10216. this.applyGravity = false;
  10217. this.angularSensibility = 2000.0;
  10218. this._keys = [];
  10219. this._collider = new BABYLON.Collider();
  10220. this._needMoveForGravity = false;
  10221. this._oldPosition = BABYLON.Vector3.Zero();
  10222. this._diffPosition = BABYLON.Vector3.Zero();
  10223. this._newPosition = BABYLON.Vector3.Zero();
  10224. this._onCollisionPositionChange = function (collisionId, newPosition, collidedMesh) {
  10225. if (collidedMesh === void 0) { collidedMesh = null; }
  10226. //TODO move this to the collision coordinator!
  10227. if (_this.getScene().workerCollisions)
  10228. newPosition.multiplyInPlace(_this._collider.radius);
  10229. var updatePosition = function (newPos) {
  10230. _this._newPosition.copyFrom(newPos);
  10231. _this._newPosition.subtractToRef(_this._oldPosition, _this._diffPosition);
  10232. var oldPosition = _this.position.clone();
  10233. if (_this._diffPosition.length() > BABYLON.Engine.CollisionsEpsilon) {
  10234. _this.position.addInPlace(_this._diffPosition);
  10235. if (_this.onCollide && collidedMesh) {
  10236. _this.onCollide(collidedMesh);
  10237. }
  10238. }
  10239. };
  10240. updatePosition(newPosition);
  10241. };
  10242. }
  10243. // Controls
  10244. FreeCamera.prototype.attachControl = function (element, noPreventDefault) {
  10245. var _this = this;
  10246. var previousPosition;
  10247. var engine = this.getEngine();
  10248. if (this._attachedElement) {
  10249. return;
  10250. }
  10251. this._attachedElement = element;
  10252. if (this._onMouseDown === undefined) {
  10253. this._onMouseDown = function (evt) {
  10254. previousPosition = {
  10255. x: evt.clientX,
  10256. y: evt.clientY
  10257. };
  10258. if (!noPreventDefault) {
  10259. evt.preventDefault();
  10260. }
  10261. };
  10262. this._onMouseUp = function (evt) {
  10263. previousPosition = null;
  10264. if (!noPreventDefault) {
  10265. evt.preventDefault();
  10266. }
  10267. };
  10268. this._onMouseOut = function (evt) {
  10269. previousPosition = null;
  10270. _this._keys = [];
  10271. if (!noPreventDefault) {
  10272. evt.preventDefault();
  10273. }
  10274. };
  10275. this._onMouseMove = function (evt) {
  10276. if (!previousPosition && !engine.isPointerLock) {
  10277. return;
  10278. }
  10279. var offsetX;
  10280. var offsetY;
  10281. if (!engine.isPointerLock) {
  10282. offsetX = evt.clientX - previousPosition.x;
  10283. offsetY = evt.clientY - previousPosition.y;
  10284. }
  10285. else {
  10286. offsetX = evt.movementX || evt.mozMovementX || evt.webkitMovementX || evt.msMovementX || 0;
  10287. offsetY = evt.movementY || evt.mozMovementY || evt.webkitMovementY || evt.msMovementY || 0;
  10288. }
  10289. _this.cameraRotation.y += offsetX / _this.angularSensibility;
  10290. _this.cameraRotation.x += offsetY / _this.angularSensibility;
  10291. previousPosition = {
  10292. x: evt.clientX,
  10293. y: evt.clientY
  10294. };
  10295. if (!noPreventDefault) {
  10296. evt.preventDefault();
  10297. }
  10298. };
  10299. this._onKeyDown = function (evt) {
  10300. if (_this.keysUp.indexOf(evt.keyCode) !== -1 ||
  10301. _this.keysDown.indexOf(evt.keyCode) !== -1 ||
  10302. _this.keysLeft.indexOf(evt.keyCode) !== -1 ||
  10303. _this.keysRight.indexOf(evt.keyCode) !== -1) {
  10304. var index = _this._keys.indexOf(evt.keyCode);
  10305. if (index === -1) {
  10306. _this._keys.push(evt.keyCode);
  10307. }
  10308. if (!noPreventDefault) {
  10309. evt.preventDefault();
  10310. }
  10311. }
  10312. };
  10313. this._onKeyUp = function (evt) {
  10314. if (_this.keysUp.indexOf(evt.keyCode) !== -1 ||
  10315. _this.keysDown.indexOf(evt.keyCode) !== -1 ||
  10316. _this.keysLeft.indexOf(evt.keyCode) !== -1 ||
  10317. _this.keysRight.indexOf(evt.keyCode) !== -1) {
  10318. var index = _this._keys.indexOf(evt.keyCode);
  10319. if (index >= 0) {
  10320. _this._keys.splice(index, 1);
  10321. }
  10322. if (!noPreventDefault) {
  10323. evt.preventDefault();
  10324. }
  10325. }
  10326. };
  10327. this._onLostFocus = function () {
  10328. _this._keys = [];
  10329. };
  10330. this._reset = function () {
  10331. _this._keys = [];
  10332. previousPosition = null;
  10333. _this.cameraDirection = new BABYLON.Vector3(0, 0, 0);
  10334. _this.cameraRotation = new BABYLON.Vector2(0, 0);
  10335. };
  10336. }
  10337. element.addEventListener("mousedown", this._onMouseDown, false);
  10338. element.addEventListener("mouseup", this._onMouseUp, false);
  10339. element.addEventListener("mouseout", this._onMouseOut, false);
  10340. element.addEventListener("mousemove", this._onMouseMove, false);
  10341. BABYLON.Tools.RegisterTopRootEvents([
  10342. { name: "keydown", handler: this._onKeyDown },
  10343. { name: "keyup", handler: this._onKeyUp },
  10344. { name: "blur", handler: this._onLostFocus }
  10345. ]);
  10346. };
  10347. FreeCamera.prototype.detachControl = function (element) {
  10348. if (this._attachedElement != element) {
  10349. return;
  10350. }
  10351. element.removeEventListener("mousedown", this._onMouseDown);
  10352. element.removeEventListener("mouseup", this._onMouseUp);
  10353. element.removeEventListener("mouseout", this._onMouseOut);
  10354. element.removeEventListener("mousemove", this._onMouseMove);
  10355. BABYLON.Tools.UnregisterTopRootEvents([
  10356. { name: "keydown", handler: this._onKeyDown },
  10357. { name: "keyup", handler: this._onKeyUp },
  10358. { name: "blur", handler: this._onLostFocus }
  10359. ]);
  10360. this._attachedElement = null;
  10361. if (this._reset) {
  10362. this._reset();
  10363. }
  10364. };
  10365. FreeCamera.prototype._collideWithWorld = function (velocity) {
  10366. var globalPosition;
  10367. if (this.parent) {
  10368. globalPosition = BABYLON.Vector3.TransformCoordinates(this.position, this.parent.getWorldMatrix());
  10369. }
  10370. else {
  10371. globalPosition = this.position;
  10372. }
  10373. globalPosition.subtractFromFloatsToRef(0, this.ellipsoid.y, 0, this._oldPosition);
  10374. this._collider.radius = this.ellipsoid;
  10375. //no need for clone, as long as gravity is not on.
  10376. var actualVelocity = velocity;
  10377. //add gravity to the velocity to prevent the dual-collision checking
  10378. if (this.applyGravity) {
  10379. //this prevents mending with cameraDirection, a global variable of the free camera class.
  10380. actualVelocity = velocity.add(this.getScene().gravity);
  10381. }
  10382. this.getScene().collisionCoordinator.getNewPosition(this._oldPosition, actualVelocity, this._collider, 3, null, this._onCollisionPositionChange, this.uniqueId);
  10383. };
  10384. FreeCamera.prototype._checkInputs = function () {
  10385. if (!this._localDirection) {
  10386. this._localDirection = BABYLON.Vector3.Zero();
  10387. this._transformedDirection = BABYLON.Vector3.Zero();
  10388. }
  10389. // Keyboard
  10390. for (var index = 0; index < this._keys.length; index++) {
  10391. var keyCode = this._keys[index];
  10392. var speed = this._computeLocalCameraSpeed();
  10393. if (this.keysLeft.indexOf(keyCode) !== -1) {
  10394. this._localDirection.copyFromFloats(-speed, 0, 0);
  10395. }
  10396. else if (this.keysUp.indexOf(keyCode) !== -1) {
  10397. this._localDirection.copyFromFloats(0, 0, speed);
  10398. }
  10399. else if (this.keysRight.indexOf(keyCode) !== -1) {
  10400. this._localDirection.copyFromFloats(speed, 0, 0);
  10401. }
  10402. else if (this.keysDown.indexOf(keyCode) !== -1) {
  10403. this._localDirection.copyFromFloats(0, 0, -speed);
  10404. }
  10405. this.getViewMatrix().invertToRef(this._cameraTransformMatrix);
  10406. BABYLON.Vector3.TransformNormalToRef(this._localDirection, this._cameraTransformMatrix, this._transformedDirection);
  10407. this.cameraDirection.addInPlace(this._transformedDirection);
  10408. }
  10409. _super.prototype._checkInputs.call(this);
  10410. };
  10411. FreeCamera.prototype._decideIfNeedsToMove = function () {
  10412. return this._needMoveForGravity || Math.abs(this.cameraDirection.x) > 0 || Math.abs(this.cameraDirection.y) > 0 || Math.abs(this.cameraDirection.z) > 0;
  10413. };
  10414. FreeCamera.prototype._updatePosition = function () {
  10415. if (this.checkCollisions && this.getScene().collisionsEnabled) {
  10416. this._collideWithWorld(this.cameraDirection);
  10417. }
  10418. else {
  10419. this.position.addInPlace(this.cameraDirection);
  10420. }
  10421. };
  10422. return FreeCamera;
  10423. })(BABYLON.TargetCamera);
  10424. BABYLON.FreeCamera = FreeCamera;
  10425. })(BABYLON || (BABYLON = {}));
  10426. var BABYLON;
  10427. (function (BABYLON) {
  10428. var FollowCamera = (function (_super) {
  10429. __extends(FollowCamera, _super);
  10430. function FollowCamera(name, position, scene) {
  10431. _super.call(this, name, position, scene);
  10432. this.radius = 12;
  10433. this.rotationOffset = 0;
  10434. this.heightOffset = 4;
  10435. this.cameraAcceleration = 0.05;
  10436. this.maxCameraSpeed = 20;
  10437. }
  10438. FollowCamera.prototype.getRadians = function (degrees) {
  10439. return degrees * Math.PI / 180;
  10440. };
  10441. FollowCamera.prototype.follow = function (cameraTarget) {
  10442. if (!cameraTarget)
  10443. return;
  10444. var yRotation;
  10445. if (cameraTarget.rotationQuaternion) {
  10446. var rotMatrix = new BABYLON.Matrix();
  10447. cameraTarget.rotationQuaternion.toRotationMatrix(rotMatrix);
  10448. yRotation = Math.atan2(rotMatrix.m[8], rotMatrix.m[10]);
  10449. }
  10450. else {
  10451. yRotation = cameraTarget.rotation.y;
  10452. }
  10453. var radians = this.getRadians(this.rotationOffset) + yRotation;
  10454. var targetX = cameraTarget.position.x + Math.sin(radians) * this.radius;
  10455. var targetZ = cameraTarget.position.z + Math.cos(radians) * this.radius;
  10456. var dx = targetX - this.position.x;
  10457. var dy = (cameraTarget.position.y + this.heightOffset) - this.position.y;
  10458. var dz = (targetZ) - this.position.z;
  10459. var vx = dx * this.cameraAcceleration * 2; //this is set to .05
  10460. var vy = dy * this.cameraAcceleration;
  10461. var vz = dz * this.cameraAcceleration * 2;
  10462. if (vx > this.maxCameraSpeed || vx < -this.maxCameraSpeed) {
  10463. vx = vx < 1 ? -this.maxCameraSpeed : this.maxCameraSpeed;
  10464. }
  10465. if (vy > this.maxCameraSpeed || vy < -this.maxCameraSpeed) {
  10466. vy = vy < 1 ? -this.maxCameraSpeed : this.maxCameraSpeed;
  10467. }
  10468. if (vz > this.maxCameraSpeed || vz < -this.maxCameraSpeed) {
  10469. vz = vz < 1 ? -this.maxCameraSpeed : this.maxCameraSpeed;
  10470. }
  10471. this.position = new BABYLON.Vector3(this.position.x + vx, this.position.y + vy, this.position.z + vz);
  10472. this.setTarget(cameraTarget.position);
  10473. };
  10474. FollowCamera.prototype._checkInputs = function () {
  10475. _super.prototype._checkInputs.call(this);
  10476. this.follow(this.target);
  10477. };
  10478. return FollowCamera;
  10479. })(BABYLON.TargetCamera);
  10480. BABYLON.FollowCamera = FollowCamera;
  10481. var ArcFollowCamera = (function (_super) {
  10482. __extends(ArcFollowCamera, _super);
  10483. function ArcFollowCamera(name, alpha, beta, radius, target, scene) {
  10484. _super.call(this, name, BABYLON.Vector3.Zero(), scene);
  10485. this.alpha = alpha;
  10486. this.beta = beta;
  10487. this.radius = radius;
  10488. this.target = target;
  10489. this._cartesianCoordinates = BABYLON.Vector3.Zero();
  10490. this.follow();
  10491. }
  10492. ArcFollowCamera.prototype.follow = function () {
  10493. this._cartesianCoordinates.x = this.radius * Math.cos(this.alpha) * Math.cos(this.beta);
  10494. this._cartesianCoordinates.y = this.radius * Math.sin(this.beta);
  10495. this._cartesianCoordinates.z = this.radius * Math.sin(this.alpha) * Math.cos(this.beta);
  10496. this.position = this.target.position.add(this._cartesianCoordinates);
  10497. this.setTarget(this.target.position);
  10498. };
  10499. ArcFollowCamera.prototype._checkInputs = function () {
  10500. _super.prototype._checkInputs.call(this);
  10501. this.follow();
  10502. };
  10503. return ArcFollowCamera;
  10504. })(BABYLON.TargetCamera);
  10505. BABYLON.ArcFollowCamera = ArcFollowCamera;
  10506. })(BABYLON || (BABYLON = {}));
  10507. var BABYLON;
  10508. (function (BABYLON) {
  10509. // We're mainly based on the logic defined into the FreeCamera code
  10510. var TouchCamera = (function (_super) {
  10511. __extends(TouchCamera, _super);
  10512. function TouchCamera(name, position, scene) {
  10513. _super.call(this, name, position, scene);
  10514. this._offsetX = null;
  10515. this._offsetY = null;
  10516. this._pointerCount = 0;
  10517. this._pointerPressed = [];
  10518. this.angularSensibility = 200000.0;
  10519. this.moveSensibility = 500.0;
  10520. }
  10521. TouchCamera.prototype.attachControl = function (canvas, noPreventDefault) {
  10522. var _this = this;
  10523. var previousPosition;
  10524. if (this._attachedCanvas) {
  10525. return;
  10526. }
  10527. this._attachedCanvas = canvas;
  10528. if (this._onPointerDown === undefined) {
  10529. this._onPointerDown = function (evt) {
  10530. if (!noPreventDefault) {
  10531. evt.preventDefault();
  10532. }
  10533. _this._pointerPressed.push(evt.pointerId);
  10534. if (_this._pointerPressed.length !== 1) {
  10535. return;
  10536. }
  10537. previousPosition = {
  10538. x: evt.clientX,
  10539. y: evt.clientY
  10540. };
  10541. };
  10542. this._onPointerUp = function (evt) {
  10543. if (!noPreventDefault) {
  10544. evt.preventDefault();
  10545. }
  10546. var index = _this._pointerPressed.indexOf(evt.pointerId);
  10547. if (index === -1) {
  10548. return;
  10549. }
  10550. _this._pointerPressed.splice(index, 1);
  10551. if (index != 0) {
  10552. return;
  10553. }
  10554. previousPosition = null;
  10555. _this._offsetX = null;
  10556. _this._offsetY = null;
  10557. };
  10558. this._onPointerMove = function (evt) {
  10559. if (!noPreventDefault) {
  10560. evt.preventDefault();
  10561. }
  10562. if (!previousPosition) {
  10563. return;
  10564. }
  10565. var index = _this._pointerPressed.indexOf(evt.pointerId);
  10566. if (index != 0) {
  10567. return;
  10568. }
  10569. _this._offsetX = evt.clientX - previousPosition.x;
  10570. _this._offsetY = -(evt.clientY - previousPosition.y);
  10571. };
  10572. this._onLostFocus = function () {
  10573. _this._offsetX = null;
  10574. _this._offsetY = null;
  10575. };
  10576. }
  10577. canvas.addEventListener("pointerdown", this._onPointerDown);
  10578. canvas.addEventListener("pointerup", this._onPointerUp);
  10579. canvas.addEventListener("pointerout", this._onPointerUp);
  10580. canvas.addEventListener("pointermove", this._onPointerMove);
  10581. BABYLON.Tools.RegisterTopRootEvents([
  10582. { name: "blur", handler: this._onLostFocus }
  10583. ]);
  10584. };
  10585. TouchCamera.prototype.detachControl = function (canvas) {
  10586. if (this._attachedCanvas != canvas) {
  10587. return;
  10588. }
  10589. canvas.removeEventListener("pointerdown", this._onPointerDown);
  10590. canvas.removeEventListener("pointerup", this._onPointerUp);
  10591. canvas.removeEventListener("pointerout", this._onPointerUp);
  10592. canvas.removeEventListener("pointermove", this._onPointerMove);
  10593. BABYLON.Tools.UnregisterTopRootEvents([
  10594. { name: "blur", handler: this._onLostFocus }
  10595. ]);
  10596. this._attachedCanvas = null;
  10597. };
  10598. TouchCamera.prototype._checkInputs = function () {
  10599. if (this._offsetX) {
  10600. this.cameraRotation.y += this._offsetX / this.angularSensibility;
  10601. if (this._pointerPressed.length > 1) {
  10602. this.cameraRotation.x += -this._offsetY / this.angularSensibility;
  10603. }
  10604. else {
  10605. var speed = this._computeLocalCameraSpeed();
  10606. var direction = new BABYLON.Vector3(0, 0, speed * this._offsetY / this.moveSensibility);
  10607. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, 0, this._cameraRotationMatrix);
  10608. this.cameraDirection.addInPlace(BABYLON.Vector3.TransformCoordinates(direction, this._cameraRotationMatrix));
  10609. }
  10610. }
  10611. _super.prototype._checkInputs.call(this);
  10612. };
  10613. return TouchCamera;
  10614. })(BABYLON.FreeCamera);
  10615. BABYLON.TouchCamera = TouchCamera;
  10616. })(BABYLON || (BABYLON = {}));
  10617. var BABYLON;
  10618. (function (BABYLON) {
  10619. var eventPrefix = BABYLON.Tools.GetPointerPrefix();
  10620. var ArcRotateCamera = (function (_super) {
  10621. __extends(ArcRotateCamera, _super);
  10622. function ArcRotateCamera(name, alpha, beta, radius, target, scene) {
  10623. var _this = this;
  10624. _super.call(this, name, BABYLON.Vector3.Zero(), scene);
  10625. this.alpha = alpha;
  10626. this.beta = beta;
  10627. this.radius = radius;
  10628. this.target = target;
  10629. this.inertialAlphaOffset = 0;
  10630. this.inertialBetaOffset = 0;
  10631. this.inertialRadiusOffset = 0;
  10632. this.lowerAlphaLimit = null;
  10633. this.upperAlphaLimit = null;
  10634. this.lowerBetaLimit = 0.01;
  10635. this.upperBetaLimit = Math.PI;
  10636. this.lowerRadiusLimit = null;
  10637. this.upperRadiusLimit = null;
  10638. this.angularSensibilityX = 1000.0;
  10639. this.angularSensibilityY = 1000.0;
  10640. this.wheelPrecision = 3.0;
  10641. this.pinchPrecision = 2.0;
  10642. this.panningSensibility = 50.0;
  10643. this.inertialPanningX = 0;
  10644. this.inertialPanningY = 0;
  10645. this.keysUp = [38];
  10646. this.keysDown = [40];
  10647. this.keysLeft = [37];
  10648. this.keysRight = [39];
  10649. this.zoomOnFactor = 1;
  10650. this.targetScreenOffset = BABYLON.Vector2.Zero();
  10651. this.pinchInwards = true;
  10652. this.allowUpsideDown = true;
  10653. this._keys = [];
  10654. this._viewMatrix = new BABYLON.Matrix();
  10655. this._isRightClick = false;
  10656. this._isCtrlPushed = false;
  10657. this.checkCollisions = false;
  10658. this.collisionRadius = new BABYLON.Vector3(0.5, 0.5, 0.5);
  10659. this._collider = new BABYLON.Collider();
  10660. this._previousPosition = BABYLON.Vector3.Zero();
  10661. this._collisionVelocity = BABYLON.Vector3.Zero();
  10662. this._newPosition = BABYLON.Vector3.Zero();
  10663. this._onCollisionPositionChange = function (collisionId, newPosition, collidedMesh) {
  10664. if (collidedMesh === void 0) { collidedMesh = null; }
  10665. if (_this.getScene().workerCollisions && _this.checkCollisions) {
  10666. newPosition.multiplyInPlace(_this._collider.radius);
  10667. }
  10668. if (!collidedMesh) {
  10669. _this._previousPosition.copyFrom(_this.position);
  10670. }
  10671. else {
  10672. _this.setPosition(_this.position);
  10673. if (_this.onCollide) {
  10674. _this.onCollide(collidedMesh);
  10675. }
  10676. }
  10677. // Recompute because of constraints
  10678. var cosa = Math.cos(_this.alpha);
  10679. var sina = Math.sin(_this.alpha);
  10680. var cosb = Math.cos(_this.beta);
  10681. var sinb = Math.sin(_this.beta);
  10682. var target = _this._getTargetPosition();
  10683. target.addToRef(new BABYLON.Vector3(_this.radius * cosa * sinb, _this.radius * cosb, _this.radius * sina * sinb), _this._newPosition);
  10684. _this.position.copyFrom(_this._newPosition);
  10685. var up = _this.upVector;
  10686. if (_this.allowUpsideDown && _this.beta < 0) {
  10687. var up = up.clone();
  10688. up = up.negate();
  10689. }
  10690. BABYLON.Matrix.LookAtLHToRef(_this.position, target, up, _this._viewMatrix);
  10691. _this._viewMatrix.m[12] += _this.targetScreenOffset.x;
  10692. _this._viewMatrix.m[13] += _this.targetScreenOffset.y;
  10693. _this._collisionTriggered = false;
  10694. };
  10695. if (!this.target) {
  10696. this.target = BABYLON.Vector3.Zero();
  10697. }
  10698. this.getViewMatrix();
  10699. }
  10700. Object.defineProperty(ArcRotateCamera.prototype, "angularSensibility", {
  10701. //deprecated angularSensibility support
  10702. get: function () {
  10703. BABYLON.Tools.Warn("Warning: angularSensibility is deprecated, use angularSensibilityX and angularSensibilityY instead.");
  10704. return Math.max(this.angularSensibilityX, this.angularSensibilityY);
  10705. },
  10706. //deprecated angularSensibility support
  10707. set: function (value) {
  10708. BABYLON.Tools.Warn("Warning: angularSensibility is deprecated, use angularSensibilityX and angularSensibilityY instead.");
  10709. this.angularSensibilityX = value;
  10710. this.angularSensibilityY = value;
  10711. },
  10712. enumerable: true,
  10713. configurable: true
  10714. });
  10715. ArcRotateCamera.prototype._getTargetPosition = function () {
  10716. return this.target.position || this.target;
  10717. };
  10718. // Cache
  10719. ArcRotateCamera.prototype._initCache = function () {
  10720. _super.prototype._initCache.call(this);
  10721. this._cache.target = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  10722. this._cache.alpha = undefined;
  10723. this._cache.beta = undefined;
  10724. this._cache.radius = undefined;
  10725. this._cache.targetScreenOffset = BABYLON.Vector2.Zero();
  10726. };
  10727. ArcRotateCamera.prototype._updateCache = function (ignoreParentClass) {
  10728. if (!ignoreParentClass) {
  10729. _super.prototype._updateCache.call(this);
  10730. }
  10731. this._cache.target.copyFrom(this._getTargetPosition());
  10732. this._cache.alpha = this.alpha;
  10733. this._cache.beta = this.beta;
  10734. this._cache.radius = this.radius;
  10735. this._cache.targetScreenOffset.copyFrom(this.targetScreenOffset);
  10736. };
  10737. // Synchronized
  10738. ArcRotateCamera.prototype._isSynchronizedViewMatrix = function () {
  10739. if (!_super.prototype._isSynchronizedViewMatrix.call(this))
  10740. return false;
  10741. return this._cache.target.equals(this._getTargetPosition())
  10742. && this._cache.alpha === this.alpha
  10743. && this._cache.beta === this.beta
  10744. && this._cache.radius === this.radius
  10745. && this._cache.targetScreenOffset.equals(this.targetScreenOffset);
  10746. };
  10747. // Methods
  10748. ArcRotateCamera.prototype.attachControl = function (element, noPreventDefault, useCtrlForPanning) {
  10749. var _this = this;
  10750. if (useCtrlForPanning === void 0) { useCtrlForPanning = true; }
  10751. var cacheSoloPointer; // cache pointer object for better perf on camera rotation
  10752. var previousPinchDistance = 0;
  10753. var pointers = new BABYLON.SmartCollection();
  10754. if (this._attachedElement) {
  10755. return;
  10756. }
  10757. this._attachedElement = element;
  10758. var engine = this.getEngine();
  10759. if (this._onPointerDown === undefined) {
  10760. this._onPointerDown = function (evt) {
  10761. // Manage panning with right click
  10762. _this._isRightClick = evt.button === 2 ? true : false;
  10763. // manage pointers
  10764. pointers.add(evt.pointerId, { x: evt.clientX, y: evt.clientY, type: evt.pointerType });
  10765. cacheSoloPointer = pointers.item(evt.pointerId);
  10766. if (!noPreventDefault) {
  10767. evt.preventDefault();
  10768. }
  10769. };
  10770. this._onPointerUp = function (evt) {
  10771. cacheSoloPointer = null;
  10772. previousPinchDistance = 0;
  10773. //would be better to use pointers.remove(evt.pointerId) for multitouch gestures,
  10774. //but emptying completly pointers collection is required to fix a bug on iPhone :
  10775. //when changing orientation while pinching camera, one pointer stay pressed forever if we don't release all pointers
  10776. //will be ok to put back pointers.remove(evt.pointerId); when iPhone bug corrected
  10777. pointers.empty();
  10778. if (!noPreventDefault) {
  10779. evt.preventDefault();
  10780. }
  10781. };
  10782. this._onContextMenu = function (evt) {
  10783. evt.preventDefault();
  10784. };
  10785. this._onPointerMove = function (evt) {
  10786. if (!noPreventDefault) {
  10787. evt.preventDefault();
  10788. }
  10789. switch (pointers.count) {
  10790. case 1:
  10791. if (_this.panningSensibility !== 0 && ((_this._isCtrlPushed && useCtrlForPanning) || (!useCtrlForPanning && _this._isRightClick))) {
  10792. _this.inertialPanningX += -(evt.clientX - cacheSoloPointer.x) / _this.panningSensibility;
  10793. _this.inertialPanningY += (evt.clientY - cacheSoloPointer.y) / _this.panningSensibility;
  10794. }
  10795. else {
  10796. var offsetX = evt.clientX - cacheSoloPointer.x;
  10797. var offsetY = evt.clientY - cacheSoloPointer.y;
  10798. _this.inertialAlphaOffset -= offsetX / _this.angularSensibilityX;
  10799. _this.inertialBetaOffset -= offsetY / _this.angularSensibilityY;
  10800. }
  10801. cacheSoloPointer.x = evt.clientX;
  10802. cacheSoloPointer.y = evt.clientY;
  10803. break;
  10804. case 2:
  10805. //if (noPreventDefault) { evt.preventDefault(); } //if pinch gesture, could be usefull to force preventDefault to avoid html page scroll/zoom in some mobile browsers
  10806. pointers.item(evt.pointerId).x = evt.clientX;
  10807. pointers.item(evt.pointerId).y = evt.clientY;
  10808. var direction = _this.pinchInwards ? 1 : -1;
  10809. var distX = pointers.getItemByIndex(0).x - pointers.getItemByIndex(1).x;
  10810. var distY = pointers.getItemByIndex(0).y - pointers.getItemByIndex(1).y;
  10811. var pinchSquaredDistance = (distX * distX) + (distY * distY);
  10812. if (previousPinchDistance === 0) {
  10813. previousPinchDistance = pinchSquaredDistance;
  10814. return;
  10815. }
  10816. if (pinchSquaredDistance !== previousPinchDistance) {
  10817. _this.inertialRadiusOffset += (pinchSquaredDistance - previousPinchDistance) / (_this.pinchPrecision * _this.wheelPrecision * ((_this.angularSensibilityX + _this.angularSensibilityY) / 2) * direction);
  10818. previousPinchDistance = pinchSquaredDistance;
  10819. }
  10820. break;
  10821. default:
  10822. if (pointers.item(evt.pointerId)) {
  10823. pointers.item(evt.pointerId).x = evt.clientX;
  10824. pointers.item(evt.pointerId).y = evt.clientY;
  10825. }
  10826. }
  10827. };
  10828. this._onMouseMove = function (evt) {
  10829. if (!engine.isPointerLock) {
  10830. return;
  10831. }
  10832. var offsetX = evt.movementX || evt.mozMovementX || evt.webkitMovementX || evt.msMovementX || 0;
  10833. var offsetY = evt.movementY || evt.mozMovementY || evt.webkitMovementY || evt.msMovementY || 0;
  10834. _this.inertialAlphaOffset -= offsetX / _this.angularSensibilityX;
  10835. _this.inertialBetaOffset -= offsetY / _this.angularSensibilityY;
  10836. if (!noPreventDefault) {
  10837. evt.preventDefault();
  10838. }
  10839. };
  10840. this._wheel = function (event) {
  10841. var delta = 0;
  10842. if (event.wheelDelta) {
  10843. delta = event.wheelDelta / (_this.wheelPrecision * 40);
  10844. }
  10845. else if (event.detail) {
  10846. delta = -event.detail / _this.wheelPrecision;
  10847. }
  10848. if (delta)
  10849. _this.inertialRadiusOffset += delta;
  10850. if (event.preventDefault) {
  10851. if (!noPreventDefault) {
  10852. event.preventDefault();
  10853. }
  10854. }
  10855. };
  10856. this._onKeyDown = function (evt) {
  10857. _this._isCtrlPushed = evt.ctrlKey;
  10858. if (_this.keysUp.indexOf(evt.keyCode) !== -1 ||
  10859. _this.keysDown.indexOf(evt.keyCode) !== -1 ||
  10860. _this.keysLeft.indexOf(evt.keyCode) !== -1 ||
  10861. _this.keysRight.indexOf(evt.keyCode) !== -1) {
  10862. var index = _this._keys.indexOf(evt.keyCode);
  10863. if (index === -1) {
  10864. _this._keys.push(evt.keyCode);
  10865. }
  10866. if (evt.preventDefault) {
  10867. if (!noPreventDefault) {
  10868. evt.preventDefault();
  10869. }
  10870. }
  10871. }
  10872. };
  10873. this._onKeyUp = function (evt) {
  10874. _this._isCtrlPushed = evt.ctrlKey;
  10875. if (_this.keysUp.indexOf(evt.keyCode) !== -1 ||
  10876. _this.keysDown.indexOf(evt.keyCode) !== -1 ||
  10877. _this.keysLeft.indexOf(evt.keyCode) !== -1 ||
  10878. _this.keysRight.indexOf(evt.keyCode) !== -1) {
  10879. var index = _this._keys.indexOf(evt.keyCode);
  10880. if (index >= 0) {
  10881. _this._keys.splice(index, 1);
  10882. }
  10883. if (evt.preventDefault) {
  10884. if (!noPreventDefault) {
  10885. evt.preventDefault();
  10886. }
  10887. }
  10888. }
  10889. };
  10890. this._onLostFocus = function () {
  10891. _this._keys = [];
  10892. pointers.empty();
  10893. previousPinchDistance = 0;
  10894. cacheSoloPointer = null;
  10895. };
  10896. this._onGestureStart = function (e) {
  10897. if (window.MSGesture === undefined) {
  10898. return;
  10899. }
  10900. if (!_this._MSGestureHandler) {
  10901. _this._MSGestureHandler = new MSGesture();
  10902. _this._MSGestureHandler.target = element;
  10903. }
  10904. _this._MSGestureHandler.addPointer(e.pointerId);
  10905. };
  10906. this._onGesture = function (e) {
  10907. _this.radius *= e.scale;
  10908. if (e.preventDefault) {
  10909. if (!noPreventDefault) {
  10910. e.stopPropagation();
  10911. e.preventDefault();
  10912. }
  10913. }
  10914. };
  10915. this._reset = function () {
  10916. _this._keys = [];
  10917. _this.inertialAlphaOffset = 0;
  10918. _this.inertialBetaOffset = 0;
  10919. _this.inertialRadiusOffset = 0;
  10920. pointers.empty();
  10921. previousPinchDistance = 0;
  10922. cacheSoloPointer = null;
  10923. };
  10924. }
  10925. if (!useCtrlForPanning) {
  10926. element.addEventListener("contextmenu", this._onContextMenu, false);
  10927. }
  10928. element.addEventListener(eventPrefix + "down", this._onPointerDown, false);
  10929. element.addEventListener(eventPrefix + "up", this._onPointerUp, false);
  10930. element.addEventListener(eventPrefix + "out", this._onPointerUp, false);
  10931. element.addEventListener(eventPrefix + "move", this._onPointerMove, false);
  10932. element.addEventListener("mousemove", this._onMouseMove, false);
  10933. element.addEventListener("MSPointerDown", this._onGestureStart, false);
  10934. element.addEventListener("MSGestureChange", this._onGesture, false);
  10935. element.addEventListener('mousewheel', this._wheel, false);
  10936. element.addEventListener('DOMMouseScroll', this._wheel, false);
  10937. BABYLON.Tools.RegisterTopRootEvents([
  10938. { name: "keydown", handler: this._onKeyDown },
  10939. { name: "keyup", handler: this._onKeyUp },
  10940. { name: "blur", handler: this._onLostFocus }
  10941. ]);
  10942. };
  10943. ArcRotateCamera.prototype.detachControl = function (element) {
  10944. if (this._attachedElement !== element) {
  10945. return;
  10946. }
  10947. element.removeEventListener("contextmenu", this._onContextMenu);
  10948. element.removeEventListener(eventPrefix + "down", this._onPointerDown);
  10949. element.removeEventListener(eventPrefix + "up", this._onPointerUp);
  10950. element.removeEventListener(eventPrefix + "out", this._onPointerUp);
  10951. element.removeEventListener(eventPrefix + "move", this._onPointerMove);
  10952. element.removeEventListener("mousemove", this._onMouseMove);
  10953. element.removeEventListener("MSPointerDown", this._onGestureStart);
  10954. element.removeEventListener("MSGestureChange", this._onGesture);
  10955. element.removeEventListener('mousewheel', this._wheel);
  10956. element.removeEventListener('DOMMouseScroll', this._wheel);
  10957. BABYLON.Tools.UnregisterTopRootEvents([
  10958. { name: "keydown", handler: this._onKeyDown },
  10959. { name: "keyup", handler: this._onKeyUp },
  10960. { name: "blur", handler: this._onLostFocus }
  10961. ]);
  10962. this._MSGestureHandler = null;
  10963. this._attachedElement = null;
  10964. if (this._reset) {
  10965. this._reset();
  10966. }
  10967. };
  10968. ArcRotateCamera.prototype._checkInputs = function () {
  10969. //if (async) collision inspection was triggered, don't update the camera's position - until the collision callback was called.
  10970. if (this._collisionTriggered) {
  10971. return;
  10972. }
  10973. // Keyboard
  10974. for (var index = 0; index < this._keys.length; index++) {
  10975. var keyCode = this._keys[index];
  10976. if (this.keysLeft.indexOf(keyCode) !== -1) {
  10977. this.inertialAlphaOffset -= 0.01;
  10978. }
  10979. else if (this.keysUp.indexOf(keyCode) !== -1) {
  10980. this.inertialBetaOffset -= 0.01;
  10981. }
  10982. else if (this.keysRight.indexOf(keyCode) !== -1) {
  10983. this.inertialAlphaOffset += 0.01;
  10984. }
  10985. else if (this.keysDown.indexOf(keyCode) !== -1) {
  10986. this.inertialBetaOffset += 0.01;
  10987. }
  10988. }
  10989. // Inertia
  10990. if (this.inertialAlphaOffset !== 0 || this.inertialBetaOffset !== 0 || this.inertialRadiusOffset != 0) {
  10991. this.alpha += this.beta <= 0 ? -this.inertialAlphaOffset : this.inertialAlphaOffset;
  10992. this.beta += this.inertialBetaOffset;
  10993. this.radius -= this.inertialRadiusOffset;
  10994. this.inertialAlphaOffset *= this.inertia;
  10995. this.inertialBetaOffset *= this.inertia;
  10996. this.inertialRadiusOffset *= this.inertia;
  10997. if (Math.abs(this.inertialAlphaOffset) < BABYLON.Engine.Epsilon)
  10998. this.inertialAlphaOffset = 0;
  10999. if (Math.abs(this.inertialBetaOffset) < BABYLON.Engine.Epsilon)
  11000. this.inertialBetaOffset = 0;
  11001. if (Math.abs(this.inertialRadiusOffset) < BABYLON.Engine.Epsilon)
  11002. this.inertialRadiusOffset = 0;
  11003. }
  11004. // Panning inertia
  11005. if (this.inertialPanningX !== 0 || this.inertialPanningY !== 0) {
  11006. if (!this._localDirection) {
  11007. this._localDirection = BABYLON.Vector3.Zero();
  11008. this._transformedDirection = BABYLON.Vector3.Zero();
  11009. }
  11010. this.inertialPanningX *= this.inertia;
  11011. this.inertialPanningY *= this.inertia;
  11012. if (Math.abs(this.inertialPanningX) < BABYLON.Engine.Epsilon)
  11013. this.inertialPanningX = 0;
  11014. if (Math.abs(this.inertialPanningY) < BABYLON.Engine.Epsilon)
  11015. this.inertialPanningY = 0;
  11016. this._localDirection.copyFromFloats(this.inertialPanningX, this.inertialPanningY, 0);
  11017. this._viewMatrix.invertToRef(this._cameraTransformMatrix);
  11018. BABYLON.Vector3.TransformNormalToRef(this._localDirection, this._cameraTransformMatrix, this._transformedDirection);
  11019. this.target.addInPlace(this._transformedDirection);
  11020. }
  11021. // Limits
  11022. this._checkLimits();
  11023. _super.prototype._checkInputs.call(this);
  11024. };
  11025. ArcRotateCamera.prototype._checkLimits = function () {
  11026. if (this.lowerBetaLimit === null || this.lowerBetaLimit === undefined) {
  11027. if (this.allowUpsideDown && this.beta > Math.PI) {
  11028. this.beta = this.beta - (2 * Math.PI);
  11029. }
  11030. }
  11031. else {
  11032. if (this.beta < this.lowerBetaLimit) {
  11033. this.beta = this.lowerBetaLimit;
  11034. }
  11035. }
  11036. if (this.upperBetaLimit === null || this.upperBetaLimit === undefined) {
  11037. if (this.allowUpsideDown && this.beta < -Math.PI) {
  11038. this.beta = this.beta + (2 * Math.PI);
  11039. }
  11040. }
  11041. else {
  11042. if (this.beta > this.upperBetaLimit) {
  11043. this.beta = this.upperBetaLimit;
  11044. }
  11045. }
  11046. if (this.lowerAlphaLimit && this.alpha < this.lowerAlphaLimit) {
  11047. this.alpha = this.lowerAlphaLimit;
  11048. }
  11049. if (this.upperAlphaLimit && this.alpha > this.upperAlphaLimit) {
  11050. this.alpha = this.upperAlphaLimit;
  11051. }
  11052. if (this.lowerRadiusLimit && this.radius < this.lowerRadiusLimit) {
  11053. this.radius = this.lowerRadiusLimit;
  11054. }
  11055. if (this.upperRadiusLimit && this.radius > this.upperRadiusLimit) {
  11056. this.radius = this.upperRadiusLimit;
  11057. }
  11058. };
  11059. ArcRotateCamera.prototype.setPosition = function (position) {
  11060. var radiusv3 = position.subtract(this._getTargetPosition());
  11061. this.radius = radiusv3.length();
  11062. // Alpha
  11063. this.alpha = Math.acos(radiusv3.x / Math.sqrt(Math.pow(radiusv3.x, 2) + Math.pow(radiusv3.z, 2)));
  11064. if (radiusv3.z < 0) {
  11065. this.alpha = 2 * Math.PI - this.alpha;
  11066. }
  11067. // Beta
  11068. this.beta = Math.acos(radiusv3.y / this.radius);
  11069. this._checkLimits();
  11070. };
  11071. ArcRotateCamera.prototype.setTarget = function (target) {
  11072. this.target = target;
  11073. };
  11074. ArcRotateCamera.prototype._getViewMatrix = function () {
  11075. // Compute
  11076. var cosa = Math.cos(this.alpha);
  11077. var sina = Math.sin(this.alpha);
  11078. var cosb = Math.cos(this.beta);
  11079. var sinb = Math.sin(this.beta);
  11080. var target = this._getTargetPosition();
  11081. target.addToRef(new BABYLON.Vector3(this.radius * cosa * sinb, this.radius * cosb, this.radius * sina * sinb), this._newPosition);
  11082. if (this.getScene().collisionsEnabled && this.checkCollisions) {
  11083. this._collider.radius = this.collisionRadius;
  11084. this._newPosition.subtractToRef(this.position, this._collisionVelocity);
  11085. this._collisionTriggered = true;
  11086. this.getScene().collisionCoordinator.getNewPosition(this.position, this._collisionVelocity, this._collider, 3, null, this._onCollisionPositionChange, this.uniqueId);
  11087. }
  11088. else {
  11089. this.position.copyFrom(this._newPosition);
  11090. var up = this.upVector;
  11091. if (this.allowUpsideDown && this.beta < 0) {
  11092. var up = up.clone();
  11093. up = up.negate();
  11094. }
  11095. BABYLON.Matrix.LookAtLHToRef(this.position, target, up, this._viewMatrix);
  11096. this._viewMatrix.m[12] += this.targetScreenOffset.x;
  11097. this._viewMatrix.m[13] += this.targetScreenOffset.y;
  11098. }
  11099. return this._viewMatrix;
  11100. };
  11101. ArcRotateCamera.prototype.zoomOn = function (meshes, doNotUpdateMaxZ) {
  11102. if (doNotUpdateMaxZ === void 0) { doNotUpdateMaxZ = false; }
  11103. meshes = meshes || this.getScene().meshes;
  11104. var minMaxVector = BABYLON.Mesh.MinMax(meshes);
  11105. var distance = BABYLON.Vector3.Distance(minMaxVector.min, minMaxVector.max);
  11106. this.radius = distance * this.zoomOnFactor;
  11107. this.focusOn({ min: minMaxVector.min, max: minMaxVector.max, distance: distance }, doNotUpdateMaxZ);
  11108. };
  11109. ArcRotateCamera.prototype.focusOn = function (meshesOrMinMaxVectorAndDistance, doNotUpdateMaxZ) {
  11110. if (doNotUpdateMaxZ === void 0) { doNotUpdateMaxZ = false; }
  11111. var meshesOrMinMaxVector;
  11112. var distance;
  11113. if (meshesOrMinMaxVectorAndDistance.min === undefined) {
  11114. meshesOrMinMaxVector = meshesOrMinMaxVectorAndDistance || this.getScene().meshes;
  11115. meshesOrMinMaxVector = BABYLON.Mesh.MinMax(meshesOrMinMaxVector);
  11116. distance = BABYLON.Vector3.Distance(meshesOrMinMaxVector.min, meshesOrMinMaxVector.max);
  11117. }
  11118. else {
  11119. meshesOrMinMaxVector = meshesOrMinMaxVectorAndDistance;
  11120. distance = meshesOrMinMaxVectorAndDistance.distance;
  11121. }
  11122. this.target = BABYLON.Mesh.Center(meshesOrMinMaxVector);
  11123. if (!doNotUpdateMaxZ) {
  11124. this.maxZ = distance * 2;
  11125. }
  11126. };
  11127. /**
  11128. * @override
  11129. * Override Camera.createRigCamera
  11130. */
  11131. ArcRotateCamera.prototype.createRigCamera = function (name, cameraIndex) {
  11132. switch (this.cameraRigMode) {
  11133. case BABYLON.Camera.RIG_MODE_STEREOSCOPIC_ANAGLYPH:
  11134. case BABYLON.Camera.RIG_MODE_STEREOSCOPIC_SIDEBYSIDE_PARALLEL:
  11135. case BABYLON.Camera.RIG_MODE_STEREOSCOPIC_SIDEBYSIDE_CROSSEYED:
  11136. case BABYLON.Camera.RIG_MODE_STEREOSCOPIC_OVERUNDER:
  11137. case BABYLON.Camera.RIG_MODE_VR:
  11138. var alphaShift = this._cameraRigParams.stereoHalfAngle * (cameraIndex === 0 ? 1 : -1);
  11139. return new ArcRotateCamera(name, this.alpha + alphaShift, this.beta, this.radius, this.target, this.getScene());
  11140. }
  11141. };
  11142. /**
  11143. * @override
  11144. * Override Camera._updateRigCameras
  11145. */
  11146. ArcRotateCamera.prototype._updateRigCameras = function () {
  11147. switch (this.cameraRigMode) {
  11148. case BABYLON.Camera.RIG_MODE_STEREOSCOPIC_ANAGLYPH:
  11149. case BABYLON.Camera.RIG_MODE_STEREOSCOPIC_SIDEBYSIDE_PARALLEL:
  11150. case BABYLON.Camera.RIG_MODE_STEREOSCOPIC_SIDEBYSIDE_CROSSEYED:
  11151. case BABYLON.Camera.RIG_MODE_STEREOSCOPIC_OVERUNDER:
  11152. case BABYLON.Camera.RIG_MODE_VR:
  11153. var camLeft = this._rigCameras[0];
  11154. var camRight = this._rigCameras[1];
  11155. camLeft.alpha = this.alpha - this._cameraRigParams.stereoHalfAngle;
  11156. camRight.alpha = this.alpha + this._cameraRigParams.stereoHalfAngle;
  11157. camLeft.beta = camRight.beta = this.beta;
  11158. camLeft.radius = camRight.radius = this.radius;
  11159. break;
  11160. }
  11161. _super.prototype._updateRigCameras.call(this);
  11162. };
  11163. return ArcRotateCamera;
  11164. })(BABYLON.TargetCamera);
  11165. BABYLON.ArcRotateCamera = ArcRotateCamera;
  11166. })(BABYLON || (BABYLON = {}));
  11167. var BABYLON;
  11168. (function (BABYLON) {
  11169. var RenderingManager = (function () {
  11170. function RenderingManager(scene) {
  11171. this._renderingGroups = new Array();
  11172. this._scene = scene;
  11173. }
  11174. RenderingManager.prototype._renderParticles = function (index, activeMeshes) {
  11175. if (this._scene._activeParticleSystems.length === 0) {
  11176. return;
  11177. }
  11178. // Particles
  11179. var activeCamera = this._scene.activeCamera;
  11180. var beforeParticlesDate = BABYLON.Tools.Now;
  11181. for (var particleIndex = 0; particleIndex < this._scene._activeParticleSystems.length; particleIndex++) {
  11182. var particleSystem = this._scene._activeParticleSystems.data[particleIndex];
  11183. if (particleSystem.renderingGroupId !== index) {
  11184. continue;
  11185. }
  11186. if ((activeCamera.layerMask & particleSystem.layerMask) === 0) {
  11187. continue;
  11188. }
  11189. this._clearDepthBuffer();
  11190. if (!particleSystem.emitter.position || !activeMeshes || activeMeshes.indexOf(particleSystem.emitter) !== -1) {
  11191. this._scene._activeParticles += particleSystem.render();
  11192. }
  11193. }
  11194. this._scene._particlesDuration += BABYLON.Tools.Now - beforeParticlesDate;
  11195. };
  11196. RenderingManager.prototype._renderSprites = function (index) {
  11197. if (!this._scene.spritesEnabled || this._scene.spriteManagers.length === 0) {
  11198. return;
  11199. }
  11200. // Sprites
  11201. var activeCamera = this._scene.activeCamera;
  11202. var beforeSpritessDate = BABYLON.Tools.Now;
  11203. for (var id = 0; id < this._scene.spriteManagers.length; id++) {
  11204. var spriteManager = this._scene.spriteManagers[id];
  11205. if (spriteManager.renderingGroupId === index && ((activeCamera.layerMask & spriteManager.layerMask) !== 0)) {
  11206. this._clearDepthBuffer();
  11207. spriteManager.render();
  11208. }
  11209. }
  11210. this._scene._spritesDuration += BABYLON.Tools.Now - beforeSpritessDate;
  11211. };
  11212. RenderingManager.prototype._clearDepthBuffer = function () {
  11213. if (this._depthBufferAlreadyCleaned) {
  11214. return;
  11215. }
  11216. this._scene.getEngine().clear(0, false, true);
  11217. this._depthBufferAlreadyCleaned = true;
  11218. };
  11219. RenderingManager.prototype._renderSpritesAndParticles = function () {
  11220. if (this._currentRenderSprites) {
  11221. this._renderSprites(this._currentIndex);
  11222. }
  11223. if (this._currentRenderParticles) {
  11224. this._renderParticles(this._currentIndex, this._currentActiveMeshes);
  11225. }
  11226. };
  11227. RenderingManager.prototype.render = function (customRenderFunction, activeMeshes, renderParticles, renderSprites) {
  11228. this._currentActiveMeshes = activeMeshes;
  11229. this._currentRenderParticles = renderParticles;
  11230. this._currentRenderSprites = renderSprites;
  11231. for (var index = 0; index < RenderingManager.MAX_RENDERINGGROUPS; index++) {
  11232. this._depthBufferAlreadyCleaned = false;
  11233. var renderingGroup = this._renderingGroups[index];
  11234. var needToStepBack = false;
  11235. this._currentIndex = index;
  11236. if (renderingGroup) {
  11237. this._clearDepthBuffer();
  11238. if (!renderingGroup.onBeforeTransparentRendering) {
  11239. renderingGroup.onBeforeTransparentRendering = this._renderSpritesAndParticles.bind(this);
  11240. }
  11241. if (!renderingGroup.render(customRenderFunction)) {
  11242. this._renderingGroups.splice(index, 1);
  11243. needToStepBack = true;
  11244. this._renderSpritesAndParticles();
  11245. }
  11246. }
  11247. else {
  11248. this._renderSpritesAndParticles();
  11249. }
  11250. if (needToStepBack) {
  11251. index--;
  11252. }
  11253. }
  11254. };
  11255. RenderingManager.prototype.reset = function () {
  11256. this._renderingGroups.forEach(function (renderingGroup, index, array) {
  11257. if (renderingGroup) {
  11258. renderingGroup.prepare();
  11259. }
  11260. });
  11261. };
  11262. RenderingManager.prototype.dispatch = function (subMesh) {
  11263. var mesh = subMesh.getMesh();
  11264. var renderingGroupId = mesh.renderingGroupId || 0;
  11265. if (!this._renderingGroups[renderingGroupId]) {
  11266. this._renderingGroups[renderingGroupId] = new BABYLON.RenderingGroup(renderingGroupId, this._scene);
  11267. }
  11268. this._renderingGroups[renderingGroupId].dispatch(subMesh);
  11269. };
  11270. RenderingManager.MAX_RENDERINGGROUPS = 4;
  11271. return RenderingManager;
  11272. })();
  11273. BABYLON.RenderingManager = RenderingManager;
  11274. })(BABYLON || (BABYLON = {}));
  11275. var BABYLON;
  11276. (function (BABYLON) {
  11277. var RenderingGroup = (function () {
  11278. function RenderingGroup(index, scene) {
  11279. this.index = index;
  11280. this._opaqueSubMeshes = new BABYLON.SmartArray(256);
  11281. this._transparentSubMeshes = new BABYLON.SmartArray(256);
  11282. this._alphaTestSubMeshes = new BABYLON.SmartArray(256);
  11283. this._scene = scene;
  11284. }
  11285. RenderingGroup.prototype.render = function (customRenderFunction) {
  11286. if (customRenderFunction) {
  11287. customRenderFunction(this._opaqueSubMeshes, this._alphaTestSubMeshes, this._transparentSubMeshes);
  11288. return true;
  11289. }
  11290. if (this._opaqueSubMeshes.length === 0 && this._alphaTestSubMeshes.length === 0 && this._transparentSubMeshes.length === 0) {
  11291. if (this.onBeforeTransparentRendering) {
  11292. this.onBeforeTransparentRendering();
  11293. }
  11294. return false;
  11295. }
  11296. var engine = this._scene.getEngine();
  11297. // Opaque
  11298. var subIndex;
  11299. var submesh;
  11300. for (subIndex = 0; subIndex < this._opaqueSubMeshes.length; subIndex++) {
  11301. submesh = this._opaqueSubMeshes.data[subIndex];
  11302. submesh.render(false);
  11303. }
  11304. // Alpha test
  11305. engine.setAlphaTesting(true);
  11306. for (subIndex = 0; subIndex < this._alphaTestSubMeshes.length; subIndex++) {
  11307. submesh = this._alphaTestSubMeshes.data[subIndex];
  11308. submesh.render(false);
  11309. }
  11310. engine.setAlphaTesting(false);
  11311. if (this.onBeforeTransparentRendering) {
  11312. this.onBeforeTransparentRendering();
  11313. }
  11314. // Transparent
  11315. if (this._transparentSubMeshes.length) {
  11316. // Sorting
  11317. for (subIndex = 0; subIndex < this._transparentSubMeshes.length; subIndex++) {
  11318. submesh = this._transparentSubMeshes.data[subIndex];
  11319. submesh._alphaIndex = submesh.getMesh().alphaIndex;
  11320. submesh._distanceToCamera = submesh.getBoundingInfo().boundingSphere.centerWorld.subtract(this._scene.activeCamera.globalPosition).length();
  11321. }
  11322. var sortedArray = this._transparentSubMeshes.data.slice(0, this._transparentSubMeshes.length);
  11323. sortedArray.sort(function (a, b) {
  11324. // Alpha index first
  11325. if (a._alphaIndex > b._alphaIndex) {
  11326. return 1;
  11327. }
  11328. if (a._alphaIndex < b._alphaIndex) {
  11329. return -1;
  11330. }
  11331. // Then distance to camera
  11332. if (a._distanceToCamera < b._distanceToCamera) {
  11333. return 1;
  11334. }
  11335. if (a._distanceToCamera > b._distanceToCamera) {
  11336. return -1;
  11337. }
  11338. return 0;
  11339. });
  11340. // Rendering
  11341. for (subIndex = 0; subIndex < sortedArray.length; subIndex++) {
  11342. submesh = sortedArray[subIndex];
  11343. submesh.render(true);
  11344. }
  11345. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  11346. }
  11347. return true;
  11348. };
  11349. RenderingGroup.prototype.prepare = function () {
  11350. this._opaqueSubMeshes.reset();
  11351. this._transparentSubMeshes.reset();
  11352. this._alphaTestSubMeshes.reset();
  11353. };
  11354. RenderingGroup.prototype.dispatch = function (subMesh) {
  11355. var material = subMesh.getMaterial();
  11356. var mesh = subMesh.getMesh();
  11357. if (material.needAlphaBlending() || mesh.visibility < 1.0 || mesh.hasVertexAlpha) {
  11358. this._transparentSubMeshes.push(subMesh);
  11359. }
  11360. else if (material.needAlphaTesting()) {
  11361. this._alphaTestSubMeshes.push(subMesh);
  11362. }
  11363. else {
  11364. this._opaqueSubMeshes.push(subMesh); // Opaque
  11365. }
  11366. };
  11367. return RenderingGroup;
  11368. })();
  11369. BABYLON.RenderingGroup = RenderingGroup;
  11370. })(BABYLON || (BABYLON = {}));
  11371. var BABYLON;
  11372. (function (BABYLON) {
  11373. /**
  11374. * Represents a scene to be rendered by the engine.
  11375. * @see http://doc.babylonjs.com/page.php?p=21911
  11376. */
  11377. var Scene = (function () {
  11378. /**
  11379. * @constructor
  11380. * @param {BABYLON.Engine} engine - the engine to be used to render this scene.
  11381. */
  11382. function Scene(engine) {
  11383. // Members
  11384. this.autoClear = true;
  11385. this.clearColor = new BABYLON.Color3(0.2, 0.2, 0.3);
  11386. this.ambientColor = new BABYLON.Color3(0, 0, 0);
  11387. this.forceWireframe = false;
  11388. this.forcePointsCloud = false;
  11389. this.forceShowBoundingBoxes = false;
  11390. this.animationsEnabled = true;
  11391. this.constantlyUpdateMeshUnderPointer = false;
  11392. this.cameraToUseForPointers = null; // Define this parameter if you are using multiple cameras and you want to specify which one should be used for pointer position
  11393. // Fog
  11394. /**
  11395. * is fog enabled on this scene.
  11396. * @type {boolean}
  11397. */
  11398. this.fogEnabled = true;
  11399. this.fogMode = Scene.FOGMODE_NONE;
  11400. this.fogColor = new BABYLON.Color3(0.2, 0.2, 0.3);
  11401. this.fogDensity = 0.1;
  11402. this.fogStart = 0;
  11403. this.fogEnd = 1000.0;
  11404. // Lights
  11405. /**
  11406. * is shadow enabled on this scene.
  11407. * @type {boolean}
  11408. */
  11409. this.shadowsEnabled = true;
  11410. /**
  11411. * is light enabled on this scene.
  11412. * @type {boolean}
  11413. */
  11414. this.lightsEnabled = true;
  11415. /**
  11416. * All of the lights added to this scene.
  11417. * @see BABYLON.Light
  11418. * @type {BABYLON.Light[]}
  11419. */
  11420. this.lights = new Array();
  11421. // Cameras
  11422. /**
  11423. * All of the cameras added to this scene.
  11424. * @see BABYLON.Camera
  11425. * @type {BABYLON.Camera[]}
  11426. */
  11427. this.cameras = new Array();
  11428. this.activeCameras = new Array();
  11429. // Meshes
  11430. /**
  11431. * All of the (abstract) meshes added to this scene.
  11432. * @see BABYLON.AbstractMesh
  11433. * @type {BABYLON.AbstractMesh[]}
  11434. */
  11435. this.meshes = new Array();
  11436. // Geometries
  11437. this._geometries = new Array();
  11438. this.materials = new Array();
  11439. this.multiMaterials = new Array();
  11440. this.defaultMaterial = new BABYLON.StandardMaterial("default material", this);
  11441. // Textures
  11442. this.texturesEnabled = true;
  11443. this.textures = new Array();
  11444. // Particles
  11445. this.particlesEnabled = true;
  11446. this.particleSystems = new Array();
  11447. // Sprites
  11448. this.spritesEnabled = true;
  11449. this.spriteManagers = new Array();
  11450. // Layers
  11451. this.layers = new Array();
  11452. // Skeletons
  11453. this.skeletonsEnabled = true;
  11454. this.skeletons = new Array();
  11455. // Lens flares
  11456. this.lensFlaresEnabled = true;
  11457. this.lensFlareSystems = new Array();
  11458. // Collisions
  11459. this.collisionsEnabled = true;
  11460. this.gravity = new BABYLON.Vector3(0, -9.807, 0);
  11461. // Postprocesses
  11462. this.postProcessesEnabled = true;
  11463. // Customs render targets
  11464. this.renderTargetsEnabled = true;
  11465. this.dumpNextRenderTargets = false;
  11466. this.customRenderTargets = new Array();
  11467. // Imported meshes
  11468. this.importedMeshesFiles = new Array();
  11469. // Probes
  11470. this.probesEnabled = true;
  11471. this.reflectionProbes = new Array();
  11472. this._actionManagers = new Array();
  11473. this._meshesForIntersections = new BABYLON.SmartArray(256);
  11474. // Procedural textures
  11475. this.proceduralTexturesEnabled = true;
  11476. this._proceduralTextures = new Array();
  11477. this.soundTracks = new Array();
  11478. this._audioEnabled = true;
  11479. this._headphone = false;
  11480. this._totalVertices = 0;
  11481. this._activeIndices = 0;
  11482. this._activeParticles = 0;
  11483. this._lastFrameDuration = 0;
  11484. this._evaluateActiveMeshesDuration = 0;
  11485. this._renderTargetsDuration = 0;
  11486. this._particlesDuration = 0;
  11487. this._renderDuration = 0;
  11488. this._spritesDuration = 0;
  11489. this._animationRatio = 0;
  11490. this._renderId = 0;
  11491. this._executeWhenReadyTimeoutId = -1;
  11492. this._toBeDisposed = new BABYLON.SmartArray(256);
  11493. this._onReadyCallbacks = new Array();
  11494. this._pendingData = []; //ANY
  11495. this._onBeforeRenderCallbacks = new Array();
  11496. this._onAfterRenderCallbacks = new Array();
  11497. this._activeMeshes = new BABYLON.SmartArray(256);
  11498. this._processedMaterials = new BABYLON.SmartArray(256);
  11499. this._renderTargets = new BABYLON.SmartArray(256);
  11500. this._activeParticleSystems = new BABYLON.SmartArray(256);
  11501. this._activeSkeletons = new BABYLON.SmartArray(32);
  11502. this._softwareSkinnedMeshes = new BABYLON.SmartArray(32);
  11503. this._activeBones = 0;
  11504. this._activeAnimatables = new Array();
  11505. this._transformMatrix = BABYLON.Matrix.Zero();
  11506. this._edgesRenderers = new BABYLON.SmartArray(16);
  11507. this._uniqueIdCounter = 0;
  11508. this._engine = engine;
  11509. engine.scenes.push(this);
  11510. this._renderingManager = new BABYLON.RenderingManager(this);
  11511. this.postProcessManager = new BABYLON.PostProcessManager(this);
  11512. this.postProcessRenderPipelineManager = new BABYLON.PostProcessRenderPipelineManager();
  11513. this._boundingBoxRenderer = new BABYLON.BoundingBoxRenderer(this);
  11514. if (BABYLON.OutlineRenderer) {
  11515. this._outlineRenderer = new BABYLON.OutlineRenderer(this);
  11516. }
  11517. this.attachControl();
  11518. this._debugLayer = new BABYLON.DebugLayer(this);
  11519. if (BABYLON.SoundTrack) {
  11520. this.mainSoundTrack = new BABYLON.SoundTrack(this, { mainTrack: true });
  11521. }
  11522. //simplification queue
  11523. if (BABYLON.SimplificationQueue) {
  11524. this.simplificationQueue = new BABYLON.SimplificationQueue();
  11525. }
  11526. //collision coordinator initialization. For now legacy per default.
  11527. this.workerCollisions = false; //(!!Worker && (!!BABYLON.CollisionWorker || BABYLON.WorkerIncluded));
  11528. }
  11529. Object.defineProperty(Scene, "FOGMODE_NONE", {
  11530. get: function () {
  11531. return Scene._FOGMODE_NONE;
  11532. },
  11533. enumerable: true,
  11534. configurable: true
  11535. });
  11536. Object.defineProperty(Scene, "FOGMODE_EXP", {
  11537. get: function () {
  11538. return Scene._FOGMODE_EXP;
  11539. },
  11540. enumerable: true,
  11541. configurable: true
  11542. });
  11543. Object.defineProperty(Scene, "FOGMODE_EXP2", {
  11544. get: function () {
  11545. return Scene._FOGMODE_EXP2;
  11546. },
  11547. enumerable: true,
  11548. configurable: true
  11549. });
  11550. Object.defineProperty(Scene, "FOGMODE_LINEAR", {
  11551. get: function () {
  11552. return Scene._FOGMODE_LINEAR;
  11553. },
  11554. enumerable: true,
  11555. configurable: true
  11556. });
  11557. Object.defineProperty(Scene.prototype, "debugLayer", {
  11558. // Properties
  11559. get: function () {
  11560. return this._debugLayer;
  11561. },
  11562. enumerable: true,
  11563. configurable: true
  11564. });
  11565. Object.defineProperty(Scene.prototype, "workerCollisions", {
  11566. get: function () {
  11567. return this._workerCollisions;
  11568. },
  11569. set: function (enabled) {
  11570. enabled = (enabled && !!Worker);
  11571. this._workerCollisions = enabled;
  11572. if (this.collisionCoordinator) {
  11573. this.collisionCoordinator.destroy();
  11574. }
  11575. this.collisionCoordinator = enabled ? new BABYLON.CollisionCoordinatorWorker() : new BABYLON.CollisionCoordinatorLegacy();
  11576. this.collisionCoordinator.init(this);
  11577. },
  11578. enumerable: true,
  11579. configurable: true
  11580. });
  11581. Object.defineProperty(Scene.prototype, "SelectionOctree", {
  11582. get: function () {
  11583. return this._selectionOctree;
  11584. },
  11585. enumerable: true,
  11586. configurable: true
  11587. });
  11588. Object.defineProperty(Scene.prototype, "meshUnderPointer", {
  11589. /**
  11590. * The mesh that is currently under the pointer.
  11591. * @return {BABYLON.AbstractMesh} mesh under the pointer/mouse cursor or null if none.
  11592. */
  11593. get: function () {
  11594. return this._meshUnderPointer;
  11595. },
  11596. enumerable: true,
  11597. configurable: true
  11598. });
  11599. Object.defineProperty(Scene.prototype, "pointerX", {
  11600. /**
  11601. * Current on-screen X position of the pointer
  11602. * @return {number} X position of the pointer
  11603. */
  11604. get: function () {
  11605. return this._pointerX;
  11606. },
  11607. enumerable: true,
  11608. configurable: true
  11609. });
  11610. Object.defineProperty(Scene.prototype, "pointerY", {
  11611. /**
  11612. * Current on-screen Y position of the pointer
  11613. * @return {number} Y position of the pointer
  11614. */
  11615. get: function () {
  11616. return this._pointerY;
  11617. },
  11618. enumerable: true,
  11619. configurable: true
  11620. });
  11621. Scene.prototype.getCachedMaterial = function () {
  11622. return this._cachedMaterial;
  11623. };
  11624. Scene.prototype.getBoundingBoxRenderer = function () {
  11625. return this._boundingBoxRenderer;
  11626. };
  11627. Scene.prototype.getOutlineRenderer = function () {
  11628. return this._outlineRenderer;
  11629. };
  11630. Scene.prototype.getEngine = function () {
  11631. return this._engine;
  11632. };
  11633. Scene.prototype.getTotalVertices = function () {
  11634. return this._totalVertices;
  11635. };
  11636. Scene.prototype.getActiveIndices = function () {
  11637. return this._activeIndices;
  11638. };
  11639. Scene.prototype.getActiveParticles = function () {
  11640. return this._activeParticles;
  11641. };
  11642. Scene.prototype.getActiveBones = function () {
  11643. return this._activeBones;
  11644. };
  11645. // Stats
  11646. Scene.prototype.getLastFrameDuration = function () {
  11647. return this._lastFrameDuration;
  11648. };
  11649. Scene.prototype.getEvaluateActiveMeshesDuration = function () {
  11650. return this._evaluateActiveMeshesDuration;
  11651. };
  11652. Scene.prototype.getActiveMeshes = function () {
  11653. return this._activeMeshes;
  11654. };
  11655. Scene.prototype.getRenderTargetsDuration = function () {
  11656. return this._renderTargetsDuration;
  11657. };
  11658. Scene.prototype.getRenderDuration = function () {
  11659. return this._renderDuration;
  11660. };
  11661. Scene.prototype.getParticlesDuration = function () {
  11662. return this._particlesDuration;
  11663. };
  11664. Scene.prototype.getSpritesDuration = function () {
  11665. return this._spritesDuration;
  11666. };
  11667. Scene.prototype.getAnimationRatio = function () {
  11668. return this._animationRatio;
  11669. };
  11670. Scene.prototype.getRenderId = function () {
  11671. return this._renderId;
  11672. };
  11673. Scene.prototype.incrementRenderId = function () {
  11674. this._renderId++;
  11675. };
  11676. Scene.prototype._updatePointerPosition = function (evt) {
  11677. var canvasRect = this._engine.getRenderingCanvasClientRect();
  11678. this._pointerX = evt.clientX - canvasRect.left;
  11679. this._pointerY = evt.clientY - canvasRect.top;
  11680. if (this.cameraToUseForPointers) {
  11681. this._pointerX = this._pointerX - this.cameraToUseForPointers.viewport.x * this._engine.getRenderWidth();
  11682. this._pointerY = this._pointerY - this.cameraToUseForPointers.viewport.y * this._engine.getRenderHeight();
  11683. }
  11684. };
  11685. // Pointers handling
  11686. Scene.prototype.attachControl = function () {
  11687. var _this = this;
  11688. var spritePredicate = function (sprite) {
  11689. return sprite.isPickable && sprite.actionManager && sprite.actionManager.hasPickTriggers;
  11690. };
  11691. this._onPointerMove = function (evt) {
  11692. var canvas = _this._engine.getRenderingCanvas();
  11693. _this._updatePointerPosition(evt);
  11694. // Meshes
  11695. var pickResult = _this.pick(_this._pointerX, _this._pointerY, function (mesh) { return mesh.isPickable && mesh.isVisible && mesh.isReady() && (_this.constantlyUpdateMeshUnderPointer || mesh.actionManager !== null && mesh.actionManager !== undefined); }, false, _this.cameraToUseForPointers);
  11696. if (pickResult.hit && pickResult.pickedMesh) {
  11697. _this._meshUnderPointer = pickResult.pickedMesh;
  11698. _this.setPointerOverMesh(pickResult.pickedMesh);
  11699. if (_this._meshUnderPointer.actionManager && _this._meshUnderPointer.actionManager.hasPointerTriggers) {
  11700. canvas.style.cursor = "pointer";
  11701. }
  11702. else {
  11703. canvas.style.cursor = "";
  11704. }
  11705. }
  11706. else {
  11707. // Sprites
  11708. pickResult = _this.pickSprite(_this._pointerX, _this._pointerY, spritePredicate, false, _this.cameraToUseForPointers);
  11709. if (pickResult.hit && pickResult.pickedSprite) {
  11710. canvas.style.cursor = "pointer";
  11711. return;
  11712. }
  11713. // Restore pointer
  11714. _this.setPointerOverMesh(null);
  11715. canvas.style.cursor = "";
  11716. _this._meshUnderPointer = null;
  11717. }
  11718. };
  11719. this._onPointerDown = function (evt) {
  11720. _this._updatePointerPosition(evt);
  11721. var predicate = null;
  11722. // Meshes
  11723. if (!_this.onPointerDown) {
  11724. predicate = function (mesh) {
  11725. return mesh.isPickable && mesh.isVisible && mesh.isReady() && mesh.actionManager && mesh.actionManager.hasPickTriggers;
  11726. };
  11727. }
  11728. var pickResult = _this.pick(_this._pointerX, _this._pointerY, predicate, false, _this.cameraToUseForPointers);
  11729. if (pickResult.hit && pickResult.pickedMesh) {
  11730. if (pickResult.pickedMesh.actionManager) {
  11731. switch (evt.button) {
  11732. case 0:
  11733. pickResult.pickedMesh.actionManager.processTrigger(BABYLON.ActionManager.OnLeftPickTrigger, BABYLON.ActionEvent.CreateNew(pickResult.pickedMesh, evt));
  11734. break;
  11735. case 1:
  11736. pickResult.pickedMesh.actionManager.processTrigger(BABYLON.ActionManager.OnCenterPickTrigger, BABYLON.ActionEvent.CreateNew(pickResult.pickedMesh, evt));
  11737. break;
  11738. case 2:
  11739. pickResult.pickedMesh.actionManager.processTrigger(BABYLON.ActionManager.OnRightPickTrigger, BABYLON.ActionEvent.CreateNew(pickResult.pickedMesh, evt));
  11740. break;
  11741. }
  11742. pickResult.pickedMesh.actionManager.processTrigger(BABYLON.ActionManager.OnPickTrigger, BABYLON.ActionEvent.CreateNew(pickResult.pickedMesh, evt));
  11743. }
  11744. }
  11745. if (_this.onPointerDown) {
  11746. _this.onPointerDown(evt, pickResult);
  11747. }
  11748. // Sprites
  11749. if (_this.spriteManagers.length > 0) {
  11750. pickResult = _this.pickSprite(_this._pointerX, _this._pointerY, spritePredicate, false, _this.cameraToUseForPointers);
  11751. if (pickResult.hit && pickResult.pickedSprite) {
  11752. if (pickResult.pickedSprite.actionManager) {
  11753. switch (evt.button) {
  11754. case 0:
  11755. pickResult.pickedSprite.actionManager.processTrigger(BABYLON.ActionManager.OnLeftPickTrigger, BABYLON.ActionEvent.CreateNewFromSprite(pickResult.pickedSprite, _this, evt));
  11756. break;
  11757. case 1:
  11758. pickResult.pickedSprite.actionManager.processTrigger(BABYLON.ActionManager.OnCenterPickTrigger, BABYLON.ActionEvent.CreateNewFromSprite(pickResult.pickedSprite, _this, evt));
  11759. break;
  11760. case 2:
  11761. pickResult.pickedSprite.actionManager.processTrigger(BABYLON.ActionManager.OnRightPickTrigger, BABYLON.ActionEvent.CreateNewFromSprite(pickResult.pickedSprite, _this, evt));
  11762. break;
  11763. }
  11764. pickResult.pickedSprite.actionManager.processTrigger(BABYLON.ActionManager.OnPickTrigger, BABYLON.ActionEvent.CreateNewFromSprite(pickResult.pickedSprite, _this, evt));
  11765. }
  11766. }
  11767. }
  11768. };
  11769. this._onPointerUp = function (evt) {
  11770. var predicate = null;
  11771. _this._updatePointerPosition(evt);
  11772. if (!_this.onPointerUp) {
  11773. predicate = function (mesh) {
  11774. return mesh.isPickable && mesh.isVisible && mesh.isReady() && mesh.actionManager && mesh.actionManager.hasSpecificTrigger(BABYLON.ActionManager.OnPickUpTrigger);
  11775. };
  11776. }
  11777. // Meshes
  11778. var pickResult = _this.pick(_this._pointerX, _this._pointerY, predicate, false, _this.cameraToUseForPointers);
  11779. if (pickResult.hit && pickResult.pickedMesh) {
  11780. if (pickResult.pickedMesh.actionManager) {
  11781. pickResult.pickedMesh.actionManager.processTrigger(BABYLON.ActionManager.OnPickUpTrigger, BABYLON.ActionEvent.CreateNew(pickResult.pickedMesh, evt));
  11782. }
  11783. }
  11784. if (_this.onPointerUp) {
  11785. _this.onPointerUp(evt, pickResult);
  11786. }
  11787. // Sprites
  11788. if (_this.spriteManagers.length > 0) {
  11789. pickResult = _this.pickSprite(_this._pointerX, _this._pointerY, spritePredicate, false, _this.cameraToUseForPointers);
  11790. if (pickResult.hit && pickResult.pickedSprite) {
  11791. if (pickResult.pickedSprite.actionManager) {
  11792. pickResult.pickedSprite.actionManager.processTrigger(BABYLON.ActionManager.OnPickUpTrigger, BABYLON.ActionEvent.CreateNewFromSprite(pickResult.pickedSprite, _this, evt));
  11793. }
  11794. }
  11795. }
  11796. };
  11797. this._onKeyDown = function (evt) {
  11798. if (_this.actionManager) {
  11799. _this.actionManager.processTrigger(BABYLON.ActionManager.OnKeyDownTrigger, BABYLON.ActionEvent.CreateNewFromScene(_this, evt));
  11800. }
  11801. };
  11802. this._onKeyUp = function (evt) {
  11803. if (_this.actionManager) {
  11804. _this.actionManager.processTrigger(BABYLON.ActionManager.OnKeyUpTrigger, BABYLON.ActionEvent.CreateNewFromScene(_this, evt));
  11805. }
  11806. };
  11807. var eventPrefix = BABYLON.Tools.GetPointerPrefix();
  11808. this._engine.getRenderingCanvas().addEventListener(eventPrefix + "move", this._onPointerMove, false);
  11809. this._engine.getRenderingCanvas().addEventListener(eventPrefix + "down", this._onPointerDown, false);
  11810. this._engine.getRenderingCanvas().addEventListener(eventPrefix + "up", this._onPointerUp, false);
  11811. // Wheel
  11812. this._engine.getRenderingCanvas().addEventListener('mousewheel', this._onPointerMove, false);
  11813. this._engine.getRenderingCanvas().addEventListener('DOMMouseScroll', this._onPointerMove, false);
  11814. BABYLON.Tools.RegisterTopRootEvents([
  11815. { name: "keydown", handler: this._onKeyDown },
  11816. { name: "keyup", handler: this._onKeyUp }
  11817. ]);
  11818. };
  11819. Scene.prototype.detachControl = function () {
  11820. var eventPrefix = BABYLON.Tools.GetPointerPrefix();
  11821. this._engine.getRenderingCanvas().removeEventListener(eventPrefix + "move", this._onPointerMove);
  11822. this._engine.getRenderingCanvas().removeEventListener(eventPrefix + "down", this._onPointerDown);
  11823. this._engine.getRenderingCanvas().removeEventListener(eventPrefix + "up", this._onPointerUp);
  11824. // Wheel
  11825. this._engine.getRenderingCanvas().removeEventListener('mousewheel', this._onPointerMove);
  11826. this._engine.getRenderingCanvas().removeEventListener('DOMMouseScroll', this._onPointerMove);
  11827. BABYLON.Tools.UnregisterTopRootEvents([
  11828. { name: "keydown", handler: this._onKeyDown },
  11829. { name: "keyup", handler: this._onKeyUp }
  11830. ]);
  11831. };
  11832. // Ready
  11833. Scene.prototype.isReady = function () {
  11834. if (this._pendingData.length > 0) {
  11835. return false;
  11836. }
  11837. var index;
  11838. for (index = 0; index < this._geometries.length; index++) {
  11839. var geometry = this._geometries[index];
  11840. if (geometry.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADING) {
  11841. return false;
  11842. }
  11843. }
  11844. for (index = 0; index < this.meshes.length; index++) {
  11845. var mesh = this.meshes[index];
  11846. if (!mesh.isReady()) {
  11847. return false;
  11848. }
  11849. var mat = mesh.material;
  11850. if (mat) {
  11851. if (!mat.isReady(mesh)) {
  11852. return false;
  11853. }
  11854. }
  11855. }
  11856. return true;
  11857. };
  11858. Scene.prototype.resetCachedMaterial = function () {
  11859. this._cachedMaterial = null;
  11860. };
  11861. Scene.prototype.registerBeforeRender = function (func) {
  11862. this._onBeforeRenderCallbacks.push(func);
  11863. };
  11864. Scene.prototype.unregisterBeforeRender = function (func) {
  11865. var index = this._onBeforeRenderCallbacks.indexOf(func);
  11866. if (index > -1) {
  11867. this._onBeforeRenderCallbacks.splice(index, 1);
  11868. }
  11869. };
  11870. Scene.prototype.registerAfterRender = function (func) {
  11871. this._onAfterRenderCallbacks.push(func);
  11872. };
  11873. Scene.prototype.unregisterAfterRender = function (func) {
  11874. var index = this._onAfterRenderCallbacks.indexOf(func);
  11875. if (index > -1) {
  11876. this._onAfterRenderCallbacks.splice(index, 1);
  11877. }
  11878. };
  11879. Scene.prototype._addPendingData = function (data) {
  11880. this._pendingData.push(data);
  11881. };
  11882. Scene.prototype._removePendingData = function (data) {
  11883. var index = this._pendingData.indexOf(data);
  11884. if (index !== -1) {
  11885. this._pendingData.splice(index, 1);
  11886. }
  11887. };
  11888. Scene.prototype.getWaitingItemsCount = function () {
  11889. return this._pendingData.length;
  11890. };
  11891. /**
  11892. * Registers a function to be executed when the scene is ready.
  11893. * @param {Function} func - the function to be executed.
  11894. */
  11895. Scene.prototype.executeWhenReady = function (func) {
  11896. var _this = this;
  11897. this._onReadyCallbacks.push(func);
  11898. if (this._executeWhenReadyTimeoutId !== -1) {
  11899. return;
  11900. }
  11901. this._executeWhenReadyTimeoutId = setTimeout(function () {
  11902. _this._checkIsReady();
  11903. }, 150);
  11904. };
  11905. Scene.prototype._checkIsReady = function () {
  11906. var _this = this;
  11907. if (this.isReady()) {
  11908. this._onReadyCallbacks.forEach(function (func) {
  11909. func();
  11910. });
  11911. this._onReadyCallbacks = [];
  11912. this._executeWhenReadyTimeoutId = -1;
  11913. return;
  11914. }
  11915. this._executeWhenReadyTimeoutId = setTimeout(function () {
  11916. _this._checkIsReady();
  11917. }, 150);
  11918. };
  11919. // Animations
  11920. /**
  11921. * Will start the animation sequence of a given target
  11922. * @param target - the target
  11923. * @param {number} from - from which frame should animation start
  11924. * @param {number} to - till which frame should animation run.
  11925. * @param {boolean} [loop] - should the animation loop
  11926. * @param {number} [speedRatio] - the speed in which to run the animation
  11927. * @param {Function} [onAnimationEnd] function to be executed when the animation ended.
  11928. * @param {BABYLON.Animatable} [animatable] an animatable object. If not provided a new one will be created from the given params.
  11929. * @return {BABYLON.Animatable} the animatable object created for this animation
  11930. * @see BABYLON.Animatable
  11931. * @see http://doc.babylonjs.com/page.php?p=22081
  11932. */
  11933. Scene.prototype.beginAnimation = function (target, from, to, loop, speedRatio, onAnimationEnd, animatable) {
  11934. if (speedRatio === void 0) { speedRatio = 1.0; }
  11935. this.stopAnimation(target);
  11936. if (!animatable) {
  11937. animatable = new BABYLON.Animatable(this, target, from, to, loop, speedRatio, onAnimationEnd);
  11938. }
  11939. // Local animations
  11940. if (target.animations) {
  11941. animatable.appendAnimations(target, target.animations);
  11942. }
  11943. // Children animations
  11944. if (target.getAnimatables) {
  11945. var animatables = target.getAnimatables();
  11946. for (var index = 0; index < animatables.length; index++) {
  11947. this.beginAnimation(animatables[index], from, to, loop, speedRatio, onAnimationEnd, animatable);
  11948. }
  11949. }
  11950. return animatable;
  11951. };
  11952. Scene.prototype.beginDirectAnimation = function (target, animations, from, to, loop, speedRatio, onAnimationEnd) {
  11953. if (speedRatio === undefined) {
  11954. speedRatio = 1.0;
  11955. }
  11956. var animatable = new BABYLON.Animatable(this, target, from, to, loop, speedRatio, onAnimationEnd, animations);
  11957. return animatable;
  11958. };
  11959. Scene.prototype.getAnimatableByTarget = function (target) {
  11960. for (var index = 0; index < this._activeAnimatables.length; index++) {
  11961. if (this._activeAnimatables[index].target === target) {
  11962. return this._activeAnimatables[index];
  11963. }
  11964. }
  11965. return null;
  11966. };
  11967. /**
  11968. * Will stop the animation of the given target
  11969. * @param target - the target
  11970. * @see beginAnimation
  11971. */
  11972. Scene.prototype.stopAnimation = function (target) {
  11973. var animatable = this.getAnimatableByTarget(target);
  11974. if (animatable) {
  11975. animatable.stop();
  11976. }
  11977. };
  11978. Scene.prototype._animate = function () {
  11979. if (!this.animationsEnabled) {
  11980. return;
  11981. }
  11982. if (!this._animationStartDate) {
  11983. this._animationStartDate = BABYLON.Tools.Now;
  11984. }
  11985. // Getting time
  11986. var now = BABYLON.Tools.Now;
  11987. var delay = now - this._animationStartDate;
  11988. for (var index = 0; index < this._activeAnimatables.length; index++) {
  11989. this._activeAnimatables[index]._animate(delay);
  11990. }
  11991. };
  11992. // Matrix
  11993. Scene.prototype.getViewMatrix = function () {
  11994. return this._viewMatrix;
  11995. };
  11996. Scene.prototype.getProjectionMatrix = function () {
  11997. return this._projectionMatrix;
  11998. };
  11999. Scene.prototype.getTransformMatrix = function () {
  12000. return this._transformMatrix;
  12001. };
  12002. Scene.prototype.setTransformMatrix = function (view, projection) {
  12003. this._viewMatrix = view;
  12004. this._projectionMatrix = projection;
  12005. this._viewMatrix.multiplyToRef(this._projectionMatrix, this._transformMatrix);
  12006. };
  12007. // Methods
  12008. Scene.prototype.addMesh = function (newMesh) {
  12009. newMesh.uniqueId = this._uniqueIdCounter++;
  12010. var position = this.meshes.push(newMesh);
  12011. //notify the collision coordinator
  12012. this.collisionCoordinator.onMeshAdded(newMesh);
  12013. if (this.onNewMeshAdded) {
  12014. this.onNewMeshAdded(newMesh, position, this);
  12015. }
  12016. };
  12017. Scene.prototype.removeMesh = function (toRemove) {
  12018. var index = this.meshes.indexOf(toRemove);
  12019. if (index !== -1) {
  12020. // Remove from the scene if mesh found
  12021. this.meshes.splice(index, 1);
  12022. }
  12023. //notify the collision coordinator
  12024. this.collisionCoordinator.onMeshRemoved(toRemove);
  12025. if (this.onMeshRemoved) {
  12026. this.onMeshRemoved(toRemove);
  12027. }
  12028. return index;
  12029. };
  12030. Scene.prototype.removeLight = function (toRemove) {
  12031. var index = this.lights.indexOf(toRemove);
  12032. if (index !== -1) {
  12033. // Remove from the scene if mesh found
  12034. this.lights.splice(index, 1);
  12035. }
  12036. if (this.onLightRemoved) {
  12037. this.onLightRemoved(toRemove);
  12038. }
  12039. return index;
  12040. };
  12041. Scene.prototype.removeCamera = function (toRemove) {
  12042. var index = this.cameras.indexOf(toRemove);
  12043. if (index !== -1) {
  12044. // Remove from the scene if mesh found
  12045. this.cameras.splice(index, 1);
  12046. }
  12047. // Remove from activeCameras
  12048. var index2 = this.activeCameras.indexOf(toRemove);
  12049. if (index2 !== -1) {
  12050. // Remove from the scene if mesh found
  12051. this.activeCameras.splice(index2, 1);
  12052. }
  12053. // Reset the activeCamera
  12054. if (this.activeCamera === toRemove) {
  12055. if (this.cameras.length > 0) {
  12056. this.activeCamera = this.cameras[0];
  12057. }
  12058. else {
  12059. this.activeCamera = null;
  12060. }
  12061. }
  12062. if (this.onCameraRemoved) {
  12063. this.onCameraRemoved(toRemove);
  12064. }
  12065. return index;
  12066. };
  12067. Scene.prototype.addLight = function (newLight) {
  12068. newLight.uniqueId = this._uniqueIdCounter++;
  12069. var position = this.lights.push(newLight);
  12070. if (this.onNewLightAdded) {
  12071. this.onNewLightAdded(newLight, position, this);
  12072. }
  12073. };
  12074. Scene.prototype.addCamera = function (newCamera) {
  12075. newCamera.uniqueId = this._uniqueIdCounter++;
  12076. var position = this.cameras.push(newCamera);
  12077. if (this.onNewCameraAdded) {
  12078. this.onNewCameraAdded(newCamera, position, this);
  12079. }
  12080. };
  12081. /**
  12082. * sets the active camera of the scene using its ID
  12083. * @param {string} id - the camera's ID
  12084. * @return {BABYLON.Camera|null} the new active camera or null if none found.
  12085. * @see activeCamera
  12086. */
  12087. Scene.prototype.setActiveCameraByID = function (id) {
  12088. var camera = this.getCameraByID(id);
  12089. if (camera) {
  12090. this.activeCamera = camera;
  12091. return camera;
  12092. }
  12093. return null;
  12094. };
  12095. /**
  12096. * sets the active camera of the scene using its name
  12097. * @param {string} name - the camera's name
  12098. * @return {BABYLON.Camera|null} the new active camera or null if none found.
  12099. * @see activeCamera
  12100. */
  12101. Scene.prototype.setActiveCameraByName = function (name) {
  12102. var camera = this.getCameraByName(name);
  12103. if (camera) {
  12104. this.activeCamera = camera;
  12105. return camera;
  12106. }
  12107. return null;
  12108. };
  12109. /**
  12110. * get a material using its id
  12111. * @param {string} the material's ID
  12112. * @return {BABYLON.Material|null} the material or null if none found.
  12113. */
  12114. Scene.prototype.getMaterialByID = function (id) {
  12115. for (var index = 0; index < this.materials.length; index++) {
  12116. if (this.materials[index].id === id) {
  12117. return this.materials[index];
  12118. }
  12119. }
  12120. return null;
  12121. };
  12122. /**
  12123. * get a material using its name
  12124. * @param {string} the material's name
  12125. * @return {BABYLON.Material|null} the material or null if none found.
  12126. */
  12127. Scene.prototype.getMaterialByName = function (name) {
  12128. for (var index = 0; index < this.materials.length; index++) {
  12129. if (this.materials[index].name === name) {
  12130. return this.materials[index];
  12131. }
  12132. }
  12133. return null;
  12134. };
  12135. Scene.prototype.getLensFlareSystemByName = function (name) {
  12136. for (var index = 0; index < this.lensFlareSystems.length; index++) {
  12137. if (this.lensFlareSystems[index].name === name) {
  12138. return this.lensFlareSystems[index];
  12139. }
  12140. }
  12141. return null;
  12142. };
  12143. Scene.prototype.getCameraByID = function (id) {
  12144. for (var index = 0; index < this.cameras.length; index++) {
  12145. if (this.cameras[index].id === id) {
  12146. return this.cameras[index];
  12147. }
  12148. }
  12149. return null;
  12150. };
  12151. Scene.prototype.getCameraByUniqueID = function (uniqueId) {
  12152. for (var index = 0; index < this.cameras.length; index++) {
  12153. if (this.cameras[index].uniqueId === uniqueId) {
  12154. return this.cameras[index];
  12155. }
  12156. }
  12157. return null;
  12158. };
  12159. /**
  12160. * get a camera using its name
  12161. * @param {string} the camera's name
  12162. * @return {BABYLON.Camera|null} the camera or null if none found.
  12163. */
  12164. Scene.prototype.getCameraByName = function (name) {
  12165. for (var index = 0; index < this.cameras.length; index++) {
  12166. if (this.cameras[index].name === name) {
  12167. return this.cameras[index];
  12168. }
  12169. }
  12170. return null;
  12171. };
  12172. /**
  12173. * get a light node using its name
  12174. * @param {string} the light's name
  12175. * @return {BABYLON.Light|null} the light or null if none found.
  12176. */
  12177. Scene.prototype.getLightByName = function (name) {
  12178. for (var index = 0; index < this.lights.length; index++) {
  12179. if (this.lights[index].name === name) {
  12180. return this.lights[index];
  12181. }
  12182. }
  12183. return null;
  12184. };
  12185. /**
  12186. * get a light node using its ID
  12187. * @param {string} the light's id
  12188. * @return {BABYLON.Light|null} the light or null if none found.
  12189. */
  12190. Scene.prototype.getLightByID = function (id) {
  12191. for (var index = 0; index < this.lights.length; index++) {
  12192. if (this.lights[index].id === id) {
  12193. return this.lights[index];
  12194. }
  12195. }
  12196. return null;
  12197. };
  12198. /**
  12199. * get a light node using its scene-generated unique ID
  12200. * @param {number} the light's unique id
  12201. * @return {BABYLON.Light|null} the light or null if none found.
  12202. */
  12203. Scene.prototype.getLightByUniqueID = function (uniqueId) {
  12204. for (var index = 0; index < this.lights.length; index++) {
  12205. if (this.lights[index].uniqueId === uniqueId) {
  12206. return this.lights[index];
  12207. }
  12208. }
  12209. return null;
  12210. };
  12211. /**
  12212. * get a geometry using its ID
  12213. * @param {string} the geometry's id
  12214. * @return {BABYLON.Geometry|null} the geometry or null if none found.
  12215. */
  12216. Scene.prototype.getGeometryByID = function (id) {
  12217. for (var index = 0; index < this._geometries.length; index++) {
  12218. if (this._geometries[index].id === id) {
  12219. return this._geometries[index];
  12220. }
  12221. }
  12222. return null;
  12223. };
  12224. /**
  12225. * add a new geometry to this scene.
  12226. * @param {BABYLON.Geometry} geometry - the geometry to be added to the scene.
  12227. * @param {boolean} [force] - force addition, even if a geometry with this ID already exists
  12228. * @return {boolean} was the geometry added or not
  12229. */
  12230. Scene.prototype.pushGeometry = function (geometry, force) {
  12231. if (!force && this.getGeometryByID(geometry.id)) {
  12232. return false;
  12233. }
  12234. this._geometries.push(geometry);
  12235. //notify the collision coordinator
  12236. this.collisionCoordinator.onGeometryAdded(geometry);
  12237. if (this.onGeometryAdded) {
  12238. this.onGeometryAdded(geometry);
  12239. }
  12240. return true;
  12241. };
  12242. /**
  12243. * Removes an existing geometry
  12244. * @param {BABYLON.Geometry} geometry - the geometry to be removed from the scene.
  12245. * @return {boolean} was the geometry removed or not
  12246. */
  12247. Scene.prototype.removeGeometry = function (geometry) {
  12248. var index = this._geometries.indexOf(geometry);
  12249. if (index > -1) {
  12250. this._geometries.splice(index, 1);
  12251. //notify the collision coordinator
  12252. this.collisionCoordinator.onGeometryDeleted(geometry);
  12253. if (this.onGeometryRemoved) {
  12254. this.onGeometryRemoved(geometry);
  12255. }
  12256. return true;
  12257. }
  12258. return false;
  12259. };
  12260. Scene.prototype.getGeometries = function () {
  12261. return this._geometries;
  12262. };
  12263. /**
  12264. * Get the first added mesh found of a given ID
  12265. * @param {string} id - the id to search for
  12266. * @return {BABYLON.AbstractMesh|null} the mesh found or null if not found at all.
  12267. */
  12268. Scene.prototype.getMeshByID = function (id) {
  12269. for (var index = 0; index < this.meshes.length; index++) {
  12270. if (this.meshes[index].id === id) {
  12271. return this.meshes[index];
  12272. }
  12273. }
  12274. return null;
  12275. };
  12276. /**
  12277. * Get a mesh with its auto-generated unique id
  12278. * @param {number} uniqueId - the unique id to search for
  12279. * @return {BABYLON.AbstractMesh|null} the mesh found or null if not found at all.
  12280. */
  12281. Scene.prototype.getMeshByUniqueID = function (uniqueId) {
  12282. for (var index = 0; index < this.meshes.length; index++) {
  12283. if (this.meshes[index].uniqueId === uniqueId) {
  12284. return this.meshes[index];
  12285. }
  12286. }
  12287. return null;
  12288. };
  12289. /**
  12290. * Get a the last added mesh found of a given ID
  12291. * @param {string} id - the id to search for
  12292. * @return {BABYLON.AbstractMesh|null} the mesh found or null if not found at all.
  12293. */
  12294. Scene.prototype.getLastMeshByID = function (id) {
  12295. for (var index = this.meshes.length - 1; index >= 0; index--) {
  12296. if (this.meshes[index].id === id) {
  12297. return this.meshes[index];
  12298. }
  12299. }
  12300. return null;
  12301. };
  12302. /**
  12303. * Get a the last added node (Mesh, Camera, Light) found of a given ID
  12304. * @param {string} id - the id to search for
  12305. * @return {BABYLON.Node|null} the node found or null if not found at all.
  12306. */
  12307. Scene.prototype.getLastEntryByID = function (id) {
  12308. var index;
  12309. for (index = this.meshes.length - 1; index >= 0; index--) {
  12310. if (this.meshes[index].id === id) {
  12311. return this.meshes[index];
  12312. }
  12313. }
  12314. for (index = this.cameras.length - 1; index >= 0; index--) {
  12315. if (this.cameras[index].id === id) {
  12316. return this.cameras[index];
  12317. }
  12318. }
  12319. for (index = this.lights.length - 1; index >= 0; index--) {
  12320. if (this.lights[index].id === id) {
  12321. return this.lights[index];
  12322. }
  12323. }
  12324. return null;
  12325. };
  12326. Scene.prototype.getNodeByID = function (id) {
  12327. var mesh = this.getMeshByID(id);
  12328. if (mesh) {
  12329. return mesh;
  12330. }
  12331. var light = this.getLightByID(id);
  12332. if (light) {
  12333. return light;
  12334. }
  12335. return this.getCameraByID(id);
  12336. };
  12337. Scene.prototype.getNodeByName = function (name) {
  12338. var mesh = this.getMeshByName(name);
  12339. if (mesh) {
  12340. return mesh;
  12341. }
  12342. var light = this.getLightByName(name);
  12343. if (light) {
  12344. return light;
  12345. }
  12346. return this.getCameraByName(name);
  12347. };
  12348. Scene.prototype.getMeshByName = function (name) {
  12349. for (var index = 0; index < this.meshes.length; index++) {
  12350. if (this.meshes[index].name === name) {
  12351. return this.meshes[index];
  12352. }
  12353. }
  12354. return null;
  12355. };
  12356. Scene.prototype.getSoundByName = function (name) {
  12357. var index;
  12358. if (BABYLON.AudioEngine) {
  12359. for (index = 0; index < this.mainSoundTrack.soundCollection.length; index++) {
  12360. if (this.mainSoundTrack.soundCollection[index].name === name) {
  12361. return this.mainSoundTrack.soundCollection[index];
  12362. }
  12363. }
  12364. for (var sdIndex = 0; sdIndex < this.soundTracks.length; sdIndex++) {
  12365. for (index = 0; index < this.soundTracks[sdIndex].soundCollection.length; index++) {
  12366. if (this.soundTracks[sdIndex].soundCollection[index].name === name) {
  12367. return this.soundTracks[sdIndex].soundCollection[index];
  12368. }
  12369. }
  12370. }
  12371. }
  12372. return null;
  12373. };
  12374. Scene.prototype.getLastSkeletonByID = function (id) {
  12375. for (var index = this.skeletons.length - 1; index >= 0; index--) {
  12376. if (this.skeletons[index].id === id) {
  12377. return this.skeletons[index];
  12378. }
  12379. }
  12380. return null;
  12381. };
  12382. Scene.prototype.getSkeletonById = function (id) {
  12383. for (var index = 0; index < this.skeletons.length; index++) {
  12384. if (this.skeletons[index].id === id) {
  12385. return this.skeletons[index];
  12386. }
  12387. }
  12388. return null;
  12389. };
  12390. Scene.prototype.getSkeletonByName = function (name) {
  12391. for (var index = 0; index < this.skeletons.length; index++) {
  12392. if (this.skeletons[index].name === name) {
  12393. return this.skeletons[index];
  12394. }
  12395. }
  12396. return null;
  12397. };
  12398. Scene.prototype.isActiveMesh = function (mesh) {
  12399. return (this._activeMeshes.indexOf(mesh) !== -1);
  12400. };
  12401. Scene.prototype._evaluateSubMesh = function (subMesh, mesh) {
  12402. if (mesh.alwaysSelectAsActiveMesh || mesh.subMeshes.length === 1 || subMesh.isInFrustum(this._frustumPlanes)) {
  12403. var material = subMesh.getMaterial();
  12404. if (mesh.showSubMeshesBoundingBox) {
  12405. this._boundingBoxRenderer.renderList.push(subMesh.getBoundingInfo().boundingBox);
  12406. }
  12407. if (material) {
  12408. // Render targets
  12409. if (material.getRenderTargetTextures) {
  12410. if (this._processedMaterials.indexOf(material) === -1) {
  12411. this._processedMaterials.push(material);
  12412. this._renderTargets.concat(material.getRenderTargetTextures());
  12413. }
  12414. }
  12415. // Dispatch
  12416. this._activeIndices += subMesh.indexCount;
  12417. this._renderingManager.dispatch(subMesh);
  12418. }
  12419. }
  12420. };
  12421. Scene.prototype._evaluateActiveMeshes = function () {
  12422. this.activeCamera._activeMeshes.reset();
  12423. this._activeMeshes.reset();
  12424. this._renderingManager.reset();
  12425. this._processedMaterials.reset();
  12426. this._activeParticleSystems.reset();
  12427. this._activeSkeletons.reset();
  12428. this._softwareSkinnedMeshes.reset();
  12429. this._boundingBoxRenderer.reset();
  12430. this._edgesRenderers.reset();
  12431. if (!this._frustumPlanes) {
  12432. this._frustumPlanes = BABYLON.Frustum.GetPlanes(this._transformMatrix);
  12433. }
  12434. else {
  12435. BABYLON.Frustum.GetPlanesToRef(this._transformMatrix, this._frustumPlanes);
  12436. }
  12437. // Meshes
  12438. var meshes;
  12439. var len;
  12440. if (this._selectionOctree) {
  12441. var selection = this._selectionOctree.select(this._frustumPlanes);
  12442. meshes = selection.data;
  12443. len = selection.length;
  12444. }
  12445. else {
  12446. len = this.meshes.length;
  12447. meshes = this.meshes;
  12448. }
  12449. for (var meshIndex = 0; meshIndex < len; meshIndex++) {
  12450. var mesh = meshes[meshIndex];
  12451. if (mesh.isBlocked) {
  12452. continue;
  12453. }
  12454. this._totalVertices += mesh.getTotalVertices();
  12455. if (!mesh.isReady() || !mesh.isEnabled()) {
  12456. continue;
  12457. }
  12458. mesh.computeWorldMatrix();
  12459. // Intersections
  12460. if (mesh.actionManager && mesh.actionManager.hasSpecificTriggers([BABYLON.ActionManager.OnIntersectionEnterTrigger, BABYLON.ActionManager.OnIntersectionExitTrigger])) {
  12461. this._meshesForIntersections.pushNoDuplicate(mesh);
  12462. }
  12463. // Switch to current LOD
  12464. var meshLOD = mesh.getLOD(this.activeCamera);
  12465. if (!meshLOD) {
  12466. continue;
  12467. }
  12468. mesh._preActivate();
  12469. if (mesh.alwaysSelectAsActiveMesh || mesh.isVisible && mesh.visibility > 0 && ((mesh.layerMask & this.activeCamera.layerMask) !== 0) && mesh.isInFrustum(this._frustumPlanes)) {
  12470. this._activeMeshes.push(mesh);
  12471. this.activeCamera._activeMeshes.push(mesh);
  12472. mesh._activate(this._renderId);
  12473. this._activeMesh(meshLOD);
  12474. }
  12475. }
  12476. // Particle systems
  12477. var beforeParticlesDate = BABYLON.Tools.Now;
  12478. if (this.particlesEnabled) {
  12479. BABYLON.Tools.StartPerformanceCounter("Particles", this.particleSystems.length > 0);
  12480. for (var particleIndex = 0; particleIndex < this.particleSystems.length; particleIndex++) {
  12481. var particleSystem = this.particleSystems[particleIndex];
  12482. if (!particleSystem.isStarted()) {
  12483. continue;
  12484. }
  12485. if (!particleSystem.emitter.position || (particleSystem.emitter && particleSystem.emitter.isEnabled())) {
  12486. this._activeParticleSystems.push(particleSystem);
  12487. particleSystem.animate();
  12488. }
  12489. }
  12490. BABYLON.Tools.EndPerformanceCounter("Particles", this.particleSystems.length > 0);
  12491. }
  12492. this._particlesDuration += BABYLON.Tools.Now - beforeParticlesDate;
  12493. };
  12494. Scene.prototype._activeMesh = function (mesh) {
  12495. if (mesh.skeleton && this.skeletonsEnabled) {
  12496. this._activeSkeletons.pushNoDuplicate(mesh.skeleton);
  12497. if (!mesh.computeBonesUsingShaders) {
  12498. this._softwareSkinnedMeshes.pushNoDuplicate(mesh);
  12499. }
  12500. }
  12501. if (mesh.showBoundingBox || this.forceShowBoundingBoxes) {
  12502. this._boundingBoxRenderer.renderList.push(mesh.getBoundingInfo().boundingBox);
  12503. }
  12504. if (mesh._edgesRenderer) {
  12505. this._edgesRenderers.push(mesh._edgesRenderer);
  12506. }
  12507. if (mesh && mesh.subMeshes) {
  12508. // Submeshes Octrees
  12509. var len;
  12510. var subMeshes;
  12511. if (mesh._submeshesOctree && mesh.useOctreeForRenderingSelection) {
  12512. var intersections = mesh._submeshesOctree.select(this._frustumPlanes);
  12513. len = intersections.length;
  12514. subMeshes = intersections.data;
  12515. }
  12516. else {
  12517. subMeshes = mesh.subMeshes;
  12518. len = subMeshes.length;
  12519. }
  12520. for (var subIndex = 0; subIndex < len; subIndex++) {
  12521. var subMesh = subMeshes[subIndex];
  12522. this._evaluateSubMesh(subMesh, mesh);
  12523. }
  12524. }
  12525. };
  12526. Scene.prototype.updateTransformMatrix = function (force) {
  12527. this.setTransformMatrix(this.activeCamera.getViewMatrix(), this.activeCamera.getProjectionMatrix(force));
  12528. };
  12529. Scene.prototype._renderForCamera = function (camera) {
  12530. var engine = this._engine;
  12531. this.activeCamera = camera;
  12532. if (!this.activeCamera)
  12533. throw new Error("Active camera not set");
  12534. BABYLON.Tools.StartPerformanceCounter("Rendering camera " + this.activeCamera.name);
  12535. // Viewport
  12536. engine.setViewport(this.activeCamera.viewport);
  12537. // Camera
  12538. this.resetCachedMaterial();
  12539. this._renderId++;
  12540. this.updateTransformMatrix();
  12541. if (this.beforeCameraRender) {
  12542. this.beforeCameraRender(this.activeCamera);
  12543. }
  12544. // Meshes
  12545. var beforeEvaluateActiveMeshesDate = BABYLON.Tools.Now;
  12546. BABYLON.Tools.StartPerformanceCounter("Active meshes evaluation");
  12547. this._evaluateActiveMeshes();
  12548. this._evaluateActiveMeshesDuration += BABYLON.Tools.Now - beforeEvaluateActiveMeshesDate;
  12549. BABYLON.Tools.EndPerformanceCounter("Active meshes evaluation");
  12550. // Skeletons
  12551. for (var skeletonIndex = 0; skeletonIndex < this._activeSkeletons.length; skeletonIndex++) {
  12552. var skeleton = this._activeSkeletons.data[skeletonIndex];
  12553. skeleton.prepare();
  12554. }
  12555. // Software skinning
  12556. for (var softwareSkinnedMeshIndex = 0; softwareSkinnedMeshIndex < this._softwareSkinnedMeshes.length; softwareSkinnedMeshIndex++) {
  12557. var mesh = this._softwareSkinnedMeshes.data[softwareSkinnedMeshIndex];
  12558. mesh.applySkeleton(mesh.skeleton);
  12559. }
  12560. // Render targets
  12561. var beforeRenderTargetDate = BABYLON.Tools.Now;
  12562. if (this.renderTargetsEnabled) {
  12563. BABYLON.Tools.StartPerformanceCounter("Render targets", this._renderTargets.length > 0);
  12564. for (var renderIndex = 0; renderIndex < this._renderTargets.length; renderIndex++) {
  12565. var renderTarget = this._renderTargets.data[renderIndex];
  12566. if (renderTarget._shouldRender()) {
  12567. this._renderId++;
  12568. var hasSpecialRenderTargetCamera = renderTarget.activeCamera && renderTarget.activeCamera !== this.activeCamera;
  12569. renderTarget.render(hasSpecialRenderTargetCamera, this.dumpNextRenderTargets);
  12570. }
  12571. }
  12572. BABYLON.Tools.EndPerformanceCounter("Render targets", this._renderTargets.length > 0);
  12573. this._renderId++;
  12574. }
  12575. if (this._renderTargets.length > 0) {
  12576. engine.restoreDefaultFramebuffer();
  12577. }
  12578. this._renderTargetsDuration += BABYLON.Tools.Now - beforeRenderTargetDate;
  12579. // Prepare Frame
  12580. this.postProcessManager._prepareFrame();
  12581. var beforeRenderDate = BABYLON.Tools.Now;
  12582. // Backgrounds
  12583. var layerIndex;
  12584. var layer;
  12585. if (this.layers.length) {
  12586. engine.setDepthBuffer(false);
  12587. for (layerIndex = 0; layerIndex < this.layers.length; layerIndex++) {
  12588. layer = this.layers[layerIndex];
  12589. if (layer.isBackground) {
  12590. layer.render();
  12591. }
  12592. }
  12593. engine.setDepthBuffer(true);
  12594. }
  12595. // Render
  12596. BABYLON.Tools.StartPerformanceCounter("Main render");
  12597. this._renderingManager.render(null, null, true, true);
  12598. BABYLON.Tools.EndPerformanceCounter("Main render");
  12599. // Bounding boxes
  12600. this._boundingBoxRenderer.render();
  12601. // Edges
  12602. for (var edgesRendererIndex = 0; edgesRendererIndex < this._edgesRenderers.length; edgesRendererIndex++) {
  12603. this._edgesRenderers.data[edgesRendererIndex].render();
  12604. }
  12605. // Lens flares
  12606. if (this.lensFlaresEnabled) {
  12607. BABYLON.Tools.StartPerformanceCounter("Lens flares", this.lensFlareSystems.length > 0);
  12608. for (var lensFlareSystemIndex = 0; lensFlareSystemIndex < this.lensFlareSystems.length; lensFlareSystemIndex++) {
  12609. var lensFlareSystem = this.lensFlareSystems[lensFlareSystemIndex];
  12610. if ((camera.layerMask & lensFlareSystem.layerMask) !== 0) {
  12611. lensFlareSystem.render();
  12612. }
  12613. }
  12614. BABYLON.Tools.EndPerformanceCounter("Lens flares", this.lensFlareSystems.length > 0);
  12615. }
  12616. // Foregrounds
  12617. if (this.layers.length) {
  12618. engine.setDepthBuffer(false);
  12619. for (layerIndex = 0; layerIndex < this.layers.length; layerIndex++) {
  12620. layer = this.layers[layerIndex];
  12621. if (!layer.isBackground) {
  12622. layer.render();
  12623. }
  12624. }
  12625. engine.setDepthBuffer(true);
  12626. }
  12627. this._renderDuration += BABYLON.Tools.Now - beforeRenderDate;
  12628. // Finalize frame
  12629. this.postProcessManager._finalizeFrame(camera.isIntermediate);
  12630. // Update camera
  12631. this.activeCamera._updateFromScene();
  12632. // Reset some special arrays
  12633. this._renderTargets.reset();
  12634. if (this.afterCameraRender) {
  12635. this.afterCameraRender(this.activeCamera);
  12636. }
  12637. BABYLON.Tools.EndPerformanceCounter("Rendering camera " + this.activeCamera.name);
  12638. };
  12639. Scene.prototype._processSubCameras = function (camera) {
  12640. if (camera.cameraRigMode === BABYLON.Camera.RIG_MODE_NONE) {
  12641. this._renderForCamera(camera);
  12642. return;
  12643. }
  12644. // rig cameras
  12645. for (var index = 0; index < camera._rigCameras.length; index++) {
  12646. this._renderForCamera(camera._rigCameras[index]);
  12647. }
  12648. this.activeCamera = camera;
  12649. this.setTransformMatrix(this.activeCamera.getViewMatrix(), this.activeCamera.getProjectionMatrix());
  12650. // Update camera
  12651. this.activeCamera._updateFromScene();
  12652. };
  12653. Scene.prototype._checkIntersections = function () {
  12654. for (var index = 0; index < this._meshesForIntersections.length; index++) {
  12655. var sourceMesh = this._meshesForIntersections.data[index];
  12656. for (var actionIndex = 0; actionIndex < sourceMesh.actionManager.actions.length; actionIndex++) {
  12657. var action = sourceMesh.actionManager.actions[actionIndex];
  12658. if (action.trigger === BABYLON.ActionManager.OnIntersectionEnterTrigger || action.trigger === BABYLON.ActionManager.OnIntersectionExitTrigger) {
  12659. var parameters = action.getTriggerParameter();
  12660. var otherMesh = parameters instanceof BABYLON.AbstractMesh ? parameters : parameters.mesh;
  12661. var areIntersecting = otherMesh.intersectsMesh(sourceMesh, parameters.usePreciseIntersection);
  12662. var currentIntersectionInProgress = sourceMesh._intersectionsInProgress.indexOf(otherMesh);
  12663. if (areIntersecting && currentIntersectionInProgress === -1) {
  12664. if (action.trigger === BABYLON.ActionManager.OnIntersectionEnterTrigger) {
  12665. action._executeCurrent(BABYLON.ActionEvent.CreateNew(sourceMesh, null, otherMesh));
  12666. sourceMesh._intersectionsInProgress.push(otherMesh);
  12667. }
  12668. else if (action.trigger === BABYLON.ActionManager.OnIntersectionExitTrigger) {
  12669. sourceMesh._intersectionsInProgress.push(otherMesh);
  12670. }
  12671. }
  12672. else if (!areIntersecting && currentIntersectionInProgress > -1) {
  12673. //They intersected, and now they don't.
  12674. //is this trigger an exit trigger? execute an event.
  12675. if (action.trigger === BABYLON.ActionManager.OnIntersectionExitTrigger) {
  12676. action._executeCurrent(BABYLON.ActionEvent.CreateNew(sourceMesh, null, otherMesh));
  12677. }
  12678. //if this is an exit trigger, or no exit trigger exists, remove the id from the intersection in progress array.
  12679. if (!sourceMesh.actionManager.hasSpecificTrigger(BABYLON.ActionManager.OnIntersectionExitTrigger) || action.trigger === BABYLON.ActionManager.OnIntersectionExitTrigger) {
  12680. sourceMesh._intersectionsInProgress.splice(currentIntersectionInProgress, 1);
  12681. }
  12682. }
  12683. }
  12684. }
  12685. }
  12686. };
  12687. Scene.prototype.render = function () {
  12688. var startDate = BABYLON.Tools.Now;
  12689. this._particlesDuration = 0;
  12690. this._spritesDuration = 0;
  12691. this._activeParticles = 0;
  12692. this._renderDuration = 0;
  12693. this._renderTargetsDuration = 0;
  12694. this._evaluateActiveMeshesDuration = 0;
  12695. this._totalVertices = 0;
  12696. this._activeIndices = 0;
  12697. this._activeBones = 0;
  12698. this.getEngine().resetDrawCalls();
  12699. this._meshesForIntersections.reset();
  12700. this.resetCachedMaterial();
  12701. BABYLON.Tools.StartPerformanceCounter("Scene rendering");
  12702. // Actions
  12703. if (this.actionManager) {
  12704. this.actionManager.processTrigger(BABYLON.ActionManager.OnEveryFrameTrigger, null);
  12705. }
  12706. //Simplification Queue
  12707. if (this.simplificationQueue && !this.simplificationQueue.running) {
  12708. this.simplificationQueue.executeNext();
  12709. }
  12710. // Animations
  12711. var deltaTime = Math.max(Scene.MinDeltaTime, Math.min(this._engine.getDeltaTime(), Scene.MaxDeltaTime));
  12712. this._animationRatio = deltaTime * (60.0 / 1000.0);
  12713. this._animate();
  12714. // Physics
  12715. if (this._physicsEngine) {
  12716. BABYLON.Tools.StartPerformanceCounter("Physics");
  12717. this._physicsEngine._runOneStep(deltaTime / 1000.0);
  12718. BABYLON.Tools.EndPerformanceCounter("Physics");
  12719. }
  12720. // Before render
  12721. if (this.beforeRender) {
  12722. this.beforeRender();
  12723. }
  12724. var callbackIndex;
  12725. for (callbackIndex = 0; callbackIndex < this._onBeforeRenderCallbacks.length; callbackIndex++) {
  12726. this._onBeforeRenderCallbacks[callbackIndex]();
  12727. }
  12728. // Customs render targets
  12729. var beforeRenderTargetDate = BABYLON.Tools.Now;
  12730. var engine = this.getEngine();
  12731. var currentActiveCamera = this.activeCamera;
  12732. if (this.renderTargetsEnabled) {
  12733. BABYLON.Tools.StartPerformanceCounter("Custom render targets", this.customRenderTargets.length > 0);
  12734. for (var customIndex = 0; customIndex < this.customRenderTargets.length; customIndex++) {
  12735. var renderTarget = this.customRenderTargets[customIndex];
  12736. if (renderTarget._shouldRender()) {
  12737. this._renderId++;
  12738. this.activeCamera = renderTarget.activeCamera || this.activeCamera;
  12739. if (!this.activeCamera)
  12740. throw new Error("Active camera not set");
  12741. // Viewport
  12742. engine.setViewport(this.activeCamera.viewport);
  12743. // Camera
  12744. this.updateTransformMatrix();
  12745. renderTarget.render(currentActiveCamera !== this.activeCamera, this.dumpNextRenderTargets);
  12746. }
  12747. }
  12748. BABYLON.Tools.EndPerformanceCounter("Custom render targets", this.customRenderTargets.length > 0);
  12749. this._renderId++;
  12750. }
  12751. if (this.customRenderTargets.length > 0) {
  12752. engine.restoreDefaultFramebuffer();
  12753. }
  12754. this._renderTargetsDuration += BABYLON.Tools.Now - beforeRenderTargetDate;
  12755. this.activeCamera = currentActiveCamera;
  12756. // Procedural textures
  12757. if (this.proceduralTexturesEnabled) {
  12758. BABYLON.Tools.StartPerformanceCounter("Procedural textures", this._proceduralTextures.length > 0);
  12759. for (var proceduralIndex = 0; proceduralIndex < this._proceduralTextures.length; proceduralIndex++) {
  12760. var proceduralTexture = this._proceduralTextures[proceduralIndex];
  12761. if (proceduralTexture._shouldRender()) {
  12762. proceduralTexture.render();
  12763. }
  12764. }
  12765. BABYLON.Tools.EndPerformanceCounter("Procedural textures", this._proceduralTextures.length > 0);
  12766. }
  12767. // Clear
  12768. this._engine.clear(this.clearColor, this.autoClear || this.forceWireframe || this.forcePointsCloud, true);
  12769. // Shadows
  12770. if (this.shadowsEnabled) {
  12771. for (var lightIndex = 0; lightIndex < this.lights.length; lightIndex++) {
  12772. var light = this.lights[lightIndex];
  12773. var shadowGenerator = light.getShadowGenerator();
  12774. if (light.isEnabled() && shadowGenerator && shadowGenerator.getShadowMap().getScene().textures.indexOf(shadowGenerator.getShadowMap()) !== -1) {
  12775. this._renderTargets.push(shadowGenerator.getShadowMap());
  12776. }
  12777. }
  12778. }
  12779. // Depth renderer
  12780. if (this._depthRenderer) {
  12781. this._renderTargets.push(this._depthRenderer.getDepthMap());
  12782. }
  12783. // RenderPipeline
  12784. this.postProcessRenderPipelineManager.update();
  12785. // Multi-cameras?
  12786. if (this.activeCameras.length > 0) {
  12787. var currentRenderId = this._renderId;
  12788. for (var cameraIndex = 0; cameraIndex < this.activeCameras.length; cameraIndex++) {
  12789. this._renderId = currentRenderId;
  12790. this._processSubCameras(this.activeCameras[cameraIndex]);
  12791. }
  12792. }
  12793. else {
  12794. if (!this.activeCamera) {
  12795. throw new Error("No camera defined");
  12796. }
  12797. this._processSubCameras(this.activeCamera);
  12798. }
  12799. // Intersection checks
  12800. this._checkIntersections();
  12801. // Update the audio listener attached to the camera
  12802. if (BABYLON.AudioEngine) {
  12803. this._updateAudioParameters();
  12804. }
  12805. // After render
  12806. if (this.afterRender) {
  12807. this.afterRender();
  12808. }
  12809. for (callbackIndex = 0; callbackIndex < this._onAfterRenderCallbacks.length; callbackIndex++) {
  12810. this._onAfterRenderCallbacks[callbackIndex]();
  12811. }
  12812. // Cleaning
  12813. for (var index = 0; index < this._toBeDisposed.length; index++) {
  12814. this._toBeDisposed.data[index].dispose();
  12815. this._toBeDisposed[index] = null;
  12816. }
  12817. this._toBeDisposed.reset();
  12818. if (this.dumpNextRenderTargets) {
  12819. this.dumpNextRenderTargets = false;
  12820. }
  12821. BABYLON.Tools.EndPerformanceCounter("Scene rendering");
  12822. this._lastFrameDuration = BABYLON.Tools.Now - startDate;
  12823. };
  12824. Scene.prototype._updateAudioParameters = function () {
  12825. if (!this.audioEnabled || (this.mainSoundTrack.soundCollection.length === 0 && this.soundTracks.length === 1)) {
  12826. return;
  12827. }
  12828. var listeningCamera;
  12829. var audioEngine = BABYLON.Engine.audioEngine;
  12830. if (this.activeCameras.length > 0) {
  12831. listeningCamera = this.activeCameras[0];
  12832. }
  12833. else {
  12834. listeningCamera = this.activeCamera;
  12835. }
  12836. if (listeningCamera && audioEngine.canUseWebAudio) {
  12837. audioEngine.audioContext.listener.setPosition(listeningCamera.position.x, listeningCamera.position.y, listeningCamera.position.z);
  12838. var mat = BABYLON.Matrix.Invert(listeningCamera.getViewMatrix());
  12839. var cameraDirection = BABYLON.Vector3.TransformNormal(new BABYLON.Vector3(0, 0, -1), mat);
  12840. cameraDirection.normalize();
  12841. audioEngine.audioContext.listener.setOrientation(cameraDirection.x, cameraDirection.y, cameraDirection.z, 0, 1, 0);
  12842. var i;
  12843. for (i = 0; i < this.mainSoundTrack.soundCollection.length; i++) {
  12844. var sound = this.mainSoundTrack.soundCollection[i];
  12845. if (sound.useCustomAttenuation) {
  12846. sound.updateDistanceFromListener();
  12847. }
  12848. }
  12849. for (i = 0; i < this.soundTracks.length; i++) {
  12850. for (var j = 0; j < this.soundTracks[i].soundCollection.length; j++) {
  12851. sound = this.soundTracks[i].soundCollection[j];
  12852. if (sound.useCustomAttenuation) {
  12853. sound.updateDistanceFromListener();
  12854. }
  12855. }
  12856. }
  12857. }
  12858. };
  12859. Object.defineProperty(Scene.prototype, "audioEnabled", {
  12860. // Audio
  12861. get: function () {
  12862. return this._audioEnabled;
  12863. },
  12864. set: function (value) {
  12865. this._audioEnabled = value;
  12866. if (BABYLON.AudioEngine) {
  12867. if (this._audioEnabled) {
  12868. this._enableAudio();
  12869. }
  12870. else {
  12871. this._disableAudio();
  12872. }
  12873. }
  12874. },
  12875. enumerable: true,
  12876. configurable: true
  12877. });
  12878. Scene.prototype._disableAudio = function () {
  12879. var i;
  12880. for (i = 0; i < this.mainSoundTrack.soundCollection.length; i++) {
  12881. this.mainSoundTrack.soundCollection[i].pause();
  12882. }
  12883. for (i = 0; i < this.soundTracks.length; i++) {
  12884. for (var j = 0; j < this.soundTracks[i].soundCollection.length; j++) {
  12885. this.soundTracks[i].soundCollection[j].pause();
  12886. }
  12887. }
  12888. };
  12889. Scene.prototype._enableAudio = function () {
  12890. var i;
  12891. for (i = 0; i < this.mainSoundTrack.soundCollection.length; i++) {
  12892. if (this.mainSoundTrack.soundCollection[i].isPaused) {
  12893. this.mainSoundTrack.soundCollection[i].play();
  12894. }
  12895. }
  12896. for (i = 0; i < this.soundTracks.length; i++) {
  12897. for (var j = 0; j < this.soundTracks[i].soundCollection.length; j++) {
  12898. if (this.soundTracks[i].soundCollection[j].isPaused) {
  12899. this.soundTracks[i].soundCollection[j].play();
  12900. }
  12901. }
  12902. }
  12903. };
  12904. Object.defineProperty(Scene.prototype, "headphone", {
  12905. get: function () {
  12906. return this._headphone;
  12907. },
  12908. set: function (value) {
  12909. this._headphone = value;
  12910. if (BABYLON.AudioEngine) {
  12911. if (this._headphone) {
  12912. this._switchAudioModeForHeadphones();
  12913. }
  12914. else {
  12915. this._switchAudioModeForNormalSpeakers();
  12916. }
  12917. }
  12918. },
  12919. enumerable: true,
  12920. configurable: true
  12921. });
  12922. Scene.prototype._switchAudioModeForHeadphones = function () {
  12923. this.mainSoundTrack.switchPanningModelToHRTF();
  12924. for (var i = 0; i < this.soundTracks.length; i++) {
  12925. this.soundTracks[i].switchPanningModelToHRTF();
  12926. }
  12927. };
  12928. Scene.prototype._switchAudioModeForNormalSpeakers = function () {
  12929. this.mainSoundTrack.switchPanningModelToEqualPower();
  12930. for (var i = 0; i < this.soundTracks.length; i++) {
  12931. this.soundTracks[i].switchPanningModelToEqualPower();
  12932. }
  12933. };
  12934. Scene.prototype.enableDepthRenderer = function () {
  12935. if (this._depthRenderer) {
  12936. return this._depthRenderer;
  12937. }
  12938. this._depthRenderer = new BABYLON.DepthRenderer(this);
  12939. return this._depthRenderer;
  12940. };
  12941. Scene.prototype.disableDepthRenderer = function () {
  12942. if (!this._depthRenderer) {
  12943. return;
  12944. }
  12945. this._depthRenderer.dispose();
  12946. this._depthRenderer = null;
  12947. };
  12948. Scene.prototype.dispose = function () {
  12949. this.beforeRender = null;
  12950. this.afterRender = null;
  12951. this.skeletons = [];
  12952. this._boundingBoxRenderer.dispose();
  12953. if (this._depthRenderer) {
  12954. this._depthRenderer.dispose();
  12955. }
  12956. // Debug layer
  12957. this.debugLayer.hide();
  12958. // Events
  12959. if (this.onDispose) {
  12960. this.onDispose();
  12961. }
  12962. this._onBeforeRenderCallbacks = [];
  12963. this._onAfterRenderCallbacks = [];
  12964. this.detachControl();
  12965. // Release sounds & sounds tracks
  12966. if (BABYLON.AudioEngine) {
  12967. this.disposeSounds();
  12968. }
  12969. // Detach cameras
  12970. var canvas = this._engine.getRenderingCanvas();
  12971. var index;
  12972. for (index = 0; index < this.cameras.length; index++) {
  12973. this.cameras[index].detachControl(canvas);
  12974. }
  12975. // Release lights
  12976. while (this.lights.length) {
  12977. this.lights[0].dispose();
  12978. }
  12979. // Release meshes
  12980. while (this.meshes.length) {
  12981. this.meshes[0].dispose(true);
  12982. }
  12983. // Release cameras
  12984. while (this.cameras.length) {
  12985. this.cameras[0].dispose();
  12986. }
  12987. // Release materials
  12988. while (this.materials.length) {
  12989. this.materials[0].dispose();
  12990. }
  12991. // Release particles
  12992. while (this.particleSystems.length) {
  12993. this.particleSystems[0].dispose();
  12994. }
  12995. // Release sprites
  12996. while (this.spriteManagers.length) {
  12997. this.spriteManagers[0].dispose();
  12998. }
  12999. // Release layers
  13000. while (this.layers.length) {
  13001. this.layers[0].dispose();
  13002. }
  13003. // Release textures
  13004. while (this.textures.length) {
  13005. this.textures[0].dispose();
  13006. }
  13007. // Post-processes
  13008. this.postProcessManager.dispose();
  13009. // Physics
  13010. if (this._physicsEngine) {
  13011. this.disablePhysicsEngine();
  13012. }
  13013. // Remove from engine
  13014. index = this._engine.scenes.indexOf(this);
  13015. if (index > -1) {
  13016. this._engine.scenes.splice(index, 1);
  13017. }
  13018. this._engine.wipeCaches();
  13019. };
  13020. // Release sounds & sounds tracks
  13021. Scene.prototype.disposeSounds = function () {
  13022. this.mainSoundTrack.dispose();
  13023. for (var scIndex = 0; scIndex < this.soundTracks.length; scIndex++) {
  13024. this.soundTracks[scIndex].dispose();
  13025. }
  13026. };
  13027. // Octrees
  13028. Scene.prototype.getWorldExtends = function () {
  13029. var min = new BABYLON.Vector3(Number.MAX_VALUE, Number.MAX_VALUE, Number.MAX_VALUE);
  13030. var max = new BABYLON.Vector3(-Number.MAX_VALUE, -Number.MAX_VALUE, -Number.MAX_VALUE);
  13031. for (var index = 0; index < this.meshes.length; index++) {
  13032. var mesh = this.meshes[index];
  13033. mesh.computeWorldMatrix(true);
  13034. var minBox = mesh.getBoundingInfo().boundingBox.minimumWorld;
  13035. var maxBox = mesh.getBoundingInfo().boundingBox.maximumWorld;
  13036. BABYLON.Tools.CheckExtends(minBox, min, max);
  13037. BABYLON.Tools.CheckExtends(maxBox, min, max);
  13038. }
  13039. return {
  13040. min: min,
  13041. max: max
  13042. };
  13043. };
  13044. Scene.prototype.createOrUpdateSelectionOctree = function (maxCapacity, maxDepth) {
  13045. if (maxCapacity === void 0) { maxCapacity = 64; }
  13046. if (maxDepth === void 0) { maxDepth = 2; }
  13047. if (!this._selectionOctree) {
  13048. this._selectionOctree = new BABYLON.Octree(BABYLON.Octree.CreationFuncForMeshes, maxCapacity, maxDepth);
  13049. }
  13050. var worldExtends = this.getWorldExtends();
  13051. // Update octree
  13052. this._selectionOctree.update(worldExtends.min, worldExtends.max, this.meshes);
  13053. return this._selectionOctree;
  13054. };
  13055. // Picking
  13056. Scene.prototype.createPickingRay = function (x, y, world, camera, cameraViewSpace) {
  13057. if (cameraViewSpace === void 0) { cameraViewSpace = false; }
  13058. var engine = this._engine;
  13059. if (!camera) {
  13060. if (!this.activeCamera)
  13061. throw new Error("Active camera not set");
  13062. camera = this.activeCamera;
  13063. }
  13064. var cameraViewport = camera.viewport;
  13065. var viewport = cameraViewport.toGlobal(engine);
  13066. // Moving coordinates to local viewport world
  13067. x = x / this._engine.getHardwareScalingLevel() - viewport.x;
  13068. y = y / this._engine.getHardwareScalingLevel() - (this._engine.getRenderHeight() - viewport.y - viewport.height);
  13069. return BABYLON.Ray.CreateNew(x, y, viewport.width, viewport.height, world ? world : BABYLON.Matrix.Identity(), cameraViewSpace ? BABYLON.Matrix.Identity() : camera.getViewMatrix(), camera.getProjectionMatrix());
  13070. // return BABYLON.Ray.CreateNew(x / window.devicePixelRatio, y / window.devicePixelRatio, viewport.width, viewport.height, world ? world : BABYLON.Matrix.Identity(), camera.getViewMatrix(), camera.getProjectionMatrix());
  13071. };
  13072. Scene.prototype.createPickingRayInCameraSpace = function (x, y, camera) {
  13073. var engine = this._engine;
  13074. if (!camera) {
  13075. if (!this.activeCamera)
  13076. throw new Error("Active camera not set");
  13077. camera = this.activeCamera;
  13078. }
  13079. var cameraViewport = camera.viewport;
  13080. var viewport = cameraViewport.toGlobal(engine);
  13081. var identity = BABYLON.Matrix.Identity();
  13082. // Moving coordinates to local viewport world
  13083. x = x / this._engine.getHardwareScalingLevel() - viewport.x;
  13084. y = y / this._engine.getHardwareScalingLevel() - (this._engine.getRenderHeight() - viewport.y - viewport.height);
  13085. return BABYLON.Ray.CreateNew(x, y, viewport.width, viewport.height, identity, identity, camera.getProjectionMatrix());
  13086. };
  13087. Scene.prototype._internalPick = function (rayFunction, predicate, fastCheck) {
  13088. var pickingInfo = null;
  13089. for (var meshIndex = 0; meshIndex < this.meshes.length; meshIndex++) {
  13090. var mesh = this.meshes[meshIndex];
  13091. if (predicate) {
  13092. if (!predicate(mesh)) {
  13093. continue;
  13094. }
  13095. }
  13096. else if (!mesh.isEnabled() || !mesh.isVisible || !mesh.isPickable) {
  13097. continue;
  13098. }
  13099. var world = mesh.getWorldMatrix();
  13100. var ray = rayFunction(world);
  13101. var result = mesh.intersects(ray, fastCheck);
  13102. if (!result || !result.hit)
  13103. continue;
  13104. if (!fastCheck && pickingInfo != null && result.distance >= pickingInfo.distance)
  13105. continue;
  13106. pickingInfo = result;
  13107. if (fastCheck) {
  13108. break;
  13109. }
  13110. }
  13111. return pickingInfo || new BABYLON.PickingInfo();
  13112. };
  13113. Scene.prototype._internalPickSprites = function (ray, predicate, fastCheck, camera) {
  13114. var pickingInfo = null;
  13115. camera = camera || this.activeCamera;
  13116. if (this.spriteManagers.length > 0) {
  13117. for (var spriteIndex = 0; spriteIndex < this.spriteManagers.length; spriteIndex++) {
  13118. var spriteManager = this.spriteManagers[spriteIndex];
  13119. if (!spriteManager.isPickable) {
  13120. continue;
  13121. }
  13122. var result = spriteManager.intersects(ray, camera, predicate, fastCheck);
  13123. if (!result || !result.hit)
  13124. continue;
  13125. if (!fastCheck && pickingInfo != null && result.distance >= pickingInfo.distance)
  13126. continue;
  13127. pickingInfo = result;
  13128. if (fastCheck) {
  13129. break;
  13130. }
  13131. }
  13132. }
  13133. return pickingInfo || new BABYLON.PickingInfo();
  13134. };
  13135. Scene.prototype.pick = function (x, y, predicate, fastCheck, camera) {
  13136. var _this = this;
  13137. /// <summary>Launch a ray to try to pick a mesh in the scene</summary>
  13138. /// <param name="x">X position on screen</param>
  13139. /// <param name="y">Y position on screen</param>
  13140. /// <param name="predicate">Predicate function used to determine eligible meshes. Can be set to null. In this case, a mesh must be enabled, visible and with isPickable set to true</param>
  13141. /// <param name="fastCheck">Launch a fast check only using the bounding boxes. Can be set to null.</param>
  13142. /// <param name="camera">camera to use for computing the picking ray. Can be set to null. In this case, the scene.activeCamera will be used</param>
  13143. return this._internalPick(function (world) { return _this.createPickingRay(x, y, world, camera); }, predicate, fastCheck);
  13144. };
  13145. Scene.prototype.pickSprite = function (x, y, predicate, fastCheck, camera) {
  13146. /// <summary>Launch a ray to try to pick a mesh in the scene</summary>
  13147. /// <param name="x">X position on screen</param>
  13148. /// <param name="y">Y position on screen</param>
  13149. /// <param name="predicate">Predicate function used to determine eligible sprites. Can be set to null. In this case, a sprite must have isPickable set to true</param>
  13150. /// <param name="fastCheck">Launch a fast check only using the bounding boxes. Can be set to null.</param>
  13151. /// <param name="camera">camera to use for computing the picking ray. Can be set to null. In this case, the scene.activeCamera will be used</param>
  13152. return this._internalPickSprites(this.createPickingRayInCameraSpace(x, y, camera), predicate, fastCheck, camera);
  13153. };
  13154. Scene.prototype.pickWithRay = function (ray, predicate, fastCheck) {
  13155. var _this = this;
  13156. return this._internalPick(function (world) {
  13157. if (!_this._pickWithRayInverseMatrix) {
  13158. _this._pickWithRayInverseMatrix = BABYLON.Matrix.Identity();
  13159. }
  13160. world.invertToRef(_this._pickWithRayInverseMatrix);
  13161. return BABYLON.Ray.Transform(ray, _this._pickWithRayInverseMatrix);
  13162. }, predicate, fastCheck);
  13163. };
  13164. Scene.prototype.setPointerOverMesh = function (mesh) {
  13165. if (this._pointerOverMesh === mesh) {
  13166. return;
  13167. }
  13168. if (this._pointerOverMesh && this._pointerOverMesh.actionManager) {
  13169. this._pointerOverMesh.actionManager.processTrigger(BABYLON.ActionManager.OnPointerOutTrigger, BABYLON.ActionEvent.CreateNew(this._pointerOverMesh));
  13170. }
  13171. this._pointerOverMesh = mesh;
  13172. if (this._pointerOverMesh && this._pointerOverMesh.actionManager) {
  13173. this._pointerOverMesh.actionManager.processTrigger(BABYLON.ActionManager.OnPointerOverTrigger, BABYLON.ActionEvent.CreateNew(this._pointerOverMesh));
  13174. }
  13175. };
  13176. Scene.prototype.getPointerOverMesh = function () {
  13177. return this._pointerOverMesh;
  13178. };
  13179. // Physics
  13180. Scene.prototype.getPhysicsEngine = function () {
  13181. return this._physicsEngine;
  13182. };
  13183. /**
  13184. * Enables physics to the current scene
  13185. * @param {BABYLON.Vector3} [gravity] - the scene's gravity for the physics engine
  13186. * @param {BABYLON.IPhysicsEnginePlugin} [plugin] - The physics engine to be used. defaults to OimoJS.
  13187. * @return {boolean} was the physics engine initialized
  13188. */
  13189. Scene.prototype.enablePhysics = function (gravity, plugin) {
  13190. if (this._physicsEngine) {
  13191. return true;
  13192. }
  13193. this._physicsEngine = new BABYLON.PhysicsEngine(plugin);
  13194. if (!this._physicsEngine.isSupported()) {
  13195. this._physicsEngine = null;
  13196. return false;
  13197. }
  13198. this._physicsEngine._initialize(gravity);
  13199. return true;
  13200. };
  13201. Scene.prototype.disablePhysicsEngine = function () {
  13202. if (!this._physicsEngine) {
  13203. return;
  13204. }
  13205. this._physicsEngine.dispose();
  13206. this._physicsEngine = undefined;
  13207. };
  13208. Scene.prototype.isPhysicsEnabled = function () {
  13209. return this._physicsEngine !== undefined;
  13210. };
  13211. /**
  13212. * Sets the gravity of the physics engine (and NOT of the scene)
  13213. * @param {BABYLON.Vector3} [gravity] - the new gravity to be used
  13214. */
  13215. Scene.prototype.setGravity = function (gravity) {
  13216. if (!this._physicsEngine) {
  13217. return;
  13218. }
  13219. this._physicsEngine._setGravity(gravity);
  13220. };
  13221. Scene.prototype.createCompoundImpostor = function (parts, options) {
  13222. if (parts.parts) {
  13223. options = parts;
  13224. parts = parts.parts;
  13225. }
  13226. if (!this._physicsEngine) {
  13227. return null;
  13228. }
  13229. for (var index = 0; index < parts.length; index++) {
  13230. var mesh = parts[index].mesh;
  13231. mesh._physicImpostor = parts[index].impostor;
  13232. mesh._physicsMass = options.mass / parts.length;
  13233. mesh._physicsFriction = options.friction;
  13234. mesh._physicRestitution = options.restitution;
  13235. }
  13236. return this._physicsEngine._registerMeshesAsCompound(parts, options);
  13237. };
  13238. Scene.prototype.deleteCompoundImpostor = function (compound) {
  13239. for (var index = 0; index < compound.parts.length; index++) {
  13240. var mesh = compound.parts[index].mesh;
  13241. mesh._physicImpostor = BABYLON.PhysicsEngine.NoImpostor;
  13242. this._physicsEngine._unregisterMesh(mesh);
  13243. }
  13244. };
  13245. // Misc.
  13246. Scene.prototype.createDefaultCameraOrLight = function () {
  13247. // Light
  13248. if (this.lights.length === 0) {
  13249. new BABYLON.HemisphericLight("default light", BABYLON.Vector3.Up(), this);
  13250. }
  13251. // Camera
  13252. if (!this.activeCamera) {
  13253. var camera = new BABYLON.FreeCamera("default camera", BABYLON.Vector3.Zero(), this);
  13254. // Compute position
  13255. var worldExtends = this.getWorldExtends();
  13256. var worldCenter = worldExtends.min.add(worldExtends.max.subtract(worldExtends.min).scale(0.5));
  13257. camera.position = new BABYLON.Vector3(worldCenter.x, worldCenter.y, worldExtends.min.z - (worldExtends.max.z - worldExtends.min.z));
  13258. camera.setTarget(worldCenter);
  13259. this.activeCamera = camera;
  13260. }
  13261. };
  13262. // Tags
  13263. Scene.prototype._getByTags = function (list, tagsQuery, forEach) {
  13264. if (tagsQuery === undefined) {
  13265. // returns the complete list (could be done with BABYLON.Tags.MatchesQuery but no need to have a for-loop here)
  13266. return list;
  13267. }
  13268. var listByTags = [];
  13269. forEach = forEach || (function (item) { return; });
  13270. for (var i in list) {
  13271. var item = list[i];
  13272. if (BABYLON.Tags.MatchesQuery(item, tagsQuery)) {
  13273. listByTags.push(item);
  13274. forEach(item);
  13275. }
  13276. }
  13277. return listByTags;
  13278. };
  13279. Scene.prototype.getMeshesByTags = function (tagsQuery, forEach) {
  13280. return this._getByTags(this.meshes, tagsQuery, forEach);
  13281. };
  13282. Scene.prototype.getCamerasByTags = function (tagsQuery, forEach) {
  13283. return this._getByTags(this.cameras, tagsQuery, forEach);
  13284. };
  13285. Scene.prototype.getLightsByTags = function (tagsQuery, forEach) {
  13286. return this._getByTags(this.lights, tagsQuery, forEach);
  13287. };
  13288. Scene.prototype.getMaterialByTags = function (tagsQuery, forEach) {
  13289. return this._getByTags(this.materials, tagsQuery, forEach).concat(this._getByTags(this.multiMaterials, tagsQuery, forEach));
  13290. };
  13291. // Statics
  13292. Scene._FOGMODE_NONE = 0;
  13293. Scene._FOGMODE_EXP = 1;
  13294. Scene._FOGMODE_EXP2 = 2;
  13295. Scene._FOGMODE_LINEAR = 3;
  13296. Scene.MinDeltaTime = 1.0;
  13297. Scene.MaxDeltaTime = 1000.0;
  13298. return Scene;
  13299. })();
  13300. BABYLON.Scene = Scene;
  13301. })(BABYLON || (BABYLON = {}));
  13302. var BABYLON;
  13303. (function (BABYLON) {
  13304. var VertexBuffer = (function () {
  13305. function VertexBuffer(engine, data, kind, updatable, postponeInternalCreation, stride) {
  13306. if (engine instanceof BABYLON.Mesh) {
  13307. this._engine = engine.getScene().getEngine();
  13308. }
  13309. else {
  13310. this._engine = engine;
  13311. }
  13312. this._updatable = updatable;
  13313. this._data = data;
  13314. if (!postponeInternalCreation) {
  13315. this.create();
  13316. }
  13317. this._kind = kind;
  13318. if (stride) {
  13319. this._strideSize = stride;
  13320. return;
  13321. }
  13322. // Deduce stride from kind
  13323. switch (kind) {
  13324. case VertexBuffer.PositionKind:
  13325. this._strideSize = 3;
  13326. break;
  13327. case VertexBuffer.NormalKind:
  13328. this._strideSize = 3;
  13329. break;
  13330. case VertexBuffer.UVKind:
  13331. case VertexBuffer.UV2Kind:
  13332. case VertexBuffer.UV3Kind:
  13333. case VertexBuffer.UV4Kind:
  13334. case VertexBuffer.UV5Kind:
  13335. case VertexBuffer.UV6Kind:
  13336. this._strideSize = 2;
  13337. break;
  13338. case VertexBuffer.ColorKind:
  13339. this._strideSize = 4;
  13340. break;
  13341. case VertexBuffer.MatricesIndicesKind:
  13342. this._strideSize = 4;
  13343. break;
  13344. case VertexBuffer.MatricesWeightsKind:
  13345. this._strideSize = 4;
  13346. break;
  13347. }
  13348. }
  13349. // Properties
  13350. VertexBuffer.prototype.isUpdatable = function () {
  13351. return this._updatable;
  13352. };
  13353. VertexBuffer.prototype.getData = function () {
  13354. return this._data;
  13355. };
  13356. VertexBuffer.prototype.getBuffer = function () {
  13357. return this._buffer;
  13358. };
  13359. VertexBuffer.prototype.getStrideSize = function () {
  13360. return this._strideSize;
  13361. };
  13362. // Methods
  13363. VertexBuffer.prototype.create = function (data) {
  13364. if (!data && this._buffer) {
  13365. return; // nothing to do
  13366. }
  13367. data = data || this._data;
  13368. if (!this._buffer) {
  13369. if (this._updatable) {
  13370. this._buffer = this._engine.createDynamicVertexBuffer(data.length * 4);
  13371. }
  13372. else {
  13373. this._buffer = this._engine.createVertexBuffer(data);
  13374. }
  13375. }
  13376. if (this._updatable) {
  13377. this._engine.updateDynamicVertexBuffer(this._buffer, data);
  13378. this._data = data;
  13379. }
  13380. };
  13381. VertexBuffer.prototype.update = function (data) {
  13382. this.create(data);
  13383. };
  13384. VertexBuffer.prototype.updateDirectly = function (data, offset) {
  13385. if (!this._buffer) {
  13386. return;
  13387. }
  13388. if (this._updatable) {
  13389. this._engine.updateDynamicVertexBuffer(this._buffer, data, offset);
  13390. this._data = null;
  13391. }
  13392. };
  13393. VertexBuffer.prototype.dispose = function () {
  13394. if (!this._buffer) {
  13395. return;
  13396. }
  13397. if (this._engine._releaseBuffer(this._buffer)) {
  13398. this._buffer = null;
  13399. }
  13400. };
  13401. Object.defineProperty(VertexBuffer, "PositionKind", {
  13402. get: function () {
  13403. return VertexBuffer._PositionKind;
  13404. },
  13405. enumerable: true,
  13406. configurable: true
  13407. });
  13408. Object.defineProperty(VertexBuffer, "NormalKind", {
  13409. get: function () {
  13410. return VertexBuffer._NormalKind;
  13411. },
  13412. enumerable: true,
  13413. configurable: true
  13414. });
  13415. Object.defineProperty(VertexBuffer, "UVKind", {
  13416. get: function () {
  13417. return VertexBuffer._UVKind;
  13418. },
  13419. enumerable: true,
  13420. configurable: true
  13421. });
  13422. Object.defineProperty(VertexBuffer, "UV2Kind", {
  13423. get: function () {
  13424. return VertexBuffer._UV2Kind;
  13425. },
  13426. enumerable: true,
  13427. configurable: true
  13428. });
  13429. Object.defineProperty(VertexBuffer, "UV3Kind", {
  13430. get: function () {
  13431. return VertexBuffer._UV3Kind;
  13432. },
  13433. enumerable: true,
  13434. configurable: true
  13435. });
  13436. Object.defineProperty(VertexBuffer, "UV4Kind", {
  13437. get: function () {
  13438. return VertexBuffer._UV4Kind;
  13439. },
  13440. enumerable: true,
  13441. configurable: true
  13442. });
  13443. Object.defineProperty(VertexBuffer, "UV5Kind", {
  13444. get: function () {
  13445. return VertexBuffer._UV5Kind;
  13446. },
  13447. enumerable: true,
  13448. configurable: true
  13449. });
  13450. Object.defineProperty(VertexBuffer, "UV6Kind", {
  13451. get: function () {
  13452. return VertexBuffer._UV6Kind;
  13453. },
  13454. enumerable: true,
  13455. configurable: true
  13456. });
  13457. Object.defineProperty(VertexBuffer, "ColorKind", {
  13458. get: function () {
  13459. return VertexBuffer._ColorKind;
  13460. },
  13461. enumerable: true,
  13462. configurable: true
  13463. });
  13464. Object.defineProperty(VertexBuffer, "MatricesIndicesKind", {
  13465. get: function () {
  13466. return VertexBuffer._MatricesIndicesKind;
  13467. },
  13468. enumerable: true,
  13469. configurable: true
  13470. });
  13471. Object.defineProperty(VertexBuffer, "MatricesWeightsKind", {
  13472. get: function () {
  13473. return VertexBuffer._MatricesWeightsKind;
  13474. },
  13475. enumerable: true,
  13476. configurable: true
  13477. });
  13478. // Enums
  13479. VertexBuffer._PositionKind = "position";
  13480. VertexBuffer._NormalKind = "normal";
  13481. VertexBuffer._UVKind = "uv";
  13482. VertexBuffer._UV2Kind = "uv2";
  13483. VertexBuffer._UV3Kind = "uv3";
  13484. VertexBuffer._UV4Kind = "uv4";
  13485. VertexBuffer._UV5Kind = "uv5";
  13486. VertexBuffer._UV6Kind = "uv6";
  13487. VertexBuffer._ColorKind = "color";
  13488. VertexBuffer._MatricesIndicesKind = "matricesIndices";
  13489. VertexBuffer._MatricesWeightsKind = "matricesWeights";
  13490. return VertexBuffer;
  13491. })();
  13492. BABYLON.VertexBuffer = VertexBuffer;
  13493. })(BABYLON || (BABYLON = {}));
  13494. var BABYLON;
  13495. (function (BABYLON) {
  13496. /**
  13497. * Creates an instance based on a source mesh.
  13498. */
  13499. var InstancedMesh = (function (_super) {
  13500. __extends(InstancedMesh, _super);
  13501. function InstancedMesh(name, source) {
  13502. _super.call(this, name, source.getScene());
  13503. source.instances.push(this);
  13504. this._sourceMesh = source;
  13505. this.position.copyFrom(source.position);
  13506. this.rotation.copyFrom(source.rotation);
  13507. this.scaling.copyFrom(source.scaling);
  13508. if (source.rotationQuaternion) {
  13509. this.rotationQuaternion = source.rotationQuaternion.clone();
  13510. }
  13511. this.infiniteDistance = source.infiniteDistance;
  13512. this.setPivotMatrix(source.getPivotMatrix());
  13513. this.refreshBoundingInfo();
  13514. this._syncSubMeshes();
  13515. }
  13516. Object.defineProperty(InstancedMesh.prototype, "receiveShadows", {
  13517. // Methods
  13518. get: function () {
  13519. return this._sourceMesh.receiveShadows;
  13520. },
  13521. enumerable: true,
  13522. configurable: true
  13523. });
  13524. Object.defineProperty(InstancedMesh.prototype, "material", {
  13525. get: function () {
  13526. return this._sourceMesh.material;
  13527. },
  13528. enumerable: true,
  13529. configurable: true
  13530. });
  13531. Object.defineProperty(InstancedMesh.prototype, "visibility", {
  13532. get: function () {
  13533. return this._sourceMesh.visibility;
  13534. },
  13535. enumerable: true,
  13536. configurable: true
  13537. });
  13538. Object.defineProperty(InstancedMesh.prototype, "skeleton", {
  13539. get: function () {
  13540. return this._sourceMesh.skeleton;
  13541. },
  13542. enumerable: true,
  13543. configurable: true
  13544. });
  13545. InstancedMesh.prototype.getTotalVertices = function () {
  13546. return this._sourceMesh.getTotalVertices();
  13547. };
  13548. Object.defineProperty(InstancedMesh.prototype, "sourceMesh", {
  13549. get: function () {
  13550. return this._sourceMesh;
  13551. },
  13552. enumerable: true,
  13553. configurable: true
  13554. });
  13555. InstancedMesh.prototype.getVerticesData = function (kind) {
  13556. return this._sourceMesh.getVerticesData(kind);
  13557. };
  13558. InstancedMesh.prototype.isVerticesDataPresent = function (kind) {
  13559. return this._sourceMesh.isVerticesDataPresent(kind);
  13560. };
  13561. InstancedMesh.prototype.getIndices = function () {
  13562. return this._sourceMesh.getIndices();
  13563. };
  13564. Object.defineProperty(InstancedMesh.prototype, "_positions", {
  13565. get: function () {
  13566. return this._sourceMesh._positions;
  13567. },
  13568. enumerable: true,
  13569. configurable: true
  13570. });
  13571. InstancedMesh.prototype.refreshBoundingInfo = function () {
  13572. var meshBB = this._sourceMesh.getBoundingInfo();
  13573. this._boundingInfo = new BABYLON.BoundingInfo(meshBB.minimum.clone(), meshBB.maximum.clone());
  13574. this._updateBoundingInfo();
  13575. };
  13576. InstancedMesh.prototype._preActivate = function () {
  13577. if (this._currentLOD) {
  13578. this._currentLOD._preActivate();
  13579. }
  13580. };
  13581. InstancedMesh.prototype._activate = function (renderId) {
  13582. if (this._currentLOD) {
  13583. this._currentLOD._registerInstanceForRenderId(this, renderId);
  13584. }
  13585. };
  13586. InstancedMesh.prototype.getLOD = function (camera) {
  13587. this._currentLOD = this.sourceMesh.getLOD(this.getScene().activeCamera, this.getBoundingInfo().boundingSphere);
  13588. if (this._currentLOD === this.sourceMesh) {
  13589. return this;
  13590. }
  13591. return this._currentLOD;
  13592. };
  13593. InstancedMesh.prototype._syncSubMeshes = function () {
  13594. this.releaseSubMeshes();
  13595. if (this._sourceMesh.subMeshes) {
  13596. for (var index = 0; index < this._sourceMesh.subMeshes.length; index++) {
  13597. this._sourceMesh.subMeshes[index].clone(this, this._sourceMesh);
  13598. }
  13599. }
  13600. };
  13601. InstancedMesh.prototype._generatePointsArray = function () {
  13602. return this._sourceMesh._generatePointsArray();
  13603. };
  13604. // Clone
  13605. InstancedMesh.prototype.clone = function (name, newParent, doNotCloneChildren) {
  13606. var result = this._sourceMesh.createInstance(name);
  13607. // Deep copy
  13608. BABYLON.Tools.DeepCopy(this, result, ["name"], []);
  13609. // Bounding info
  13610. this.refreshBoundingInfo();
  13611. // Parent
  13612. if (newParent) {
  13613. result.parent = newParent;
  13614. }
  13615. if (!doNotCloneChildren) {
  13616. // Children
  13617. for (var index = 0; index < this.getScene().meshes.length; index++) {
  13618. var mesh = this.getScene().meshes[index];
  13619. if (mesh.parent === this) {
  13620. mesh.clone(mesh.name, result);
  13621. }
  13622. }
  13623. }
  13624. result.computeWorldMatrix(true);
  13625. return result;
  13626. };
  13627. // Dispoe
  13628. InstancedMesh.prototype.dispose = function (doNotRecurse) {
  13629. // Remove from mesh
  13630. var index = this._sourceMesh.instances.indexOf(this);
  13631. this._sourceMesh.instances.splice(index, 1);
  13632. _super.prototype.dispose.call(this, doNotRecurse);
  13633. };
  13634. return InstancedMesh;
  13635. })(BABYLON.AbstractMesh);
  13636. BABYLON.InstancedMesh = InstancedMesh;
  13637. })(BABYLON || (BABYLON = {}));
  13638. var BABYLON;
  13639. (function (BABYLON) {
  13640. var _InstancesBatch = (function () {
  13641. function _InstancesBatch() {
  13642. this.mustReturn = false;
  13643. this.visibleInstances = new Array();
  13644. this.renderSelf = new Array();
  13645. }
  13646. return _InstancesBatch;
  13647. })();
  13648. BABYLON._InstancesBatch = _InstancesBatch;
  13649. var Mesh = (function (_super) {
  13650. __extends(Mesh, _super);
  13651. /**
  13652. * @constructor
  13653. * @param {string} name - The value used by scene.getMeshByName() to do a lookup.
  13654. * @param {Scene} scene - The scene to add this mesh to.
  13655. * @param {Node} parent - The parent of this mesh, if it has one
  13656. * @param {Mesh} source - An optional Mesh from which geometry is shared, cloned.
  13657. * @param {boolean} doNotCloneChildren - When cloning, skip cloning child meshes of source, default False.
  13658. * When false, achieved by calling a clone(), also passing False.
  13659. * This will make creation of children, recursive.
  13660. */
  13661. function Mesh(name, scene, parent, source, doNotCloneChildren) {
  13662. if (parent === void 0) { parent = null; }
  13663. _super.call(this, name, scene);
  13664. // Members
  13665. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NONE;
  13666. this.instances = new Array();
  13667. this._LODLevels = new Array();
  13668. this._onBeforeRenderCallbacks = new Array();
  13669. this._onAfterRenderCallbacks = new Array();
  13670. this._visibleInstances = {};
  13671. this._renderIdForInstances = new Array();
  13672. this._batchCache = new _InstancesBatch();
  13673. this._instancesBufferSize = 32 * 16 * 4; // let's start with a maximum of 32 instances
  13674. this._sideOrientation = Mesh._DEFAULTSIDE;
  13675. this._areNormalsFrozen = false; // Will be used by ribbons mainly
  13676. if (source) {
  13677. // Geometry
  13678. if (source._geometry) {
  13679. source._geometry.applyToMesh(this);
  13680. }
  13681. // Deep copy
  13682. BABYLON.Tools.DeepCopy(source, this, ["name", "material", "skeleton", "instances"], []);
  13683. this.id = name + "." + source.id;
  13684. // Material
  13685. this.material = source.material;
  13686. var index;
  13687. if (!doNotCloneChildren) {
  13688. // Children
  13689. for (index = 0; index < scene.meshes.length; index++) {
  13690. var mesh = scene.meshes[index];
  13691. if (mesh.parent === source) {
  13692. // doNotCloneChildren is always going to be False
  13693. var newChild = mesh.clone(name + "." + mesh.name, this, doNotCloneChildren);
  13694. }
  13695. }
  13696. }
  13697. // Particles
  13698. for (index = 0; index < scene.particleSystems.length; index++) {
  13699. var system = scene.particleSystems[index];
  13700. if (system.emitter === source) {
  13701. system.clone(system.name, this);
  13702. }
  13703. }
  13704. this.computeWorldMatrix(true);
  13705. }
  13706. // Parent
  13707. if (parent !== null) {
  13708. this.parent = parent;
  13709. }
  13710. }
  13711. Object.defineProperty(Mesh, "FRONTSIDE", {
  13712. get: function () {
  13713. return Mesh._FRONTSIDE;
  13714. },
  13715. enumerable: true,
  13716. configurable: true
  13717. });
  13718. Object.defineProperty(Mesh, "BACKSIDE", {
  13719. get: function () {
  13720. return Mesh._BACKSIDE;
  13721. },
  13722. enumerable: true,
  13723. configurable: true
  13724. });
  13725. Object.defineProperty(Mesh, "DOUBLESIDE", {
  13726. get: function () {
  13727. return Mesh._DOUBLESIDE;
  13728. },
  13729. enumerable: true,
  13730. configurable: true
  13731. });
  13732. Object.defineProperty(Mesh, "DEFAULTSIDE", {
  13733. get: function () {
  13734. return Mesh._DEFAULTSIDE;
  13735. },
  13736. enumerable: true,
  13737. configurable: true
  13738. });
  13739. Object.defineProperty(Mesh, "NO_CAP", {
  13740. get: function () {
  13741. return Mesh._NO_CAP;
  13742. },
  13743. enumerable: true,
  13744. configurable: true
  13745. });
  13746. Object.defineProperty(Mesh, "CAP_START", {
  13747. get: function () {
  13748. return Mesh._CAP_START;
  13749. },
  13750. enumerable: true,
  13751. configurable: true
  13752. });
  13753. Object.defineProperty(Mesh, "CAP_END", {
  13754. get: function () {
  13755. return Mesh._CAP_END;
  13756. },
  13757. enumerable: true,
  13758. configurable: true
  13759. });
  13760. Object.defineProperty(Mesh, "CAP_ALL", {
  13761. get: function () {
  13762. return Mesh._CAP_ALL;
  13763. },
  13764. enumerable: true,
  13765. configurable: true
  13766. });
  13767. Object.defineProperty(Mesh.prototype, "hasLODLevels", {
  13768. // Methods
  13769. get: function () {
  13770. return this._LODLevels.length > 0;
  13771. },
  13772. enumerable: true,
  13773. configurable: true
  13774. });
  13775. Mesh.prototype._sortLODLevels = function () {
  13776. this._LODLevels.sort(function (a, b) {
  13777. if (a.distance < b.distance) {
  13778. return 1;
  13779. }
  13780. if (a.distance > b.distance) {
  13781. return -1;
  13782. }
  13783. return 0;
  13784. });
  13785. };
  13786. /**
  13787. * Add a mesh as LOD level triggered at the given distance.
  13788. * @param {number} distance - the distance from the center of the object to show this level
  13789. * @param {BABYLON.Mesh} mesh - the mesh to be added as LOD level
  13790. * @return {BABYLON.Mesh} this mesh (for chaining)
  13791. */
  13792. Mesh.prototype.addLODLevel = function (distance, mesh) {
  13793. if (mesh && mesh._masterMesh) {
  13794. BABYLON.Tools.Warn("You cannot use a mesh as LOD level twice");
  13795. return this;
  13796. }
  13797. var level = new BABYLON.Internals.MeshLODLevel(distance, mesh);
  13798. this._LODLevels.push(level);
  13799. if (mesh) {
  13800. mesh._masterMesh = this;
  13801. }
  13802. this._sortLODLevels();
  13803. return this;
  13804. };
  13805. Mesh.prototype.getLODLevelAtDistance = function (distance) {
  13806. for (var index = 0; index < this._LODLevels.length; index++) {
  13807. var level = this._LODLevels[index];
  13808. if (level.distance === distance) {
  13809. return level.mesh;
  13810. }
  13811. }
  13812. return null;
  13813. };
  13814. /**
  13815. * Remove a mesh from the LOD array
  13816. * @param {BABYLON.Mesh} mesh - the mesh to be removed.
  13817. * @return {BABYLON.Mesh} this mesh (for chaining)
  13818. */
  13819. Mesh.prototype.removeLODLevel = function (mesh) {
  13820. for (var index = 0; index < this._LODLevels.length; index++) {
  13821. if (this._LODLevels[index].mesh === mesh) {
  13822. this._LODLevels.splice(index, 1);
  13823. if (mesh) {
  13824. mesh._masterMesh = null;
  13825. }
  13826. }
  13827. }
  13828. this._sortLODLevels();
  13829. return this;
  13830. };
  13831. Mesh.prototype.getLOD = function (camera, boundingSphere) {
  13832. if (!this._LODLevels || this._LODLevels.length === 0) {
  13833. return this;
  13834. }
  13835. var distanceToCamera = (boundingSphere ? boundingSphere : this.getBoundingInfo().boundingSphere).centerWorld.subtract(camera.position).length();
  13836. if (this._LODLevels[this._LODLevels.length - 1].distance > distanceToCamera) {
  13837. if (this.onLODLevelSelection) {
  13838. this.onLODLevelSelection(distanceToCamera, this, this._LODLevels[this._LODLevels.length - 1].mesh);
  13839. }
  13840. return this;
  13841. }
  13842. for (var index = 0; index < this._LODLevels.length; index++) {
  13843. var level = this._LODLevels[index];
  13844. if (level.distance < distanceToCamera) {
  13845. if (level.mesh) {
  13846. level.mesh._preActivate();
  13847. level.mesh._updateSubMeshesBoundingInfo(this.worldMatrixFromCache);
  13848. }
  13849. if (this.onLODLevelSelection) {
  13850. this.onLODLevelSelection(distanceToCamera, this, level.mesh);
  13851. }
  13852. return level.mesh;
  13853. }
  13854. }
  13855. if (this.onLODLevelSelection) {
  13856. this.onLODLevelSelection(distanceToCamera, this, this);
  13857. }
  13858. return this;
  13859. };
  13860. Object.defineProperty(Mesh.prototype, "geometry", {
  13861. get: function () {
  13862. return this._geometry;
  13863. },
  13864. enumerable: true,
  13865. configurable: true
  13866. });
  13867. Mesh.prototype.getTotalVertices = function () {
  13868. if (!this._geometry) {
  13869. return 0;
  13870. }
  13871. return this._geometry.getTotalVertices();
  13872. };
  13873. Mesh.prototype.getVerticesData = function (kind, copyWhenShared) {
  13874. if (!this._geometry) {
  13875. return null;
  13876. }
  13877. return this._geometry.getVerticesData(kind, copyWhenShared);
  13878. };
  13879. Mesh.prototype.getVertexBuffer = function (kind) {
  13880. if (!this._geometry) {
  13881. return undefined;
  13882. }
  13883. return this._geometry.getVertexBuffer(kind);
  13884. };
  13885. Mesh.prototype.isVerticesDataPresent = function (kind) {
  13886. if (!this._geometry) {
  13887. if (this._delayInfo) {
  13888. return this._delayInfo.indexOf(kind) !== -1;
  13889. }
  13890. return false;
  13891. }
  13892. return this._geometry.isVerticesDataPresent(kind);
  13893. };
  13894. Mesh.prototype.getVerticesDataKinds = function () {
  13895. if (!this._geometry) {
  13896. var result = [];
  13897. if (this._delayInfo) {
  13898. for (var kind in this._delayInfo) {
  13899. result.push(kind);
  13900. }
  13901. }
  13902. return result;
  13903. }
  13904. return this._geometry.getVerticesDataKinds();
  13905. };
  13906. Mesh.prototype.getTotalIndices = function () {
  13907. if (!this._geometry) {
  13908. return 0;
  13909. }
  13910. return this._geometry.getTotalIndices();
  13911. };
  13912. Mesh.prototype.getIndices = function (copyWhenShared) {
  13913. if (!this._geometry) {
  13914. return [];
  13915. }
  13916. return this._geometry.getIndices(copyWhenShared);
  13917. };
  13918. Object.defineProperty(Mesh.prototype, "isBlocked", {
  13919. get: function () {
  13920. return this._masterMesh !== null && this._masterMesh !== undefined;
  13921. },
  13922. enumerable: true,
  13923. configurable: true
  13924. });
  13925. Mesh.prototype.isReady = function () {
  13926. if (this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADING) {
  13927. return false;
  13928. }
  13929. return _super.prototype.isReady.call(this);
  13930. };
  13931. Mesh.prototype.isDisposed = function () {
  13932. return this._isDisposed;
  13933. };
  13934. Object.defineProperty(Mesh.prototype, "sideOrientation", {
  13935. get: function () {
  13936. return this._sideOrientation;
  13937. },
  13938. set: function (sideO) {
  13939. this._sideOrientation = sideO;
  13940. },
  13941. enumerable: true,
  13942. configurable: true
  13943. });
  13944. Object.defineProperty(Mesh.prototype, "areNormalsFrozen", {
  13945. get: function () {
  13946. return this._areNormalsFrozen;
  13947. },
  13948. enumerable: true,
  13949. configurable: true
  13950. });
  13951. /** This function affects parametric shapes on update only : ribbons, tubes, etc. It has no effect at all on other shapes */
  13952. Mesh.prototype.freezeNormals = function () {
  13953. this._areNormalsFrozen = true;
  13954. };
  13955. /** This function affects parametric shapes on update only : ribbons, tubes, etc. It has no effect at all on other shapes */
  13956. Mesh.prototype.unfreezeNormals = function () {
  13957. this._areNormalsFrozen = false;
  13958. };
  13959. // Methods
  13960. Mesh.prototype._preActivate = function () {
  13961. var sceneRenderId = this.getScene().getRenderId();
  13962. if (this._preActivateId === sceneRenderId) {
  13963. return;
  13964. }
  13965. this._preActivateId = sceneRenderId;
  13966. this._visibleInstances = null;
  13967. };
  13968. Mesh.prototype._registerInstanceForRenderId = function (instance, renderId) {
  13969. if (!this._visibleInstances) {
  13970. this._visibleInstances = {};
  13971. this._visibleInstances.defaultRenderId = renderId;
  13972. this._visibleInstances.selfDefaultRenderId = this._renderId;
  13973. }
  13974. if (!this._visibleInstances[renderId]) {
  13975. this._visibleInstances[renderId] = new Array();
  13976. }
  13977. this._visibleInstances[renderId].push(instance);
  13978. };
  13979. Mesh.prototype.refreshBoundingInfo = function () {
  13980. var data = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  13981. if (data) {
  13982. var extend = BABYLON.Tools.ExtractMinAndMax(data, 0, this.getTotalVertices());
  13983. this._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  13984. }
  13985. if (this.subMeshes) {
  13986. for (var index = 0; index < this.subMeshes.length; index++) {
  13987. this.subMeshes[index].refreshBoundingInfo();
  13988. }
  13989. }
  13990. this._updateBoundingInfo();
  13991. };
  13992. Mesh.prototype._createGlobalSubMesh = function () {
  13993. var totalVertices = this.getTotalVertices();
  13994. if (!totalVertices || !this.getIndices()) {
  13995. return null;
  13996. }
  13997. this.releaseSubMeshes();
  13998. return new BABYLON.SubMesh(0, 0, totalVertices, 0, this.getTotalIndices(), this);
  13999. };
  14000. Mesh.prototype.subdivide = function (count) {
  14001. if (count < 1) {
  14002. return;
  14003. }
  14004. var totalIndices = this.getTotalIndices();
  14005. var subdivisionSize = (totalIndices / count) | 0;
  14006. var offset = 0;
  14007. // Ensure that subdivisionSize is a multiple of 3
  14008. while (subdivisionSize % 3 !== 0) {
  14009. subdivisionSize++;
  14010. }
  14011. this.releaseSubMeshes();
  14012. for (var index = 0; index < count; index++) {
  14013. if (offset >= totalIndices) {
  14014. break;
  14015. }
  14016. BABYLON.SubMesh.CreateFromIndices(0, offset, Math.min(subdivisionSize, totalIndices - offset), this);
  14017. offset += subdivisionSize;
  14018. }
  14019. this.synchronizeInstances();
  14020. };
  14021. Mesh.prototype.setVerticesData = function (kind, data, updatable, stride) {
  14022. if (!this._geometry) {
  14023. var vertexData = new BABYLON.VertexData();
  14024. vertexData.set(data, kind);
  14025. var scene = this.getScene();
  14026. new BABYLON.Geometry(BABYLON.Geometry.RandomId(), scene, vertexData, updatable, this);
  14027. }
  14028. else {
  14029. this._geometry.setVerticesData(kind, data, updatable, stride);
  14030. }
  14031. };
  14032. Mesh.prototype.updateVerticesData = function (kind, data, updateExtends, makeItUnique) {
  14033. if (!this._geometry) {
  14034. return;
  14035. }
  14036. if (!makeItUnique) {
  14037. this._geometry.updateVerticesData(kind, data, updateExtends);
  14038. }
  14039. else {
  14040. this.makeGeometryUnique();
  14041. this.updateVerticesData(kind, data, updateExtends, false);
  14042. }
  14043. };
  14044. Mesh.prototype.updateVerticesDataDirectly = function (kind, data, offset, makeItUnique) {
  14045. BABYLON.Tools.Warn("Mesh.updateVerticesDataDirectly deprecated since 2.3.");
  14046. if (!this._geometry) {
  14047. return;
  14048. }
  14049. if (!makeItUnique) {
  14050. this._geometry.updateVerticesDataDirectly(kind, data, offset);
  14051. }
  14052. else {
  14053. this.makeGeometryUnique();
  14054. this.updateVerticesDataDirectly(kind, data, offset, false);
  14055. }
  14056. };
  14057. // Mesh positions update function :
  14058. // updates the mesh positions according to the positionFunction returned values.
  14059. // The positionFunction argument must be a javascript function accepting the mesh "positions" array as parameter.
  14060. // This dedicated positionFunction computes new mesh positions according to the given mesh type.
  14061. Mesh.prototype.updateMeshPositions = function (positionFunction, computeNormals) {
  14062. if (computeNormals === void 0) { computeNormals = true; }
  14063. var positions = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  14064. positionFunction(positions);
  14065. this.updateVerticesData(BABYLON.VertexBuffer.PositionKind, positions, false, false);
  14066. if (computeNormals) {
  14067. var indices = this.getIndices();
  14068. var normals = this.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  14069. BABYLON.VertexData.ComputeNormals(positions, indices, normals);
  14070. this.updateVerticesData(BABYLON.VertexBuffer.NormalKind, normals, false, false);
  14071. }
  14072. };
  14073. Mesh.prototype.makeGeometryUnique = function () {
  14074. if (!this._geometry) {
  14075. return;
  14076. }
  14077. var geometry = this._geometry.copy(BABYLON.Geometry.RandomId());
  14078. geometry.applyToMesh(this);
  14079. };
  14080. Mesh.prototype.setIndices = function (indices, totalVertices) {
  14081. if (!this._geometry) {
  14082. var vertexData = new BABYLON.VertexData();
  14083. vertexData.indices = indices;
  14084. var scene = this.getScene();
  14085. new BABYLON.Geometry(BABYLON.Geometry.RandomId(), scene, vertexData, false, this);
  14086. }
  14087. else {
  14088. this._geometry.setIndices(indices, totalVertices);
  14089. }
  14090. };
  14091. Mesh.prototype._bind = function (subMesh, effect, fillMode) {
  14092. var engine = this.getScene().getEngine();
  14093. // Wireframe
  14094. var indexToBind;
  14095. switch (fillMode) {
  14096. case BABYLON.Material.PointFillMode:
  14097. indexToBind = null;
  14098. break;
  14099. case BABYLON.Material.WireFrameFillMode:
  14100. indexToBind = subMesh.getLinesIndexBuffer(this.getIndices(), engine);
  14101. break;
  14102. default:
  14103. case BABYLON.Material.TriangleFillMode:
  14104. indexToBind = this._geometry.getIndexBuffer();
  14105. break;
  14106. }
  14107. // VBOs
  14108. engine.bindMultiBuffers(this._geometry.getVertexBuffers(), indexToBind, effect);
  14109. };
  14110. Mesh.prototype._draw = function (subMesh, fillMode, instancesCount) {
  14111. if (!this._geometry || !this._geometry.getVertexBuffers() || !this._geometry.getIndexBuffer()) {
  14112. return;
  14113. }
  14114. var engine = this.getScene().getEngine();
  14115. // Draw order
  14116. switch (fillMode) {
  14117. case BABYLON.Material.PointFillMode:
  14118. engine.drawPointClouds(subMesh.verticesStart, subMesh.verticesCount, instancesCount);
  14119. break;
  14120. case BABYLON.Material.WireFrameFillMode:
  14121. engine.draw(false, 0, subMesh.linesIndexCount, instancesCount);
  14122. break;
  14123. default:
  14124. engine.draw(true, subMesh.indexStart, subMesh.indexCount, instancesCount);
  14125. }
  14126. };
  14127. Mesh.prototype.registerBeforeRender = function (func) {
  14128. this._onBeforeRenderCallbacks.push(func);
  14129. };
  14130. Mesh.prototype.unregisterBeforeRender = function (func) {
  14131. var index = this._onBeforeRenderCallbacks.indexOf(func);
  14132. if (index > -1) {
  14133. this._onBeforeRenderCallbacks.splice(index, 1);
  14134. }
  14135. };
  14136. Mesh.prototype.registerAfterRender = function (func) {
  14137. this._onAfterRenderCallbacks.push(func);
  14138. };
  14139. Mesh.prototype.unregisterAfterRender = function (func) {
  14140. var index = this._onAfterRenderCallbacks.indexOf(func);
  14141. if (index > -1) {
  14142. this._onAfterRenderCallbacks.splice(index, 1);
  14143. }
  14144. };
  14145. Mesh.prototype._getInstancesRenderList = function (subMeshId) {
  14146. var scene = this.getScene();
  14147. this._batchCache.mustReturn = false;
  14148. this._batchCache.renderSelf[subMeshId] = this.isEnabled() && this.isVisible;
  14149. this._batchCache.visibleInstances[subMeshId] = null;
  14150. if (this._visibleInstances) {
  14151. var currentRenderId = scene.getRenderId();
  14152. this._batchCache.visibleInstances[subMeshId] = this._visibleInstances[currentRenderId];
  14153. var selfRenderId = this._renderId;
  14154. if (!this._batchCache.visibleInstances[subMeshId] && this._visibleInstances.defaultRenderId) {
  14155. this._batchCache.visibleInstances[subMeshId] = this._visibleInstances[this._visibleInstances.defaultRenderId];
  14156. currentRenderId = Math.max(this._visibleInstances.defaultRenderId, currentRenderId);
  14157. selfRenderId = Math.max(this._visibleInstances.selfDefaultRenderId, currentRenderId);
  14158. }
  14159. if (this._batchCache.visibleInstances[subMeshId] && this._batchCache.visibleInstances[subMeshId].length) {
  14160. if (this._renderIdForInstances[subMeshId] === currentRenderId) {
  14161. this._batchCache.mustReturn = true;
  14162. return this._batchCache;
  14163. }
  14164. if (currentRenderId !== selfRenderId) {
  14165. this._batchCache.renderSelf[subMeshId] = false;
  14166. }
  14167. }
  14168. this._renderIdForInstances[subMeshId] = currentRenderId;
  14169. }
  14170. return this._batchCache;
  14171. };
  14172. Mesh.prototype._renderWithInstances = function (subMesh, fillMode, batch, effect, engine) {
  14173. var visibleInstances = batch.visibleInstances[subMesh._id];
  14174. var matricesCount = visibleInstances.length + 1;
  14175. var bufferSize = matricesCount * 16 * 4;
  14176. while (this._instancesBufferSize < bufferSize) {
  14177. this._instancesBufferSize *= 2;
  14178. }
  14179. if (!this._worldMatricesInstancesBuffer || this._worldMatricesInstancesBuffer.capacity < this._instancesBufferSize) {
  14180. if (this._worldMatricesInstancesBuffer) {
  14181. engine.deleteInstancesBuffer(this._worldMatricesInstancesBuffer);
  14182. }
  14183. this._worldMatricesInstancesBuffer = engine.createInstancesBuffer(this._instancesBufferSize);
  14184. this._worldMatricesInstancesArray = new Float32Array(this._instancesBufferSize / 4);
  14185. }
  14186. var offset = 0;
  14187. var instancesCount = 0;
  14188. var world = this.getWorldMatrix();
  14189. if (batch.renderSelf[subMesh._id]) {
  14190. world.copyToArray(this._worldMatricesInstancesArray, offset);
  14191. offset += 16;
  14192. instancesCount++;
  14193. }
  14194. if (visibleInstances) {
  14195. for (var instanceIndex = 0; instanceIndex < visibleInstances.length; instanceIndex++) {
  14196. var instance = visibleInstances[instanceIndex];
  14197. instance.getWorldMatrix().copyToArray(this._worldMatricesInstancesArray, offset);
  14198. offset += 16;
  14199. instancesCount++;
  14200. }
  14201. }
  14202. var offsetLocation0 = effect.getAttributeLocationByName("world0");
  14203. var offsetLocation1 = effect.getAttributeLocationByName("world1");
  14204. var offsetLocation2 = effect.getAttributeLocationByName("world2");
  14205. var offsetLocation3 = effect.getAttributeLocationByName("world3");
  14206. var offsetLocations = [offsetLocation0, offsetLocation1, offsetLocation2, offsetLocation3];
  14207. engine.updateAndBindInstancesBuffer(this._worldMatricesInstancesBuffer, this._worldMatricesInstancesArray, offsetLocations);
  14208. this._draw(subMesh, fillMode, instancesCount);
  14209. engine.unBindInstancesBuffer(this._worldMatricesInstancesBuffer, offsetLocations);
  14210. };
  14211. Mesh.prototype._processRendering = function (subMesh, effect, fillMode, batch, hardwareInstancedRendering, onBeforeDraw) {
  14212. var scene = this.getScene();
  14213. var engine = scene.getEngine();
  14214. if (hardwareInstancedRendering) {
  14215. this._renderWithInstances(subMesh, fillMode, batch, effect, engine);
  14216. }
  14217. else {
  14218. if (batch.renderSelf[subMesh._id]) {
  14219. // Draw
  14220. if (onBeforeDraw) {
  14221. onBeforeDraw(false, this.getWorldMatrix());
  14222. }
  14223. this._draw(subMesh, fillMode);
  14224. }
  14225. if (batch.visibleInstances[subMesh._id]) {
  14226. for (var instanceIndex = 0; instanceIndex < batch.visibleInstances[subMesh._id].length; instanceIndex++) {
  14227. var instance = batch.visibleInstances[subMesh._id][instanceIndex];
  14228. // World
  14229. var world = instance.getWorldMatrix();
  14230. if (onBeforeDraw) {
  14231. onBeforeDraw(true, world);
  14232. }
  14233. // Draw
  14234. this._draw(subMesh, fillMode);
  14235. }
  14236. }
  14237. }
  14238. };
  14239. Mesh.prototype.render = function (subMesh, enableAlphaMode) {
  14240. var scene = this.getScene();
  14241. // Managing instances
  14242. var batch = this._getInstancesRenderList(subMesh._id);
  14243. if (batch.mustReturn) {
  14244. return;
  14245. }
  14246. // Checking geometry state
  14247. if (!this._geometry || !this._geometry.getVertexBuffers() || !this._geometry.getIndexBuffer()) {
  14248. return;
  14249. }
  14250. var callbackIndex;
  14251. for (callbackIndex = 0; callbackIndex < this._onBeforeRenderCallbacks.length; callbackIndex++) {
  14252. this._onBeforeRenderCallbacks[callbackIndex](this);
  14253. }
  14254. var engine = scene.getEngine();
  14255. var hardwareInstancedRendering = (engine.getCaps().instancedArrays !== null) && (batch.visibleInstances[subMesh._id] !== null) && (batch.visibleInstances[subMesh._id] !== undefined);
  14256. // Material
  14257. var effectiveMaterial = subMesh.getMaterial();
  14258. if (!effectiveMaterial || !effectiveMaterial.isReady(this, hardwareInstancedRendering)) {
  14259. return;
  14260. }
  14261. // Outline - step 1
  14262. var savedDepthWrite = engine.getDepthWrite();
  14263. if (this.renderOutline) {
  14264. engine.setDepthWrite(false);
  14265. scene.getOutlineRenderer().render(subMesh, batch);
  14266. engine.setDepthWrite(savedDepthWrite);
  14267. }
  14268. effectiveMaterial._preBind();
  14269. var effect = effectiveMaterial.getEffect();
  14270. // Bind
  14271. var fillMode = scene.forcePointsCloud ? BABYLON.Material.PointFillMode : (scene.forceWireframe ? BABYLON.Material.WireFrameFillMode : effectiveMaterial.fillMode);
  14272. this._bind(subMesh, effect, fillMode);
  14273. var world = this.getWorldMatrix();
  14274. effectiveMaterial.bind(world, this);
  14275. // Alpha mode
  14276. if (enableAlphaMode) {
  14277. engine.setAlphaMode(effectiveMaterial.alphaMode);
  14278. }
  14279. // Draw
  14280. this._processRendering(subMesh, effect, fillMode, batch, hardwareInstancedRendering, function (isInstance, world) {
  14281. if (isInstance) {
  14282. effectiveMaterial.bindOnlyWorldMatrix(world);
  14283. }
  14284. });
  14285. // Unbind
  14286. effectiveMaterial.unbind();
  14287. // Outline - step 2
  14288. if (this.renderOutline && savedDepthWrite) {
  14289. engine.setDepthWrite(true);
  14290. engine.setColorWrite(false);
  14291. scene.getOutlineRenderer().render(subMesh, batch);
  14292. engine.setColorWrite(true);
  14293. }
  14294. // Overlay
  14295. if (this.renderOverlay) {
  14296. var currentMode = engine.getAlphaMode();
  14297. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  14298. scene.getOutlineRenderer().render(subMesh, batch, true);
  14299. engine.setAlphaMode(currentMode);
  14300. }
  14301. for (callbackIndex = 0; callbackIndex < this._onAfterRenderCallbacks.length; callbackIndex++) {
  14302. this._onAfterRenderCallbacks[callbackIndex](this);
  14303. }
  14304. };
  14305. Mesh.prototype.getEmittedParticleSystems = function () {
  14306. var results = new Array();
  14307. for (var index = 0; index < this.getScene().particleSystems.length; index++) {
  14308. var particleSystem = this.getScene().particleSystems[index];
  14309. if (particleSystem.emitter === this) {
  14310. results.push(particleSystem);
  14311. }
  14312. }
  14313. return results;
  14314. };
  14315. Mesh.prototype.getHierarchyEmittedParticleSystems = function () {
  14316. var results = new Array();
  14317. var descendants = this.getDescendants();
  14318. descendants.push(this);
  14319. for (var index = 0; index < this.getScene().particleSystems.length; index++) {
  14320. var particleSystem = this.getScene().particleSystems[index];
  14321. if (descendants.indexOf(particleSystem.emitter) !== -1) {
  14322. results.push(particleSystem);
  14323. }
  14324. }
  14325. return results;
  14326. };
  14327. Mesh.prototype.getChildren = function () {
  14328. var results = [];
  14329. for (var index = 0; index < this.getScene().meshes.length; index++) {
  14330. var mesh = this.getScene().meshes[index];
  14331. if (mesh.parent === this) {
  14332. results.push(mesh);
  14333. }
  14334. }
  14335. return results;
  14336. };
  14337. Mesh.prototype._checkDelayState = function () {
  14338. var _this = this;
  14339. var that = this;
  14340. var scene = this.getScene();
  14341. if (this._geometry) {
  14342. this._geometry.load(scene);
  14343. }
  14344. else if (that.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) {
  14345. that.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADING;
  14346. scene._addPendingData(that);
  14347. var getBinaryData = (this.delayLoadingFile.indexOf(".babylonbinarymeshdata") !== -1);
  14348. BABYLON.Tools.LoadFile(this.delayLoadingFile, function (data) {
  14349. if (data instanceof ArrayBuffer) {
  14350. _this._delayLoadingFunction(data, _this);
  14351. }
  14352. else {
  14353. _this._delayLoadingFunction(JSON.parse(data), _this);
  14354. }
  14355. _this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADED;
  14356. scene._removePendingData(_this);
  14357. }, function () { }, scene.database, getBinaryData);
  14358. }
  14359. };
  14360. Mesh.prototype.isInFrustum = function (frustumPlanes) {
  14361. if (this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADING) {
  14362. return false;
  14363. }
  14364. if (!_super.prototype.isInFrustum.call(this, frustumPlanes)) {
  14365. return false;
  14366. }
  14367. this._checkDelayState();
  14368. return true;
  14369. };
  14370. Mesh.prototype.setMaterialByID = function (id) {
  14371. var materials = this.getScene().materials;
  14372. var index;
  14373. for (index = 0; index < materials.length; index++) {
  14374. if (materials[index].id === id) {
  14375. this.material = materials[index];
  14376. return;
  14377. }
  14378. }
  14379. // Multi
  14380. var multiMaterials = this.getScene().multiMaterials;
  14381. for (index = 0; index < multiMaterials.length; index++) {
  14382. if (multiMaterials[index].id === id) {
  14383. this.material = multiMaterials[index];
  14384. return;
  14385. }
  14386. }
  14387. };
  14388. Mesh.prototype.getAnimatables = function () {
  14389. var results = [];
  14390. if (this.material) {
  14391. results.push(this.material);
  14392. }
  14393. if (this.skeleton) {
  14394. results.push(this.skeleton);
  14395. }
  14396. return results;
  14397. };
  14398. // Geometry
  14399. Mesh.prototype.bakeTransformIntoVertices = function (transform) {
  14400. // Position
  14401. if (!this.isVerticesDataPresent(BABYLON.VertexBuffer.PositionKind)) {
  14402. return;
  14403. }
  14404. this._resetPointsArrayCache();
  14405. var data = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  14406. var temp = [];
  14407. var index;
  14408. for (index = 0; index < data.length; index += 3) {
  14409. BABYLON.Vector3.TransformCoordinates(BABYLON.Vector3.FromArray(data, index), transform).toArray(temp, index);
  14410. }
  14411. this.setVerticesData(BABYLON.VertexBuffer.PositionKind, temp, this.getVertexBuffer(BABYLON.VertexBuffer.PositionKind).isUpdatable());
  14412. // Normals
  14413. if (!this.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) {
  14414. return;
  14415. }
  14416. data = this.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  14417. temp = [];
  14418. for (index = 0; index < data.length; index += 3) {
  14419. BABYLON.Vector3.TransformNormal(BABYLON.Vector3.FromArray(data, index), transform).normalize().toArray(temp, index);
  14420. }
  14421. this.setVerticesData(BABYLON.VertexBuffer.NormalKind, temp, this.getVertexBuffer(BABYLON.VertexBuffer.NormalKind).isUpdatable());
  14422. // flip faces?
  14423. if (transform.m[0] * transform.m[5] * transform.m[10] < 0) {
  14424. this.flipFaces();
  14425. }
  14426. };
  14427. // Will apply current transform to mesh and reset world matrix
  14428. Mesh.prototype.bakeCurrentTransformIntoVertices = function () {
  14429. this.bakeTransformIntoVertices(this.computeWorldMatrix(true));
  14430. this.scaling.copyFromFloats(1, 1, 1);
  14431. this.position.copyFromFloats(0, 0, 0);
  14432. this.rotation.copyFromFloats(0, 0, 0);
  14433. //only if quaternion is already set
  14434. if (this.rotationQuaternion) {
  14435. this.rotationQuaternion = BABYLON.Quaternion.Identity();
  14436. }
  14437. this._worldMatrix = BABYLON.Matrix.Identity();
  14438. };
  14439. // Cache
  14440. Mesh.prototype._resetPointsArrayCache = function () {
  14441. this._positions = null;
  14442. };
  14443. Mesh.prototype._generatePointsArray = function () {
  14444. if (this._positions)
  14445. return true;
  14446. this._positions = [];
  14447. var data = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  14448. if (!data) {
  14449. return false;
  14450. }
  14451. for (var index = 0; index < data.length; index += 3) {
  14452. this._positions.push(BABYLON.Vector3.FromArray(data, index));
  14453. }
  14454. return true;
  14455. };
  14456. // Clone
  14457. Mesh.prototype.clone = function (name, newParent, doNotCloneChildren) {
  14458. return new Mesh(name, this.getScene(), newParent, this, doNotCloneChildren);
  14459. };
  14460. // Dispose
  14461. Mesh.prototype.dispose = function (doNotRecurse) {
  14462. if (this._geometry) {
  14463. this._geometry.releaseForMesh(this, true);
  14464. }
  14465. // Instances
  14466. if (this._worldMatricesInstancesBuffer) {
  14467. this.getEngine().deleteInstancesBuffer(this._worldMatricesInstancesBuffer);
  14468. this._worldMatricesInstancesBuffer = null;
  14469. }
  14470. while (this.instances.length) {
  14471. this.instances[0].dispose();
  14472. }
  14473. _super.prototype.dispose.call(this, doNotRecurse);
  14474. };
  14475. // Geometric tools
  14476. Mesh.prototype.applyDisplacementMap = function (url, minHeight, maxHeight, onSuccess) {
  14477. var _this = this;
  14478. var scene = this.getScene();
  14479. var onload = function (img) {
  14480. // Getting height map data
  14481. var canvas = document.createElement("canvas");
  14482. var context = canvas.getContext("2d");
  14483. var heightMapWidth = img.width;
  14484. var heightMapHeight = img.height;
  14485. canvas.width = heightMapWidth;
  14486. canvas.height = heightMapHeight;
  14487. context.drawImage(img, 0, 0);
  14488. // Create VertexData from map data
  14489. //Cast is due to wrong definition in lib.d.ts from ts 1.3 - https://github.com/Microsoft/TypeScript/issues/949
  14490. var buffer = context.getImageData(0, 0, heightMapWidth, heightMapHeight).data;
  14491. _this.applyDisplacementMapFromBuffer(buffer, heightMapWidth, heightMapHeight, minHeight, maxHeight);
  14492. //execute success callback, if set
  14493. if (onSuccess) {
  14494. onSuccess(_this);
  14495. }
  14496. };
  14497. BABYLON.Tools.LoadImage(url, onload, function () { }, scene.database);
  14498. };
  14499. Mesh.prototype.applyDisplacementMapFromBuffer = function (buffer, heightMapWidth, heightMapHeight, minHeight, maxHeight) {
  14500. if (!this.isVerticesDataPresent(BABYLON.VertexBuffer.PositionKind)
  14501. || !this.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)
  14502. || !this.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  14503. BABYLON.Tools.Warn("Cannot call applyDisplacementMap: Given mesh is not complete. Position, Normal or UV are missing");
  14504. return;
  14505. }
  14506. var positions = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  14507. var normals = this.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  14508. var uvs = this.getVerticesData(BABYLON.VertexBuffer.UVKind);
  14509. var position = BABYLON.Vector3.Zero();
  14510. var normal = BABYLON.Vector3.Zero();
  14511. var uv = BABYLON.Vector2.Zero();
  14512. for (var index = 0; index < positions.length; index += 3) {
  14513. BABYLON.Vector3.FromArrayToRef(positions, index, position);
  14514. BABYLON.Vector3.FromArrayToRef(normals, index, normal);
  14515. BABYLON.Vector2.FromArrayToRef(uvs, (index / 3) * 2, uv);
  14516. // Compute height
  14517. var u = ((Math.abs(uv.x) * heightMapWidth) % heightMapWidth) | 0;
  14518. var v = ((Math.abs(uv.y) * heightMapHeight) % heightMapHeight) | 0;
  14519. var pos = (u + v * heightMapWidth) * 4;
  14520. var r = buffer[pos] / 255.0;
  14521. var g = buffer[pos + 1] / 255.0;
  14522. var b = buffer[pos + 2] / 255.0;
  14523. var gradient = r * 0.3 + g * 0.59 + b * 0.11;
  14524. normal.normalize();
  14525. normal.scaleInPlace(minHeight + (maxHeight - minHeight) * gradient);
  14526. position = position.add(normal);
  14527. position.toArray(positions, index);
  14528. }
  14529. BABYLON.VertexData.ComputeNormals(positions, this.getIndices(), normals);
  14530. this.updateVerticesData(BABYLON.VertexBuffer.PositionKind, positions);
  14531. this.updateVerticesData(BABYLON.VertexBuffer.NormalKind, normals);
  14532. };
  14533. Mesh.prototype.convertToFlatShadedMesh = function () {
  14534. /// <summary>Update normals and vertices to get a flat shading rendering.</summary>
  14535. /// <summary>Warning: This may imply adding vertices to the mesh in order to get exactly 3 vertices per face</summary>
  14536. var kinds = this.getVerticesDataKinds();
  14537. var vbs = [];
  14538. var data = [];
  14539. var newdata = [];
  14540. var updatableNormals = false;
  14541. var kindIndex;
  14542. var kind;
  14543. for (kindIndex = 0; kindIndex < kinds.length; kindIndex++) {
  14544. kind = kinds[kindIndex];
  14545. var vertexBuffer = this.getVertexBuffer(kind);
  14546. if (kind === BABYLON.VertexBuffer.NormalKind) {
  14547. updatableNormals = vertexBuffer.isUpdatable();
  14548. kinds.splice(kindIndex, 1);
  14549. kindIndex--;
  14550. continue;
  14551. }
  14552. vbs[kind] = vertexBuffer;
  14553. data[kind] = vbs[kind].getData();
  14554. newdata[kind] = [];
  14555. }
  14556. // Save previous submeshes
  14557. var previousSubmeshes = this.subMeshes.slice(0);
  14558. var indices = this.getIndices();
  14559. var totalIndices = this.getTotalIndices();
  14560. // Generating unique vertices per face
  14561. var index;
  14562. for (index = 0; index < totalIndices; index++) {
  14563. var vertexIndex = indices[index];
  14564. for (kindIndex = 0; kindIndex < kinds.length; kindIndex++) {
  14565. kind = kinds[kindIndex];
  14566. var stride = vbs[kind].getStrideSize();
  14567. for (var offset = 0; offset < stride; offset++) {
  14568. newdata[kind].push(data[kind][vertexIndex * stride + offset]);
  14569. }
  14570. }
  14571. }
  14572. // Updating faces & normal
  14573. var normals = [];
  14574. var positions = newdata[BABYLON.VertexBuffer.PositionKind];
  14575. for (index = 0; index < totalIndices; index += 3) {
  14576. indices[index] = index;
  14577. indices[index + 1] = index + 1;
  14578. indices[index + 2] = index + 2;
  14579. var p1 = BABYLON.Vector3.FromArray(positions, index * 3);
  14580. var p2 = BABYLON.Vector3.FromArray(positions, (index + 1) * 3);
  14581. var p3 = BABYLON.Vector3.FromArray(positions, (index + 2) * 3);
  14582. var p1p2 = p1.subtract(p2);
  14583. var p3p2 = p3.subtract(p2);
  14584. var normal = BABYLON.Vector3.Normalize(BABYLON.Vector3.Cross(p1p2, p3p2));
  14585. // Store same normals for every vertex
  14586. for (var localIndex = 0; localIndex < 3; localIndex++) {
  14587. normals.push(normal.x);
  14588. normals.push(normal.y);
  14589. normals.push(normal.z);
  14590. }
  14591. }
  14592. this.setIndices(indices);
  14593. this.setVerticesData(BABYLON.VertexBuffer.NormalKind, normals, updatableNormals);
  14594. // Updating vertex buffers
  14595. for (kindIndex = 0; kindIndex < kinds.length; kindIndex++) {
  14596. kind = kinds[kindIndex];
  14597. this.setVerticesData(kind, newdata[kind], vbs[kind].isUpdatable());
  14598. }
  14599. // Updating submeshes
  14600. this.releaseSubMeshes();
  14601. for (var submeshIndex = 0; submeshIndex < previousSubmeshes.length; submeshIndex++) {
  14602. var previousOne = previousSubmeshes[submeshIndex];
  14603. var subMesh = new BABYLON.SubMesh(previousOne.materialIndex, previousOne.indexStart, previousOne.indexCount, previousOne.indexStart, previousOne.indexCount, this);
  14604. }
  14605. this.synchronizeInstances();
  14606. };
  14607. // will inverse faces orientations, and invert normals too if specified
  14608. Mesh.prototype.flipFaces = function (flipNormals) {
  14609. if (flipNormals === void 0) { flipNormals = false; }
  14610. var vertex_data = BABYLON.VertexData.ExtractFromMesh(this);
  14611. var i;
  14612. if (flipNormals && this.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) {
  14613. for (i = 0; i < vertex_data.normals.length; i++) {
  14614. vertex_data.normals[i] *= -1;
  14615. }
  14616. }
  14617. var temp;
  14618. for (i = 0; i < vertex_data.indices.length; i += 3) {
  14619. // reassign indices
  14620. temp = vertex_data.indices[i + 1];
  14621. vertex_data.indices[i + 1] = vertex_data.indices[i + 2];
  14622. vertex_data.indices[i + 2] = temp;
  14623. }
  14624. vertex_data.applyToMesh(this);
  14625. };
  14626. // Instances
  14627. Mesh.prototype.createInstance = function (name) {
  14628. return new BABYLON.InstancedMesh(name, this);
  14629. };
  14630. Mesh.prototype.synchronizeInstances = function () {
  14631. for (var instanceIndex = 0; instanceIndex < this.instances.length; instanceIndex++) {
  14632. var instance = this.instances[instanceIndex];
  14633. instance._syncSubMeshes();
  14634. }
  14635. };
  14636. /**
  14637. * Simplify the mesh according to the given array of settings.
  14638. * Function will return immediately and will simplify async.
  14639. * @param settings a collection of simplification settings.
  14640. * @param parallelProcessing should all levels calculate parallel or one after the other.
  14641. * @param type the type of simplification to run.
  14642. * @param successCallback optional success callback to be called after the simplification finished processing all settings.
  14643. */
  14644. Mesh.prototype.simplify = function (settings, parallelProcessing, simplificationType, successCallback) {
  14645. if (parallelProcessing === void 0) { parallelProcessing = true; }
  14646. if (simplificationType === void 0) { simplificationType = BABYLON.SimplificationType.QUADRATIC; }
  14647. this.getScene().simplificationQueue.addTask({
  14648. settings: settings,
  14649. parallelProcessing: parallelProcessing,
  14650. mesh: this,
  14651. simplificationType: simplificationType,
  14652. successCallback: successCallback
  14653. });
  14654. };
  14655. /**
  14656. * Optimization of the mesh's indices, in case a mesh has duplicated vertices.
  14657. * The function will only reorder the indices and will not remove unused vertices to avoid problems with submeshes.
  14658. * This should be used together with the simplification to avoid disappearing triangles.
  14659. * @param successCallback an optional success callback to be called after the optimization finished.
  14660. */
  14661. Mesh.prototype.optimizeIndices = function (successCallback) {
  14662. var _this = this;
  14663. var indices = this.getIndices();
  14664. var positions = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  14665. var vectorPositions = [];
  14666. for (var pos = 0; pos < positions.length; pos = pos + 3) {
  14667. vectorPositions.push(BABYLON.Vector3.FromArray(positions, pos));
  14668. }
  14669. var dupes = [];
  14670. BABYLON.AsyncLoop.SyncAsyncForLoop(vectorPositions.length, 40, function (iteration) {
  14671. var realPos = vectorPositions.length - 1 - iteration;
  14672. var testedPosition = vectorPositions[realPos];
  14673. for (var j = 0; j < realPos; ++j) {
  14674. var againstPosition = vectorPositions[j];
  14675. if (testedPosition.equals(againstPosition)) {
  14676. dupes[realPos] = j;
  14677. break;
  14678. }
  14679. }
  14680. }, function () {
  14681. for (var i = 0; i < indices.length; ++i) {
  14682. indices[i] = dupes[indices[i]] || indices[i];
  14683. }
  14684. //indices are now reordered
  14685. var originalSubMeshes = _this.subMeshes.slice(0);
  14686. _this.setIndices(indices);
  14687. _this.subMeshes = originalSubMeshes;
  14688. if (successCallback) {
  14689. successCallback(_this);
  14690. }
  14691. });
  14692. };
  14693. // Statics
  14694. Mesh.CreateRibbon = function (name, pathArray, closeArray, closePath, offset, scene, updatable, sideOrientation, instance) {
  14695. return BABYLON.MeshBuilder.CreateRibbon(name, {
  14696. pathArray: pathArray,
  14697. closeArray: closeArray,
  14698. closePath: closePath,
  14699. offset: offset,
  14700. updatable: updatable,
  14701. sideOrientation: sideOrientation,
  14702. instance: instance
  14703. }, scene);
  14704. };
  14705. Mesh.CreateDisc = function (name, radius, tessellation, scene, updatable, sideOrientation) {
  14706. var options = {
  14707. radius: radius,
  14708. tessellation: tessellation,
  14709. sideOrientation: sideOrientation,
  14710. updatable: updatable
  14711. };
  14712. return BABYLON.MeshBuilder.CreateDisc(name, options, scene);
  14713. };
  14714. Mesh.CreateBox = function (name, size, scene, updatable, sideOrientation) {
  14715. var options = {
  14716. size: size,
  14717. sideOrientation: sideOrientation,
  14718. updatable: updatable
  14719. };
  14720. return BABYLON.MeshBuilder.CreateBox(name, options, scene);
  14721. };
  14722. Mesh.CreateSphere = function (name, segments, diameter, scene, updatable, sideOrientation) {
  14723. var options = {
  14724. segments: segments,
  14725. diameterX: diameter,
  14726. diameterY: diameter,
  14727. diameterZ: diameter,
  14728. sideOrientation: sideOrientation,
  14729. updatable: updatable
  14730. };
  14731. return BABYLON.MeshBuilder.CreateSphere(name, options, scene);
  14732. };
  14733. // Cylinder and cone
  14734. Mesh.CreateCylinder = function (name, height, diameterTop, diameterBottom, tessellation, subdivisions, scene, updatable, sideOrientation) {
  14735. var options = {
  14736. height: height,
  14737. diameterTop: diameterTop,
  14738. diameterBottom: diameterBottom,
  14739. tessellation: tessellation,
  14740. subdivisions: subdivisions,
  14741. sideOrientation: sideOrientation,
  14742. updatable: updatable
  14743. };
  14744. return BABYLON.MeshBuilder.CreateCylinder(name, options, scene);
  14745. };
  14746. // Torus (Code from SharpDX.org)
  14747. Mesh.CreateTorus = function (name, diameter, thickness, tessellation, scene, updatable, sideOrientation) {
  14748. var options = {
  14749. diameter: diameter,
  14750. thickness: thickness,
  14751. tessellation: tessellation,
  14752. sideOrientation: sideOrientation,
  14753. updatable: updatable
  14754. };
  14755. return BABYLON.MeshBuilder.CreateTorus(name, options, scene);
  14756. };
  14757. Mesh.CreateTorusKnot = function (name, radius, tube, radialSegments, tubularSegments, p, q, scene, updatable, sideOrientation) {
  14758. var options = {
  14759. radius: radius,
  14760. tube: tube,
  14761. radialSegments: radialSegments,
  14762. tubularSegments: tubularSegments,
  14763. p: p,
  14764. q: q,
  14765. sideOrientation: sideOrientation,
  14766. updatable: updatable
  14767. };
  14768. return BABYLON.MeshBuilder.CreateTorusKnot(name, options, scene);
  14769. };
  14770. // Lines
  14771. Mesh.CreateLines = function (name, points, scene, updatable, instance) {
  14772. var options = {
  14773. points: points,
  14774. updatable: updatable,
  14775. instance: instance
  14776. };
  14777. return BABYLON.MeshBuilder.CreateLines(name, options, scene);
  14778. };
  14779. // Dashed Lines
  14780. Mesh.CreateDashedLines = function (name, points, dashSize, gapSize, dashNb, scene, updatable, instance) {
  14781. var options = {
  14782. points: points,
  14783. dashSize: dashSize,
  14784. gapSize: gapSize,
  14785. dashNb: dashNb,
  14786. updatable: updatable
  14787. };
  14788. return BABYLON.MeshBuilder.CreateDashedLines(name, options, scene);
  14789. };
  14790. // Extrusion
  14791. Mesh.ExtrudeShape = function (name, shape, path, scale, rotation, cap, scene, updatable, sideOrientation, instance) {
  14792. var options = {
  14793. shape: shape,
  14794. path: path,
  14795. scale: scale,
  14796. rotation: rotation,
  14797. cap: (cap === 0) ? 0 : cap || Mesh.NO_CAP,
  14798. sideOrientation: sideOrientation,
  14799. instance: instance,
  14800. updatable: updatable
  14801. };
  14802. return BABYLON.MeshBuilder.ExtrudeShape(name, options, scene);
  14803. };
  14804. Mesh.ExtrudeShapeCustom = function (name, shape, path, scaleFunction, rotationFunction, ribbonCloseArray, ribbonClosePath, cap, scene, updatable, sideOrientation, instance) {
  14805. var options = {
  14806. shape: shape,
  14807. path: path,
  14808. scaleFunction: scaleFunction,
  14809. rotationFunction: rotationFunction,
  14810. ribbonCloseArray: ribbonCloseArray,
  14811. ribbonClosePath: ribbonClosePath,
  14812. cap: (cap === 0) ? 0 : cap || Mesh.NO_CAP,
  14813. sideOrientation: sideOrientation,
  14814. instance: instance,
  14815. updatable: updatable
  14816. };
  14817. return BABYLON.MeshBuilder.ExtrudeShapeCustom(name, options, scene);
  14818. };
  14819. // Lathe
  14820. Mesh.CreateLathe = function (name, shape, radius, tessellation, scene, updatable, sideOrientation) {
  14821. var options = {
  14822. shape: shape,
  14823. radius: radius,
  14824. tesselation: tessellation,
  14825. sideOrientation: sideOrientation,
  14826. updatable: updatable
  14827. };
  14828. return BABYLON.MeshBuilder.CreateLathe(name, options, scene);
  14829. };
  14830. // Plane & ground
  14831. Mesh.CreatePlane = function (name, size, scene, updatable, sideOrientation) {
  14832. var options = {
  14833. size: size,
  14834. width: size,
  14835. height: size,
  14836. sideOrientation: sideOrientation,
  14837. updatable: updatable
  14838. };
  14839. return BABYLON.MeshBuilder.CreatePlane(name, options, scene);
  14840. };
  14841. Mesh.CreateGround = function (name, width, height, subdivisions, scene, updatable) {
  14842. var options = {
  14843. width: width,
  14844. height: height,
  14845. subdivisions: subdivisions,
  14846. updatable: updatable
  14847. };
  14848. return BABYLON.MeshBuilder.CreateGround(name, options, scene);
  14849. };
  14850. Mesh.CreateTiledGround = function (name, xmin, zmin, xmax, zmax, subdivisions, precision, scene, updatable) {
  14851. var options = {
  14852. xmin: xmin,
  14853. zmin: zmin,
  14854. xmax: xmax,
  14855. zmax: zmax,
  14856. subdivisions: subdivisions,
  14857. precision: precision,
  14858. updatable: updatable
  14859. };
  14860. return BABYLON.MeshBuilder.CreateTiledGround(name, options, scene);
  14861. };
  14862. Mesh.CreateGroundFromHeightMap = function (name, url, width, height, subdivisions, minHeight, maxHeight, scene, updatable, onReady) {
  14863. var options = {
  14864. width: width,
  14865. height: height,
  14866. subdivisions: subdivisions,
  14867. minHeight: minHeight,
  14868. maxHeight: maxHeight,
  14869. updatable: updatable,
  14870. onReady: onReady
  14871. };
  14872. return BABYLON.MeshBuilder.CreateGroundFromHeightMap(name, url, options, scene);
  14873. };
  14874. Mesh.CreateTube = function (name, path, radius, tessellation, radiusFunction, cap, scene, updatable, sideOrientation, instance) {
  14875. var options = {
  14876. path: path,
  14877. radius: radius,
  14878. tessellation: tessellation,
  14879. radiusFunction: radiusFunction,
  14880. arc: 1,
  14881. cap: cap,
  14882. updatable: updatable,
  14883. sideOrientation: sideOrientation,
  14884. instance: instance
  14885. };
  14886. return BABYLON.MeshBuilder.CreateTube(name, options, scene);
  14887. };
  14888. Mesh.CreatePolyhedron = function (name, options, scene) {
  14889. return BABYLON.MeshBuilder.CreatePolyhedron(name, options, scene);
  14890. };
  14891. // Decals
  14892. Mesh.CreateDecal = function (name, sourceMesh, position, normal, size, angle) {
  14893. var options = {
  14894. position: position,
  14895. normal: normal,
  14896. size: size,
  14897. angle: angle
  14898. };
  14899. return BABYLON.MeshBuilder.CreateDecal(name, sourceMesh, options);
  14900. };
  14901. // Skeletons
  14902. /**
  14903. * @returns original positions used for CPU skinning. Useful for integrating Morphing with skeletons in same mesh.
  14904. */
  14905. Mesh.prototype.setPositionsForCPUSkinning = function () {
  14906. var source;
  14907. if (!this._sourcePositions) {
  14908. source = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  14909. this._sourcePositions = new Float32Array(source);
  14910. if (!this.getVertexBuffer(BABYLON.VertexBuffer.PositionKind).isUpdatable()) {
  14911. this.setVerticesData(BABYLON.VertexBuffer.PositionKind, source, true);
  14912. }
  14913. }
  14914. return this._sourcePositions;
  14915. };
  14916. /**
  14917. * @returns original normals used for CPU skinning. Useful for integrating Morphing with skeletons in same mesh.
  14918. */
  14919. Mesh.prototype.setNormalsForCPUSkinning = function () {
  14920. var source;
  14921. if (!this._sourceNormals) {
  14922. source = this.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  14923. this._sourceNormals = new Float32Array(source);
  14924. if (!this.getVertexBuffer(BABYLON.VertexBuffer.NormalKind).isUpdatable()) {
  14925. this.setVerticesData(BABYLON.VertexBuffer.NormalKind, source, true);
  14926. }
  14927. }
  14928. return this._sourceNormals;
  14929. };
  14930. /**
  14931. * Update the vertex buffers by applying transformation from the bones
  14932. * @param {skeleton} skeleton to apply
  14933. */
  14934. Mesh.prototype.applySkeleton = function (skeleton) {
  14935. if (!this.isVerticesDataPresent(BABYLON.VertexBuffer.PositionKind)) {
  14936. return this;
  14937. }
  14938. if (!this.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) {
  14939. return this;
  14940. }
  14941. if (!this.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind)) {
  14942. return this;
  14943. }
  14944. if (!this.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind)) {
  14945. return this;
  14946. }
  14947. if (!this._sourcePositions) {
  14948. this.setPositionsForCPUSkinning();
  14949. }
  14950. if (!this._sourceNormals) {
  14951. this.setNormalsForCPUSkinning();
  14952. }
  14953. // positionsData checks for not being Float32Array will only pass at most once
  14954. var positionsData = this.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  14955. if (!(positionsData instanceof Float32Array)) {
  14956. positionsData = new Float32Array(positionsData);
  14957. }
  14958. // normalsData checks for not being Float32Array will only pass at most once
  14959. var normalsData = this.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  14960. if (!(normalsData instanceof Float32Array)) {
  14961. normalsData = new Float32Array(normalsData);
  14962. }
  14963. var matricesIndicesData = this.getVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind);
  14964. var matricesWeightsData = this.getVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind);
  14965. var skeletonMatrices = skeleton.getTransformMatrices();
  14966. var tempVector3 = BABYLON.Vector3.Zero();
  14967. var finalMatrix = new BABYLON.Matrix();
  14968. var tempMatrix = new BABYLON.Matrix();
  14969. for (var index = 0; index < positionsData.length; index += 3) {
  14970. var index4 = (index / 3) * 4;
  14971. var matricesWeight0 = matricesWeightsData[index4];
  14972. var matricesWeight1 = matricesWeightsData[index4 + 1];
  14973. var matricesWeight2 = matricesWeightsData[index4 + 2];
  14974. var matricesWeight3 = matricesWeightsData[index4 + 3];
  14975. if (matricesWeight0 > 0) {
  14976. BABYLON.Matrix.FromFloat32ArrayToRefScaled(skeletonMatrices, matricesIndicesData[index4] * 16, matricesWeight0, tempMatrix);
  14977. finalMatrix.addToSelf(tempMatrix);
  14978. }
  14979. if (matricesWeight1 > 0) {
  14980. BABYLON.Matrix.FromFloat32ArrayToRefScaled(skeletonMatrices, matricesIndicesData[index4 + 1] * 16, matricesWeight1, tempMatrix);
  14981. finalMatrix.addToSelf(tempMatrix);
  14982. }
  14983. if (matricesWeight2 > 0) {
  14984. BABYLON.Matrix.FromFloat32ArrayToRefScaled(skeletonMatrices, matricesIndicesData[index4 + 2] * 16, matricesWeight2, tempMatrix);
  14985. finalMatrix.addToSelf(tempMatrix);
  14986. }
  14987. if (matricesWeight3 > 0) {
  14988. BABYLON.Matrix.FromFloat32ArrayToRefScaled(skeletonMatrices, matricesIndicesData[index4 + 3] * 16, matricesWeight3, tempMatrix);
  14989. finalMatrix.addToSelf(tempMatrix);
  14990. }
  14991. BABYLON.Vector3.TransformCoordinatesFromFloatsToRef(this._sourcePositions[index], this._sourcePositions[index + 1], this._sourcePositions[index + 2], finalMatrix, tempVector3);
  14992. tempVector3.toArray(positionsData, index);
  14993. BABYLON.Vector3.TransformNormalFromFloatsToRef(this._sourceNormals[index], this._sourceNormals[index + 1], this._sourceNormals[index + 2], finalMatrix, tempVector3);
  14994. tempVector3.toArray(normalsData, index);
  14995. finalMatrix.reset();
  14996. }
  14997. this.updateVerticesData(BABYLON.VertexBuffer.PositionKind, positionsData);
  14998. this.updateVerticesData(BABYLON.VertexBuffer.NormalKind, normalsData);
  14999. return this;
  15000. };
  15001. // Tools
  15002. Mesh.MinMax = function (meshes) {
  15003. var minVector = null;
  15004. var maxVector = null;
  15005. for (var i in meshes) {
  15006. var mesh = meshes[i];
  15007. var boundingBox = mesh.getBoundingInfo().boundingBox;
  15008. if (!minVector) {
  15009. minVector = boundingBox.minimumWorld;
  15010. maxVector = boundingBox.maximumWorld;
  15011. continue;
  15012. }
  15013. minVector.MinimizeInPlace(boundingBox.minimumWorld);
  15014. maxVector.MaximizeInPlace(boundingBox.maximumWorld);
  15015. }
  15016. return {
  15017. min: minVector,
  15018. max: maxVector
  15019. };
  15020. };
  15021. Mesh.Center = function (meshesOrMinMaxVector) {
  15022. var minMaxVector = meshesOrMinMaxVector.min !== undefined ? meshesOrMinMaxVector : Mesh.MinMax(meshesOrMinMaxVector);
  15023. return BABYLON.Vector3.Center(minMaxVector.min, minMaxVector.max);
  15024. };
  15025. /**
  15026. * Merge the array of meshes into a single mesh for performance reasons.
  15027. * @param {Array<Mesh>} meshes - The vertices source. They should all be of the same material. Entries can empty
  15028. * @param {boolean} disposeSource - When true (default), dispose of the vertices from the source meshes
  15029. * @param {boolean} allow32BitsIndices - When the sum of the vertices > 64k, this must be set to true.
  15030. * @param {Mesh} meshSubclass - When set, vertices inserted into this Mesh. Meshes can then be merged into a Mesh sub-class.
  15031. */
  15032. Mesh.MergeMeshes = function (meshes, disposeSource, allow32BitsIndices, meshSubclass) {
  15033. if (disposeSource === void 0) { disposeSource = true; }
  15034. var index;
  15035. if (!allow32BitsIndices) {
  15036. var totalVertices = 0;
  15037. // Counting vertices
  15038. for (index = 0; index < meshes.length; index++) {
  15039. if (meshes[index]) {
  15040. totalVertices += meshes[index].getTotalVertices();
  15041. if (totalVertices > 65536) {
  15042. BABYLON.Tools.Warn("Cannot merge meshes because resulting mesh will have more than 65536 vertices. Please use allow32BitsIndices = true to use 32 bits indices");
  15043. return null;
  15044. }
  15045. }
  15046. }
  15047. }
  15048. // Merge
  15049. var vertexData;
  15050. var otherVertexData;
  15051. var source;
  15052. for (index = 0; index < meshes.length; index++) {
  15053. if (meshes[index]) {
  15054. meshes[index].computeWorldMatrix(true);
  15055. otherVertexData = BABYLON.VertexData.ExtractFromMesh(meshes[index], true);
  15056. otherVertexData.transform(meshes[index].getWorldMatrix());
  15057. if (vertexData) {
  15058. vertexData.merge(otherVertexData);
  15059. }
  15060. else {
  15061. vertexData = otherVertexData;
  15062. source = meshes[index];
  15063. }
  15064. }
  15065. }
  15066. if (!meshSubclass) {
  15067. meshSubclass = new Mesh(source.name + "_merged", source.getScene());
  15068. }
  15069. vertexData.applyToMesh(meshSubclass);
  15070. // Setting properties
  15071. meshSubclass.material = source.material;
  15072. meshSubclass.checkCollisions = source.checkCollisions;
  15073. // Cleaning
  15074. if (disposeSource) {
  15075. for (index = 0; index < meshes.length; index++) {
  15076. if (meshes[index]) {
  15077. meshes[index].dispose();
  15078. }
  15079. }
  15080. }
  15081. return meshSubclass;
  15082. };
  15083. // Consts
  15084. Mesh._FRONTSIDE = 0;
  15085. Mesh._BACKSIDE = 1;
  15086. Mesh._DOUBLESIDE = 2;
  15087. Mesh._DEFAULTSIDE = 0;
  15088. Mesh._NO_CAP = 0;
  15089. Mesh._CAP_START = 1;
  15090. Mesh._CAP_END = 2;
  15091. Mesh._CAP_ALL = 3;
  15092. return Mesh;
  15093. })(BABYLON.AbstractMesh);
  15094. BABYLON.Mesh = Mesh;
  15095. })(BABYLON || (BABYLON = {}));
  15096. var BABYLON;
  15097. (function (BABYLON) {
  15098. var SubMesh = (function () {
  15099. function SubMesh(materialIndex, verticesStart, verticesCount, indexStart, indexCount, mesh, renderingMesh, createBoundingBox) {
  15100. if (createBoundingBox === void 0) { createBoundingBox = true; }
  15101. this.materialIndex = materialIndex;
  15102. this.verticesStart = verticesStart;
  15103. this.verticesCount = verticesCount;
  15104. this.indexStart = indexStart;
  15105. this.indexCount = indexCount;
  15106. this._renderId = 0;
  15107. this._mesh = mesh;
  15108. this._renderingMesh = renderingMesh || mesh;
  15109. mesh.subMeshes.push(this);
  15110. this._trianglePlanes = [];
  15111. this._id = mesh.subMeshes.length - 1;
  15112. if (createBoundingBox) {
  15113. this.refreshBoundingInfo();
  15114. mesh.computeWorldMatrix(true);
  15115. }
  15116. }
  15117. SubMesh.prototype.getBoundingInfo = function () {
  15118. return this._boundingInfo;
  15119. };
  15120. SubMesh.prototype.getMesh = function () {
  15121. return this._mesh;
  15122. };
  15123. SubMesh.prototype.getRenderingMesh = function () {
  15124. return this._renderingMesh;
  15125. };
  15126. SubMesh.prototype.getMaterial = function () {
  15127. var rootMaterial = this._renderingMesh.material;
  15128. if (rootMaterial && rootMaterial instanceof BABYLON.MultiMaterial) {
  15129. var multiMaterial = rootMaterial;
  15130. return multiMaterial.getSubMaterial(this.materialIndex);
  15131. }
  15132. if (!rootMaterial) {
  15133. return this._mesh.getScene().defaultMaterial;
  15134. }
  15135. return rootMaterial;
  15136. };
  15137. // Methods
  15138. SubMesh.prototype.refreshBoundingInfo = function () {
  15139. var data = this._renderingMesh.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  15140. if (!data) {
  15141. this._boundingInfo = this._mesh._boundingInfo;
  15142. return;
  15143. }
  15144. var indices = this._renderingMesh.getIndices();
  15145. var extend;
  15146. //is this the only submesh?
  15147. if (this.indexStart === 0 && this.indexCount === indices.length) {
  15148. //the rendering mesh's bounding info can be used, it is the standard submesh for all indices.
  15149. extend = { minimum: this._renderingMesh.getBoundingInfo().minimum.clone(), maximum: this._renderingMesh.getBoundingInfo().maximum.clone() };
  15150. }
  15151. else {
  15152. extend = BABYLON.Tools.ExtractMinAndMaxIndexed(data, indices, this.indexStart, this.indexCount);
  15153. }
  15154. this._boundingInfo = new BABYLON.BoundingInfo(extend.minimum, extend.maximum);
  15155. };
  15156. SubMesh.prototype._checkCollision = function (collider) {
  15157. return this._boundingInfo._checkCollision(collider);
  15158. };
  15159. SubMesh.prototype.updateBoundingInfo = function (world) {
  15160. if (!this._boundingInfo) {
  15161. this.refreshBoundingInfo();
  15162. }
  15163. this._boundingInfo._update(world);
  15164. };
  15165. SubMesh.prototype.isInFrustum = function (frustumPlanes) {
  15166. return this._boundingInfo.isInFrustum(frustumPlanes);
  15167. };
  15168. SubMesh.prototype.render = function (enableAlphaMode) {
  15169. this._renderingMesh.render(this, enableAlphaMode);
  15170. };
  15171. SubMesh.prototype.getLinesIndexBuffer = function (indices, engine) {
  15172. if (!this._linesIndexBuffer) {
  15173. var linesIndices = [];
  15174. for (var index = this.indexStart; index < this.indexStart + this.indexCount; index += 3) {
  15175. linesIndices.push(indices[index], indices[index + 1], indices[index + 1], indices[index + 2], indices[index + 2], indices[index]);
  15176. }
  15177. this._linesIndexBuffer = engine.createIndexBuffer(linesIndices);
  15178. this.linesIndexCount = linesIndices.length;
  15179. }
  15180. return this._linesIndexBuffer;
  15181. };
  15182. SubMesh.prototype.canIntersects = function (ray) {
  15183. return ray.intersectsBox(this._boundingInfo.boundingBox);
  15184. };
  15185. SubMesh.prototype.intersects = function (ray, positions, indices, fastCheck) {
  15186. var intersectInfo = null;
  15187. // Triangles test
  15188. for (var index = this.indexStart; index < this.indexStart + this.indexCount; index += 3) {
  15189. var p0 = positions[indices[index]];
  15190. var p1 = positions[indices[index + 1]];
  15191. var p2 = positions[indices[index + 2]];
  15192. var currentIntersectInfo = ray.intersectsTriangle(p0, p1, p2);
  15193. if (currentIntersectInfo) {
  15194. if (currentIntersectInfo.distance < 0) {
  15195. continue;
  15196. }
  15197. if (fastCheck || !intersectInfo || currentIntersectInfo.distance < intersectInfo.distance) {
  15198. intersectInfo = currentIntersectInfo;
  15199. intersectInfo.faceId = index / 3;
  15200. if (fastCheck) {
  15201. break;
  15202. }
  15203. }
  15204. }
  15205. }
  15206. return intersectInfo;
  15207. };
  15208. // Clone
  15209. SubMesh.prototype.clone = function (newMesh, newRenderingMesh) {
  15210. var result = new SubMesh(this.materialIndex, this.verticesStart, this.verticesCount, this.indexStart, this.indexCount, newMesh, newRenderingMesh, false);
  15211. result._boundingInfo = new BABYLON.BoundingInfo(this._boundingInfo.minimum, this._boundingInfo.maximum);
  15212. return result;
  15213. };
  15214. // Dispose
  15215. SubMesh.prototype.dispose = function () {
  15216. if (this._linesIndexBuffer) {
  15217. this._mesh.getScene().getEngine()._releaseBuffer(this._linesIndexBuffer);
  15218. this._linesIndexBuffer = null;
  15219. }
  15220. // Remove from mesh
  15221. var index = this._mesh.subMeshes.indexOf(this);
  15222. this._mesh.subMeshes.splice(index, 1);
  15223. };
  15224. // Statics
  15225. SubMesh.CreateFromIndices = function (materialIndex, startIndex, indexCount, mesh, renderingMesh) {
  15226. var minVertexIndex = Number.MAX_VALUE;
  15227. var maxVertexIndex = -Number.MAX_VALUE;
  15228. renderingMesh = renderingMesh || mesh;
  15229. var indices = renderingMesh.getIndices();
  15230. for (var index = startIndex; index < startIndex + indexCount; index++) {
  15231. var vertexIndex = indices[index];
  15232. if (vertexIndex < minVertexIndex)
  15233. minVertexIndex = vertexIndex;
  15234. if (vertexIndex > maxVertexIndex)
  15235. maxVertexIndex = vertexIndex;
  15236. }
  15237. return new SubMesh(materialIndex, minVertexIndex, maxVertexIndex - minVertexIndex + 1, startIndex, indexCount, mesh, renderingMesh);
  15238. };
  15239. return SubMesh;
  15240. })();
  15241. BABYLON.SubMesh = SubMesh;
  15242. })(BABYLON || (BABYLON = {}));
  15243. var BABYLON;
  15244. (function (BABYLON) {
  15245. var MeshBuilder = (function () {
  15246. function MeshBuilder() {
  15247. }
  15248. MeshBuilder.CreateBox = function (name, options, scene) {
  15249. var box = new BABYLON.Mesh(name, scene);
  15250. var vertexData = BABYLON.VertexData.CreateBox(options);
  15251. vertexData.applyToMesh(box, options.updatable);
  15252. return box;
  15253. };
  15254. MeshBuilder.CreateSphere = function (name, options, scene) {
  15255. var sphere = new BABYLON.Mesh(name, scene);
  15256. var vertexData = BABYLON.VertexData.CreateSphere(options);
  15257. vertexData.applyToMesh(sphere, options.updatable);
  15258. return sphere;
  15259. };
  15260. MeshBuilder.CreateDisc = function (name, options, scene) {
  15261. var disc = new BABYLON.Mesh(name, scene);
  15262. var vertexData = BABYLON.VertexData.CreateDisc(options);
  15263. vertexData.applyToMesh(disc, options.updatable);
  15264. return disc;
  15265. };
  15266. MeshBuilder.CreateRibbon = function (name, options, scene) {
  15267. var pathArray = options.pathArray;
  15268. var closeArray = options.closeArray;
  15269. var closePath = options.closePath;
  15270. var offset = options.offset;
  15271. var sideOrientation = options.sideOrientation;
  15272. var instance = options.instance;
  15273. var updatable = options.updatable;
  15274. if (instance) {
  15275. // positionFunction : ribbon case
  15276. // only pathArray and sideOrientation parameters are taken into account for positions update
  15277. var positionFunction = function (positions) {
  15278. var minlg = pathArray[0].length;
  15279. var i = 0;
  15280. var ns = (instance.sideOrientation === BABYLON.Mesh.DOUBLESIDE) ? 2 : 1;
  15281. for (var si = 1; si <= ns; si++) {
  15282. for (var p = 0; p < pathArray.length; p++) {
  15283. var path = pathArray[p];
  15284. var l = path.length;
  15285. minlg = (minlg < l) ? minlg : l;
  15286. var j = 0;
  15287. while (j < minlg) {
  15288. positions[i] = path[j].x;
  15289. positions[i + 1] = path[j].y;
  15290. positions[i + 2] = path[j].z;
  15291. j++;
  15292. i += 3;
  15293. }
  15294. if (instance._closePath) {
  15295. positions[i] = path[0].x;
  15296. positions[i + 1] = path[0].y;
  15297. positions[i + 2] = path[0].z;
  15298. i += 3;
  15299. }
  15300. }
  15301. }
  15302. };
  15303. var positions = instance.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  15304. positionFunction(positions);
  15305. instance.updateVerticesData(BABYLON.VertexBuffer.PositionKind, positions, false, false);
  15306. if (!(instance.areNormalsFrozen)) {
  15307. var indices = instance.getIndices();
  15308. var normals = instance.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  15309. BABYLON.VertexData.ComputeNormals(positions, indices, normals);
  15310. if (instance._closePath) {
  15311. var indexFirst = 0;
  15312. var indexLast = 0;
  15313. for (var p = 0; p < pathArray.length; p++) {
  15314. indexFirst = instance._idx[p] * 3;
  15315. if (p + 1 < pathArray.length) {
  15316. indexLast = (instance._idx[p + 1] - 1) * 3;
  15317. }
  15318. else {
  15319. indexLast = normals.length - 3;
  15320. }
  15321. normals[indexFirst] = (normals[indexFirst] + normals[indexLast]) * 0.5;
  15322. normals[indexFirst + 1] = (normals[indexFirst + 1] + normals[indexLast + 1]) * 0.5;
  15323. normals[indexFirst + 2] = (normals[indexFirst + 2] + normals[indexLast + 2]) * 0.5;
  15324. normals[indexLast] = normals[indexFirst];
  15325. normals[indexLast + 1] = normals[indexFirst + 1];
  15326. normals[indexLast + 2] = normals[indexFirst + 2];
  15327. }
  15328. }
  15329. instance.updateVerticesData(BABYLON.VertexBuffer.NormalKind, normals, false, false);
  15330. }
  15331. return instance;
  15332. }
  15333. else {
  15334. var ribbon = new BABYLON.Mesh(name, scene);
  15335. ribbon.sideOrientation = sideOrientation;
  15336. var vertexData = BABYLON.VertexData.CreateRibbon(options);
  15337. if (closePath) {
  15338. ribbon._idx = vertexData._idx;
  15339. }
  15340. ribbon._closePath = closePath;
  15341. ribbon._closeArray = closeArray;
  15342. vertexData.applyToMesh(ribbon, updatable);
  15343. return ribbon;
  15344. }
  15345. };
  15346. MeshBuilder.CreateCylinder = function (name, options, scene) {
  15347. var cylinder = new BABYLON.Mesh(name, scene);
  15348. var vertexData = BABYLON.VertexData.CreateCylinder(options);
  15349. vertexData.applyToMesh(cylinder, options.updatable);
  15350. return cylinder;
  15351. };
  15352. MeshBuilder.CreateTorus = function (name, options, scene) {
  15353. var torus = new BABYLON.Mesh(name, scene);
  15354. var vertexData = BABYLON.VertexData.CreateTorus(options);
  15355. vertexData.applyToMesh(torus, options.updatable);
  15356. return torus;
  15357. };
  15358. MeshBuilder.CreateTorusKnot = function (name, options, scene) {
  15359. var torusKnot = new BABYLON.Mesh(name, scene);
  15360. var vertexData = BABYLON.VertexData.CreateTorusKnot(options);
  15361. vertexData.applyToMesh(torusKnot, options.updatable);
  15362. return torusKnot;
  15363. };
  15364. MeshBuilder.CreateLines = function (name, options, scene) {
  15365. var instance = options.instance;
  15366. var points = options.points;
  15367. if (instance) {
  15368. var positionFunction = function (positions) {
  15369. var i = 0;
  15370. for (var p = 0; p < points.length; p++) {
  15371. positions[i] = points[p].x;
  15372. positions[i + 1] = points[p].y;
  15373. positions[i + 2] = points[p].z;
  15374. i += 3;
  15375. }
  15376. };
  15377. instance.updateMeshPositions(positionFunction, false);
  15378. return instance;
  15379. }
  15380. // lines creation
  15381. var lines = new BABYLON.LinesMesh(name, scene);
  15382. var vertexData = BABYLON.VertexData.CreateLines(options);
  15383. vertexData.applyToMesh(lines, options.updatable);
  15384. return lines;
  15385. };
  15386. MeshBuilder.CreateDashedLines = function (name, options, scene) {
  15387. var points = options.points;
  15388. var instance = options.instance;
  15389. var gapSize = options.gapSize;
  15390. var dashNb = options.dashNb;
  15391. var dashSize = options.dashSize;
  15392. if (instance) {
  15393. var positionFunction = function (positions) {
  15394. var curvect = BABYLON.Vector3.Zero();
  15395. var nbSeg = positions.length / 6;
  15396. var lg = 0;
  15397. var nb = 0;
  15398. var shft = 0;
  15399. var dashshft = 0;
  15400. var curshft = 0;
  15401. var p = 0;
  15402. var i = 0;
  15403. var j = 0;
  15404. for (i = 0; i < points.length - 1; i++) {
  15405. points[i + 1].subtractToRef(points[i], curvect);
  15406. lg += curvect.length();
  15407. }
  15408. shft = lg / nbSeg;
  15409. dashshft = instance.dashSize * shft / (instance.dashSize + instance.gapSize);
  15410. for (i = 0; i < points.length - 1; i++) {
  15411. points[i + 1].subtractToRef(points[i], curvect);
  15412. nb = Math.floor(curvect.length() / shft);
  15413. curvect.normalize();
  15414. j = 0;
  15415. while (j < nb && p < positions.length) {
  15416. curshft = shft * j;
  15417. positions[p] = points[i].x + curshft * curvect.x;
  15418. positions[p + 1] = points[i].y + curshft * curvect.y;
  15419. positions[p + 2] = points[i].z + curshft * curvect.z;
  15420. positions[p + 3] = points[i].x + (curshft + dashshft) * curvect.x;
  15421. positions[p + 4] = points[i].y + (curshft + dashshft) * curvect.y;
  15422. positions[p + 5] = points[i].z + (curshft + dashshft) * curvect.z;
  15423. p += 6;
  15424. j++;
  15425. }
  15426. }
  15427. while (p < positions.length) {
  15428. positions[p] = points[i].x;
  15429. positions[p + 1] = points[i].y;
  15430. positions[p + 2] = points[i].z;
  15431. p += 3;
  15432. }
  15433. };
  15434. instance.updateMeshPositions(positionFunction, false);
  15435. return instance;
  15436. }
  15437. // dashed lines creation
  15438. var dashedLines = new BABYLON.LinesMesh(name, scene);
  15439. var vertexData = BABYLON.VertexData.CreateDashedLines(options);
  15440. vertexData.applyToMesh(dashedLines, options.updatable);
  15441. dashedLines.dashSize = dashSize;
  15442. dashedLines.gapSize = gapSize;
  15443. return dashedLines;
  15444. };
  15445. MeshBuilder.ExtrudeShape = function (name, options, scene) {
  15446. var path = options.path;
  15447. var shape = options.shape;
  15448. var scale = options.scale || 1;
  15449. var rotation = options.rotation || 0;
  15450. var cap = (options.cap === 0) ? 0 : options.cap || BABYLON.Mesh.NO_CAP;
  15451. var updatable = options.updatable;
  15452. var sideOrientation = (options.sideOrientation === 0) ? 0 : options.sideOrientation || BABYLON.Mesh.DEFAULTSIDE;
  15453. var instance = options.instance;
  15454. return MeshBuilder._ExtrudeShapeGeneric(name, shape, path, scale, rotation, null, null, false, false, cap, false, scene, updatable, sideOrientation, instance);
  15455. };
  15456. MeshBuilder.ExtrudeShapeCustom = function (name, options, scene) {
  15457. var path = options.path;
  15458. var shape = options.shape;
  15459. var scaleFunction = options.scaleFunction || (function () { return 1; });
  15460. var rotationFunction = options.rotationFunction || (function () { return 0; });
  15461. var ribbonCloseArray = options.ribbonCloseArray || false;
  15462. var ribbonClosePath = options.ribbonClosePath || false;
  15463. var cap = (options.cap === 0) ? 0 : options.cap || BABYLON.Mesh.NO_CAP;
  15464. var updatable = options.updatable;
  15465. var sideOrientation = (options.sideOrientation === 0) ? 0 : options.sideOrientation || BABYLON.Mesh.DEFAULTSIDE;
  15466. var instance = options.instance;
  15467. return MeshBuilder._ExtrudeShapeGeneric(name, shape, path, null, null, scaleFunction, rotationFunction, ribbonCloseArray, ribbonClosePath, cap, true, scene, updatable, sideOrientation, instance);
  15468. };
  15469. MeshBuilder.CreateLathe = function (name, options, scene) {
  15470. var arc = (options.arc <= 0) ? 1.0 : options.arc || 1.0;
  15471. var closed = (options.closed === undefined) ? true : options.closed;
  15472. var shape = options.shape;
  15473. var radius = options.radius || 1;
  15474. var tessellation = options.tessellation || 64;
  15475. var updatable = options.updatable;
  15476. var sideOrientation = (options.sideOrientation === 0) ? 0 : options.sideOrientation || BABYLON.Mesh.DEFAULTSIDE;
  15477. var pi2 = Math.PI * 2;
  15478. var shapeLathe = new Array();
  15479. // first rotatable point
  15480. var i = 0;
  15481. while (shape[i].x === 0) {
  15482. i++;
  15483. }
  15484. var pt = shape[i];
  15485. for (i = 0; i < shape.length; i++) {
  15486. shapeLathe.push(shape[i].subtract(pt));
  15487. }
  15488. // circle path
  15489. var step = pi2 / tessellation * arc;
  15490. var rotated;
  15491. var path = new Array();
  15492. ;
  15493. for (i = 0; i <= tessellation; i++) {
  15494. rotated = new BABYLON.Vector3(Math.cos(i * step) * radius, 0, Math.sin(i * step) * radius);
  15495. path.push(rotated);
  15496. }
  15497. if (closed) {
  15498. path.push(path[0]);
  15499. }
  15500. // extrusion
  15501. var scaleFunction = function () { return 1; };
  15502. var rotateFunction = function () { return 0; };
  15503. var lathe = BABYLON.Mesh.ExtrudeShapeCustom(name, shapeLathe, path, scaleFunction, rotateFunction, closed, false, BABYLON.Mesh.NO_CAP, scene, updatable, sideOrientation);
  15504. return lathe;
  15505. };
  15506. MeshBuilder.CreatePlane = function (name, options, scene) {
  15507. var plane = new BABYLON.Mesh(name, scene);
  15508. var vertexData = BABYLON.VertexData.CreatePlane(options);
  15509. vertexData.applyToMesh(plane, options.updatable);
  15510. if (options.sourcePlane) {
  15511. plane.translate(options.sourcePlane.normal, options.sourcePlane.d);
  15512. var product = Math.acos(BABYLON.Vector3.Dot(options.sourcePlane.normal, BABYLON.Axis.Z));
  15513. var vectorProduct = BABYLON.Vector3.Cross(BABYLON.Axis.Z, options.sourcePlane.normal);
  15514. plane.rotate(vectorProduct, product);
  15515. }
  15516. return plane;
  15517. };
  15518. MeshBuilder.CreateGround = function (name, options, scene) {
  15519. var ground = new BABYLON.GroundMesh(name, scene);
  15520. ground._setReady(false);
  15521. ground._subdivisions = options.subdivisions || 1;
  15522. var vertexData = BABYLON.VertexData.CreateGround(options);
  15523. vertexData.applyToMesh(ground, options.updatable);
  15524. ground._setReady(true);
  15525. return ground;
  15526. };
  15527. MeshBuilder.CreateTiledGround = function (name, options, scene) {
  15528. var tiledGround = new BABYLON.Mesh(name, scene);
  15529. var vertexData = BABYLON.VertexData.CreateTiledGround(options);
  15530. vertexData.applyToMesh(tiledGround, options.updatable);
  15531. return tiledGround;
  15532. };
  15533. MeshBuilder.CreateGroundFromHeightMap = function (name, url, options, scene) {
  15534. var width = options.width || 10;
  15535. var height = options.height || 10;
  15536. var subdivisions = options.subdivisions || 1;
  15537. var minHeight = options.minHeight;
  15538. var maxHeight = options.maxHeight || 10;
  15539. var updatable = options.updatable;
  15540. var onReady = options.onReady;
  15541. var ground = new BABYLON.GroundMesh(name, scene);
  15542. ground._subdivisions = subdivisions;
  15543. ground._setReady(false);
  15544. var onload = function (img) {
  15545. // Getting height map data
  15546. var canvas = document.createElement("canvas");
  15547. var context = canvas.getContext("2d");
  15548. var bufferWidth = img.width;
  15549. var bufferHeight = img.height;
  15550. canvas.width = bufferWidth;
  15551. canvas.height = bufferHeight;
  15552. context.drawImage(img, 0, 0);
  15553. // Create VertexData from map data
  15554. // Cast is due to wrong definition in lib.d.ts from ts 1.3 - https://github.com/Microsoft/TypeScript/issues/949
  15555. var buffer = context.getImageData(0, 0, bufferWidth, bufferHeight).data;
  15556. var vertexData = BABYLON.VertexData.CreateGroundFromHeightMap({
  15557. width: width, height: height,
  15558. subdivisions: subdivisions,
  15559. minHeight: minHeight, maxHeight: maxHeight,
  15560. buffer: buffer, bufferWidth: bufferWidth, bufferHeight: bufferHeight
  15561. });
  15562. vertexData.applyToMesh(ground, updatable);
  15563. ground._setReady(true);
  15564. //execute ready callback, if set
  15565. if (onReady) {
  15566. onReady(ground);
  15567. }
  15568. };
  15569. BABYLON.Tools.LoadImage(url, onload, function () { }, scene.database);
  15570. return ground;
  15571. };
  15572. MeshBuilder.CreateTube = function (name, options, scene) {
  15573. var path = options.path;
  15574. var radius = options.radius || 1;
  15575. var tessellation = options.tessellation || 64;
  15576. var radiusFunction = options.radiusFunction;
  15577. var cap = options.cap || BABYLON.Mesh.NO_CAP;
  15578. var updatable = options.updatable;
  15579. var sideOrientation = options.sideOrientation || BABYLON.Mesh.DEFAULTSIDE;
  15580. var instance = options.instance;
  15581. options.arc = (options.arc < 0) ? 1 : options.arc || 1;
  15582. // tube geometry
  15583. var tubePathArray = function (path, path3D, circlePaths, radius, tessellation, radiusFunction, cap, arc) {
  15584. var tangents = path3D.getTangents();
  15585. var normals = path3D.getNormals();
  15586. var distances = path3D.getDistances();
  15587. var pi2 = Math.PI * 2;
  15588. var step = pi2 / tessellation * arc;
  15589. var returnRadius = function () { return radius; };
  15590. var radiusFunctionFinal = radiusFunction || returnRadius;
  15591. var circlePath;
  15592. var rad;
  15593. var normal;
  15594. var rotated;
  15595. var rotationMatrix = BABYLON.Matrix.Zero();
  15596. var index = (cap === BABYLON.Mesh._NO_CAP || cap === BABYLON.Mesh.CAP_END) ? 0 : 2;
  15597. for (var i = 0; i < path.length; i++) {
  15598. rad = radiusFunctionFinal(i, distances[i]); // current radius
  15599. circlePath = Array(); // current circle array
  15600. normal = normals[i]; // current normal
  15601. for (var t = 0; t < tessellation; t++) {
  15602. BABYLON.Matrix.RotationAxisToRef(tangents[i], step * t, rotationMatrix);
  15603. rotated = BABYLON.Vector3.TransformCoordinates(normal, rotationMatrix).scaleInPlace(rad).add(path[i]);
  15604. circlePath.push(rotated);
  15605. }
  15606. circlePaths[index] = circlePath;
  15607. index++;
  15608. }
  15609. // cap
  15610. var capPath = function (nbPoints, pathIndex) {
  15611. var pointCap = Array();
  15612. for (var i = 0; i < nbPoints; i++) {
  15613. pointCap.push(path[pathIndex]);
  15614. }
  15615. return pointCap;
  15616. };
  15617. switch (cap) {
  15618. case BABYLON.Mesh.NO_CAP:
  15619. break;
  15620. case BABYLON.Mesh.CAP_START:
  15621. circlePaths[0] = capPath(tessellation, 0);
  15622. circlePaths[1] = circlePaths[2].slice(0);
  15623. break;
  15624. case BABYLON.Mesh.CAP_END:
  15625. circlePaths[index] = circlePaths[index - 1].slice(0);
  15626. circlePaths[index + 1] = capPath(tessellation, path.length - 1);
  15627. break;
  15628. case BABYLON.Mesh.CAP_ALL:
  15629. circlePaths[0] = capPath(tessellation, 0);
  15630. circlePaths[1] = circlePaths[2].slice(0);
  15631. circlePaths[index] = circlePaths[index - 1].slice(0);
  15632. circlePaths[index + 1] = capPath(tessellation, path.length - 1);
  15633. break;
  15634. default:
  15635. break;
  15636. }
  15637. return circlePaths;
  15638. };
  15639. var path3D;
  15640. var pathArray;
  15641. if (instance) {
  15642. var arc = options.arc || instance.arc;
  15643. path3D = (instance.path3D).update(path);
  15644. pathArray = tubePathArray(path, path3D, instance.pathArray, radius, instance.tessellation, radiusFunction, instance.cap, arc);
  15645. instance = MeshBuilder.CreateRibbon(null, { pathArray: pathArray, instance: instance });
  15646. instance.path3D = path3D;
  15647. instance.pathArray = pathArray;
  15648. instance.arc = arc;
  15649. return instance;
  15650. }
  15651. // tube creation
  15652. path3D = new BABYLON.Path3D(path);
  15653. var newPathArray = new Array();
  15654. cap = (cap < 0 || cap > 3) ? 0 : cap;
  15655. pathArray = tubePathArray(path, path3D, newPathArray, radius, tessellation, radiusFunction, cap, options.arc);
  15656. var tube = MeshBuilder.CreateRibbon(name, { pathArray: pathArray, closePath: true, closeArray: false, updatable: updatable, sideOrientation: sideOrientation }, scene);
  15657. tube.pathArray = pathArray;
  15658. tube.path3D = path3D;
  15659. tube.tessellation = tessellation;
  15660. tube.cap = cap;
  15661. tube.arc = options.arc;
  15662. return tube;
  15663. };
  15664. MeshBuilder.CreatePolyhedron = function (name, options, scene) {
  15665. var polyhedron = new BABYLON.Mesh(name, scene);
  15666. var vertexData = BABYLON.VertexData.CreatePolyhedron(options);
  15667. vertexData.applyToMesh(polyhedron, options.updatable);
  15668. return polyhedron;
  15669. };
  15670. MeshBuilder.CreateDecal = function (name, sourceMesh, options) {
  15671. var indices = sourceMesh.getIndices();
  15672. var positions = sourceMesh.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  15673. var normals = sourceMesh.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  15674. var position = options.position || BABYLON.Vector3.Zero();
  15675. var normal = options.normal || BABYLON.Vector3.Up();
  15676. var size = options.size || new BABYLON.Vector3(1, 1, 1);
  15677. var angle = options.angle || 0;
  15678. // Getting correct rotation
  15679. if (!normal) {
  15680. var target = new BABYLON.Vector3(0, 0, 1);
  15681. var camera = sourceMesh.getScene().activeCamera;
  15682. var cameraWorldTarget = BABYLON.Vector3.TransformCoordinates(target, camera.getWorldMatrix());
  15683. normal = camera.globalPosition.subtract(cameraWorldTarget);
  15684. }
  15685. var yaw = -Math.atan2(normal.z, normal.x) - Math.PI / 2;
  15686. var len = Math.sqrt(normal.x * normal.x + normal.z * normal.z);
  15687. var pitch = Math.atan2(normal.y, len);
  15688. // Matrix
  15689. var decalWorldMatrix = BABYLON.Matrix.RotationYawPitchRoll(yaw, pitch, angle).multiply(BABYLON.Matrix.Translation(position.x, position.y, position.z));
  15690. var inverseDecalWorldMatrix = BABYLON.Matrix.Invert(decalWorldMatrix);
  15691. var meshWorldMatrix = sourceMesh.getWorldMatrix();
  15692. var transformMatrix = meshWorldMatrix.multiply(inverseDecalWorldMatrix);
  15693. var vertexData = new BABYLON.VertexData();
  15694. vertexData.indices = [];
  15695. vertexData.positions = [];
  15696. vertexData.normals = [];
  15697. vertexData.uvs = [];
  15698. var currentVertexDataIndex = 0;
  15699. var extractDecalVector3 = function (indexId) {
  15700. var vertexId = indices[indexId];
  15701. var result = new BABYLON.PositionNormalVertex();
  15702. result.position = new BABYLON.Vector3(positions[vertexId * 3], positions[vertexId * 3 + 1], positions[vertexId * 3 + 2]);
  15703. // Send vector to decal local world
  15704. result.position = BABYLON.Vector3.TransformCoordinates(result.position, transformMatrix);
  15705. // Get normal
  15706. result.normal = new BABYLON.Vector3(normals[vertexId * 3], normals[vertexId * 3 + 1], normals[vertexId * 3 + 2]);
  15707. return result;
  15708. }; // Inspired by https://github.com/mrdoob/three.js/blob/eee231960882f6f3b6113405f524956145148146/examples/js/geometries/DecalGeometry.js
  15709. var clip = function (vertices, axis) {
  15710. if (vertices.length === 0) {
  15711. return vertices;
  15712. }
  15713. var clipSize = 0.5 * Math.abs(BABYLON.Vector3.Dot(size, axis));
  15714. var clipVertices = function (v0, v1) {
  15715. var clipFactor = BABYLON.Vector3.GetClipFactor(v0.position, v1.position, axis, clipSize);
  15716. return new BABYLON.PositionNormalVertex(BABYLON.Vector3.Lerp(v0.position, v1.position, clipFactor), BABYLON.Vector3.Lerp(v0.normal, v1.normal, clipFactor));
  15717. };
  15718. var result = new Array();
  15719. for (var index = 0; index < vertices.length; index += 3) {
  15720. var v1Out;
  15721. var v2Out;
  15722. var v3Out;
  15723. var total = 0;
  15724. var nV1, nV2, nV3, nV4;
  15725. var d1 = BABYLON.Vector3.Dot(vertices[index].position, axis) - clipSize;
  15726. var d2 = BABYLON.Vector3.Dot(vertices[index + 1].position, axis) - clipSize;
  15727. var d3 = BABYLON.Vector3.Dot(vertices[index + 2].position, axis) - clipSize;
  15728. v1Out = d1 > 0;
  15729. v2Out = d2 > 0;
  15730. v3Out = d3 > 0;
  15731. total = (v1Out ? 1 : 0) + (v2Out ? 1 : 0) + (v3Out ? 1 : 0);
  15732. switch (total) {
  15733. case 0:
  15734. result.push(vertices[index]);
  15735. result.push(vertices[index + 1]);
  15736. result.push(vertices[index + 2]);
  15737. break;
  15738. case 1:
  15739. if (v1Out) {
  15740. nV1 = vertices[index + 1];
  15741. nV2 = vertices[index + 2];
  15742. nV3 = clipVertices(vertices[index], nV1);
  15743. nV4 = clipVertices(vertices[index], nV2);
  15744. }
  15745. if (v2Out) {
  15746. nV1 = vertices[index];
  15747. nV2 = vertices[index + 2];
  15748. nV3 = clipVertices(vertices[index + 1], nV1);
  15749. nV4 = clipVertices(vertices[index + 1], nV2);
  15750. result.push(nV3);
  15751. result.push(nV2.clone());
  15752. result.push(nV1.clone());
  15753. result.push(nV2.clone());
  15754. result.push(nV3.clone());
  15755. result.push(nV4);
  15756. break;
  15757. }
  15758. if (v3Out) {
  15759. nV1 = vertices[index];
  15760. nV2 = vertices[index + 1];
  15761. nV3 = clipVertices(vertices[index + 2], nV1);
  15762. nV4 = clipVertices(vertices[index + 2], nV2);
  15763. }
  15764. result.push(nV1.clone());
  15765. result.push(nV2.clone());
  15766. result.push(nV3);
  15767. result.push(nV4);
  15768. result.push(nV3.clone());
  15769. result.push(nV2.clone());
  15770. break;
  15771. case 2:
  15772. if (!v1Out) {
  15773. nV1 = vertices[index].clone();
  15774. nV2 = clipVertices(nV1, vertices[index + 1]);
  15775. nV3 = clipVertices(nV1, vertices[index + 2]);
  15776. result.push(nV1);
  15777. result.push(nV2);
  15778. result.push(nV3);
  15779. }
  15780. if (!v2Out) {
  15781. nV1 = vertices[index + 1].clone();
  15782. nV2 = clipVertices(nV1, vertices[index + 2]);
  15783. nV3 = clipVertices(nV1, vertices[index]);
  15784. result.push(nV1);
  15785. result.push(nV2);
  15786. result.push(nV3);
  15787. }
  15788. if (!v3Out) {
  15789. nV1 = vertices[index + 2].clone();
  15790. nV2 = clipVertices(nV1, vertices[index]);
  15791. nV3 = clipVertices(nV1, vertices[index + 1]);
  15792. result.push(nV1);
  15793. result.push(nV2);
  15794. result.push(nV3);
  15795. }
  15796. break;
  15797. case 3:
  15798. break;
  15799. }
  15800. }
  15801. return result;
  15802. };
  15803. for (var index = 0; index < indices.length; index += 3) {
  15804. var faceVertices = new Array();
  15805. faceVertices.push(extractDecalVector3(index));
  15806. faceVertices.push(extractDecalVector3(index + 1));
  15807. faceVertices.push(extractDecalVector3(index + 2));
  15808. // Clip
  15809. faceVertices = clip(faceVertices, new BABYLON.Vector3(1, 0, 0));
  15810. faceVertices = clip(faceVertices, new BABYLON.Vector3(-1, 0, 0));
  15811. faceVertices = clip(faceVertices, new BABYLON.Vector3(0, 1, 0));
  15812. faceVertices = clip(faceVertices, new BABYLON.Vector3(0, -1, 0));
  15813. faceVertices = clip(faceVertices, new BABYLON.Vector3(0, 0, 1));
  15814. faceVertices = clip(faceVertices, new BABYLON.Vector3(0, 0, -1));
  15815. if (faceVertices.length === 0) {
  15816. continue;
  15817. }
  15818. // Add UVs and get back to world
  15819. for (var vIndex = 0; vIndex < faceVertices.length; vIndex++) {
  15820. var vertex = faceVertices[vIndex];
  15821. vertexData.indices.push(currentVertexDataIndex);
  15822. vertex.position.toArray(vertexData.positions, currentVertexDataIndex * 3);
  15823. vertex.normal.toArray(vertexData.normals, currentVertexDataIndex * 3);
  15824. vertexData.uvs.push(0.5 + vertex.position.x / size.x);
  15825. vertexData.uvs.push(0.5 + vertex.position.y / size.y);
  15826. currentVertexDataIndex++;
  15827. }
  15828. }
  15829. // Return mesh
  15830. var decal = new BABYLON.Mesh(name, sourceMesh.getScene());
  15831. vertexData.applyToMesh(decal);
  15832. decal.position = position.clone();
  15833. decal.rotation = new BABYLON.Vector3(pitch, yaw, angle);
  15834. return decal;
  15835. };
  15836. // Privates
  15837. MeshBuilder._ExtrudeShapeGeneric = function (name, shape, curve, scale, rotation, scaleFunction, rotateFunction, rbCA, rbCP, cap, custom, scene, updtbl, side, instance) {
  15838. // extrusion geometry
  15839. var extrusionPathArray = function (shape, curve, path3D, shapePaths, scale, rotation, scaleFunction, rotateFunction, cap, custom) {
  15840. var tangents = path3D.getTangents();
  15841. var normals = path3D.getNormals();
  15842. var binormals = path3D.getBinormals();
  15843. var distances = path3D.getDistances();
  15844. var angle = 0;
  15845. var returnScale = function () { return scale; };
  15846. var returnRotation = function () { return rotation; };
  15847. var rotate = custom ? rotateFunction : returnRotation;
  15848. var scl = custom ? scaleFunction : returnScale;
  15849. var index = (cap === BABYLON.Mesh.NO_CAP || cap === BABYLON.Mesh.CAP_END) ? 0 : 2;
  15850. var rotationMatrix = BABYLON.Matrix.Zero();
  15851. for (var i = 0; i < curve.length; i++) {
  15852. var shapePath = new Array();
  15853. var angleStep = rotate(i, distances[i]);
  15854. var scaleRatio = scl(i, distances[i]);
  15855. for (var p = 0; p < shape.length; p++) {
  15856. BABYLON.Matrix.RotationAxisToRef(tangents[i], angle, rotationMatrix);
  15857. var planed = ((tangents[i].scale(shape[p].z)).add(normals[i].scale(shape[p].x)).add(binormals[i].scale(shape[p].y)));
  15858. var rotated = BABYLON.Vector3.TransformCoordinates(planed, rotationMatrix).scaleInPlace(scaleRatio).add(curve[i]);
  15859. shapePath.push(rotated);
  15860. }
  15861. shapePaths[index] = shapePath;
  15862. angle += angleStep;
  15863. index++;
  15864. }
  15865. // cap
  15866. var capPath = function (shapePath) {
  15867. var pointCap = Array();
  15868. var barycenter = BABYLON.Vector3.Zero();
  15869. var i;
  15870. for (i = 0; i < shapePath.length; i++) {
  15871. barycenter.addInPlace(shapePath[i]);
  15872. }
  15873. barycenter.scaleInPlace(1 / shapePath.length);
  15874. for (i = 0; i < shapePath.length; i++) {
  15875. pointCap.push(barycenter);
  15876. }
  15877. return pointCap;
  15878. };
  15879. switch (cap) {
  15880. case BABYLON.Mesh.NO_CAP:
  15881. break;
  15882. case BABYLON.Mesh.CAP_START:
  15883. shapePaths[0] = capPath(shapePaths[2]);
  15884. shapePaths[1] = shapePaths[2].slice(0);
  15885. break;
  15886. case BABYLON.Mesh.CAP_END:
  15887. shapePaths[index] = shapePaths[index - 1];
  15888. shapePaths[index + 1] = capPath(shapePaths[index - 1]);
  15889. break;
  15890. case BABYLON.Mesh.CAP_ALL:
  15891. shapePaths[0] = capPath(shapePaths[2]);
  15892. shapePaths[1] = shapePaths[2].slice(0);
  15893. shapePaths[index] = shapePaths[index - 1];
  15894. shapePaths[index + 1] = capPath(shapePaths[index - 1]);
  15895. break;
  15896. default:
  15897. break;
  15898. }
  15899. return shapePaths;
  15900. };
  15901. var path3D;
  15902. var pathArray;
  15903. if (instance) {
  15904. path3D = (instance.path3D).update(curve);
  15905. pathArray = extrusionPathArray(shape, curve, instance.path3D, instance.pathArray, scale, rotation, scaleFunction, rotateFunction, instance.cap, custom);
  15906. instance = BABYLON.Mesh.CreateRibbon(null, pathArray, null, null, null, null, null, null, instance);
  15907. return instance;
  15908. }
  15909. // extruded shape creation
  15910. path3D = new BABYLON.Path3D(curve);
  15911. var newShapePaths = new Array();
  15912. cap = (cap < 0 || cap > 3) ? 0 : cap;
  15913. pathArray = extrusionPathArray(shape, curve, path3D, newShapePaths, scale, rotation, scaleFunction, rotateFunction, cap, custom);
  15914. var extrudedGeneric = BABYLON.Mesh.CreateRibbon(name, pathArray, rbCA, rbCP, 0, scene, updtbl, side);
  15915. extrudedGeneric.pathArray = pathArray;
  15916. extrudedGeneric.path3D = path3D;
  15917. extrudedGeneric.cap = cap;
  15918. return extrudedGeneric;
  15919. };
  15920. return MeshBuilder;
  15921. })();
  15922. BABYLON.MeshBuilder = MeshBuilder;
  15923. })(BABYLON || (BABYLON = {}));
  15924. var BABYLON;
  15925. (function (BABYLON) {
  15926. var BaseTexture = (function () {
  15927. function BaseTexture(scene) {
  15928. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NONE;
  15929. this.hasAlpha = false;
  15930. this.getAlphaFromRGB = false;
  15931. this.level = 1;
  15932. this.isCube = false;
  15933. this.isRenderTarget = false;
  15934. this.animations = new Array();
  15935. this.coordinatesIndex = 0;
  15936. this.coordinatesMode = BABYLON.Texture.EXPLICIT_MODE;
  15937. this.wrapU = BABYLON.Texture.WRAP_ADDRESSMODE;
  15938. this.wrapV = BABYLON.Texture.WRAP_ADDRESSMODE;
  15939. this.anisotropicFilteringLevel = 4;
  15940. this._scene = scene;
  15941. this._scene.textures.push(this);
  15942. }
  15943. BaseTexture.prototype.getScene = function () {
  15944. return this._scene;
  15945. };
  15946. BaseTexture.prototype.getTextureMatrix = function () {
  15947. return null;
  15948. };
  15949. BaseTexture.prototype.getReflectionTextureMatrix = function () {
  15950. return null;
  15951. };
  15952. BaseTexture.prototype.getInternalTexture = function () {
  15953. return this._texture;
  15954. };
  15955. BaseTexture.prototype.isReady = function () {
  15956. if (this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) {
  15957. return true;
  15958. }
  15959. if (this._texture) {
  15960. return this._texture.isReady;
  15961. }
  15962. return false;
  15963. };
  15964. BaseTexture.prototype.getSize = function () {
  15965. if (this._texture._width) {
  15966. return { width: this._texture._width, height: this._texture._height };
  15967. }
  15968. if (this._texture._size) {
  15969. return { width: this._texture._size, height: this._texture._size };
  15970. }
  15971. return { width: 0, height: 0 };
  15972. };
  15973. BaseTexture.prototype.getBaseSize = function () {
  15974. if (!this.isReady())
  15975. return { width: 0, height: 0 };
  15976. if (this._texture._size) {
  15977. return { width: this._texture._size, height: this._texture._size };
  15978. }
  15979. return { width: this._texture._baseWidth, height: this._texture._baseHeight };
  15980. };
  15981. BaseTexture.prototype.scale = function (ratio) {
  15982. };
  15983. Object.defineProperty(BaseTexture.prototype, "canRescale", {
  15984. get: function () {
  15985. return false;
  15986. },
  15987. enumerable: true,
  15988. configurable: true
  15989. });
  15990. BaseTexture.prototype._removeFromCache = function (url, noMipmap) {
  15991. var texturesCache = this._scene.getEngine().getLoadedTexturesCache();
  15992. for (var index = 0; index < texturesCache.length; index++) {
  15993. var texturesCacheEntry = texturesCache[index];
  15994. if (texturesCacheEntry.url === url && texturesCacheEntry.noMipmap === noMipmap) {
  15995. texturesCache.splice(index, 1);
  15996. return;
  15997. }
  15998. }
  15999. };
  16000. BaseTexture.prototype._getFromCache = function (url, noMipmap, sampling) {
  16001. var texturesCache = this._scene.getEngine().getLoadedTexturesCache();
  16002. for (var index = 0; index < texturesCache.length; index++) {
  16003. var texturesCacheEntry = texturesCache[index];
  16004. if (texturesCacheEntry.url === url && texturesCacheEntry.noMipmap === noMipmap) {
  16005. if (!sampling || sampling === texturesCacheEntry.samplingMode) {
  16006. texturesCacheEntry.references++;
  16007. return texturesCacheEntry;
  16008. }
  16009. }
  16010. }
  16011. return null;
  16012. };
  16013. BaseTexture.prototype.delayLoad = function () {
  16014. };
  16015. BaseTexture.prototype.clone = function () {
  16016. return null;
  16017. };
  16018. BaseTexture.prototype.releaseInternalTexture = function () {
  16019. if (this._texture) {
  16020. this._scene.getEngine().releaseInternalTexture(this._texture);
  16021. delete this._texture;
  16022. }
  16023. };
  16024. BaseTexture.prototype.dispose = function () {
  16025. // Remove from scene
  16026. var index = this._scene.textures.indexOf(this);
  16027. if (index >= 0) {
  16028. this._scene.textures.splice(index, 1);
  16029. }
  16030. if (this._texture === undefined) {
  16031. return;
  16032. }
  16033. // Callback
  16034. if (this.onDispose) {
  16035. this.onDispose();
  16036. }
  16037. };
  16038. return BaseTexture;
  16039. })();
  16040. BABYLON.BaseTexture = BaseTexture;
  16041. })(BABYLON || (BABYLON = {}));
  16042. var BABYLON;
  16043. (function (BABYLON) {
  16044. var Texture = (function (_super) {
  16045. __extends(Texture, _super);
  16046. function Texture(url, scene, noMipmap, invertY, samplingMode, onLoad, onError, buffer, deleteBuffer) {
  16047. if (samplingMode === void 0) { samplingMode = Texture.TRILINEAR_SAMPLINGMODE; }
  16048. if (onLoad === void 0) { onLoad = null; }
  16049. if (onError === void 0) { onError = null; }
  16050. if (buffer === void 0) { buffer = null; }
  16051. if (deleteBuffer === void 0) { deleteBuffer = false; }
  16052. _super.call(this, scene);
  16053. this.uOffset = 0;
  16054. this.vOffset = 0;
  16055. this.uScale = 1.0;
  16056. this.vScale = 1.0;
  16057. this.uAng = 0;
  16058. this.vAng = 0;
  16059. this.wAng = 0;
  16060. this.name = url;
  16061. this.url = url;
  16062. this._noMipmap = noMipmap;
  16063. this._invertY = invertY;
  16064. this._samplingMode = samplingMode;
  16065. this._buffer = buffer;
  16066. this._deleteBuffer = deleteBuffer;
  16067. if (!url) {
  16068. return;
  16069. }
  16070. this._texture = this._getFromCache(url, noMipmap, samplingMode);
  16071. if (!this._texture) {
  16072. if (!scene.useDelayedTextureLoading) {
  16073. this._texture = scene.getEngine().createTexture(url, noMipmap, invertY, scene, this._samplingMode, onLoad, onError, this._buffer);
  16074. if (deleteBuffer) {
  16075. delete this._buffer;
  16076. }
  16077. }
  16078. else {
  16079. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NOTLOADED;
  16080. }
  16081. }
  16082. else {
  16083. BABYLON.Tools.SetImmediate(function () {
  16084. if (onLoad) {
  16085. onLoad();
  16086. }
  16087. });
  16088. }
  16089. }
  16090. Texture.prototype.delayLoad = function () {
  16091. if (this.delayLoadState !== BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) {
  16092. return;
  16093. }
  16094. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADED;
  16095. this._texture = this._getFromCache(this.url, this._noMipmap, this._samplingMode);
  16096. if (!this._texture) {
  16097. this._texture = this.getScene().getEngine().createTexture(this.url, this._noMipmap, this._invertY, this.getScene(), this._samplingMode, null, null, this._buffer);
  16098. if (this._deleteBuffer) {
  16099. delete this._buffer;
  16100. }
  16101. }
  16102. };
  16103. Texture.prototype.updateSamplingMode = function (samplingMode) {
  16104. if (!this._texture) {
  16105. return;
  16106. }
  16107. this.getScene().getEngine().updateTextureSamplingMode(samplingMode, this._texture);
  16108. };
  16109. Texture.prototype._prepareRowForTextureGeneration = function (x, y, z, t) {
  16110. x *= this.uScale;
  16111. y *= this.vScale;
  16112. x -= 0.5 * this.uScale;
  16113. y -= 0.5 * this.vScale;
  16114. z -= 0.5;
  16115. BABYLON.Vector3.TransformCoordinatesFromFloatsToRef(x, y, z, this._rowGenerationMatrix, t);
  16116. t.x += 0.5 * this.uScale + this.uOffset;
  16117. t.y += 0.5 * this.vScale + this.vOffset;
  16118. t.z += 0.5;
  16119. };
  16120. Texture.prototype.getTextureMatrix = function () {
  16121. if (this.uOffset === this._cachedUOffset &&
  16122. this.vOffset === this._cachedVOffset &&
  16123. this.uScale === this._cachedUScale &&
  16124. this.vScale === this._cachedVScale &&
  16125. this.uAng === this._cachedUAng &&
  16126. this.vAng === this._cachedVAng &&
  16127. this.wAng === this._cachedWAng) {
  16128. return this._cachedTextureMatrix;
  16129. }
  16130. this._cachedUOffset = this.uOffset;
  16131. this._cachedVOffset = this.vOffset;
  16132. this._cachedUScale = this.uScale;
  16133. this._cachedVScale = this.vScale;
  16134. this._cachedUAng = this.uAng;
  16135. this._cachedVAng = this.vAng;
  16136. this._cachedWAng = this.wAng;
  16137. if (!this._cachedTextureMatrix) {
  16138. this._cachedTextureMatrix = BABYLON.Matrix.Zero();
  16139. this._rowGenerationMatrix = new BABYLON.Matrix();
  16140. this._t0 = BABYLON.Vector3.Zero();
  16141. this._t1 = BABYLON.Vector3.Zero();
  16142. this._t2 = BABYLON.Vector3.Zero();
  16143. }
  16144. BABYLON.Matrix.RotationYawPitchRollToRef(this.vAng, this.uAng, this.wAng, this._rowGenerationMatrix);
  16145. this._prepareRowForTextureGeneration(0, 0, 0, this._t0);
  16146. this._prepareRowForTextureGeneration(1.0, 0, 0, this._t1);
  16147. this._prepareRowForTextureGeneration(0, 1.0, 0, this._t2);
  16148. this._t1.subtractInPlace(this._t0);
  16149. this._t2.subtractInPlace(this._t0);
  16150. BABYLON.Matrix.IdentityToRef(this._cachedTextureMatrix);
  16151. this._cachedTextureMatrix.m[0] = this._t1.x;
  16152. this._cachedTextureMatrix.m[1] = this._t1.y;
  16153. this._cachedTextureMatrix.m[2] = this._t1.z;
  16154. this._cachedTextureMatrix.m[4] = this._t2.x;
  16155. this._cachedTextureMatrix.m[5] = this._t2.y;
  16156. this._cachedTextureMatrix.m[6] = this._t2.z;
  16157. this._cachedTextureMatrix.m[8] = this._t0.x;
  16158. this._cachedTextureMatrix.m[9] = this._t0.y;
  16159. this._cachedTextureMatrix.m[10] = this._t0.z;
  16160. return this._cachedTextureMatrix;
  16161. };
  16162. Texture.prototype.getReflectionTextureMatrix = function () {
  16163. if (this.uOffset === this._cachedUOffset &&
  16164. this.vOffset === this._cachedVOffset &&
  16165. this.uScale === this._cachedUScale &&
  16166. this.vScale === this._cachedVScale &&
  16167. this.coordinatesMode === this._cachedCoordinatesMode) {
  16168. return this._cachedTextureMatrix;
  16169. }
  16170. if (!this._cachedTextureMatrix) {
  16171. this._cachedTextureMatrix = BABYLON.Matrix.Zero();
  16172. this._projectionModeMatrix = BABYLON.Matrix.Zero();
  16173. }
  16174. this._cachedCoordinatesMode = this.coordinatesMode;
  16175. switch (this.coordinatesMode) {
  16176. case Texture.PLANAR_MODE:
  16177. BABYLON.Matrix.IdentityToRef(this._cachedTextureMatrix);
  16178. this._cachedTextureMatrix[0] = this.uScale;
  16179. this._cachedTextureMatrix[5] = this.vScale;
  16180. this._cachedTextureMatrix[12] = this.uOffset;
  16181. this._cachedTextureMatrix[13] = this.vOffset;
  16182. break;
  16183. case Texture.PROJECTION_MODE:
  16184. BABYLON.Matrix.IdentityToRef(this._projectionModeMatrix);
  16185. this._projectionModeMatrix.m[0] = 0.5;
  16186. this._projectionModeMatrix.m[5] = -0.5;
  16187. this._projectionModeMatrix.m[10] = 0.0;
  16188. this._projectionModeMatrix.m[12] = 0.5;
  16189. this._projectionModeMatrix.m[13] = 0.5;
  16190. this._projectionModeMatrix.m[14] = 1.0;
  16191. this._projectionModeMatrix.m[15] = 1.0;
  16192. this.getScene().getProjectionMatrix().multiplyToRef(this._projectionModeMatrix, this._cachedTextureMatrix);
  16193. break;
  16194. default:
  16195. BABYLON.Matrix.IdentityToRef(this._cachedTextureMatrix);
  16196. break;
  16197. }
  16198. return this._cachedTextureMatrix;
  16199. };
  16200. Texture.prototype.clone = function () {
  16201. var newTexture = new Texture(this._texture.url, this.getScene(), this._noMipmap, this._invertY, this._samplingMode);
  16202. // Base texture
  16203. newTexture.hasAlpha = this.hasAlpha;
  16204. newTexture.level = this.level;
  16205. newTexture.wrapU = this.wrapU;
  16206. newTexture.wrapV = this.wrapV;
  16207. newTexture.coordinatesIndex = this.coordinatesIndex;
  16208. newTexture.coordinatesMode = this.coordinatesMode;
  16209. // Texture
  16210. newTexture.uOffset = this.uOffset;
  16211. newTexture.vOffset = this.vOffset;
  16212. newTexture.uScale = this.uScale;
  16213. newTexture.vScale = this.vScale;
  16214. newTexture.uAng = this.uAng;
  16215. newTexture.vAng = this.vAng;
  16216. newTexture.wAng = this.wAng;
  16217. return newTexture;
  16218. };
  16219. // Statics
  16220. Texture.CreateFromBase64String = function (data, name, scene, noMipmap, invertY, samplingMode, onLoad, onError) {
  16221. if (samplingMode === void 0) { samplingMode = Texture.TRILINEAR_SAMPLINGMODE; }
  16222. if (onLoad === void 0) { onLoad = null; }
  16223. if (onError === void 0) { onError = null; }
  16224. return new Texture("data:" + name, scene, noMipmap, invertY, samplingMode, onLoad, onError, data);
  16225. };
  16226. // Constants
  16227. Texture.NEAREST_SAMPLINGMODE = 1;
  16228. Texture.BILINEAR_SAMPLINGMODE = 2;
  16229. Texture.TRILINEAR_SAMPLINGMODE = 3;
  16230. Texture.EXPLICIT_MODE = 0;
  16231. Texture.SPHERICAL_MODE = 1;
  16232. Texture.PLANAR_MODE = 2;
  16233. Texture.CUBIC_MODE = 3;
  16234. Texture.PROJECTION_MODE = 4;
  16235. Texture.SKYBOX_MODE = 5;
  16236. Texture.INVCUBIC_MODE = 6;
  16237. Texture.CLAMP_ADDRESSMODE = 0;
  16238. Texture.WRAP_ADDRESSMODE = 1;
  16239. Texture.MIRROR_ADDRESSMODE = 2;
  16240. return Texture;
  16241. })(BABYLON.BaseTexture);
  16242. BABYLON.Texture = Texture;
  16243. })(BABYLON || (BABYLON = {}));
  16244. var BABYLON;
  16245. (function (BABYLON) {
  16246. var CubeTexture = (function (_super) {
  16247. __extends(CubeTexture, _super);
  16248. function CubeTexture(rootUrl, scene, extensions, noMipmap) {
  16249. _super.call(this, scene);
  16250. this.coordinatesMode = BABYLON.Texture.CUBIC_MODE;
  16251. this.name = rootUrl;
  16252. this.url = rootUrl;
  16253. this._noMipmap = noMipmap;
  16254. this.hasAlpha = false;
  16255. if (!rootUrl) {
  16256. return;
  16257. }
  16258. this._texture = this._getFromCache(rootUrl, noMipmap);
  16259. if (!extensions) {
  16260. extensions = ["_px.jpg", "_py.jpg", "_pz.jpg", "_nx.jpg", "_ny.jpg", "_nz.jpg"];
  16261. }
  16262. this._extensions = extensions;
  16263. if (!this._texture) {
  16264. if (!scene.useDelayedTextureLoading) {
  16265. this._texture = scene.getEngine().createCubeTexture(rootUrl, scene, extensions, noMipmap);
  16266. }
  16267. else {
  16268. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NOTLOADED;
  16269. }
  16270. }
  16271. this.isCube = true;
  16272. this._textureMatrix = BABYLON.Matrix.Identity();
  16273. }
  16274. CubeTexture.prototype.clone = function () {
  16275. var newTexture = new CubeTexture(this.url, this.getScene(), this._extensions, this._noMipmap);
  16276. // Base texture
  16277. newTexture.level = this.level;
  16278. newTexture.wrapU = this.wrapU;
  16279. newTexture.wrapV = this.wrapV;
  16280. newTexture.coordinatesIndex = this.coordinatesIndex;
  16281. newTexture.coordinatesMode = this.coordinatesMode;
  16282. return newTexture;
  16283. };
  16284. // Methods
  16285. CubeTexture.prototype.delayLoad = function () {
  16286. if (this.delayLoadState !== BABYLON.Engine.DELAYLOADSTATE_NOTLOADED) {
  16287. return;
  16288. }
  16289. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADED;
  16290. this._texture = this._getFromCache(this.url, this._noMipmap);
  16291. if (!this._texture) {
  16292. this._texture = this.getScene().getEngine().createCubeTexture(this.url, this.getScene(), this._extensions);
  16293. }
  16294. };
  16295. CubeTexture.prototype.getReflectionTextureMatrix = function () {
  16296. return this._textureMatrix;
  16297. };
  16298. return CubeTexture;
  16299. })(BABYLON.BaseTexture);
  16300. BABYLON.CubeTexture = CubeTexture;
  16301. })(BABYLON || (BABYLON = {}));
  16302. var BABYLON;
  16303. (function (BABYLON) {
  16304. var RenderTargetTexture = (function (_super) {
  16305. __extends(RenderTargetTexture, _super);
  16306. function RenderTargetTexture(name, size, scene, generateMipMaps, doNotChangeAspectRatio, type, isCube) {
  16307. if (doNotChangeAspectRatio === void 0) { doNotChangeAspectRatio = true; }
  16308. if (type === void 0) { type = BABYLON.Engine.TEXTURETYPE_UNSIGNED_INT; }
  16309. if (isCube === void 0) { isCube = false; }
  16310. _super.call(this, null, scene, !generateMipMaps);
  16311. this.isCube = isCube;
  16312. this.renderList = new Array();
  16313. this.renderParticles = true;
  16314. this.renderSprites = false;
  16315. this.coordinatesMode = BABYLON.Texture.PROJECTION_MODE;
  16316. this._currentRefreshId = -1;
  16317. this._refreshRate = 1;
  16318. this.name = name;
  16319. this.isRenderTarget = true;
  16320. this._size = size;
  16321. this._generateMipMaps = generateMipMaps;
  16322. this._doNotChangeAspectRatio = doNotChangeAspectRatio;
  16323. if (isCube) {
  16324. this._texture = scene.getEngine().createRenderTargetCubeTexture(size, { generateMipMaps: generateMipMaps });
  16325. this.coordinatesMode = BABYLON.Texture.INVCUBIC_MODE;
  16326. this._textureMatrix = BABYLON.Matrix.Identity();
  16327. }
  16328. else {
  16329. this._texture = scene.getEngine().createRenderTargetTexture(size, { generateMipMaps: generateMipMaps, type: type });
  16330. }
  16331. // Rendering groups
  16332. this._renderingManager = new BABYLON.RenderingManager(scene);
  16333. }
  16334. Object.defineProperty(RenderTargetTexture, "REFRESHRATE_RENDER_ONCE", {
  16335. get: function () {
  16336. return RenderTargetTexture._REFRESHRATE_RENDER_ONCE;
  16337. },
  16338. enumerable: true,
  16339. configurable: true
  16340. });
  16341. Object.defineProperty(RenderTargetTexture, "REFRESHRATE_RENDER_ONEVERYFRAME", {
  16342. get: function () {
  16343. return RenderTargetTexture._REFRESHRATE_RENDER_ONEVERYFRAME;
  16344. },
  16345. enumerable: true,
  16346. configurable: true
  16347. });
  16348. Object.defineProperty(RenderTargetTexture, "REFRESHRATE_RENDER_ONEVERYTWOFRAMES", {
  16349. get: function () {
  16350. return RenderTargetTexture._REFRESHRATE_RENDER_ONEVERYTWOFRAMES;
  16351. },
  16352. enumerable: true,
  16353. configurable: true
  16354. });
  16355. RenderTargetTexture.prototype.resetRefreshCounter = function () {
  16356. this._currentRefreshId = -1;
  16357. };
  16358. Object.defineProperty(RenderTargetTexture.prototype, "refreshRate", {
  16359. get: function () {
  16360. return this._refreshRate;
  16361. },
  16362. // Use 0 to render just once, 1 to render on every frame, 2 to render every two frames and so on...
  16363. set: function (value) {
  16364. this._refreshRate = value;
  16365. this.resetRefreshCounter();
  16366. },
  16367. enumerable: true,
  16368. configurable: true
  16369. });
  16370. RenderTargetTexture.prototype._shouldRender = function () {
  16371. if (this._currentRefreshId === -1) {
  16372. this._currentRefreshId = 1;
  16373. return true;
  16374. }
  16375. if (this.refreshRate === this._currentRefreshId) {
  16376. this._currentRefreshId = 1;
  16377. return true;
  16378. }
  16379. this._currentRefreshId++;
  16380. return false;
  16381. };
  16382. RenderTargetTexture.prototype.isReady = function () {
  16383. if (!this.getScene().renderTargetsEnabled) {
  16384. return false;
  16385. }
  16386. return _super.prototype.isReady.call(this);
  16387. };
  16388. RenderTargetTexture.prototype.getRenderSize = function () {
  16389. return this._size;
  16390. };
  16391. Object.defineProperty(RenderTargetTexture.prototype, "canRescale", {
  16392. get: function () {
  16393. return true;
  16394. },
  16395. enumerable: true,
  16396. configurable: true
  16397. });
  16398. RenderTargetTexture.prototype.scale = function (ratio) {
  16399. var newSize = this._size * ratio;
  16400. this.resize(newSize, this._generateMipMaps);
  16401. };
  16402. RenderTargetTexture.prototype.getReflectionTextureMatrix = function () {
  16403. if (this.isCube) {
  16404. return this._textureMatrix;
  16405. }
  16406. return _super.prototype.getReflectionTextureMatrix.call(this);
  16407. };
  16408. RenderTargetTexture.prototype.resize = function (size, generateMipMaps) {
  16409. this.releaseInternalTexture();
  16410. if (this.isCube) {
  16411. this._texture = this.getScene().getEngine().createRenderTargetCubeTexture(size);
  16412. }
  16413. else {
  16414. this._texture = this.getScene().getEngine().createRenderTargetTexture(size, generateMipMaps);
  16415. }
  16416. };
  16417. RenderTargetTexture.prototype.render = function (useCameraPostProcess, dumpForDebug) {
  16418. var scene = this.getScene();
  16419. if (this._waitingRenderList) {
  16420. this.renderList = [];
  16421. for (var index = 0; index < this._waitingRenderList.length; index++) {
  16422. var id = this._waitingRenderList[index];
  16423. this.renderList.push(scene.getMeshByID(id));
  16424. }
  16425. delete this._waitingRenderList;
  16426. }
  16427. if (this.renderList && this.renderList.length === 0) {
  16428. return;
  16429. }
  16430. // Prepare renderingManager
  16431. this._renderingManager.reset();
  16432. var currentRenderList = this.renderList ? this.renderList : scene.getActiveMeshes().data;
  16433. for (var meshIndex = 0; meshIndex < currentRenderList.length; meshIndex++) {
  16434. var mesh = currentRenderList[meshIndex];
  16435. if (mesh) {
  16436. if (!mesh.isReady()) {
  16437. // Reset _currentRefreshId
  16438. this.resetRefreshCounter();
  16439. continue;
  16440. }
  16441. if (mesh.isEnabled() && mesh.isVisible && mesh.subMeshes && ((mesh.layerMask & scene.activeCamera.layerMask) !== 0)) {
  16442. mesh._activate(scene.getRenderId());
  16443. for (var subIndex = 0; subIndex < mesh.subMeshes.length; subIndex++) {
  16444. var subMesh = mesh.subMeshes[subIndex];
  16445. scene._activeIndices += subMesh.indexCount;
  16446. this._renderingManager.dispatch(subMesh);
  16447. }
  16448. }
  16449. }
  16450. }
  16451. if (this.isCube) {
  16452. for (var face = 0; face < 6; face++) {
  16453. this.renderToTarget(face, currentRenderList, useCameraPostProcess, dumpForDebug);
  16454. }
  16455. }
  16456. else {
  16457. this.renderToTarget(0, currentRenderList, useCameraPostProcess, dumpForDebug);
  16458. }
  16459. if (this.onAfterUnbind) {
  16460. this.onAfterUnbind();
  16461. }
  16462. scene.resetCachedMaterial();
  16463. };
  16464. RenderTargetTexture.prototype.renderToTarget = function (faceIndex, currentRenderList, useCameraPostProcess, dumpForDebug) {
  16465. var scene = this.getScene();
  16466. var engine = scene.getEngine();
  16467. // Bind
  16468. if (!useCameraPostProcess || !scene.postProcessManager._prepareFrame(this._texture)) {
  16469. if (this.isCube) {
  16470. engine.bindFramebuffer(this._texture, faceIndex);
  16471. }
  16472. else {
  16473. engine.bindFramebuffer(this._texture);
  16474. }
  16475. }
  16476. if (this.onBeforeRender) {
  16477. this.onBeforeRender(faceIndex);
  16478. }
  16479. // Clear
  16480. if (this.onClear) {
  16481. this.onClear(engine);
  16482. }
  16483. else {
  16484. engine.clear(scene.clearColor, true, true);
  16485. }
  16486. if (!this._doNotChangeAspectRatio) {
  16487. scene.updateTransformMatrix(true);
  16488. }
  16489. // Render
  16490. this._renderingManager.render(this.customRenderFunction, currentRenderList, this.renderParticles, this.renderSprites);
  16491. if (useCameraPostProcess) {
  16492. scene.postProcessManager._finalizeFrame(false, this._texture, faceIndex);
  16493. }
  16494. if (!this._doNotChangeAspectRatio) {
  16495. scene.updateTransformMatrix(true);
  16496. }
  16497. if (this.onAfterRender) {
  16498. this.onAfterRender(faceIndex);
  16499. }
  16500. // Dump ?
  16501. if (dumpForDebug) {
  16502. BABYLON.Tools.DumpFramebuffer(this._size, this._size, engine);
  16503. }
  16504. // Unbind
  16505. if (!this.isCube || faceIndex === 5) {
  16506. if (this.isCube) {
  16507. if (faceIndex === 5) {
  16508. engine.generateMipMapsForCubemap(this._texture);
  16509. }
  16510. }
  16511. engine.unBindFramebuffer(this._texture, this.isCube);
  16512. }
  16513. };
  16514. RenderTargetTexture.prototype.clone = function () {
  16515. var textureSize = this.getSize();
  16516. var newTexture = new RenderTargetTexture(this.name, textureSize.width, this.getScene(), this._generateMipMaps);
  16517. // Base texture
  16518. newTexture.hasAlpha = this.hasAlpha;
  16519. newTexture.level = this.level;
  16520. // RenderTarget Texture
  16521. newTexture.coordinatesMode = this.coordinatesMode;
  16522. newTexture.renderList = this.renderList.slice(0);
  16523. return newTexture;
  16524. };
  16525. RenderTargetTexture._REFRESHRATE_RENDER_ONCE = 0;
  16526. RenderTargetTexture._REFRESHRATE_RENDER_ONEVERYFRAME = 1;
  16527. RenderTargetTexture._REFRESHRATE_RENDER_ONEVERYTWOFRAMES = 2;
  16528. return RenderTargetTexture;
  16529. })(BABYLON.Texture);
  16530. BABYLON.RenderTargetTexture = RenderTargetTexture;
  16531. })(BABYLON || (BABYLON = {}));
  16532. var BABYLON;
  16533. (function (BABYLON) {
  16534. var ProceduralTexture = (function (_super) {
  16535. __extends(ProceduralTexture, _super);
  16536. function ProceduralTexture(name, size, fragment, scene, fallbackTexture, generateMipMaps) {
  16537. if (generateMipMaps === void 0) { generateMipMaps = true; }
  16538. _super.call(this, null, scene, !generateMipMaps);
  16539. this.isEnabled = true;
  16540. this._currentRefreshId = -1;
  16541. this._refreshRate = 1;
  16542. this._vertexDeclaration = [2];
  16543. this._vertexStrideSize = 2 * 4;
  16544. this._uniforms = new Array();
  16545. this._samplers = new Array();
  16546. this._textures = new Array();
  16547. this._floats = new Array();
  16548. this._floatsArrays = {};
  16549. this._colors3 = new Array();
  16550. this._colors4 = new Array();
  16551. this._vectors2 = new Array();
  16552. this._vectors3 = new Array();
  16553. this._matrices = new Array();
  16554. this._fallbackTextureUsed = false;
  16555. scene._proceduralTextures.push(this);
  16556. this.name = name;
  16557. this.isRenderTarget = true;
  16558. this._size = size;
  16559. this._generateMipMaps = generateMipMaps;
  16560. this.setFragment(fragment);
  16561. this._fallbackTexture = fallbackTexture;
  16562. this._texture = scene.getEngine().createRenderTargetTexture(size, generateMipMaps);
  16563. // VBO
  16564. var vertices = [];
  16565. vertices.push(1, 1);
  16566. vertices.push(-1, 1);
  16567. vertices.push(-1, -1);
  16568. vertices.push(1, -1);
  16569. this._vertexBuffer = scene.getEngine().createVertexBuffer(vertices);
  16570. // Indices
  16571. var indices = [];
  16572. indices.push(0);
  16573. indices.push(1);
  16574. indices.push(2);
  16575. indices.push(0);
  16576. indices.push(2);
  16577. indices.push(3);
  16578. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  16579. }
  16580. ProceduralTexture.prototype.reset = function () {
  16581. if (this._effect === undefined) {
  16582. return;
  16583. }
  16584. var engine = this.getScene().getEngine();
  16585. engine._releaseEffect(this._effect);
  16586. };
  16587. ProceduralTexture.prototype.isReady = function () {
  16588. var _this = this;
  16589. var engine = this.getScene().getEngine();
  16590. var shaders;
  16591. if (!this._fragment) {
  16592. return false;
  16593. }
  16594. if (this._fallbackTextureUsed) {
  16595. return true;
  16596. }
  16597. if (this._fragment.fragmentElement !== undefined) {
  16598. shaders = { vertex: "procedural", fragmentElement: this._fragment.fragmentElement };
  16599. }
  16600. else {
  16601. shaders = { vertex: "procedural", fragment: this._fragment };
  16602. }
  16603. this._effect = engine.createEffect(shaders, ["position"], this._uniforms, this._samplers, "", null, null, function () {
  16604. _this.releaseInternalTexture();
  16605. if (_this._fallbackTexture) {
  16606. _this._texture = _this._fallbackTexture._texture;
  16607. _this._texture.references++;
  16608. }
  16609. _this._fallbackTextureUsed = true;
  16610. });
  16611. return this._effect.isReady();
  16612. };
  16613. ProceduralTexture.prototype.resetRefreshCounter = function () {
  16614. this._currentRefreshId = -1;
  16615. };
  16616. ProceduralTexture.prototype.setFragment = function (fragment) {
  16617. this._fragment = fragment;
  16618. };
  16619. Object.defineProperty(ProceduralTexture.prototype, "refreshRate", {
  16620. get: function () {
  16621. return this._refreshRate;
  16622. },
  16623. // Use 0 to render just once, 1 to render on every frame, 2 to render every two frames and so on...
  16624. set: function (value) {
  16625. this._refreshRate = value;
  16626. this.resetRefreshCounter();
  16627. },
  16628. enumerable: true,
  16629. configurable: true
  16630. });
  16631. ProceduralTexture.prototype._shouldRender = function () {
  16632. if (!this.isEnabled || !this.isReady() || !this._texture) {
  16633. return false;
  16634. }
  16635. if (this._fallbackTextureUsed) {
  16636. return false;
  16637. }
  16638. if (this._currentRefreshId === -1) {
  16639. this._currentRefreshId = 1;
  16640. return true;
  16641. }
  16642. if (this.refreshRate === this._currentRefreshId) {
  16643. this._currentRefreshId = 1;
  16644. return true;
  16645. }
  16646. this._currentRefreshId++;
  16647. return false;
  16648. };
  16649. ProceduralTexture.prototype.getRenderSize = function () {
  16650. return this._size;
  16651. };
  16652. ProceduralTexture.prototype.resize = function (size, generateMipMaps) {
  16653. if (this._fallbackTextureUsed) {
  16654. return;
  16655. }
  16656. this.releaseInternalTexture();
  16657. this._texture = this.getScene().getEngine().createRenderTargetTexture(size, generateMipMaps);
  16658. };
  16659. ProceduralTexture.prototype._checkUniform = function (uniformName) {
  16660. if (this._uniforms.indexOf(uniformName) === -1) {
  16661. this._uniforms.push(uniformName);
  16662. }
  16663. };
  16664. ProceduralTexture.prototype.setTexture = function (name, texture) {
  16665. if (this._samplers.indexOf(name) === -1) {
  16666. this._samplers.push(name);
  16667. }
  16668. this._textures[name] = texture;
  16669. return this;
  16670. };
  16671. ProceduralTexture.prototype.setFloat = function (name, value) {
  16672. this._checkUniform(name);
  16673. this._floats[name] = value;
  16674. return this;
  16675. };
  16676. ProceduralTexture.prototype.setFloats = function (name, value) {
  16677. this._checkUniform(name);
  16678. this._floatsArrays[name] = value;
  16679. return this;
  16680. };
  16681. ProceduralTexture.prototype.setColor3 = function (name, value) {
  16682. this._checkUniform(name);
  16683. this._colors3[name] = value;
  16684. return this;
  16685. };
  16686. ProceduralTexture.prototype.setColor4 = function (name, value) {
  16687. this._checkUniform(name);
  16688. this._colors4[name] = value;
  16689. return this;
  16690. };
  16691. ProceduralTexture.prototype.setVector2 = function (name, value) {
  16692. this._checkUniform(name);
  16693. this._vectors2[name] = value;
  16694. return this;
  16695. };
  16696. ProceduralTexture.prototype.setVector3 = function (name, value) {
  16697. this._checkUniform(name);
  16698. this._vectors3[name] = value;
  16699. return this;
  16700. };
  16701. ProceduralTexture.prototype.setMatrix = function (name, value) {
  16702. this._checkUniform(name);
  16703. this._matrices[name] = value;
  16704. return this;
  16705. };
  16706. ProceduralTexture.prototype.render = function (useCameraPostProcess) {
  16707. var scene = this.getScene();
  16708. var engine = scene.getEngine();
  16709. engine.bindFramebuffer(this._texture);
  16710. // Clear
  16711. engine.clear(scene.clearColor, true, true);
  16712. // Render
  16713. engine.enableEffect(this._effect);
  16714. engine.setState(false);
  16715. // Texture
  16716. for (var name in this._textures) {
  16717. this._effect.setTexture(name, this._textures[name]);
  16718. }
  16719. // Float
  16720. for (name in this._floats) {
  16721. this._effect.setFloat(name, this._floats[name]);
  16722. }
  16723. // Floats
  16724. for (name in this._floatsArrays) {
  16725. this._effect.setArray(name, this._floatsArrays[name]);
  16726. }
  16727. // Color3
  16728. for (name in this._colors3) {
  16729. this._effect.setColor3(name, this._colors3[name]);
  16730. }
  16731. // Color4
  16732. for (name in this._colors4) {
  16733. var color = this._colors4[name];
  16734. this._effect.setFloat4(name, color.r, color.g, color.b, color.a);
  16735. }
  16736. // Vector2
  16737. for (name in this._vectors2) {
  16738. this._effect.setVector2(name, this._vectors2[name]);
  16739. }
  16740. // Vector3
  16741. for (name in this._vectors3) {
  16742. this._effect.setVector3(name, this._vectors3[name]);
  16743. }
  16744. // Matrix
  16745. for (name in this._matrices) {
  16746. this._effect.setMatrix(name, this._matrices[name]);
  16747. }
  16748. // VBOs
  16749. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, this._effect);
  16750. // Draw order
  16751. engine.draw(true, 0, 6);
  16752. // Unbind
  16753. engine.unBindFramebuffer(this._texture);
  16754. };
  16755. ProceduralTexture.prototype.clone = function () {
  16756. var textureSize = this.getSize();
  16757. var newTexture = new ProceduralTexture(this.name, textureSize.width, this._fragment, this.getScene(), this._fallbackTexture, this._generateMipMaps);
  16758. // Base texture
  16759. newTexture.hasAlpha = this.hasAlpha;
  16760. newTexture.level = this.level;
  16761. // RenderTarget Texture
  16762. newTexture.coordinatesMode = this.coordinatesMode;
  16763. return newTexture;
  16764. };
  16765. ProceduralTexture.prototype.dispose = function () {
  16766. var index = this.getScene()._proceduralTextures.indexOf(this);
  16767. if (index >= 0) {
  16768. this.getScene()._proceduralTextures.splice(index, 1);
  16769. }
  16770. _super.prototype.dispose.call(this);
  16771. };
  16772. return ProceduralTexture;
  16773. })(BABYLON.Texture);
  16774. BABYLON.ProceduralTexture = ProceduralTexture;
  16775. })(BABYLON || (BABYLON = {}));
  16776. var BABYLON;
  16777. (function (BABYLON) {
  16778. var MirrorTexture = (function (_super) {
  16779. __extends(MirrorTexture, _super);
  16780. function MirrorTexture(name, size, scene, generateMipMaps) {
  16781. var _this = this;
  16782. _super.call(this, name, size, scene, generateMipMaps, true);
  16783. this.mirrorPlane = new BABYLON.Plane(0, 1, 0, 1);
  16784. this._transformMatrix = BABYLON.Matrix.Zero();
  16785. this._mirrorMatrix = BABYLON.Matrix.Zero();
  16786. this.onBeforeRender = function () {
  16787. BABYLON.Matrix.ReflectionToRef(_this.mirrorPlane, _this._mirrorMatrix);
  16788. _this._savedViewMatrix = scene.getViewMatrix();
  16789. _this._mirrorMatrix.multiplyToRef(_this._savedViewMatrix, _this._transformMatrix);
  16790. scene.setTransformMatrix(_this._transformMatrix, scene.getProjectionMatrix());
  16791. scene.clipPlane = _this.mirrorPlane;
  16792. scene.getEngine().cullBackFaces = false;
  16793. scene._mirroredCameraPosition = BABYLON.Vector3.TransformCoordinates(scene.activeCamera.position, _this._mirrorMatrix);
  16794. };
  16795. this.onAfterRender = function () {
  16796. scene.setTransformMatrix(_this._savedViewMatrix, scene.getProjectionMatrix());
  16797. scene.getEngine().cullBackFaces = true;
  16798. scene._mirroredCameraPosition = null;
  16799. delete scene.clipPlane;
  16800. };
  16801. }
  16802. MirrorTexture.prototype.clone = function () {
  16803. var textureSize = this.getSize();
  16804. var newTexture = new MirrorTexture(this.name, textureSize.width, this.getScene(), this._generateMipMaps);
  16805. // Base texture
  16806. newTexture.hasAlpha = this.hasAlpha;
  16807. newTexture.level = this.level;
  16808. // Mirror Texture
  16809. newTexture.mirrorPlane = this.mirrorPlane.clone();
  16810. newTexture.renderList = this.renderList.slice(0);
  16811. return newTexture;
  16812. };
  16813. return MirrorTexture;
  16814. })(BABYLON.RenderTargetTexture);
  16815. BABYLON.MirrorTexture = MirrorTexture;
  16816. })(BABYLON || (BABYLON = {}));
  16817. var BABYLON;
  16818. (function (BABYLON) {
  16819. var DynamicTexture = (function (_super) {
  16820. __extends(DynamicTexture, _super);
  16821. function DynamicTexture(name, options, scene, generateMipMaps, samplingMode) {
  16822. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  16823. _super.call(this, null, scene, !generateMipMaps);
  16824. this.name = name;
  16825. this.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  16826. this.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  16827. this._generateMipMaps = generateMipMaps;
  16828. if (options.getContext) {
  16829. this._canvas = options;
  16830. this._texture = scene.getEngine().createDynamicTexture(options.width, options.height, generateMipMaps, samplingMode);
  16831. }
  16832. else {
  16833. this._canvas = document.createElement("canvas");
  16834. if (options.width) {
  16835. this._texture = scene.getEngine().createDynamicTexture(options.width, options.height, generateMipMaps, samplingMode);
  16836. }
  16837. else {
  16838. this._texture = scene.getEngine().createDynamicTexture(options, options, generateMipMaps, samplingMode);
  16839. }
  16840. }
  16841. var textureSize = this.getSize();
  16842. this._canvas.width = textureSize.width;
  16843. this._canvas.height = textureSize.height;
  16844. this._context = this._canvas.getContext("2d");
  16845. }
  16846. Object.defineProperty(DynamicTexture.prototype, "canRescale", {
  16847. get: function () {
  16848. return true;
  16849. },
  16850. enumerable: true,
  16851. configurable: true
  16852. });
  16853. DynamicTexture.prototype.scale = function (ratio) {
  16854. var textureSize = this.getSize();
  16855. textureSize.width *= ratio;
  16856. textureSize.height *= ratio;
  16857. this._canvas.width = textureSize.width;
  16858. this._canvas.height = textureSize.height;
  16859. this.releaseInternalTexture();
  16860. this._texture = this.getScene().getEngine().createDynamicTexture(textureSize.width, textureSize.height, this._generateMipMaps, this._samplingMode);
  16861. };
  16862. DynamicTexture.prototype.getContext = function () {
  16863. return this._context;
  16864. };
  16865. DynamicTexture.prototype.clear = function () {
  16866. var size = this.getSize();
  16867. this._context.fillRect(0, 0, size.width, size.height);
  16868. };
  16869. DynamicTexture.prototype.update = function (invertY) {
  16870. this.getScene().getEngine().updateDynamicTexture(this._texture, this._canvas, invertY === undefined ? true : invertY);
  16871. };
  16872. DynamicTexture.prototype.drawText = function (text, x, y, font, color, clearColor, invertY, update) {
  16873. if (update === void 0) { update = true; }
  16874. var size = this.getSize();
  16875. if (clearColor) {
  16876. this._context.fillStyle = clearColor;
  16877. this._context.fillRect(0, 0, size.width, size.height);
  16878. }
  16879. this._context.font = font;
  16880. if (x === null) {
  16881. var textSize = this._context.measureText(text);
  16882. x = (size.width - textSize.width) / 2;
  16883. }
  16884. this._context.fillStyle = color;
  16885. this._context.fillText(text, x, y);
  16886. if (update) {
  16887. this.update(invertY);
  16888. }
  16889. };
  16890. DynamicTexture.prototype.clone = function () {
  16891. var textureSize = this.getSize();
  16892. var newTexture = new DynamicTexture(this.name, textureSize.width, this.getScene(), this._generateMipMaps);
  16893. // Base texture
  16894. newTexture.hasAlpha = this.hasAlpha;
  16895. newTexture.level = this.level;
  16896. // Dynamic Texture
  16897. newTexture.wrapU = this.wrapU;
  16898. newTexture.wrapV = this.wrapV;
  16899. return newTexture;
  16900. };
  16901. return DynamicTexture;
  16902. })(BABYLON.Texture);
  16903. BABYLON.DynamicTexture = DynamicTexture;
  16904. })(BABYLON || (BABYLON = {}));
  16905. var BABYLON;
  16906. (function (BABYLON) {
  16907. var VideoTexture = (function (_super) {
  16908. __extends(VideoTexture, _super);
  16909. function VideoTexture(name, urls, scene, generateMipMaps, invertY, samplingMode) {
  16910. var _this = this;
  16911. if (generateMipMaps === void 0) { generateMipMaps = false; }
  16912. if (invertY === void 0) { invertY = false; }
  16913. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  16914. _super.call(this, null, scene, !generateMipMaps, invertY);
  16915. this._autoLaunch = true;
  16916. this.name = name;
  16917. this.video = document.createElement("video");
  16918. this.video.autoplay = false;
  16919. this.video.loop = true;
  16920. this.video.addEventListener("canplaythrough", function () {
  16921. if (BABYLON.Tools.IsExponentOfTwo(_this.video.videoWidth) && BABYLON.Tools.IsExponentOfTwo(_this.video.videoHeight)) {
  16922. _this.wrapU = BABYLON.Texture.WRAP_ADDRESSMODE;
  16923. _this.wrapV = BABYLON.Texture.WRAP_ADDRESSMODE;
  16924. }
  16925. else {
  16926. _this.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  16927. _this.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  16928. generateMipMaps = false;
  16929. }
  16930. _this._texture = scene.getEngine().createDynamicTexture(_this.video.videoWidth, _this.video.videoHeight, generateMipMaps, samplingMode, false);
  16931. _this._texture.isReady = true;
  16932. });
  16933. urls.forEach(function (url) {
  16934. //Backwards-compatibility for typescript 1. from 1.3 it should say "SOURCE". see here - https://github.com/Microsoft/TypeScript/issues/1850
  16935. var source = document.createElement("source");
  16936. source.src = url;
  16937. _this.video.appendChild(source);
  16938. });
  16939. this._lastUpdate = BABYLON.Tools.Now;
  16940. }
  16941. VideoTexture.prototype.update = function () {
  16942. if (this._autoLaunch) {
  16943. this._autoLaunch = false;
  16944. this.video.play();
  16945. }
  16946. var now = BABYLON.Tools.Now;
  16947. if (now - this._lastUpdate < 15 || this.video.readyState !== this.video.HAVE_ENOUGH_DATA) {
  16948. return false;
  16949. }
  16950. this._lastUpdate = now;
  16951. this.getScene().getEngine().updateVideoTexture(this._texture, this.video, this._invertY);
  16952. return true;
  16953. };
  16954. return VideoTexture;
  16955. })(BABYLON.Texture);
  16956. BABYLON.VideoTexture = VideoTexture;
  16957. })(BABYLON || (BABYLON = {}));
  16958. var BABYLON;
  16959. (function (BABYLON) {
  16960. var CustomProceduralTexture = (function (_super) {
  16961. __extends(CustomProceduralTexture, _super);
  16962. function CustomProceduralTexture(name, texturePath, size, scene, fallbackTexture, generateMipMaps) {
  16963. _super.call(this, name, size, null, scene, fallbackTexture, generateMipMaps);
  16964. this._animate = true;
  16965. this._time = 0;
  16966. this._texturePath = texturePath;
  16967. //Try to load json
  16968. this.loadJson(texturePath);
  16969. this.refreshRate = 1;
  16970. }
  16971. CustomProceduralTexture.prototype.loadJson = function (jsonUrl) {
  16972. var _this = this;
  16973. var that = this;
  16974. function noConfigFile() {
  16975. BABYLON.Tools.Log("No config file found in " + jsonUrl + " trying to use ShadersStore or DOM element");
  16976. try {
  16977. that.setFragment(that._texturePath);
  16978. }
  16979. catch (ex) {
  16980. BABYLON.Tools.Error("No json or ShaderStore or DOM element found for CustomProceduralTexture");
  16981. }
  16982. }
  16983. var configFileUrl = jsonUrl + "/config.json";
  16984. var xhr = new XMLHttpRequest();
  16985. xhr.open("GET", configFileUrl, true);
  16986. xhr.addEventListener("load", function () {
  16987. if (xhr.status === 200 || BABYLON.Tools.ValidateXHRData(xhr, 1)) {
  16988. try {
  16989. _this._config = JSON.parse(xhr.response);
  16990. _this.updateShaderUniforms();
  16991. _this.updateTextures();
  16992. _this.setFragment(_this._texturePath + "/custom");
  16993. _this._animate = _this._config.animate;
  16994. _this.refreshRate = _this._config.refreshrate;
  16995. }
  16996. catch (ex) {
  16997. noConfigFile();
  16998. }
  16999. }
  17000. else {
  17001. noConfigFile();
  17002. }
  17003. }, false);
  17004. xhr.addEventListener("error", function () {
  17005. noConfigFile();
  17006. }, false);
  17007. try {
  17008. xhr.send();
  17009. }
  17010. catch (ex) {
  17011. BABYLON.Tools.Error("CustomProceduralTexture: Error on XHR send request.");
  17012. }
  17013. };
  17014. CustomProceduralTexture.prototype.isReady = function () {
  17015. if (!_super.prototype.isReady.call(this)) {
  17016. return false;
  17017. }
  17018. for (var name in this._textures) {
  17019. var texture = this._textures[name];
  17020. if (!texture.isReady()) {
  17021. return false;
  17022. }
  17023. }
  17024. return true;
  17025. };
  17026. CustomProceduralTexture.prototype.render = function (useCameraPostProcess) {
  17027. if (this._animate) {
  17028. this._time += this.getScene().getAnimationRatio() * 0.03;
  17029. this.updateShaderUniforms();
  17030. }
  17031. _super.prototype.render.call(this, useCameraPostProcess);
  17032. };
  17033. CustomProceduralTexture.prototype.updateTextures = function () {
  17034. for (var i = 0; i < this._config.sampler2Ds.length; i++) {
  17035. this.setTexture(this._config.sampler2Ds[i].sample2Dname, new BABYLON.Texture(this._texturePath + "/" + this._config.sampler2Ds[i].textureRelativeUrl, this.getScene()));
  17036. }
  17037. };
  17038. CustomProceduralTexture.prototype.updateShaderUniforms = function () {
  17039. if (this._config) {
  17040. for (var j = 0; j < this._config.uniforms.length; j++) {
  17041. var uniform = this._config.uniforms[j];
  17042. switch (uniform.type) {
  17043. case "float":
  17044. this.setFloat(uniform.name, uniform.value);
  17045. break;
  17046. case "color3":
  17047. this.setColor3(uniform.name, new BABYLON.Color3(uniform.r, uniform.g, uniform.b));
  17048. break;
  17049. case "color4":
  17050. this.setColor4(uniform.name, new BABYLON.Color4(uniform.r, uniform.g, uniform.b, uniform.a));
  17051. break;
  17052. case "vector2":
  17053. this.setVector2(uniform.name, new BABYLON.Vector2(uniform.x, uniform.y));
  17054. break;
  17055. case "vector3":
  17056. this.setVector3(uniform.name, new BABYLON.Vector3(uniform.x, uniform.y, uniform.z));
  17057. break;
  17058. }
  17059. }
  17060. }
  17061. this.setFloat("time", this._time);
  17062. };
  17063. Object.defineProperty(CustomProceduralTexture.prototype, "animate", {
  17064. get: function () {
  17065. return this._animate;
  17066. },
  17067. set: function (value) {
  17068. this._animate = value;
  17069. },
  17070. enumerable: true,
  17071. configurable: true
  17072. });
  17073. return CustomProceduralTexture;
  17074. })(BABYLON.ProceduralTexture);
  17075. BABYLON.CustomProceduralTexture = CustomProceduralTexture;
  17076. })(BABYLON || (BABYLON = {}));
  17077. var BABYLON;
  17078. (function (BABYLON) {
  17079. var WoodProceduralTexture = (function (_super) {
  17080. __extends(WoodProceduralTexture, _super);
  17081. function WoodProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  17082. _super.call(this, name, size, "wood", scene, fallbackTexture, generateMipMaps);
  17083. this._ampScale = 100.0;
  17084. this._woodColor = new BABYLON.Color3(0.32, 0.17, 0.09);
  17085. this.updateShaderUniforms();
  17086. this.refreshRate = 0;
  17087. }
  17088. WoodProceduralTexture.prototype.updateShaderUniforms = function () {
  17089. this.setFloat("ampScale", this._ampScale);
  17090. this.setColor3("woodColor", this._woodColor);
  17091. };
  17092. Object.defineProperty(WoodProceduralTexture.prototype, "ampScale", {
  17093. get: function () {
  17094. return this._ampScale;
  17095. },
  17096. set: function (value) {
  17097. this._ampScale = value;
  17098. this.updateShaderUniforms();
  17099. },
  17100. enumerable: true,
  17101. configurable: true
  17102. });
  17103. Object.defineProperty(WoodProceduralTexture.prototype, "woodColor", {
  17104. get: function () {
  17105. return this._woodColor;
  17106. },
  17107. set: function (value) {
  17108. this._woodColor = value;
  17109. this.updateShaderUniforms();
  17110. },
  17111. enumerable: true,
  17112. configurable: true
  17113. });
  17114. return WoodProceduralTexture;
  17115. })(BABYLON.ProceduralTexture);
  17116. BABYLON.WoodProceduralTexture = WoodProceduralTexture;
  17117. var FireProceduralTexture = (function (_super) {
  17118. __extends(FireProceduralTexture, _super);
  17119. function FireProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  17120. _super.call(this, name, size, "fire", scene, fallbackTexture, generateMipMaps);
  17121. this._time = 0.0;
  17122. this._speed = new BABYLON.Vector2(0.5, 0.3);
  17123. this._autoGenerateTime = true;
  17124. this._alphaThreshold = 0.5;
  17125. this._fireColors = FireProceduralTexture.RedFireColors;
  17126. this.updateShaderUniforms();
  17127. this.refreshRate = 1;
  17128. }
  17129. FireProceduralTexture.prototype.updateShaderUniforms = function () {
  17130. this.setFloat("time", this._time);
  17131. this.setVector2("speed", this._speed);
  17132. this.setColor3("c1", this._fireColors[0]);
  17133. this.setColor3("c2", this._fireColors[1]);
  17134. this.setColor3("c3", this._fireColors[2]);
  17135. this.setColor3("c4", this._fireColors[3]);
  17136. this.setColor3("c5", this._fireColors[4]);
  17137. this.setColor3("c6", this._fireColors[5]);
  17138. this.setFloat("alphaThreshold", this._alphaThreshold);
  17139. };
  17140. FireProceduralTexture.prototype.render = function (useCameraPostProcess) {
  17141. if (this._autoGenerateTime) {
  17142. this._time += this.getScene().getAnimationRatio() * 0.03;
  17143. this.updateShaderUniforms();
  17144. }
  17145. _super.prototype.render.call(this, useCameraPostProcess);
  17146. };
  17147. Object.defineProperty(FireProceduralTexture, "PurpleFireColors", {
  17148. get: function () {
  17149. return [
  17150. new BABYLON.Color3(0.5, 0.0, 1.0),
  17151. new BABYLON.Color3(0.9, 0.0, 1.0),
  17152. new BABYLON.Color3(0.2, 0.0, 1.0),
  17153. new BABYLON.Color3(1.0, 0.9, 1.0),
  17154. new BABYLON.Color3(0.1, 0.1, 1.0),
  17155. new BABYLON.Color3(0.9, 0.9, 1.0)
  17156. ];
  17157. },
  17158. enumerable: true,
  17159. configurable: true
  17160. });
  17161. Object.defineProperty(FireProceduralTexture, "GreenFireColors", {
  17162. get: function () {
  17163. return [
  17164. new BABYLON.Color3(0.5, 1.0, 0.0),
  17165. new BABYLON.Color3(0.5, 1.0, 0.0),
  17166. new BABYLON.Color3(0.3, 0.4, 0.0),
  17167. new BABYLON.Color3(0.5, 1.0, 0.0),
  17168. new BABYLON.Color3(0.2, 0.0, 0.0),
  17169. new BABYLON.Color3(0.5, 1.0, 0.0)
  17170. ];
  17171. },
  17172. enumerable: true,
  17173. configurable: true
  17174. });
  17175. Object.defineProperty(FireProceduralTexture, "RedFireColors", {
  17176. get: function () {
  17177. return [
  17178. new BABYLON.Color3(0.5, 0.0, 0.1),
  17179. new BABYLON.Color3(0.9, 0.0, 0.0),
  17180. new BABYLON.Color3(0.2, 0.0, 0.0),
  17181. new BABYLON.Color3(1.0, 0.9, 0.0),
  17182. new BABYLON.Color3(0.1, 0.1, 0.1),
  17183. new BABYLON.Color3(0.9, 0.9, 0.9)
  17184. ];
  17185. },
  17186. enumerable: true,
  17187. configurable: true
  17188. });
  17189. Object.defineProperty(FireProceduralTexture, "BlueFireColors", {
  17190. get: function () {
  17191. return [
  17192. new BABYLON.Color3(0.1, 0.0, 0.5),
  17193. new BABYLON.Color3(0.0, 0.0, 0.5),
  17194. new BABYLON.Color3(0.1, 0.0, 0.2),
  17195. new BABYLON.Color3(0.0, 0.0, 1.0),
  17196. new BABYLON.Color3(0.1, 0.2, 0.3),
  17197. new BABYLON.Color3(0.0, 0.2, 0.9)
  17198. ];
  17199. },
  17200. enumerable: true,
  17201. configurable: true
  17202. });
  17203. Object.defineProperty(FireProceduralTexture.prototype, "fireColors", {
  17204. get: function () {
  17205. return this._fireColors;
  17206. },
  17207. set: function (value) {
  17208. this._fireColors = value;
  17209. this.updateShaderUniforms();
  17210. },
  17211. enumerable: true,
  17212. configurable: true
  17213. });
  17214. Object.defineProperty(FireProceduralTexture.prototype, "time", {
  17215. get: function () {
  17216. return this._time;
  17217. },
  17218. set: function (value) {
  17219. this._time = value;
  17220. this.updateShaderUniforms();
  17221. },
  17222. enumerable: true,
  17223. configurable: true
  17224. });
  17225. Object.defineProperty(FireProceduralTexture.prototype, "speed", {
  17226. get: function () {
  17227. return this._speed;
  17228. },
  17229. set: function (value) {
  17230. this._speed = value;
  17231. this.updateShaderUniforms();
  17232. },
  17233. enumerable: true,
  17234. configurable: true
  17235. });
  17236. Object.defineProperty(FireProceduralTexture.prototype, "alphaThreshold", {
  17237. get: function () {
  17238. return this._alphaThreshold;
  17239. },
  17240. set: function (value) {
  17241. this._alphaThreshold = value;
  17242. this.updateShaderUniforms();
  17243. },
  17244. enumerable: true,
  17245. configurable: true
  17246. });
  17247. return FireProceduralTexture;
  17248. })(BABYLON.ProceduralTexture);
  17249. BABYLON.FireProceduralTexture = FireProceduralTexture;
  17250. var CloudProceduralTexture = (function (_super) {
  17251. __extends(CloudProceduralTexture, _super);
  17252. function CloudProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  17253. _super.call(this, name, size, "cloud", scene, fallbackTexture, generateMipMaps);
  17254. this._skyColor = new BABYLON.Color4(0.15, 0.68, 1.0, 1.0);
  17255. this._cloudColor = new BABYLON.Color4(1, 1, 1, 1.0);
  17256. this.updateShaderUniforms();
  17257. this.refreshRate = 0;
  17258. }
  17259. CloudProceduralTexture.prototype.updateShaderUniforms = function () {
  17260. this.setColor4("skyColor", this._skyColor);
  17261. this.setColor4("cloudColor", this._cloudColor);
  17262. };
  17263. Object.defineProperty(CloudProceduralTexture.prototype, "skyColor", {
  17264. get: function () {
  17265. return this._skyColor;
  17266. },
  17267. set: function (value) {
  17268. this._skyColor = value;
  17269. this.updateShaderUniforms();
  17270. },
  17271. enumerable: true,
  17272. configurable: true
  17273. });
  17274. Object.defineProperty(CloudProceduralTexture.prototype, "cloudColor", {
  17275. get: function () {
  17276. return this._cloudColor;
  17277. },
  17278. set: function (value) {
  17279. this._cloudColor = value;
  17280. this.updateShaderUniforms();
  17281. },
  17282. enumerable: true,
  17283. configurable: true
  17284. });
  17285. return CloudProceduralTexture;
  17286. })(BABYLON.ProceduralTexture);
  17287. BABYLON.CloudProceduralTexture = CloudProceduralTexture;
  17288. var GrassProceduralTexture = (function (_super) {
  17289. __extends(GrassProceduralTexture, _super);
  17290. function GrassProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  17291. _super.call(this, name, size, "grass", scene, fallbackTexture, generateMipMaps);
  17292. this._herb1 = new BABYLON.Color3(0.29, 0.38, 0.02);
  17293. this._herb2 = new BABYLON.Color3(0.36, 0.49, 0.09);
  17294. this._herb3 = new BABYLON.Color3(0.51, 0.6, 0.28);
  17295. this._groundColor = new BABYLON.Color3(1, 1, 1);
  17296. this._grassColors = [
  17297. new BABYLON.Color3(0.29, 0.38, 0.02),
  17298. new BABYLON.Color3(0.36, 0.49, 0.09),
  17299. new BABYLON.Color3(0.51, 0.6, 0.28)
  17300. ];
  17301. this.updateShaderUniforms();
  17302. this.refreshRate = 0;
  17303. }
  17304. GrassProceduralTexture.prototype.updateShaderUniforms = function () {
  17305. this.setColor3("herb1Color", this._grassColors[0]);
  17306. this.setColor3("herb2Color", this._grassColors[1]);
  17307. this.setColor3("herb3Color", this._grassColors[2]);
  17308. this.setColor3("groundColor", this._groundColor);
  17309. };
  17310. Object.defineProperty(GrassProceduralTexture.prototype, "grassColors", {
  17311. get: function () {
  17312. return this._grassColors;
  17313. },
  17314. set: function (value) {
  17315. this._grassColors = value;
  17316. this.updateShaderUniforms();
  17317. },
  17318. enumerable: true,
  17319. configurable: true
  17320. });
  17321. Object.defineProperty(GrassProceduralTexture.prototype, "groundColor", {
  17322. get: function () {
  17323. return this._groundColor;
  17324. },
  17325. set: function (value) {
  17326. this.groundColor = value;
  17327. this.updateShaderUniforms();
  17328. },
  17329. enumerable: true,
  17330. configurable: true
  17331. });
  17332. return GrassProceduralTexture;
  17333. })(BABYLON.ProceduralTexture);
  17334. BABYLON.GrassProceduralTexture = GrassProceduralTexture;
  17335. var RoadProceduralTexture = (function (_super) {
  17336. __extends(RoadProceduralTexture, _super);
  17337. function RoadProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  17338. _super.call(this, name, size, "road", scene, fallbackTexture, generateMipMaps);
  17339. this._roadColor = new BABYLON.Color3(0.53, 0.53, 0.53);
  17340. this.updateShaderUniforms();
  17341. this.refreshRate = 0;
  17342. }
  17343. RoadProceduralTexture.prototype.updateShaderUniforms = function () {
  17344. this.setColor3("roadColor", this._roadColor);
  17345. };
  17346. Object.defineProperty(RoadProceduralTexture.prototype, "roadColor", {
  17347. get: function () {
  17348. return this._roadColor;
  17349. },
  17350. set: function (value) {
  17351. this._roadColor = value;
  17352. this.updateShaderUniforms();
  17353. },
  17354. enumerable: true,
  17355. configurable: true
  17356. });
  17357. return RoadProceduralTexture;
  17358. })(BABYLON.ProceduralTexture);
  17359. BABYLON.RoadProceduralTexture = RoadProceduralTexture;
  17360. var BrickProceduralTexture = (function (_super) {
  17361. __extends(BrickProceduralTexture, _super);
  17362. function BrickProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  17363. _super.call(this, name, size, "brick", scene, fallbackTexture, generateMipMaps);
  17364. this._numberOfBricksHeight = 15;
  17365. this._numberOfBricksWidth = 5;
  17366. this._jointColor = new BABYLON.Color3(0.72, 0.72, 0.72);
  17367. this._brickColor = new BABYLON.Color3(0.77, 0.47, 0.40);
  17368. this.updateShaderUniforms();
  17369. this.refreshRate = 0;
  17370. }
  17371. BrickProceduralTexture.prototype.updateShaderUniforms = function () {
  17372. this.setFloat("numberOfBricksHeight", this._numberOfBricksHeight);
  17373. this.setFloat("numberOfBricksWidth", this._numberOfBricksWidth);
  17374. this.setColor3("brickColor", this._brickColor);
  17375. this.setColor3("jointColor", this._jointColor);
  17376. };
  17377. Object.defineProperty(BrickProceduralTexture.prototype, "numberOfBricksHeight", {
  17378. get: function () {
  17379. return this._numberOfBricksHeight;
  17380. },
  17381. set: function (value) {
  17382. this._numberOfBricksHeight = value;
  17383. this.updateShaderUniforms();
  17384. },
  17385. enumerable: true,
  17386. configurable: true
  17387. });
  17388. Object.defineProperty(BrickProceduralTexture.prototype, "numberOfBricksWidth", {
  17389. get: function () {
  17390. return this._numberOfBricksWidth;
  17391. },
  17392. set: function (value) {
  17393. this._numberOfBricksWidth = value;
  17394. this.updateShaderUniforms();
  17395. },
  17396. enumerable: true,
  17397. configurable: true
  17398. });
  17399. Object.defineProperty(BrickProceduralTexture.prototype, "jointColor", {
  17400. get: function () {
  17401. return this._jointColor;
  17402. },
  17403. set: function (value) {
  17404. this._jointColor = value;
  17405. this.updateShaderUniforms();
  17406. },
  17407. enumerable: true,
  17408. configurable: true
  17409. });
  17410. Object.defineProperty(BrickProceduralTexture.prototype, "brickColor", {
  17411. get: function () {
  17412. return this._brickColor;
  17413. },
  17414. set: function (value) {
  17415. this._brickColor = value;
  17416. this.updateShaderUniforms();
  17417. },
  17418. enumerable: true,
  17419. configurable: true
  17420. });
  17421. return BrickProceduralTexture;
  17422. })(BABYLON.ProceduralTexture);
  17423. BABYLON.BrickProceduralTexture = BrickProceduralTexture;
  17424. var MarbleProceduralTexture = (function (_super) {
  17425. __extends(MarbleProceduralTexture, _super);
  17426. function MarbleProceduralTexture(name, size, scene, fallbackTexture, generateMipMaps) {
  17427. _super.call(this, name, size, "marble", scene, fallbackTexture, generateMipMaps);
  17428. this._numberOfTilesHeight = 3;
  17429. this._numberOfTilesWidth = 3;
  17430. this._amplitude = 9.0;
  17431. this._marbleColor = new BABYLON.Color3(0.77, 0.47, 0.40);
  17432. this._jointColor = new BABYLON.Color3(0.72, 0.72, 0.72);
  17433. this.updateShaderUniforms();
  17434. this.refreshRate = 0;
  17435. }
  17436. MarbleProceduralTexture.prototype.updateShaderUniforms = function () {
  17437. this.setFloat("numberOfTilesHeight", this._numberOfTilesHeight);
  17438. this.setFloat("numberOfTilesWidth", this._numberOfTilesWidth);
  17439. this.setFloat("amplitude", this._amplitude);
  17440. this.setColor3("marbleColor", this._marbleColor);
  17441. this.setColor3("jointColor", this._jointColor);
  17442. };
  17443. Object.defineProperty(MarbleProceduralTexture.prototype, "numberOfTilesHeight", {
  17444. get: function () {
  17445. return this._numberOfTilesHeight;
  17446. },
  17447. set: function (value) {
  17448. this._numberOfTilesHeight = value;
  17449. this.updateShaderUniforms();
  17450. },
  17451. enumerable: true,
  17452. configurable: true
  17453. });
  17454. Object.defineProperty(MarbleProceduralTexture.prototype, "numberOfTilesWidth", {
  17455. get: function () {
  17456. return this._numberOfTilesWidth;
  17457. },
  17458. set: function (value) {
  17459. this._numberOfTilesWidth = value;
  17460. this.updateShaderUniforms();
  17461. },
  17462. enumerable: true,
  17463. configurable: true
  17464. });
  17465. Object.defineProperty(MarbleProceduralTexture.prototype, "jointColor", {
  17466. get: function () {
  17467. return this._jointColor;
  17468. },
  17469. set: function (value) {
  17470. this._jointColor = value;
  17471. this.updateShaderUniforms();
  17472. },
  17473. enumerable: true,
  17474. configurable: true
  17475. });
  17476. Object.defineProperty(MarbleProceduralTexture.prototype, "marbleColor", {
  17477. get: function () {
  17478. return this._marbleColor;
  17479. },
  17480. set: function (value) {
  17481. this._marbleColor = value;
  17482. this.updateShaderUniforms();
  17483. },
  17484. enumerable: true,
  17485. configurable: true
  17486. });
  17487. return MarbleProceduralTexture;
  17488. })(BABYLON.ProceduralTexture);
  17489. BABYLON.MarbleProceduralTexture = MarbleProceduralTexture;
  17490. })(BABYLON || (BABYLON = {}));
  17491. var BABYLON;
  17492. (function (BABYLON) {
  17493. var EffectFallbacks = (function () {
  17494. function EffectFallbacks() {
  17495. this._defines = {};
  17496. this._currentRank = 32;
  17497. this._maxRank = -1;
  17498. }
  17499. EffectFallbacks.prototype.addFallback = function (rank, define) {
  17500. if (!this._defines[rank]) {
  17501. if (rank < this._currentRank) {
  17502. this._currentRank = rank;
  17503. }
  17504. if (rank > this._maxRank) {
  17505. this._maxRank = rank;
  17506. }
  17507. this._defines[rank] = new Array();
  17508. }
  17509. this._defines[rank].push(define);
  17510. };
  17511. Object.defineProperty(EffectFallbacks.prototype, "isMoreFallbacks", {
  17512. get: function () {
  17513. return this._currentRank <= this._maxRank;
  17514. },
  17515. enumerable: true,
  17516. configurable: true
  17517. });
  17518. EffectFallbacks.prototype.reduce = function (currentDefines) {
  17519. var currentFallbacks = this._defines[this._currentRank];
  17520. for (var index = 0; index < currentFallbacks.length; index++) {
  17521. currentDefines = currentDefines.replace("#define " + currentFallbacks[index], "");
  17522. }
  17523. this._currentRank++;
  17524. return currentDefines;
  17525. };
  17526. return EffectFallbacks;
  17527. })();
  17528. BABYLON.EffectFallbacks = EffectFallbacks;
  17529. var Effect = (function () {
  17530. function Effect(baseName, attributesNames, uniformsNames, samplers, engine, defines, fallbacks, onCompiled, onError) {
  17531. var _this = this;
  17532. this._isReady = false;
  17533. this._compilationError = "";
  17534. this._valueCache = [];
  17535. this._engine = engine;
  17536. this.name = baseName;
  17537. this.defines = defines;
  17538. this._uniformsNames = uniformsNames.concat(samplers);
  17539. this._samplers = samplers;
  17540. this._attributesNames = attributesNames;
  17541. this.onError = onError;
  17542. this.onCompiled = onCompiled;
  17543. var vertexSource;
  17544. var fragmentSource;
  17545. if (baseName.vertexElement) {
  17546. vertexSource = document.getElementById(baseName.vertexElement);
  17547. if (!vertexSource) {
  17548. vertexSource = baseName.vertexElement;
  17549. }
  17550. }
  17551. else {
  17552. vertexSource = baseName.vertex || baseName;
  17553. }
  17554. if (baseName.fragmentElement) {
  17555. fragmentSource = document.getElementById(baseName.fragmentElement);
  17556. if (!fragmentSource) {
  17557. fragmentSource = baseName.fragmentElement;
  17558. }
  17559. }
  17560. else {
  17561. fragmentSource = baseName.fragment || baseName;
  17562. }
  17563. this._loadVertexShader(vertexSource, function (vertexCode) {
  17564. _this._loadFragmentShader(fragmentSource, function (fragmentCode) {
  17565. _this._prepareEffect(vertexCode, fragmentCode, attributesNames, defines, fallbacks);
  17566. });
  17567. });
  17568. }
  17569. // Properties
  17570. Effect.prototype.isReady = function () {
  17571. return this._isReady;
  17572. };
  17573. Effect.prototype.getProgram = function () {
  17574. return this._program;
  17575. };
  17576. Effect.prototype.getAttributesNames = function () {
  17577. return this._attributesNames;
  17578. };
  17579. Effect.prototype.getAttributeLocation = function (index) {
  17580. return this._attributes[index];
  17581. };
  17582. Effect.prototype.getAttributeLocationByName = function (name) {
  17583. var index = this._attributesNames.indexOf(name);
  17584. return this._attributes[index];
  17585. };
  17586. Effect.prototype.getAttributesCount = function () {
  17587. return this._attributes.length;
  17588. };
  17589. Effect.prototype.getUniformIndex = function (uniformName) {
  17590. return this._uniformsNames.indexOf(uniformName);
  17591. };
  17592. Effect.prototype.getUniform = function (uniformName) {
  17593. return this._uniforms[this._uniformsNames.indexOf(uniformName)];
  17594. };
  17595. Effect.prototype.getSamplers = function () {
  17596. return this._samplers;
  17597. };
  17598. Effect.prototype.getCompilationError = function () {
  17599. return this._compilationError;
  17600. };
  17601. // Methods
  17602. Effect.prototype._loadVertexShader = function (vertex, callback) {
  17603. // DOM element ?
  17604. if (vertex instanceof HTMLElement) {
  17605. var vertexCode = BABYLON.Tools.GetDOMTextContent(vertex);
  17606. callback(vertexCode);
  17607. return;
  17608. }
  17609. // Is in local store ?
  17610. if (Effect.ShadersStore[vertex + "VertexShader"]) {
  17611. callback(Effect.ShadersStore[vertex + "VertexShader"]);
  17612. return;
  17613. }
  17614. var vertexShaderUrl;
  17615. if (vertex[0] === "." || vertex[0] === "/") {
  17616. vertexShaderUrl = vertex;
  17617. }
  17618. else {
  17619. vertexShaderUrl = BABYLON.Engine.ShadersRepository + vertex;
  17620. }
  17621. // Vertex shader
  17622. BABYLON.Tools.LoadFile(vertexShaderUrl + ".vertex.fx", callback);
  17623. };
  17624. Effect.prototype._loadFragmentShader = function (fragment, callback) {
  17625. // DOM element ?
  17626. if (fragment instanceof HTMLElement) {
  17627. var fragmentCode = BABYLON.Tools.GetDOMTextContent(fragment);
  17628. callback(fragmentCode);
  17629. return;
  17630. }
  17631. // Is in local store ?
  17632. if (Effect.ShadersStore[fragment + "PixelShader"]) {
  17633. callback(Effect.ShadersStore[fragment + "PixelShader"]);
  17634. return;
  17635. }
  17636. if (Effect.ShadersStore[fragment + "FragmentShader"]) {
  17637. callback(Effect.ShadersStore[fragment + "FragmentShader"]);
  17638. return;
  17639. }
  17640. var fragmentShaderUrl;
  17641. if (fragment[0] === "." || fragment[0] === "/") {
  17642. fragmentShaderUrl = fragment;
  17643. }
  17644. else {
  17645. fragmentShaderUrl = BABYLON.Engine.ShadersRepository + fragment;
  17646. }
  17647. // Fragment shader
  17648. BABYLON.Tools.LoadFile(fragmentShaderUrl + ".fragment.fx", callback);
  17649. };
  17650. Effect.prototype._prepareEffect = function (vertexSourceCode, fragmentSourceCode, attributesNames, defines, fallbacks) {
  17651. try {
  17652. var engine = this._engine;
  17653. if (!engine.getCaps().highPrecisionShaderSupported) {
  17654. vertexSourceCode = vertexSourceCode.replace("precision highp float", "precision mediump float");
  17655. fragmentSourceCode = fragmentSourceCode.replace("precision highp float", "precision mediump float");
  17656. }
  17657. this._program = engine.createShaderProgram(vertexSourceCode, fragmentSourceCode, defines);
  17658. this._uniforms = engine.getUniforms(this._program, this._uniformsNames);
  17659. this._attributes = engine.getAttributes(this._program, attributesNames);
  17660. for (var index = 0; index < this._samplers.length; index++) {
  17661. var sampler = this.getUniform(this._samplers[index]);
  17662. if (sampler == null) {
  17663. this._samplers.splice(index, 1);
  17664. index--;
  17665. }
  17666. }
  17667. engine.bindSamplers(this);
  17668. this._isReady = true;
  17669. if (this.onCompiled) {
  17670. this.onCompiled(this);
  17671. }
  17672. }
  17673. catch (e) {
  17674. // Is it a problem with precision?
  17675. if (e.message.indexOf("highp") !== -1) {
  17676. vertexSourceCode = vertexSourceCode.replace("precision highp float", "precision mediump float");
  17677. fragmentSourceCode = fragmentSourceCode.replace("precision highp float", "precision mediump float");
  17678. this._prepareEffect(vertexSourceCode, fragmentSourceCode, attributesNames, defines, fallbacks);
  17679. return;
  17680. }
  17681. // Let's go through fallbacks then
  17682. if (fallbacks && fallbacks.isMoreFallbacks) {
  17683. defines = fallbacks.reduce(defines);
  17684. this._prepareEffect(vertexSourceCode, fragmentSourceCode, attributesNames, defines, fallbacks);
  17685. }
  17686. else {
  17687. BABYLON.Tools.Error("Unable to compile effect: ");
  17688. if (this.name.vertexElement) {
  17689. BABYLON.Tools.Error("Vertex shader:" + this.name.vertexElement);
  17690. BABYLON.Tools.Error("Fragment shader:" + this.name.fragmentElement);
  17691. }
  17692. else if (this.name.vertex) {
  17693. BABYLON.Tools.Error("Vertex shader:" + this.name.vertex);
  17694. BABYLON.Tools.Error("Fragment shader:" + this.name.fragment);
  17695. }
  17696. else {
  17697. BABYLON.Tools.Error("Vertex shader:" + this.name);
  17698. BABYLON.Tools.Error("Fragment shader:" + this.name);
  17699. }
  17700. BABYLON.Tools.Error("Defines: " + defines);
  17701. BABYLON.Tools.Error("Error: " + e.message);
  17702. this._compilationError = e.message;
  17703. if (this.onError) {
  17704. this.onError(this, this._compilationError);
  17705. }
  17706. }
  17707. }
  17708. };
  17709. Effect.prototype._bindTexture = function (channel, texture) {
  17710. this._engine._bindTexture(this._samplers.indexOf(channel), texture);
  17711. };
  17712. Effect.prototype.setTexture = function (channel, texture) {
  17713. this._engine.setTexture(this._samplers.indexOf(channel), texture);
  17714. };
  17715. Effect.prototype.setTextureFromPostProcess = function (channel, postProcess) {
  17716. this._engine.setTextureFromPostProcess(this._samplers.indexOf(channel), postProcess);
  17717. };
  17718. Effect.prototype._cacheMatrix = function (uniformName, matrix) {
  17719. if (!this._valueCache[uniformName]) {
  17720. this._valueCache[uniformName] = new BABYLON.Matrix();
  17721. }
  17722. for (var index = 0; index < 16; index++) {
  17723. this._valueCache[uniformName].m[index] = matrix.m[index];
  17724. }
  17725. };
  17726. Effect.prototype._cacheFloat2 = function (uniformName, x, y) {
  17727. if (!this._valueCache[uniformName]) {
  17728. this._valueCache[uniformName] = [x, y];
  17729. return;
  17730. }
  17731. this._valueCache[uniformName][0] = x;
  17732. this._valueCache[uniformName][1] = y;
  17733. };
  17734. Effect.prototype._cacheFloat3 = function (uniformName, x, y, z) {
  17735. if (!this._valueCache[uniformName]) {
  17736. this._valueCache[uniformName] = [x, y, z];
  17737. return;
  17738. }
  17739. this._valueCache[uniformName][0] = x;
  17740. this._valueCache[uniformName][1] = y;
  17741. this._valueCache[uniformName][2] = z;
  17742. };
  17743. Effect.prototype._cacheFloat4 = function (uniformName, x, y, z, w) {
  17744. if (!this._valueCache[uniformName]) {
  17745. this._valueCache[uniformName] = [x, y, z, w];
  17746. return;
  17747. }
  17748. this._valueCache[uniformName][0] = x;
  17749. this._valueCache[uniformName][1] = y;
  17750. this._valueCache[uniformName][2] = z;
  17751. this._valueCache[uniformName][3] = w;
  17752. };
  17753. Effect.prototype.setArray = function (uniformName, array) {
  17754. this._engine.setArray(this.getUniform(uniformName), array);
  17755. return this;
  17756. };
  17757. Effect.prototype.setArray2 = function (uniformName, array) {
  17758. this._engine.setArray2(this.getUniform(uniformName), array);
  17759. return this;
  17760. };
  17761. Effect.prototype.setArray3 = function (uniformName, array) {
  17762. this._engine.setArray3(this.getUniform(uniformName), array);
  17763. return this;
  17764. };
  17765. Effect.prototype.setArray4 = function (uniformName, array) {
  17766. this._engine.setArray4(this.getUniform(uniformName), array);
  17767. return this;
  17768. };
  17769. Effect.prototype.setMatrices = function (uniformName, matrices) {
  17770. this._engine.setMatrices(this.getUniform(uniformName), matrices);
  17771. return this;
  17772. };
  17773. Effect.prototype.setMatrix = function (uniformName, matrix) {
  17774. if (this._valueCache[uniformName] && this._valueCache[uniformName].equals(matrix))
  17775. return this;
  17776. this._cacheMatrix(uniformName, matrix);
  17777. this._engine.setMatrix(this.getUniform(uniformName), matrix);
  17778. return this;
  17779. };
  17780. Effect.prototype.setMatrix3x3 = function (uniformName, matrix) {
  17781. this._engine.setMatrix3x3(this.getUniform(uniformName), matrix);
  17782. return this;
  17783. };
  17784. Effect.prototype.setMatrix2x2 = function (uniformname, matrix) {
  17785. this._engine.setMatrix2x2(this.getUniform(uniformname), matrix);
  17786. return this;
  17787. };
  17788. Effect.prototype.setFloat = function (uniformName, value) {
  17789. if (this._valueCache[uniformName] && this._valueCache[uniformName] === value)
  17790. return this;
  17791. this._valueCache[uniformName] = value;
  17792. this._engine.setFloat(this.getUniform(uniformName), value);
  17793. return this;
  17794. };
  17795. Effect.prototype.setBool = function (uniformName, bool) {
  17796. if (this._valueCache[uniformName] && this._valueCache[uniformName] === bool)
  17797. return this;
  17798. this._valueCache[uniformName] = bool;
  17799. this._engine.setBool(this.getUniform(uniformName), bool ? 1 : 0);
  17800. return this;
  17801. };
  17802. Effect.prototype.setVector2 = function (uniformName, vector2) {
  17803. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === vector2.x && this._valueCache[uniformName][1] === vector2.y)
  17804. return this;
  17805. this._cacheFloat2(uniformName, vector2.x, vector2.y);
  17806. this._engine.setFloat2(this.getUniform(uniformName), vector2.x, vector2.y);
  17807. return this;
  17808. };
  17809. Effect.prototype.setFloat2 = function (uniformName, x, y) {
  17810. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === x && this._valueCache[uniformName][1] === y)
  17811. return this;
  17812. this._cacheFloat2(uniformName, x, y);
  17813. this._engine.setFloat2(this.getUniform(uniformName), x, y);
  17814. return this;
  17815. };
  17816. Effect.prototype.setVector3 = function (uniformName, vector3) {
  17817. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === vector3.x && this._valueCache[uniformName][1] === vector3.y && this._valueCache[uniformName][2] === vector3.z)
  17818. return this;
  17819. this._cacheFloat3(uniformName, vector3.x, vector3.y, vector3.z);
  17820. this._engine.setFloat3(this.getUniform(uniformName), vector3.x, vector3.y, vector3.z);
  17821. return this;
  17822. };
  17823. Effect.prototype.setFloat3 = function (uniformName, x, y, z) {
  17824. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === x && this._valueCache[uniformName][1] === y && this._valueCache[uniformName][2] === z)
  17825. return this;
  17826. this._cacheFloat3(uniformName, x, y, z);
  17827. this._engine.setFloat3(this.getUniform(uniformName), x, y, z);
  17828. return this;
  17829. };
  17830. Effect.prototype.setVector4 = function (uniformName, vector4) {
  17831. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === vector4.x && this._valueCache[uniformName][1] === vector4.y && this._valueCache[uniformName][2] === vector4.z && this._valueCache[uniformName][3] === vector4.w)
  17832. return this;
  17833. this._cacheFloat4(uniformName, vector4.x, vector4.y, vector4.z, vector4.w);
  17834. this._engine.setFloat4(this.getUniform(uniformName), vector4.x, vector4.y, vector4.z, vector4.w);
  17835. return this;
  17836. };
  17837. Effect.prototype.setFloat4 = function (uniformName, x, y, z, w) {
  17838. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === x && this._valueCache[uniformName][1] === y && this._valueCache[uniformName][2] === z && this._valueCache[uniformName][3] === w)
  17839. return this;
  17840. this._cacheFloat4(uniformName, x, y, z, w);
  17841. this._engine.setFloat4(this.getUniform(uniformName), x, y, z, w);
  17842. return this;
  17843. };
  17844. Effect.prototype.setColor3 = function (uniformName, color3) {
  17845. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === color3.r && this._valueCache[uniformName][1] === color3.g && this._valueCache[uniformName][2] === color3.b)
  17846. return this;
  17847. this._cacheFloat3(uniformName, color3.r, color3.g, color3.b);
  17848. this._engine.setColor3(this.getUniform(uniformName), color3);
  17849. return this;
  17850. };
  17851. Effect.prototype.setColor4 = function (uniformName, color3, alpha) {
  17852. if (this._valueCache[uniformName] && this._valueCache[uniformName][0] === color3.r && this._valueCache[uniformName][1] === color3.g && this._valueCache[uniformName][2] === color3.b && this._valueCache[uniformName][3] === alpha)
  17853. return this;
  17854. this._cacheFloat4(uniformName, color3.r, color3.g, color3.b, alpha);
  17855. this._engine.setColor4(this.getUniform(uniformName), color3, alpha);
  17856. return this;
  17857. };
  17858. // Statics
  17859. Effect.ShadersStore = {};
  17860. return Effect;
  17861. })();
  17862. BABYLON.Effect = Effect;
  17863. })(BABYLON || (BABYLON = {}));
  17864. var BABYLON;
  17865. (function (BABYLON) {
  17866. var MaterialDefines = (function () {
  17867. function MaterialDefines() {
  17868. }
  17869. MaterialDefines.prototype.isEqual = function (other) {
  17870. for (var index = 0; index < this._keys.length; index++) {
  17871. var prop = this._keys[index];
  17872. if (this[prop] !== other[prop]) {
  17873. return false;
  17874. }
  17875. }
  17876. return true;
  17877. };
  17878. MaterialDefines.prototype.cloneTo = function (other) {
  17879. for (var index = 0; index < this._keys.length; index++) {
  17880. var prop = this._keys[index];
  17881. other[prop] = this[prop];
  17882. }
  17883. };
  17884. MaterialDefines.prototype.reset = function () {
  17885. for (var index = 0; index < this._keys.length; index++) {
  17886. var prop = this._keys[index];
  17887. if (prop === "BonesPerMesh") {
  17888. this[prop] = 0;
  17889. continue;
  17890. }
  17891. this[prop] = false;
  17892. }
  17893. };
  17894. MaterialDefines.prototype.toString = function () {
  17895. var result = "";
  17896. for (var index = 0; index < this._keys.length; index++) {
  17897. var prop = this._keys[index];
  17898. if (prop === "BonesPerMesh" && this[prop] > 0) {
  17899. result += "#define BonesPerMesh " + this[prop] + "\n";
  17900. continue;
  17901. }
  17902. if (this[prop]) {
  17903. result += "#define " + prop + "\n";
  17904. }
  17905. }
  17906. return result;
  17907. };
  17908. return MaterialDefines;
  17909. })();
  17910. BABYLON.MaterialDefines = MaterialDefines;
  17911. var Material = (function () {
  17912. function Material(name, scene, doNotAdd) {
  17913. this.name = name;
  17914. this.checkReadyOnEveryCall = false;
  17915. this.checkReadyOnlyOnce = false;
  17916. this.state = "";
  17917. this.alpha = 1.0;
  17918. this.backFaceCulling = true;
  17919. this.sideOrientation = Material.CounterClockWiseSideOrientation;
  17920. this.alphaMode = BABYLON.Engine.ALPHA_COMBINE;
  17921. this.disableDepthWrite = false;
  17922. this.fogEnabled = true;
  17923. this._wasPreviouslyReady = false;
  17924. this._fillMode = Material.TriangleFillMode;
  17925. this.pointSize = 1.0;
  17926. this.zOffset = 0;
  17927. this.id = name;
  17928. this._scene = scene;
  17929. if (!doNotAdd) {
  17930. scene.materials.push(this);
  17931. }
  17932. }
  17933. Object.defineProperty(Material, "TriangleFillMode", {
  17934. get: function () {
  17935. return Material._TriangleFillMode;
  17936. },
  17937. enumerable: true,
  17938. configurable: true
  17939. });
  17940. Object.defineProperty(Material, "WireFrameFillMode", {
  17941. get: function () {
  17942. return Material._WireFrameFillMode;
  17943. },
  17944. enumerable: true,
  17945. configurable: true
  17946. });
  17947. Object.defineProperty(Material, "PointFillMode", {
  17948. get: function () {
  17949. return Material._PointFillMode;
  17950. },
  17951. enumerable: true,
  17952. configurable: true
  17953. });
  17954. Object.defineProperty(Material, "ClockWiseSideOrientation", {
  17955. get: function () {
  17956. return Material._ClockWiseSideOrientation;
  17957. },
  17958. enumerable: true,
  17959. configurable: true
  17960. });
  17961. Object.defineProperty(Material, "CounterClockWiseSideOrientation", {
  17962. get: function () {
  17963. return Material._CounterClockWiseSideOrientation;
  17964. },
  17965. enumerable: true,
  17966. configurable: true
  17967. });
  17968. Object.defineProperty(Material.prototype, "wireframe", {
  17969. get: function () {
  17970. return this._fillMode === Material.WireFrameFillMode;
  17971. },
  17972. set: function (value) {
  17973. this._fillMode = (value ? Material.WireFrameFillMode : Material.TriangleFillMode);
  17974. },
  17975. enumerable: true,
  17976. configurable: true
  17977. });
  17978. Object.defineProperty(Material.prototype, "pointsCloud", {
  17979. get: function () {
  17980. return this._fillMode === Material.PointFillMode;
  17981. },
  17982. set: function (value) {
  17983. this._fillMode = (value ? Material.PointFillMode : Material.TriangleFillMode);
  17984. },
  17985. enumerable: true,
  17986. configurable: true
  17987. });
  17988. Object.defineProperty(Material.prototype, "fillMode", {
  17989. get: function () {
  17990. return this._fillMode;
  17991. },
  17992. set: function (value) {
  17993. this._fillMode = value;
  17994. },
  17995. enumerable: true,
  17996. configurable: true
  17997. });
  17998. Material.prototype.isReady = function (mesh, useInstances) {
  17999. return true;
  18000. };
  18001. Material.prototype.getEffect = function () {
  18002. return this._effect;
  18003. };
  18004. Material.prototype.getScene = function () {
  18005. return this._scene;
  18006. };
  18007. Material.prototype.needAlphaBlending = function () {
  18008. return (this.alpha < 1.0);
  18009. };
  18010. Material.prototype.needAlphaTesting = function () {
  18011. return false;
  18012. };
  18013. Material.prototype.getAlphaTestTexture = function () {
  18014. return null;
  18015. };
  18016. Material.prototype.trackCreation = function (onCompiled, onError) {
  18017. };
  18018. Material.prototype._preBind = function () {
  18019. var engine = this._scene.getEngine();
  18020. engine.enableEffect(this._effect);
  18021. engine.setState(this.backFaceCulling, this.zOffset, false, this.sideOrientation === Material.ClockWiseSideOrientation);
  18022. };
  18023. Material.prototype.bind = function (world, mesh) {
  18024. this._scene._cachedMaterial = this;
  18025. if (this.onBind) {
  18026. this.onBind(this, mesh);
  18027. }
  18028. if (this.disableDepthWrite) {
  18029. var engine = this._scene.getEngine();
  18030. this._cachedDepthWriteState = engine.getDepthWrite();
  18031. engine.setDepthWrite(false);
  18032. }
  18033. };
  18034. Material.prototype.bindOnlyWorldMatrix = function (world) {
  18035. };
  18036. Material.prototype.unbind = function () {
  18037. if (this.disableDepthWrite) {
  18038. var engine = this._scene.getEngine();
  18039. engine.setDepthWrite(this._cachedDepthWriteState);
  18040. }
  18041. };
  18042. Material.prototype.clone = function (name) {
  18043. return null;
  18044. };
  18045. Material.prototype.getBindedMeshes = function () {
  18046. var result = new Array();
  18047. for (var index = 0; index < this._scene.meshes.length; index++) {
  18048. var mesh = this._scene.meshes[index];
  18049. if (mesh.material === this) {
  18050. result.push(mesh);
  18051. }
  18052. }
  18053. return result;
  18054. };
  18055. Material.prototype.dispose = function (forceDisposeEffect) {
  18056. // Remove from scene
  18057. var index = this._scene.materials.indexOf(this);
  18058. if (index >= 0) {
  18059. this._scene.materials.splice(index, 1);
  18060. }
  18061. // Shader are kept in cache for further use but we can get rid of this by using forceDisposeEffect
  18062. if (forceDisposeEffect && this._effect) {
  18063. this._scene.getEngine()._releaseEffect(this._effect);
  18064. this._effect = null;
  18065. }
  18066. // Remove from meshes
  18067. for (index = 0; index < this._scene.meshes.length; index++) {
  18068. var mesh = this._scene.meshes[index];
  18069. if (mesh.material === this) {
  18070. mesh.material = null;
  18071. }
  18072. }
  18073. // Callback
  18074. if (this.onDispose) {
  18075. this.onDispose();
  18076. }
  18077. };
  18078. Material.prototype.copyTo = function (other) {
  18079. other.checkReadyOnlyOnce = this.checkReadyOnlyOnce;
  18080. other.checkReadyOnEveryCall = this.checkReadyOnEveryCall;
  18081. other.alpha = this.alpha;
  18082. other.fillMode = this.fillMode;
  18083. other.backFaceCulling = this.backFaceCulling;
  18084. other.wireframe = this.wireframe;
  18085. other.fogEnabled = this.fogEnabled;
  18086. other.wireframe = this.wireframe;
  18087. other.zOffset = this.zOffset;
  18088. other.alphaMode = this.alphaMode;
  18089. other.sideOrientation = this.sideOrientation;
  18090. other.disableDepthWrite = this.disableDepthWrite;
  18091. other.pointSize = this.pointSize;
  18092. other.pointsCloud = this.pointsCloud;
  18093. };
  18094. Material._TriangleFillMode = 0;
  18095. Material._WireFrameFillMode = 1;
  18096. Material._PointFillMode = 2;
  18097. Material._ClockWiseSideOrientation = 0;
  18098. Material._CounterClockWiseSideOrientation = 1;
  18099. return Material;
  18100. })();
  18101. BABYLON.Material = Material;
  18102. })(BABYLON || (BABYLON = {}));
  18103. var BABYLON;
  18104. (function (BABYLON) {
  18105. var maxSimultaneousLights = 4;
  18106. var FresnelParameters = (function () {
  18107. function FresnelParameters() {
  18108. this.isEnabled = true;
  18109. this.leftColor = BABYLON.Color3.White();
  18110. this.rightColor = BABYLON.Color3.Black();
  18111. this.bias = 0;
  18112. this.power = 1;
  18113. }
  18114. FresnelParameters.prototype.clone = function () {
  18115. var newFresnelParameters = new FresnelParameters();
  18116. BABYLON.Tools.DeepCopy(this, newFresnelParameters);
  18117. return new FresnelParameters;
  18118. };
  18119. return FresnelParameters;
  18120. })();
  18121. BABYLON.FresnelParameters = FresnelParameters;
  18122. var StandardMaterialDefines = (function (_super) {
  18123. __extends(StandardMaterialDefines, _super);
  18124. function StandardMaterialDefines() {
  18125. _super.call(this);
  18126. this.DIFFUSE = false;
  18127. this.AMBIENT = false;
  18128. this.OPACITY = false;
  18129. this.OPACITYRGB = false;
  18130. this.REFLECTION = false;
  18131. this.EMISSIVE = false;
  18132. this.SPECULAR = false;
  18133. this.BUMP = false;
  18134. this.SPECULAROVERALPHA = false;
  18135. this.CLIPPLANE = false;
  18136. this.ALPHATEST = false;
  18137. this.ALPHAFROMDIFFUSE = false;
  18138. this.POINTSIZE = false;
  18139. this.FOG = false;
  18140. this.LIGHT0 = false;
  18141. this.LIGHT1 = false;
  18142. this.LIGHT2 = false;
  18143. this.LIGHT3 = false;
  18144. this.SPOTLIGHT0 = false;
  18145. this.SPOTLIGHT1 = false;
  18146. this.SPOTLIGHT2 = false;
  18147. this.SPOTLIGHT3 = false;
  18148. this.HEMILIGHT0 = false;
  18149. this.HEMILIGHT1 = false;
  18150. this.HEMILIGHT2 = false;
  18151. this.HEMILIGHT3 = false;
  18152. this.POINTDIRLIGHT0 = false;
  18153. this.POINTDIRLIGHT1 = false;
  18154. this.POINTDIRLIGHT2 = false;
  18155. this.POINTDIRLIGHT3 = false;
  18156. this.SPECULARTERM = false;
  18157. this.SHADOW0 = false;
  18158. this.SHADOW1 = false;
  18159. this.SHADOW2 = false;
  18160. this.SHADOW3 = false;
  18161. this.SHADOWS = false;
  18162. this.SHADOWVSM0 = false;
  18163. this.SHADOWVSM1 = false;
  18164. this.SHADOWVSM2 = false;
  18165. this.SHADOWVSM3 = false;
  18166. this.SHADOWPCF0 = false;
  18167. this.SHADOWPCF1 = false;
  18168. this.SHADOWPCF2 = false;
  18169. this.SHADOWPCF3 = false;
  18170. this.DIFFUSEFRESNEL = false;
  18171. this.OPACITYFRESNEL = false;
  18172. this.REFLECTIONFRESNEL = false;
  18173. this.EMISSIVEFRESNEL = false;
  18174. this.FRESNEL = false;
  18175. this.NORMAL = false;
  18176. this.UV1 = false;
  18177. this.UV2 = false;
  18178. this.VERTEXCOLOR = false;
  18179. this.VERTEXALPHA = false;
  18180. this.BONES = false;
  18181. this.BONES4 = false;
  18182. this.BonesPerMesh = 0;
  18183. this.INSTANCES = false;
  18184. this.GLOSSINESS = false;
  18185. this.ROUGHNESS = false;
  18186. this.EMISSIVEASILLUMINATION = false;
  18187. this.REFLECTIONFRESNELFROMSPECULAR = false;
  18188. this.LIGHTMAP = false;
  18189. this.USELIGHTMAPASSHADOWMAP = false;
  18190. this.REFLECTIONMAP_3D = false;
  18191. this.REFLECTIONMAP_SPHERICAL = false;
  18192. this.REFLECTIONMAP_PLANAR = false;
  18193. this.REFLECTIONMAP_CUBIC = false;
  18194. this.REFLECTIONMAP_PROJECTION = false;
  18195. this.REFLECTIONMAP_SKYBOX = false;
  18196. this.REFLECTIONMAP_EXPLICIT = false;
  18197. this.INVERTCUBICMAP = false;
  18198. this._keys = Object.keys(this);
  18199. }
  18200. return StandardMaterialDefines;
  18201. })(BABYLON.MaterialDefines);
  18202. var StandardMaterial = (function (_super) {
  18203. __extends(StandardMaterial, _super);
  18204. function StandardMaterial(name, scene) {
  18205. var _this = this;
  18206. _super.call(this, name, scene);
  18207. this.ambientColor = new BABYLON.Color3(0, 0, 0);
  18208. this.diffuseColor = new BABYLON.Color3(1, 1, 1);
  18209. this.specularColor = new BABYLON.Color3(1, 1, 1);
  18210. this.specularPower = 64;
  18211. this.emissiveColor = new BABYLON.Color3(0, 0, 0);
  18212. this.useAlphaFromDiffuseTexture = false;
  18213. this.useEmissiveAsIllumination = false;
  18214. this.useReflectionFresnelFromSpecular = false;
  18215. this.useSpecularOverAlpha = true;
  18216. this.disableLighting = false;
  18217. this.roughness = 0;
  18218. this.useLightmapAsShadowmap = false;
  18219. this.useGlossinessFromSpecularMapAlpha = false;
  18220. this._renderTargets = new BABYLON.SmartArray(16);
  18221. this._worldViewProjectionMatrix = BABYLON.Matrix.Zero();
  18222. this._globalAmbientColor = new BABYLON.Color3(0, 0, 0);
  18223. this._scaledDiffuse = new BABYLON.Color3();
  18224. this._scaledSpecular = new BABYLON.Color3();
  18225. this._defines = new StandardMaterialDefines();
  18226. this._cachedDefines = new StandardMaterialDefines();
  18227. this._cachedDefines.BonesPerMesh = -1;
  18228. this.getRenderTargetTextures = function () {
  18229. _this._renderTargets.reset();
  18230. if (_this.reflectionTexture && _this.reflectionTexture.isRenderTarget) {
  18231. _this._renderTargets.push(_this.reflectionTexture);
  18232. }
  18233. return _this._renderTargets;
  18234. };
  18235. }
  18236. StandardMaterial.prototype.needAlphaBlending = function () {
  18237. return (this.alpha < 1.0) || (this.opacityTexture != null) || this._shouldUseAlphaFromDiffuseTexture() || this.opacityFresnelParameters && this.opacityFresnelParameters.isEnabled;
  18238. };
  18239. StandardMaterial.prototype.needAlphaTesting = function () {
  18240. return this.diffuseTexture != null && this.diffuseTexture.hasAlpha;
  18241. };
  18242. StandardMaterial.prototype._shouldUseAlphaFromDiffuseTexture = function () {
  18243. return this.diffuseTexture != null && this.diffuseTexture.hasAlpha && this.useAlphaFromDiffuseTexture;
  18244. };
  18245. StandardMaterial.prototype.getAlphaTestTexture = function () {
  18246. return this.diffuseTexture;
  18247. };
  18248. // Methods
  18249. StandardMaterial.prototype._checkCache = function (scene, mesh, useInstances) {
  18250. if (!mesh) {
  18251. return true;
  18252. }
  18253. if (this._defines.INSTANCES !== useInstances) {
  18254. return false;
  18255. }
  18256. if (mesh._materialDefines && mesh._materialDefines.isEqual(this._defines)) {
  18257. return true;
  18258. }
  18259. return false;
  18260. };
  18261. StandardMaterial.prototype.isReady = function (mesh, useInstances) {
  18262. if (this.checkReadyOnlyOnce) {
  18263. if (this._wasPreviouslyReady) {
  18264. return true;
  18265. }
  18266. }
  18267. var scene = this.getScene();
  18268. if (!this.checkReadyOnEveryCall) {
  18269. if (this._renderId === scene.getRenderId()) {
  18270. if (this._checkCache(scene, mesh, useInstances)) {
  18271. return true;
  18272. }
  18273. }
  18274. }
  18275. var engine = scene.getEngine();
  18276. var needNormals = false;
  18277. var needUVs = false;
  18278. this._defines.reset();
  18279. // Textures
  18280. if (scene.texturesEnabled) {
  18281. if (this.diffuseTexture && StandardMaterial.DiffuseTextureEnabled) {
  18282. if (!this.diffuseTexture.isReady()) {
  18283. return false;
  18284. }
  18285. else {
  18286. needUVs = true;
  18287. this._defines.DIFFUSE = true;
  18288. }
  18289. }
  18290. if (this.ambientTexture && StandardMaterial.AmbientTextureEnabled) {
  18291. if (!this.ambientTexture.isReady()) {
  18292. return false;
  18293. }
  18294. else {
  18295. needUVs = true;
  18296. this._defines.AMBIENT = true;
  18297. }
  18298. }
  18299. if (this.opacityTexture && StandardMaterial.OpacityTextureEnabled) {
  18300. if (!this.opacityTexture.isReady()) {
  18301. return false;
  18302. }
  18303. else {
  18304. needUVs = true;
  18305. this._defines.OPACITY = true;
  18306. if (this.opacityTexture.getAlphaFromRGB) {
  18307. this._defines.OPACITYRGB = true;
  18308. }
  18309. }
  18310. }
  18311. if (this.reflectionTexture && StandardMaterial.ReflectionTextureEnabled) {
  18312. if (!this.reflectionTexture.isReady()) {
  18313. return false;
  18314. }
  18315. else {
  18316. needNormals = true;
  18317. this._defines.REFLECTION = true;
  18318. if (this.roughness > 0) {
  18319. this._defines.ROUGHNESS = true;
  18320. }
  18321. if (this.reflectionTexture.coordinatesMode === BABYLON.Texture.INVCUBIC_MODE) {
  18322. this._defines.INVERTCUBICMAP = true;
  18323. }
  18324. this._defines.REFLECTIONMAP_3D = this.reflectionTexture.isCube;
  18325. switch (this.reflectionTexture.coordinatesMode) {
  18326. case BABYLON.Texture.CUBIC_MODE:
  18327. case BABYLON.Texture.INVCUBIC_MODE:
  18328. this._defines.REFLECTIONMAP_CUBIC = true;
  18329. break;
  18330. case BABYLON.Texture.EXPLICIT_MODE:
  18331. this._defines.REFLECTIONMAP_EXPLICIT = true;
  18332. break;
  18333. case BABYLON.Texture.PLANAR_MODE:
  18334. this._defines.REFLECTIONMAP_PLANAR = true;
  18335. break;
  18336. case BABYLON.Texture.PROJECTION_MODE:
  18337. this._defines.REFLECTIONMAP_PROJECTION = true;
  18338. break;
  18339. case BABYLON.Texture.SKYBOX_MODE:
  18340. this._defines.REFLECTIONMAP_SKYBOX = true;
  18341. break;
  18342. case BABYLON.Texture.SPHERICAL_MODE:
  18343. this._defines.REFLECTIONMAP_SPHERICAL = true;
  18344. break;
  18345. }
  18346. }
  18347. }
  18348. if (this.emissiveTexture && StandardMaterial.EmissiveTextureEnabled) {
  18349. if (!this.emissiveTexture.isReady()) {
  18350. return false;
  18351. }
  18352. else {
  18353. needUVs = true;
  18354. this._defines.EMISSIVE = true;
  18355. }
  18356. }
  18357. if (this.lightmapTexture && StandardMaterial.LightmapEnabled) {
  18358. if (!this.lightmapTexture.isReady()) {
  18359. return false;
  18360. }
  18361. else {
  18362. needUVs = true;
  18363. this._defines.LIGHTMAP = true;
  18364. this._defines.USELIGHTMAPASSHADOWMAP = this.useLightmapAsShadowmap;
  18365. }
  18366. }
  18367. if (this.specularTexture && StandardMaterial.SpecularTextureEnabled) {
  18368. if (!this.specularTexture.isReady()) {
  18369. return false;
  18370. }
  18371. else {
  18372. needUVs = true;
  18373. this._defines.SPECULAR = true;
  18374. this._defines.GLOSSINESS = this.useGlossinessFromSpecularMapAlpha;
  18375. }
  18376. }
  18377. }
  18378. if (scene.getEngine().getCaps().standardDerivatives && this.bumpTexture && StandardMaterial.BumpTextureEnabled) {
  18379. if (!this.bumpTexture.isReady()) {
  18380. return false;
  18381. }
  18382. else {
  18383. needUVs = true;
  18384. this._defines.BUMP = true;
  18385. }
  18386. }
  18387. // Effect
  18388. if (scene.clipPlane) {
  18389. this._defines.CLIPPLANE = true;
  18390. }
  18391. if (engine.getAlphaTesting()) {
  18392. this._defines.ALPHATEST = true;
  18393. }
  18394. if (this._shouldUseAlphaFromDiffuseTexture()) {
  18395. this._defines.ALPHAFROMDIFFUSE = true;
  18396. }
  18397. if (this.useEmissiveAsIllumination) {
  18398. this._defines.EMISSIVEASILLUMINATION = true;
  18399. }
  18400. if (this.useReflectionFresnelFromSpecular) {
  18401. this._defines.REFLECTIONFRESNELFROMSPECULAR = true;
  18402. }
  18403. // Point size
  18404. if (this.pointsCloud || scene.forcePointsCloud) {
  18405. this._defines.POINTSIZE = true;
  18406. }
  18407. // Fog
  18408. if (scene.fogEnabled && mesh && mesh.applyFog && scene.fogMode !== BABYLON.Scene.FOGMODE_NONE && this.fogEnabled) {
  18409. this._defines.FOG = true;
  18410. }
  18411. var lightIndex = 0;
  18412. if (scene.lightsEnabled && !this.disableLighting) {
  18413. for (var index = 0; index < scene.lights.length; index++) {
  18414. var light = scene.lights[index];
  18415. if (!light.isEnabled()) {
  18416. continue;
  18417. }
  18418. // Excluded check
  18419. if (light._excludedMeshesIds.length > 0) {
  18420. for (var excludedIndex = 0; excludedIndex < light._excludedMeshesIds.length; excludedIndex++) {
  18421. var excludedMesh = scene.getMeshByID(light._excludedMeshesIds[excludedIndex]);
  18422. if (excludedMesh) {
  18423. light.excludedMeshes.push(excludedMesh);
  18424. }
  18425. }
  18426. light._excludedMeshesIds = [];
  18427. }
  18428. // Included check
  18429. if (light._includedOnlyMeshesIds.length > 0) {
  18430. for (var includedOnlyIndex = 0; includedOnlyIndex < light._includedOnlyMeshesIds.length; includedOnlyIndex++) {
  18431. var includedOnlyMesh = scene.getMeshByID(light._includedOnlyMeshesIds[includedOnlyIndex]);
  18432. if (includedOnlyMesh) {
  18433. light.includedOnlyMeshes.push(includedOnlyMesh);
  18434. }
  18435. }
  18436. light._includedOnlyMeshesIds = [];
  18437. }
  18438. if (!light.canAffectMesh(mesh)) {
  18439. continue;
  18440. }
  18441. needNormals = true;
  18442. this._defines["LIGHT" + lightIndex] = true;
  18443. var type;
  18444. if (light instanceof BABYLON.SpotLight) {
  18445. type = "SPOTLIGHT" + lightIndex;
  18446. }
  18447. else if (light instanceof BABYLON.HemisphericLight) {
  18448. type = "HEMILIGHT" + lightIndex;
  18449. }
  18450. else {
  18451. type = "POINTDIRLIGHT" + lightIndex;
  18452. }
  18453. this._defines[type] = true;
  18454. // Specular
  18455. if (!light.specular.equalsFloats(0, 0, 0)) {
  18456. this._defines.SPECULARTERM = true;
  18457. }
  18458. // Shadows
  18459. if (scene.shadowsEnabled) {
  18460. var shadowGenerator = light.getShadowGenerator();
  18461. if (mesh && mesh.receiveShadows && shadowGenerator) {
  18462. this._defines["SHADOW" + lightIndex] = true;
  18463. this._defines.SHADOWS = true;
  18464. if (shadowGenerator.useVarianceShadowMap || shadowGenerator.useBlurVarianceShadowMap) {
  18465. this._defines["SHADOWVSM" + lightIndex] = true;
  18466. }
  18467. if (shadowGenerator.usePoissonSampling) {
  18468. this._defines["SHADOWPCF" + lightIndex] = true;
  18469. }
  18470. }
  18471. }
  18472. lightIndex++;
  18473. if (lightIndex === maxSimultaneousLights)
  18474. break;
  18475. }
  18476. }
  18477. if (StandardMaterial.FresnelEnabled) {
  18478. // Fresnel
  18479. if (this.diffuseFresnelParameters && this.diffuseFresnelParameters.isEnabled ||
  18480. this.opacityFresnelParameters && this.opacityFresnelParameters.isEnabled ||
  18481. this.emissiveFresnelParameters && this.emissiveFresnelParameters.isEnabled ||
  18482. this.reflectionFresnelParameters && this.reflectionFresnelParameters.isEnabled) {
  18483. if (this.diffuseFresnelParameters && this.diffuseFresnelParameters.isEnabled) {
  18484. this._defines.DIFFUSEFRESNEL = true;
  18485. }
  18486. if (this.opacityFresnelParameters && this.opacityFresnelParameters.isEnabled) {
  18487. this._defines.OPACITYFRESNEL = true;
  18488. }
  18489. if (this.reflectionFresnelParameters && this.reflectionFresnelParameters.isEnabled) {
  18490. this._defines.REFLECTIONFRESNEL = true;
  18491. }
  18492. if (this.emissiveFresnelParameters && this.emissiveFresnelParameters.isEnabled) {
  18493. this._defines.EMISSIVEFRESNEL = true;
  18494. }
  18495. needNormals = true;
  18496. this._defines.FRESNEL = true;
  18497. }
  18498. }
  18499. if (this._defines.SPECULARTERM && this.useSpecularOverAlpha) {
  18500. this._defines.SPECULAROVERALPHA = true;
  18501. }
  18502. // Attribs
  18503. if (mesh) {
  18504. if (needNormals && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) {
  18505. this._defines.NORMAL = true;
  18506. }
  18507. if (needUVs) {
  18508. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  18509. this._defines.UV1 = true;
  18510. }
  18511. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  18512. this._defines.UV2 = true;
  18513. }
  18514. }
  18515. if (mesh.useVertexColors && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.ColorKind)) {
  18516. this._defines.VERTEXCOLOR = true;
  18517. if (mesh.hasVertexAlpha) {
  18518. this._defines.VERTEXALPHA = true;
  18519. }
  18520. }
  18521. if (mesh.useBones && mesh.computeBonesUsingShaders) {
  18522. this._defines.BONES = true;
  18523. this._defines.BonesPerMesh = (mesh.skeleton.bones.length + 1);
  18524. this._defines.BONES4 = true;
  18525. }
  18526. // Instances
  18527. if (useInstances) {
  18528. this._defines.INSTANCES = true;
  18529. }
  18530. }
  18531. // Get correct effect
  18532. if (!this._defines.isEqual(this._cachedDefines)) {
  18533. this._defines.cloneTo(this._cachedDefines);
  18534. scene.resetCachedMaterial();
  18535. // Fallbacks
  18536. var fallbacks = new BABYLON.EffectFallbacks();
  18537. if (this._defines.REFLECTION) {
  18538. fallbacks.addFallback(0, "REFLECTION");
  18539. }
  18540. if (this._defines.SPECULAR) {
  18541. fallbacks.addFallback(0, "SPECULAR");
  18542. }
  18543. if (this._defines.BUMP) {
  18544. fallbacks.addFallback(0, "BUMP");
  18545. }
  18546. if (this._defines.SPECULAROVERALPHA) {
  18547. fallbacks.addFallback(0, "SPECULAROVERALPHA");
  18548. }
  18549. if (this._defines.FOG) {
  18550. fallbacks.addFallback(1, "FOG");
  18551. }
  18552. for (lightIndex = 0; lightIndex < maxSimultaneousLights; lightIndex++) {
  18553. if (!this._defines["LIGHT" + lightIndex]) {
  18554. continue;
  18555. }
  18556. if (lightIndex > 0) {
  18557. fallbacks.addFallback(lightIndex, "LIGHT" + lightIndex);
  18558. }
  18559. if (this._defines["SHADOW" + lightIndex]) {
  18560. fallbacks.addFallback(0, "SHADOW" + lightIndex);
  18561. }
  18562. if (this._defines["SHADOWPCF" + lightIndex]) {
  18563. fallbacks.addFallback(0, "SHADOWPCF" + lightIndex);
  18564. }
  18565. if (this._defines["SHADOWVSM" + lightIndex]) {
  18566. fallbacks.addFallback(0, "SHADOWVSM" + lightIndex);
  18567. }
  18568. }
  18569. if (this._defines.SPECULARTERM) {
  18570. fallbacks.addFallback(0, "SPECULARTERM");
  18571. }
  18572. if (this._defines.DIFFUSEFRESNEL) {
  18573. fallbacks.addFallback(1, "DIFFUSEFRESNEL");
  18574. }
  18575. if (this._defines.OPACITYFRESNEL) {
  18576. fallbacks.addFallback(2, "OPACITYFRESNEL");
  18577. }
  18578. if (this._defines.REFLECTIONFRESNEL) {
  18579. fallbacks.addFallback(3, "REFLECTIONFRESNEL");
  18580. }
  18581. if (this._defines.EMISSIVEFRESNEL) {
  18582. fallbacks.addFallback(4, "EMISSIVEFRESNEL");
  18583. }
  18584. if (this._defines.FRESNEL) {
  18585. fallbacks.addFallback(4, "FRESNEL");
  18586. }
  18587. if (this._defines.BONES4) {
  18588. fallbacks.addFallback(0, "BONES4");
  18589. }
  18590. //Attributes
  18591. var attribs = [BABYLON.VertexBuffer.PositionKind];
  18592. if (this._defines.NORMAL) {
  18593. attribs.push(BABYLON.VertexBuffer.NormalKind);
  18594. }
  18595. if (this._defines.UV1) {
  18596. attribs.push(BABYLON.VertexBuffer.UVKind);
  18597. }
  18598. if (this._defines.UV2) {
  18599. attribs.push(BABYLON.VertexBuffer.UV2Kind);
  18600. }
  18601. if (this._defines.VERTEXCOLOR) {
  18602. attribs.push(BABYLON.VertexBuffer.ColorKind);
  18603. }
  18604. if (this._defines.BONES) {
  18605. attribs.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  18606. attribs.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  18607. }
  18608. if (this._defines.INSTANCES) {
  18609. attribs.push("world0");
  18610. attribs.push("world1");
  18611. attribs.push("world2");
  18612. attribs.push("world3");
  18613. }
  18614. // Legacy browser patch
  18615. var shaderName = "default";
  18616. if (!scene.getEngine().getCaps().standardDerivatives) {
  18617. shaderName = "legacydefault";
  18618. }
  18619. var join = this._defines.toString();
  18620. this._effect = scene.getEngine().createEffect(shaderName, attribs, ["world", "view", "viewProjection", "vEyePosition", "vLightsType", "vAmbientColor", "vDiffuseColor", "vSpecularColor", "vEmissiveColor",
  18621. "vLightData0", "vLightDiffuse0", "vLightSpecular0", "vLightDirection0", "vLightGround0", "lightMatrix0",
  18622. "vLightData1", "vLightDiffuse1", "vLightSpecular1", "vLightDirection1", "vLightGround1", "lightMatrix1",
  18623. "vLightData2", "vLightDiffuse2", "vLightSpecular2", "vLightDirection2", "vLightGround2", "lightMatrix2",
  18624. "vLightData3", "vLightDiffuse3", "vLightSpecular3", "vLightDirection3", "vLightGround3", "lightMatrix3",
  18625. "vFogInfos", "vFogColor", "pointSize",
  18626. "vDiffuseInfos", "vAmbientInfos", "vOpacityInfos", "vReflectionInfos", "vEmissiveInfos", "vSpecularInfos", "vBumpInfos", "vLightmapInfos",
  18627. "mBones",
  18628. "vClipPlane", "diffuseMatrix", "ambientMatrix", "opacityMatrix", "reflectionMatrix", "emissiveMatrix", "specularMatrix", "bumpMatrix", "lightmapMatrix",
  18629. "shadowsInfo0", "shadowsInfo1", "shadowsInfo2", "shadowsInfo3",
  18630. "diffuseLeftColor", "diffuseRightColor", "opacityParts", "reflectionLeftColor", "reflectionRightColor", "emissiveLeftColor", "emissiveRightColor"
  18631. ], ["diffuseSampler", "ambientSampler", "opacitySampler", "reflectionCubeSampler", "reflection2DSampler", "emissiveSampler", "specularSampler", "bumpSampler", "lightmapSampler",
  18632. "shadowSampler0", "shadowSampler1", "shadowSampler2", "shadowSampler3"
  18633. ], join, fallbacks, this.onCompiled, this.onError);
  18634. }
  18635. if (!this._effect.isReady()) {
  18636. return false;
  18637. }
  18638. this._renderId = scene.getRenderId();
  18639. this._wasPreviouslyReady = true;
  18640. if (mesh) {
  18641. if (!mesh._materialDefines) {
  18642. mesh._materialDefines = new StandardMaterialDefines();
  18643. }
  18644. this._defines.cloneTo(mesh._materialDefines);
  18645. }
  18646. return true;
  18647. };
  18648. StandardMaterial.prototype.unbind = function () {
  18649. if (this.reflectionTexture && this.reflectionTexture.isRenderTarget) {
  18650. this._effect.setTexture("reflection2DSampler", null);
  18651. }
  18652. _super.prototype.unbind.call(this);
  18653. };
  18654. StandardMaterial.prototype.bindOnlyWorldMatrix = function (world) {
  18655. this._effect.setMatrix("world", world);
  18656. };
  18657. StandardMaterial.prototype.bind = function (world, mesh) {
  18658. var scene = this.getScene();
  18659. // Matrices
  18660. this.bindOnlyWorldMatrix(world);
  18661. this._effect.setMatrix("viewProjection", scene.getTransformMatrix());
  18662. // Bones
  18663. if (mesh && mesh.useBones && mesh.computeBonesUsingShaders) {
  18664. this._effect.setMatrices("mBones", mesh.skeleton.getTransformMatrices());
  18665. }
  18666. if (scene.getCachedMaterial() !== this) {
  18667. if (StandardMaterial.FresnelEnabled) {
  18668. // Fresnel
  18669. if (this.diffuseFresnelParameters && this.diffuseFresnelParameters.isEnabled) {
  18670. this._effect.setColor4("diffuseLeftColor", this.diffuseFresnelParameters.leftColor, this.diffuseFresnelParameters.power);
  18671. this._effect.setColor4("diffuseRightColor", this.diffuseFresnelParameters.rightColor, this.diffuseFresnelParameters.bias);
  18672. }
  18673. if (this.opacityFresnelParameters && this.opacityFresnelParameters.isEnabled) {
  18674. this._effect.setColor4("opacityParts", new BABYLON.Color3(this.opacityFresnelParameters.leftColor.toLuminance(), this.opacityFresnelParameters.rightColor.toLuminance(), this.opacityFresnelParameters.bias), this.opacityFresnelParameters.power);
  18675. }
  18676. if (this.reflectionFresnelParameters && this.reflectionFresnelParameters.isEnabled) {
  18677. this._effect.setColor4("reflectionLeftColor", this.reflectionFresnelParameters.leftColor, this.reflectionFresnelParameters.power);
  18678. this._effect.setColor4("reflectionRightColor", this.reflectionFresnelParameters.rightColor, this.reflectionFresnelParameters.bias);
  18679. }
  18680. if (this.emissiveFresnelParameters && this.emissiveFresnelParameters.isEnabled) {
  18681. this._effect.setColor4("emissiveLeftColor", this.emissiveFresnelParameters.leftColor, this.emissiveFresnelParameters.power);
  18682. this._effect.setColor4("emissiveRightColor", this.emissiveFresnelParameters.rightColor, this.emissiveFresnelParameters.bias);
  18683. }
  18684. }
  18685. // Textures
  18686. if (this.diffuseTexture && StandardMaterial.DiffuseTextureEnabled) {
  18687. this._effect.setTexture("diffuseSampler", this.diffuseTexture);
  18688. this._effect.setFloat2("vDiffuseInfos", this.diffuseTexture.coordinatesIndex, this.diffuseTexture.level);
  18689. this._effect.setMatrix("diffuseMatrix", this.diffuseTexture.getTextureMatrix());
  18690. }
  18691. if (this.ambientTexture && StandardMaterial.AmbientTextureEnabled) {
  18692. this._effect.setTexture("ambientSampler", this.ambientTexture);
  18693. this._effect.setFloat2("vAmbientInfos", this.ambientTexture.coordinatesIndex, this.ambientTexture.level);
  18694. this._effect.setMatrix("ambientMatrix", this.ambientTexture.getTextureMatrix());
  18695. }
  18696. if (this.opacityTexture && StandardMaterial.OpacityTextureEnabled) {
  18697. this._effect.setTexture("opacitySampler", this.opacityTexture);
  18698. this._effect.setFloat2("vOpacityInfos", this.opacityTexture.coordinatesIndex, this.opacityTexture.level);
  18699. this._effect.setMatrix("opacityMatrix", this.opacityTexture.getTextureMatrix());
  18700. }
  18701. if (this.reflectionTexture && StandardMaterial.ReflectionTextureEnabled) {
  18702. if (this.reflectionTexture.isCube) {
  18703. this._effect.setTexture("reflectionCubeSampler", this.reflectionTexture);
  18704. }
  18705. else {
  18706. this._effect.setTexture("reflection2DSampler", this.reflectionTexture);
  18707. }
  18708. this._effect.setMatrix("reflectionMatrix", this.reflectionTexture.getReflectionTextureMatrix());
  18709. this._effect.setFloat2("vReflectionInfos", this.reflectionTexture.level, this.roughness);
  18710. }
  18711. if (this.emissiveTexture && StandardMaterial.EmissiveTextureEnabled) {
  18712. this._effect.setTexture("emissiveSampler", this.emissiveTexture);
  18713. this._effect.setFloat2("vEmissiveInfos", this.emissiveTexture.coordinatesIndex, this.emissiveTexture.level);
  18714. this._effect.setMatrix("emissiveMatrix", this.emissiveTexture.getTextureMatrix());
  18715. }
  18716. if (this.lightmapTexture && StandardMaterial.LightmapEnabled) {
  18717. this._effect.setTexture("lightmapSampler", this.lightmapTexture);
  18718. this._effect.setFloat2("vLightmapInfos", this.lightmapTexture.coordinatesIndex, this.lightmapTexture.level);
  18719. this._effect.setMatrix("lightmapMatrix", this.lightmapTexture.getTextureMatrix());
  18720. }
  18721. if (this.specularTexture && StandardMaterial.SpecularTextureEnabled) {
  18722. this._effect.setTexture("specularSampler", this.specularTexture);
  18723. this._effect.setFloat2("vSpecularInfos", this.specularTexture.coordinatesIndex, this.specularTexture.level);
  18724. this._effect.setMatrix("specularMatrix", this.specularTexture.getTextureMatrix());
  18725. }
  18726. if (this.bumpTexture && scene.getEngine().getCaps().standardDerivatives && StandardMaterial.BumpTextureEnabled) {
  18727. this._effect.setTexture("bumpSampler", this.bumpTexture);
  18728. this._effect.setFloat2("vBumpInfos", this.bumpTexture.coordinatesIndex, 1.0 / this.bumpTexture.level);
  18729. this._effect.setMatrix("bumpMatrix", this.bumpTexture.getTextureMatrix());
  18730. }
  18731. // Clip plane
  18732. if (scene.clipPlane) {
  18733. var clipPlane = scene.clipPlane;
  18734. this._effect.setFloat4("vClipPlane", clipPlane.normal.x, clipPlane.normal.y, clipPlane.normal.z, clipPlane.d);
  18735. }
  18736. // Point size
  18737. if (this.pointsCloud) {
  18738. this._effect.setFloat("pointSize", this.pointSize);
  18739. }
  18740. // Colors
  18741. scene.ambientColor.multiplyToRef(this.ambientColor, this._globalAmbientColor);
  18742. // Scaling down color according to emissive
  18743. this._scaledSpecular.r = this.specularColor.r * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.r);
  18744. this._scaledSpecular.g = this.specularColor.g * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.g);
  18745. this._scaledSpecular.b = this.specularColor.b * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.b);
  18746. this._effect.setVector3("vEyePosition", scene._mirroredCameraPosition ? scene._mirroredCameraPosition : scene.activeCamera.position);
  18747. this._effect.setColor3("vAmbientColor", this._globalAmbientColor);
  18748. if (this._defines.SPECULARTERM) {
  18749. this._effect.setColor4("vSpecularColor", this._scaledSpecular, this.specularPower);
  18750. }
  18751. this._effect.setColor3("vEmissiveColor", this.emissiveColor);
  18752. }
  18753. // Scaling down color according to emissive
  18754. this._scaledDiffuse.r = this.diffuseColor.r * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.r);
  18755. this._scaledDiffuse.g = this.diffuseColor.g * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.g);
  18756. this._scaledDiffuse.b = this.diffuseColor.b * BABYLON.Tools.Clamp(1.0 - this.emissiveColor.b);
  18757. this._effect.setColor4("vDiffuseColor", this._scaledDiffuse, this.alpha * mesh.visibility);
  18758. if (scene.lightsEnabled && !this.disableLighting) {
  18759. var lightIndex = 0;
  18760. for (var index = 0; index < scene.lights.length; index++) {
  18761. var light = scene.lights[index];
  18762. if (!light.isEnabled()) {
  18763. continue;
  18764. }
  18765. if (!light.canAffectMesh(mesh)) {
  18766. continue;
  18767. }
  18768. if (light instanceof BABYLON.PointLight) {
  18769. // Point Light
  18770. light.transferToEffect(this._effect, "vLightData" + lightIndex);
  18771. }
  18772. else if (light instanceof BABYLON.DirectionalLight) {
  18773. // Directional Light
  18774. light.transferToEffect(this._effect, "vLightData" + lightIndex);
  18775. }
  18776. else if (light instanceof BABYLON.SpotLight) {
  18777. // Spot Light
  18778. light.transferToEffect(this._effect, "vLightData" + lightIndex, "vLightDirection" + lightIndex);
  18779. }
  18780. else if (light instanceof BABYLON.HemisphericLight) {
  18781. // Hemispheric Light
  18782. light.transferToEffect(this._effect, "vLightData" + lightIndex, "vLightGround" + lightIndex);
  18783. }
  18784. light.diffuse.scaleToRef(light.intensity, this._scaledDiffuse);
  18785. this._effect.setColor4("vLightDiffuse" + lightIndex, this._scaledDiffuse, light.range);
  18786. if (this._defines.SPECULARTERM) {
  18787. light.specular.scaleToRef(light.intensity, this._scaledSpecular);
  18788. this._effect.setColor3("vLightSpecular" + lightIndex, this._scaledSpecular);
  18789. }
  18790. // Shadows
  18791. if (scene.shadowsEnabled) {
  18792. var shadowGenerator = light.getShadowGenerator();
  18793. if (mesh.receiveShadows && shadowGenerator) {
  18794. this._effect.setMatrix("lightMatrix" + lightIndex, shadowGenerator.getTransformMatrix());
  18795. this._effect.setTexture("shadowSampler" + lightIndex, shadowGenerator.getShadowMapForRendering());
  18796. this._effect.setFloat3("shadowsInfo" + lightIndex, shadowGenerator.getDarkness(), shadowGenerator.getShadowMap().getSize().width, shadowGenerator.bias);
  18797. }
  18798. }
  18799. lightIndex++;
  18800. if (lightIndex === maxSimultaneousLights)
  18801. break;
  18802. }
  18803. }
  18804. // View
  18805. if (scene.fogEnabled && mesh.applyFog && scene.fogMode !== BABYLON.Scene.FOGMODE_NONE || this.reflectionTexture) {
  18806. this._effect.setMatrix("view", scene.getViewMatrix());
  18807. }
  18808. // Fog
  18809. if (scene.fogEnabled && mesh.applyFog && scene.fogMode !== BABYLON.Scene.FOGMODE_NONE) {
  18810. this._effect.setFloat4("vFogInfos", scene.fogMode, scene.fogStart, scene.fogEnd, scene.fogDensity);
  18811. this._effect.setColor3("vFogColor", scene.fogColor);
  18812. }
  18813. _super.prototype.bind.call(this, world, mesh);
  18814. };
  18815. StandardMaterial.prototype.getAnimatables = function () {
  18816. var results = [];
  18817. if (this.diffuseTexture && this.diffuseTexture.animations && this.diffuseTexture.animations.length > 0) {
  18818. results.push(this.diffuseTexture);
  18819. }
  18820. if (this.ambientTexture && this.ambientTexture.animations && this.ambientTexture.animations.length > 0) {
  18821. results.push(this.ambientTexture);
  18822. }
  18823. if (this.opacityTexture && this.opacityTexture.animations && this.opacityTexture.animations.length > 0) {
  18824. results.push(this.opacityTexture);
  18825. }
  18826. if (this.reflectionTexture && this.reflectionTexture.animations && this.reflectionTexture.animations.length > 0) {
  18827. results.push(this.reflectionTexture);
  18828. }
  18829. if (this.emissiveTexture && this.emissiveTexture.animations && this.emissiveTexture.animations.length > 0) {
  18830. results.push(this.emissiveTexture);
  18831. }
  18832. if (this.specularTexture && this.specularTexture.animations && this.specularTexture.animations.length > 0) {
  18833. results.push(this.specularTexture);
  18834. }
  18835. if (this.bumpTexture && this.bumpTexture.animations && this.bumpTexture.animations.length > 0) {
  18836. results.push(this.bumpTexture);
  18837. }
  18838. return results;
  18839. };
  18840. StandardMaterial.prototype.dispose = function (forceDisposeEffect) {
  18841. if (this.diffuseTexture) {
  18842. this.diffuseTexture.dispose();
  18843. }
  18844. if (this.ambientTexture) {
  18845. this.ambientTexture.dispose();
  18846. }
  18847. if (this.opacityTexture) {
  18848. this.opacityTexture.dispose();
  18849. }
  18850. if (this.reflectionTexture) {
  18851. this.reflectionTexture.dispose();
  18852. }
  18853. if (this.emissiveTexture) {
  18854. this.emissiveTexture.dispose();
  18855. }
  18856. if (this.specularTexture) {
  18857. this.specularTexture.dispose();
  18858. }
  18859. if (this.bumpTexture) {
  18860. this.bumpTexture.dispose();
  18861. }
  18862. _super.prototype.dispose.call(this, forceDisposeEffect);
  18863. };
  18864. StandardMaterial.prototype.clone = function (name) {
  18865. var newStandardMaterial = new StandardMaterial(name, this.getScene());
  18866. // Base material
  18867. this.copyTo(newStandardMaterial);
  18868. // Standard material
  18869. if (this.diffuseTexture && this.diffuseTexture.clone) {
  18870. newStandardMaterial.diffuseTexture = this.diffuseTexture.clone();
  18871. }
  18872. if (this.ambientTexture && this.ambientTexture.clone) {
  18873. newStandardMaterial.ambientTexture = this.ambientTexture.clone();
  18874. }
  18875. if (this.opacityTexture && this.opacityTexture.clone) {
  18876. newStandardMaterial.opacityTexture = this.opacityTexture.clone();
  18877. }
  18878. if (this.reflectionTexture && this.reflectionTexture.clone) {
  18879. newStandardMaterial.reflectionTexture = this.reflectionTexture.clone();
  18880. }
  18881. if (this.emissiveTexture && this.emissiveTexture.clone) {
  18882. newStandardMaterial.emissiveTexture = this.emissiveTexture.clone();
  18883. }
  18884. if (this.specularTexture && this.specularTexture.clone) {
  18885. newStandardMaterial.specularTexture = this.specularTexture.clone();
  18886. }
  18887. if (this.bumpTexture && this.bumpTexture.clone) {
  18888. newStandardMaterial.bumpTexture = this.bumpTexture.clone();
  18889. }
  18890. if (this.lightmapTexture && this.lightmapTexture.clone) {
  18891. newStandardMaterial.lightmapTexture = this.lightmapTexture.clone();
  18892. newStandardMaterial.useLightmapAsShadowmap = this.useLightmapAsShadowmap;
  18893. }
  18894. newStandardMaterial.ambientColor = this.ambientColor.clone();
  18895. newStandardMaterial.diffuseColor = this.diffuseColor.clone();
  18896. newStandardMaterial.specularColor = this.specularColor.clone();
  18897. newStandardMaterial.specularPower = this.specularPower;
  18898. newStandardMaterial.emissiveColor = this.emissiveColor.clone();
  18899. newStandardMaterial.useAlphaFromDiffuseTexture = this.useAlphaFromDiffuseTexture;
  18900. newStandardMaterial.useEmissiveAsIllumination = this.useEmissiveAsIllumination;
  18901. newStandardMaterial.useGlossinessFromSpecularMapAlpha = this.useGlossinessFromSpecularMapAlpha;
  18902. newStandardMaterial.useReflectionFresnelFromSpecular = this.useReflectionFresnelFromSpecular;
  18903. newStandardMaterial.useSpecularOverAlpha = this.useSpecularOverAlpha;
  18904. newStandardMaterial.roughness = this.roughness;
  18905. if (this.diffuseFresnelParameters && this.diffuseFresnelParameters.clone) {
  18906. newStandardMaterial.diffuseFresnelParameters = this.diffuseFresnelParameters.clone();
  18907. }
  18908. if (this.emissiveFresnelParameters && this.emissiveFresnelParameters.clone) {
  18909. newStandardMaterial.emissiveFresnelParameters = this.emissiveFresnelParameters.clone();
  18910. }
  18911. if (this.reflectionFresnelParameters && this.reflectionFresnelParameters.clone) {
  18912. newStandardMaterial.reflectionFresnelParameters = this.reflectionFresnelParameters.clone();
  18913. }
  18914. if (this.opacityFresnelParameters && this.opacityFresnelParameters.clone) {
  18915. newStandardMaterial.opacityFresnelParameters = this.opacityFresnelParameters.clone();
  18916. }
  18917. return newStandardMaterial;
  18918. };
  18919. // Statics
  18920. // Flags used to enable or disable a type of texture for all Standard Materials
  18921. StandardMaterial.DiffuseTextureEnabled = true;
  18922. StandardMaterial.AmbientTextureEnabled = true;
  18923. StandardMaterial.OpacityTextureEnabled = true;
  18924. StandardMaterial.ReflectionTextureEnabled = true;
  18925. StandardMaterial.EmissiveTextureEnabled = true;
  18926. StandardMaterial.SpecularTextureEnabled = true;
  18927. StandardMaterial.BumpTextureEnabled = true;
  18928. StandardMaterial.FresnelEnabled = true;
  18929. StandardMaterial.LightmapEnabled = true;
  18930. return StandardMaterial;
  18931. })(BABYLON.Material);
  18932. BABYLON.StandardMaterial = StandardMaterial;
  18933. })(BABYLON || (BABYLON = {}));
  18934. var BABYLON;
  18935. (function (BABYLON) {
  18936. var MultiMaterial = (function (_super) {
  18937. __extends(MultiMaterial, _super);
  18938. function MultiMaterial(name, scene) {
  18939. _super.call(this, name, scene, true);
  18940. this.subMaterials = new Array();
  18941. scene.multiMaterials.push(this);
  18942. }
  18943. // Properties
  18944. MultiMaterial.prototype.getSubMaterial = function (index) {
  18945. if (index < 0 || index >= this.subMaterials.length) {
  18946. return this.getScene().defaultMaterial;
  18947. }
  18948. return this.subMaterials[index];
  18949. };
  18950. // Methods
  18951. MultiMaterial.prototype.isReady = function (mesh) {
  18952. for (var index = 0; index < this.subMaterials.length; index++) {
  18953. var subMaterial = this.subMaterials[index];
  18954. if (subMaterial) {
  18955. if (!this.subMaterials[index].isReady(mesh)) {
  18956. return false;
  18957. }
  18958. }
  18959. }
  18960. return true;
  18961. };
  18962. MultiMaterial.prototype.clone = function (name) {
  18963. var newMultiMaterial = new MultiMaterial(name, this.getScene());
  18964. for (var index = 0; index < this.subMaterials.length; index++) {
  18965. var subMaterial = this.subMaterials[index];
  18966. newMultiMaterial.subMaterials.push(subMaterial);
  18967. }
  18968. return newMultiMaterial;
  18969. };
  18970. return MultiMaterial;
  18971. })(BABYLON.Material);
  18972. BABYLON.MultiMaterial = MultiMaterial;
  18973. })(BABYLON || (BABYLON = {}));
  18974. var BABYLON;
  18975. (function (BABYLON) {
  18976. var SceneLoader = (function () {
  18977. function SceneLoader() {
  18978. }
  18979. Object.defineProperty(SceneLoader, "ForceFullSceneLoadingForIncremental", {
  18980. get: function () {
  18981. return SceneLoader._ForceFullSceneLoadingForIncremental;
  18982. },
  18983. set: function (value) {
  18984. SceneLoader._ForceFullSceneLoadingForIncremental = value;
  18985. },
  18986. enumerable: true,
  18987. configurable: true
  18988. });
  18989. Object.defineProperty(SceneLoader, "ShowLoadingScreen", {
  18990. get: function () {
  18991. return SceneLoader._ShowLoadingScreen;
  18992. },
  18993. set: function (value) {
  18994. SceneLoader._ShowLoadingScreen = value;
  18995. },
  18996. enumerable: true,
  18997. configurable: true
  18998. });
  18999. SceneLoader._getPluginForFilename = function (sceneFilename) {
  19000. var dotPosition = sceneFilename.lastIndexOf(".");
  19001. var queryStringPosition = sceneFilename.indexOf("?");
  19002. if (queryStringPosition === -1) {
  19003. queryStringPosition = sceneFilename.length;
  19004. }
  19005. var extension = sceneFilename.substring(dotPosition, queryStringPosition).toLowerCase();
  19006. for (var index = 0; index < this._registeredPlugins.length; index++) {
  19007. var plugin = this._registeredPlugins[index];
  19008. if (plugin.extensions.indexOf(extension) !== -1) {
  19009. return plugin;
  19010. }
  19011. }
  19012. return this._registeredPlugins[this._registeredPlugins.length - 1];
  19013. };
  19014. // Public functions
  19015. SceneLoader.RegisterPlugin = function (plugin) {
  19016. plugin.extensions = plugin.extensions.toLowerCase();
  19017. SceneLoader._registeredPlugins.push(plugin);
  19018. };
  19019. SceneLoader.ImportMesh = function (meshesNames, rootUrl, sceneFilename, scene, onsuccess, progressCallBack, onerror) {
  19020. if (sceneFilename.substr && sceneFilename.substr(0, 1) === "/") {
  19021. BABYLON.Tools.Error("Wrong sceneFilename parameter");
  19022. return;
  19023. }
  19024. var loadingToken = {};
  19025. scene._addPendingData(loadingToken);
  19026. var manifestChecked = function (success) {
  19027. scene.database = database;
  19028. var plugin = SceneLoader._getPluginForFilename(sceneFilename);
  19029. var importMeshFromData = function (data) {
  19030. var meshes = [];
  19031. var particleSystems = [];
  19032. var skeletons = [];
  19033. try {
  19034. if (!plugin.importMesh(meshesNames, scene, data, rootUrl, meshes, particleSystems, skeletons)) {
  19035. if (onerror) {
  19036. onerror(scene, 'Unable to import meshes from ' + rootUrl + sceneFilename);
  19037. }
  19038. scene._removePendingData(loadingToken);
  19039. return;
  19040. }
  19041. }
  19042. catch (e) {
  19043. if (onerror) {
  19044. onerror(scene, 'Unable to import meshes from ' + rootUrl + sceneFilename + ' (Exception: ' + e + ')');
  19045. }
  19046. scene._removePendingData(loadingToken);
  19047. return;
  19048. }
  19049. if (onsuccess) {
  19050. scene.importedMeshesFiles.push(rootUrl + sceneFilename);
  19051. onsuccess(meshes, particleSystems, skeletons);
  19052. scene._removePendingData(loadingToken);
  19053. }
  19054. };
  19055. if (sceneFilename.substr && sceneFilename.substr(0, 5) === "data:") {
  19056. // Direct load
  19057. importMeshFromData(sceneFilename.substr(5));
  19058. return;
  19059. }
  19060. BABYLON.Tools.LoadFile(rootUrl + sceneFilename, function (data) {
  19061. importMeshFromData(data);
  19062. }, progressCallBack, database);
  19063. };
  19064. if (scene.getEngine().enableOfflineSupport) {
  19065. // Checking if a manifest file has been set for this scene and if offline mode has been requested
  19066. var database = new BABYLON.Database(rootUrl + sceneFilename, manifestChecked);
  19067. }
  19068. else {
  19069. manifestChecked(true);
  19070. }
  19071. };
  19072. /**
  19073. * Load a scene
  19074. * @param rootUrl a string that defines the root url for scene and resources
  19075. * @param sceneFilename a string that defines the name of the scene file. can start with "data:" following by the stringified version of the scene
  19076. * @param engine is the instance of BABYLON.Engine to use to create the scene
  19077. */
  19078. SceneLoader.Load = function (rootUrl, sceneFilename, engine, onsuccess, progressCallBack, onerror) {
  19079. SceneLoader.Append(rootUrl, sceneFilename, new BABYLON.Scene(engine), onsuccess, progressCallBack, onerror);
  19080. };
  19081. /**
  19082. * Append a scene
  19083. * @param rootUrl a string that defines the root url for scene and resources
  19084. * @param sceneFilename a string that defines the name of the scene file. can start with "data:" following by the stringified version of the scene
  19085. * @param scene is the instance of BABYLON.Scene to append to
  19086. */
  19087. SceneLoader.Append = function (rootUrl, sceneFilename, scene, onsuccess, progressCallBack, onerror) {
  19088. if (sceneFilename.substr && sceneFilename.substr(0, 1) === "/") {
  19089. BABYLON.Tools.Error("Wrong sceneFilename parameter");
  19090. return;
  19091. }
  19092. var plugin = this._getPluginForFilename(sceneFilename.name || sceneFilename);
  19093. var database;
  19094. var loadingToken = {};
  19095. scene._addPendingData(loadingToken);
  19096. if (SceneLoader.ShowLoadingScreen) {
  19097. scene.getEngine().displayLoadingUI();
  19098. }
  19099. var loadSceneFromData = function (data) {
  19100. scene.database = database;
  19101. if (!plugin.load(scene, data, rootUrl)) {
  19102. if (onerror) {
  19103. onerror(scene);
  19104. }
  19105. scene._removePendingData(loadingToken);
  19106. scene.getEngine().hideLoadingUI();
  19107. return;
  19108. }
  19109. if (onsuccess) {
  19110. onsuccess(scene);
  19111. }
  19112. scene._removePendingData(loadingToken);
  19113. if (SceneLoader.ShowLoadingScreen) {
  19114. scene.executeWhenReady(function () {
  19115. scene.getEngine().hideLoadingUI();
  19116. });
  19117. }
  19118. };
  19119. var manifestChecked = function (success) {
  19120. BABYLON.Tools.LoadFile(rootUrl + sceneFilename, loadSceneFromData, progressCallBack, database);
  19121. };
  19122. if (sceneFilename.substr && sceneFilename.substr(0, 5) === "data:") {
  19123. // Direct load
  19124. loadSceneFromData(sceneFilename.substr(5));
  19125. return;
  19126. }
  19127. if (rootUrl.indexOf("file:") === -1) {
  19128. if (scene.getEngine().enableOfflineSupport) {
  19129. // Checking if a manifest file has been set for this scene and if offline mode has been requested
  19130. database = new BABYLON.Database(rootUrl + sceneFilename, manifestChecked);
  19131. }
  19132. else {
  19133. manifestChecked(true);
  19134. }
  19135. }
  19136. else {
  19137. BABYLON.Tools.ReadFile(sceneFilename, loadSceneFromData, progressCallBack);
  19138. }
  19139. };
  19140. // Flags
  19141. SceneLoader._ForceFullSceneLoadingForIncremental = false;
  19142. SceneLoader._ShowLoadingScreen = true;
  19143. // Members
  19144. SceneLoader._registeredPlugins = new Array();
  19145. return SceneLoader;
  19146. })();
  19147. BABYLON.SceneLoader = SceneLoader;
  19148. ;
  19149. })(BABYLON || (BABYLON = {}));
  19150. var BABYLON;
  19151. (function (BABYLON) {
  19152. var Internals;
  19153. (function (Internals) {
  19154. var checkColors4 = function (colors, count) {
  19155. // Check if color3 was used
  19156. if (colors.length === count * 3) {
  19157. var colors4 = [];
  19158. for (var index = 0; index < colors.length; index += 3) {
  19159. var newIndex = (index / 3) * 4;
  19160. colors4[newIndex] = colors[index];
  19161. colors4[newIndex + 1] = colors[index + 1];
  19162. colors4[newIndex + 2] = colors[index + 2];
  19163. colors4[newIndex + 3] = 1.0;
  19164. }
  19165. return colors4;
  19166. }
  19167. return colors;
  19168. };
  19169. var loadCubeTexture = function (rootUrl, parsedTexture, scene) {
  19170. var texture = null;
  19171. if ((parsedTexture.name || parsedTexture.extensions) && !parsedTexture.isRenderTarget) {
  19172. texture = new BABYLON.CubeTexture(rootUrl + parsedTexture.name, scene, parsedTexture.extensions);
  19173. texture.name = parsedTexture.name;
  19174. texture.hasAlpha = parsedTexture.hasAlpha;
  19175. texture.level = parsedTexture.level;
  19176. texture.coordinatesMode = parsedTexture.coordinatesMode;
  19177. }
  19178. return texture;
  19179. };
  19180. var loadTexture = function (rootUrl, parsedTexture, scene) {
  19181. if (parsedTexture.isCube) {
  19182. return loadCubeTexture(rootUrl, parsedTexture, scene);
  19183. }
  19184. if (!parsedTexture.name && !parsedTexture.isRenderTarget) {
  19185. return null;
  19186. }
  19187. var texture;
  19188. if (parsedTexture.mirrorPlane) {
  19189. texture = new BABYLON.MirrorTexture(parsedTexture.name, parsedTexture.renderTargetSize, scene);
  19190. texture._waitingRenderList = parsedTexture.renderList;
  19191. texture.mirrorPlane = BABYLON.Plane.FromArray(parsedTexture.mirrorPlane);
  19192. }
  19193. else if (parsedTexture.isRenderTarget) {
  19194. texture = new BABYLON.RenderTargetTexture(parsedTexture.name, parsedTexture.renderTargetSize, scene);
  19195. texture._waitingRenderList = parsedTexture.renderList;
  19196. }
  19197. else {
  19198. if (parsedTexture.base64String) {
  19199. texture = BABYLON.Texture.CreateFromBase64String(parsedTexture.base64String, parsedTexture.name, scene);
  19200. }
  19201. else {
  19202. texture = new BABYLON.Texture(rootUrl + parsedTexture.name, scene);
  19203. }
  19204. }
  19205. texture.name = parsedTexture.name;
  19206. texture.hasAlpha = parsedTexture.hasAlpha;
  19207. texture.getAlphaFromRGB = parsedTexture.getAlphaFromRGB;
  19208. texture.level = parsedTexture.level;
  19209. texture.coordinatesIndex = parsedTexture.coordinatesIndex;
  19210. texture.coordinatesMode = parsedTexture.coordinatesMode;
  19211. texture.uOffset = parsedTexture.uOffset;
  19212. texture.vOffset = parsedTexture.vOffset;
  19213. texture.uScale = parsedTexture.uScale;
  19214. texture.vScale = parsedTexture.vScale;
  19215. texture.uAng = parsedTexture.uAng;
  19216. texture.vAng = parsedTexture.vAng;
  19217. texture.wAng = parsedTexture.wAng;
  19218. texture.wrapU = parsedTexture.wrapU;
  19219. texture.wrapV = parsedTexture.wrapV;
  19220. // Animations
  19221. if (parsedTexture.animations) {
  19222. for (var animationIndex = 0; animationIndex < parsedTexture.animations.length; animationIndex++) {
  19223. var parsedAnimation = parsedTexture.animations[animationIndex];
  19224. texture.animations.push(parseAnimation(parsedAnimation));
  19225. }
  19226. }
  19227. return texture;
  19228. };
  19229. var parseSkeleton = function (parsedSkeleton, scene) {
  19230. var skeleton = new BABYLON.Skeleton(parsedSkeleton.name, parsedSkeleton.id, scene);
  19231. for (var index = 0; index < parsedSkeleton.bones.length; index++) {
  19232. var parsedBone = parsedSkeleton.bones[index];
  19233. var parentBone = null;
  19234. if (parsedBone.parentBoneIndex > -1) {
  19235. parentBone = skeleton.bones[parsedBone.parentBoneIndex];
  19236. }
  19237. var bone = new BABYLON.Bone(parsedBone.name, skeleton, parentBone, BABYLON.Matrix.FromArray(parsedBone.matrix));
  19238. if (parsedBone.animation) {
  19239. bone.animations.push(parseAnimation(parsedBone.animation));
  19240. }
  19241. }
  19242. return skeleton;
  19243. };
  19244. var parseFresnelParameters = function (parsedFresnelParameters) {
  19245. var fresnelParameters = new BABYLON.FresnelParameters();
  19246. fresnelParameters.isEnabled = parsedFresnelParameters.isEnabled;
  19247. fresnelParameters.leftColor = BABYLON.Color3.FromArray(parsedFresnelParameters.leftColor);
  19248. fresnelParameters.rightColor = BABYLON.Color3.FromArray(parsedFresnelParameters.rightColor);
  19249. fresnelParameters.bias = parsedFresnelParameters.bias;
  19250. fresnelParameters.power = parsedFresnelParameters.power || 1.0;
  19251. return fresnelParameters;
  19252. };
  19253. var parseMaterial = function (parsedMaterial, scene, rootUrl) {
  19254. var material;
  19255. material = new BABYLON.StandardMaterial(parsedMaterial.name, scene);
  19256. material.ambientColor = BABYLON.Color3.FromArray(parsedMaterial.ambient);
  19257. material.diffuseColor = BABYLON.Color3.FromArray(parsedMaterial.diffuse);
  19258. material.specularColor = BABYLON.Color3.FromArray(parsedMaterial.specular);
  19259. material.specularPower = parsedMaterial.specularPower;
  19260. material.emissiveColor = BABYLON.Color3.FromArray(parsedMaterial.emissive);
  19261. material.useReflectionFresnelFromSpecular = parsedMaterial.useReflectionFresnelFromSpecular;
  19262. material.useEmissiveAsIllumination = parsedMaterial.useEmissiveAsIllumination;
  19263. material.alpha = parsedMaterial.alpha;
  19264. material.id = parsedMaterial.id;
  19265. if (parsedMaterial.disableDepthWrite) {
  19266. material.disableDepthWrite = parsedMaterial.disableDepthWrite;
  19267. }
  19268. BABYLON.Tags.AddTagsTo(material, parsedMaterial.tags);
  19269. material.backFaceCulling = parsedMaterial.backFaceCulling;
  19270. material.wireframe = parsedMaterial.wireframe;
  19271. if (parsedMaterial.diffuseTexture) {
  19272. material.diffuseTexture = loadTexture(rootUrl, parsedMaterial.diffuseTexture, scene);
  19273. }
  19274. if (parsedMaterial.diffuseFresnelParameters) {
  19275. material.diffuseFresnelParameters = parseFresnelParameters(parsedMaterial.diffuseFresnelParameters);
  19276. }
  19277. if (parsedMaterial.ambientTexture) {
  19278. material.ambientTexture = loadTexture(rootUrl, parsedMaterial.ambientTexture, scene);
  19279. }
  19280. if (parsedMaterial.opacityTexture) {
  19281. material.opacityTexture = loadTexture(rootUrl, parsedMaterial.opacityTexture, scene);
  19282. }
  19283. if (parsedMaterial.opacityFresnelParameters) {
  19284. material.opacityFresnelParameters = parseFresnelParameters(parsedMaterial.opacityFresnelParameters);
  19285. }
  19286. if (parsedMaterial.reflectionTexture) {
  19287. material.reflectionTexture = loadTexture(rootUrl, parsedMaterial.reflectionTexture, scene);
  19288. }
  19289. if (parsedMaterial.reflectionFresnelParameters) {
  19290. material.reflectionFresnelParameters = parseFresnelParameters(parsedMaterial.reflectionFresnelParameters);
  19291. }
  19292. if (parsedMaterial.emissiveTexture) {
  19293. material.emissiveTexture = loadTexture(rootUrl, parsedMaterial.emissiveTexture, scene);
  19294. }
  19295. if (parsedMaterial.lightmapTexture) {
  19296. material.lightmapTexture = loadTexture(rootUrl, parsedMaterial.lightmapTexture, scene);
  19297. material.lightmapThreshold = parsedMaterial.lightmapThreshold;
  19298. }
  19299. if (parsedMaterial.emissiveFresnelParameters) {
  19300. material.emissiveFresnelParameters = parseFresnelParameters(parsedMaterial.emissiveFresnelParameters);
  19301. }
  19302. if (parsedMaterial.specularTexture) {
  19303. material.specularTexture = loadTexture(rootUrl, parsedMaterial.specularTexture, scene);
  19304. }
  19305. if (parsedMaterial.bumpTexture) {
  19306. material.bumpTexture = loadTexture(rootUrl, parsedMaterial.bumpTexture, scene);
  19307. }
  19308. if (parsedMaterial.checkReadyOnlyOnce) {
  19309. material.checkReadyOnlyOnce = parsedMaterial.checkReadyOnlyOnce;
  19310. }
  19311. return material;
  19312. };
  19313. var parseMaterialById = function (id, parsedData, scene, rootUrl) {
  19314. for (var index = 0; index < parsedData.materials.length; index++) {
  19315. var parsedMaterial = parsedData.materials[index];
  19316. if (parsedMaterial.id === id) {
  19317. return parseMaterial(parsedMaterial, scene, rootUrl);
  19318. }
  19319. }
  19320. return null;
  19321. };
  19322. var parseMultiMaterial = function (parsedMultiMaterial, scene) {
  19323. var multiMaterial = new BABYLON.MultiMaterial(parsedMultiMaterial.name, scene);
  19324. multiMaterial.id = parsedMultiMaterial.id;
  19325. BABYLON.Tags.AddTagsTo(multiMaterial, parsedMultiMaterial.tags);
  19326. for (var matIndex = 0; matIndex < parsedMultiMaterial.materials.length; matIndex++) {
  19327. var subMatId = parsedMultiMaterial.materials[matIndex];
  19328. if (subMatId) {
  19329. multiMaterial.subMaterials.push(scene.getMaterialByID(subMatId));
  19330. }
  19331. else {
  19332. multiMaterial.subMaterials.push(null);
  19333. }
  19334. }
  19335. return multiMaterial;
  19336. };
  19337. var parseLensFlareSystem = function (parsedLensFlareSystem, scene, rootUrl) {
  19338. var emitter = scene.getLastEntryByID(parsedLensFlareSystem.emitterId);
  19339. var lensFlareSystem = new BABYLON.LensFlareSystem("lensFlareSystem#" + parsedLensFlareSystem.emitterId, emitter, scene);
  19340. lensFlareSystem.borderLimit = parsedLensFlareSystem.borderLimit;
  19341. for (var index = 0; index < parsedLensFlareSystem.flares.length; index++) {
  19342. var parsedFlare = parsedLensFlareSystem.flares[index];
  19343. var flare = new BABYLON.LensFlare(parsedFlare.size, parsedFlare.position, BABYLON.Color3.FromArray(parsedFlare.color), rootUrl + parsedFlare.textureName, lensFlareSystem);
  19344. }
  19345. return lensFlareSystem;
  19346. };
  19347. var parseParticleSystem = function (parsedParticleSystem, scene, rootUrl) {
  19348. var emitter = scene.getLastMeshByID(parsedParticleSystem.emitterId);
  19349. var particleSystem = new BABYLON.ParticleSystem("particles#" + emitter.name, parsedParticleSystem.capacity, scene);
  19350. if (parsedParticleSystem.textureName) {
  19351. particleSystem.particleTexture = new BABYLON.Texture(rootUrl + parsedParticleSystem.textureName, scene);
  19352. particleSystem.particleTexture.name = parsedParticleSystem.textureName;
  19353. }
  19354. particleSystem.minAngularSpeed = parsedParticleSystem.minAngularSpeed;
  19355. particleSystem.maxAngularSpeed = parsedParticleSystem.maxAngularSpeed;
  19356. particleSystem.minSize = parsedParticleSystem.minSize;
  19357. particleSystem.maxSize = parsedParticleSystem.maxSize;
  19358. particleSystem.minLifeTime = parsedParticleSystem.minLifeTime;
  19359. particleSystem.maxLifeTime = parsedParticleSystem.maxLifeTime;
  19360. particleSystem.emitter = emitter;
  19361. particleSystem.emitRate = parsedParticleSystem.emitRate;
  19362. particleSystem.minEmitBox = BABYLON.Vector3.FromArray(parsedParticleSystem.minEmitBox);
  19363. particleSystem.maxEmitBox = BABYLON.Vector3.FromArray(parsedParticleSystem.maxEmitBox);
  19364. particleSystem.gravity = BABYLON.Vector3.FromArray(parsedParticleSystem.gravity);
  19365. particleSystem.direction1 = BABYLON.Vector3.FromArray(parsedParticleSystem.direction1);
  19366. particleSystem.direction2 = BABYLON.Vector3.FromArray(parsedParticleSystem.direction2);
  19367. particleSystem.color1 = BABYLON.Color4.FromArray(parsedParticleSystem.color1);
  19368. particleSystem.color2 = BABYLON.Color4.FromArray(parsedParticleSystem.color2);
  19369. particleSystem.colorDead = BABYLON.Color4.FromArray(parsedParticleSystem.colorDead);
  19370. particleSystem.updateSpeed = parsedParticleSystem.updateSpeed;
  19371. particleSystem.targetStopDuration = parsedParticleSystem.targetStopFrame;
  19372. particleSystem.textureMask = BABYLON.Color4.FromArray(parsedParticleSystem.textureMask);
  19373. particleSystem.blendMode = parsedParticleSystem.blendMode;
  19374. particleSystem.start();
  19375. return particleSystem;
  19376. };
  19377. var parseShadowGenerator = function (parsedShadowGenerator, scene) {
  19378. var light = scene.getLightByID(parsedShadowGenerator.lightId);
  19379. var shadowGenerator = new BABYLON.ShadowGenerator(parsedShadowGenerator.mapSize, light);
  19380. for (var meshIndex = 0; meshIndex < parsedShadowGenerator.renderList.length; meshIndex++) {
  19381. var mesh = scene.getMeshByID(parsedShadowGenerator.renderList[meshIndex]);
  19382. shadowGenerator.getShadowMap().renderList.push(mesh);
  19383. }
  19384. if (parsedShadowGenerator.usePoissonSampling) {
  19385. shadowGenerator.usePoissonSampling = true;
  19386. }
  19387. else if (parsedShadowGenerator.useVarianceShadowMap) {
  19388. shadowGenerator.useVarianceShadowMap = true;
  19389. }
  19390. else if (parsedShadowGenerator.useBlurVarianceShadowMap) {
  19391. shadowGenerator.useBlurVarianceShadowMap = true;
  19392. if (parsedShadowGenerator.blurScale) {
  19393. shadowGenerator.blurScale = parsedShadowGenerator.blurScale;
  19394. }
  19395. if (parsedShadowGenerator.blurBoxOffset) {
  19396. shadowGenerator.blurBoxOffset = parsedShadowGenerator.blurBoxOffset;
  19397. }
  19398. }
  19399. if (parsedShadowGenerator.bias !== undefined) {
  19400. shadowGenerator.bias = parsedShadowGenerator.bias;
  19401. }
  19402. return shadowGenerator;
  19403. };
  19404. var parseAnimation = function (parsedAnimation) {
  19405. var animation = new BABYLON.Animation(parsedAnimation.name, parsedAnimation.property, parsedAnimation.framePerSecond, parsedAnimation.dataType, parsedAnimation.loopBehavior);
  19406. var dataType = parsedAnimation.dataType;
  19407. var keys = [];
  19408. for (var index = 0; index < parsedAnimation.keys.length; index++) {
  19409. var key = parsedAnimation.keys[index];
  19410. var data;
  19411. switch (dataType) {
  19412. case BABYLON.Animation.ANIMATIONTYPE_FLOAT:
  19413. data = key.values[0];
  19414. break;
  19415. case BABYLON.Animation.ANIMATIONTYPE_QUATERNION:
  19416. data = BABYLON.Quaternion.FromArray(key.values);
  19417. break;
  19418. case BABYLON.Animation.ANIMATIONTYPE_MATRIX:
  19419. data = BABYLON.Matrix.FromArray(key.values);
  19420. break;
  19421. case BABYLON.Animation.ANIMATIONTYPE_VECTOR3:
  19422. default:
  19423. data = BABYLON.Vector3.FromArray(key.values);
  19424. break;
  19425. }
  19426. keys.push({
  19427. frame: key.frame,
  19428. value: data
  19429. });
  19430. }
  19431. animation.setKeys(keys);
  19432. return animation;
  19433. };
  19434. var parseLight = function (parsedLight, scene) {
  19435. var light;
  19436. switch (parsedLight.type) {
  19437. case 0:
  19438. light = new BABYLON.PointLight(parsedLight.name, BABYLON.Vector3.FromArray(parsedLight.position), scene);
  19439. break;
  19440. case 1:
  19441. light = new BABYLON.DirectionalLight(parsedLight.name, BABYLON.Vector3.FromArray(parsedLight.direction), scene);
  19442. light.position = BABYLON.Vector3.FromArray(parsedLight.position);
  19443. break;
  19444. case 2:
  19445. light = new BABYLON.SpotLight(parsedLight.name, BABYLON.Vector3.FromArray(parsedLight.position), BABYLON.Vector3.FromArray(parsedLight.direction), parsedLight.angle, parsedLight.exponent, scene);
  19446. break;
  19447. case 3:
  19448. light = new BABYLON.HemisphericLight(parsedLight.name, BABYLON.Vector3.FromArray(parsedLight.direction), scene);
  19449. light.groundColor = BABYLON.Color3.FromArray(parsedLight.groundColor);
  19450. break;
  19451. }
  19452. light.id = parsedLight.id;
  19453. BABYLON.Tags.AddTagsTo(light, parsedLight.tags);
  19454. if (parsedLight.intensity !== undefined) {
  19455. light.intensity = parsedLight.intensity;
  19456. }
  19457. if (parsedLight.range) {
  19458. light.range = parsedLight.range;
  19459. }
  19460. light.diffuse = BABYLON.Color3.FromArray(parsedLight.diffuse);
  19461. light.specular = BABYLON.Color3.FromArray(parsedLight.specular);
  19462. if (parsedLight.excludedMeshesIds) {
  19463. light._excludedMeshesIds = parsedLight.excludedMeshesIds;
  19464. }
  19465. // Parent
  19466. if (parsedLight.parentId) {
  19467. light._waitingParentId = parsedLight.parentId;
  19468. }
  19469. if (parsedLight.includedOnlyMeshesIds) {
  19470. light._includedOnlyMeshesIds = parsedLight.includedOnlyMeshesIds;
  19471. }
  19472. // Animations
  19473. if (parsedLight.animations) {
  19474. for (var animationIndex = 0; animationIndex < parsedLight.animations.length; animationIndex++) {
  19475. var parsedAnimation = parsedLight.animations[animationIndex];
  19476. light.animations.push(parseAnimation(parsedAnimation));
  19477. }
  19478. }
  19479. if (parsedLight.autoAnimate) {
  19480. scene.beginAnimation(light, parsedLight.autoAnimateFrom, parsedLight.autoAnimateTo, parsedLight.autoAnimateLoop, 1.0);
  19481. }
  19482. };
  19483. var parseCamera = function (parsedCamera, scene) {
  19484. var camera;
  19485. var position = BABYLON.Vector3.FromArray(parsedCamera.position);
  19486. var lockedTargetMesh = (parsedCamera.lockedTargetId) ? scene.getLastMeshByID(parsedCamera.lockedTargetId) : null;
  19487. if (parsedCamera.type === "AnaglyphArcRotateCamera" || parsedCamera.type === "ArcRotateCamera") {
  19488. var alpha = parsedCamera.alpha;
  19489. var beta = parsedCamera.beta;
  19490. var radius = parsedCamera.radius;
  19491. if (parsedCamera.type === "AnaglyphArcRotateCamera") {
  19492. var interaxial_distance = parsedCamera.interaxial_distance;
  19493. camera = new BABYLON.AnaglyphArcRotateCamera(parsedCamera.name, alpha, beta, radius, lockedTargetMesh, interaxial_distance, scene);
  19494. }
  19495. else {
  19496. camera = new BABYLON.ArcRotateCamera(parsedCamera.name, alpha, beta, radius, lockedTargetMesh, scene);
  19497. }
  19498. }
  19499. else if (parsedCamera.type === "AnaglyphFreeCamera") {
  19500. interaxial_distance = parsedCamera.interaxial_distance;
  19501. camera = new BABYLON.AnaglyphFreeCamera(parsedCamera.name, position, interaxial_distance, scene);
  19502. }
  19503. else if (parsedCamera.type === "DeviceOrientationCamera") {
  19504. camera = new BABYLON.DeviceOrientationCamera(parsedCamera.name, position, scene);
  19505. }
  19506. else if (parsedCamera.type === "FollowCamera") {
  19507. camera = new BABYLON.FollowCamera(parsedCamera.name, position, scene);
  19508. camera.heightOffset = parsedCamera.heightOffset;
  19509. camera.radius = parsedCamera.radius;
  19510. camera.rotationOffset = parsedCamera.rotationOffset;
  19511. if (lockedTargetMesh)
  19512. camera.target = lockedTargetMesh;
  19513. }
  19514. else if (parsedCamera.type === "GamepadCamera") {
  19515. camera = new BABYLON.GamepadCamera(parsedCamera.name, position, scene);
  19516. }
  19517. else if (parsedCamera.type === "TouchCamera") {
  19518. camera = new BABYLON.TouchCamera(parsedCamera.name, position, scene);
  19519. }
  19520. else if (parsedCamera.type === "VirtualJoysticksCamera") {
  19521. camera = new BABYLON.VirtualJoysticksCamera(parsedCamera.name, position, scene);
  19522. }
  19523. else if (parsedCamera.type === "WebVRFreeCamera") {
  19524. camera = new BABYLON.WebVRFreeCamera(parsedCamera.name, position, scene);
  19525. }
  19526. else if (parsedCamera.type === "VRDeviceOrientationFreeCamera") {
  19527. camera = new BABYLON.VRDeviceOrientationFreeCamera(parsedCamera.name, position, scene);
  19528. }
  19529. else {
  19530. // Free Camera is the default value
  19531. camera = new BABYLON.FreeCamera(parsedCamera.name, position, scene);
  19532. }
  19533. // apply 3d rig, when found
  19534. if (parsedCamera.cameraRigMode) {
  19535. var rigParams = (parsedCamera.interaxial_distance) ? { interaxialDistance: parsedCamera.interaxial_distance } : {};
  19536. camera.setCameraRigMode(parsedCamera.cameraRigMode, rigParams);
  19537. }
  19538. // Test for lockedTargetMesh & FreeCamera outside of if-else-if nest, since things like GamepadCamera extend FreeCamera
  19539. if (lockedTargetMesh && camera instanceof BABYLON.FreeCamera) {
  19540. camera.lockedTarget = lockedTargetMesh;
  19541. }
  19542. camera.id = parsedCamera.id;
  19543. BABYLON.Tags.AddTagsTo(camera, parsedCamera.tags);
  19544. // Parent
  19545. if (parsedCamera.parentId) {
  19546. camera._waitingParentId = parsedCamera.parentId;
  19547. }
  19548. // Target
  19549. if (parsedCamera.target) {
  19550. if (camera.setTarget) {
  19551. camera.setTarget(BABYLON.Vector3.FromArray(parsedCamera.target));
  19552. }
  19553. else {
  19554. //For ArcRotate
  19555. camera.target = BABYLON.Vector3.FromArray(parsedCamera.target);
  19556. }
  19557. }
  19558. else {
  19559. camera.rotation = BABYLON.Vector3.FromArray(parsedCamera.rotation);
  19560. }
  19561. camera.fov = parsedCamera.fov;
  19562. camera.minZ = parsedCamera.minZ;
  19563. camera.maxZ = parsedCamera.maxZ;
  19564. camera.speed = parsedCamera.speed;
  19565. camera.inertia = parsedCamera.inertia;
  19566. camera.checkCollisions = parsedCamera.checkCollisions;
  19567. camera.applyGravity = parsedCamera.applyGravity;
  19568. if (parsedCamera.ellipsoid) {
  19569. camera.ellipsoid = BABYLON.Vector3.FromArray(parsedCamera.ellipsoid);
  19570. }
  19571. // Animations
  19572. if (parsedCamera.animations) {
  19573. for (var animationIndex = 0; animationIndex < parsedCamera.animations.length; animationIndex++) {
  19574. var parsedAnimation = parsedCamera.animations[animationIndex];
  19575. camera.animations.push(parseAnimation(parsedAnimation));
  19576. }
  19577. }
  19578. if (parsedCamera.autoAnimate) {
  19579. scene.beginAnimation(camera, parsedCamera.autoAnimateFrom, parsedCamera.autoAnimateTo, parsedCamera.autoAnimateLoop, 1.0);
  19580. }
  19581. // Layer Mask
  19582. if (parsedCamera.layerMask && (!isNaN(parsedCamera.layerMask))) {
  19583. camera.layerMask = Math.abs(parseInt(parsedCamera.layerMask));
  19584. }
  19585. else {
  19586. camera.layerMask = 0x0FFFFFFF;
  19587. }
  19588. return camera;
  19589. };
  19590. var parseGeometry = function (parsedGeometry, scene) {
  19591. var id = parsedGeometry.id;
  19592. return scene.getGeometryByID(id);
  19593. };
  19594. var parseBox = function (parsedBox, scene) {
  19595. if (parseGeometry(parsedBox, scene)) {
  19596. return null; // null since geometry could be something else than a box...
  19597. }
  19598. var box = new BABYLON.Geometry.Primitives.Box(parsedBox.id, scene, parsedBox.size, parsedBox.canBeRegenerated, null);
  19599. BABYLON.Tags.AddTagsTo(box, parsedBox.tags);
  19600. scene.pushGeometry(box, true);
  19601. return box;
  19602. };
  19603. var parseSphere = function (parsedSphere, scene) {
  19604. if (parseGeometry(parsedSphere, scene)) {
  19605. return null; // null since geometry could be something else than a sphere...
  19606. }
  19607. var sphere = new BABYLON.Geometry.Primitives.Sphere(parsedSphere.id, scene, parsedSphere.segments, parsedSphere.diameter, parsedSphere.canBeRegenerated, null);
  19608. BABYLON.Tags.AddTagsTo(sphere, parsedSphere.tags);
  19609. scene.pushGeometry(sphere, true);
  19610. return sphere;
  19611. };
  19612. var parseCylinder = function (parsedCylinder, scene) {
  19613. if (parseGeometry(parsedCylinder, scene)) {
  19614. return null; // null since geometry could be something else than a cylinder...
  19615. }
  19616. var cylinder = new BABYLON.Geometry.Primitives.Cylinder(parsedCylinder.id, scene, parsedCylinder.height, parsedCylinder.diameterTop, parsedCylinder.diameterBottom, parsedCylinder.tessellation, parsedCylinder.subdivisions, parsedCylinder.canBeRegenerated, null);
  19617. BABYLON.Tags.AddTagsTo(cylinder, parsedCylinder.tags);
  19618. scene.pushGeometry(cylinder, true);
  19619. return cylinder;
  19620. };
  19621. var parseTorus = function (parsedTorus, scene) {
  19622. if (parseGeometry(parsedTorus, scene)) {
  19623. return null; // null since geometry could be something else than a torus...
  19624. }
  19625. var torus = new BABYLON.Geometry.Primitives.Torus(parsedTorus.id, scene, parsedTorus.diameter, parsedTorus.thickness, parsedTorus.tessellation, parsedTorus.canBeRegenerated, null);
  19626. BABYLON.Tags.AddTagsTo(torus, parsedTorus.tags);
  19627. scene.pushGeometry(torus, true);
  19628. return torus;
  19629. };
  19630. var parseGround = function (parsedGround, scene) {
  19631. if (parseGeometry(parsedGround, scene)) {
  19632. return null; // null since geometry could be something else than a ground...
  19633. }
  19634. var ground = new BABYLON.Geometry.Primitives.Ground(parsedGround.id, scene, parsedGround.width, parsedGround.height, parsedGround.subdivisions, parsedGround.canBeRegenerated, null);
  19635. BABYLON.Tags.AddTagsTo(ground, parsedGround.tags);
  19636. scene.pushGeometry(ground, true);
  19637. return ground;
  19638. };
  19639. var parsePlane = function (parsedPlane, scene) {
  19640. if (parseGeometry(parsedPlane, scene)) {
  19641. return null; // null since geometry could be something else than a plane...
  19642. }
  19643. var plane = new BABYLON.Geometry.Primitives.Plane(parsedPlane.id, scene, parsedPlane.size, parsedPlane.canBeRegenerated, null);
  19644. BABYLON.Tags.AddTagsTo(plane, parsedPlane.tags);
  19645. scene.pushGeometry(plane, true);
  19646. return plane;
  19647. };
  19648. var parseTorusKnot = function (parsedTorusKnot, scene) {
  19649. if (parseGeometry(parsedTorusKnot, scene)) {
  19650. return null; // null since geometry could be something else than a torusKnot...
  19651. }
  19652. var torusKnot = new BABYLON.Geometry.Primitives.TorusKnot(parsedTorusKnot.id, scene, parsedTorusKnot.radius, parsedTorusKnot.tube, parsedTorusKnot.radialSegments, parsedTorusKnot.tubularSegments, parsedTorusKnot.p, parsedTorusKnot.q, parsedTorusKnot.canBeRegenerated, null);
  19653. BABYLON.Tags.AddTagsTo(torusKnot, parsedTorusKnot.tags);
  19654. scene.pushGeometry(torusKnot, true);
  19655. return torusKnot;
  19656. };
  19657. var parseVertexData = function (parsedVertexData, scene, rootUrl) {
  19658. if (parseGeometry(parsedVertexData, scene)) {
  19659. return null; // null since geometry could be a primitive
  19660. }
  19661. var geometry = new BABYLON.Geometry(parsedVertexData.id, scene);
  19662. BABYLON.Tags.AddTagsTo(geometry, parsedVertexData.tags);
  19663. if (parsedVertexData.delayLoadingFile) {
  19664. geometry.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NOTLOADED;
  19665. geometry.delayLoadingFile = rootUrl + parsedVertexData.delayLoadingFile;
  19666. geometry._boundingInfo = new BABYLON.BoundingInfo(BABYLON.Vector3.FromArray(parsedVertexData.boundingBoxMinimum), BABYLON.Vector3.FromArray(parsedVertexData.boundingBoxMaximum));
  19667. geometry._delayInfo = [];
  19668. if (parsedVertexData.hasUVs) {
  19669. geometry._delayInfo.push(BABYLON.VertexBuffer.UVKind);
  19670. }
  19671. if (parsedVertexData.hasUVs2) {
  19672. geometry._delayInfo.push(BABYLON.VertexBuffer.UV2Kind);
  19673. }
  19674. if (parsedVertexData.hasUVs3) {
  19675. geometry._delayInfo.push(BABYLON.VertexBuffer.UV3Kind);
  19676. }
  19677. if (parsedVertexData.hasUVs4) {
  19678. geometry._delayInfo.push(BABYLON.VertexBuffer.UV4Kind);
  19679. }
  19680. if (parsedVertexData.hasUVs5) {
  19681. geometry._delayInfo.push(BABYLON.VertexBuffer.UV5Kind);
  19682. }
  19683. if (parsedVertexData.hasUVs6) {
  19684. geometry._delayInfo.push(BABYLON.VertexBuffer.UV6Kind);
  19685. }
  19686. if (parsedVertexData.hasColors) {
  19687. geometry._delayInfo.push(BABYLON.VertexBuffer.ColorKind);
  19688. }
  19689. if (parsedVertexData.hasMatricesIndices) {
  19690. geometry._delayInfo.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  19691. }
  19692. if (parsedVertexData.hasMatricesWeights) {
  19693. geometry._delayInfo.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  19694. }
  19695. geometry._delayLoadingFunction = importVertexData;
  19696. }
  19697. else {
  19698. importVertexData(parsedVertexData, geometry);
  19699. }
  19700. scene.pushGeometry(geometry, true);
  19701. return geometry;
  19702. };
  19703. var parseMesh = function (parsedMesh, scene, rootUrl) {
  19704. var mesh = new BABYLON.Mesh(parsedMesh.name, scene);
  19705. mesh.id = parsedMesh.id;
  19706. BABYLON.Tags.AddTagsTo(mesh, parsedMesh.tags);
  19707. mesh.position = BABYLON.Vector3.FromArray(parsedMesh.position);
  19708. if (parsedMesh.rotationQuaternion) {
  19709. mesh.rotationQuaternion = BABYLON.Quaternion.FromArray(parsedMesh.rotationQuaternion);
  19710. }
  19711. else if (parsedMesh.rotation) {
  19712. mesh.rotation = BABYLON.Vector3.FromArray(parsedMesh.rotation);
  19713. }
  19714. mesh.scaling = BABYLON.Vector3.FromArray(parsedMesh.scaling);
  19715. if (parsedMesh.localMatrix) {
  19716. mesh.setPivotMatrix(BABYLON.Matrix.FromArray(parsedMesh.localMatrix));
  19717. }
  19718. else if (parsedMesh.pivotMatrix) {
  19719. mesh.setPivotMatrix(BABYLON.Matrix.FromArray(parsedMesh.pivotMatrix));
  19720. }
  19721. mesh.setEnabled(parsedMesh.isEnabled);
  19722. mesh.isVisible = parsedMesh.isVisible;
  19723. mesh.infiniteDistance = parsedMesh.infiniteDistance;
  19724. mesh.showBoundingBox = parsedMesh.showBoundingBox;
  19725. mesh.showSubMeshesBoundingBox = parsedMesh.showSubMeshesBoundingBox;
  19726. if (parsedMesh.applyFog !== undefined) {
  19727. mesh.applyFog = parsedMesh.applyFog;
  19728. }
  19729. if (parsedMesh.pickable !== undefined) {
  19730. mesh.isPickable = parsedMesh.pickable;
  19731. }
  19732. if (parsedMesh.alphaIndex !== undefined) {
  19733. mesh.alphaIndex = parsedMesh.alphaIndex;
  19734. }
  19735. mesh.receiveShadows = parsedMesh.receiveShadows;
  19736. mesh.billboardMode = parsedMesh.billboardMode;
  19737. if (parsedMesh.visibility !== undefined) {
  19738. mesh.visibility = parsedMesh.visibility;
  19739. }
  19740. mesh.checkCollisions = parsedMesh.checkCollisions;
  19741. mesh._shouldGenerateFlatShading = parsedMesh.useFlatShading;
  19742. // freezeWorldMatrix
  19743. if (parsedMesh.freezeWorldMatrix) {
  19744. mesh._waitingFreezeWorldMatrix = parsedMesh.freezeWorldMatrix;
  19745. }
  19746. // Parent
  19747. if (parsedMesh.parentId) {
  19748. mesh._waitingParentId = parsedMesh.parentId;
  19749. }
  19750. // Actions
  19751. if (parsedMesh.actions !== undefined) {
  19752. mesh._waitingActions = parsedMesh.actions;
  19753. }
  19754. // Geometry
  19755. mesh.hasVertexAlpha = parsedMesh.hasVertexAlpha;
  19756. if (parsedMesh.delayLoadingFile) {
  19757. mesh.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NOTLOADED;
  19758. mesh.delayLoadingFile = rootUrl + parsedMesh.delayLoadingFile;
  19759. mesh._boundingInfo = new BABYLON.BoundingInfo(BABYLON.Vector3.FromArray(parsedMesh.boundingBoxMinimum), BABYLON.Vector3.FromArray(parsedMesh.boundingBoxMaximum));
  19760. if (parsedMesh._binaryInfo) {
  19761. mesh._binaryInfo = parsedMesh._binaryInfo;
  19762. }
  19763. mesh._delayInfo = [];
  19764. if (parsedMesh.hasUVs) {
  19765. mesh._delayInfo.push(BABYLON.VertexBuffer.UVKind);
  19766. }
  19767. if (parsedMesh.hasUVs2) {
  19768. mesh._delayInfo.push(BABYLON.VertexBuffer.UV2Kind);
  19769. }
  19770. if (parsedMesh.hasUVs3) {
  19771. mesh._delayInfo.push(BABYLON.VertexBuffer.UV3Kind);
  19772. }
  19773. if (parsedMesh.hasUVs4) {
  19774. mesh._delayInfo.push(BABYLON.VertexBuffer.UV4Kind);
  19775. }
  19776. if (parsedMesh.hasUVs5) {
  19777. mesh._delayInfo.push(BABYLON.VertexBuffer.UV5Kind);
  19778. }
  19779. if (parsedMesh.hasUVs6) {
  19780. mesh._delayInfo.push(BABYLON.VertexBuffer.UV6Kind);
  19781. }
  19782. if (parsedMesh.hasColors) {
  19783. mesh._delayInfo.push(BABYLON.VertexBuffer.ColorKind);
  19784. }
  19785. if (parsedMesh.hasMatricesIndices) {
  19786. mesh._delayInfo.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  19787. }
  19788. if (parsedMesh.hasMatricesWeights) {
  19789. mesh._delayInfo.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  19790. }
  19791. mesh._delayLoadingFunction = importGeometry;
  19792. if (BABYLON.SceneLoader.ForceFullSceneLoadingForIncremental) {
  19793. mesh._checkDelayState();
  19794. }
  19795. }
  19796. else {
  19797. importGeometry(parsedMesh, mesh);
  19798. }
  19799. // Material
  19800. if (parsedMesh.materialId) {
  19801. mesh.setMaterialByID(parsedMesh.materialId);
  19802. }
  19803. else {
  19804. mesh.material = null;
  19805. }
  19806. // Skeleton
  19807. if (parsedMesh.skeletonId > -1) {
  19808. mesh.skeleton = scene.getLastSkeletonByID(parsedMesh.skeletonId);
  19809. }
  19810. // Physics
  19811. if (parsedMesh.physicsImpostor) {
  19812. if (!scene.isPhysicsEnabled()) {
  19813. scene.enablePhysics();
  19814. }
  19815. mesh.setPhysicsState({ impostor: parsedMesh.physicsImpostor, mass: parsedMesh.physicsMass, friction: parsedMesh.physicsFriction, restitution: parsedMesh.physicsRestitution });
  19816. }
  19817. // Animations
  19818. if (parsedMesh.animations) {
  19819. for (var animationIndex = 0; animationIndex < parsedMesh.animations.length; animationIndex++) {
  19820. var parsedAnimation = parsedMesh.animations[animationIndex];
  19821. mesh.animations.push(parseAnimation(parsedAnimation));
  19822. }
  19823. }
  19824. if (parsedMesh.autoAnimate) {
  19825. scene.beginAnimation(mesh, parsedMesh.autoAnimateFrom, parsedMesh.autoAnimateTo, parsedMesh.autoAnimateLoop, 1.0);
  19826. }
  19827. // Layer Mask
  19828. if (parsedMesh.layerMask && (!isNaN(parsedMesh.layerMask))) {
  19829. mesh.layerMask = Math.abs(parseInt(parsedMesh.layerMask));
  19830. }
  19831. else {
  19832. mesh.layerMask = 0x0FFFFFFF;
  19833. }
  19834. // Instances
  19835. if (parsedMesh.instances) {
  19836. for (var index = 0; index < parsedMesh.instances.length; index++) {
  19837. var parsedInstance = parsedMesh.instances[index];
  19838. var instance = mesh.createInstance(parsedInstance.name);
  19839. BABYLON.Tags.AddTagsTo(instance, parsedInstance.tags);
  19840. instance.position = BABYLON.Vector3.FromArray(parsedInstance.position);
  19841. if (parsedInstance.rotationQuaternion) {
  19842. instance.rotationQuaternion = BABYLON.Quaternion.FromArray(parsedInstance.rotationQuaternion);
  19843. }
  19844. else if (parsedInstance.rotation) {
  19845. instance.rotation = BABYLON.Vector3.FromArray(parsedInstance.rotation);
  19846. }
  19847. instance.scaling = BABYLON.Vector3.FromArray(parsedInstance.scaling);
  19848. instance.checkCollisions = mesh.checkCollisions;
  19849. if (parsedMesh.animations) {
  19850. for (animationIndex = 0; animationIndex < parsedMesh.animations.length; animationIndex++) {
  19851. parsedAnimation = parsedMesh.animations[animationIndex];
  19852. instance.animations.push(parseAnimation(parsedAnimation));
  19853. }
  19854. }
  19855. }
  19856. }
  19857. return mesh;
  19858. };
  19859. var parseActions = function (parsedActions, object, scene) {
  19860. var actionManager = new BABYLON.ActionManager(scene);
  19861. if (object === null)
  19862. scene.actionManager = actionManager;
  19863. else
  19864. object.actionManager = actionManager;
  19865. // instanciate a new object
  19866. var instanciate = function (name, params) {
  19867. var newInstance = Object.create(BABYLON[name].prototype);
  19868. newInstance.constructor.apply(newInstance, params);
  19869. return newInstance;
  19870. };
  19871. var parseParameter = function (name, value, target, propertyPath) {
  19872. if (propertyPath === null) {
  19873. // String, boolean or float
  19874. var floatValue = parseFloat(value);
  19875. if (value === "true" || value === "false")
  19876. return value === "true";
  19877. else
  19878. return isNaN(floatValue) ? value : floatValue;
  19879. }
  19880. var effectiveTarget = propertyPath.split(".");
  19881. var values = value.split(",");
  19882. // Get effective Target
  19883. for (var i = 0; i < effectiveTarget.length; i++) {
  19884. target = target[effectiveTarget[i]];
  19885. }
  19886. // Return appropriate value with its type
  19887. if (typeof (target) === "boolean")
  19888. return values[0] === "true";
  19889. if (typeof (target) === "string")
  19890. return values[0];
  19891. // Parameters with multiple values such as Vector3 etc.
  19892. var split = new Array();
  19893. for (var i = 0; i < values.length; i++)
  19894. split.push(parseFloat(values[i]));
  19895. if (target instanceof BABYLON.Vector3)
  19896. return BABYLON.Vector3.FromArray(split);
  19897. if (target instanceof BABYLON.Vector4)
  19898. return BABYLON.Vector4.FromArray(split);
  19899. if (target instanceof BABYLON.Color3)
  19900. return BABYLON.Color3.FromArray(split);
  19901. if (target instanceof BABYLON.Color4)
  19902. return BABYLON.Color4.FromArray(split);
  19903. return parseFloat(values[0]);
  19904. };
  19905. // traverse graph per trigger
  19906. var traverse = function (parsedAction, trigger, condition, action, combineArray) {
  19907. if (combineArray === void 0) { combineArray = null; }
  19908. if (parsedAction.detached)
  19909. return;
  19910. var parameters = new Array();
  19911. var target = null;
  19912. var propertyPath = null;
  19913. var combine = parsedAction.combine && parsedAction.combine.length > 0;
  19914. // Parameters
  19915. if (parsedAction.type === 2)
  19916. parameters.push(actionManager);
  19917. else
  19918. parameters.push(trigger);
  19919. if (combine) {
  19920. var actions = new Array();
  19921. for (var j = 0; j < parsedAction.combine.length; j++) {
  19922. traverse(parsedAction.combine[j], BABYLON.ActionManager.NothingTrigger, condition, action, actions);
  19923. }
  19924. parameters.push(actions);
  19925. }
  19926. else {
  19927. for (var i = 0; i < parsedAction.properties.length; i++) {
  19928. var value = parsedAction.properties[i].value;
  19929. var name = parsedAction.properties[i].name;
  19930. var targetType = parsedAction.properties[i].targetType;
  19931. if (name === "target")
  19932. if (targetType !== null && targetType === "SceneProperties")
  19933. value = target = scene;
  19934. else
  19935. value = target = scene.getNodeByName(value);
  19936. else if (name === "parent")
  19937. value = scene.getNodeByName(value);
  19938. else if (name === "sound")
  19939. value = scene.getSoundByName(value);
  19940. else if (name !== "propertyPath") {
  19941. if (parsedAction.type === 2 && name === "operator")
  19942. value = BABYLON.ValueCondition[value];
  19943. else
  19944. value = parseParameter(name, value, target, name === "value" ? propertyPath : null);
  19945. }
  19946. else {
  19947. propertyPath = value;
  19948. }
  19949. parameters.push(value);
  19950. }
  19951. }
  19952. if (combineArray === null) {
  19953. parameters.push(condition);
  19954. }
  19955. else {
  19956. parameters.push(null);
  19957. }
  19958. // If interpolate value action
  19959. if (parsedAction.name === "InterpolateValueAction") {
  19960. var param = parameters[parameters.length - 2];
  19961. parameters[parameters.length - 1] = param;
  19962. parameters[parameters.length - 2] = condition;
  19963. }
  19964. // Action or condition(s) and not CombineAction
  19965. var newAction = instanciate(parsedAction.name, parameters);
  19966. if (newAction instanceof BABYLON.Condition && condition !== null) {
  19967. var nothing = new BABYLON.DoNothingAction(trigger, condition);
  19968. if (action)
  19969. action.then(nothing);
  19970. else
  19971. actionManager.registerAction(nothing);
  19972. action = nothing;
  19973. }
  19974. if (combineArray === null) {
  19975. if (newAction instanceof BABYLON.Condition) {
  19976. condition = newAction;
  19977. newAction = action;
  19978. }
  19979. else {
  19980. condition = null;
  19981. if (action)
  19982. action.then(newAction);
  19983. else
  19984. actionManager.registerAction(newAction);
  19985. }
  19986. }
  19987. else {
  19988. combineArray.push(newAction);
  19989. }
  19990. for (var i = 0; i < parsedAction.children.length; i++)
  19991. traverse(parsedAction.children[i], trigger, condition, newAction, null);
  19992. };
  19993. // triggers
  19994. for (var i = 0; i < parsedActions.children.length; i++) {
  19995. var triggerParams;
  19996. var trigger = parsedActions.children[i];
  19997. if (trigger.properties.length > 0) {
  19998. var param = trigger.properties[0].value;
  19999. var value = trigger.properties[0].targetType === null ? param : scene.getMeshByName(param);
  20000. triggerParams = { trigger: BABYLON.ActionManager[trigger.name], parameter: value };
  20001. }
  20002. else
  20003. triggerParams = BABYLON.ActionManager[trigger.name];
  20004. for (var j = 0; j < trigger.children.length; j++) {
  20005. if (!trigger.detached)
  20006. traverse(trigger.children[j], triggerParams, null, null);
  20007. }
  20008. }
  20009. };
  20010. var parseSound = function (parsedSound, scene, rootUrl) {
  20011. var soundName = parsedSound.name;
  20012. var soundUrl = rootUrl + soundName;
  20013. var options = {
  20014. autoplay: parsedSound.autoplay, loop: parsedSound.loop, volume: parsedSound.volume,
  20015. spatialSound: parsedSound.spatialSound, maxDistance: parsedSound.maxDistance,
  20016. rolloffFactor: parsedSound.rolloffFactor,
  20017. refDistance: parsedSound.refDistance,
  20018. distanceModel: parsedSound.distanceModel,
  20019. playbackRate: parsedSound.playbackRate
  20020. };
  20021. var newSound = new BABYLON.Sound(soundName, soundUrl, scene, function () { scene._removePendingData(newSound); }, options);
  20022. scene._addPendingData(newSound);
  20023. if (parsedSound.position) {
  20024. var soundPosition = BABYLON.Vector3.FromArray(parsedSound.position);
  20025. newSound.setPosition(soundPosition);
  20026. }
  20027. if (parsedSound.isDirectional) {
  20028. newSound.setDirectionalCone(parsedSound.coneInnerAngle || 360, parsedSound.coneOuterAngle || 360, parsedSound.coneOuterGain || 0);
  20029. if (parsedSound.localDirectionToMesh) {
  20030. var localDirectionToMesh = BABYLON.Vector3.FromArray(parsedSound.localDirectionToMesh);
  20031. newSound.setLocalDirectionToMesh(localDirectionToMesh);
  20032. }
  20033. }
  20034. if (parsedSound.connectedMeshId) {
  20035. var connectedMesh = scene.getMeshByID(parsedSound.connectedMeshId);
  20036. if (connectedMesh) {
  20037. newSound.attachToMesh(connectedMesh);
  20038. }
  20039. }
  20040. };
  20041. var isDescendantOf = function (mesh, names, hierarchyIds) {
  20042. names = (names instanceof Array) ? names : [names];
  20043. for (var i in names) {
  20044. if (mesh.name === names[i]) {
  20045. hierarchyIds.push(mesh.id);
  20046. return true;
  20047. }
  20048. }
  20049. if (mesh.parentId && hierarchyIds.indexOf(mesh.parentId) !== -1) {
  20050. hierarchyIds.push(mesh.id);
  20051. return true;
  20052. }
  20053. return false;
  20054. };
  20055. var importVertexData = function (parsedVertexData, geometry) {
  20056. var vertexData = new BABYLON.VertexData();
  20057. // positions
  20058. var positions = parsedVertexData.positions;
  20059. if (positions) {
  20060. vertexData.set(positions, BABYLON.VertexBuffer.PositionKind);
  20061. }
  20062. // normals
  20063. var normals = parsedVertexData.normals;
  20064. if (normals) {
  20065. vertexData.set(normals, BABYLON.VertexBuffer.NormalKind);
  20066. }
  20067. // uvs
  20068. var uvs = parsedVertexData.uvs;
  20069. if (uvs) {
  20070. vertexData.set(uvs, BABYLON.VertexBuffer.UVKind);
  20071. }
  20072. // uv2s
  20073. var uv2s = parsedVertexData.uv2s;
  20074. if (uv2s) {
  20075. vertexData.set(uv2s, BABYLON.VertexBuffer.UV2Kind);
  20076. }
  20077. // uv3s
  20078. var uv3s = parsedVertexData.uv3s;
  20079. if (uv3s) {
  20080. vertexData.set(uv3s, BABYLON.VertexBuffer.UV3Kind);
  20081. }
  20082. // uv4s
  20083. var uv4s = parsedVertexData.uv4s;
  20084. if (uv4s) {
  20085. vertexData.set(uv4s, BABYLON.VertexBuffer.UV4Kind);
  20086. }
  20087. // uv5s
  20088. var uv5s = parsedVertexData.uv5s;
  20089. if (uv5s) {
  20090. vertexData.set(uv5s, BABYLON.VertexBuffer.UV5Kind);
  20091. }
  20092. // uv6s
  20093. var uv6s = parsedVertexData.uv6s;
  20094. if (uv6s) {
  20095. vertexData.set(uv6s, BABYLON.VertexBuffer.UV6Kind);
  20096. }
  20097. // colors
  20098. var colors = parsedVertexData.colors;
  20099. if (colors) {
  20100. vertexData.set(checkColors4(colors, positions.length / 3), BABYLON.VertexBuffer.ColorKind);
  20101. }
  20102. // matricesIndices
  20103. var matricesIndices = parsedVertexData.matricesIndices;
  20104. if (matricesIndices) {
  20105. vertexData.set(matricesIndices, BABYLON.VertexBuffer.MatricesIndicesKind);
  20106. }
  20107. // matricesWeights
  20108. var matricesWeights = parsedVertexData.matricesWeights;
  20109. if (matricesWeights) {
  20110. vertexData.set(matricesWeights, BABYLON.VertexBuffer.MatricesWeightsKind);
  20111. }
  20112. // indices
  20113. var indices = parsedVertexData.indices;
  20114. if (indices) {
  20115. vertexData.indices = indices;
  20116. }
  20117. geometry.setAllVerticesData(vertexData, parsedVertexData.updatable);
  20118. };
  20119. var importGeometry = function (parsedGeometry, mesh) {
  20120. var scene = mesh.getScene();
  20121. // Geometry
  20122. var geometryId = parsedGeometry.geometryId;
  20123. if (geometryId) {
  20124. var geometry = scene.getGeometryByID(geometryId);
  20125. if (geometry) {
  20126. geometry.applyToMesh(mesh);
  20127. }
  20128. }
  20129. else if (parsedGeometry instanceof ArrayBuffer) {
  20130. var binaryInfo = mesh._binaryInfo;
  20131. if (binaryInfo.positionsAttrDesc && binaryInfo.positionsAttrDesc.count > 0) {
  20132. var positionsData = new Float32Array(parsedGeometry, binaryInfo.positionsAttrDesc.offset, binaryInfo.positionsAttrDesc.count);
  20133. mesh.setVerticesData(BABYLON.VertexBuffer.PositionKind, positionsData, false);
  20134. }
  20135. if (binaryInfo.normalsAttrDesc && binaryInfo.normalsAttrDesc.count > 0) {
  20136. var normalsData = new Float32Array(parsedGeometry, binaryInfo.normalsAttrDesc.offset, binaryInfo.normalsAttrDesc.count);
  20137. mesh.setVerticesData(BABYLON.VertexBuffer.NormalKind, normalsData, false);
  20138. }
  20139. if (binaryInfo.uvsAttrDesc && binaryInfo.uvsAttrDesc.count > 0) {
  20140. var uvsData = new Float32Array(parsedGeometry, binaryInfo.uvsAttrDesc.offset, binaryInfo.uvsAttrDesc.count);
  20141. mesh.setVerticesData(BABYLON.VertexBuffer.UVKind, uvsData, false);
  20142. }
  20143. if (binaryInfo.uvs2AttrDesc && binaryInfo.uvs2AttrDesc.count > 0) {
  20144. var uvs2Data = new Float32Array(parsedGeometry, binaryInfo.uvs2AttrDesc.offset, binaryInfo.uvs2AttrDesc.count);
  20145. mesh.setVerticesData(BABYLON.VertexBuffer.UV2Kind, uvs2Data, false);
  20146. }
  20147. if (binaryInfo.uvs3AttrDesc && binaryInfo.uvs3AttrDesc.count > 0) {
  20148. var uvs3Data = new Float32Array(parsedGeometry, binaryInfo.uvs3AttrDesc.offset, binaryInfo.uvs3AttrDesc.count);
  20149. mesh.setVerticesData(BABYLON.VertexBuffer.UV3Kind, uvs3Data, false);
  20150. }
  20151. if (binaryInfo.uvs4AttrDesc && binaryInfo.uvs4AttrDesc.count > 0) {
  20152. var uvs4Data = new Float32Array(parsedGeometry, binaryInfo.uvs4AttrDesc.offset, binaryInfo.uvs4AttrDesc.count);
  20153. mesh.setVerticesData(BABYLON.VertexBuffer.UV4Kind, uvs4Data, false);
  20154. }
  20155. if (binaryInfo.uvs5AttrDesc && binaryInfo.uvs5AttrDesc.count > 0) {
  20156. var uvs5Data = new Float32Array(parsedGeometry, binaryInfo.uvs5AttrDesc.offset, binaryInfo.uvs5AttrDesc.count);
  20157. mesh.setVerticesData(BABYLON.VertexBuffer.UV5Kind, uvs5Data, false);
  20158. }
  20159. if (binaryInfo.uvs6AttrDesc && binaryInfo.uvs6AttrDesc.count > 0) {
  20160. var uvs6Data = new Float32Array(parsedGeometry, binaryInfo.uvs6AttrDesc.offset, binaryInfo.uvs6AttrDesc.count);
  20161. mesh.setVerticesData(BABYLON.VertexBuffer.UV6Kind, uvs6Data, false);
  20162. }
  20163. if (binaryInfo.colorsAttrDesc && binaryInfo.colorsAttrDesc.count > 0) {
  20164. var colorsData = new Float32Array(parsedGeometry, binaryInfo.colorsAttrDesc.offset, binaryInfo.colorsAttrDesc.count);
  20165. mesh.setVerticesData(BABYLON.VertexBuffer.ColorKind, colorsData, false, binaryInfo.colorsAttrDesc.stride);
  20166. }
  20167. if (binaryInfo.matricesIndicesAttrDesc && binaryInfo.matricesIndicesAttrDesc.count > 0) {
  20168. var matricesIndicesData = new Int32Array(parsedGeometry, binaryInfo.matricesIndicesAttrDesc.offset, binaryInfo.matricesIndicesAttrDesc.count);
  20169. mesh.setVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, matricesIndicesData, false);
  20170. }
  20171. if (binaryInfo.matricesWeightsAttrDesc && binaryInfo.matricesWeightsAttrDesc.count > 0) {
  20172. var matricesWeightsData = new Float32Array(parsedGeometry, binaryInfo.matricesWeightsAttrDesc.offset, binaryInfo.matricesWeightsAttrDesc.count);
  20173. mesh.setVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind, matricesWeightsData, false);
  20174. }
  20175. if (binaryInfo.indicesAttrDesc && binaryInfo.indicesAttrDesc.count > 0) {
  20176. var indicesData = new Int32Array(parsedGeometry, binaryInfo.indicesAttrDesc.offset, binaryInfo.indicesAttrDesc.count);
  20177. mesh.setIndices(indicesData);
  20178. }
  20179. if (binaryInfo.subMeshesAttrDesc && binaryInfo.subMeshesAttrDesc.count > 0) {
  20180. var subMeshesData = new Int32Array(parsedGeometry, binaryInfo.subMeshesAttrDesc.offset, binaryInfo.subMeshesAttrDesc.count * 5);
  20181. mesh.subMeshes = [];
  20182. for (var i = 0; i < binaryInfo.subMeshesAttrDesc.count; i++) {
  20183. var materialIndex = subMeshesData[(i * 5) + 0];
  20184. var verticesStart = subMeshesData[(i * 5) + 1];
  20185. var verticesCount = subMeshesData[(i * 5) + 2];
  20186. var indexStart = subMeshesData[(i * 5) + 3];
  20187. var indexCount = subMeshesData[(i * 5) + 4];
  20188. var subMesh = new BABYLON.SubMesh(materialIndex, verticesStart, verticesCount, indexStart, indexCount, mesh);
  20189. }
  20190. }
  20191. }
  20192. else if (parsedGeometry.positions && parsedGeometry.normals && parsedGeometry.indices) {
  20193. mesh.setVerticesData(BABYLON.VertexBuffer.PositionKind, parsedGeometry.positions, false);
  20194. mesh.setVerticesData(BABYLON.VertexBuffer.NormalKind, parsedGeometry.normals, false);
  20195. if (parsedGeometry.uvs) {
  20196. mesh.setVerticesData(BABYLON.VertexBuffer.UVKind, parsedGeometry.uvs, false);
  20197. }
  20198. if (parsedGeometry.uvs2) {
  20199. mesh.setVerticesData(BABYLON.VertexBuffer.UV2Kind, parsedGeometry.uvs2, false);
  20200. }
  20201. if (parsedGeometry.uvs3) {
  20202. mesh.setVerticesData(BABYLON.VertexBuffer.UV3Kind, parsedGeometry.uvs3, false);
  20203. }
  20204. if (parsedGeometry.uvs4) {
  20205. mesh.setVerticesData(BABYLON.VertexBuffer.UV4Kind, parsedGeometry.uvs4, false);
  20206. }
  20207. if (parsedGeometry.uvs5) {
  20208. mesh.setVerticesData(BABYLON.VertexBuffer.UV5Kind, parsedGeometry.uvs5, false);
  20209. }
  20210. if (parsedGeometry.uvs6) {
  20211. mesh.setVerticesData(BABYLON.VertexBuffer.UV6Kind, parsedGeometry.uvs6, false);
  20212. }
  20213. if (parsedGeometry.colors) {
  20214. mesh.setVerticesData(BABYLON.VertexBuffer.ColorKind, checkColors4(parsedGeometry.colors, parsedGeometry.positions.length / 3), false);
  20215. }
  20216. if (parsedGeometry.matricesIndices) {
  20217. if (!parsedGeometry.matricesIndices._isExpanded) {
  20218. var floatIndices = [];
  20219. for (var i = 0; i < parsedGeometry.matricesIndices.length; i++) {
  20220. var matricesIndex = parsedGeometry.matricesIndices[i];
  20221. floatIndices.push(matricesIndex & 0x000000FF);
  20222. floatIndices.push((matricesIndex & 0x0000FF00) >> 8);
  20223. floatIndices.push((matricesIndex & 0x00FF0000) >> 16);
  20224. floatIndices.push(matricesIndex >> 24);
  20225. }
  20226. mesh.setVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, floatIndices, false);
  20227. }
  20228. else {
  20229. delete parsedGeometry.matricesIndices._isExpanded;
  20230. mesh.setVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, parsedGeometry.matricesIndices, false);
  20231. }
  20232. }
  20233. if (parsedGeometry.matricesWeights) {
  20234. mesh.setVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind, parsedGeometry.matricesWeights, false);
  20235. }
  20236. mesh.setIndices(parsedGeometry.indices);
  20237. }
  20238. // SubMeshes
  20239. if (parsedGeometry.subMeshes) {
  20240. mesh.subMeshes = [];
  20241. for (var subIndex = 0; subIndex < parsedGeometry.subMeshes.length; subIndex++) {
  20242. var parsedSubMesh = parsedGeometry.subMeshes[subIndex];
  20243. var subMesh = new BABYLON.SubMesh(parsedSubMesh.materialIndex, parsedSubMesh.verticesStart, parsedSubMesh.verticesCount, parsedSubMesh.indexStart, parsedSubMesh.indexCount, mesh);
  20244. }
  20245. }
  20246. // Flat shading
  20247. if (mesh._shouldGenerateFlatShading) {
  20248. mesh.convertToFlatShadedMesh();
  20249. delete mesh._shouldGenerateFlatShading;
  20250. }
  20251. // Update
  20252. mesh.computeWorldMatrix(true);
  20253. // Octree
  20254. if (scene._selectionOctree) {
  20255. scene._selectionOctree.addMesh(mesh);
  20256. }
  20257. };
  20258. BABYLON.SceneLoader.RegisterPlugin({
  20259. extensions: ".babylon",
  20260. importMesh: function (meshesNames, scene, data, rootUrl, meshes, particleSystems, skeletons) {
  20261. var parsedData = JSON.parse(data);
  20262. var loadedSkeletonsIds = [];
  20263. var loadedMaterialsIds = [];
  20264. var hierarchyIds = [];
  20265. for (var index = 0; index < parsedData.meshes.length; index++) {
  20266. var parsedMesh = parsedData.meshes[index];
  20267. if (!meshesNames || isDescendantOf(parsedMesh, meshesNames, hierarchyIds)) {
  20268. if (meshesNames instanceof Array) {
  20269. // Remove found mesh name from list.
  20270. delete meshesNames[meshesNames.indexOf(parsedMesh.name)];
  20271. }
  20272. //Geometry?
  20273. if (parsedMesh.geometryId) {
  20274. //does the file contain geometries?
  20275. if (parsedData.geometries) {
  20276. //find the correct geometry and add it to the scene
  20277. var found = false;
  20278. ["boxes", "spheres", "cylinders", "toruses", "grounds", "planes", "torusKnots", "vertexData"].forEach(function (geometryType) {
  20279. if (found || !parsedData.geometries[geometryType] || !(parsedData.geometries[geometryType] instanceof Array)) {
  20280. return;
  20281. }
  20282. else {
  20283. parsedData.geometries[geometryType].forEach(function (parsedGeometryData) {
  20284. if (parsedGeometryData.id == parsedMesh.geometryId) {
  20285. switch (geometryType) {
  20286. case "boxes":
  20287. parseBox(parsedGeometryData, scene);
  20288. break;
  20289. case "spheres":
  20290. parseSphere(parsedGeometryData, scene);
  20291. break;
  20292. case "cylinders":
  20293. parseCylinder(parsedGeometryData, scene);
  20294. break;
  20295. case "toruses":
  20296. parseTorus(parsedGeometryData, scene);
  20297. break;
  20298. case "grounds":
  20299. parseGround(parsedGeometryData, scene);
  20300. break;
  20301. case "planes":
  20302. parsePlane(parsedGeometryData, scene);
  20303. break;
  20304. case "torusKnots":
  20305. parseTorusKnot(parsedGeometryData, scene);
  20306. break;
  20307. case "vertexData":
  20308. parseVertexData(parsedGeometryData, scene, rootUrl);
  20309. break;
  20310. }
  20311. found = true;
  20312. }
  20313. });
  20314. }
  20315. });
  20316. if (!found) {
  20317. BABYLON.Tools.Warn("Geometry not found for mesh " + parsedMesh.id);
  20318. }
  20319. }
  20320. }
  20321. // Material ?
  20322. if (parsedMesh.materialId) {
  20323. var materialFound = (loadedMaterialsIds.indexOf(parsedMesh.materialId) !== -1);
  20324. if (!materialFound && parsedData.multiMaterials) {
  20325. for (var multimatIndex = 0; multimatIndex < parsedData.multiMaterials.length; multimatIndex++) {
  20326. var parsedMultiMaterial = parsedData.multiMaterials[multimatIndex];
  20327. if (parsedMultiMaterial.id == parsedMesh.materialId) {
  20328. for (var matIndex = 0; matIndex < parsedMultiMaterial.materials.length; matIndex++) {
  20329. var subMatId = parsedMultiMaterial.materials[matIndex];
  20330. loadedMaterialsIds.push(subMatId);
  20331. parseMaterialById(subMatId, parsedData, scene, rootUrl);
  20332. }
  20333. loadedMaterialsIds.push(parsedMultiMaterial.id);
  20334. parseMultiMaterial(parsedMultiMaterial, scene);
  20335. materialFound = true;
  20336. break;
  20337. }
  20338. }
  20339. }
  20340. if (!materialFound) {
  20341. loadedMaterialsIds.push(parsedMesh.materialId);
  20342. if (!parseMaterialById(parsedMesh.materialId, parsedData, scene, rootUrl)) {
  20343. BABYLON.Tools.Warn("Material not found for mesh " + parsedMesh.id);
  20344. }
  20345. }
  20346. }
  20347. // Skeleton ?
  20348. if (parsedMesh.skeletonId > -1 && scene.skeletons) {
  20349. var skeletonAlreadyLoaded = (loadedSkeletonsIds.indexOf(parsedMesh.skeletonId) > -1);
  20350. if (!skeletonAlreadyLoaded) {
  20351. for (var skeletonIndex = 0; skeletonIndex < parsedData.skeletons.length; skeletonIndex++) {
  20352. var parsedSkeleton = parsedData.skeletons[skeletonIndex];
  20353. if (parsedSkeleton.id === parsedMesh.skeletonId) {
  20354. skeletons.push(parseSkeleton(parsedSkeleton, scene));
  20355. loadedSkeletonsIds.push(parsedSkeleton.id);
  20356. }
  20357. }
  20358. }
  20359. }
  20360. var mesh = parseMesh(parsedMesh, scene, rootUrl);
  20361. meshes.push(mesh);
  20362. }
  20363. }
  20364. // Connecting parents
  20365. for (index = 0; index < scene.meshes.length; index++) {
  20366. var currentMesh = scene.meshes[index];
  20367. if (currentMesh._waitingParentId) {
  20368. currentMesh.parent = scene.getLastEntryByID(currentMesh._waitingParentId);
  20369. currentMesh._waitingParentId = undefined;
  20370. }
  20371. }
  20372. // freeze world matrix application
  20373. for (index = 0; index < scene.meshes.length; index++) {
  20374. var currentMesh = scene.meshes[index];
  20375. if (currentMesh._waitingFreezeWorldMatrix) {
  20376. currentMesh.freezeWorldMatrix();
  20377. currentMesh._waitingFreezeWorldMatrix = undefined;
  20378. }
  20379. }
  20380. // Particles
  20381. if (parsedData.particleSystems) {
  20382. for (index = 0; index < parsedData.particleSystems.length; index++) {
  20383. var parsedParticleSystem = parsedData.particleSystems[index];
  20384. if (hierarchyIds.indexOf(parsedParticleSystem.emitterId) !== -1) {
  20385. particleSystems.push(parseParticleSystem(parsedParticleSystem, scene, rootUrl));
  20386. }
  20387. }
  20388. }
  20389. return true;
  20390. },
  20391. load: function (scene, data, rootUrl) {
  20392. var parsedData = JSON.parse(data);
  20393. // Scene
  20394. scene.useDelayedTextureLoading = parsedData.useDelayedTextureLoading && !BABYLON.SceneLoader.ForceFullSceneLoadingForIncremental;
  20395. scene.autoClear = parsedData.autoClear;
  20396. scene.clearColor = BABYLON.Color3.FromArray(parsedData.clearColor);
  20397. scene.ambientColor = BABYLON.Color3.FromArray(parsedData.ambientColor);
  20398. scene.gravity = BABYLON.Vector3.FromArray(parsedData.gravity);
  20399. // Fog
  20400. if (parsedData.fogMode && parsedData.fogMode !== 0) {
  20401. scene.fogMode = parsedData.fogMode;
  20402. scene.fogColor = BABYLON.Color3.FromArray(parsedData.fogColor);
  20403. scene.fogStart = parsedData.fogStart;
  20404. scene.fogEnd = parsedData.fogEnd;
  20405. scene.fogDensity = parsedData.fogDensity;
  20406. }
  20407. // Lights
  20408. for (var index = 0; index < parsedData.lights.length; index++) {
  20409. var parsedLight = parsedData.lights[index];
  20410. parseLight(parsedLight, scene);
  20411. }
  20412. // Materials
  20413. if (parsedData.materials) {
  20414. for (index = 0; index < parsedData.materials.length; index++) {
  20415. var parsedMaterial = parsedData.materials[index];
  20416. parseMaterial(parsedMaterial, scene, rootUrl);
  20417. }
  20418. }
  20419. if (parsedData.multiMaterials) {
  20420. for (index = 0; index < parsedData.multiMaterials.length; index++) {
  20421. var parsedMultiMaterial = parsedData.multiMaterials[index];
  20422. parseMultiMaterial(parsedMultiMaterial, scene);
  20423. }
  20424. }
  20425. // Skeletons
  20426. if (parsedData.skeletons) {
  20427. for (index = 0; index < parsedData.skeletons.length; index++) {
  20428. var parsedSkeleton = parsedData.skeletons[index];
  20429. parseSkeleton(parsedSkeleton, scene);
  20430. }
  20431. }
  20432. // Geometries
  20433. var geometries = parsedData.geometries;
  20434. if (geometries) {
  20435. // Boxes
  20436. var boxes = geometries.boxes;
  20437. if (boxes) {
  20438. for (index = 0; index < boxes.length; index++) {
  20439. var parsedBox = boxes[index];
  20440. parseBox(parsedBox, scene);
  20441. }
  20442. }
  20443. // Spheres
  20444. var spheres = geometries.spheres;
  20445. if (spheres) {
  20446. for (index = 0; index < spheres.length; index++) {
  20447. var parsedSphere = spheres[index];
  20448. parseSphere(parsedSphere, scene);
  20449. }
  20450. }
  20451. // Cylinders
  20452. var cylinders = geometries.cylinders;
  20453. if (cylinders) {
  20454. for (index = 0; index < cylinders.length; index++) {
  20455. var parsedCylinder = cylinders[index];
  20456. parseCylinder(parsedCylinder, scene);
  20457. }
  20458. }
  20459. // Toruses
  20460. var toruses = geometries.toruses;
  20461. if (toruses) {
  20462. for (index = 0; index < toruses.length; index++) {
  20463. var parsedTorus = toruses[index];
  20464. parseTorus(parsedTorus, scene);
  20465. }
  20466. }
  20467. // Grounds
  20468. var grounds = geometries.grounds;
  20469. if (grounds) {
  20470. for (index = 0; index < grounds.length; index++) {
  20471. var parsedGround = grounds[index];
  20472. parseGround(parsedGround, scene);
  20473. }
  20474. }
  20475. // Planes
  20476. var planes = geometries.planes;
  20477. if (planes) {
  20478. for (index = 0; index < planes.length; index++) {
  20479. var parsedPlane = planes[index];
  20480. parsePlane(parsedPlane, scene);
  20481. }
  20482. }
  20483. // TorusKnots
  20484. var torusKnots = geometries.torusKnots;
  20485. if (torusKnots) {
  20486. for (index = 0; index < torusKnots.length; index++) {
  20487. var parsedTorusKnot = torusKnots[index];
  20488. parseTorusKnot(parsedTorusKnot, scene);
  20489. }
  20490. }
  20491. // VertexData
  20492. var vertexData = geometries.vertexData;
  20493. if (vertexData) {
  20494. for (index = 0; index < vertexData.length; index++) {
  20495. var parsedVertexData = vertexData[index];
  20496. parseVertexData(parsedVertexData, scene, rootUrl);
  20497. }
  20498. }
  20499. }
  20500. // Meshes
  20501. for (index = 0; index < parsedData.meshes.length; index++) {
  20502. var parsedMesh = parsedData.meshes[index];
  20503. parseMesh(parsedMesh, scene, rootUrl);
  20504. }
  20505. // Cameras
  20506. for (index = 0; index < parsedData.cameras.length; index++) {
  20507. var parsedCamera = parsedData.cameras[index];
  20508. parseCamera(parsedCamera, scene);
  20509. }
  20510. if (parsedData.activeCameraID) {
  20511. scene.setActiveCameraByID(parsedData.activeCameraID);
  20512. }
  20513. // Browsing all the graph to connect the dots
  20514. for (index = 0; index < scene.cameras.length; index++) {
  20515. var camera = scene.cameras[index];
  20516. if (camera._waitingParentId) {
  20517. camera.parent = scene.getLastEntryByID(camera._waitingParentId);
  20518. camera._waitingParentId = undefined;
  20519. }
  20520. }
  20521. for (index = 0; index < scene.lights.length; index++) {
  20522. var light = scene.lights[index];
  20523. if (light._waitingParentId) {
  20524. light.parent = scene.getLastEntryByID(light._waitingParentId);
  20525. light._waitingParentId = undefined;
  20526. }
  20527. }
  20528. // Sounds
  20529. if (BABYLON.AudioEngine && parsedData.sounds) {
  20530. for (index = 0; index < parsedData.sounds.length; index++) {
  20531. var parsedSound = parsedData.sounds[index];
  20532. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  20533. parseSound(parsedSound, scene, rootUrl);
  20534. }
  20535. else {
  20536. var emptySound = new BABYLON.Sound(parsedSound.name, null, scene);
  20537. }
  20538. }
  20539. }
  20540. // Connect parents & children and parse actions
  20541. for (index = 0; index < scene.meshes.length; index++) {
  20542. var mesh = scene.meshes[index];
  20543. if (mesh._waitingParentId) {
  20544. mesh.parent = scene.getLastEntryByID(mesh._waitingParentId);
  20545. mesh._waitingParentId = undefined;
  20546. }
  20547. if (mesh._waitingActions) {
  20548. parseActions(mesh._waitingActions, mesh, scene);
  20549. mesh._waitingActions = undefined;
  20550. }
  20551. }
  20552. // freeze world matrix application
  20553. for (index = 0; index < scene.meshes.length; index++) {
  20554. var currentMesh = scene.meshes[index];
  20555. if (currentMesh._waitingFreezeWorldMatrix) {
  20556. currentMesh.freezeWorldMatrix();
  20557. currentMesh._waitingFreezeWorldMatrix = undefined;
  20558. }
  20559. }
  20560. // Particles Systems
  20561. if (parsedData.particleSystems) {
  20562. for (index = 0; index < parsedData.particleSystems.length; index++) {
  20563. var parsedParticleSystem = parsedData.particleSystems[index];
  20564. parseParticleSystem(parsedParticleSystem, scene, rootUrl);
  20565. }
  20566. }
  20567. // Lens flares
  20568. if (parsedData.lensFlareSystems) {
  20569. for (index = 0; index < parsedData.lensFlareSystems.length; index++) {
  20570. var parsedLensFlareSystem = parsedData.lensFlareSystems[index];
  20571. parseLensFlareSystem(parsedLensFlareSystem, scene, rootUrl);
  20572. }
  20573. }
  20574. // Shadows
  20575. if (parsedData.shadowGenerators) {
  20576. for (index = 0; index < parsedData.shadowGenerators.length; index++) {
  20577. var parsedShadowGenerator = parsedData.shadowGenerators[index];
  20578. parseShadowGenerator(parsedShadowGenerator, scene);
  20579. }
  20580. }
  20581. // Actions (scene)
  20582. if (parsedData.actions) {
  20583. parseActions(parsedData.actions, null, scene);
  20584. }
  20585. // Finish
  20586. return true;
  20587. }
  20588. });
  20589. })(Internals = BABYLON.Internals || (BABYLON.Internals = {}));
  20590. })(BABYLON || (BABYLON = {}));
  20591. var BABYLON;
  20592. (function (BABYLON) {
  20593. var SpriteManager = (function () {
  20594. function SpriteManager(name, imgUrl, capacity, cellSize, scene, epsilon, samplingMode) {
  20595. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  20596. this.name = name;
  20597. this.cellSize = cellSize;
  20598. this.sprites = new Array();
  20599. this.renderingGroupId = 0;
  20600. this.layerMask = 0x0FFFFFFF;
  20601. this.fogEnabled = true;
  20602. this.isPickable = false;
  20603. this._vertexDeclaration = [4, 4, 4, 4];
  20604. this._vertexStrideSize = 16 * 4; // 15 floats per sprite (x, y, z, angle, sizeX, sizeY, offsetX, offsetY, invertU, invertV, cellIndexX, cellIndexY, color)
  20605. this._capacity = capacity;
  20606. this._spriteTexture = new BABYLON.Texture(imgUrl, scene, true, false, samplingMode);
  20607. this._spriteTexture.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  20608. this._spriteTexture.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  20609. this._epsilon = epsilon === undefined ? 0.01 : epsilon;
  20610. this._scene = scene;
  20611. this._scene.spriteManagers.push(this);
  20612. // VBO
  20613. this._vertexBuffer = scene.getEngine().createDynamicVertexBuffer(capacity * this._vertexStrideSize * 4);
  20614. var indices = [];
  20615. var index = 0;
  20616. for (var count = 0; count < capacity; count++) {
  20617. indices.push(index);
  20618. indices.push(index + 1);
  20619. indices.push(index + 2);
  20620. indices.push(index);
  20621. indices.push(index + 2);
  20622. indices.push(index + 3);
  20623. index += 4;
  20624. }
  20625. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  20626. this._vertices = new Float32Array(capacity * this._vertexStrideSize);
  20627. // Effects
  20628. this._effectBase = this._scene.getEngine().createEffect("sprites", ["position", "options", "cellInfo", "color"], ["view", "projection", "textureInfos", "alphaTest"], ["diffuseSampler"], "");
  20629. this._effectFog = this._scene.getEngine().createEffect("sprites", ["position", "options", "cellInfo", "color"], ["view", "projection", "textureInfos", "alphaTest", "vFogInfos", "vFogColor"], ["diffuseSampler"], "#define FOG");
  20630. }
  20631. SpriteManager.prototype._appendSpriteVertex = function (index, sprite, offsetX, offsetY, rowSize) {
  20632. var arrayOffset = index * 16;
  20633. if (offsetX === 0)
  20634. offsetX = this._epsilon;
  20635. else if (offsetX === 1)
  20636. offsetX = 1 - this._epsilon;
  20637. if (offsetY === 0)
  20638. offsetY = this._epsilon;
  20639. else if (offsetY === 1)
  20640. offsetY = 1 - this._epsilon;
  20641. this._vertices[arrayOffset] = sprite.position.x;
  20642. this._vertices[arrayOffset + 1] = sprite.position.y;
  20643. this._vertices[arrayOffset + 2] = sprite.position.z;
  20644. this._vertices[arrayOffset + 3] = sprite.angle;
  20645. this._vertices[arrayOffset + 4] = sprite.width;
  20646. this._vertices[arrayOffset + 5] = sprite.height;
  20647. this._vertices[arrayOffset + 6] = offsetX;
  20648. this._vertices[arrayOffset + 7] = offsetY;
  20649. this._vertices[arrayOffset + 8] = sprite.invertU ? 1 : 0;
  20650. this._vertices[arrayOffset + 9] = sprite.invertV ? 1 : 0;
  20651. var offset = (sprite.cellIndex / rowSize) >> 0;
  20652. this._vertices[arrayOffset + 10] = sprite.cellIndex - offset * rowSize;
  20653. this._vertices[arrayOffset + 11] = offset;
  20654. // Color
  20655. this._vertices[arrayOffset + 12] = sprite.color.r;
  20656. this._vertices[arrayOffset + 13] = sprite.color.g;
  20657. this._vertices[arrayOffset + 14] = sprite.color.b;
  20658. this._vertices[arrayOffset + 15] = sprite.color.a;
  20659. };
  20660. SpriteManager.prototype.intersects = function (ray, camera, predicate, fastCheck) {
  20661. var count = Math.min(this._capacity, this.sprites.length);
  20662. var min = BABYLON.Vector3.Zero();
  20663. var max = BABYLON.Vector3.Zero();
  20664. var distance = Number.MAX_VALUE;
  20665. var currentSprite;
  20666. var cameraSpacePosition = BABYLON.Vector3.Zero();
  20667. var cameraView = camera.getViewMatrix();
  20668. for (var index = 0; index < count; index++) {
  20669. var sprite = this.sprites[index];
  20670. if (!sprite) {
  20671. continue;
  20672. }
  20673. if (predicate) {
  20674. if (!predicate(sprite)) {
  20675. continue;
  20676. }
  20677. }
  20678. else if (!sprite.isPickable) {
  20679. continue;
  20680. }
  20681. BABYLON.Vector3.TransformCoordinatesToRef(sprite.position, cameraView, cameraSpacePosition);
  20682. min.copyFromFloats(cameraSpacePosition.x - sprite.width / 2, cameraSpacePosition.y - sprite.height / 2, cameraSpacePosition.z);
  20683. max.copyFromFloats(cameraSpacePosition.x + sprite.width / 2, cameraSpacePosition.y + sprite.height / 2, cameraSpacePosition.z);
  20684. if (ray.intersectsBoxMinMax(min, max)) {
  20685. var currentDistance = BABYLON.Vector3.Distance(cameraSpacePosition, ray.origin);
  20686. if (distance > currentDistance) {
  20687. distance = currentDistance;
  20688. currentSprite = sprite;
  20689. if (fastCheck) {
  20690. break;
  20691. }
  20692. }
  20693. }
  20694. }
  20695. if (currentSprite) {
  20696. var result = new BABYLON.PickingInfo();
  20697. result.hit = true;
  20698. result.pickedSprite = currentSprite;
  20699. result.distance = distance;
  20700. return result;
  20701. }
  20702. return null;
  20703. };
  20704. SpriteManager.prototype.render = function () {
  20705. // Check
  20706. if (!this._effectBase.isReady() || !this._effectFog.isReady() || !this._spriteTexture || !this._spriteTexture.isReady())
  20707. return;
  20708. var engine = this._scene.getEngine();
  20709. var baseSize = this._spriteTexture.getBaseSize();
  20710. // Sprites
  20711. var deltaTime = engine.getDeltaTime();
  20712. var max = Math.min(this._capacity, this.sprites.length);
  20713. var rowSize = baseSize.width / this.cellSize;
  20714. var offset = 0;
  20715. for (var index = 0; index < max; index++) {
  20716. var sprite = this.sprites[index];
  20717. if (!sprite) {
  20718. continue;
  20719. }
  20720. sprite._animate(deltaTime);
  20721. this._appendSpriteVertex(offset++, sprite, 0, 0, rowSize);
  20722. this._appendSpriteVertex(offset++, sprite, 1, 0, rowSize);
  20723. this._appendSpriteVertex(offset++, sprite, 1, 1, rowSize);
  20724. this._appendSpriteVertex(offset++, sprite, 0, 1, rowSize);
  20725. }
  20726. engine.updateDynamicVertexBuffer(this._vertexBuffer, this._vertices);
  20727. // Render
  20728. var effect = this._effectBase;
  20729. if (this._scene.fogEnabled && this._scene.fogMode !== BABYLON.Scene.FOGMODE_NONE && this.fogEnabled) {
  20730. effect = this._effectFog;
  20731. }
  20732. engine.enableEffect(effect);
  20733. var viewMatrix = this._scene.getViewMatrix();
  20734. effect.setTexture("diffuseSampler", this._spriteTexture);
  20735. effect.setMatrix("view", viewMatrix);
  20736. effect.setMatrix("projection", this._scene.getProjectionMatrix());
  20737. effect.setFloat2("textureInfos", this.cellSize / baseSize.width, this.cellSize / baseSize.height);
  20738. // Fog
  20739. if (this._scene.fogEnabled && this._scene.fogMode !== BABYLON.Scene.FOGMODE_NONE && this.fogEnabled) {
  20740. effect.setFloat4("vFogInfos", this._scene.fogMode, this._scene.fogStart, this._scene.fogEnd, this._scene.fogDensity);
  20741. effect.setColor3("vFogColor", this._scene.fogColor);
  20742. }
  20743. // VBOs
  20744. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, effect);
  20745. // Draw order
  20746. engine.setDepthFunctionToLessOrEqual();
  20747. effect.setBool("alphaTest", true);
  20748. engine.setColorWrite(false);
  20749. engine.draw(true, 0, max * 6);
  20750. engine.setColorWrite(true);
  20751. effect.setBool("alphaTest", false);
  20752. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  20753. engine.draw(true, 0, max * 6);
  20754. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  20755. };
  20756. SpriteManager.prototype.dispose = function () {
  20757. if (this._vertexBuffer) {
  20758. this._scene.getEngine()._releaseBuffer(this._vertexBuffer);
  20759. this._vertexBuffer = null;
  20760. }
  20761. if (this._indexBuffer) {
  20762. this._scene.getEngine()._releaseBuffer(this._indexBuffer);
  20763. this._indexBuffer = null;
  20764. }
  20765. if (this._spriteTexture) {
  20766. this._spriteTexture.dispose();
  20767. this._spriteTexture = null;
  20768. }
  20769. // Remove from scene
  20770. var index = this._scene.spriteManagers.indexOf(this);
  20771. this._scene.spriteManagers.splice(index, 1);
  20772. // Callback
  20773. if (this.onDispose) {
  20774. this.onDispose();
  20775. }
  20776. };
  20777. return SpriteManager;
  20778. })();
  20779. BABYLON.SpriteManager = SpriteManager;
  20780. })(BABYLON || (BABYLON = {}));
  20781. var BABYLON;
  20782. (function (BABYLON) {
  20783. var Sprite = (function () {
  20784. function Sprite(name, manager) {
  20785. this.name = name;
  20786. this.color = new BABYLON.Color4(1.0, 1.0, 1.0, 1.0);
  20787. this.width = 1.0;
  20788. this.height = 1.0;
  20789. this.angle = 0;
  20790. this.cellIndex = 0;
  20791. this.invertU = 0;
  20792. this.invertV = 0;
  20793. this.animations = new Array();
  20794. this.isPickable = false;
  20795. this._animationStarted = false;
  20796. this._loopAnimation = false;
  20797. this._fromIndex = 0;
  20798. this._toIndex = 0;
  20799. this._delay = 0;
  20800. this._direction = 1;
  20801. this._frameCount = 0;
  20802. this._time = 0;
  20803. this._manager = manager;
  20804. this._manager.sprites.push(this);
  20805. this.position = BABYLON.Vector3.Zero();
  20806. }
  20807. Object.defineProperty(Sprite.prototype, "size", {
  20808. get: function () {
  20809. return this.width;
  20810. },
  20811. set: function (value) {
  20812. this.width = value;
  20813. this.height = value;
  20814. },
  20815. enumerable: true,
  20816. configurable: true
  20817. });
  20818. Sprite.prototype.playAnimation = function (from, to, loop, delay) {
  20819. this._fromIndex = from;
  20820. this._toIndex = to;
  20821. this._loopAnimation = loop;
  20822. this._delay = delay;
  20823. this._animationStarted = true;
  20824. this._direction = from < to ? 1 : -1;
  20825. this.cellIndex = from;
  20826. this._time = 0;
  20827. };
  20828. Sprite.prototype.stopAnimation = function () {
  20829. this._animationStarted = false;
  20830. };
  20831. Sprite.prototype._animate = function (deltaTime) {
  20832. if (!this._animationStarted)
  20833. return;
  20834. this._time += deltaTime;
  20835. if (this._time > this._delay) {
  20836. this._time = this._time % this._delay;
  20837. this.cellIndex += this._direction;
  20838. if (this.cellIndex == this._toIndex) {
  20839. if (this._loopAnimation) {
  20840. this.cellIndex = this._fromIndex;
  20841. }
  20842. else {
  20843. this._animationStarted = false;
  20844. if (this.disposeWhenFinishedAnimating) {
  20845. this.dispose();
  20846. }
  20847. }
  20848. }
  20849. }
  20850. };
  20851. Sprite.prototype.dispose = function () {
  20852. for (var i = 0; i < this._manager.sprites.length; i++) {
  20853. if (this._manager.sprites[i] == this) {
  20854. this._manager.sprites.splice(i, 1);
  20855. }
  20856. }
  20857. };
  20858. return Sprite;
  20859. })();
  20860. BABYLON.Sprite = Sprite;
  20861. })(BABYLON || (BABYLON = {}));
  20862. var BABYLON;
  20863. (function (BABYLON) {
  20864. var Layer = (function () {
  20865. function Layer(name, imgUrl, scene, isBackground, color) {
  20866. this.name = name;
  20867. this._vertexDeclaration = [2];
  20868. this._vertexStrideSize = 2 * 4;
  20869. this.texture = imgUrl ? new BABYLON.Texture(imgUrl, scene, true) : null;
  20870. this.isBackground = isBackground === undefined ? true : isBackground;
  20871. this.color = color === undefined ? new BABYLON.Color4(1, 1, 1, 1) : color;
  20872. this._scene = scene;
  20873. this._scene.layers.push(this);
  20874. // VBO
  20875. var vertices = [];
  20876. vertices.push(1, 1);
  20877. vertices.push(-1, 1);
  20878. vertices.push(-1, -1);
  20879. vertices.push(1, -1);
  20880. this._vertexBuffer = scene.getEngine().createVertexBuffer(vertices);
  20881. // Indices
  20882. var indices = [];
  20883. indices.push(0);
  20884. indices.push(1);
  20885. indices.push(2);
  20886. indices.push(0);
  20887. indices.push(2);
  20888. indices.push(3);
  20889. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  20890. // Effects
  20891. this._effect = this._scene.getEngine().createEffect("layer", ["position"], ["textureMatrix", "color"], ["textureSampler"], "");
  20892. }
  20893. Layer.prototype.render = function () {
  20894. // Check
  20895. if (!this._effect.isReady() || !this.texture || !this.texture.isReady())
  20896. return;
  20897. var engine = this._scene.getEngine();
  20898. // Render
  20899. engine.enableEffect(this._effect);
  20900. engine.setState(false);
  20901. // Texture
  20902. this._effect.setTexture("textureSampler", this.texture);
  20903. this._effect.setMatrix("textureMatrix", this.texture.getTextureMatrix());
  20904. // Color
  20905. this._effect.setFloat4("color", this.color.r, this.color.g, this.color.b, this.color.a);
  20906. // VBOs
  20907. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, this._effect);
  20908. // Draw order
  20909. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  20910. engine.draw(true, 0, 6);
  20911. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  20912. };
  20913. Layer.prototype.dispose = function () {
  20914. if (this._vertexBuffer) {
  20915. this._scene.getEngine()._releaseBuffer(this._vertexBuffer);
  20916. this._vertexBuffer = null;
  20917. }
  20918. if (this._indexBuffer) {
  20919. this._scene.getEngine()._releaseBuffer(this._indexBuffer);
  20920. this._indexBuffer = null;
  20921. }
  20922. if (this.texture) {
  20923. this.texture.dispose();
  20924. this.texture = null;
  20925. }
  20926. // Remove from scene
  20927. var index = this._scene.layers.indexOf(this);
  20928. this._scene.layers.splice(index, 1);
  20929. // Callback
  20930. if (this.onDispose) {
  20931. this.onDispose();
  20932. }
  20933. };
  20934. return Layer;
  20935. })();
  20936. BABYLON.Layer = Layer;
  20937. })(BABYLON || (BABYLON = {}));
  20938. var BABYLON;
  20939. (function (BABYLON) {
  20940. var Particle = (function () {
  20941. function Particle() {
  20942. this.position = BABYLON.Vector3.Zero();
  20943. this.direction = BABYLON.Vector3.Zero();
  20944. this.color = new BABYLON.Color4(0, 0, 0, 0);
  20945. this.colorStep = new BABYLON.Color4(0, 0, 0, 0);
  20946. this.lifeTime = 1.0;
  20947. this.age = 0;
  20948. this.size = 0;
  20949. this.angle = 0;
  20950. this.angularSpeed = 0;
  20951. }
  20952. Particle.prototype.copyTo = function (other) {
  20953. other.position.copyFrom(this.position);
  20954. other.direction.copyFrom(this.direction);
  20955. other.color.copyFrom(this.color);
  20956. other.colorStep.copyFrom(this.colorStep);
  20957. other.lifeTime = this.lifeTime;
  20958. other.age = this.age;
  20959. other.size = this.size;
  20960. other.angle = this.angle;
  20961. other.angularSpeed = this.angularSpeed;
  20962. };
  20963. return Particle;
  20964. })();
  20965. BABYLON.Particle = Particle;
  20966. })(BABYLON || (BABYLON = {}));
  20967. var BABYLON;
  20968. (function (BABYLON) {
  20969. var randomNumber = function (min, max) {
  20970. if (min === max) {
  20971. return (min);
  20972. }
  20973. var random = Math.random();
  20974. return ((random * (max - min)) + min);
  20975. };
  20976. var ParticleSystem = (function () {
  20977. function ParticleSystem(name, capacity, scene, customEffect) {
  20978. var _this = this;
  20979. this.name = name;
  20980. this.renderingGroupId = 0;
  20981. this.emitter = null;
  20982. this.emitRate = 10;
  20983. this.manualEmitCount = -1;
  20984. this.updateSpeed = 0.01;
  20985. this.targetStopDuration = 0;
  20986. this.disposeOnStop = false;
  20987. this.minEmitPower = 1;
  20988. this.maxEmitPower = 1;
  20989. this.minLifeTime = 1;
  20990. this.maxLifeTime = 1;
  20991. this.minSize = 1;
  20992. this.maxSize = 1;
  20993. this.minAngularSpeed = 0;
  20994. this.maxAngularSpeed = 0;
  20995. this.layerMask = 0x0FFFFFFF;
  20996. this.blendMode = ParticleSystem.BLENDMODE_ONEONE;
  20997. this.forceDepthWrite = false;
  20998. this.gravity = BABYLON.Vector3.Zero();
  20999. this.direction1 = new BABYLON.Vector3(0, 1.0, 0);
  21000. this.direction2 = new BABYLON.Vector3(0, 1.0, 0);
  21001. this.minEmitBox = new BABYLON.Vector3(-0.5, -0.5, -0.5);
  21002. this.maxEmitBox = new BABYLON.Vector3(0.5, 0.5, 0.5);
  21003. this.color1 = new BABYLON.Color4(1.0, 1.0, 1.0, 1.0);
  21004. this.color2 = new BABYLON.Color4(1.0, 1.0, 1.0, 1.0);
  21005. this.colorDead = new BABYLON.Color4(0, 0, 0, 1.0);
  21006. this.textureMask = new BABYLON.Color4(1.0, 1.0, 1.0, 1.0);
  21007. this.particles = new Array();
  21008. this._vertexDeclaration = [3, 4, 4];
  21009. this._vertexStrideSize = 11 * 4; // 11 floats per particle (x, y, z, r, g, b, a, angle, size, offsetX, offsetY)
  21010. this._stockParticles = new Array();
  21011. this._newPartsExcess = 0;
  21012. this._scaledColorStep = new BABYLON.Color4(0, 0, 0, 0);
  21013. this._colorDiff = new BABYLON.Color4(0, 0, 0, 0);
  21014. this._scaledDirection = BABYLON.Vector3.Zero();
  21015. this._scaledGravity = BABYLON.Vector3.Zero();
  21016. this._currentRenderId = -1;
  21017. this._started = false;
  21018. this._stopped = false;
  21019. this._actualFrame = 0;
  21020. this.id = name;
  21021. this._capacity = capacity;
  21022. this._scene = scene;
  21023. this._customEffect = customEffect;
  21024. scene.particleSystems.push(this);
  21025. // VBO
  21026. this._vertexBuffer = scene.getEngine().createDynamicVertexBuffer(capacity * this._vertexStrideSize * 4);
  21027. var indices = [];
  21028. var index = 0;
  21029. for (var count = 0; count < capacity; count++) {
  21030. indices.push(index);
  21031. indices.push(index + 1);
  21032. indices.push(index + 2);
  21033. indices.push(index);
  21034. indices.push(index + 2);
  21035. indices.push(index + 3);
  21036. index += 4;
  21037. }
  21038. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  21039. this._vertices = new Float32Array(capacity * this._vertexStrideSize);
  21040. // Default behaviors
  21041. this.startDirectionFunction = function (emitPower, worldMatrix, directionToUpdate) {
  21042. var randX = randomNumber(_this.direction1.x, _this.direction2.x);
  21043. var randY = randomNumber(_this.direction1.y, _this.direction2.y);
  21044. var randZ = randomNumber(_this.direction1.z, _this.direction2.z);
  21045. BABYLON.Vector3.TransformNormalFromFloatsToRef(randX * emitPower, randY * emitPower, randZ * emitPower, worldMatrix, directionToUpdate);
  21046. };
  21047. this.startPositionFunction = function (worldMatrix, positionToUpdate) {
  21048. var randX = randomNumber(_this.minEmitBox.x, _this.maxEmitBox.x);
  21049. var randY = randomNumber(_this.minEmitBox.y, _this.maxEmitBox.y);
  21050. var randZ = randomNumber(_this.minEmitBox.z, _this.maxEmitBox.z);
  21051. BABYLON.Vector3.TransformCoordinatesFromFloatsToRef(randX, randY, randZ, worldMatrix, positionToUpdate);
  21052. };
  21053. this.updateFunction = function (particles) {
  21054. for (var index = 0; index < particles.length; index++) {
  21055. var particle = particles[index];
  21056. particle.age += _this._scaledUpdateSpeed;
  21057. if (particle.age >= particle.lifeTime) {
  21058. _this.recycleParticle(particle);
  21059. index--;
  21060. continue;
  21061. }
  21062. else {
  21063. particle.colorStep.scaleToRef(_this._scaledUpdateSpeed, _this._scaledColorStep);
  21064. particle.color.addInPlace(_this._scaledColorStep);
  21065. if (particle.color.a < 0)
  21066. particle.color.a = 0;
  21067. particle.angle += particle.angularSpeed * _this._scaledUpdateSpeed;
  21068. particle.direction.scaleToRef(_this._scaledUpdateSpeed, _this._scaledDirection);
  21069. particle.position.addInPlace(_this._scaledDirection);
  21070. _this.gravity.scaleToRef(_this._scaledUpdateSpeed, _this._scaledGravity);
  21071. particle.direction.addInPlace(_this._scaledGravity);
  21072. }
  21073. }
  21074. };
  21075. }
  21076. ParticleSystem.prototype.recycleParticle = function (particle) {
  21077. var lastParticle = this.particles.pop();
  21078. if (lastParticle !== particle) {
  21079. lastParticle.copyTo(particle);
  21080. this._stockParticles.push(lastParticle);
  21081. }
  21082. };
  21083. ParticleSystem.prototype.getCapacity = function () {
  21084. return this._capacity;
  21085. };
  21086. ParticleSystem.prototype.isAlive = function () {
  21087. return this._alive;
  21088. };
  21089. ParticleSystem.prototype.isStarted = function () {
  21090. return this._started;
  21091. };
  21092. ParticleSystem.prototype.start = function () {
  21093. this._started = true;
  21094. this._stopped = false;
  21095. this._actualFrame = 0;
  21096. };
  21097. ParticleSystem.prototype.stop = function () {
  21098. this._stopped = true;
  21099. };
  21100. ParticleSystem.prototype._appendParticleVertex = function (index, particle, offsetX, offsetY) {
  21101. var offset = index * 11;
  21102. this._vertices[offset] = particle.position.x;
  21103. this._vertices[offset + 1] = particle.position.y;
  21104. this._vertices[offset + 2] = particle.position.z;
  21105. this._vertices[offset + 3] = particle.color.r;
  21106. this._vertices[offset + 4] = particle.color.g;
  21107. this._vertices[offset + 5] = particle.color.b;
  21108. this._vertices[offset + 6] = particle.color.a;
  21109. this._vertices[offset + 7] = particle.angle;
  21110. this._vertices[offset + 8] = particle.size;
  21111. this._vertices[offset + 9] = offsetX;
  21112. this._vertices[offset + 10] = offsetY;
  21113. };
  21114. ParticleSystem.prototype._update = function (newParticles) {
  21115. // Update current
  21116. this._alive = this.particles.length > 0;
  21117. this.updateFunction(this.particles);
  21118. // Add new ones
  21119. var worldMatrix;
  21120. if (this.emitter.position) {
  21121. worldMatrix = this.emitter.getWorldMatrix();
  21122. }
  21123. else {
  21124. worldMatrix = BABYLON.Matrix.Translation(this.emitter.x, this.emitter.y, this.emitter.z);
  21125. }
  21126. for (var index = 0; index < newParticles; index++) {
  21127. if (this.particles.length === this._capacity) {
  21128. break;
  21129. }
  21130. if (this._stockParticles.length !== 0) {
  21131. var particle = this._stockParticles.pop();
  21132. particle.age = 0;
  21133. }
  21134. else {
  21135. particle = new BABYLON.Particle();
  21136. }
  21137. this.particles.push(particle);
  21138. var emitPower = randomNumber(this.minEmitPower, this.maxEmitPower);
  21139. this.startDirectionFunction(emitPower, worldMatrix, particle.direction);
  21140. particle.lifeTime = randomNumber(this.minLifeTime, this.maxLifeTime);
  21141. particle.size = randomNumber(this.minSize, this.maxSize);
  21142. particle.angularSpeed = randomNumber(this.minAngularSpeed, this.maxAngularSpeed);
  21143. this.startPositionFunction(worldMatrix, particle.position);
  21144. var step = randomNumber(0, 1.0);
  21145. BABYLON.Color4.LerpToRef(this.color1, this.color2, step, particle.color);
  21146. this.colorDead.subtractToRef(particle.color, this._colorDiff);
  21147. this._colorDiff.scaleToRef(1.0 / particle.lifeTime, particle.colorStep);
  21148. }
  21149. };
  21150. ParticleSystem.prototype._getEffect = function () {
  21151. if (this._customEffect) {
  21152. return this._customEffect;
  21153. }
  21154. ;
  21155. var defines = [];
  21156. if (this._scene.clipPlane) {
  21157. defines.push("#define CLIPPLANE");
  21158. }
  21159. // Effect
  21160. var join = defines.join("\n");
  21161. if (this._cachedDefines !== join) {
  21162. this._cachedDefines = join;
  21163. this._effect = this._scene.getEngine().createEffect("particles", ["position", "color", "options"], ["invView", "view", "projection", "vClipPlane", "textureMask"], ["diffuseSampler"], join);
  21164. }
  21165. return this._effect;
  21166. };
  21167. ParticleSystem.prototype.animate = function () {
  21168. if (!this._started)
  21169. return;
  21170. var effect = this._getEffect();
  21171. // Check
  21172. if (!this.emitter || !effect.isReady() || !this.particleTexture || !this.particleTexture.isReady())
  21173. return;
  21174. if (this._currentRenderId === this._scene.getRenderId()) {
  21175. return;
  21176. }
  21177. this._currentRenderId = this._scene.getRenderId();
  21178. this._scaledUpdateSpeed = this.updateSpeed * this._scene.getAnimationRatio();
  21179. // determine the number of particles we need to create
  21180. var emitCout;
  21181. if (this.manualEmitCount > -1) {
  21182. emitCout = this.manualEmitCount;
  21183. this.manualEmitCount = 0;
  21184. }
  21185. else {
  21186. emitCout = this.emitRate;
  21187. }
  21188. var newParticles = ((emitCout * this._scaledUpdateSpeed) >> 0);
  21189. this._newPartsExcess += emitCout * this._scaledUpdateSpeed - newParticles;
  21190. if (this._newPartsExcess > 1.0) {
  21191. newParticles += this._newPartsExcess >> 0;
  21192. this._newPartsExcess -= this._newPartsExcess >> 0;
  21193. }
  21194. this._alive = false;
  21195. if (!this._stopped) {
  21196. this._actualFrame += this._scaledUpdateSpeed;
  21197. if (this.targetStopDuration && this._actualFrame >= this.targetStopDuration)
  21198. this.stop();
  21199. }
  21200. else {
  21201. newParticles = 0;
  21202. }
  21203. this._update(newParticles);
  21204. // Stopped?
  21205. if (this._stopped) {
  21206. if (!this._alive) {
  21207. this._started = false;
  21208. if (this.disposeOnStop) {
  21209. this._scene._toBeDisposed.push(this);
  21210. }
  21211. }
  21212. }
  21213. // Update VBO
  21214. var offset = 0;
  21215. for (var index = 0; index < this.particles.length; index++) {
  21216. var particle = this.particles[index];
  21217. this._appendParticleVertex(offset++, particle, 0, 0);
  21218. this._appendParticleVertex(offset++, particle, 1, 0);
  21219. this._appendParticleVertex(offset++, particle, 1, 1);
  21220. this._appendParticleVertex(offset++, particle, 0, 1);
  21221. }
  21222. var engine = this._scene.getEngine();
  21223. engine.updateDynamicVertexBuffer(this._vertexBuffer, this._vertices);
  21224. };
  21225. ParticleSystem.prototype.render = function () {
  21226. var effect = this._getEffect();
  21227. // Check
  21228. if (!this.emitter || !effect.isReady() || !this.particleTexture || !this.particleTexture.isReady() || !this.particles.length)
  21229. return 0;
  21230. var engine = this._scene.getEngine();
  21231. // Render
  21232. engine.enableEffect(effect);
  21233. engine.setState(false);
  21234. var viewMatrix = this._scene.getViewMatrix();
  21235. effect.setTexture("diffuseSampler", this.particleTexture);
  21236. effect.setMatrix("view", viewMatrix);
  21237. effect.setMatrix("projection", this._scene.getProjectionMatrix());
  21238. effect.setFloat4("textureMask", this.textureMask.r, this.textureMask.g, this.textureMask.b, this.textureMask.a);
  21239. if (this._scene.clipPlane) {
  21240. var clipPlane = this._scene.clipPlane;
  21241. var invView = viewMatrix.clone();
  21242. invView.invert();
  21243. effect.setMatrix("invView", invView);
  21244. effect.setFloat4("vClipPlane", clipPlane.normal.x, clipPlane.normal.y, clipPlane.normal.z, clipPlane.d);
  21245. }
  21246. // VBOs
  21247. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, effect);
  21248. // Draw order
  21249. if (this.blendMode === ParticleSystem.BLENDMODE_ONEONE) {
  21250. engine.setAlphaMode(BABYLON.Engine.ALPHA_ONEONE);
  21251. }
  21252. else {
  21253. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  21254. }
  21255. if (this.forceDepthWrite) {
  21256. engine.setDepthWrite(true);
  21257. }
  21258. engine.draw(true, 0, this.particles.length * 6);
  21259. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  21260. return this.particles.length;
  21261. };
  21262. ParticleSystem.prototype.dispose = function () {
  21263. if (this._vertexBuffer) {
  21264. this._scene.getEngine()._releaseBuffer(this._vertexBuffer);
  21265. this._vertexBuffer = null;
  21266. }
  21267. if (this._indexBuffer) {
  21268. this._scene.getEngine()._releaseBuffer(this._indexBuffer);
  21269. this._indexBuffer = null;
  21270. }
  21271. if (this.particleTexture) {
  21272. this.particleTexture.dispose();
  21273. this.particleTexture = null;
  21274. }
  21275. // Remove from scene
  21276. var index = this._scene.particleSystems.indexOf(this);
  21277. this._scene.particleSystems.splice(index, 1);
  21278. // Callback
  21279. if (this.onDispose) {
  21280. this.onDispose();
  21281. }
  21282. };
  21283. // Clone
  21284. ParticleSystem.prototype.clone = function (name, newEmitter) {
  21285. var result = new ParticleSystem(name, this._capacity, this._scene);
  21286. BABYLON.Tools.DeepCopy(this, result, ["particles"], ["_vertexDeclaration", "_vertexStrideSize"]);
  21287. if (newEmitter === undefined) {
  21288. newEmitter = this.emitter;
  21289. }
  21290. result.emitter = newEmitter;
  21291. if (this.particleTexture) {
  21292. result.particleTexture = new BABYLON.Texture(this.particleTexture.url, this._scene);
  21293. }
  21294. result.start();
  21295. return result;
  21296. };
  21297. // Statics
  21298. ParticleSystem.BLENDMODE_ONEONE = 0;
  21299. ParticleSystem.BLENDMODE_STANDARD = 1;
  21300. return ParticleSystem;
  21301. })();
  21302. BABYLON.ParticleSystem = ParticleSystem;
  21303. })(BABYLON || (BABYLON = {}));
  21304. var BABYLON;
  21305. (function (BABYLON) {
  21306. var AnimationRange = (function () {
  21307. function AnimationRange(name, from, to) {
  21308. this.name = name;
  21309. this.from = from;
  21310. this.to = to;
  21311. }
  21312. return AnimationRange;
  21313. })();
  21314. BABYLON.AnimationRange = AnimationRange;
  21315. var Animation = (function () {
  21316. function Animation(name, targetProperty, framePerSecond, dataType, loopMode) {
  21317. this.name = name;
  21318. this.targetProperty = targetProperty;
  21319. this.framePerSecond = framePerSecond;
  21320. this.dataType = dataType;
  21321. this.loopMode = loopMode;
  21322. this._offsetsCache = {};
  21323. this._highLimitsCache = {};
  21324. this._stopped = false;
  21325. this.allowMatricesInterpolation = false;
  21326. this._ranges = new Array();
  21327. this.targetPropertyPath = targetProperty.split(".");
  21328. this.dataType = dataType;
  21329. this.loopMode = loopMode === undefined ? Animation.ANIMATIONLOOPMODE_CYCLE : loopMode;
  21330. }
  21331. Animation.CreateAndStartAnimation = function (name, mesh, targetProperty, framePerSecond, totalFrame, from, to, loopMode, easingFunction, onAnimationEnd) {
  21332. var dataType = undefined;
  21333. if (!isNaN(parseFloat(from)) && isFinite(from)) {
  21334. dataType = Animation.ANIMATIONTYPE_FLOAT;
  21335. }
  21336. else if (from instanceof BABYLON.Quaternion) {
  21337. dataType = Animation.ANIMATIONTYPE_QUATERNION;
  21338. }
  21339. else if (from instanceof BABYLON.Vector3) {
  21340. dataType = Animation.ANIMATIONTYPE_VECTOR3;
  21341. }
  21342. else if (from instanceof BABYLON.Vector2) {
  21343. dataType = Animation.ANIMATIONTYPE_VECTOR2;
  21344. }
  21345. else if (from instanceof BABYLON.Color3) {
  21346. dataType = Animation.ANIMATIONTYPE_COLOR3;
  21347. }
  21348. if (dataType == undefined) {
  21349. return null;
  21350. }
  21351. var animation = new Animation(name, targetProperty, framePerSecond, dataType, loopMode);
  21352. var keys = [];
  21353. keys.push({ frame: 0, value: from });
  21354. keys.push({ frame: totalFrame, value: to });
  21355. animation.setKeys(keys);
  21356. if (easingFunction !== undefined) {
  21357. animation.setEasingFunction(easingFunction);
  21358. }
  21359. mesh.animations.push(animation);
  21360. return mesh.getScene().beginAnimation(mesh, 0, totalFrame, (animation.loopMode === 1), 1.0, onAnimationEnd);
  21361. };
  21362. // Methods
  21363. Animation.prototype.createRange = function (name, from, to) {
  21364. this._ranges.push(new AnimationRange(name, from, to));
  21365. };
  21366. Animation.prototype.deleteRange = function (name) {
  21367. for (var index = 0; index < this._ranges.length; index++) {
  21368. if (this._ranges[index].name === name) {
  21369. this._ranges.splice(index, 1);
  21370. return;
  21371. }
  21372. }
  21373. };
  21374. Animation.prototype.getRange = function (name) {
  21375. for (var index = 0; index < this._ranges.length; index++) {
  21376. if (this._ranges[index].name === name) {
  21377. return this._ranges[index];
  21378. }
  21379. }
  21380. return null;
  21381. };
  21382. Animation.prototype.reset = function () {
  21383. this._offsetsCache = {};
  21384. this._highLimitsCache = {};
  21385. this.currentFrame = 0;
  21386. };
  21387. Animation.prototype.isStopped = function () {
  21388. return this._stopped;
  21389. };
  21390. Animation.prototype.getKeys = function () {
  21391. return this._keys;
  21392. };
  21393. Animation.prototype.getEasingFunction = function () {
  21394. return this._easingFunction;
  21395. };
  21396. Animation.prototype.setEasingFunction = function (easingFunction) {
  21397. this._easingFunction = easingFunction;
  21398. };
  21399. Animation.prototype.floatInterpolateFunction = function (startValue, endValue, gradient) {
  21400. return startValue + (endValue - startValue) * gradient;
  21401. };
  21402. Animation.prototype.quaternionInterpolateFunction = function (startValue, endValue, gradient) {
  21403. return BABYLON.Quaternion.Slerp(startValue, endValue, gradient);
  21404. };
  21405. Animation.prototype.vector3InterpolateFunction = function (startValue, endValue, gradient) {
  21406. return BABYLON.Vector3.Lerp(startValue, endValue, gradient);
  21407. };
  21408. Animation.prototype.vector2InterpolateFunction = function (startValue, endValue, gradient) {
  21409. return BABYLON.Vector2.Lerp(startValue, endValue, gradient);
  21410. };
  21411. Animation.prototype.color3InterpolateFunction = function (startValue, endValue, gradient) {
  21412. return BABYLON.Color3.Lerp(startValue, endValue, gradient);
  21413. };
  21414. Animation.prototype.matrixInterpolateFunction = function (startValue, endValue, gradient) {
  21415. var startScale = new BABYLON.Vector3(0, 0, 0);
  21416. var startRotation = new BABYLON.Quaternion();
  21417. var startTranslation = new BABYLON.Vector3(0, 0, 0);
  21418. startValue.decompose(startScale, startRotation, startTranslation);
  21419. var endScale = new BABYLON.Vector3(0, 0, 0);
  21420. var endRotation = new BABYLON.Quaternion();
  21421. var endTranslation = new BABYLON.Vector3(0, 0, 0);
  21422. endValue.decompose(endScale, endRotation, endTranslation);
  21423. var resultScale = this.vector3InterpolateFunction(startScale, endScale, gradient);
  21424. var resultRotation = this.quaternionInterpolateFunction(startRotation, endRotation, gradient);
  21425. var resultTranslation = this.vector3InterpolateFunction(startTranslation, endTranslation, gradient);
  21426. var result = BABYLON.Matrix.Compose(resultScale, resultRotation, resultTranslation);
  21427. return result;
  21428. };
  21429. Animation.prototype.clone = function () {
  21430. var clone = new Animation(this.name, this.targetPropertyPath.join("."), this.framePerSecond, this.dataType, this.loopMode);
  21431. if (this._keys) {
  21432. clone.setKeys(this._keys);
  21433. }
  21434. return clone;
  21435. };
  21436. Animation.prototype.setKeys = function (values) {
  21437. this._keys = values.slice(0);
  21438. this._offsetsCache = {};
  21439. this._highLimitsCache = {};
  21440. };
  21441. Animation.prototype._getKeyValue = function (value) {
  21442. if (typeof value === "function") {
  21443. return value();
  21444. }
  21445. return value;
  21446. };
  21447. Animation.prototype._interpolate = function (currentFrame, repeatCount, loopMode, offsetValue, highLimitValue) {
  21448. if (loopMode === Animation.ANIMATIONLOOPMODE_CONSTANT && repeatCount > 0) {
  21449. return highLimitValue.clone ? highLimitValue.clone() : highLimitValue;
  21450. }
  21451. this.currentFrame = currentFrame;
  21452. // Try to get a hash to find the right key
  21453. var startKey = Math.max(0, Math.min(this._keys.length - 1, Math.floor(this._keys.length * (currentFrame - this._keys[0].frame) / (this._keys[this._keys.length - 1].frame - this._keys[0].frame)) - 1));
  21454. if (this._keys[startKey].frame >= currentFrame) {
  21455. while (startKey - 1 >= 0 && this._keys[startKey].frame >= currentFrame) {
  21456. startKey--;
  21457. }
  21458. }
  21459. for (var key = startKey; key < this._keys.length; key++) {
  21460. if (this._keys[key + 1].frame >= currentFrame) {
  21461. var startValue = this._getKeyValue(this._keys[key].value);
  21462. var endValue = this._getKeyValue(this._keys[key + 1].value);
  21463. // gradient : percent of currentFrame between the frame inf and the frame sup
  21464. var gradient = (currentFrame - this._keys[key].frame) / (this._keys[key + 1].frame - this._keys[key].frame);
  21465. // check for easingFunction and correction of gradient
  21466. if (this._easingFunction != null) {
  21467. gradient = this._easingFunction.ease(gradient);
  21468. }
  21469. switch (this.dataType) {
  21470. // Float
  21471. case Animation.ANIMATIONTYPE_FLOAT:
  21472. switch (loopMode) {
  21473. case Animation.ANIMATIONLOOPMODE_CYCLE:
  21474. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  21475. return this.floatInterpolateFunction(startValue, endValue, gradient);
  21476. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  21477. return offsetValue * repeatCount + this.floatInterpolateFunction(startValue, endValue, gradient);
  21478. }
  21479. break;
  21480. // Quaternion
  21481. case Animation.ANIMATIONTYPE_QUATERNION:
  21482. var quaternion = null;
  21483. switch (loopMode) {
  21484. case Animation.ANIMATIONLOOPMODE_CYCLE:
  21485. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  21486. quaternion = this.quaternionInterpolateFunction(startValue, endValue, gradient);
  21487. break;
  21488. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  21489. quaternion = this.quaternionInterpolateFunction(startValue, endValue, gradient).add(offsetValue.scale(repeatCount));
  21490. break;
  21491. }
  21492. return quaternion;
  21493. // Vector3
  21494. case Animation.ANIMATIONTYPE_VECTOR3:
  21495. switch (loopMode) {
  21496. case Animation.ANIMATIONLOOPMODE_CYCLE:
  21497. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  21498. return this.vector3InterpolateFunction(startValue, endValue, gradient);
  21499. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  21500. return this.vector3InterpolateFunction(startValue, endValue, gradient).add(offsetValue.scale(repeatCount));
  21501. }
  21502. // Vector2
  21503. case Animation.ANIMATIONTYPE_VECTOR2:
  21504. switch (loopMode) {
  21505. case Animation.ANIMATIONLOOPMODE_CYCLE:
  21506. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  21507. return this.vector2InterpolateFunction(startValue, endValue, gradient);
  21508. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  21509. return this.vector2InterpolateFunction(startValue, endValue, gradient).add(offsetValue.scale(repeatCount));
  21510. }
  21511. // Color3
  21512. case Animation.ANIMATIONTYPE_COLOR3:
  21513. switch (loopMode) {
  21514. case Animation.ANIMATIONLOOPMODE_CYCLE:
  21515. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  21516. return this.color3InterpolateFunction(startValue, endValue, gradient);
  21517. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  21518. return this.color3InterpolateFunction(startValue, endValue, gradient).add(offsetValue.scale(repeatCount));
  21519. }
  21520. // Matrix
  21521. case Animation.ANIMATIONTYPE_MATRIX:
  21522. switch (loopMode) {
  21523. case Animation.ANIMATIONLOOPMODE_CYCLE:
  21524. case Animation.ANIMATIONLOOPMODE_CONSTANT:
  21525. if (this.allowMatricesInterpolation) {
  21526. return this.matrixInterpolateFunction(startValue, endValue, gradient);
  21527. }
  21528. case Animation.ANIMATIONLOOPMODE_RELATIVE:
  21529. return startValue;
  21530. }
  21531. default:
  21532. break;
  21533. }
  21534. break;
  21535. }
  21536. }
  21537. return this._getKeyValue(this._keys[this._keys.length - 1].value);
  21538. };
  21539. Animation.prototype.animate = function (delay, from, to, loop, speedRatio) {
  21540. if (!this.targetPropertyPath || this.targetPropertyPath.length < 1) {
  21541. this._stopped = true;
  21542. return false;
  21543. }
  21544. var returnValue = true;
  21545. // Adding a start key at frame 0 if missing
  21546. if (this._keys[0].frame !== 0) {
  21547. var newKey = { frame: 0, value: this._keys[0].value };
  21548. this._keys.splice(0, 0, newKey);
  21549. }
  21550. // Check limits
  21551. if (from < this._keys[0].frame || from > this._keys[this._keys.length - 1].frame) {
  21552. from = this._keys[0].frame;
  21553. }
  21554. if (to < this._keys[0].frame || to > this._keys[this._keys.length - 1].frame) {
  21555. to = this._keys[this._keys.length - 1].frame;
  21556. }
  21557. // Compute ratio
  21558. var range = to - from;
  21559. var offsetValue;
  21560. // ratio represents the frame delta between from and to
  21561. var ratio = delay * (this.framePerSecond * speedRatio) / 1000.0;
  21562. var highLimitValue = 0;
  21563. if (ratio > range && !loop) {
  21564. returnValue = false;
  21565. highLimitValue = this._getKeyValue(this._keys[this._keys.length - 1].value);
  21566. }
  21567. else {
  21568. // Get max value if required
  21569. if (this.loopMode !== Animation.ANIMATIONLOOPMODE_CYCLE) {
  21570. var keyOffset = to.toString() + from.toString();
  21571. if (!this._offsetsCache[keyOffset]) {
  21572. var fromValue = this._interpolate(from, 0, Animation.ANIMATIONLOOPMODE_CYCLE);
  21573. var toValue = this._interpolate(to, 0, Animation.ANIMATIONLOOPMODE_CYCLE);
  21574. switch (this.dataType) {
  21575. // Float
  21576. case Animation.ANIMATIONTYPE_FLOAT:
  21577. this._offsetsCache[keyOffset] = toValue - fromValue;
  21578. break;
  21579. // Quaternion
  21580. case Animation.ANIMATIONTYPE_QUATERNION:
  21581. this._offsetsCache[keyOffset] = toValue.subtract(fromValue);
  21582. break;
  21583. // Vector3
  21584. case Animation.ANIMATIONTYPE_VECTOR3:
  21585. this._offsetsCache[keyOffset] = toValue.subtract(fromValue);
  21586. // Vector2
  21587. case Animation.ANIMATIONTYPE_VECTOR2:
  21588. this._offsetsCache[keyOffset] = toValue.subtract(fromValue);
  21589. // Color3
  21590. case Animation.ANIMATIONTYPE_COLOR3:
  21591. this._offsetsCache[keyOffset] = toValue.subtract(fromValue);
  21592. default:
  21593. break;
  21594. }
  21595. this._highLimitsCache[keyOffset] = toValue;
  21596. }
  21597. highLimitValue = this._highLimitsCache[keyOffset];
  21598. offsetValue = this._offsetsCache[keyOffset];
  21599. }
  21600. }
  21601. if (offsetValue === undefined) {
  21602. switch (this.dataType) {
  21603. // Float
  21604. case Animation.ANIMATIONTYPE_FLOAT:
  21605. offsetValue = 0;
  21606. break;
  21607. // Quaternion
  21608. case Animation.ANIMATIONTYPE_QUATERNION:
  21609. offsetValue = new BABYLON.Quaternion(0, 0, 0, 0);
  21610. break;
  21611. // Vector3
  21612. case Animation.ANIMATIONTYPE_VECTOR3:
  21613. offsetValue = BABYLON.Vector3.Zero();
  21614. break;
  21615. // Vector2
  21616. case Animation.ANIMATIONTYPE_VECTOR2:
  21617. offsetValue = BABYLON.Vector2.Zero();
  21618. break;
  21619. // Color3
  21620. case Animation.ANIMATIONTYPE_COLOR3:
  21621. offsetValue = BABYLON.Color3.Black();
  21622. }
  21623. }
  21624. // Compute value
  21625. var repeatCount = (ratio / range) >> 0;
  21626. var currentFrame = returnValue ? from + ratio % range : to;
  21627. var currentValue = this._interpolate(currentFrame, repeatCount, this.loopMode, offsetValue, highLimitValue);
  21628. // Set value
  21629. if (this.targetPropertyPath.length > 1) {
  21630. var property = this._target[this.targetPropertyPath[0]];
  21631. for (var index = 1; index < this.targetPropertyPath.length - 1; index++) {
  21632. property = property[this.targetPropertyPath[index]];
  21633. }
  21634. property[this.targetPropertyPath[this.targetPropertyPath.length - 1]] = currentValue;
  21635. }
  21636. else {
  21637. this._target[this.targetPropertyPath[0]] = currentValue;
  21638. }
  21639. if (this._target.markAsDirty) {
  21640. this._target.markAsDirty(this.targetProperty);
  21641. }
  21642. if (!returnValue) {
  21643. this._stopped = true;
  21644. }
  21645. return returnValue;
  21646. };
  21647. Object.defineProperty(Animation, "ANIMATIONTYPE_FLOAT", {
  21648. get: function () {
  21649. return Animation._ANIMATIONTYPE_FLOAT;
  21650. },
  21651. enumerable: true,
  21652. configurable: true
  21653. });
  21654. Object.defineProperty(Animation, "ANIMATIONTYPE_VECTOR3", {
  21655. get: function () {
  21656. return Animation._ANIMATIONTYPE_VECTOR3;
  21657. },
  21658. enumerable: true,
  21659. configurable: true
  21660. });
  21661. Object.defineProperty(Animation, "ANIMATIONTYPE_VECTOR2", {
  21662. get: function () {
  21663. return Animation._ANIMATIONTYPE_VECTOR2;
  21664. },
  21665. enumerable: true,
  21666. configurable: true
  21667. });
  21668. Object.defineProperty(Animation, "ANIMATIONTYPE_QUATERNION", {
  21669. get: function () {
  21670. return Animation._ANIMATIONTYPE_QUATERNION;
  21671. },
  21672. enumerable: true,
  21673. configurable: true
  21674. });
  21675. Object.defineProperty(Animation, "ANIMATIONTYPE_MATRIX", {
  21676. get: function () {
  21677. return Animation._ANIMATIONTYPE_MATRIX;
  21678. },
  21679. enumerable: true,
  21680. configurable: true
  21681. });
  21682. Object.defineProperty(Animation, "ANIMATIONTYPE_COLOR3", {
  21683. get: function () {
  21684. return Animation._ANIMATIONTYPE_COLOR3;
  21685. },
  21686. enumerable: true,
  21687. configurable: true
  21688. });
  21689. Object.defineProperty(Animation, "ANIMATIONLOOPMODE_RELATIVE", {
  21690. get: function () {
  21691. return Animation._ANIMATIONLOOPMODE_RELATIVE;
  21692. },
  21693. enumerable: true,
  21694. configurable: true
  21695. });
  21696. Object.defineProperty(Animation, "ANIMATIONLOOPMODE_CYCLE", {
  21697. get: function () {
  21698. return Animation._ANIMATIONLOOPMODE_CYCLE;
  21699. },
  21700. enumerable: true,
  21701. configurable: true
  21702. });
  21703. Object.defineProperty(Animation, "ANIMATIONLOOPMODE_CONSTANT", {
  21704. get: function () {
  21705. return Animation._ANIMATIONLOOPMODE_CONSTANT;
  21706. },
  21707. enumerable: true,
  21708. configurable: true
  21709. });
  21710. // Statics
  21711. Animation._ANIMATIONTYPE_FLOAT = 0;
  21712. Animation._ANIMATIONTYPE_VECTOR3 = 1;
  21713. Animation._ANIMATIONTYPE_QUATERNION = 2;
  21714. Animation._ANIMATIONTYPE_MATRIX = 3;
  21715. Animation._ANIMATIONTYPE_COLOR3 = 4;
  21716. Animation._ANIMATIONTYPE_VECTOR2 = 5;
  21717. Animation._ANIMATIONLOOPMODE_RELATIVE = 0;
  21718. Animation._ANIMATIONLOOPMODE_CYCLE = 1;
  21719. Animation._ANIMATIONLOOPMODE_CONSTANT = 2;
  21720. return Animation;
  21721. })();
  21722. BABYLON.Animation = Animation;
  21723. })(BABYLON || (BABYLON = {}));
  21724. var BABYLON;
  21725. (function (BABYLON) {
  21726. var Animatable = (function () {
  21727. function Animatable(scene, target, fromFrame, toFrame, loopAnimation, speedRatio, onAnimationEnd, animations) {
  21728. if (fromFrame === void 0) { fromFrame = 0; }
  21729. if (toFrame === void 0) { toFrame = 100; }
  21730. if (loopAnimation === void 0) { loopAnimation = false; }
  21731. if (speedRatio === void 0) { speedRatio = 1.0; }
  21732. this.target = target;
  21733. this.fromFrame = fromFrame;
  21734. this.toFrame = toFrame;
  21735. this.loopAnimation = loopAnimation;
  21736. this.speedRatio = speedRatio;
  21737. this.onAnimationEnd = onAnimationEnd;
  21738. this._animations = new Array();
  21739. this._paused = false;
  21740. this.animationStarted = false;
  21741. if (animations) {
  21742. this.appendAnimations(target, animations);
  21743. }
  21744. this._scene = scene;
  21745. scene._activeAnimatables.push(this);
  21746. }
  21747. // Methods
  21748. Animatable.prototype.getAnimations = function () {
  21749. return this._animations;
  21750. };
  21751. Animatable.prototype.appendAnimations = function (target, animations) {
  21752. for (var index = 0; index < animations.length; index++) {
  21753. var animation = animations[index];
  21754. animation._target = target;
  21755. this._animations.push(animation);
  21756. }
  21757. };
  21758. Animatable.prototype.getAnimationByTargetProperty = function (property) {
  21759. var animations = this._animations;
  21760. for (var index = 0; index < animations.length; index++) {
  21761. if (animations[index].targetProperty === property) {
  21762. return animations[index];
  21763. }
  21764. }
  21765. return null;
  21766. };
  21767. Animatable.prototype.reset = function () {
  21768. var animations = this._animations;
  21769. for (var index = 0; index < animations.length; index++) {
  21770. animations[index].reset();
  21771. }
  21772. this._localDelayOffset = null;
  21773. this._pausedDelay = null;
  21774. };
  21775. Animatable.prototype.pause = function () {
  21776. if (this._paused) {
  21777. return;
  21778. }
  21779. this._paused = true;
  21780. };
  21781. Animatable.prototype.restart = function () {
  21782. this._paused = false;
  21783. };
  21784. Animatable.prototype.stop = function () {
  21785. var index = this._scene._activeAnimatables.indexOf(this);
  21786. if (index > -1) {
  21787. this._scene._activeAnimatables.splice(index, 1);
  21788. }
  21789. if (this.onAnimationEnd) {
  21790. this.onAnimationEnd();
  21791. }
  21792. };
  21793. Animatable.prototype._animate = function (delay) {
  21794. if (this._paused) {
  21795. if (!this._pausedDelay) {
  21796. this._pausedDelay = delay;
  21797. }
  21798. return true;
  21799. }
  21800. if (!this._localDelayOffset) {
  21801. this._localDelayOffset = delay;
  21802. }
  21803. else if (this._pausedDelay) {
  21804. this._localDelayOffset += delay - this._pausedDelay;
  21805. this._pausedDelay = null;
  21806. }
  21807. // Animating
  21808. var running = false;
  21809. var animations = this._animations;
  21810. for (var index = 0; index < animations.length; index++) {
  21811. var animation = animations[index];
  21812. var isRunning = animation.animate(delay - this._localDelayOffset, this.fromFrame, this.toFrame, this.loopAnimation, this.speedRatio);
  21813. running = running || isRunning;
  21814. }
  21815. if (!running) {
  21816. // Remove from active animatables
  21817. index = this._scene._activeAnimatables.indexOf(this);
  21818. this._scene._activeAnimatables.splice(index, 1);
  21819. }
  21820. if (!running && this.onAnimationEnd) {
  21821. this.onAnimationEnd();
  21822. }
  21823. return running;
  21824. };
  21825. return Animatable;
  21826. })();
  21827. BABYLON.Animatable = Animatable;
  21828. })(BABYLON || (BABYLON = {}));
  21829. var BABYLON;
  21830. (function (BABYLON) {
  21831. var EasingFunction = (function () {
  21832. function EasingFunction() {
  21833. // Properties
  21834. this._easingMode = EasingFunction.EASINGMODE_EASEIN;
  21835. }
  21836. Object.defineProperty(EasingFunction, "EASINGMODE_EASEIN", {
  21837. get: function () {
  21838. return EasingFunction._EASINGMODE_EASEIN;
  21839. },
  21840. enumerable: true,
  21841. configurable: true
  21842. });
  21843. Object.defineProperty(EasingFunction, "EASINGMODE_EASEOUT", {
  21844. get: function () {
  21845. return EasingFunction._EASINGMODE_EASEOUT;
  21846. },
  21847. enumerable: true,
  21848. configurable: true
  21849. });
  21850. Object.defineProperty(EasingFunction, "EASINGMODE_EASEINOUT", {
  21851. get: function () {
  21852. return EasingFunction._EASINGMODE_EASEINOUT;
  21853. },
  21854. enumerable: true,
  21855. configurable: true
  21856. });
  21857. EasingFunction.prototype.setEasingMode = function (easingMode) {
  21858. var n = Math.min(Math.max(easingMode, 0), 2);
  21859. this._easingMode = n;
  21860. };
  21861. EasingFunction.prototype.getEasingMode = function () {
  21862. return this._easingMode;
  21863. };
  21864. EasingFunction.prototype.easeInCore = function (gradient) {
  21865. throw new Error('You must implement this method');
  21866. };
  21867. EasingFunction.prototype.ease = function (gradient) {
  21868. switch (this._easingMode) {
  21869. case EasingFunction.EASINGMODE_EASEIN:
  21870. return this.easeInCore(gradient);
  21871. case EasingFunction.EASINGMODE_EASEOUT:
  21872. return (1 - this.easeInCore(1 - gradient));
  21873. }
  21874. if (gradient >= 0.5) {
  21875. return (((1 - this.easeInCore((1 - gradient) * 2)) * 0.5) + 0.5);
  21876. }
  21877. return (this.easeInCore(gradient * 2) * 0.5);
  21878. };
  21879. //Statics
  21880. EasingFunction._EASINGMODE_EASEIN = 0;
  21881. EasingFunction._EASINGMODE_EASEOUT = 1;
  21882. EasingFunction._EASINGMODE_EASEINOUT = 2;
  21883. return EasingFunction;
  21884. })();
  21885. BABYLON.EasingFunction = EasingFunction;
  21886. var CircleEase = (function (_super) {
  21887. __extends(CircleEase, _super);
  21888. function CircleEase() {
  21889. _super.apply(this, arguments);
  21890. }
  21891. CircleEase.prototype.easeInCore = function (gradient) {
  21892. gradient = Math.max(0, Math.min(1, gradient));
  21893. return (1.0 - Math.sqrt(1.0 - (gradient * gradient)));
  21894. };
  21895. return CircleEase;
  21896. })(EasingFunction);
  21897. BABYLON.CircleEase = CircleEase;
  21898. var BackEase = (function (_super) {
  21899. __extends(BackEase, _super);
  21900. function BackEase(amplitude) {
  21901. if (amplitude === void 0) { amplitude = 1; }
  21902. _super.call(this);
  21903. this.amplitude = amplitude;
  21904. }
  21905. BackEase.prototype.easeInCore = function (gradient) {
  21906. var num = Math.max(0, this.amplitude);
  21907. return (Math.pow(gradient, 3.0) - ((gradient * num) * Math.sin(3.1415926535897931 * gradient)));
  21908. };
  21909. return BackEase;
  21910. })(EasingFunction);
  21911. BABYLON.BackEase = BackEase;
  21912. var BounceEase = (function (_super) {
  21913. __extends(BounceEase, _super);
  21914. function BounceEase(bounces, bounciness) {
  21915. if (bounces === void 0) { bounces = 3; }
  21916. if (bounciness === void 0) { bounciness = 2; }
  21917. _super.call(this);
  21918. this.bounces = bounces;
  21919. this.bounciness = bounciness;
  21920. }
  21921. BounceEase.prototype.easeInCore = function (gradient) {
  21922. var y = Math.max(0.0, this.bounces);
  21923. var bounciness = this.bounciness;
  21924. if (bounciness <= 1.0) {
  21925. bounciness = 1.001;
  21926. }
  21927. var num9 = Math.pow(bounciness, y);
  21928. var num5 = 1.0 - bounciness;
  21929. var num4 = ((1.0 - num9) / num5) + (num9 * 0.5);
  21930. var num15 = gradient * num4;
  21931. var num65 = Math.log((-num15 * (1.0 - bounciness)) + 1.0) / Math.log(bounciness);
  21932. var num3 = Math.floor(num65);
  21933. var num13 = num3 + 1.0;
  21934. var num8 = (1.0 - Math.pow(bounciness, num3)) / (num5 * num4);
  21935. var num12 = (1.0 - Math.pow(bounciness, num13)) / (num5 * num4);
  21936. var num7 = (num8 + num12) * 0.5;
  21937. var num6 = gradient - num7;
  21938. var num2 = num7 - num8;
  21939. return (((-Math.pow(1.0 / bounciness, y - num3) / (num2 * num2)) * (num6 - num2)) * (num6 + num2));
  21940. };
  21941. return BounceEase;
  21942. })(EasingFunction);
  21943. BABYLON.BounceEase = BounceEase;
  21944. var CubicEase = (function (_super) {
  21945. __extends(CubicEase, _super);
  21946. function CubicEase() {
  21947. _super.apply(this, arguments);
  21948. }
  21949. CubicEase.prototype.easeInCore = function (gradient) {
  21950. return (gradient * gradient * gradient);
  21951. };
  21952. return CubicEase;
  21953. })(EasingFunction);
  21954. BABYLON.CubicEase = CubicEase;
  21955. var ElasticEase = (function (_super) {
  21956. __extends(ElasticEase, _super);
  21957. function ElasticEase(oscillations, springiness) {
  21958. if (oscillations === void 0) { oscillations = 3; }
  21959. if (springiness === void 0) { springiness = 3; }
  21960. _super.call(this);
  21961. this.oscillations = oscillations;
  21962. this.springiness = springiness;
  21963. }
  21964. ElasticEase.prototype.easeInCore = function (gradient) {
  21965. var num2;
  21966. var num3 = Math.max(0.0, this.oscillations);
  21967. var num = Math.max(0.0, this.springiness);
  21968. if (num == 0) {
  21969. num2 = gradient;
  21970. }
  21971. else {
  21972. num2 = (Math.exp(num * gradient) - 1.0) / (Math.exp(num) - 1.0);
  21973. }
  21974. return (num2 * Math.sin(((6.2831853071795862 * num3) + 1.5707963267948966) * gradient));
  21975. };
  21976. return ElasticEase;
  21977. })(EasingFunction);
  21978. BABYLON.ElasticEase = ElasticEase;
  21979. var ExponentialEase = (function (_super) {
  21980. __extends(ExponentialEase, _super);
  21981. function ExponentialEase(exponent) {
  21982. if (exponent === void 0) { exponent = 2; }
  21983. _super.call(this);
  21984. this.exponent = exponent;
  21985. }
  21986. ExponentialEase.prototype.easeInCore = function (gradient) {
  21987. if (this.exponent <= 0) {
  21988. return gradient;
  21989. }
  21990. return ((Math.exp(this.exponent * gradient) - 1.0) / (Math.exp(this.exponent) - 1.0));
  21991. };
  21992. return ExponentialEase;
  21993. })(EasingFunction);
  21994. BABYLON.ExponentialEase = ExponentialEase;
  21995. var PowerEase = (function (_super) {
  21996. __extends(PowerEase, _super);
  21997. function PowerEase(power) {
  21998. if (power === void 0) { power = 2; }
  21999. _super.call(this);
  22000. this.power = power;
  22001. }
  22002. PowerEase.prototype.easeInCore = function (gradient) {
  22003. var y = Math.max(0.0, this.power);
  22004. return Math.pow(gradient, y);
  22005. };
  22006. return PowerEase;
  22007. })(EasingFunction);
  22008. BABYLON.PowerEase = PowerEase;
  22009. var QuadraticEase = (function (_super) {
  22010. __extends(QuadraticEase, _super);
  22011. function QuadraticEase() {
  22012. _super.apply(this, arguments);
  22013. }
  22014. QuadraticEase.prototype.easeInCore = function (gradient) {
  22015. return (gradient * gradient);
  22016. };
  22017. return QuadraticEase;
  22018. })(EasingFunction);
  22019. BABYLON.QuadraticEase = QuadraticEase;
  22020. var QuarticEase = (function (_super) {
  22021. __extends(QuarticEase, _super);
  22022. function QuarticEase() {
  22023. _super.apply(this, arguments);
  22024. }
  22025. QuarticEase.prototype.easeInCore = function (gradient) {
  22026. return (gradient * gradient * gradient * gradient);
  22027. };
  22028. return QuarticEase;
  22029. })(EasingFunction);
  22030. BABYLON.QuarticEase = QuarticEase;
  22031. var QuinticEase = (function (_super) {
  22032. __extends(QuinticEase, _super);
  22033. function QuinticEase() {
  22034. _super.apply(this, arguments);
  22035. }
  22036. QuinticEase.prototype.easeInCore = function (gradient) {
  22037. return (gradient * gradient * gradient * gradient * gradient);
  22038. };
  22039. return QuinticEase;
  22040. })(EasingFunction);
  22041. BABYLON.QuinticEase = QuinticEase;
  22042. var SineEase = (function (_super) {
  22043. __extends(SineEase, _super);
  22044. function SineEase() {
  22045. _super.apply(this, arguments);
  22046. }
  22047. SineEase.prototype.easeInCore = function (gradient) {
  22048. return (1.0 - Math.sin(1.5707963267948966 * (1.0 - gradient)));
  22049. };
  22050. return SineEase;
  22051. })(EasingFunction);
  22052. BABYLON.SineEase = SineEase;
  22053. var BezierCurveEase = (function (_super) {
  22054. __extends(BezierCurveEase, _super);
  22055. function BezierCurveEase(x1, y1, x2, y2) {
  22056. if (x1 === void 0) { x1 = 0; }
  22057. if (y1 === void 0) { y1 = 0; }
  22058. if (x2 === void 0) { x2 = 1; }
  22059. if (y2 === void 0) { y2 = 1; }
  22060. _super.call(this);
  22061. this.x1 = x1;
  22062. this.y1 = y1;
  22063. this.x2 = x2;
  22064. this.y2 = y2;
  22065. }
  22066. BezierCurveEase.prototype.easeInCore = function (gradient) {
  22067. return BABYLON.BezierCurve.interpolate(gradient, this.x1, this.y1, this.x2, this.y2);
  22068. };
  22069. return BezierCurveEase;
  22070. })(EasingFunction);
  22071. BABYLON.BezierCurveEase = BezierCurveEase;
  22072. })(BABYLON || (BABYLON = {}));
  22073. var BABYLON;
  22074. (function (BABYLON) {
  22075. var Bone = (function (_super) {
  22076. __extends(Bone, _super);
  22077. function Bone(name, skeleton, parentBone, matrix) {
  22078. _super.call(this, name, skeleton.getScene());
  22079. this.name = name;
  22080. this.children = new Array();
  22081. this.animations = new Array();
  22082. this._worldTransform = new BABYLON.Matrix();
  22083. this._absoluteTransform = new BABYLON.Matrix();
  22084. this._invertedAbsoluteTransform = new BABYLON.Matrix();
  22085. this._skeleton = skeleton;
  22086. this._matrix = matrix;
  22087. this._baseMatrix = matrix;
  22088. skeleton.bones.push(this);
  22089. if (parentBone) {
  22090. this._parent = parentBone;
  22091. parentBone.children.push(this);
  22092. }
  22093. else {
  22094. this._parent = null;
  22095. }
  22096. this._updateDifferenceMatrix();
  22097. }
  22098. // Members
  22099. Bone.prototype.getParent = function () {
  22100. return this._parent;
  22101. };
  22102. Bone.prototype.getLocalMatrix = function () {
  22103. return this._matrix;
  22104. };
  22105. Bone.prototype.getBaseMatrix = function () {
  22106. return this._baseMatrix;
  22107. };
  22108. Bone.prototype.getWorldMatrix = function () {
  22109. return this._worldTransform;
  22110. };
  22111. Bone.prototype.getInvertedAbsoluteTransform = function () {
  22112. return this._invertedAbsoluteTransform;
  22113. };
  22114. Bone.prototype.getAbsoluteMatrix = function () {
  22115. var matrix = this._matrix.clone();
  22116. var parent = this._parent;
  22117. while (parent) {
  22118. matrix = matrix.multiply(parent.getLocalMatrix());
  22119. parent = parent.getParent();
  22120. }
  22121. return matrix;
  22122. };
  22123. // Methods
  22124. Bone.prototype.updateMatrix = function (matrix) {
  22125. this._matrix = matrix;
  22126. this._skeleton._markAsDirty();
  22127. this._updateDifferenceMatrix();
  22128. };
  22129. Bone.prototype._updateDifferenceMatrix = function () {
  22130. if (this._parent) {
  22131. this._matrix.multiplyToRef(this._parent._absoluteTransform, this._absoluteTransform);
  22132. }
  22133. else {
  22134. this._absoluteTransform.copyFrom(this._matrix);
  22135. }
  22136. this._absoluteTransform.invertToRef(this._invertedAbsoluteTransform);
  22137. for (var index = 0; index < this.children.length; index++) {
  22138. this.children[index]._updateDifferenceMatrix();
  22139. }
  22140. };
  22141. Bone.prototype.markAsDirty = function () {
  22142. this._currentRenderId++;
  22143. this._skeleton._markAsDirty();
  22144. };
  22145. return Bone;
  22146. })(BABYLON.Node);
  22147. BABYLON.Bone = Bone;
  22148. })(BABYLON || (BABYLON = {}));
  22149. var BABYLON;
  22150. (function (BABYLON) {
  22151. var Skeleton = (function () {
  22152. function Skeleton(name, id, scene) {
  22153. this.name = name;
  22154. this.id = id;
  22155. this.bones = new Array();
  22156. this._isDirty = true;
  22157. this._identity = BABYLON.Matrix.Identity();
  22158. this._ranges = new Array();
  22159. this.bones = [];
  22160. this._scene = scene;
  22161. scene.skeletons.push(this);
  22162. this.prepare();
  22163. //make sure it will recalculate the matrix next time prepare is called.
  22164. this._isDirty = true;
  22165. }
  22166. // Members
  22167. Skeleton.prototype.getTransformMatrices = function () {
  22168. return this._transformMatrices;
  22169. };
  22170. Skeleton.prototype.getScene = function () {
  22171. return this._scene;
  22172. };
  22173. // Methods
  22174. Skeleton.prototype.createAnimationRange = function (name, from, to) {
  22175. this._ranges.push(new BABYLON.AnimationRange(name, from, to));
  22176. };
  22177. Skeleton.prototype.deleteAnimationRange = function (name) {
  22178. for (var index = 0; index < this._ranges.length; index++) {
  22179. if (this._ranges[index].name === name) {
  22180. this._ranges.splice(index, 1);
  22181. return;
  22182. }
  22183. }
  22184. };
  22185. Skeleton.prototype.getAnimationRange = function (name) {
  22186. for (var index = 0; index < this._ranges.length; index++) {
  22187. if (this._ranges[index].name === name) {
  22188. return this._ranges[index];
  22189. }
  22190. }
  22191. return null;
  22192. };
  22193. Skeleton.prototype.beginAnimation = function (name, loop, speedRatio, onAnimationEnd) {
  22194. var range = this.getAnimationRange(name);
  22195. if (!range) {
  22196. return null;
  22197. }
  22198. this._scene.beginAnimation(this, range.from, range.to, loop, speedRatio, onAnimationEnd);
  22199. };
  22200. Skeleton.prototype._markAsDirty = function () {
  22201. this._isDirty = true;
  22202. };
  22203. Skeleton.prototype.prepare = function () {
  22204. if (!this._isDirty) {
  22205. return;
  22206. }
  22207. if (!this._transformMatrices || this._transformMatrices.length !== 16 * (this.bones.length + 1)) {
  22208. this._transformMatrices = new Float32Array(16 * (this.bones.length + 1));
  22209. }
  22210. for (var index = 0; index < this.bones.length; index++) {
  22211. var bone = this.bones[index];
  22212. var parentBone = bone.getParent();
  22213. if (parentBone) {
  22214. bone.getLocalMatrix().multiplyToRef(parentBone.getWorldMatrix(), bone.getWorldMatrix());
  22215. }
  22216. else {
  22217. bone.getWorldMatrix().copyFrom(bone.getLocalMatrix());
  22218. }
  22219. bone.getInvertedAbsoluteTransform().multiplyToArray(bone.getWorldMatrix(), this._transformMatrices, index * 16);
  22220. }
  22221. this._identity.copyToArray(this._transformMatrices, this.bones.length * 16);
  22222. this._isDirty = false;
  22223. this._scene._activeBones += this.bones.length;
  22224. };
  22225. Skeleton.prototype.getAnimatables = function () {
  22226. if (!this._animatables || this._animatables.length !== this.bones.length) {
  22227. this._animatables = [];
  22228. for (var index = 0; index < this.bones.length; index++) {
  22229. this._animatables.push(this.bones[index]);
  22230. }
  22231. }
  22232. return this._animatables;
  22233. };
  22234. Skeleton.prototype.clone = function (name, id) {
  22235. var result = new Skeleton(name, id || name, this._scene);
  22236. for (var index = 0; index < this.bones.length; index++) {
  22237. var source = this.bones[index];
  22238. var parentBone = null;
  22239. if (source.getParent()) {
  22240. var parentIndex = this.bones.indexOf(source.getParent());
  22241. parentBone = result.bones[parentIndex];
  22242. }
  22243. var bone = new BABYLON.Bone(source.name, result, parentBone, source.getBaseMatrix());
  22244. BABYLON.Tools.DeepCopy(source.animations, bone.animations);
  22245. }
  22246. return result;
  22247. };
  22248. return Skeleton;
  22249. })();
  22250. BABYLON.Skeleton = Skeleton;
  22251. })(BABYLON || (BABYLON = {}));
  22252. var BABYLON;
  22253. (function (BABYLON) {
  22254. var PostProcess = (function () {
  22255. function PostProcess(name, fragmentUrl, parameters, samplers, ratio, camera, samplingMode, engine, reusable, defines, textureType) {
  22256. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.NEAREST_SAMPLINGMODE; }
  22257. if (textureType === void 0) { textureType = BABYLON.Engine.TEXTURETYPE_UNSIGNED_INT; }
  22258. this.name = name;
  22259. this.width = -1;
  22260. this.height = -1;
  22261. this._reusable = false;
  22262. this._textures = new BABYLON.SmartArray(2);
  22263. this._currentRenderTextureInd = 0;
  22264. if (camera != null) {
  22265. this._camera = camera;
  22266. this._scene = camera.getScene();
  22267. camera.attachPostProcess(this);
  22268. this._engine = this._scene.getEngine();
  22269. }
  22270. else {
  22271. this._engine = engine;
  22272. }
  22273. this._renderRatio = ratio;
  22274. this.renderTargetSamplingMode = samplingMode ? samplingMode : BABYLON.Texture.NEAREST_SAMPLINGMODE;
  22275. this._reusable = reusable || false;
  22276. this._textureType = textureType;
  22277. samplers = samplers || [];
  22278. samplers.push("textureSampler");
  22279. this._effect = this._engine.createEffect({ vertex: "postprocess", fragment: fragmentUrl }, ["position"], parameters || [], samplers, defines !== undefined ? defines : "");
  22280. }
  22281. PostProcess.prototype.isReusable = function () {
  22282. return this._reusable;
  22283. };
  22284. PostProcess.prototype.activate = function (camera, sourceTexture) {
  22285. camera = camera || this._camera;
  22286. var scene = camera.getScene();
  22287. var maxSize = camera.getEngine().getCaps().maxTextureSize;
  22288. var desiredWidth = ((sourceTexture ? sourceTexture._width : this._engine.getRenderingCanvas().width) * this._renderRatio) | 0;
  22289. var desiredHeight = ((sourceTexture ? sourceTexture._height : this._engine.getRenderingCanvas().height) * this._renderRatio) | 0;
  22290. desiredWidth = this._renderRatio.width || BABYLON.Tools.GetExponentOfTwo(desiredWidth, maxSize);
  22291. desiredHeight = this._renderRatio.height || BABYLON.Tools.GetExponentOfTwo(desiredHeight, maxSize);
  22292. if (this.width !== desiredWidth || this.height !== desiredHeight) {
  22293. if (this._textures.length > 0) {
  22294. for (var i = 0; i < this._textures.length; i++) {
  22295. this._engine._releaseTexture(this._textures.data[i]);
  22296. }
  22297. this._textures.reset();
  22298. }
  22299. this.width = desiredWidth;
  22300. this.height = desiredHeight;
  22301. this._textures.push(this._engine.createRenderTargetTexture({ width: this.width, height: this.height }, { generateMipMaps: false, generateDepthBuffer: camera._postProcesses.indexOf(this) === camera._postProcessesTakenIndices[0], samplingMode: this.renderTargetSamplingMode, type: this._textureType }));
  22302. if (this._reusable) {
  22303. this._textures.push(this._engine.createRenderTargetTexture({ width: this.width, height: this.height }, { generateMipMaps: false, generateDepthBuffer: camera._postProcesses.indexOf(this) === camera._postProcessesTakenIndices[0], samplingMode: this.renderTargetSamplingMode, type: this._textureType }));
  22304. }
  22305. if (this.onSizeChanged) {
  22306. this.onSizeChanged();
  22307. }
  22308. }
  22309. this._engine.bindFramebuffer(this._textures.data[this._currentRenderTextureInd]);
  22310. if (this.onActivate) {
  22311. this.onActivate(camera);
  22312. }
  22313. // Clear
  22314. if (this.clearColor) {
  22315. this._engine.clear(this.clearColor, true, true);
  22316. }
  22317. else {
  22318. this._engine.clear(scene.clearColor, scene.autoClear || scene.forceWireframe, true);
  22319. }
  22320. if (this._reusable) {
  22321. this._currentRenderTextureInd = (this._currentRenderTextureInd + 1) % 2;
  22322. }
  22323. };
  22324. PostProcess.prototype.apply = function () {
  22325. // Check
  22326. if (!this._effect.isReady())
  22327. return null;
  22328. // States
  22329. this._engine.enableEffect(this._effect);
  22330. this._engine.setState(false);
  22331. this._engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  22332. this._engine.setDepthBuffer(false);
  22333. this._engine.setDepthWrite(false);
  22334. // Texture
  22335. this._effect._bindTexture("textureSampler", this._textures.data[this._currentRenderTextureInd]);
  22336. // Parameters
  22337. if (this.onApply) {
  22338. this.onApply(this._effect);
  22339. }
  22340. return this._effect;
  22341. };
  22342. PostProcess.prototype.dispose = function (camera) {
  22343. camera = camera || this._camera;
  22344. if (this._textures.length > 0) {
  22345. for (var i = 0; i < this._textures.length; i++) {
  22346. this._engine._releaseTexture(this._textures.data[i]);
  22347. }
  22348. this._textures.reset();
  22349. }
  22350. if (!camera) {
  22351. return;
  22352. }
  22353. camera.detachPostProcess(this);
  22354. var index = camera._postProcesses.indexOf(this);
  22355. if (index === camera._postProcessesTakenIndices[0] && camera._postProcessesTakenIndices.length > 0) {
  22356. this._camera._postProcesses[camera._postProcessesTakenIndices[0]].width = -1; // invalidate frameBuffer to hint the postprocess to create a depth buffer
  22357. }
  22358. };
  22359. return PostProcess;
  22360. })();
  22361. BABYLON.PostProcess = PostProcess;
  22362. })(BABYLON || (BABYLON = {}));
  22363. var BABYLON;
  22364. (function (BABYLON) {
  22365. var PostProcessManager = (function () {
  22366. function PostProcessManager(scene) {
  22367. this._vertexDeclaration = [2];
  22368. this._vertexStrideSize = 2 * 4;
  22369. this._scene = scene;
  22370. }
  22371. PostProcessManager.prototype._prepareBuffers = function () {
  22372. if (this._vertexBuffer) {
  22373. return;
  22374. }
  22375. // VBO
  22376. var vertices = [];
  22377. vertices.push(1, 1);
  22378. vertices.push(-1, 1);
  22379. vertices.push(-1, -1);
  22380. vertices.push(1, -1);
  22381. this._vertexBuffer = this._scene.getEngine().createVertexBuffer(vertices);
  22382. // Indices
  22383. var indices = [];
  22384. indices.push(0);
  22385. indices.push(1);
  22386. indices.push(2);
  22387. indices.push(0);
  22388. indices.push(2);
  22389. indices.push(3);
  22390. this._indexBuffer = this._scene.getEngine().createIndexBuffer(indices);
  22391. };
  22392. // Methods
  22393. PostProcessManager.prototype._prepareFrame = function (sourceTexture) {
  22394. var postProcesses = this._scene.activeCamera._postProcesses;
  22395. var postProcessesTakenIndices = this._scene.activeCamera._postProcessesTakenIndices;
  22396. if (postProcessesTakenIndices.length === 0 || !this._scene.postProcessesEnabled) {
  22397. return false;
  22398. }
  22399. postProcesses[this._scene.activeCamera._postProcessesTakenIndices[0]].activate(this._scene.activeCamera, sourceTexture);
  22400. return true;
  22401. };
  22402. PostProcessManager.prototype.directRender = function (postProcesses, targetTexture) {
  22403. var engine = this._scene.getEngine();
  22404. for (var index = 0; index < postProcesses.length; index++) {
  22405. if (index < postProcesses.length - 1) {
  22406. postProcesses[index + 1].activate(this._scene.activeCamera, targetTexture);
  22407. }
  22408. else {
  22409. if (targetTexture) {
  22410. engine.bindFramebuffer(targetTexture);
  22411. }
  22412. else {
  22413. engine.restoreDefaultFramebuffer();
  22414. }
  22415. }
  22416. var pp = postProcesses[index];
  22417. var effect = pp.apply();
  22418. if (effect) {
  22419. if (pp.onBeforeRender) {
  22420. pp.onBeforeRender(effect);
  22421. }
  22422. // VBOs
  22423. this._prepareBuffers();
  22424. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, effect);
  22425. // Draw order
  22426. engine.draw(true, 0, 6);
  22427. if (pp.onAfterRender) {
  22428. pp.onAfterRender(effect);
  22429. }
  22430. }
  22431. }
  22432. // Restore depth buffer
  22433. engine.setDepthBuffer(true);
  22434. engine.setDepthWrite(true);
  22435. };
  22436. PostProcessManager.prototype._finalizeFrame = function (doNotPresent, targetTexture, faceIndex, postProcesses) {
  22437. postProcesses = postProcesses || this._scene.activeCamera._postProcesses;
  22438. var postProcessesTakenIndices = this._scene.activeCamera._postProcessesTakenIndices;
  22439. if (postProcessesTakenIndices.length === 0 || !this._scene.postProcessesEnabled) {
  22440. return;
  22441. }
  22442. var engine = this._scene.getEngine();
  22443. for (var index = 0; index < postProcessesTakenIndices.length; index++) {
  22444. if (index < postProcessesTakenIndices.length - 1) {
  22445. postProcesses[postProcessesTakenIndices[index + 1]].activate(this._scene.activeCamera);
  22446. }
  22447. else {
  22448. if (targetTexture) {
  22449. engine.bindFramebuffer(targetTexture, faceIndex);
  22450. }
  22451. else {
  22452. engine.restoreDefaultFramebuffer();
  22453. }
  22454. }
  22455. if (doNotPresent) {
  22456. break;
  22457. }
  22458. var pp = postProcesses[postProcessesTakenIndices[index]];
  22459. var effect = pp.apply();
  22460. if (effect) {
  22461. if (pp.onBeforeRender) {
  22462. pp.onBeforeRender(effect);
  22463. }
  22464. // VBOs
  22465. this._prepareBuffers();
  22466. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, effect);
  22467. // Draw order
  22468. engine.draw(true, 0, 6);
  22469. if (pp.onAfterRender) {
  22470. pp.onAfterRender(effect);
  22471. }
  22472. }
  22473. }
  22474. // Restore depth buffer
  22475. engine.setDepthBuffer(true);
  22476. engine.setDepthWrite(true);
  22477. };
  22478. PostProcessManager.prototype.dispose = function () {
  22479. if (this._vertexBuffer) {
  22480. this._scene.getEngine()._releaseBuffer(this._vertexBuffer);
  22481. this._vertexBuffer = null;
  22482. }
  22483. if (this._indexBuffer) {
  22484. this._scene.getEngine()._releaseBuffer(this._indexBuffer);
  22485. this._indexBuffer = null;
  22486. }
  22487. };
  22488. return PostProcessManager;
  22489. })();
  22490. BABYLON.PostProcessManager = PostProcessManager;
  22491. })(BABYLON || (BABYLON = {}));
  22492. var BABYLON;
  22493. (function (BABYLON) {
  22494. var PassPostProcess = (function (_super) {
  22495. __extends(PassPostProcess, _super);
  22496. function PassPostProcess(name, ratio, camera, samplingMode, engine, reusable) {
  22497. _super.call(this, name, "pass", null, null, ratio, camera, samplingMode, engine, reusable);
  22498. }
  22499. return PassPostProcess;
  22500. })(BABYLON.PostProcess);
  22501. BABYLON.PassPostProcess = PassPostProcess;
  22502. })(BABYLON || (BABYLON = {}));
  22503. var BABYLON;
  22504. (function (BABYLON) {
  22505. var PhysicsEngine = (function () {
  22506. function PhysicsEngine(plugin) {
  22507. this._currentPlugin = plugin || new BABYLON.OimoJSPlugin();
  22508. }
  22509. PhysicsEngine.prototype._initialize = function (gravity) {
  22510. this._currentPlugin.initialize();
  22511. this._setGravity(gravity);
  22512. };
  22513. PhysicsEngine.prototype._runOneStep = function (delta) {
  22514. if (delta > 0.1) {
  22515. delta = 0.1;
  22516. }
  22517. else if (delta <= 0) {
  22518. delta = 1.0 / 60.0;
  22519. }
  22520. this._currentPlugin.runOneStep(delta);
  22521. };
  22522. PhysicsEngine.prototype._setGravity = function (gravity) {
  22523. this.gravity = gravity || new BABYLON.Vector3(0, -9.807, 0);
  22524. this._currentPlugin.setGravity(this.gravity);
  22525. };
  22526. PhysicsEngine.prototype._registerMesh = function (mesh, impostor, options) {
  22527. return this._currentPlugin.registerMesh(mesh, impostor, options);
  22528. };
  22529. PhysicsEngine.prototype._registerMeshesAsCompound = function (parts, options) {
  22530. return this._currentPlugin.registerMeshesAsCompound(parts, options);
  22531. };
  22532. PhysicsEngine.prototype._unregisterMesh = function (mesh) {
  22533. this._currentPlugin.unregisterMesh(mesh);
  22534. };
  22535. PhysicsEngine.prototype._applyImpulse = function (mesh, force, contactPoint) {
  22536. this._currentPlugin.applyImpulse(mesh, force, contactPoint);
  22537. };
  22538. PhysicsEngine.prototype._createLink = function (mesh1, mesh2, pivot1, pivot2, options) {
  22539. return this._currentPlugin.createLink(mesh1, mesh2, pivot1, pivot2, options);
  22540. };
  22541. PhysicsEngine.prototype._updateBodyPosition = function (mesh) {
  22542. this._currentPlugin.updateBodyPosition(mesh);
  22543. };
  22544. PhysicsEngine.prototype.dispose = function () {
  22545. this._currentPlugin.dispose();
  22546. };
  22547. PhysicsEngine.prototype.isSupported = function () {
  22548. return this._currentPlugin.isSupported();
  22549. };
  22550. PhysicsEngine.prototype.getPhysicsBodyOfMesh = function (mesh) {
  22551. return this._currentPlugin.getPhysicsBodyOfMesh(mesh);
  22552. };
  22553. // Statics
  22554. PhysicsEngine.NoImpostor = 0;
  22555. PhysicsEngine.SphereImpostor = 1;
  22556. PhysicsEngine.BoxImpostor = 2;
  22557. PhysicsEngine.PlaneImpostor = 3;
  22558. PhysicsEngine.MeshImpostor = 4;
  22559. PhysicsEngine.CapsuleImpostor = 5;
  22560. PhysicsEngine.ConeImpostor = 6;
  22561. PhysicsEngine.CylinderImpostor = 7;
  22562. PhysicsEngine.ConvexHullImpostor = 8;
  22563. PhysicsEngine.HeightmapImpostor = 9;
  22564. PhysicsEngine.Epsilon = 0.001;
  22565. return PhysicsEngine;
  22566. })();
  22567. BABYLON.PhysicsEngine = PhysicsEngine;
  22568. })(BABYLON || (BABYLON = {}));
  22569. var BABYLON;
  22570. (function (BABYLON) {
  22571. var VertexData = (function () {
  22572. function VertexData() {
  22573. }
  22574. VertexData.prototype.set = function (data, kind) {
  22575. switch (kind) {
  22576. case BABYLON.VertexBuffer.PositionKind:
  22577. this.positions = data;
  22578. break;
  22579. case BABYLON.VertexBuffer.NormalKind:
  22580. this.normals = data;
  22581. break;
  22582. case BABYLON.VertexBuffer.UVKind:
  22583. this.uvs = data;
  22584. break;
  22585. case BABYLON.VertexBuffer.UV2Kind:
  22586. this.uvs2 = data;
  22587. break;
  22588. case BABYLON.VertexBuffer.UV3Kind:
  22589. this.uvs3 = data;
  22590. break;
  22591. case BABYLON.VertexBuffer.UV4Kind:
  22592. this.uvs4 = data;
  22593. break;
  22594. case BABYLON.VertexBuffer.UV5Kind:
  22595. this.uvs5 = data;
  22596. break;
  22597. case BABYLON.VertexBuffer.UV6Kind:
  22598. this.uvs6 = data;
  22599. break;
  22600. case BABYLON.VertexBuffer.ColorKind:
  22601. this.colors = data;
  22602. break;
  22603. case BABYLON.VertexBuffer.MatricesIndicesKind:
  22604. this.matricesIndices = data;
  22605. break;
  22606. case BABYLON.VertexBuffer.MatricesWeightsKind:
  22607. this.matricesWeights = data;
  22608. break;
  22609. }
  22610. };
  22611. VertexData.prototype.applyToMesh = function (mesh, updatable) {
  22612. this._applyTo(mesh, updatable);
  22613. };
  22614. VertexData.prototype.applyToGeometry = function (geometry, updatable) {
  22615. this._applyTo(geometry, updatable);
  22616. };
  22617. VertexData.prototype.updateMesh = function (mesh, updateExtends, makeItUnique) {
  22618. this._update(mesh);
  22619. };
  22620. VertexData.prototype.updateGeometry = function (geometry, updateExtends, makeItUnique) {
  22621. this._update(geometry);
  22622. };
  22623. VertexData.prototype._applyTo = function (meshOrGeometry, updatable) {
  22624. if (this.positions) {
  22625. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.PositionKind, this.positions, updatable);
  22626. }
  22627. if (this.normals) {
  22628. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.NormalKind, this.normals, updatable);
  22629. }
  22630. if (this.uvs) {
  22631. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.UVKind, this.uvs, updatable);
  22632. }
  22633. if (this.uvs2) {
  22634. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.UV2Kind, this.uvs2, updatable);
  22635. }
  22636. if (this.uvs3) {
  22637. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.UV3Kind, this.uvs3, updatable);
  22638. }
  22639. if (this.uvs4) {
  22640. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.UV4Kind, this.uvs4, updatable);
  22641. }
  22642. if (this.uvs5) {
  22643. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.UV5Kind, this.uvs5, updatable);
  22644. }
  22645. if (this.uvs6) {
  22646. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.UV6Kind, this.uvs6, updatable);
  22647. }
  22648. if (this.colors) {
  22649. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.ColorKind, this.colors, updatable);
  22650. }
  22651. if (this.matricesIndices) {
  22652. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, this.matricesIndices, updatable);
  22653. }
  22654. if (this.matricesWeights) {
  22655. meshOrGeometry.setVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind, this.matricesWeights, updatable);
  22656. }
  22657. if (this.indices) {
  22658. meshOrGeometry.setIndices(this.indices);
  22659. }
  22660. };
  22661. VertexData.prototype._update = function (meshOrGeometry, updateExtends, makeItUnique) {
  22662. if (this.positions) {
  22663. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.PositionKind, this.positions, updateExtends, makeItUnique);
  22664. }
  22665. if (this.normals) {
  22666. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.NormalKind, this.normals, updateExtends, makeItUnique);
  22667. }
  22668. if (this.uvs) {
  22669. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.UVKind, this.uvs, updateExtends, makeItUnique);
  22670. }
  22671. if (this.uvs2) {
  22672. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.UV2Kind, this.uvs2, updateExtends, makeItUnique);
  22673. }
  22674. if (this.uvs3) {
  22675. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.UV3Kind, this.uvs3, updateExtends, makeItUnique);
  22676. }
  22677. if (this.uvs4) {
  22678. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.UV4Kind, this.uvs4, updateExtends, makeItUnique);
  22679. }
  22680. if (this.uvs5) {
  22681. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.UV5Kind, this.uvs5, updateExtends, makeItUnique);
  22682. }
  22683. if (this.uvs6) {
  22684. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.UV6Kind, this.uvs6, updateExtends, makeItUnique);
  22685. }
  22686. if (this.colors) {
  22687. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.ColorKind, this.colors, updateExtends, makeItUnique);
  22688. }
  22689. if (this.matricesIndices) {
  22690. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, this.matricesIndices, updateExtends, makeItUnique);
  22691. }
  22692. if (this.matricesWeights) {
  22693. meshOrGeometry.updateVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind, this.matricesWeights, updateExtends, makeItUnique);
  22694. }
  22695. if (this.indices) {
  22696. meshOrGeometry.setIndices(this.indices);
  22697. }
  22698. };
  22699. VertexData.prototype.transform = function (matrix) {
  22700. var transformed = BABYLON.Vector3.Zero();
  22701. var index;
  22702. if (this.positions) {
  22703. var position = BABYLON.Vector3.Zero();
  22704. for (index = 0; index < this.positions.length; index += 3) {
  22705. BABYLON.Vector3.FromArrayToRef(this.positions, index, position);
  22706. BABYLON.Vector3.TransformCoordinatesToRef(position, matrix, transformed);
  22707. this.positions[index] = transformed.x;
  22708. this.positions[index + 1] = transformed.y;
  22709. this.positions[index + 2] = transformed.z;
  22710. }
  22711. }
  22712. if (this.normals) {
  22713. var normal = BABYLON.Vector3.Zero();
  22714. for (index = 0; index < this.normals.length; index += 3) {
  22715. BABYLON.Vector3.FromArrayToRef(this.normals, index, normal);
  22716. BABYLON.Vector3.TransformNormalToRef(normal, matrix, transformed);
  22717. this.normals[index] = transformed.x;
  22718. this.normals[index + 1] = transformed.y;
  22719. this.normals[index + 2] = transformed.z;
  22720. }
  22721. }
  22722. };
  22723. VertexData.prototype.merge = function (other) {
  22724. var index;
  22725. if (other.indices) {
  22726. if (!this.indices) {
  22727. this.indices = [];
  22728. }
  22729. var offset = this.positions ? this.positions.length / 3 : 0;
  22730. for (index = 0; index < other.indices.length; index++) {
  22731. this.indices.push(other.indices[index] + offset);
  22732. }
  22733. }
  22734. if (other.positions) {
  22735. if (!this.positions) {
  22736. this.positions = [];
  22737. }
  22738. for (index = 0; index < other.positions.length; index++) {
  22739. this.positions.push(other.positions[index]);
  22740. }
  22741. }
  22742. if (other.normals) {
  22743. if (!this.normals) {
  22744. this.normals = [];
  22745. }
  22746. for (index = 0; index < other.normals.length; index++) {
  22747. this.normals.push(other.normals[index]);
  22748. }
  22749. }
  22750. if (other.uvs) {
  22751. if (!this.uvs) {
  22752. this.uvs = [];
  22753. }
  22754. for (index = 0; index < other.uvs.length; index++) {
  22755. this.uvs.push(other.uvs[index]);
  22756. }
  22757. }
  22758. if (other.uvs2) {
  22759. if (!this.uvs2) {
  22760. this.uvs2 = [];
  22761. }
  22762. for (index = 0; index < other.uvs2.length; index++) {
  22763. this.uvs2.push(other.uvs2[index]);
  22764. }
  22765. }
  22766. if (other.uvs3) {
  22767. if (!this.uvs3) {
  22768. this.uvs3 = [];
  22769. }
  22770. for (index = 0; index < other.uvs3.length; index++) {
  22771. this.uvs3.push(other.uvs3[index]);
  22772. }
  22773. }
  22774. if (other.uvs4) {
  22775. if (!this.uvs4) {
  22776. this.uvs4 = [];
  22777. }
  22778. for (index = 0; index < other.uvs4.length; index++) {
  22779. this.uvs4.push(other.uvs4[index]);
  22780. }
  22781. }
  22782. if (other.uvs5) {
  22783. if (!this.uvs5) {
  22784. this.uvs5 = [];
  22785. }
  22786. for (index = 0; index < other.uvs5.length; index++) {
  22787. this.uvs5.push(other.uvs5[index]);
  22788. }
  22789. }
  22790. if (other.uvs6) {
  22791. if (!this.uvs6) {
  22792. this.uvs6 = [];
  22793. }
  22794. for (index = 0; index < other.uvs6.length; index++) {
  22795. this.uvs6.push(other.uvs6[index]);
  22796. }
  22797. }
  22798. if (other.matricesIndices) {
  22799. if (!this.matricesIndices) {
  22800. this.matricesIndices = [];
  22801. }
  22802. for (index = 0; index < other.matricesIndices.length; index++) {
  22803. this.matricesIndices.push(other.matricesIndices[index]);
  22804. }
  22805. }
  22806. if (other.matricesWeights) {
  22807. if (!this.matricesWeights) {
  22808. this.matricesWeights = [];
  22809. }
  22810. for (index = 0; index < other.matricesWeights.length; index++) {
  22811. this.matricesWeights.push(other.matricesWeights[index]);
  22812. }
  22813. }
  22814. if (other.colors) {
  22815. if (!this.colors) {
  22816. this.colors = [];
  22817. }
  22818. for (index = 0; index < other.colors.length; index++) {
  22819. this.colors.push(other.colors[index]);
  22820. }
  22821. }
  22822. };
  22823. // Statics
  22824. VertexData.ExtractFromMesh = function (mesh, copyWhenShared) {
  22825. return VertexData._ExtractFrom(mesh, copyWhenShared);
  22826. };
  22827. VertexData.ExtractFromGeometry = function (geometry, copyWhenShared) {
  22828. return VertexData._ExtractFrom(geometry, copyWhenShared);
  22829. };
  22830. VertexData._ExtractFrom = function (meshOrGeometry, copyWhenShared) {
  22831. var result = new VertexData();
  22832. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.PositionKind)) {
  22833. result.positions = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.PositionKind, copyWhenShared);
  22834. }
  22835. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) {
  22836. result.normals = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.NormalKind, copyWhenShared);
  22837. }
  22838. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  22839. result.uvs = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.UVKind, copyWhenShared);
  22840. }
  22841. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  22842. result.uvs2 = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.UV2Kind, copyWhenShared);
  22843. }
  22844. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.UV3Kind)) {
  22845. result.uvs3 = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.UV3Kind, copyWhenShared);
  22846. }
  22847. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.UV4Kind)) {
  22848. result.uvs4 = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.UV4Kind, copyWhenShared);
  22849. }
  22850. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.UV5Kind)) {
  22851. result.uvs5 = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.UV5Kind, copyWhenShared);
  22852. }
  22853. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.UV6Kind)) {
  22854. result.uvs6 = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.UV6Kind, copyWhenShared);
  22855. }
  22856. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.ColorKind)) {
  22857. result.colors = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.ColorKind, copyWhenShared);
  22858. }
  22859. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind)) {
  22860. result.matricesIndices = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind, copyWhenShared);
  22861. }
  22862. if (meshOrGeometry.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind)) {
  22863. result.matricesWeights = meshOrGeometry.getVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind, copyWhenShared);
  22864. }
  22865. result.indices = meshOrGeometry.getIndices(copyWhenShared);
  22866. return result;
  22867. };
  22868. VertexData.CreateRibbon = function (options) {
  22869. var pathArray = options.pathArray;
  22870. var closeArray = options.closeArray || false;
  22871. var closePath = options.closePath || false;
  22872. var defaultOffset = Math.floor(pathArray[0].length / 2);
  22873. var offset = options.offset || defaultOffset;
  22874. offset = offset > defaultOffset ? defaultOffset : Math.floor(offset); // offset max allowed : defaultOffset
  22875. var sideOrientation = (options.sideOrientation === 0) ? 0 : options.sideOrientation || BABYLON.Mesh.DEFAULTSIDE;
  22876. var positions = [];
  22877. var indices = [];
  22878. var normals = [];
  22879. var uvs = [];
  22880. var us = []; // us[path_id] = [uDist1, uDist2, uDist3 ... ] distances between points on path path_id
  22881. var vs = []; // vs[i] = [vDist1, vDist2, vDist3, ... ] distances between points i of consecutives paths from pathArray
  22882. var uTotalDistance = []; // uTotalDistance[p] : total distance of path p
  22883. var vTotalDistance = []; // vTotalDistance[i] : total distance between points i of first and last path from pathArray
  22884. var minlg; // minimal length among all paths from pathArray
  22885. var lg = []; // array of path lengths : nb of vertex per path
  22886. var idx = []; // array of path indexes : index of each path (first vertex) in the total vertex number
  22887. var p; // path iterator
  22888. var i; // point iterator
  22889. var j; // point iterator
  22890. // if single path in pathArray
  22891. if (pathArray.length < 2) {
  22892. var ar1 = [];
  22893. var ar2 = [];
  22894. for (i = 0; i < pathArray[0].length - offset; i++) {
  22895. ar1.push(pathArray[0][i]);
  22896. ar2.push(pathArray[0][i + offset]);
  22897. }
  22898. pathArray = [ar1, ar2];
  22899. }
  22900. // positions and horizontal distances (u)
  22901. var idc = 0;
  22902. var closePathCorr = (closePath) ? 1 : 0;
  22903. var path;
  22904. var l;
  22905. minlg = pathArray[0].length;
  22906. var vectlg;
  22907. var dist;
  22908. for (p = 0; p < pathArray.length; p++) {
  22909. uTotalDistance[p] = 0;
  22910. us[p] = [0];
  22911. path = pathArray[p];
  22912. l = path.length;
  22913. minlg = (minlg < l) ? minlg : l;
  22914. j = 0;
  22915. while (j < l) {
  22916. positions.push(path[j].x, path[j].y, path[j].z);
  22917. if (j > 0) {
  22918. vectlg = path[j].subtract(path[j - 1]).length();
  22919. dist = vectlg + uTotalDistance[p];
  22920. us[p].push(dist);
  22921. uTotalDistance[p] = dist;
  22922. }
  22923. j++;
  22924. }
  22925. if (closePath) {
  22926. j--;
  22927. positions.push(path[0].x, path[0].y, path[0].z);
  22928. vectlg = path[j].subtract(path[0]).length();
  22929. dist = vectlg + uTotalDistance[p];
  22930. us[p].push(dist);
  22931. uTotalDistance[p] = dist;
  22932. }
  22933. lg[p] = l + closePathCorr;
  22934. idx[p] = idc;
  22935. idc += (l + closePathCorr);
  22936. }
  22937. // vertical distances (v)
  22938. var path1;
  22939. var path2;
  22940. var vertex1;
  22941. var vertex2;
  22942. for (i = 0; i < minlg + closePathCorr; i++) {
  22943. vTotalDistance[i] = 0;
  22944. vs[i] = [0];
  22945. for (p = 0; p < pathArray.length - 1; p++) {
  22946. path1 = pathArray[p];
  22947. path2 = pathArray[p + 1];
  22948. if (i === minlg) {
  22949. vertex1 = path1[0];
  22950. vertex2 = path2[0];
  22951. }
  22952. else {
  22953. vertex1 = path1[i];
  22954. vertex2 = path2[i];
  22955. }
  22956. vectlg = vertex2.subtract(vertex1).length();
  22957. dist = vectlg + vTotalDistance[i];
  22958. vs[i].push(dist);
  22959. vTotalDistance[i] = dist;
  22960. }
  22961. if (closeArray) {
  22962. path1 = pathArray[p];
  22963. path2 = pathArray[0];
  22964. if (i === minlg) {
  22965. vertex2 = path2[0];
  22966. }
  22967. vectlg = vertex2.subtract(vertex1).length();
  22968. dist = vectlg + vTotalDistance[i];
  22969. vTotalDistance[i] = dist;
  22970. }
  22971. }
  22972. // uvs
  22973. var u;
  22974. var v;
  22975. for (p = 0; p < pathArray.length; p++) {
  22976. for (i = 0; i < minlg + closePathCorr; i++) {
  22977. u = us[p][i] / uTotalDistance[p];
  22978. v = vs[i][p] / vTotalDistance[i];
  22979. uvs.push(u, v);
  22980. }
  22981. }
  22982. // indices
  22983. p = 0; // path index
  22984. var pi = 0; // positions array index
  22985. var l1 = lg[p] - 1; // path1 length
  22986. var l2 = lg[p + 1] - 1; // path2 length
  22987. var min = (l1 < l2) ? l1 : l2; // current path stop index
  22988. var shft = idx[1] - idx[0]; // shift
  22989. var path1nb = closeArray ? lg.length : lg.length - 1; // number of path1 to iterate on
  22990. while (pi <= min && p < path1nb) {
  22991. // draw two triangles between path1 (p1) and path2 (p2) : (p1.pi, p2.pi, p1.pi+1) and (p2.pi+1, p1.pi+1, p2.pi) clockwise
  22992. indices.push(pi, pi + shft, pi + 1);
  22993. indices.push(pi + shft + 1, pi + 1, pi + shft);
  22994. pi += 1;
  22995. if (pi === min) {
  22996. p++;
  22997. if (p === lg.length - 1) {
  22998. shft = idx[0] - idx[p];
  22999. l1 = lg[p] - 1;
  23000. l2 = lg[0] - 1;
  23001. }
  23002. else {
  23003. shft = idx[p + 1] - idx[p];
  23004. l1 = lg[p] - 1;
  23005. l2 = lg[p + 1] - 1;
  23006. }
  23007. pi = idx[p];
  23008. min = (l1 < l2) ? l1 + pi : l2 + pi;
  23009. }
  23010. }
  23011. // normals
  23012. VertexData.ComputeNormals(positions, indices, normals);
  23013. if (closePath) {
  23014. var indexFirst = 0;
  23015. var indexLast = 0;
  23016. for (p = 0; p < pathArray.length; p++) {
  23017. indexFirst = idx[p] * 3;
  23018. if (p + 1 < pathArray.length) {
  23019. indexLast = (idx[p + 1] - 1) * 3;
  23020. }
  23021. else {
  23022. indexLast = normals.length - 3;
  23023. }
  23024. normals[indexFirst] = (normals[indexFirst] + normals[indexLast]) * 0.5;
  23025. normals[indexFirst + 1] = (normals[indexFirst + 1] + normals[indexLast + 1]) * 0.5;
  23026. normals[indexFirst + 2] = (normals[indexFirst + 2] + normals[indexLast + 2]) * 0.5;
  23027. normals[indexLast] = normals[indexFirst];
  23028. normals[indexLast + 1] = normals[indexFirst + 1];
  23029. normals[indexLast + 2] = normals[indexFirst + 2];
  23030. }
  23031. }
  23032. // sides
  23033. VertexData._ComputeSides(sideOrientation, positions, indices, normals, uvs);
  23034. // Result
  23035. var vertexData = new VertexData();
  23036. vertexData.indices = indices;
  23037. vertexData.positions = positions;
  23038. vertexData.normals = normals;
  23039. vertexData.uvs = uvs;
  23040. if (closePath) {
  23041. vertexData._idx = idx;
  23042. }
  23043. return vertexData;
  23044. };
  23045. VertexData.CreateBox = function (options) {
  23046. var normalsSource = [
  23047. new BABYLON.Vector3(0, 0, 1),
  23048. new BABYLON.Vector3(0, 0, -1),
  23049. new BABYLON.Vector3(1, 0, 0),
  23050. new BABYLON.Vector3(-1, 0, 0),
  23051. new BABYLON.Vector3(0, 1, 0),
  23052. new BABYLON.Vector3(0, -1, 0)
  23053. ];
  23054. var indices = [];
  23055. var positions = [];
  23056. var normals = [];
  23057. var uvs = [];
  23058. var width = options.width || options.size || 1;
  23059. var height = options.height || options.size || 1;
  23060. var depth = options.depth || options.size || 1;
  23061. var sideOrientation = (options.sideOrientation === 0) ? 0 : options.sideOrientation || BABYLON.Mesh.DEFAULTSIDE;
  23062. var faceUV = options.faceUV || new Array(6);
  23063. var faceColors = options.faceColors;
  23064. var colors = [];
  23065. // default face colors and UV if undefined
  23066. for (var f = 0; f < 6; f++) {
  23067. if (faceUV[f] === undefined) {
  23068. faceUV[f] = new BABYLON.Vector4(0, 0, 1, 1);
  23069. }
  23070. if (faceColors && faceColors[f] === undefined) {
  23071. faceColors[f] = new BABYLON.Color4(1, 1, 1, 1);
  23072. }
  23073. }
  23074. var scaleVector = new BABYLON.Vector3(width / 2, height / 2, depth / 2);
  23075. // Create each face in turn.
  23076. for (var index = 0; index < normalsSource.length; index++) {
  23077. var normal = normalsSource[index];
  23078. // Get two vectors perpendicular to the face normal and to each other.
  23079. var side1 = new BABYLON.Vector3(normal.y, normal.z, normal.x);
  23080. var side2 = BABYLON.Vector3.Cross(normal, side1);
  23081. // Six indices (two triangles) per face.
  23082. var verticesLength = positions.length / 3;
  23083. indices.push(verticesLength);
  23084. indices.push(verticesLength + 1);
  23085. indices.push(verticesLength + 2);
  23086. indices.push(verticesLength);
  23087. indices.push(verticesLength + 2);
  23088. indices.push(verticesLength + 3);
  23089. // Four vertices per face.
  23090. var vertex = normal.subtract(side1).subtract(side2).multiply(scaleVector);
  23091. positions.push(vertex.x, vertex.y, vertex.z);
  23092. normals.push(normal.x, normal.y, normal.z);
  23093. uvs.push(faceUV[index].z, faceUV[index].w);
  23094. if (faceColors) {
  23095. colors.push(faceColors[index].r, faceColors[index].g, faceColors[index].b, faceColors[index].a);
  23096. }
  23097. vertex = normal.subtract(side1).add(side2).multiply(scaleVector);
  23098. positions.push(vertex.x, vertex.y, vertex.z);
  23099. normals.push(normal.x, normal.y, normal.z);
  23100. uvs.push(faceUV[index].x, faceUV[index].w);
  23101. if (faceColors) {
  23102. colors.push(faceColors[index].r, faceColors[index].g, faceColors[index].b, faceColors[index].a);
  23103. }
  23104. vertex = normal.add(side1).add(side2).multiply(scaleVector);
  23105. positions.push(vertex.x, vertex.y, vertex.z);
  23106. normals.push(normal.x, normal.y, normal.z);
  23107. uvs.push(faceUV[index].x, faceUV[index].y);
  23108. if (faceColors) {
  23109. colors.push(faceColors[index].r, faceColors[index].g, faceColors[index].b, faceColors[index].a);
  23110. }
  23111. vertex = normal.add(side1).subtract(side2).multiply(scaleVector);
  23112. positions.push(vertex.x, vertex.y, vertex.z);
  23113. normals.push(normal.x, normal.y, normal.z);
  23114. uvs.push(faceUV[index].z, faceUV[index].y);
  23115. if (faceColors) {
  23116. colors.push(faceColors[index].r, faceColors[index].g, faceColors[index].b, faceColors[index].a);
  23117. }
  23118. }
  23119. // sides
  23120. VertexData._ComputeSides(sideOrientation, positions, indices, normals, uvs);
  23121. // Result
  23122. var vertexData = new VertexData();
  23123. vertexData.indices = indices;
  23124. vertexData.positions = positions;
  23125. vertexData.normals = normals;
  23126. vertexData.uvs = uvs;
  23127. if (faceColors) {
  23128. var totalColors = (sideOrientation === BABYLON.Mesh.DOUBLESIDE) ? colors.concat(colors) : colors;
  23129. vertexData.colors = totalColors;
  23130. }
  23131. return vertexData;
  23132. };
  23133. VertexData.CreateSphere = function (options) {
  23134. var segments = options.segments || 32;
  23135. var diameterX = options.diameterX || options.diameter || 1;
  23136. var diameterY = options.diameterY || options.diameter || 1;
  23137. var diameterZ = options.diameterZ || options.diameter || 1;
  23138. var arc = (options.arc <= 0) ? 1.0 : options.arc || 1.0;
  23139. var slice = (options.slice <= 0) ? 1.0 : options.slice || 1.0;
  23140. var sideOrientation = (options.sideOrientation === 0) ? 0 : options.sideOrientation || BABYLON.Mesh.DEFAULTSIDE;
  23141. var radius = new BABYLON.Vector3(diameterX / 2, diameterY / 2, diameterZ / 2);
  23142. var totalZRotationSteps = 2 + segments;
  23143. var totalYRotationSteps = 2 * totalZRotationSteps;
  23144. var indices = [];
  23145. var positions = [];
  23146. var normals = [];
  23147. var uvs = [];
  23148. for (var zRotationStep = 0; zRotationStep <= totalZRotationSteps; zRotationStep++) {
  23149. var normalizedZ = zRotationStep / totalZRotationSteps;
  23150. var angleZ = normalizedZ * Math.PI * slice;
  23151. for (var yRotationStep = 0; yRotationStep <= totalYRotationSteps; yRotationStep++) {
  23152. var normalizedY = yRotationStep / totalYRotationSteps;
  23153. var angleY = normalizedY * Math.PI * 2 * arc;
  23154. var rotationZ = BABYLON.Matrix.RotationZ(-angleZ);
  23155. var rotationY = BABYLON.Matrix.RotationY(angleY);
  23156. var afterRotZ = BABYLON.Vector3.TransformCoordinates(BABYLON.Vector3.Up(), rotationZ);
  23157. var complete = BABYLON.Vector3.TransformCoordinates(afterRotZ, rotationY);
  23158. var vertex = complete.multiply(radius);
  23159. var normal = BABYLON.Vector3.Normalize(vertex);
  23160. positions.push(vertex.x, vertex.y, vertex.z);
  23161. normals.push(normal.x, normal.y, normal.z);
  23162. uvs.push(normalizedY, normalizedZ);
  23163. }
  23164. if (zRotationStep > 0) {
  23165. var verticesCount = positions.length / 3;
  23166. for (var firstIndex = verticesCount - 2 * (totalYRotationSteps + 1); (firstIndex + totalYRotationSteps + 2) < verticesCount; firstIndex++) {
  23167. indices.push((firstIndex));
  23168. indices.push((firstIndex + 1));
  23169. indices.push(firstIndex + totalYRotationSteps + 1);
  23170. indices.push((firstIndex + totalYRotationSteps + 1));
  23171. indices.push((firstIndex + 1));
  23172. indices.push((firstIndex + totalYRotationSteps + 2));
  23173. }
  23174. }
  23175. }
  23176. // Sides
  23177. VertexData._ComputeSides(sideOrientation, positions, indices, normals, uvs);
  23178. // Result
  23179. var vertexData = new VertexData();
  23180. vertexData.indices = indices;
  23181. vertexData.positions = positions;
  23182. vertexData.normals = normals;
  23183. vertexData.uvs = uvs;
  23184. return vertexData;
  23185. };
  23186. // Cylinder and cone
  23187. VertexData.CreateCylinder = function (options) {
  23188. var height = options.height || 2;
  23189. var diameterTop = (options.diameterTop === 0) ? 0 : options.diameterTop || options.diameter || 1;
  23190. var diameterBottom = options.diameterBottom || options.diameter || 1;
  23191. var tessellation = options.tessellation || 24;
  23192. var subdivisions = options.subdivisions || 1;
  23193. var arc = (options.arc <= 0) ? 1.0 : options.arc || 1.0;
  23194. var sideOrientation = (options.sideOrientation === 0) ? 0 : options.sideOrientation || BABYLON.Mesh.DEFAULTSIDE;
  23195. var faceUV = options.faceUV || new Array(3);
  23196. var faceColors = options.faceColors;
  23197. // default face colors and UV if undefined
  23198. for (var f = 0; f < 3; f++) {
  23199. if (faceColors && faceColors[f] === undefined) {
  23200. faceColors[f] = new BABYLON.Color4(1, 1, 1, 1);
  23201. }
  23202. if (faceUV && faceUV[f] === undefined) {
  23203. faceUV[f] = new BABYLON.Vector4(0, 0, 1, 1);
  23204. }
  23205. }
  23206. var indices = [];
  23207. var positions = [];
  23208. var normals = [];
  23209. var uvs = [];
  23210. var colors = [];
  23211. var angle_step = Math.PI * 2 * arc / tessellation;
  23212. var angle;
  23213. var h;
  23214. var radius;
  23215. var tan = (diameterBottom - diameterTop) / 2 / height;
  23216. var ringVertex = BABYLON.Vector3.Zero();
  23217. var ringNormal = BABYLON.Vector3.Zero();
  23218. // positions, normals, uvs
  23219. var i;
  23220. var j;
  23221. for (i = 0; i <= subdivisions; i++) {
  23222. h = i / subdivisions;
  23223. radius = (h * (diameterTop - diameterBottom) + diameterBottom) / 2;
  23224. for (j = 0; j <= tessellation; j++) {
  23225. angle = j * angle_step;
  23226. ringVertex.x = Math.cos(-angle) * radius;
  23227. ringVertex.y = -height / 2 + h * height;
  23228. ringVertex.z = Math.sin(-angle) * radius;
  23229. if (diameterTop === 0 && i === subdivisions) {
  23230. // if no top cap, reuse former normals
  23231. ringNormal.x = normals[normals.length - (tessellation + 1) * 3];
  23232. ringNormal.y = normals[normals.length - (tessellation + 1) * 3 + 1];
  23233. ringNormal.z = normals[normals.length - (tessellation + 1) * 3 + 2];
  23234. }
  23235. else {
  23236. ringNormal.x = ringVertex.x;
  23237. ringNormal.z = ringVertex.z;
  23238. ringNormal.y = Math.sqrt(ringNormal.x * ringNormal.x + ringNormal.z * ringNormal.z) * tan;
  23239. ringNormal.normalize();
  23240. }
  23241. positions.push(ringVertex.x, ringVertex.y, ringVertex.z);
  23242. normals.push(ringNormal.x, ringNormal.y, ringNormal.z);
  23243. uvs.push(faceUV[1].x + (faceUV[1].z - faceUV[1].x) * j / tessellation, faceUV[1].y + (faceUV[1].w - faceUV[1].y) * h);
  23244. if (faceColors) {
  23245. colors.push(faceColors[1].r, faceColors[1].g, faceColors[1].b, faceColors[1].a);
  23246. }
  23247. }
  23248. }
  23249. // indices
  23250. for (i = 0; i < subdivisions; i++) {
  23251. for (j = 0; j < tessellation; j++) {
  23252. var i0 = i * (tessellation + 1) + j;
  23253. var i1 = (i + 1) * (tessellation + 1) + j;
  23254. var i2 = i * (tessellation + 1) + (j + 1);
  23255. var i3 = (i + 1) * (tessellation + 1) + (j + 1);
  23256. indices.push(i0, i1, i2);
  23257. indices.push(i3, i2, i1);
  23258. }
  23259. }
  23260. // Caps
  23261. var createCylinderCap = function (isTop) {
  23262. var radius = isTop ? diameterTop / 2 : diameterBottom / 2;
  23263. if (radius === 0) {
  23264. return;
  23265. }
  23266. // Cap positions, normals & uvs
  23267. var angle;
  23268. var circleVector;
  23269. var i;
  23270. var u = (isTop) ? faceUV[2] : faceUV[0];
  23271. var c;
  23272. if (faceColors) {
  23273. c = (isTop) ? faceColors[2] : faceColors[0];
  23274. }
  23275. // cap center
  23276. var vbase = positions.length / 3;
  23277. var offset = isTop ? height / 2 : -height / 2;
  23278. var center = new BABYLON.Vector3(0, offset, 0);
  23279. positions.push(center.x, center.y, center.z);
  23280. normals.push(0, isTop ? 1 : -1, 0);
  23281. uvs.push(u.x + (u.z - u.x) * 0.5, u.y + (u.w - u.y) * 0.5);
  23282. if (faceColors) {
  23283. colors.push(c.r, c.g, c.b, c.a);
  23284. }
  23285. var textureScale = new BABYLON.Vector2(0.5, 0.5);
  23286. for (i = 0; i <= tessellation; i++) {
  23287. angle = Math.PI * 2 * i * arc / tessellation;
  23288. var cos = Math.cos(-angle);
  23289. var sin = Math.sin(-angle);
  23290. circleVector = new BABYLON.Vector3(cos * radius, offset, sin * radius);
  23291. var textureCoordinate = new BABYLON.Vector2(cos * textureScale.x + 0.5, sin * textureScale.y + 0.5);
  23292. positions.push(circleVector.x, circleVector.y, circleVector.z);
  23293. normals.push(0, isTop ? 1 : -1, 0);
  23294. uvs.push(u.x + (u.z - u.x) * textureCoordinate.x, u.y + (u.w - u.y) * textureCoordinate.y);
  23295. if (faceColors) {
  23296. colors.push(c.r, c.g, c.b, c.a);
  23297. }
  23298. }
  23299. // Cap indices
  23300. for (i = 0; i < tessellation; i++) {
  23301. if (!isTop) {
  23302. indices.push(vbase);
  23303. indices.push(vbase + (i + 1));
  23304. indices.push(vbase + (i + 2));
  23305. }
  23306. else {
  23307. indices.push(vbase);
  23308. indices.push(vbase + (i + 2));
  23309. indices.push(vbase + (i + 1));
  23310. }
  23311. }
  23312. };
  23313. // add caps to geometry
  23314. createCylinderCap(false);
  23315. createCylinderCap(true);
  23316. // Sides
  23317. VertexData._ComputeSides(sideOrientation, positions, indices, normals, uvs);
  23318. var vertexData = new VertexData();
  23319. vertexData.indices = indices;
  23320. vertexData.positions = positions;
  23321. vertexData.normals = normals;
  23322. vertexData.uvs = uvs;
  23323. if (faceColors) {
  23324. vertexData.colors = colors;
  23325. }
  23326. return vertexData;
  23327. };
  23328. VertexData.CreateTorus = function (options) {
  23329. var indices = [];
  23330. var positions = [];
  23331. var normals = [];
  23332. var uvs = [];
  23333. var diameter = options.diameter || 1;
  23334. var thickness = options.thickness || 0.5;
  23335. var tessellation = options.tessellation || 16;
  23336. var sideOrientation = (options.sideOrientation === 0) ? 0 : options.sideOrientation || BABYLON.Mesh.DEFAULTSIDE;
  23337. var stride = tessellation + 1;
  23338. for (var i = 0; i <= tessellation; i++) {
  23339. var u = i / tessellation;
  23340. var outerAngle = i * Math.PI * 2.0 / tessellation - Math.PI / 2.0;
  23341. var transform = BABYLON.Matrix.Translation(diameter / 2.0, 0, 0).multiply(BABYLON.Matrix.RotationY(outerAngle));
  23342. for (var j = 0; j <= tessellation; j++) {
  23343. var v = 1 - j / tessellation;
  23344. var innerAngle = j * Math.PI * 2.0 / tessellation + Math.PI;
  23345. var dx = Math.cos(innerAngle);
  23346. var dy = Math.sin(innerAngle);
  23347. // Create a vertex.
  23348. var normal = new BABYLON.Vector3(dx, dy, 0);
  23349. var position = normal.scale(thickness / 2);
  23350. var textureCoordinate = new BABYLON.Vector2(u, v);
  23351. position = BABYLON.Vector3.TransformCoordinates(position, transform);
  23352. normal = BABYLON.Vector3.TransformNormal(normal, transform);
  23353. positions.push(position.x, position.y, position.z);
  23354. normals.push(normal.x, normal.y, normal.z);
  23355. uvs.push(textureCoordinate.x, textureCoordinate.y);
  23356. // And create indices for two triangles.
  23357. var nextI = (i + 1) % stride;
  23358. var nextJ = (j + 1) % stride;
  23359. indices.push(i * stride + j);
  23360. indices.push(i * stride + nextJ);
  23361. indices.push(nextI * stride + j);
  23362. indices.push(i * stride + nextJ);
  23363. indices.push(nextI * stride + nextJ);
  23364. indices.push(nextI * stride + j);
  23365. }
  23366. }
  23367. // Sides
  23368. VertexData._ComputeSides(sideOrientation, positions, indices, normals, uvs);
  23369. // Result
  23370. var vertexData = new VertexData();
  23371. vertexData.indices = indices;
  23372. vertexData.positions = positions;
  23373. vertexData.normals = normals;
  23374. vertexData.uvs = uvs;
  23375. return vertexData;
  23376. };
  23377. VertexData.CreateLines = function (options) {
  23378. var indices = [];
  23379. var positions = [];
  23380. var points = options.points;
  23381. for (var index = 0; index < points.length; index++) {
  23382. positions.push(points[index].x, points[index].y, points[index].z);
  23383. if (index > 0) {
  23384. indices.push(index - 1);
  23385. indices.push(index);
  23386. }
  23387. }
  23388. // Result
  23389. var vertexData = new VertexData();
  23390. vertexData.indices = indices;
  23391. vertexData.positions = positions;
  23392. return vertexData;
  23393. };
  23394. VertexData.CreateDashedLines = function (options) {
  23395. var dashSize = options.dashSize || 3;
  23396. var gapSize = options.gapSize || 1;
  23397. var dashNb = options.dashNb || 200;
  23398. var points = options.points;
  23399. var positions = new Array();
  23400. var indices = new Array();
  23401. var curvect = BABYLON.Vector3.Zero();
  23402. var lg = 0;
  23403. var nb = 0;
  23404. var shft = 0;
  23405. var dashshft = 0;
  23406. var curshft = 0;
  23407. var idx = 0;
  23408. var i = 0;
  23409. for (i = 0; i < points.length - 1; i++) {
  23410. points[i + 1].subtractToRef(points[i], curvect);
  23411. lg += curvect.length();
  23412. }
  23413. shft = lg / dashNb;
  23414. dashshft = dashSize * shft / (dashSize + gapSize);
  23415. for (i = 0; i < points.length - 1; i++) {
  23416. points[i + 1].subtractToRef(points[i], curvect);
  23417. nb = Math.floor(curvect.length() / shft);
  23418. curvect.normalize();
  23419. for (var j = 0; j < nb; j++) {
  23420. curshft = shft * j;
  23421. positions.push(points[i].x + curshft * curvect.x, points[i].y + curshft * curvect.y, points[i].z + curshft * curvect.z);
  23422. positions.push(points[i].x + (curshft + dashshft) * curvect.x, points[i].y + (curshft + dashshft) * curvect.y, points[i].z + (curshft + dashshft) * curvect.z);
  23423. indices.push(idx, idx + 1);
  23424. idx += 2;
  23425. }
  23426. }
  23427. // Result
  23428. var vertexData = new VertexData();
  23429. vertexData.positions = positions;
  23430. vertexData.indices = indices;
  23431. return vertexData;
  23432. };
  23433. VertexData.CreateGround = function (options) {
  23434. var indices = [];
  23435. var positions = [];
  23436. var normals = [];
  23437. var uvs = [];
  23438. var row, col;
  23439. var width = options.width || 1;
  23440. var height = options.height || 1;
  23441. var subdivisions = options.subdivisions || 1;
  23442. for (row = 0; row <= subdivisions; row++) {
  23443. for (col = 0; col <= subdivisions; col++) {
  23444. var position = new BABYLON.Vector3((col * width) / subdivisions - (width / 2.0), 0, ((subdivisions - row) * height) / subdivisions - (height / 2.0));
  23445. var normal = new BABYLON.Vector3(0, 1.0, 0);
  23446. positions.push(position.x, position.y, position.z);
  23447. normals.push(normal.x, normal.y, normal.z);
  23448. uvs.push(col / subdivisions, 1.0 - row / subdivisions);
  23449. }
  23450. }
  23451. for (row = 0; row < subdivisions; row++) {
  23452. for (col = 0; col < subdivisions; col++) {
  23453. indices.push(col + 1 + (row + 1) * (subdivisions + 1));
  23454. indices.push(col + 1 + row * (subdivisions + 1));
  23455. indices.push(col + row * (subdivisions + 1));
  23456. indices.push(col + (row + 1) * (subdivisions + 1));
  23457. indices.push(col + 1 + (row + 1) * (subdivisions + 1));
  23458. indices.push(col + row * (subdivisions + 1));
  23459. }
  23460. }
  23461. // Result
  23462. var vertexData = new VertexData();
  23463. vertexData.indices = indices;
  23464. vertexData.positions = positions;
  23465. vertexData.normals = normals;
  23466. vertexData.uvs = uvs;
  23467. return vertexData;
  23468. };
  23469. VertexData.CreateTiledGround = function (options) {
  23470. var xmin = options.xmin;
  23471. var zmin = options.zmin;
  23472. var xmax = options.xmax;
  23473. var zmax = options.zmax;
  23474. var subdivisions = options.subdivisions || { w: 1, h: 1 };
  23475. var precision = options.precision || { w: 1, h: 1 };
  23476. var indices = [];
  23477. var positions = [];
  23478. var normals = [];
  23479. var uvs = [];
  23480. var row, col, tileRow, tileCol;
  23481. subdivisions.h = (subdivisions.w < 1) ? 1 : subdivisions.h;
  23482. subdivisions.w = (subdivisions.w < 1) ? 1 : subdivisions.w;
  23483. precision.w = (precision.w < 1) ? 1 : precision.w;
  23484. precision.h = (precision.h < 1) ? 1 : precision.h;
  23485. var tileSize = {
  23486. 'w': (xmax - xmin) / subdivisions.w,
  23487. 'h': (zmax - zmin) / subdivisions.h
  23488. };
  23489. function applyTile(xTileMin, zTileMin, xTileMax, zTileMax) {
  23490. // Indices
  23491. var base = positions.length / 3;
  23492. var rowLength = precision.w + 1;
  23493. for (row = 0; row < precision.h; row++) {
  23494. for (col = 0; col < precision.w; col++) {
  23495. var square = [
  23496. base + col + row * rowLength,
  23497. base + (col + 1) + row * rowLength,
  23498. base + (col + 1) + (row + 1) * rowLength,
  23499. base + col + (row + 1) * rowLength
  23500. ];
  23501. indices.push(square[1]);
  23502. indices.push(square[2]);
  23503. indices.push(square[3]);
  23504. indices.push(square[0]);
  23505. indices.push(square[1]);
  23506. indices.push(square[3]);
  23507. }
  23508. }
  23509. // Position, normals and uvs
  23510. var position = BABYLON.Vector3.Zero();
  23511. var normal = new BABYLON.Vector3(0, 1.0, 0);
  23512. for (row = 0; row <= precision.h; row++) {
  23513. position.z = (row * (zTileMax - zTileMin)) / precision.h + zTileMin;
  23514. for (col = 0; col <= precision.w; col++) {
  23515. position.x = (col * (xTileMax - xTileMin)) / precision.w + xTileMin;
  23516. position.y = 0;
  23517. positions.push(position.x, position.y, position.z);
  23518. normals.push(normal.x, normal.y, normal.z);
  23519. uvs.push(col / precision.w, row / precision.h);
  23520. }
  23521. }
  23522. }
  23523. for (tileRow = 0; tileRow < subdivisions.h; tileRow++) {
  23524. for (tileCol = 0; tileCol < subdivisions.w; tileCol++) {
  23525. applyTile(xmin + tileCol * tileSize.w, zmin + tileRow * tileSize.h, xmin + (tileCol + 1) * tileSize.w, zmin + (tileRow + 1) * tileSize.h);
  23526. }
  23527. }
  23528. // Result
  23529. var vertexData = new VertexData();
  23530. vertexData.indices = indices;
  23531. vertexData.positions = positions;
  23532. vertexData.normals = normals;
  23533. vertexData.uvs = uvs;
  23534. return vertexData;
  23535. };
  23536. VertexData.CreateGroundFromHeightMap = function (options) {
  23537. var indices = [];
  23538. var positions = [];
  23539. var normals = [];
  23540. var uvs = [];
  23541. var row, col;
  23542. // Vertices
  23543. for (row = 0; row <= options.subdivisions; row++) {
  23544. for (col = 0; col <= options.subdivisions; col++) {
  23545. var position = new BABYLON.Vector3((col * options.width) / options.subdivisions - (options.width / 2.0), 0, ((options.subdivisions - row) * options.height) / options.subdivisions - (options.height / 2.0));
  23546. // Compute height
  23547. var heightMapX = (((position.x + options.width / 2) / options.width) * (options.bufferWidth - 1)) | 0;
  23548. var heightMapY = ((1.0 - (position.z + options.height / 2) / options.height) * (options.bufferHeight - 1)) | 0;
  23549. var pos = (heightMapX + heightMapY * options.bufferWidth) * 4;
  23550. var r = options.buffer[pos] / 255.0;
  23551. var g = options.buffer[pos + 1] / 255.0;
  23552. var b = options.buffer[pos + 2] / 255.0;
  23553. var gradient = r * 0.3 + g * 0.59 + b * 0.11;
  23554. position.y = options.minHeight + (options.maxHeight - options.minHeight) * gradient;
  23555. // Add vertex
  23556. positions.push(position.x, position.y, position.z);
  23557. normals.push(0, 0, 0);
  23558. uvs.push(col / options.subdivisions, 1.0 - row / options.subdivisions);
  23559. }
  23560. }
  23561. // Indices
  23562. for (row = 0; row < options.subdivisions; row++) {
  23563. for (col = 0; col < options.subdivisions; col++) {
  23564. indices.push(col + 1 + (row + 1) * (options.subdivisions + 1));
  23565. indices.push(col + 1 + row * (options.subdivisions + 1));
  23566. indices.push(col + row * (options.subdivisions + 1));
  23567. indices.push(col + (row + 1) * (options.subdivisions + 1));
  23568. indices.push(col + 1 + (row + 1) * (options.subdivisions + 1));
  23569. indices.push(col + row * (options.subdivisions + 1));
  23570. }
  23571. }
  23572. // Normals
  23573. VertexData.ComputeNormals(positions, indices, normals);
  23574. // Result
  23575. var vertexData = new VertexData();
  23576. vertexData.indices = indices;
  23577. vertexData.positions = positions;
  23578. vertexData.normals = normals;
  23579. vertexData.uvs = uvs;
  23580. return vertexData;
  23581. };
  23582. VertexData.CreatePlane = function (options) {
  23583. var indices = [];
  23584. var positions = [];
  23585. var normals = [];
  23586. var uvs = [];
  23587. var width = options.width || options.size || 1;
  23588. var height = options.height || options.size || 1;
  23589. var sideOrientation = (options.sideOrientation === 0) ? 0 : options.sideOrientation || BABYLON.Mesh.DEFAULTSIDE;
  23590. // Vertices
  23591. var halfWidth = width / 2.0;
  23592. var halfHeight = height / 2.0;
  23593. positions.push(-halfWidth, -halfHeight, 0);
  23594. normals.push(0, 0, -1.0);
  23595. uvs.push(0.0, 0.0);
  23596. positions.push(halfWidth, -halfHeight, 0);
  23597. normals.push(0, 0, -1.0);
  23598. uvs.push(1.0, 0.0);
  23599. positions.push(halfWidth, halfHeight, 0);
  23600. normals.push(0, 0, -1.0);
  23601. uvs.push(1.0, 1.0);
  23602. positions.push(-halfWidth, halfHeight, 0);
  23603. normals.push(0, 0, -1.0);
  23604. uvs.push(0.0, 1.0);
  23605. // Indices
  23606. indices.push(0);
  23607. indices.push(1);
  23608. indices.push(2);
  23609. indices.push(0);
  23610. indices.push(2);
  23611. indices.push(3);
  23612. // Sides
  23613. VertexData._ComputeSides(sideOrientation, positions, indices, normals, uvs);
  23614. // Result
  23615. var vertexData = new VertexData();
  23616. vertexData.indices = indices;
  23617. vertexData.positions = positions;
  23618. vertexData.normals = normals;
  23619. vertexData.uvs = uvs;
  23620. return vertexData;
  23621. };
  23622. VertexData.CreateDisc = function (options) {
  23623. var positions = [];
  23624. var indices = [];
  23625. var normals = [];
  23626. var uvs = [];
  23627. var radius = options.radius || 0.5;
  23628. var tessellation = options.tessellation || 64;
  23629. var arc = (options.arc <= 0) ? 1.0 : options.arc || 1.0;
  23630. var sideOrientation = (options.sideOrientation === 0) ? 0 : options.sideOrientation || BABYLON.Mesh.DEFAULTSIDE;
  23631. // positions and uvs
  23632. positions.push(0, 0, 0); // disc center first
  23633. uvs.push(0.5, 0.5);
  23634. var theta = Math.PI * 2 * arc;
  23635. var step = theta / tessellation;
  23636. for (var a = 0; a < theta; a += step) {
  23637. var x = Math.cos(a);
  23638. var y = Math.sin(a);
  23639. var u = (x + 1) / 2;
  23640. var v = (1 - y) / 2;
  23641. positions.push(radius * x, radius * y, 0);
  23642. uvs.push(u, v);
  23643. }
  23644. if (arc === 1) {
  23645. positions.push(positions[3], positions[4], positions[5]); // close the circle
  23646. uvs.push(uvs[2], uvs[3]);
  23647. }
  23648. //indices
  23649. var vertexNb = positions.length / 3;
  23650. for (var i = 1; i < vertexNb - 1; i++) {
  23651. indices.push(i + 1, 0, i);
  23652. }
  23653. // result
  23654. VertexData.ComputeNormals(positions, indices, normals);
  23655. VertexData._ComputeSides(sideOrientation, positions, indices, normals, uvs);
  23656. var vertexData = new VertexData();
  23657. vertexData.indices = indices;
  23658. vertexData.positions = positions;
  23659. vertexData.normals = normals;
  23660. vertexData.uvs = uvs;
  23661. return vertexData;
  23662. };
  23663. // inspired from // http://stemkoski.github.io/Three.js/Polyhedra.html
  23664. VertexData.CreatePolyhedron = function (options) {
  23665. // provided polyhedron types :
  23666. // 0 : Tetrahedron, 1 : Octahedron, 2 : Dodecahedron, 3 : Icosahedron, 4 : Rhombicuboctahedron, 5 : Triangular Prism, 6 : Pentagonal Prism, 7 : Hexagonal Prism, 8 : Square Pyramid (J1)
  23667. // 9 : Pentagonal Pyramid (J2), 10 : Triangular Dipyramid (J12), 11 : Pentagonal Dipyramid (J13), 12 : Elongated Square Dipyramid (J15), 13 : Elongated Pentagonal Dipyramid (J16), 14 : Elongated Pentagonal Cupola (J20)
  23668. var polyhedra = [];
  23669. polyhedra[0] = { vertex: [[0, 0, 1.732051], [1.632993, 0, -0.5773503], [-0.8164966, 1.414214, -0.5773503], [-0.8164966, -1.414214, -0.5773503]], face: [[0, 1, 2], [0, 2, 3], [0, 3, 1], [1, 3, 2]] };
  23670. polyhedra[1] = { vertex: [[0, 0, 1.414214], [1.414214, 0, 0], [0, 1.414214, 0], [-1.414214, 0, 0], [0, -1.414214, 0], [0, 0, -1.414214]], face: [[0, 1, 2], [0, 2, 3], [0, 3, 4], [0, 4, 1], [1, 4, 5], [1, 5, 2], [2, 5, 3], [3, 5, 4]] };
  23671. polyhedra[2] = {
  23672. vertex: [[0, 0, 1.070466], [0.7136442, 0, 0.7978784], [-0.3568221, 0.618034, 0.7978784], [-0.3568221, -0.618034, 0.7978784], [0.7978784, 0.618034, 0.3568221], [0.7978784, -0.618034, 0.3568221], [-0.9341724, 0.381966, 0.3568221], [0.1362939, 1, 0.3568221], [0.1362939, -1, 0.3568221], [-0.9341724, -0.381966, 0.3568221], [0.9341724, 0.381966, -0.3568221], [0.9341724, -0.381966, -0.3568221], [-0.7978784, 0.618034, -0.3568221], [-0.1362939, 1, -0.3568221], [-0.1362939, -1, -0.3568221], [-0.7978784, -0.618034, -0.3568221], [0.3568221, 0.618034, -0.7978784], [0.3568221, -0.618034, -0.7978784], [-0.7136442, 0, -0.7978784], [0, 0, -1.070466]],
  23673. face: [[0, 1, 4, 7, 2], [0, 2, 6, 9, 3], [0, 3, 8, 5, 1], [1, 5, 11, 10, 4], [2, 7, 13, 12, 6], [3, 9, 15, 14, 8], [4, 10, 16, 13, 7], [5, 8, 14, 17, 11], [6, 12, 18, 15, 9], [10, 11, 17, 19, 16], [12, 13, 16, 19, 18], [14, 15, 18, 19, 17]]
  23674. };
  23675. polyhedra[3] = {
  23676. vertex: [[0, 0, 1.175571], [1.051462, 0, 0.5257311], [0.3249197, 1, 0.5257311], [-0.8506508, 0.618034, 0.5257311], [-0.8506508, -0.618034, 0.5257311], [0.3249197, -1, 0.5257311], [0.8506508, 0.618034, -0.5257311], [0.8506508, -0.618034, -0.5257311], [-0.3249197, 1, -0.5257311], [-1.051462, 0, -0.5257311], [-0.3249197, -1, -0.5257311], [0, 0, -1.175571]],
  23677. face: [[0, 1, 2], [0, 2, 3], [0, 3, 4], [0, 4, 5], [0, 5, 1], [1, 5, 7], [1, 7, 6], [1, 6, 2], [2, 6, 8], [2, 8, 3], [3, 8, 9], [3, 9, 4], [4, 9, 10], [4, 10, 5], [5, 10, 7], [6, 7, 11], [6, 11, 8], [7, 10, 11], [8, 11, 9], [9, 11, 10]]
  23678. };
  23679. polyhedra[4] = {
  23680. vertex: [[0, 0, 1.070722], [0.7148135, 0, 0.7971752], [-0.104682, 0.7071068, 0.7971752], [-0.6841528, 0.2071068, 0.7971752], [-0.104682, -0.7071068, 0.7971752], [0.6101315, 0.7071068, 0.5236279], [1.04156, 0.2071068, 0.1367736], [0.6101315, -0.7071068, 0.5236279], [-0.3574067, 1, 0.1367736], [-0.7888348, -0.5, 0.5236279], [-0.9368776, 0.5, 0.1367736], [-0.3574067, -1, 0.1367736], [0.3574067, 1, -0.1367736], [0.9368776, -0.5, -0.1367736], [0.7888348, 0.5, -0.5236279], [0.3574067, -1, -0.1367736], [-0.6101315, 0.7071068, -0.5236279], [-1.04156, -0.2071068, -0.1367736], [-0.6101315, -0.7071068, -0.5236279], [0.104682, 0.7071068, -0.7971752], [0.6841528, -0.2071068, -0.7971752], [0.104682, -0.7071068, -0.7971752], [-0.7148135, 0, -0.7971752], [0, 0, -1.070722]],
  23681. face: [[0, 2, 3], [1, 6, 5], [4, 9, 11], [7, 15, 13], [8, 16, 10], [12, 14, 19], [17, 22, 18], [20, 21, 23], [0, 1, 5, 2], [0, 3, 9, 4], [0, 4, 7, 1], [1, 7, 13, 6], [2, 5, 12, 8], [2, 8, 10, 3], [3, 10, 17, 9], [4, 11, 15, 7], [5, 6, 14, 12], [6, 13, 20, 14], [8, 12, 19, 16], [9, 17, 18, 11], [10, 16, 22, 17], [11, 18, 21, 15], [13, 15, 21, 20], [14, 20, 23, 19], [16, 19, 23, 22], [18, 22, 23, 21]]
  23682. };
  23683. polyhedra[5] = { vertex: [[0, 0, 1.322876], [1.309307, 0, 0.1889822], [-0.9819805, 0.8660254, 0.1889822], [0.1636634, -1.299038, 0.1889822], [0.3273268, 0.8660254, -0.9449112], [-0.8183171, -0.4330127, -0.9449112]], face: [[0, 3, 1], [2, 4, 5], [0, 1, 4, 2], [0, 2, 5, 3], [1, 3, 5, 4]] };
  23684. polyhedra[6] = { vertex: [[0, 0, 1.159953], [1.013464, 0, 0.5642542], [-0.3501431, 0.9510565, 0.5642542], [-0.7715208, -0.6571639, 0.5642542], [0.6633206, 0.9510565, -0.03144481], [0.8682979, -0.6571639, -0.3996071], [-1.121664, 0.2938926, -0.03144481], [-0.2348831, -1.063314, -0.3996071], [0.5181548, 0.2938926, -0.9953061], [-0.5850262, -0.112257, -0.9953061]], face: [[0, 1, 4, 2], [0, 2, 6, 3], [1, 5, 8, 4], [3, 6, 9, 7], [5, 7, 9, 8], [0, 3, 7, 5, 1], [2, 4, 8, 9, 6]] };
  23685. polyhedra[7] = { vertex: [[0, 0, 1.118034], [0.8944272, 0, 0.6708204], [-0.2236068, 0.8660254, 0.6708204], [-0.7826238, -0.4330127, 0.6708204], [0.6708204, 0.8660254, 0.2236068], [1.006231, -0.4330127, -0.2236068], [-1.006231, 0.4330127, 0.2236068], [-0.6708204, -0.8660254, -0.2236068], [0.7826238, 0.4330127, -0.6708204], [0.2236068, -0.8660254, -0.6708204], [-0.8944272, 0, -0.6708204], [0, 0, -1.118034]], face: [[0, 1, 4, 2], [0, 2, 6, 3], [1, 5, 8, 4], [3, 6, 10, 7], [5, 9, 11, 8], [7, 10, 11, 9], [0, 3, 7, 9, 5, 1], [2, 4, 8, 11, 10, 6]] };
  23686. polyhedra[8] = { vertex: [[-0.729665, 0.670121, 0.319155], [-0.655235, -0.29213, -0.754096], [-0.093922, -0.607123, 0.537818], [0.702196, 0.595691, 0.485187], [0.776626, -0.36656, -0.588064]], face: [[1, 4, 2], [0, 1, 2], [3, 0, 2], [4, 3, 2], [4, 1, 0, 3]] };
  23687. polyhedra[9] = { vertex: [[-0.868849, -0.100041, 0.61257], [-0.329458, 0.976099, 0.28078], [-0.26629, -0.013796, -0.477654], [-0.13392, -1.034115, 0.229829], [0.738834, 0.707117, -0.307018], [0.859683, -0.535264, -0.338508]], face: [[3, 0, 2], [5, 3, 2], [4, 5, 2], [1, 4, 2], [0, 1, 2], [0, 3, 5, 4, 1]] };
  23688. polyhedra[10] = { vertex: [[-0.610389, 0.243975, 0.531213], [-0.187812, -0.48795, -0.664016], [-0.187812, 0.9759, -0.664016], [0.187812, -0.9759, 0.664016], [0.798201, 0.243975, 0.132803]], face: [[1, 3, 0], [3, 4, 0], [3, 1, 4], [0, 2, 1], [0, 4, 2], [2, 4, 1]] };
  23689. polyhedra[11] = { vertex: [[-1.028778, 0.392027, -0.048786], [-0.640503, -0.646161, 0.621837], [-0.125162, -0.395663, -0.540059], [0.004683, 0.888447, -0.651988], [0.125161, 0.395663, 0.540059], [0.632925, -0.791376, 0.433102], [1.031672, 0.157063, -0.354165]], face: [[3, 2, 0], [2, 1, 0], [2, 5, 1], [0, 4, 3], [0, 1, 4], [4, 1, 5], [2, 3, 6], [3, 4, 6], [5, 2, 6], [4, 5, 6]] };
  23690. polyhedra[12] = { vertex: [[-0.669867, 0.334933, -0.529576], [-0.669867, 0.334933, 0.529577], [-0.4043, 1.212901, 0], [-0.334933, -0.669867, -0.529576], [-0.334933, -0.669867, 0.529577], [0.334933, 0.669867, -0.529576], [0.334933, 0.669867, 0.529577], [0.4043, -1.212901, 0], [0.669867, -0.334933, -0.529576], [0.669867, -0.334933, 0.529577]], face: [[8, 9, 7], [6, 5, 2], [3, 8, 7], [5, 0, 2], [4, 3, 7], [0, 1, 2], [9, 4, 7], [1, 6, 2], [9, 8, 5, 6], [8, 3, 0, 5], [3, 4, 1, 0], [4, 9, 6, 1]] };
  23691. polyhedra[13] = { vertex: [[-0.931836, 0.219976, -0.264632], [-0.636706, 0.318353, 0.692816], [-0.613483, -0.735083, -0.264632], [-0.326545, 0.979634, 0], [-0.318353, -0.636706, 0.692816], [-0.159176, 0.477529, -0.856368], [0.159176, -0.477529, -0.856368], [0.318353, 0.636706, 0.692816], [0.326545, -0.979634, 0], [0.613482, 0.735082, -0.264632], [0.636706, -0.318353, 0.692816], [0.931835, -0.219977, -0.264632]], face: [[11, 10, 8], [7, 9, 3], [6, 11, 8], [9, 5, 3], [2, 6, 8], [5, 0, 3], [4, 2, 8], [0, 1, 3], [10, 4, 8], [1, 7, 3], [10, 11, 9, 7], [11, 6, 5, 9], [6, 2, 0, 5], [2, 4, 1, 0], [4, 10, 7, 1]] };
  23692. polyhedra[14] = {
  23693. vertex: [[-0.93465, 0.300459, -0.271185], [-0.838689, -0.260219, -0.516017], [-0.711319, 0.717591, 0.128359], [-0.710334, -0.156922, 0.080946], [-0.599799, 0.556003, -0.725148], [-0.503838, -0.004675, -0.969981], [-0.487004, 0.26021, 0.48049], [-0.460089, -0.750282, -0.512622], [-0.376468, 0.973135, -0.325605], [-0.331735, -0.646985, 0.084342], [-0.254001, 0.831847, 0.530001], [-0.125239, -0.494738, -0.966586], [0.029622, 0.027949, 0.730817], [0.056536, -0.982543, -0.262295], [0.08085, 1.087391, 0.076037], [0.125583, -0.532729, 0.485984], [0.262625, 0.599586, 0.780328], [0.391387, -0.726999, -0.716259], [0.513854, -0.868287, 0.139347], [0.597475, 0.85513, 0.326364], [0.641224, 0.109523, 0.783723], [0.737185, -0.451155, 0.538891], [0.848705, -0.612742, -0.314616], [0.976075, 0.365067, 0.32976], [1.072036, -0.19561, 0.084927]],
  23694. face: [[15, 18, 21], [12, 20, 16], [6, 10, 2], [3, 0, 1], [9, 7, 13], [2, 8, 4, 0], [0, 4, 5, 1], [1, 5, 11, 7], [7, 11, 17, 13], [13, 17, 22, 18], [18, 22, 24, 21], [21, 24, 23, 20], [20, 23, 19, 16], [16, 19, 14, 10], [10, 14, 8, 2], [15, 9, 13, 18], [12, 15, 21, 20], [6, 12, 16, 10], [3, 6, 2, 0], [9, 3, 1, 7], [9, 15, 12, 6, 3], [22, 17, 11, 5, 4, 8, 14, 19, 23, 24]]
  23695. };
  23696. var type = (options.type < 0 || options.type >= polyhedra.length) ? 0 : options.type || 0;
  23697. var size = options.size;
  23698. var sizeX = options.sizeX || size || 1;
  23699. var sizeY = options.sizeY || size || 1;
  23700. var sizeZ = options.sizeZ || size || 1;
  23701. var data = options.custom || polyhedra[type];
  23702. var nbfaces = data.face.length;
  23703. var faceUV = options.faceUV || new Array(nbfaces);
  23704. var faceColors = options.faceColors;
  23705. var singleFace = options.singleFace;
  23706. var sideOrientation = (options.sideOrientation === 0) ? 0 : options.sideOrientation || BABYLON.Mesh.DEFAULTSIDE;
  23707. var positions = [];
  23708. var indices = [];
  23709. var normals = [];
  23710. var uvs = [];
  23711. var colors = [];
  23712. var index = 0;
  23713. var faceIdx = 0; // face cursor in the array "indexes"
  23714. var indexes = [];
  23715. var i = 0;
  23716. var f = 0;
  23717. var u, v, ang, x, y, tmp;
  23718. // default face colors and UV if undefined
  23719. if (!singleFace) {
  23720. for (f = 0; f < nbfaces; f++) {
  23721. if (faceColors && faceColors[f] === undefined) {
  23722. faceColors[f] = new BABYLON.Color4(1, 1, 1, 1);
  23723. }
  23724. if (faceUV && faceUV[f] === undefined) {
  23725. faceUV[f] = new BABYLON.Vector4(0, 0, 1, 1);
  23726. }
  23727. }
  23728. }
  23729. if (singleFace) {
  23730. for (i = 0; i < data.vertex.length; i++) {
  23731. positions.push(data.vertex[i][0] * sizeX, data.vertex[i][1] * sizeY, data.vertex[i][2] * sizeZ);
  23732. uvs.push(0, 0);
  23733. }
  23734. for (f = 0; f < nbfaces; f++) {
  23735. for (i = 0; i < data.face[f].length - 2; i++) {
  23736. indices.push(data.face[f][0], data.face[f][i + 2], data.face[f][i + 1]);
  23737. }
  23738. }
  23739. }
  23740. else {
  23741. for (f = 0; f < nbfaces; f++) {
  23742. var fl = data.face[f].length; // number of vertices of the current face
  23743. ang = 2 * Math.PI / fl;
  23744. x = 0.5 * Math.tan(ang / 2);
  23745. y = 0.5;
  23746. // positions, uvs, colors
  23747. for (i = 0; i < fl; i++) {
  23748. // positions
  23749. positions.push(data.vertex[data.face[f][i]][0] * sizeX, data.vertex[data.face[f][i]][1] * sizeY, data.vertex[data.face[f][i]][2] * sizeZ);
  23750. indexes.push(index);
  23751. index++;
  23752. // uvs
  23753. u = faceUV[f].x + (faceUV[f].z - faceUV[f].x) * (0.5 + x);
  23754. v = faceUV[f].y + (faceUV[f].w - faceUV[f].y) * (y - 0.5);
  23755. uvs.push(u, v);
  23756. tmp = x * Math.cos(ang) - y * Math.sin(ang);
  23757. y = x * Math.sin(ang) + y * Math.cos(ang);
  23758. x = tmp;
  23759. // colors
  23760. if (faceColors) {
  23761. colors.push(faceColors[f].r, faceColors[f].g, faceColors[f].b, faceColors[f].a);
  23762. }
  23763. }
  23764. // indices from indexes
  23765. for (i = 0; i < fl - 2; i++) {
  23766. indices.push(indexes[0 + faceIdx], indexes[i + 2 + faceIdx], indexes[i + 1 + faceIdx]);
  23767. }
  23768. faceIdx += fl;
  23769. }
  23770. }
  23771. VertexData.ComputeNormals(positions, indices, normals);
  23772. VertexData._ComputeSides(sideOrientation, positions, indices, normals, uvs);
  23773. var vertexData = new VertexData();
  23774. vertexData.positions = positions;
  23775. vertexData.indices = indices;
  23776. vertexData.normals = normals;
  23777. vertexData.uvs = uvs;
  23778. if (faceColors && !singleFace) {
  23779. vertexData.colors = colors;
  23780. }
  23781. return vertexData;
  23782. };
  23783. // based on http://code.google.com/p/away3d/source/browse/trunk/fp10/Away3D/src/away3d/primitives/TorusKnot.as?spec=svn2473&r=2473
  23784. VertexData.CreateTorusKnot = function (options) {
  23785. var indices = [];
  23786. var positions = [];
  23787. var normals = [];
  23788. var uvs = [];
  23789. var radius = options.radius || 2;
  23790. var tube = options.tube || 0.5;
  23791. var radialSegments = options.radialSegments || 32;
  23792. var tubularSegments = options.tubularSegments || 32;
  23793. var p = options.p || 2;
  23794. var q = options.q || 3;
  23795. var sideOrientation = (options.sideOrientation === 0) ? 0 : options.sideOrientation || BABYLON.Mesh.DEFAULTSIDE;
  23796. // Helper
  23797. var getPos = function (angle) {
  23798. var cu = Math.cos(angle);
  23799. var su = Math.sin(angle);
  23800. var quOverP = q / p * angle;
  23801. var cs = Math.cos(quOverP);
  23802. var tx = radius * (2 + cs) * 0.5 * cu;
  23803. var ty = radius * (2 + cs) * su * 0.5;
  23804. var tz = radius * Math.sin(quOverP) * 0.5;
  23805. return new BABYLON.Vector3(tx, ty, tz);
  23806. };
  23807. // Vertices
  23808. var i;
  23809. var j;
  23810. for (i = 0; i <= radialSegments; i++) {
  23811. var modI = i % radialSegments;
  23812. var u = modI / radialSegments * 2 * p * Math.PI;
  23813. var p1 = getPos(u);
  23814. var p2 = getPos(u + 0.01);
  23815. var tang = p2.subtract(p1);
  23816. var n = p2.add(p1);
  23817. var bitan = BABYLON.Vector3.Cross(tang, n);
  23818. n = BABYLON.Vector3.Cross(bitan, tang);
  23819. bitan.normalize();
  23820. n.normalize();
  23821. for (j = 0; j < tubularSegments; j++) {
  23822. var modJ = j % tubularSegments;
  23823. var v = modJ / tubularSegments * 2 * Math.PI;
  23824. var cx = -tube * Math.cos(v);
  23825. var cy = tube * Math.sin(v);
  23826. positions.push(p1.x + cx * n.x + cy * bitan.x);
  23827. positions.push(p1.y + cx * n.y + cy * bitan.y);
  23828. positions.push(p1.z + cx * n.z + cy * bitan.z);
  23829. uvs.push(i / radialSegments);
  23830. uvs.push(j / tubularSegments);
  23831. }
  23832. }
  23833. for (i = 0; i < radialSegments; i++) {
  23834. for (j = 0; j < tubularSegments; j++) {
  23835. var jNext = (j + 1) % tubularSegments;
  23836. var a = i * tubularSegments + j;
  23837. var b = (i + 1) * tubularSegments + j;
  23838. var c = (i + 1) * tubularSegments + jNext;
  23839. var d = i * tubularSegments + jNext;
  23840. indices.push(d);
  23841. indices.push(b);
  23842. indices.push(a);
  23843. indices.push(d);
  23844. indices.push(c);
  23845. indices.push(b);
  23846. }
  23847. }
  23848. // Normals
  23849. VertexData.ComputeNormals(positions, indices, normals);
  23850. // Sides
  23851. VertexData._ComputeSides(sideOrientation, positions, indices, normals, uvs);
  23852. // Result
  23853. var vertexData = new VertexData();
  23854. vertexData.indices = indices;
  23855. vertexData.positions = positions;
  23856. vertexData.normals = normals;
  23857. vertexData.uvs = uvs;
  23858. return vertexData;
  23859. };
  23860. // Tools
  23861. /**
  23862. * @param {any} - positions (number[] or Float32Array)
  23863. * @param {any} - indices (number[] or Uint16Array)
  23864. * @param {any} - normals (number[] or Float32Array)
  23865. */
  23866. VertexData.ComputeNormals = function (positions, indices, normals) {
  23867. var index = 0;
  23868. // temp Vector3
  23869. var p1p2 = BABYLON.Vector3.Zero();
  23870. var p3p2 = BABYLON.Vector3.Zero();
  23871. var faceNormal = BABYLON.Vector3.Zero();
  23872. var vertexNormali1 = BABYLON.Vector3.Zero();
  23873. for (index = 0; index < positions.length; index++) {
  23874. normals[index] = 0.0;
  23875. }
  23876. // indice triplet = 1 face
  23877. var nbFaces = indices.length / 3;
  23878. for (index = 0; index < nbFaces; index++) {
  23879. var i1 = indices[index * 3];
  23880. var i2 = indices[index * 3 + 1];
  23881. var i3 = indices[index * 3 + 2];
  23882. p1p2.x = positions[i1 * 3] - positions[i2 * 3];
  23883. p1p2.y = positions[i1 * 3 + 1] - positions[i2 * 3 + 1];
  23884. p1p2.z = positions[i1 * 3 + 2] - positions[i2 * 3 + 2];
  23885. p3p2.x = positions[i3 * 3] - positions[i2 * 3];
  23886. p3p2.y = positions[i3 * 3 + 1] - positions[i2 * 3 + 1];
  23887. p3p2.z = positions[i3 * 3 + 2] - positions[i2 * 3 + 2];
  23888. BABYLON.Vector3.CrossToRef(p1p2, p3p2, faceNormal);
  23889. faceNormal.normalize();
  23890. normals[i1 * 3] += faceNormal.x;
  23891. normals[i1 * 3 + 1] += faceNormal.y;
  23892. normals[i1 * 3 + 2] += faceNormal.z;
  23893. normals[i2 * 3] += faceNormal.x;
  23894. normals[i2 * 3 + 1] += faceNormal.y;
  23895. normals[i2 * 3 + 2] += faceNormal.z;
  23896. normals[i3 * 3] += faceNormal.x;
  23897. normals[i3 * 3 + 1] += faceNormal.y;
  23898. normals[i3 * 3 + 2] += faceNormal.z;
  23899. }
  23900. // last normalization
  23901. for (index = 0; index < normals.length / 3; index++) {
  23902. BABYLON.Vector3.FromFloatsToRef(normals[index * 3], normals[index * 3 + 1], normals[index * 3 + 2], vertexNormali1);
  23903. vertexNormali1.normalize();
  23904. normals[index * 3] = vertexNormali1.x;
  23905. normals[index * 3 + 1] = vertexNormali1.y;
  23906. normals[index * 3 + 2] = vertexNormali1.z;
  23907. }
  23908. };
  23909. VertexData._ComputeSides = function (sideOrientation, positions, indices, normals, uvs) {
  23910. var li = indices.length;
  23911. var ln = normals.length;
  23912. var i;
  23913. var n;
  23914. sideOrientation = sideOrientation || BABYLON.Mesh.DEFAULTSIDE;
  23915. switch (sideOrientation) {
  23916. case BABYLON.Mesh.FRONTSIDE:
  23917. // nothing changed
  23918. break;
  23919. case BABYLON.Mesh.BACKSIDE:
  23920. var tmp;
  23921. // indices
  23922. for (i = 0; i < li; i += 3) {
  23923. tmp = indices[i];
  23924. indices[i] = indices[i + 2];
  23925. indices[i + 2] = tmp;
  23926. }
  23927. // normals
  23928. for (n = 0; n < ln; n++) {
  23929. normals[n] = -normals[n];
  23930. }
  23931. break;
  23932. case BABYLON.Mesh.DOUBLESIDE:
  23933. // positions
  23934. var lp = positions.length;
  23935. var l = lp / 3;
  23936. for (var p = 0; p < lp; p++) {
  23937. positions[lp + p] = positions[p];
  23938. }
  23939. // indices
  23940. for (i = 0; i < li; i += 3) {
  23941. indices[i + li] = indices[i + 2] + l;
  23942. indices[i + 1 + li] = indices[i + 1] + l;
  23943. indices[i + 2 + li] = indices[i] + l;
  23944. }
  23945. // normals
  23946. for (n = 0; n < ln; n++) {
  23947. normals[ln + n] = -normals[n];
  23948. }
  23949. // uvs
  23950. var lu = uvs.length;
  23951. for (var u = 0; u < lu; u++) {
  23952. uvs[u + lu] = uvs[u];
  23953. }
  23954. break;
  23955. }
  23956. };
  23957. return VertexData;
  23958. })();
  23959. BABYLON.VertexData = VertexData;
  23960. })(BABYLON || (BABYLON = {}));
  23961. var BABYLON;
  23962. (function (BABYLON) {
  23963. var Tags = (function () {
  23964. function Tags() {
  23965. }
  23966. Tags.EnableFor = function (obj) {
  23967. obj._tags = obj._tags || {};
  23968. obj.hasTags = function () {
  23969. return Tags.HasTags(obj);
  23970. };
  23971. obj.addTags = function (tagsString) {
  23972. return Tags.AddTagsTo(obj, tagsString);
  23973. };
  23974. obj.removeTags = function (tagsString) {
  23975. return Tags.RemoveTagsFrom(obj, tagsString);
  23976. };
  23977. obj.matchesTagsQuery = function (tagsQuery) {
  23978. return Tags.MatchesQuery(obj, tagsQuery);
  23979. };
  23980. };
  23981. Tags.DisableFor = function (obj) {
  23982. delete obj._tags;
  23983. delete obj.hasTags;
  23984. delete obj.addTags;
  23985. delete obj.removeTags;
  23986. delete obj.matchesTagsQuery;
  23987. };
  23988. Tags.HasTags = function (obj) {
  23989. if (!obj._tags) {
  23990. return false;
  23991. }
  23992. return !BABYLON.Tools.IsEmpty(obj._tags);
  23993. };
  23994. Tags.GetTags = function (obj) {
  23995. if (!obj._tags) {
  23996. return null;
  23997. }
  23998. return obj._tags;
  23999. };
  24000. // the tags 'true' and 'false' are reserved and cannot be used as tags
  24001. // a tag cannot start with '||', '&&', and '!'
  24002. // it cannot contain whitespaces
  24003. Tags.AddTagsTo = function (obj, tagsString) {
  24004. if (!tagsString) {
  24005. return;
  24006. }
  24007. var tags = tagsString.split(" ");
  24008. for (var t in tags) {
  24009. Tags._AddTagTo(obj, tags[t]);
  24010. }
  24011. };
  24012. Tags._AddTagTo = function (obj, tag) {
  24013. tag = tag.trim();
  24014. if (tag === "" || tag === "true" || tag === "false") {
  24015. return;
  24016. }
  24017. if (tag.match(/[\s]/) || tag.match(/^([!]|([|]|[&]){2})/)) {
  24018. return;
  24019. }
  24020. Tags.EnableFor(obj);
  24021. obj._tags[tag] = true;
  24022. };
  24023. Tags.RemoveTagsFrom = function (obj, tagsString) {
  24024. if (!Tags.HasTags(obj)) {
  24025. return;
  24026. }
  24027. var tags = tagsString.split(" ");
  24028. for (var t in tags) {
  24029. Tags._RemoveTagFrom(obj, tags[t]);
  24030. }
  24031. };
  24032. Tags._RemoveTagFrom = function (obj, tag) {
  24033. delete obj._tags[tag];
  24034. };
  24035. Tags.MatchesQuery = function (obj, tagsQuery) {
  24036. if (tagsQuery === undefined) {
  24037. return true;
  24038. }
  24039. if (tagsQuery === "") {
  24040. return Tags.HasTags(obj);
  24041. }
  24042. return BABYLON.Internals.AndOrNotEvaluator.Eval(tagsQuery, function (r) { return Tags.HasTags(obj) && obj._tags[r]; });
  24043. };
  24044. return Tags;
  24045. })();
  24046. BABYLON.Tags = Tags;
  24047. })(BABYLON || (BABYLON = {}));
  24048. var BABYLON;
  24049. (function (BABYLON) {
  24050. var Internals;
  24051. (function (Internals) {
  24052. var AndOrNotEvaluator = (function () {
  24053. function AndOrNotEvaluator() {
  24054. }
  24055. AndOrNotEvaluator.Eval = function (query, evaluateCallback) {
  24056. if (!query.match(/\([^\(\)]*\)/g)) {
  24057. query = AndOrNotEvaluator._HandleParenthesisContent(query, evaluateCallback);
  24058. }
  24059. else {
  24060. query = query.replace(/\([^\(\)]*\)/g, function (r) {
  24061. // remove parenthesis
  24062. r = r.slice(1, r.length - 1);
  24063. return AndOrNotEvaluator._HandleParenthesisContent(r, evaluateCallback);
  24064. });
  24065. }
  24066. if (query === "true") {
  24067. return true;
  24068. }
  24069. if (query === "false") {
  24070. return false;
  24071. }
  24072. return AndOrNotEvaluator.Eval(query, evaluateCallback);
  24073. };
  24074. AndOrNotEvaluator._HandleParenthesisContent = function (parenthesisContent, evaluateCallback) {
  24075. evaluateCallback = evaluateCallback || (function (r) {
  24076. return r === "true" ? true : false;
  24077. });
  24078. var result;
  24079. var or = parenthesisContent.split("||");
  24080. for (var i in or) {
  24081. var ori = AndOrNotEvaluator._SimplifyNegation(or[i].trim());
  24082. var and = ori.split("&&");
  24083. if (and.length > 1) {
  24084. for (var j = 0; j < and.length; ++j) {
  24085. var andj = AndOrNotEvaluator._SimplifyNegation(and[j].trim());
  24086. if (andj !== "true" && andj !== "false") {
  24087. if (andj[0] === "!") {
  24088. result = !evaluateCallback(andj.substring(1));
  24089. }
  24090. else {
  24091. result = evaluateCallback(andj);
  24092. }
  24093. }
  24094. else {
  24095. result = andj === "true" ? true : false;
  24096. }
  24097. if (!result) {
  24098. ori = "false";
  24099. break;
  24100. }
  24101. }
  24102. }
  24103. if (result || ori === "true") {
  24104. result = true;
  24105. break;
  24106. }
  24107. // result equals false (or undefined)
  24108. if (ori !== "true" && ori !== "false") {
  24109. if (ori[0] === "!") {
  24110. result = !evaluateCallback(ori.substring(1));
  24111. }
  24112. else {
  24113. result = evaluateCallback(ori);
  24114. }
  24115. }
  24116. else {
  24117. result = ori === "true" ? true : false;
  24118. }
  24119. }
  24120. // the whole parenthesis scope is replaced by 'true' or 'false'
  24121. return result ? "true" : "false";
  24122. };
  24123. AndOrNotEvaluator._SimplifyNegation = function (booleanString) {
  24124. booleanString = booleanString.replace(/^[\s!]+/, function (r) {
  24125. // remove whitespaces
  24126. r = r.replace(/[\s]/g, function () { return ""; });
  24127. return r.length % 2 ? "!" : "";
  24128. });
  24129. booleanString = booleanString.trim();
  24130. if (booleanString === "!true") {
  24131. booleanString = "false";
  24132. }
  24133. else if (booleanString === "!false") {
  24134. booleanString = "true";
  24135. }
  24136. return booleanString;
  24137. };
  24138. return AndOrNotEvaluator;
  24139. })();
  24140. Internals.AndOrNotEvaluator = AndOrNotEvaluator;
  24141. })(Internals = BABYLON.Internals || (BABYLON.Internals = {}));
  24142. })(BABYLON || (BABYLON = {}));
  24143. var BABYLON;
  24144. (function (BABYLON) {
  24145. var PostProcessRenderPass = (function () {
  24146. function PostProcessRenderPass(scene, name, size, renderList, beforeRender, afterRender) {
  24147. this._enabled = true;
  24148. this._refCount = 0;
  24149. this._name = name;
  24150. this._renderTexture = new BABYLON.RenderTargetTexture(name, size, scene);
  24151. this.setRenderList(renderList);
  24152. this._renderTexture.onBeforeRender = beforeRender;
  24153. this._renderTexture.onAfterRender = afterRender;
  24154. this._scene = scene;
  24155. this._renderList = renderList;
  24156. }
  24157. // private
  24158. PostProcessRenderPass.prototype._incRefCount = function () {
  24159. if (this._refCount === 0) {
  24160. this._scene.customRenderTargets.push(this._renderTexture);
  24161. }
  24162. return ++this._refCount;
  24163. };
  24164. PostProcessRenderPass.prototype._decRefCount = function () {
  24165. this._refCount--;
  24166. if (this._refCount <= 0) {
  24167. this._scene.customRenderTargets.splice(this._scene.customRenderTargets.indexOf(this._renderTexture), 1);
  24168. }
  24169. return this._refCount;
  24170. };
  24171. PostProcessRenderPass.prototype._update = function () {
  24172. this.setRenderList(this._renderList);
  24173. };
  24174. // public
  24175. PostProcessRenderPass.prototype.setRenderList = function (renderList) {
  24176. this._renderTexture.renderList = renderList;
  24177. };
  24178. PostProcessRenderPass.prototype.getRenderTexture = function () {
  24179. return this._renderTexture;
  24180. };
  24181. return PostProcessRenderPass;
  24182. })();
  24183. BABYLON.PostProcessRenderPass = PostProcessRenderPass;
  24184. })(BABYLON || (BABYLON = {}));
  24185. var BABYLON;
  24186. (function (BABYLON) {
  24187. var PostProcessRenderEffect = (function () {
  24188. function PostProcessRenderEffect(engine, name, getPostProcess, singleInstance) {
  24189. this._engine = engine;
  24190. this._name = name;
  24191. this._singleInstance = singleInstance || true;
  24192. this._getPostProcess = getPostProcess;
  24193. this._cameras = [];
  24194. this._indicesForCamera = [];
  24195. this._postProcesses = {};
  24196. this._renderPasses = {};
  24197. this._renderEffectAsPasses = {};
  24198. }
  24199. PostProcessRenderEffect.prototype._update = function () {
  24200. for (var renderPassName in this._renderPasses) {
  24201. this._renderPasses[renderPassName]._update();
  24202. }
  24203. };
  24204. PostProcessRenderEffect.prototype.addPass = function (renderPass) {
  24205. this._renderPasses[renderPass._name] = renderPass;
  24206. this._linkParameters();
  24207. };
  24208. PostProcessRenderEffect.prototype.removePass = function (renderPass) {
  24209. delete this._renderPasses[renderPass._name];
  24210. this._linkParameters();
  24211. };
  24212. PostProcessRenderEffect.prototype.addRenderEffectAsPass = function (renderEffect) {
  24213. this._renderEffectAsPasses[renderEffect._name] = renderEffect;
  24214. this._linkParameters();
  24215. };
  24216. PostProcessRenderEffect.prototype.getPass = function (passName) {
  24217. for (var renderPassName in this._renderPasses) {
  24218. if (renderPassName === passName) {
  24219. return this._renderPasses[passName];
  24220. }
  24221. }
  24222. };
  24223. PostProcessRenderEffect.prototype.emptyPasses = function () {
  24224. this._renderPasses = {};
  24225. this._linkParameters();
  24226. };
  24227. PostProcessRenderEffect.prototype._attachCameras = function (cameras) {
  24228. var cameraKey;
  24229. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  24230. for (var i = 0; i < _cam.length; i++) {
  24231. var camera = _cam[i];
  24232. var cameraName = camera.name;
  24233. if (this._singleInstance) {
  24234. cameraKey = 0;
  24235. }
  24236. else {
  24237. cameraKey = cameraName;
  24238. }
  24239. this._postProcesses[cameraKey] = this._postProcesses[cameraKey] || this._getPostProcess();
  24240. var index = camera.attachPostProcess(this._postProcesses[cameraKey]);
  24241. if (!this._indicesForCamera[cameraName]) {
  24242. this._indicesForCamera[cameraName] = [];
  24243. }
  24244. this._indicesForCamera[cameraName].push(index);
  24245. if (this._cameras.indexOf(camera) === -1) {
  24246. this._cameras[cameraName] = camera;
  24247. }
  24248. for (var passName in this._renderPasses) {
  24249. this._renderPasses[passName]._incRefCount();
  24250. }
  24251. }
  24252. this._linkParameters();
  24253. };
  24254. PostProcessRenderEffect.prototype._detachCameras = function (cameras) {
  24255. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  24256. for (var i = 0; i < _cam.length; i++) {
  24257. var camera = _cam[i];
  24258. var cameraName = camera.name;
  24259. camera.detachPostProcess(this._postProcesses[this._singleInstance ? 0 : cameraName], this._indicesForCamera[cameraName]);
  24260. var index = this._cameras.indexOf(cameraName);
  24261. this._indicesForCamera.splice(index, 1);
  24262. this._cameras.splice(index, 1);
  24263. for (var passName in this._renderPasses) {
  24264. this._renderPasses[passName]._decRefCount();
  24265. }
  24266. }
  24267. };
  24268. PostProcessRenderEffect.prototype._enable = function (cameras) {
  24269. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  24270. for (var i = 0; i < _cam.length; i++) {
  24271. var camera = _cam[i];
  24272. var cameraName = camera.name;
  24273. for (var j = 0; j < this._indicesForCamera[cameraName].length; j++) {
  24274. if (camera._postProcesses[this._indicesForCamera[cameraName][j]] === undefined) {
  24275. cameras[i].attachPostProcess(this._postProcesses[this._singleInstance ? 0 : cameraName], this._indicesForCamera[cameraName][j]);
  24276. }
  24277. }
  24278. for (var passName in this._renderPasses) {
  24279. this._renderPasses[passName]._incRefCount();
  24280. }
  24281. }
  24282. };
  24283. PostProcessRenderEffect.prototype._disable = function (cameras) {
  24284. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  24285. for (var i = 0; i < _cam.length; i++) {
  24286. var camera = _cam[i];
  24287. var cameraName = camera.Name;
  24288. camera.detachPostProcess(this._postProcesses[this._singleInstance ? 0 : cameraName], this._indicesForCamera[cameraName]);
  24289. for (var passName in this._renderPasses) {
  24290. this._renderPasses[passName]._decRefCount();
  24291. }
  24292. }
  24293. };
  24294. PostProcessRenderEffect.prototype.getPostProcess = function (camera) {
  24295. if (this._singleInstance) {
  24296. return this._postProcesses[0];
  24297. }
  24298. else {
  24299. return this._postProcesses[camera.name];
  24300. }
  24301. };
  24302. PostProcessRenderEffect.prototype._linkParameters = function () {
  24303. var _this = this;
  24304. for (var index in this._postProcesses) {
  24305. if (this.applyParameters) {
  24306. this.applyParameters(this._postProcesses[index]);
  24307. }
  24308. this._postProcesses[index].onBeforeRender = function (effect) {
  24309. _this._linkTextures(effect);
  24310. };
  24311. }
  24312. };
  24313. PostProcessRenderEffect.prototype._linkTextures = function (effect) {
  24314. for (var renderPassName in this._renderPasses) {
  24315. effect.setTexture(renderPassName, this._renderPasses[renderPassName].getRenderTexture());
  24316. }
  24317. for (var renderEffectName in this._renderEffectAsPasses) {
  24318. effect.setTextureFromPostProcess(renderEffectName + "Sampler", this._renderEffectAsPasses[renderEffectName].getPostProcess());
  24319. }
  24320. };
  24321. return PostProcessRenderEffect;
  24322. })();
  24323. BABYLON.PostProcessRenderEffect = PostProcessRenderEffect;
  24324. })(BABYLON || (BABYLON = {}));
  24325. var BABYLON;
  24326. (function (BABYLON) {
  24327. var PostProcessRenderPipeline = (function () {
  24328. function PostProcessRenderPipeline(engine, name) {
  24329. this._engine = engine;
  24330. this._name = name;
  24331. this._renderEffects = {};
  24332. this._renderEffectsForIsolatedPass = {};
  24333. this._cameras = [];
  24334. }
  24335. PostProcessRenderPipeline.prototype.addEffect = function (renderEffect) {
  24336. this._renderEffects[renderEffect._name] = renderEffect;
  24337. };
  24338. PostProcessRenderPipeline.prototype._enableEffect = function (renderEffectName, cameras) {
  24339. var renderEffects = this._renderEffects[renderEffectName];
  24340. if (!renderEffects) {
  24341. return;
  24342. }
  24343. renderEffects._enable(BABYLON.Tools.MakeArray(cameras || this._cameras));
  24344. };
  24345. PostProcessRenderPipeline.prototype._disableEffect = function (renderEffectName, cameras) {
  24346. var renderEffects = this._renderEffects[renderEffectName];
  24347. if (!renderEffects) {
  24348. return;
  24349. }
  24350. renderEffects._disable(BABYLON.Tools.MakeArray(cameras || this._cameras));
  24351. };
  24352. PostProcessRenderPipeline.prototype._attachCameras = function (cameras, unique) {
  24353. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  24354. var indicesToDelete = [];
  24355. for (var i = 0; i < _cam.length; i++) {
  24356. var camera = _cam[i];
  24357. var cameraName = camera.name;
  24358. if (this._cameras.indexOf(camera) === -1) {
  24359. this._cameras[cameraName] = camera;
  24360. }
  24361. else if (unique) {
  24362. indicesToDelete.push(i);
  24363. }
  24364. }
  24365. for (var i = 0; i < indicesToDelete.length; i++) {
  24366. cameras.splice(indicesToDelete[i], 1);
  24367. }
  24368. for (var renderEffectName in this._renderEffects) {
  24369. this._renderEffects[renderEffectName]._attachCameras(_cam);
  24370. }
  24371. };
  24372. PostProcessRenderPipeline.prototype._detachCameras = function (cameras) {
  24373. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  24374. for (var renderEffectName in this._renderEffects) {
  24375. this._renderEffects[renderEffectName]._detachCameras(_cam);
  24376. }
  24377. for (var i = 0; i < _cam.length; i++) {
  24378. this._cameras.splice(this._cameras.indexOf(_cam[i]), 1);
  24379. }
  24380. };
  24381. PostProcessRenderPipeline.prototype._enableDisplayOnlyPass = function (passName, cameras) {
  24382. var _this = this;
  24383. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  24384. var pass = null;
  24385. for (var renderEffectName in this._renderEffects) {
  24386. pass = this._renderEffects[renderEffectName].getPass(passName);
  24387. if (pass != null) {
  24388. break;
  24389. }
  24390. }
  24391. if (pass === null) {
  24392. return;
  24393. }
  24394. for (var renderEffectName in this._renderEffects) {
  24395. this._renderEffects[renderEffectName]._disable(_cam);
  24396. }
  24397. pass._name = PostProcessRenderPipeline.PASS_SAMPLER_NAME;
  24398. for (var i = 0; i < _cam.length; i++) {
  24399. var camera = _cam[i];
  24400. var cameraName = camera.name;
  24401. this._renderEffectsForIsolatedPass[cameraName] = this._renderEffectsForIsolatedPass[cameraName] || new BABYLON.PostProcessRenderEffect(this._engine, PostProcessRenderPipeline.PASS_EFFECT_NAME, function () { return new BABYLON.DisplayPassPostProcess(PostProcessRenderPipeline.PASS_EFFECT_NAME, 1.0, null, null, _this._engine, true); });
  24402. this._renderEffectsForIsolatedPass[cameraName].emptyPasses();
  24403. this._renderEffectsForIsolatedPass[cameraName].addPass(pass);
  24404. this._renderEffectsForIsolatedPass[cameraName]._attachCameras(camera);
  24405. }
  24406. };
  24407. PostProcessRenderPipeline.prototype._disableDisplayOnlyPass = function (cameras) {
  24408. var _this = this;
  24409. var _cam = BABYLON.Tools.MakeArray(cameras || this._cameras);
  24410. for (var i = 0; i < _cam.length; i++) {
  24411. var camera = _cam[i];
  24412. var cameraName = camera.name;
  24413. this._renderEffectsForIsolatedPass[cameraName] = this._renderEffectsForIsolatedPass[cameraName] || new BABYLON.PostProcessRenderEffect(this._engine, PostProcessRenderPipeline.PASS_EFFECT_NAME, function () { return new BABYLON.DisplayPassPostProcess(PostProcessRenderPipeline.PASS_EFFECT_NAME, 1.0, null, null, _this._engine, true); });
  24414. this._renderEffectsForIsolatedPass[cameraName]._disable(camera);
  24415. }
  24416. for (var renderEffectName in this._renderEffects) {
  24417. this._renderEffects[renderEffectName]._enable(_cam);
  24418. }
  24419. };
  24420. PostProcessRenderPipeline.prototype._update = function () {
  24421. for (var renderEffectName in this._renderEffects) {
  24422. this._renderEffects[renderEffectName]._update();
  24423. }
  24424. for (var i = 0; i < this._cameras.length; i++) {
  24425. var cameraName = this._cameras[i].name;
  24426. if (this._renderEffectsForIsolatedPass[cameraName]) {
  24427. this._renderEffectsForIsolatedPass[cameraName]._update();
  24428. }
  24429. }
  24430. };
  24431. PostProcessRenderPipeline.PASS_EFFECT_NAME = "passEffect";
  24432. PostProcessRenderPipeline.PASS_SAMPLER_NAME = "passSampler";
  24433. return PostProcessRenderPipeline;
  24434. })();
  24435. BABYLON.PostProcessRenderPipeline = PostProcessRenderPipeline;
  24436. })(BABYLON || (BABYLON = {}));
  24437. var BABYLON;
  24438. (function (BABYLON) {
  24439. var PostProcessRenderPipelineManager = (function () {
  24440. function PostProcessRenderPipelineManager() {
  24441. this._renderPipelines = {};
  24442. }
  24443. PostProcessRenderPipelineManager.prototype.addPipeline = function (renderPipeline) {
  24444. this._renderPipelines[renderPipeline._name] = renderPipeline;
  24445. };
  24446. PostProcessRenderPipelineManager.prototype.attachCamerasToRenderPipeline = function (renderPipelineName, cameras, unique) {
  24447. var renderPipeline = this._renderPipelines[renderPipelineName];
  24448. if (!renderPipeline) {
  24449. return;
  24450. }
  24451. renderPipeline._attachCameras(cameras, unique);
  24452. };
  24453. PostProcessRenderPipelineManager.prototype.detachCamerasFromRenderPipeline = function (renderPipelineName, cameras) {
  24454. var renderPipeline = this._renderPipelines[renderPipelineName];
  24455. if (!renderPipeline) {
  24456. return;
  24457. }
  24458. renderPipeline._detachCameras(cameras);
  24459. };
  24460. PostProcessRenderPipelineManager.prototype.enableEffectInPipeline = function (renderPipelineName, renderEffectName, cameras) {
  24461. var renderPipeline = this._renderPipelines[renderPipelineName];
  24462. if (!renderPipeline) {
  24463. return;
  24464. }
  24465. renderPipeline._enableEffect(renderEffectName, cameras);
  24466. };
  24467. PostProcessRenderPipelineManager.prototype.disableEffectInPipeline = function (renderPipelineName, renderEffectName, cameras) {
  24468. var renderPipeline = this._renderPipelines[renderPipelineName];
  24469. if (!renderPipeline) {
  24470. return;
  24471. }
  24472. renderPipeline._disableEffect(renderEffectName, cameras);
  24473. };
  24474. PostProcessRenderPipelineManager.prototype.enableDisplayOnlyPassInPipeline = function (renderPipelineName, passName, cameras) {
  24475. var renderPipeline = this._renderPipelines[renderPipelineName];
  24476. if (!renderPipeline) {
  24477. return;
  24478. }
  24479. renderPipeline._enableDisplayOnlyPass(passName, cameras);
  24480. };
  24481. PostProcessRenderPipelineManager.prototype.disableDisplayOnlyPassInPipeline = function (renderPipelineName, cameras) {
  24482. var renderPipeline = this._renderPipelines[renderPipelineName];
  24483. if (!renderPipeline) {
  24484. return;
  24485. }
  24486. renderPipeline._disableDisplayOnlyPass(cameras);
  24487. };
  24488. PostProcessRenderPipelineManager.prototype.update = function () {
  24489. for (var renderPipelineName in this._renderPipelines) {
  24490. this._renderPipelines[renderPipelineName]._update();
  24491. }
  24492. };
  24493. return PostProcessRenderPipelineManager;
  24494. })();
  24495. BABYLON.PostProcessRenderPipelineManager = PostProcessRenderPipelineManager;
  24496. })(BABYLON || (BABYLON = {}));
  24497. var BABYLON;
  24498. (function (BABYLON) {
  24499. var BoundingBoxRenderer = (function () {
  24500. function BoundingBoxRenderer(scene) {
  24501. this.frontColor = new BABYLON.Color3(1, 1, 1);
  24502. this.backColor = new BABYLON.Color3(0.1, 0.1, 0.1);
  24503. this.showBackLines = true;
  24504. this.renderList = new BABYLON.SmartArray(32);
  24505. this._scene = scene;
  24506. }
  24507. BoundingBoxRenderer.prototype._prepareRessources = function () {
  24508. if (this._colorShader) {
  24509. return;
  24510. }
  24511. this._colorShader = new BABYLON.ShaderMaterial("colorShader", this._scene, "color", {
  24512. attributes: ["position"],
  24513. uniforms: ["worldViewProjection", "color"]
  24514. });
  24515. var engine = this._scene.getEngine();
  24516. var boxdata = BABYLON.VertexData.CreateBox(1.0);
  24517. this._vb = new BABYLON.VertexBuffer(engine, boxdata.positions, BABYLON.VertexBuffer.PositionKind, false);
  24518. this._ib = engine.createIndexBuffer([0, 1, 1, 2, 2, 3, 3, 0, 4, 5, 5, 6, 6, 7, 7, 4, 0, 7, 1, 6, 2, 5, 3, 4]);
  24519. };
  24520. BoundingBoxRenderer.prototype.reset = function () {
  24521. this.renderList.reset();
  24522. };
  24523. BoundingBoxRenderer.prototype.render = function () {
  24524. if (this.renderList.length === 0) {
  24525. return;
  24526. }
  24527. this._prepareRessources();
  24528. if (!this._colorShader.isReady()) {
  24529. return;
  24530. }
  24531. var engine = this._scene.getEngine();
  24532. engine.setDepthWrite(false);
  24533. this._colorShader._preBind();
  24534. for (var boundingBoxIndex = 0; boundingBoxIndex < this.renderList.length; boundingBoxIndex++) {
  24535. var boundingBox = this.renderList.data[boundingBoxIndex];
  24536. var min = boundingBox.minimum;
  24537. var max = boundingBox.maximum;
  24538. var diff = max.subtract(min);
  24539. var median = min.add(diff.scale(0.5));
  24540. var worldMatrix = BABYLON.Matrix.Scaling(diff.x, diff.y, diff.z)
  24541. .multiply(BABYLON.Matrix.Translation(median.x, median.y, median.z))
  24542. .multiply(boundingBox.getWorldMatrix());
  24543. // VBOs
  24544. engine.bindBuffers(this._vb.getBuffer(), this._ib, [3], 3 * 4, this._colorShader.getEffect());
  24545. if (this.showBackLines) {
  24546. // Back
  24547. engine.setDepthFunctionToGreaterOrEqual();
  24548. this._scene.resetCachedMaterial();
  24549. this._colorShader.setColor4("color", this.backColor.toColor4());
  24550. this._colorShader.bind(worldMatrix);
  24551. // Draw order
  24552. engine.draw(false, 0, 24);
  24553. }
  24554. // Front
  24555. engine.setDepthFunctionToLess();
  24556. this._scene.resetCachedMaterial();
  24557. this._colorShader.setColor4("color", this.frontColor.toColor4());
  24558. this._colorShader.bind(worldMatrix);
  24559. // Draw order
  24560. engine.draw(false, 0, 24);
  24561. }
  24562. this._colorShader.unbind();
  24563. engine.setDepthFunctionToLessOrEqual();
  24564. engine.setDepthWrite(true);
  24565. };
  24566. BoundingBoxRenderer.prototype.dispose = function () {
  24567. if (!this._colorShader) {
  24568. return;
  24569. }
  24570. this._colorShader.dispose();
  24571. this._vb.dispose();
  24572. this._scene.getEngine()._releaseBuffer(this._ib);
  24573. };
  24574. return BoundingBoxRenderer;
  24575. })();
  24576. BABYLON.BoundingBoxRenderer = BoundingBoxRenderer;
  24577. })(BABYLON || (BABYLON = {}));
  24578. var BABYLON;
  24579. (function (BABYLON) {
  24580. var Condition = (function () {
  24581. function Condition(actionManager) {
  24582. this._actionManager = actionManager;
  24583. }
  24584. Condition.prototype.isValid = function () {
  24585. return true;
  24586. };
  24587. Condition.prototype._getProperty = function (propertyPath) {
  24588. return this._actionManager._getProperty(propertyPath);
  24589. };
  24590. Condition.prototype._getEffectiveTarget = function (target, propertyPath) {
  24591. return this._actionManager._getEffectiveTarget(target, propertyPath);
  24592. };
  24593. return Condition;
  24594. })();
  24595. BABYLON.Condition = Condition;
  24596. var ValueCondition = (function (_super) {
  24597. __extends(ValueCondition, _super);
  24598. function ValueCondition(actionManager, target, propertyPath, value, operator) {
  24599. if (operator === void 0) { operator = ValueCondition.IsEqual; }
  24600. _super.call(this, actionManager);
  24601. this.propertyPath = propertyPath;
  24602. this.value = value;
  24603. this.operator = operator;
  24604. this._target = this._getEffectiveTarget(target, this.propertyPath);
  24605. this._property = this._getProperty(this.propertyPath);
  24606. }
  24607. Object.defineProperty(ValueCondition, "IsEqual", {
  24608. get: function () {
  24609. return ValueCondition._IsEqual;
  24610. },
  24611. enumerable: true,
  24612. configurable: true
  24613. });
  24614. Object.defineProperty(ValueCondition, "IsDifferent", {
  24615. get: function () {
  24616. return ValueCondition._IsDifferent;
  24617. },
  24618. enumerable: true,
  24619. configurable: true
  24620. });
  24621. Object.defineProperty(ValueCondition, "IsGreater", {
  24622. get: function () {
  24623. return ValueCondition._IsGreater;
  24624. },
  24625. enumerable: true,
  24626. configurable: true
  24627. });
  24628. Object.defineProperty(ValueCondition, "IsLesser", {
  24629. get: function () {
  24630. return ValueCondition._IsLesser;
  24631. },
  24632. enumerable: true,
  24633. configurable: true
  24634. });
  24635. // Methods
  24636. ValueCondition.prototype.isValid = function () {
  24637. switch (this.operator) {
  24638. case ValueCondition.IsGreater:
  24639. return this._target[this._property] > this.value;
  24640. case ValueCondition.IsLesser:
  24641. return this._target[this._property] < this.value;
  24642. case ValueCondition.IsEqual:
  24643. case ValueCondition.IsDifferent:
  24644. var check;
  24645. if (this.value.equals) {
  24646. check = this.value.equals(this._target[this._property]);
  24647. }
  24648. else {
  24649. check = this.value === this._target[this._property];
  24650. }
  24651. return this.operator === ValueCondition.IsEqual ? check : !check;
  24652. }
  24653. return false;
  24654. };
  24655. // Statics
  24656. ValueCondition._IsEqual = 0;
  24657. ValueCondition._IsDifferent = 1;
  24658. ValueCondition._IsGreater = 2;
  24659. ValueCondition._IsLesser = 3;
  24660. return ValueCondition;
  24661. })(Condition);
  24662. BABYLON.ValueCondition = ValueCondition;
  24663. var PredicateCondition = (function (_super) {
  24664. __extends(PredicateCondition, _super);
  24665. function PredicateCondition(actionManager, predicate) {
  24666. _super.call(this, actionManager);
  24667. this.predicate = predicate;
  24668. }
  24669. PredicateCondition.prototype.isValid = function () {
  24670. return this.predicate();
  24671. };
  24672. return PredicateCondition;
  24673. })(Condition);
  24674. BABYLON.PredicateCondition = PredicateCondition;
  24675. var StateCondition = (function (_super) {
  24676. __extends(StateCondition, _super);
  24677. function StateCondition(actionManager, target, value) {
  24678. _super.call(this, actionManager);
  24679. this.value = value;
  24680. this._target = target;
  24681. }
  24682. // Methods
  24683. StateCondition.prototype.isValid = function () {
  24684. return this._target.state === this.value;
  24685. };
  24686. return StateCondition;
  24687. })(Condition);
  24688. BABYLON.StateCondition = StateCondition;
  24689. })(BABYLON || (BABYLON = {}));
  24690. var BABYLON;
  24691. (function (BABYLON) {
  24692. var Action = (function () {
  24693. function Action(triggerOptions, condition) {
  24694. this.triggerOptions = triggerOptions;
  24695. if (triggerOptions.parameter) {
  24696. this.trigger = triggerOptions.trigger;
  24697. this._triggerParameter = triggerOptions.parameter;
  24698. }
  24699. else {
  24700. this.trigger = triggerOptions;
  24701. }
  24702. this._nextActiveAction = this;
  24703. this._condition = condition;
  24704. }
  24705. // Methods
  24706. Action.prototype._prepare = function () {
  24707. };
  24708. Action.prototype.getTriggerParameter = function () {
  24709. return this._triggerParameter;
  24710. };
  24711. Action.prototype._executeCurrent = function (evt) {
  24712. if (this._nextActiveAction._condition) {
  24713. var condition = this._nextActiveAction._condition;
  24714. var currentRenderId = this._actionManager.getScene().getRenderId();
  24715. // We cache the current evaluation for the current frame
  24716. if (condition._evaluationId === currentRenderId) {
  24717. if (!condition._currentResult) {
  24718. return;
  24719. }
  24720. }
  24721. else {
  24722. condition._evaluationId = currentRenderId;
  24723. if (!condition.isValid()) {
  24724. condition._currentResult = false;
  24725. return;
  24726. }
  24727. condition._currentResult = true;
  24728. }
  24729. }
  24730. this._nextActiveAction.execute(evt);
  24731. if (this._nextActiveAction._child) {
  24732. if (!this._nextActiveAction._child._actionManager) {
  24733. this._nextActiveAction._child._actionManager = this._actionManager;
  24734. }
  24735. this._nextActiveAction = this._nextActiveAction._child;
  24736. }
  24737. else {
  24738. this._nextActiveAction = this;
  24739. }
  24740. };
  24741. Action.prototype.execute = function (evt) {
  24742. };
  24743. Action.prototype.then = function (action) {
  24744. this._child = action;
  24745. action._actionManager = this._actionManager;
  24746. action._prepare();
  24747. return action;
  24748. };
  24749. Action.prototype._getProperty = function (propertyPath) {
  24750. return this._actionManager._getProperty(propertyPath);
  24751. };
  24752. Action.prototype._getEffectiveTarget = function (target, propertyPath) {
  24753. return this._actionManager._getEffectiveTarget(target, propertyPath);
  24754. };
  24755. return Action;
  24756. })();
  24757. BABYLON.Action = Action;
  24758. })(BABYLON || (BABYLON = {}));
  24759. var BABYLON;
  24760. (function (BABYLON) {
  24761. /**
  24762. * ActionEvent is the event beint sent when an action is triggered.
  24763. */
  24764. var ActionEvent = (function () {
  24765. /**
  24766. * @constructor
  24767. * @param source The mesh or sprite that triggered the action.
  24768. * @param pointerX The X mouse cursor position at the time of the event
  24769. * @param pointerY The Y mouse cursor position at the time of the event
  24770. * @param meshUnderPointer The mesh that is currently pointed at (can be null)
  24771. * @param sourceEvent the original (browser) event that triggered the ActionEvent
  24772. */
  24773. function ActionEvent(source, pointerX, pointerY, meshUnderPointer, sourceEvent, additionalData) {
  24774. this.source = source;
  24775. this.pointerX = pointerX;
  24776. this.pointerY = pointerY;
  24777. this.meshUnderPointer = meshUnderPointer;
  24778. this.sourceEvent = sourceEvent;
  24779. this.additionalData = additionalData;
  24780. }
  24781. /**
  24782. * Helper function to auto-create an ActionEvent from a source mesh.
  24783. * @param source The source mesh that triggered the event
  24784. * @param evt {Event} The original (browser) event
  24785. */
  24786. ActionEvent.CreateNew = function (source, evt, additionalData) {
  24787. var scene = source.getScene();
  24788. return new ActionEvent(source, scene.pointerX, scene.pointerY, scene.meshUnderPointer, evt, additionalData);
  24789. };
  24790. /**
  24791. * Helper function to auto-create an ActionEvent from a source mesh.
  24792. * @param source The source sprite that triggered the event
  24793. * @param scene Scene associated with the sprite
  24794. * @param evt {Event} The original (browser) event
  24795. */
  24796. ActionEvent.CreateNewFromSprite = function (source, scene, evt, additionalData) {
  24797. return new ActionEvent(source, scene.pointerX, scene.pointerY, scene.meshUnderPointer, evt, additionalData);
  24798. };
  24799. /**
  24800. * Helper function to auto-create an ActionEvent from a scene. If triggered by a mesh use ActionEvent.CreateNew
  24801. * @param scene the scene where the event occurred
  24802. * @param evt {Event} The original (browser) event
  24803. */
  24804. ActionEvent.CreateNewFromScene = function (scene, evt) {
  24805. return new ActionEvent(null, scene.pointerX, scene.pointerY, scene.meshUnderPointer, evt);
  24806. };
  24807. return ActionEvent;
  24808. })();
  24809. BABYLON.ActionEvent = ActionEvent;
  24810. /**
  24811. * Action Manager manages all events to be triggered on a given mesh or the global scene.
  24812. * A single scene can have many Action Managers to handle predefined actions on specific meshes.
  24813. */
  24814. var ActionManager = (function () {
  24815. function ActionManager(scene) {
  24816. // Members
  24817. this.actions = new Array();
  24818. this._scene = scene;
  24819. scene._actionManagers.push(this);
  24820. }
  24821. Object.defineProperty(ActionManager, "NothingTrigger", {
  24822. get: function () {
  24823. return ActionManager._NothingTrigger;
  24824. },
  24825. enumerable: true,
  24826. configurable: true
  24827. });
  24828. Object.defineProperty(ActionManager, "OnPickTrigger", {
  24829. get: function () {
  24830. return ActionManager._OnPickTrigger;
  24831. },
  24832. enumerable: true,
  24833. configurable: true
  24834. });
  24835. Object.defineProperty(ActionManager, "OnLeftPickTrigger", {
  24836. get: function () {
  24837. return ActionManager._OnLeftPickTrigger;
  24838. },
  24839. enumerable: true,
  24840. configurable: true
  24841. });
  24842. Object.defineProperty(ActionManager, "OnRightPickTrigger", {
  24843. get: function () {
  24844. return ActionManager._OnRightPickTrigger;
  24845. },
  24846. enumerable: true,
  24847. configurable: true
  24848. });
  24849. Object.defineProperty(ActionManager, "OnCenterPickTrigger", {
  24850. get: function () {
  24851. return ActionManager._OnCenterPickTrigger;
  24852. },
  24853. enumerable: true,
  24854. configurable: true
  24855. });
  24856. Object.defineProperty(ActionManager, "OnPointerOverTrigger", {
  24857. get: function () {
  24858. return ActionManager._OnPointerOverTrigger;
  24859. },
  24860. enumerable: true,
  24861. configurable: true
  24862. });
  24863. Object.defineProperty(ActionManager, "OnPointerOutTrigger", {
  24864. get: function () {
  24865. return ActionManager._OnPointerOutTrigger;
  24866. },
  24867. enumerable: true,
  24868. configurable: true
  24869. });
  24870. Object.defineProperty(ActionManager, "OnEveryFrameTrigger", {
  24871. get: function () {
  24872. return ActionManager._OnEveryFrameTrigger;
  24873. },
  24874. enumerable: true,
  24875. configurable: true
  24876. });
  24877. Object.defineProperty(ActionManager, "OnIntersectionEnterTrigger", {
  24878. get: function () {
  24879. return ActionManager._OnIntersectionEnterTrigger;
  24880. },
  24881. enumerable: true,
  24882. configurable: true
  24883. });
  24884. Object.defineProperty(ActionManager, "OnIntersectionExitTrigger", {
  24885. get: function () {
  24886. return ActionManager._OnIntersectionExitTrigger;
  24887. },
  24888. enumerable: true,
  24889. configurable: true
  24890. });
  24891. Object.defineProperty(ActionManager, "OnKeyDownTrigger", {
  24892. get: function () {
  24893. return ActionManager._OnKeyDownTrigger;
  24894. },
  24895. enumerable: true,
  24896. configurable: true
  24897. });
  24898. Object.defineProperty(ActionManager, "OnKeyUpTrigger", {
  24899. get: function () {
  24900. return ActionManager._OnKeyUpTrigger;
  24901. },
  24902. enumerable: true,
  24903. configurable: true
  24904. });
  24905. Object.defineProperty(ActionManager, "OnPickUpTrigger", {
  24906. get: function () {
  24907. return ActionManager._OnPickUpTrigger;
  24908. },
  24909. enumerable: true,
  24910. configurable: true
  24911. });
  24912. // Methods
  24913. ActionManager.prototype.dispose = function () {
  24914. var index = this._scene._actionManagers.indexOf(this);
  24915. if (index > -1) {
  24916. this._scene._actionManagers.splice(index, 1);
  24917. }
  24918. };
  24919. ActionManager.prototype.getScene = function () {
  24920. return this._scene;
  24921. };
  24922. /**
  24923. * Does this action manager handles actions of any of the given triggers
  24924. * @param {number[]} triggers - the triggers to be tested
  24925. * @return {boolean} whether one (or more) of the triggers is handeled
  24926. */
  24927. ActionManager.prototype.hasSpecificTriggers = function (triggers) {
  24928. for (var index = 0; index < this.actions.length; index++) {
  24929. var action = this.actions[index];
  24930. if (triggers.indexOf(action.trigger) > -1) {
  24931. return true;
  24932. }
  24933. }
  24934. return false;
  24935. };
  24936. /**
  24937. * Does this action manager handles actions of a given trigger
  24938. * @param {number} trigger - the trigger to be tested
  24939. * @return {boolean} whether the trigger is handeled
  24940. */
  24941. ActionManager.prototype.hasSpecificTrigger = function (trigger) {
  24942. for (var index = 0; index < this.actions.length; index++) {
  24943. var action = this.actions[index];
  24944. if (action.trigger === trigger) {
  24945. return true;
  24946. }
  24947. }
  24948. return false;
  24949. };
  24950. Object.defineProperty(ActionManager.prototype, "hasPointerTriggers", {
  24951. /**
  24952. * Does this action manager has pointer triggers
  24953. * @return {boolean} whether or not it has pointer triggers
  24954. */
  24955. get: function () {
  24956. for (var index = 0; index < this.actions.length; index++) {
  24957. var action = this.actions[index];
  24958. if (action.trigger >= ActionManager._OnPickTrigger && action.trigger <= ActionManager._OnPointerOutTrigger) {
  24959. return true;
  24960. }
  24961. if (action.trigger === ActionManager._OnPickUpTrigger) {
  24962. return true;
  24963. }
  24964. }
  24965. return false;
  24966. },
  24967. enumerable: true,
  24968. configurable: true
  24969. });
  24970. Object.defineProperty(ActionManager.prototype, "hasPickTriggers", {
  24971. /**
  24972. * Does this action manager has pick triggers
  24973. * @return {boolean} whether or not it has pick triggers
  24974. */
  24975. get: function () {
  24976. for (var index = 0; index < this.actions.length; index++) {
  24977. var action = this.actions[index];
  24978. if (action.trigger >= ActionManager._OnPickTrigger && action.trigger <= ActionManager._OnCenterPickTrigger) {
  24979. return true;
  24980. }
  24981. if (action.trigger === ActionManager._OnPickUpTrigger) {
  24982. return true;
  24983. }
  24984. }
  24985. return false;
  24986. },
  24987. enumerable: true,
  24988. configurable: true
  24989. });
  24990. /**
  24991. * Registers an action to this action manager
  24992. * @param {BABYLON.Action} action - the action to be registered
  24993. * @return {BABYLON.Action} the action amended (prepared) after registration
  24994. */
  24995. ActionManager.prototype.registerAction = function (action) {
  24996. if (action.trigger === ActionManager.OnEveryFrameTrigger) {
  24997. if (this.getScene().actionManager !== this) {
  24998. BABYLON.Tools.Warn("OnEveryFrameTrigger can only be used with scene.actionManager");
  24999. return null;
  25000. }
  25001. }
  25002. this.actions.push(action);
  25003. action._actionManager = this;
  25004. action._prepare();
  25005. return action;
  25006. };
  25007. /**
  25008. * Process a specific trigger
  25009. * @param {number} trigger - the trigger to process
  25010. * @param evt {BABYLON.ActionEvent} the event details to be processed
  25011. */
  25012. ActionManager.prototype.processTrigger = function (trigger, evt) {
  25013. for (var index = 0; index < this.actions.length; index++) {
  25014. var action = this.actions[index];
  25015. if (action.trigger === trigger) {
  25016. if (trigger === ActionManager.OnKeyUpTrigger
  25017. || trigger === ActionManager.OnKeyDownTrigger) {
  25018. var parameter = action.getTriggerParameter();
  25019. if (parameter) {
  25020. var unicode = evt.sourceEvent.charCode ? evt.sourceEvent.charCode : evt.sourceEvent.keyCode;
  25021. var actualkey = String.fromCharCode(unicode).toLowerCase();
  25022. if (actualkey !== parameter.toLowerCase()) {
  25023. continue;
  25024. }
  25025. }
  25026. }
  25027. action._executeCurrent(evt);
  25028. }
  25029. }
  25030. };
  25031. ActionManager.prototype._getEffectiveTarget = function (target, propertyPath) {
  25032. var properties = propertyPath.split(".");
  25033. for (var index = 0; index < properties.length - 1; index++) {
  25034. target = target[properties[index]];
  25035. }
  25036. return target;
  25037. };
  25038. ActionManager.prototype._getProperty = function (propertyPath) {
  25039. var properties = propertyPath.split(".");
  25040. return properties[properties.length - 1];
  25041. };
  25042. // Statics
  25043. ActionManager._NothingTrigger = 0;
  25044. ActionManager._OnPickTrigger = 1;
  25045. ActionManager._OnLeftPickTrigger = 2;
  25046. ActionManager._OnRightPickTrigger = 3;
  25047. ActionManager._OnCenterPickTrigger = 4;
  25048. ActionManager._OnPointerOverTrigger = 5;
  25049. ActionManager._OnPointerOutTrigger = 6;
  25050. ActionManager._OnEveryFrameTrigger = 7;
  25051. ActionManager._OnIntersectionEnterTrigger = 8;
  25052. ActionManager._OnIntersectionExitTrigger = 9;
  25053. ActionManager._OnKeyDownTrigger = 10;
  25054. ActionManager._OnKeyUpTrigger = 11;
  25055. ActionManager._OnPickUpTrigger = 12;
  25056. return ActionManager;
  25057. })();
  25058. BABYLON.ActionManager = ActionManager;
  25059. })(BABYLON || (BABYLON = {}));
  25060. var BABYLON;
  25061. (function (BABYLON) {
  25062. var InterpolateValueAction = (function (_super) {
  25063. __extends(InterpolateValueAction, _super);
  25064. function InterpolateValueAction(triggerOptions, target, propertyPath, value, duration, condition, stopOtherAnimations, onInterpolationDone) {
  25065. if (duration === void 0) { duration = 1000; }
  25066. _super.call(this, triggerOptions, condition);
  25067. this.propertyPath = propertyPath;
  25068. this.value = value;
  25069. this.duration = duration;
  25070. this.stopOtherAnimations = stopOtherAnimations;
  25071. this.onInterpolationDone = onInterpolationDone;
  25072. this._target = target;
  25073. }
  25074. InterpolateValueAction.prototype._prepare = function () {
  25075. this._target = this._getEffectiveTarget(this._target, this.propertyPath);
  25076. this._property = this._getProperty(this.propertyPath);
  25077. };
  25078. InterpolateValueAction.prototype.execute = function () {
  25079. var scene = this._actionManager.getScene();
  25080. var keys = [
  25081. {
  25082. frame: 0,
  25083. value: this._target[this._property]
  25084. }, {
  25085. frame: 100,
  25086. value: this.value
  25087. }
  25088. ];
  25089. var dataType;
  25090. if (typeof this.value === "number") {
  25091. dataType = BABYLON.Animation.ANIMATIONTYPE_FLOAT;
  25092. }
  25093. else if (this.value instanceof BABYLON.Color3) {
  25094. dataType = BABYLON.Animation.ANIMATIONTYPE_COLOR3;
  25095. }
  25096. else if (this.value instanceof BABYLON.Vector3) {
  25097. dataType = BABYLON.Animation.ANIMATIONTYPE_VECTOR3;
  25098. }
  25099. else if (this.value instanceof BABYLON.Matrix) {
  25100. dataType = BABYLON.Animation.ANIMATIONTYPE_MATRIX;
  25101. }
  25102. else if (this.value instanceof BABYLON.Quaternion) {
  25103. dataType = BABYLON.Animation.ANIMATIONTYPE_QUATERNION;
  25104. }
  25105. else {
  25106. BABYLON.Tools.Warn("InterpolateValueAction: Unsupported type (" + typeof this.value + ")");
  25107. return;
  25108. }
  25109. var animation = new BABYLON.Animation("InterpolateValueAction", this._property, 100 * (1000.0 / this.duration), dataType, BABYLON.Animation.ANIMATIONLOOPMODE_CONSTANT);
  25110. animation.setKeys(keys);
  25111. if (this.stopOtherAnimations) {
  25112. scene.stopAnimation(this._target);
  25113. }
  25114. scene.beginDirectAnimation(this._target, [animation], 0, 100, false, 1, this.onInterpolationDone);
  25115. };
  25116. return InterpolateValueAction;
  25117. })(BABYLON.Action);
  25118. BABYLON.InterpolateValueAction = InterpolateValueAction;
  25119. })(BABYLON || (BABYLON = {}));
  25120. var BABYLON;
  25121. (function (BABYLON) {
  25122. var SwitchBooleanAction = (function (_super) {
  25123. __extends(SwitchBooleanAction, _super);
  25124. function SwitchBooleanAction(triggerOptions, target, propertyPath, condition) {
  25125. _super.call(this, triggerOptions, condition);
  25126. this.propertyPath = propertyPath;
  25127. this._target = target;
  25128. }
  25129. SwitchBooleanAction.prototype._prepare = function () {
  25130. this._target = this._getEffectiveTarget(this._target, this.propertyPath);
  25131. this._property = this._getProperty(this.propertyPath);
  25132. };
  25133. SwitchBooleanAction.prototype.execute = function () {
  25134. this._target[this._property] = !this._target[this._property];
  25135. };
  25136. return SwitchBooleanAction;
  25137. })(BABYLON.Action);
  25138. BABYLON.SwitchBooleanAction = SwitchBooleanAction;
  25139. var SetStateAction = (function (_super) {
  25140. __extends(SetStateAction, _super);
  25141. function SetStateAction(triggerOptions, target, value, condition) {
  25142. _super.call(this, triggerOptions, condition);
  25143. this.value = value;
  25144. this._target = target;
  25145. }
  25146. SetStateAction.prototype.execute = function () {
  25147. this._target.state = this.value;
  25148. };
  25149. return SetStateAction;
  25150. })(BABYLON.Action);
  25151. BABYLON.SetStateAction = SetStateAction;
  25152. var SetValueAction = (function (_super) {
  25153. __extends(SetValueAction, _super);
  25154. function SetValueAction(triggerOptions, target, propertyPath, value, condition) {
  25155. _super.call(this, triggerOptions, condition);
  25156. this.propertyPath = propertyPath;
  25157. this.value = value;
  25158. this._target = target;
  25159. }
  25160. SetValueAction.prototype._prepare = function () {
  25161. this._target = this._getEffectiveTarget(this._target, this.propertyPath);
  25162. this._property = this._getProperty(this.propertyPath);
  25163. };
  25164. SetValueAction.prototype.execute = function () {
  25165. this._target[this._property] = this.value;
  25166. };
  25167. return SetValueAction;
  25168. })(BABYLON.Action);
  25169. BABYLON.SetValueAction = SetValueAction;
  25170. var IncrementValueAction = (function (_super) {
  25171. __extends(IncrementValueAction, _super);
  25172. function IncrementValueAction(triggerOptions, target, propertyPath, value, condition) {
  25173. _super.call(this, triggerOptions, condition);
  25174. this.propertyPath = propertyPath;
  25175. this.value = value;
  25176. this._target = target;
  25177. }
  25178. IncrementValueAction.prototype._prepare = function () {
  25179. this._target = this._getEffectiveTarget(this._target, this.propertyPath);
  25180. this._property = this._getProperty(this.propertyPath);
  25181. if (typeof this._target[this._property] !== "number") {
  25182. BABYLON.Tools.Warn("Warning: IncrementValueAction can only be used with number values");
  25183. }
  25184. };
  25185. IncrementValueAction.prototype.execute = function () {
  25186. this._target[this._property] += this.value;
  25187. };
  25188. return IncrementValueAction;
  25189. })(BABYLON.Action);
  25190. BABYLON.IncrementValueAction = IncrementValueAction;
  25191. var PlayAnimationAction = (function (_super) {
  25192. __extends(PlayAnimationAction, _super);
  25193. function PlayAnimationAction(triggerOptions, target, from, to, loop, condition) {
  25194. _super.call(this, triggerOptions, condition);
  25195. this.from = from;
  25196. this.to = to;
  25197. this.loop = loop;
  25198. this._target = target;
  25199. }
  25200. PlayAnimationAction.prototype._prepare = function () {
  25201. };
  25202. PlayAnimationAction.prototype.execute = function () {
  25203. var scene = this._actionManager.getScene();
  25204. scene.beginAnimation(this._target, this.from, this.to, this.loop);
  25205. };
  25206. return PlayAnimationAction;
  25207. })(BABYLON.Action);
  25208. BABYLON.PlayAnimationAction = PlayAnimationAction;
  25209. var StopAnimationAction = (function (_super) {
  25210. __extends(StopAnimationAction, _super);
  25211. function StopAnimationAction(triggerOptions, target, condition) {
  25212. _super.call(this, triggerOptions, condition);
  25213. this._target = target;
  25214. }
  25215. StopAnimationAction.prototype._prepare = function () {
  25216. };
  25217. StopAnimationAction.prototype.execute = function () {
  25218. var scene = this._actionManager.getScene();
  25219. scene.stopAnimation(this._target);
  25220. };
  25221. return StopAnimationAction;
  25222. })(BABYLON.Action);
  25223. BABYLON.StopAnimationAction = StopAnimationAction;
  25224. var DoNothingAction = (function (_super) {
  25225. __extends(DoNothingAction, _super);
  25226. function DoNothingAction(triggerOptions, condition) {
  25227. if (triggerOptions === void 0) { triggerOptions = BABYLON.ActionManager.NothingTrigger; }
  25228. _super.call(this, triggerOptions, condition);
  25229. }
  25230. DoNothingAction.prototype.execute = function () {
  25231. };
  25232. return DoNothingAction;
  25233. })(BABYLON.Action);
  25234. BABYLON.DoNothingAction = DoNothingAction;
  25235. var CombineAction = (function (_super) {
  25236. __extends(CombineAction, _super);
  25237. function CombineAction(triggerOptions, children, condition) {
  25238. _super.call(this, triggerOptions, condition);
  25239. this.children = children;
  25240. }
  25241. CombineAction.prototype._prepare = function () {
  25242. for (var index = 0; index < this.children.length; index++) {
  25243. this.children[index]._actionManager = this._actionManager;
  25244. this.children[index]._prepare();
  25245. }
  25246. };
  25247. CombineAction.prototype.execute = function (evt) {
  25248. for (var index = 0; index < this.children.length; index++) {
  25249. this.children[index].execute(evt);
  25250. }
  25251. };
  25252. return CombineAction;
  25253. })(BABYLON.Action);
  25254. BABYLON.CombineAction = CombineAction;
  25255. var ExecuteCodeAction = (function (_super) {
  25256. __extends(ExecuteCodeAction, _super);
  25257. function ExecuteCodeAction(triggerOptions, func, condition) {
  25258. _super.call(this, triggerOptions, condition);
  25259. this.func = func;
  25260. }
  25261. ExecuteCodeAction.prototype.execute = function (evt) {
  25262. this.func(evt);
  25263. };
  25264. return ExecuteCodeAction;
  25265. })(BABYLON.Action);
  25266. BABYLON.ExecuteCodeAction = ExecuteCodeAction;
  25267. var SetParentAction = (function (_super) {
  25268. __extends(SetParentAction, _super);
  25269. function SetParentAction(triggerOptions, target, parent, condition) {
  25270. _super.call(this, triggerOptions, condition);
  25271. this._target = target;
  25272. this._parent = parent;
  25273. }
  25274. SetParentAction.prototype._prepare = function () {
  25275. };
  25276. SetParentAction.prototype.execute = function () {
  25277. if (this._target.parent === this._parent) {
  25278. return;
  25279. }
  25280. var invertParentWorldMatrix = this._parent.getWorldMatrix().clone();
  25281. invertParentWorldMatrix.invert();
  25282. this._target.position = BABYLON.Vector3.TransformCoordinates(this._target.position, invertParentWorldMatrix);
  25283. this._target.parent = this._parent;
  25284. };
  25285. return SetParentAction;
  25286. })(BABYLON.Action);
  25287. BABYLON.SetParentAction = SetParentAction;
  25288. var PlaySoundAction = (function (_super) {
  25289. __extends(PlaySoundAction, _super);
  25290. function PlaySoundAction(triggerOptions, sound, condition) {
  25291. _super.call(this, triggerOptions, condition);
  25292. this._sound = sound;
  25293. }
  25294. PlaySoundAction.prototype._prepare = function () {
  25295. };
  25296. PlaySoundAction.prototype.execute = function () {
  25297. if (this._sound !== undefined)
  25298. this._sound.play();
  25299. };
  25300. return PlaySoundAction;
  25301. })(BABYLON.Action);
  25302. BABYLON.PlaySoundAction = PlaySoundAction;
  25303. var StopSoundAction = (function (_super) {
  25304. __extends(StopSoundAction, _super);
  25305. function StopSoundAction(triggerOptions, sound, condition) {
  25306. _super.call(this, triggerOptions, condition);
  25307. this._sound = sound;
  25308. }
  25309. StopSoundAction.prototype._prepare = function () {
  25310. };
  25311. StopSoundAction.prototype.execute = function () {
  25312. if (this._sound !== undefined)
  25313. this._sound.stop();
  25314. };
  25315. return StopSoundAction;
  25316. })(BABYLON.Action);
  25317. BABYLON.StopSoundAction = StopSoundAction;
  25318. })(BABYLON || (BABYLON = {}));
  25319. var BABYLON;
  25320. (function (BABYLON) {
  25321. var Geometry = (function () {
  25322. function Geometry(id, scene, vertexData, updatable, mesh) {
  25323. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NONE;
  25324. this._totalVertices = 0;
  25325. this._isDisposed = false;
  25326. this.id = id;
  25327. this._engine = scene.getEngine();
  25328. this._meshes = [];
  25329. this._scene = scene;
  25330. //Init vertex buffer cache
  25331. this._vertexBuffers = {};
  25332. this._indices = [];
  25333. // vertexData
  25334. if (vertexData) {
  25335. this.setAllVerticesData(vertexData, updatable);
  25336. }
  25337. else {
  25338. this._totalVertices = 0;
  25339. this._indices = [];
  25340. }
  25341. // applyToMesh
  25342. if (mesh) {
  25343. this.applyToMesh(mesh);
  25344. mesh.computeWorldMatrix(true);
  25345. }
  25346. }
  25347. Object.defineProperty(Geometry.prototype, "extend", {
  25348. get: function () {
  25349. return this._extend;
  25350. },
  25351. enumerable: true,
  25352. configurable: true
  25353. });
  25354. Geometry.prototype.getScene = function () {
  25355. return this._scene;
  25356. };
  25357. Geometry.prototype.getEngine = function () {
  25358. return this._engine;
  25359. };
  25360. Geometry.prototype.isReady = function () {
  25361. return this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADED || this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_NONE;
  25362. };
  25363. Geometry.prototype.setAllVerticesData = function (vertexData, updatable) {
  25364. vertexData.applyToGeometry(this, updatable);
  25365. this.notifyUpdate();
  25366. };
  25367. Geometry.prototype.setVerticesData = function (kind, data, updatable, stride) {
  25368. if (this._vertexBuffers[kind]) {
  25369. this._vertexBuffers[kind].dispose();
  25370. }
  25371. this._vertexBuffers[kind] = new BABYLON.VertexBuffer(this._engine, data, kind, updatable, this._meshes.length === 0, stride);
  25372. if (kind === BABYLON.VertexBuffer.PositionKind) {
  25373. stride = this._vertexBuffers[kind].getStrideSize();
  25374. this._totalVertices = data.length / stride;
  25375. this._extend = BABYLON.Tools.ExtractMinAndMax(data, 0, this._totalVertices);
  25376. var meshes = this._meshes;
  25377. var numOfMeshes = meshes.length;
  25378. for (var index = 0; index < numOfMeshes; index++) {
  25379. var mesh = meshes[index];
  25380. mesh._resetPointsArrayCache();
  25381. mesh._boundingInfo = new BABYLON.BoundingInfo(this._extend.minimum, this._extend.maximum);
  25382. mesh._createGlobalSubMesh();
  25383. mesh.computeWorldMatrix(true);
  25384. }
  25385. }
  25386. this.notifyUpdate(kind);
  25387. };
  25388. Geometry.prototype.updateVerticesDataDirectly = function (kind, data, offset) {
  25389. var vertexBuffer = this.getVertexBuffer(kind);
  25390. if (!vertexBuffer) {
  25391. return;
  25392. }
  25393. vertexBuffer.updateDirectly(data, offset);
  25394. this.notifyUpdate(kind);
  25395. };
  25396. Geometry.prototype.updateVerticesData = function (kind, data, updateExtends) {
  25397. var vertexBuffer = this.getVertexBuffer(kind);
  25398. if (!vertexBuffer) {
  25399. return;
  25400. }
  25401. vertexBuffer.update(data);
  25402. if (kind === BABYLON.VertexBuffer.PositionKind) {
  25403. var stride = vertexBuffer.getStrideSize();
  25404. this._totalVertices = data.length / stride;
  25405. if (updateExtends) {
  25406. this._extend = BABYLON.Tools.ExtractMinAndMax(data, 0, this._totalVertices);
  25407. }
  25408. var meshes = this._meshes;
  25409. var numOfMeshes = meshes.length;
  25410. for (var index = 0; index < numOfMeshes; index++) {
  25411. var mesh = meshes[index];
  25412. mesh._resetPointsArrayCache();
  25413. if (updateExtends) {
  25414. mesh._boundingInfo = new BABYLON.BoundingInfo(this._extend.minimum, this._extend.maximum);
  25415. for (var subIndex = 0; subIndex < mesh.subMeshes.length; subIndex++) {
  25416. var subMesh = mesh.subMeshes[subIndex];
  25417. subMesh.refreshBoundingInfo();
  25418. }
  25419. }
  25420. }
  25421. }
  25422. this.notifyUpdate(kind);
  25423. };
  25424. Geometry.prototype.getTotalVertices = function () {
  25425. if (!this.isReady()) {
  25426. return 0;
  25427. }
  25428. return this._totalVertices;
  25429. };
  25430. Geometry.prototype.getVerticesData = function (kind, copyWhenShared) {
  25431. var vertexBuffer = this.getVertexBuffer(kind);
  25432. if (!vertexBuffer) {
  25433. return null;
  25434. }
  25435. var orig = vertexBuffer.getData();
  25436. if (!copyWhenShared || this._meshes.length === 1) {
  25437. return orig;
  25438. }
  25439. else {
  25440. var len = orig.length;
  25441. var copy = [];
  25442. for (var i = 0; i < len; i++) {
  25443. copy.push(orig[i]);
  25444. }
  25445. return copy;
  25446. }
  25447. };
  25448. Geometry.prototype.getVertexBuffer = function (kind) {
  25449. if (!this.isReady()) {
  25450. return null;
  25451. }
  25452. return this._vertexBuffers[kind];
  25453. };
  25454. Geometry.prototype.getVertexBuffers = function () {
  25455. if (!this.isReady()) {
  25456. return null;
  25457. }
  25458. return this._vertexBuffers;
  25459. };
  25460. Geometry.prototype.isVerticesDataPresent = function (kind) {
  25461. if (!this._vertexBuffers) {
  25462. if (this._delayInfo) {
  25463. return this._delayInfo.indexOf(kind) !== -1;
  25464. }
  25465. return false;
  25466. }
  25467. return this._vertexBuffers[kind] !== undefined;
  25468. };
  25469. Geometry.prototype.getVerticesDataKinds = function () {
  25470. var result = [];
  25471. var kind;
  25472. if (!this._vertexBuffers && this._delayInfo) {
  25473. for (kind in this._delayInfo) {
  25474. result.push(kind);
  25475. }
  25476. }
  25477. else {
  25478. for (kind in this._vertexBuffers) {
  25479. result.push(kind);
  25480. }
  25481. }
  25482. return result;
  25483. };
  25484. Geometry.prototype.setIndices = function (indices, totalVertices) {
  25485. if (this._indexBuffer) {
  25486. this._engine._releaseBuffer(this._indexBuffer);
  25487. }
  25488. this._indices = indices;
  25489. if (this._meshes.length !== 0 && this._indices) {
  25490. this._indexBuffer = this._engine.createIndexBuffer(this._indices);
  25491. }
  25492. if (totalVertices !== undefined) {
  25493. this._totalVertices = totalVertices;
  25494. }
  25495. var meshes = this._meshes;
  25496. var numOfMeshes = meshes.length;
  25497. for (var index = 0; index < numOfMeshes; index++) {
  25498. meshes[index]._createGlobalSubMesh();
  25499. }
  25500. this.notifyUpdate();
  25501. };
  25502. Geometry.prototype.getTotalIndices = function () {
  25503. if (!this.isReady()) {
  25504. return 0;
  25505. }
  25506. return this._indices.length;
  25507. };
  25508. Geometry.prototype.getIndices = function (copyWhenShared) {
  25509. if (!this.isReady()) {
  25510. return null;
  25511. }
  25512. var orig = this._indices;
  25513. if (!copyWhenShared || this._meshes.length === 1) {
  25514. return orig;
  25515. }
  25516. else {
  25517. var len = orig.length;
  25518. var copy = [];
  25519. for (var i = 0; i < len; i++) {
  25520. copy.push(orig[i]);
  25521. }
  25522. return copy;
  25523. }
  25524. };
  25525. Geometry.prototype.getIndexBuffer = function () {
  25526. if (!this.isReady()) {
  25527. return null;
  25528. }
  25529. return this._indexBuffer;
  25530. };
  25531. Geometry.prototype.releaseForMesh = function (mesh, shouldDispose) {
  25532. var meshes = this._meshes;
  25533. var index = meshes.indexOf(mesh);
  25534. if (index === -1) {
  25535. return;
  25536. }
  25537. for (var kind in this._vertexBuffers) {
  25538. this._vertexBuffers[kind].dispose();
  25539. }
  25540. if (this._indexBuffer && this._engine._releaseBuffer(this._indexBuffer)) {
  25541. this._indexBuffer = null;
  25542. }
  25543. meshes.splice(index, 1);
  25544. mesh._geometry = null;
  25545. if (meshes.length === 0 && shouldDispose) {
  25546. this.dispose();
  25547. }
  25548. };
  25549. Geometry.prototype.applyToMesh = function (mesh) {
  25550. if (mesh._geometry === this) {
  25551. return;
  25552. }
  25553. var previousGeometry = mesh._geometry;
  25554. if (previousGeometry) {
  25555. previousGeometry.releaseForMesh(mesh);
  25556. }
  25557. var meshes = this._meshes;
  25558. // must be done before setting vertexBuffers because of mesh._createGlobalSubMesh()
  25559. mesh._geometry = this;
  25560. this._scene.pushGeometry(this);
  25561. meshes.push(mesh);
  25562. if (this.isReady()) {
  25563. this._applyToMesh(mesh);
  25564. }
  25565. else {
  25566. mesh._boundingInfo = this._boundingInfo;
  25567. }
  25568. };
  25569. Geometry.prototype._applyToMesh = function (mesh) {
  25570. var numOfMeshes = this._meshes.length;
  25571. // vertexBuffers
  25572. for (var kind in this._vertexBuffers) {
  25573. if (numOfMeshes === 1) {
  25574. this._vertexBuffers[kind].create();
  25575. }
  25576. this._vertexBuffers[kind]._buffer.references = numOfMeshes;
  25577. if (kind === BABYLON.VertexBuffer.PositionKind) {
  25578. mesh._resetPointsArrayCache();
  25579. if (!this._extend) {
  25580. this._extend = BABYLON.Tools.ExtractMinAndMax(this._vertexBuffers[kind].getData(), 0, this._totalVertices);
  25581. }
  25582. mesh._boundingInfo = new BABYLON.BoundingInfo(this._extend.minimum, this._extend.maximum);
  25583. mesh._createGlobalSubMesh();
  25584. //bounding info was just created again, world matrix should be applied again.
  25585. mesh._updateBoundingInfo();
  25586. }
  25587. }
  25588. // indexBuffer
  25589. if (numOfMeshes === 1 && this._indices) {
  25590. this._indexBuffer = this._engine.createIndexBuffer(this._indices);
  25591. }
  25592. if (this._indexBuffer) {
  25593. this._indexBuffer.references = numOfMeshes;
  25594. }
  25595. };
  25596. Geometry.prototype.notifyUpdate = function (kind) {
  25597. if (this.onGeometryUpdated) {
  25598. this.onGeometryUpdated(this, kind);
  25599. }
  25600. };
  25601. Geometry.prototype.load = function (scene, onLoaded) {
  25602. var _this = this;
  25603. if (this.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADING) {
  25604. return;
  25605. }
  25606. if (this.isReady()) {
  25607. if (onLoaded) {
  25608. onLoaded();
  25609. }
  25610. return;
  25611. }
  25612. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADING;
  25613. scene._addPendingData(this);
  25614. BABYLON.Tools.LoadFile(this.delayLoadingFile, function (data) {
  25615. _this._delayLoadingFunction(JSON.parse(data), _this);
  25616. _this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_LOADED;
  25617. _this._delayInfo = [];
  25618. scene._removePendingData(_this);
  25619. var meshes = _this._meshes;
  25620. var numOfMeshes = meshes.length;
  25621. for (var index = 0; index < numOfMeshes; index++) {
  25622. _this._applyToMesh(meshes[index]);
  25623. }
  25624. if (onLoaded) {
  25625. onLoaded();
  25626. }
  25627. }, function () { }, scene.database);
  25628. };
  25629. Geometry.prototype.isDisposed = function () {
  25630. return this._isDisposed;
  25631. };
  25632. Geometry.prototype.dispose = function () {
  25633. var meshes = this._meshes;
  25634. var numOfMeshes = meshes.length;
  25635. var index;
  25636. for (index = 0; index < numOfMeshes; index++) {
  25637. this.releaseForMesh(meshes[index]);
  25638. }
  25639. this._meshes = [];
  25640. for (var kind in this._vertexBuffers) {
  25641. this._vertexBuffers[kind].dispose();
  25642. }
  25643. this._vertexBuffers = [];
  25644. this._totalVertices = 0;
  25645. if (this._indexBuffer) {
  25646. this._engine._releaseBuffer(this._indexBuffer);
  25647. }
  25648. this._indexBuffer = null;
  25649. this._indices = [];
  25650. this.delayLoadState = BABYLON.Engine.DELAYLOADSTATE_NONE;
  25651. this.delayLoadingFile = null;
  25652. this._delayLoadingFunction = null;
  25653. this._delayInfo = [];
  25654. this._boundingInfo = null;
  25655. this._scene.removeGeometry(this);
  25656. this._isDisposed = true;
  25657. };
  25658. Geometry.prototype.copy = function (id) {
  25659. var vertexData = new BABYLON.VertexData();
  25660. vertexData.indices = [];
  25661. var indices = this.getIndices();
  25662. for (var index = 0; index < indices.length; index++) {
  25663. vertexData.indices.push(indices[index]);
  25664. }
  25665. var updatable = false;
  25666. var stopChecking = false;
  25667. var kind;
  25668. for (kind in this._vertexBuffers) {
  25669. // using slice() to make a copy of the array and not just reference it
  25670. var data = this.getVerticesData(kind);
  25671. if (data instanceof Float32Array) {
  25672. vertexData.set(new Float32Array(data), kind);
  25673. }
  25674. else {
  25675. vertexData.set(data.slice(0), kind);
  25676. }
  25677. if (!stopChecking) {
  25678. updatable = this.getVertexBuffer(kind).isUpdatable();
  25679. stopChecking = !updatable;
  25680. }
  25681. }
  25682. var geometry = new Geometry(id, this._scene, vertexData, updatable, null);
  25683. geometry.delayLoadState = this.delayLoadState;
  25684. geometry.delayLoadingFile = this.delayLoadingFile;
  25685. geometry._delayLoadingFunction = this._delayLoadingFunction;
  25686. for (kind in this._delayInfo) {
  25687. geometry._delayInfo = geometry._delayInfo || [];
  25688. geometry._delayInfo.push(kind);
  25689. }
  25690. // Bounding info
  25691. geometry._boundingInfo = new BABYLON.BoundingInfo(this._extend.minimum, this._extend.maximum);
  25692. return geometry;
  25693. };
  25694. // Statics
  25695. Geometry.ExtractFromMesh = function (mesh, id) {
  25696. var geometry = mesh._geometry;
  25697. if (!geometry) {
  25698. return null;
  25699. }
  25700. return geometry.copy(id);
  25701. };
  25702. // from http://stackoverflow.com/questions/105034/how-to-create-a-guid-uuid-in-javascript/2117523#answer-2117523
  25703. // be aware Math.random() could cause collisions
  25704. Geometry.RandomId = function () {
  25705. return 'xxxxxxxx-xxxx-4xxx-yxxx-xxxxxxxxxxxx'.replace(/[xy]/g, function (c) {
  25706. var r = Math.random() * 16 | 0, v = c === 'x' ? r : (r & 0x3 | 0x8);
  25707. return v.toString(16);
  25708. });
  25709. };
  25710. return Geometry;
  25711. })();
  25712. BABYLON.Geometry = Geometry;
  25713. /////// Primitives //////////////////////////////////////////////
  25714. var Geometry;
  25715. (function (Geometry) {
  25716. var Primitives;
  25717. (function (Primitives) {
  25718. /// Abstract class
  25719. var _Primitive = (function (_super) {
  25720. __extends(_Primitive, _super);
  25721. function _Primitive(id, scene, vertexData, canBeRegenerated, mesh) {
  25722. this._beingRegenerated = true;
  25723. this._canBeRegenerated = canBeRegenerated;
  25724. _super.call(this, id, scene, vertexData, false, mesh); // updatable = false to be sure not to update vertices
  25725. this._beingRegenerated = false;
  25726. }
  25727. _Primitive.prototype.canBeRegenerated = function () {
  25728. return this._canBeRegenerated;
  25729. };
  25730. _Primitive.prototype.regenerate = function () {
  25731. if (!this._canBeRegenerated) {
  25732. return;
  25733. }
  25734. this._beingRegenerated = true;
  25735. this.setAllVerticesData(this._regenerateVertexData(), false);
  25736. this._beingRegenerated = false;
  25737. };
  25738. _Primitive.prototype.asNewGeometry = function (id) {
  25739. return _super.prototype.copy.call(this, id);
  25740. };
  25741. // overrides
  25742. _Primitive.prototype.setAllVerticesData = function (vertexData, updatable) {
  25743. if (!this._beingRegenerated) {
  25744. return;
  25745. }
  25746. _super.prototype.setAllVerticesData.call(this, vertexData, false);
  25747. };
  25748. _Primitive.prototype.setVerticesData = function (kind, data, updatable) {
  25749. if (!this._beingRegenerated) {
  25750. return;
  25751. }
  25752. _super.prototype.setVerticesData.call(this, kind, data, false);
  25753. };
  25754. // to override
  25755. // protected
  25756. _Primitive.prototype._regenerateVertexData = function () {
  25757. throw new Error("Abstract method");
  25758. };
  25759. _Primitive.prototype.copy = function (id) {
  25760. throw new Error("Must be overriden in sub-classes.");
  25761. };
  25762. return _Primitive;
  25763. })(Geometry);
  25764. Primitives._Primitive = _Primitive;
  25765. var Ribbon = (function (_super) {
  25766. __extends(Ribbon, _super);
  25767. function Ribbon(id, scene, pathArray, closeArray, closePath, offset, canBeRegenerated, mesh, side) {
  25768. if (side === void 0) { side = BABYLON.Mesh.DEFAULTSIDE; }
  25769. this.pathArray = pathArray;
  25770. this.closeArray = closeArray;
  25771. this.closePath = closePath;
  25772. this.offset = offset;
  25773. this.side = side;
  25774. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  25775. }
  25776. Ribbon.prototype._regenerateVertexData = function () {
  25777. return BABYLON.VertexData.CreateRibbon({ pathArray: this.pathArray, closeArray: this.closeArray, closePath: this.closePath, offset: this.offset, sideOrientation: this.side });
  25778. };
  25779. Ribbon.prototype.copy = function (id) {
  25780. return new Ribbon(id, this.getScene(), this.pathArray, this.closeArray, this.closePath, this.offset, this.canBeRegenerated(), null, this.side);
  25781. };
  25782. return Ribbon;
  25783. })(_Primitive);
  25784. Primitives.Ribbon = Ribbon;
  25785. var Box = (function (_super) {
  25786. __extends(Box, _super);
  25787. function Box(id, scene, size, canBeRegenerated, mesh, side) {
  25788. if (side === void 0) { side = BABYLON.Mesh.DEFAULTSIDE; }
  25789. this.size = size;
  25790. this.side = side;
  25791. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  25792. }
  25793. Box.prototype._regenerateVertexData = function () {
  25794. return BABYLON.VertexData.CreateBox({ size: this.size, sideOrientation: this.side });
  25795. };
  25796. Box.prototype.copy = function (id) {
  25797. return new Box(id, this.getScene(), this.size, this.canBeRegenerated(), null, this.side);
  25798. };
  25799. return Box;
  25800. })(_Primitive);
  25801. Primitives.Box = Box;
  25802. var Sphere = (function (_super) {
  25803. __extends(Sphere, _super);
  25804. function Sphere(id, scene, segments, diameter, canBeRegenerated, mesh, side) {
  25805. if (side === void 0) { side = BABYLON.Mesh.DEFAULTSIDE; }
  25806. this.segments = segments;
  25807. this.diameter = diameter;
  25808. this.side = side;
  25809. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  25810. }
  25811. Sphere.prototype._regenerateVertexData = function () {
  25812. return BABYLON.VertexData.CreateSphere({ segments: this.segments, diameter: this.diameter, sideOrientation: this.side });
  25813. };
  25814. Sphere.prototype.copy = function (id) {
  25815. return new Sphere(id, this.getScene(), this.segments, this.diameter, this.canBeRegenerated(), null, this.side);
  25816. };
  25817. return Sphere;
  25818. })(_Primitive);
  25819. Primitives.Sphere = Sphere;
  25820. var Disc = (function (_super) {
  25821. __extends(Disc, _super);
  25822. function Disc(id, scene, radius, tessellation, canBeRegenerated, mesh, side) {
  25823. if (side === void 0) { side = BABYLON.Mesh.DEFAULTSIDE; }
  25824. this.radius = radius;
  25825. this.tessellation = tessellation;
  25826. this.side = side;
  25827. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  25828. }
  25829. Disc.prototype._regenerateVertexData = function () {
  25830. return BABYLON.VertexData.CreateDisc({ radius: this.radius, tessellation: this.tessellation, sideOrientation: this.side });
  25831. };
  25832. Disc.prototype.copy = function (id) {
  25833. return new Disc(id, this.getScene(), this.radius, this.tessellation, this.canBeRegenerated(), null, this.side);
  25834. };
  25835. return Disc;
  25836. })(_Primitive);
  25837. Primitives.Disc = Disc;
  25838. var Cylinder = (function (_super) {
  25839. __extends(Cylinder, _super);
  25840. function Cylinder(id, scene, height, diameterTop, diameterBottom, tessellation, subdivisions, canBeRegenerated, mesh, side) {
  25841. if (subdivisions === void 0) { subdivisions = 1; }
  25842. if (side === void 0) { side = BABYLON.Mesh.DEFAULTSIDE; }
  25843. this.height = height;
  25844. this.diameterTop = diameterTop;
  25845. this.diameterBottom = diameterBottom;
  25846. this.tessellation = tessellation;
  25847. this.subdivisions = subdivisions;
  25848. this.side = side;
  25849. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  25850. }
  25851. Cylinder.prototype._regenerateVertexData = function () {
  25852. return BABYLON.VertexData.CreateCylinder({ height: this.height, diameterTop: this.diameterTop, diameterBottom: this.diameterBottom, tessellation: this.tessellation, subdivisions: this.subdivisions, sideOrientation: this.side });
  25853. };
  25854. Cylinder.prototype.copy = function (id) {
  25855. return new Cylinder(id, this.getScene(), this.height, this.diameterTop, this.diameterBottom, this.tessellation, this.subdivisions, this.canBeRegenerated(), null, this.side);
  25856. };
  25857. return Cylinder;
  25858. })(_Primitive);
  25859. Primitives.Cylinder = Cylinder;
  25860. var Torus = (function (_super) {
  25861. __extends(Torus, _super);
  25862. function Torus(id, scene, diameter, thickness, tessellation, canBeRegenerated, mesh, side) {
  25863. if (side === void 0) { side = BABYLON.Mesh.DEFAULTSIDE; }
  25864. this.diameter = diameter;
  25865. this.thickness = thickness;
  25866. this.tessellation = tessellation;
  25867. this.side = side;
  25868. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  25869. }
  25870. Torus.prototype._regenerateVertexData = function () {
  25871. return BABYLON.VertexData.CreateTorus({ diameter: this.diameter, thickness: this.thickness, tessellation: this.tessellation, sideOrientation: this.side });
  25872. };
  25873. Torus.prototype.copy = function (id) {
  25874. return new Torus(id, this.getScene(), this.diameter, this.thickness, this.tessellation, this.canBeRegenerated(), null, this.side);
  25875. };
  25876. return Torus;
  25877. })(_Primitive);
  25878. Primitives.Torus = Torus;
  25879. var Ground = (function (_super) {
  25880. __extends(Ground, _super);
  25881. function Ground(id, scene, width, height, subdivisions, canBeRegenerated, mesh) {
  25882. this.width = width;
  25883. this.height = height;
  25884. this.subdivisions = subdivisions;
  25885. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  25886. }
  25887. Ground.prototype._regenerateVertexData = function () {
  25888. return BABYLON.VertexData.CreateGround({ width: this.width, height: this.height, subdivisions: this.subdivisions });
  25889. };
  25890. Ground.prototype.copy = function (id) {
  25891. return new Ground(id, this.getScene(), this.width, this.height, this.subdivisions, this.canBeRegenerated(), null);
  25892. };
  25893. return Ground;
  25894. })(_Primitive);
  25895. Primitives.Ground = Ground;
  25896. var TiledGround = (function (_super) {
  25897. __extends(TiledGround, _super);
  25898. function TiledGround(id, scene, xmin, zmin, xmax, zmax, subdivisions, precision, canBeRegenerated, mesh) {
  25899. this.xmin = xmin;
  25900. this.zmin = zmin;
  25901. this.xmax = xmax;
  25902. this.zmax = zmax;
  25903. this.subdivisions = subdivisions;
  25904. this.precision = precision;
  25905. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  25906. }
  25907. TiledGround.prototype._regenerateVertexData = function () {
  25908. return BABYLON.VertexData.CreateTiledGround({ xmin: this.xmin, zmin: this.zmin, xmax: this.xmax, zmax: this.zmax, subdivisions: this.subdivisions, precision: this.precision });
  25909. };
  25910. TiledGround.prototype.copy = function (id) {
  25911. return new TiledGround(id, this.getScene(), this.xmin, this.zmin, this.xmax, this.zmax, this.subdivisions, this.precision, this.canBeRegenerated(), null);
  25912. };
  25913. return TiledGround;
  25914. })(_Primitive);
  25915. Primitives.TiledGround = TiledGround;
  25916. var Plane = (function (_super) {
  25917. __extends(Plane, _super);
  25918. function Plane(id, scene, size, canBeRegenerated, mesh, side) {
  25919. if (side === void 0) { side = BABYLON.Mesh.DEFAULTSIDE; }
  25920. this.size = size;
  25921. this.side = side;
  25922. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  25923. }
  25924. Plane.prototype._regenerateVertexData = function () {
  25925. return BABYLON.VertexData.CreatePlane({ size: this.size, sideOrientation: this.side });
  25926. };
  25927. Plane.prototype.copy = function (id) {
  25928. return new Plane(id, this.getScene(), this.size, this.canBeRegenerated(), null, this.side);
  25929. };
  25930. return Plane;
  25931. })(_Primitive);
  25932. Primitives.Plane = Plane;
  25933. var TorusKnot = (function (_super) {
  25934. __extends(TorusKnot, _super);
  25935. function TorusKnot(id, scene, radius, tube, radialSegments, tubularSegments, p, q, canBeRegenerated, mesh, side) {
  25936. if (side === void 0) { side = BABYLON.Mesh.DEFAULTSIDE; }
  25937. this.radius = radius;
  25938. this.tube = tube;
  25939. this.radialSegments = radialSegments;
  25940. this.tubularSegments = tubularSegments;
  25941. this.p = p;
  25942. this.q = q;
  25943. this.side = side;
  25944. _super.call(this, id, scene, this._regenerateVertexData(), canBeRegenerated, mesh);
  25945. }
  25946. TorusKnot.prototype._regenerateVertexData = function () {
  25947. return BABYLON.VertexData.CreateTorusKnot({ radius: this.radius, tube: this.tube, radialSegments: this.radialSegments, tubularSegments: this.tubularSegments, p: this.p, q: this.q, sideOrientation: this.side });
  25948. };
  25949. TorusKnot.prototype.copy = function (id) {
  25950. return new TorusKnot(id, this.getScene(), this.radius, this.tube, this.radialSegments, this.tubularSegments, this.p, this.q, this.canBeRegenerated(), null, this.side);
  25951. };
  25952. return TorusKnot;
  25953. })(_Primitive);
  25954. Primitives.TorusKnot = TorusKnot;
  25955. })(Primitives = Geometry.Primitives || (Geometry.Primitives = {}));
  25956. })(Geometry = BABYLON.Geometry || (BABYLON.Geometry = {}));
  25957. })(BABYLON || (BABYLON = {}));
  25958. var BABYLON;
  25959. (function (BABYLON) {
  25960. var GroundMesh = (function (_super) {
  25961. __extends(GroundMesh, _super);
  25962. function GroundMesh(name, scene) {
  25963. _super.call(this, name, scene);
  25964. this.generateOctree = false;
  25965. this._worldInverse = new BABYLON.Matrix();
  25966. }
  25967. Object.defineProperty(GroundMesh.prototype, "subdivisions", {
  25968. get: function () {
  25969. return this._subdivisions;
  25970. },
  25971. enumerable: true,
  25972. configurable: true
  25973. });
  25974. GroundMesh.prototype.optimize = function (chunksCount, octreeBlocksSize) {
  25975. if (octreeBlocksSize === void 0) { octreeBlocksSize = 32; }
  25976. this._subdivisions = chunksCount;
  25977. this.subdivide(this._subdivisions);
  25978. this.createOrUpdateSubmeshesOctree(octreeBlocksSize);
  25979. };
  25980. GroundMesh.prototype.getHeightAtCoordinates = function (x, z) {
  25981. var ray = new BABYLON.Ray(new BABYLON.Vector3(x, this.getBoundingInfo().boundingBox.maximumWorld.y + 1, z), new BABYLON.Vector3(0, -1, 0));
  25982. this.getWorldMatrix().invertToRef(this._worldInverse);
  25983. ray = BABYLON.Ray.Transform(ray, this._worldInverse);
  25984. var pickInfo = this.intersects(ray);
  25985. if (pickInfo.hit) {
  25986. return pickInfo.pickedPoint.y;
  25987. }
  25988. return 0;
  25989. };
  25990. return GroundMesh;
  25991. })(BABYLON.Mesh);
  25992. BABYLON.GroundMesh = GroundMesh;
  25993. })(BABYLON || (BABYLON = {}));
  25994. var BABYLON;
  25995. (function (BABYLON) {
  25996. var LinesMesh = (function (_super) {
  25997. __extends(LinesMesh, _super);
  25998. function LinesMesh(name, scene, parent, source, doNotCloneChildren) {
  25999. if (parent === void 0) { parent = null; }
  26000. _super.call(this, name, scene, parent, source, doNotCloneChildren);
  26001. this.color = new BABYLON.Color3(1, 1, 1);
  26002. this.alpha = 1;
  26003. this._colorShader = new BABYLON.ShaderMaterial("colorShader", scene, "color", {
  26004. attributes: ["position"],
  26005. uniforms: ["worldViewProjection", "color"],
  26006. needAlphaBlending: true
  26007. });
  26008. }
  26009. Object.defineProperty(LinesMesh.prototype, "material", {
  26010. get: function () {
  26011. return this._colorShader;
  26012. },
  26013. enumerable: true,
  26014. configurable: true
  26015. });
  26016. Object.defineProperty(LinesMesh.prototype, "isPickable", {
  26017. get: function () {
  26018. return false;
  26019. },
  26020. enumerable: true,
  26021. configurable: true
  26022. });
  26023. Object.defineProperty(LinesMesh.prototype, "checkCollisions", {
  26024. get: function () {
  26025. return false;
  26026. },
  26027. enumerable: true,
  26028. configurable: true
  26029. });
  26030. LinesMesh.prototype._bind = function (subMesh, effect, fillMode) {
  26031. var engine = this.getScene().getEngine();
  26032. var indexToBind = this._geometry.getIndexBuffer();
  26033. // VBOs
  26034. engine.bindBuffers(this._geometry.getVertexBuffer(BABYLON.VertexBuffer.PositionKind).getBuffer(), indexToBind, [3], 3 * 4, this._colorShader.getEffect());
  26035. // Color
  26036. this._colorShader.setColor4("color", this.color.toColor4(this.alpha));
  26037. };
  26038. LinesMesh.prototype._draw = function (subMesh, fillMode, instancesCount) {
  26039. if (!this._geometry || !this._geometry.getVertexBuffers() || !this._geometry.getIndexBuffer()) {
  26040. return;
  26041. }
  26042. var engine = this.getScene().getEngine();
  26043. // Draw order
  26044. engine.draw(false, subMesh.indexStart, subMesh.indexCount);
  26045. };
  26046. LinesMesh.prototype.intersects = function (ray, fastCheck) {
  26047. return null;
  26048. };
  26049. LinesMesh.prototype.dispose = function (doNotRecurse) {
  26050. this._colorShader.dispose();
  26051. _super.prototype.dispose.call(this, doNotRecurse);
  26052. };
  26053. LinesMesh.prototype.clone = function (name, newParent, doNotCloneChildren) {
  26054. return new LinesMesh(name, this.getScene(), newParent, this, doNotCloneChildren);
  26055. };
  26056. return LinesMesh;
  26057. })(BABYLON.Mesh);
  26058. BABYLON.LinesMesh = LinesMesh;
  26059. })(BABYLON || (BABYLON = {}));
  26060. var BABYLON;
  26061. (function (BABYLON) {
  26062. var DebugLayer = (function () {
  26063. function DebugLayer(scene) {
  26064. var _this = this;
  26065. this._transformationMatrix = BABYLON.Matrix.Identity();
  26066. this._enabled = false;
  26067. this._labelsEnabled = false;
  26068. this._displayStatistics = true;
  26069. this._displayTree = false;
  26070. this._displayLogs = false;
  26071. this._identityMatrix = BABYLON.Matrix.Identity();
  26072. this.axisRatio = 0.02;
  26073. this.accentColor = "orange";
  26074. this._scene = scene;
  26075. this._syncPositions = function () {
  26076. var engine = _this._scene.getEngine();
  26077. var canvasRect = engine.getRenderingCanvasClientRect();
  26078. if (_this._showUI) {
  26079. _this._statsDiv.style.left = (canvasRect.width - 410) + "px";
  26080. _this._statsDiv.style.top = (canvasRect.height - 290) + "px";
  26081. _this._statsDiv.style.width = "400px";
  26082. _this._statsDiv.style.height = "auto";
  26083. _this._statsSubsetDiv.style.maxHeight = "240px";
  26084. _this._optionsDiv.style.left = "0px";
  26085. _this._optionsDiv.style.top = "10px";
  26086. _this._optionsDiv.style.width = "200px";
  26087. _this._optionsDiv.style.height = "auto";
  26088. _this._optionsSubsetDiv.style.maxHeight = (canvasRect.height - 225) + "px";
  26089. _this._logDiv.style.left = "0px";
  26090. _this._logDiv.style.top = (canvasRect.height - 170) + "px";
  26091. _this._logDiv.style.width = "600px";
  26092. _this._logDiv.style.height = "160px";
  26093. _this._treeDiv.style.left = (canvasRect.width - 310) + "px";
  26094. _this._treeDiv.style.top = "10px";
  26095. _this._treeDiv.style.width = "300px";
  26096. _this._treeDiv.style.height = "auto";
  26097. _this._treeSubsetDiv.style.maxHeight = (canvasRect.height - 340) + "px";
  26098. }
  26099. _this._globalDiv.style.left = canvasRect.left + "px";
  26100. _this._globalDiv.style.top = canvasRect.top + "px";
  26101. _this._drawingCanvas.style.left = "0px";
  26102. _this._drawingCanvas.style.top = "0px";
  26103. _this._drawingCanvas.style.width = engine.getRenderWidth() + "px";
  26104. _this._drawingCanvas.style.height = engine.getRenderHeight() + "px";
  26105. var devicePixelRatio = window.devicePixelRatio || 1;
  26106. var context = _this._drawingContext;
  26107. var backingStoreRatio = context.webkitBackingStorePixelRatio ||
  26108. context.mozBackingStorePixelRatio ||
  26109. context.msBackingStorePixelRatio ||
  26110. context.oBackingStorePixelRatio ||
  26111. context.backingStorePixelRatio || 1;
  26112. _this._ratio = devicePixelRatio / backingStoreRatio;
  26113. _this._drawingCanvas.width = engine.getRenderWidth() * _this._ratio;
  26114. _this._drawingCanvas.height = engine.getRenderHeight() * _this._ratio;
  26115. };
  26116. this._onCanvasClick = function (evt) {
  26117. _this._clickPosition = {
  26118. x: evt.clientX * _this._ratio,
  26119. y: evt.clientY * _this._ratio
  26120. };
  26121. };
  26122. this._syncUI = function () {
  26123. if (_this._showUI) {
  26124. if (_this._displayStatistics) {
  26125. _this._displayStats();
  26126. _this._statsDiv.style.display = "";
  26127. }
  26128. else {
  26129. _this._statsDiv.style.display = "none";
  26130. }
  26131. if (_this._displayLogs) {
  26132. _this._logDiv.style.display = "";
  26133. }
  26134. else {
  26135. _this._logDiv.style.display = "none";
  26136. }
  26137. if (_this._displayTree) {
  26138. _this._treeDiv.style.display = "";
  26139. if (_this._needToRefreshMeshesTree) {
  26140. _this._needToRefreshMeshesTree = false;
  26141. _this._refreshMeshesTreeContent();
  26142. }
  26143. }
  26144. else {
  26145. _this._treeDiv.style.display = "none";
  26146. }
  26147. }
  26148. };
  26149. this._syncData = function () {
  26150. if (_this._labelsEnabled || !_this._showUI) {
  26151. _this._camera.getViewMatrix().multiplyToRef(_this._camera.getProjectionMatrix(), _this._transformationMatrix);
  26152. _this._drawingContext.clearRect(0, 0, _this._drawingCanvas.width, _this._drawingCanvas.height);
  26153. var engine = _this._scene.getEngine();
  26154. var viewport = _this._camera.viewport;
  26155. var globalViewport = viewport.toGlobal(engine);
  26156. // Meshes
  26157. var meshes = _this._camera.getActiveMeshes();
  26158. for (var index = 0; index < meshes.length; index++) {
  26159. var mesh = meshes.data[index];
  26160. var position = mesh.getBoundingInfo().boundingSphere.center;
  26161. var projectedPosition = BABYLON.Vector3.Project(position, mesh.getWorldMatrix(), _this._transformationMatrix, globalViewport);
  26162. if (mesh.renderOverlay || _this.shouldDisplayAxis && _this.shouldDisplayAxis(mesh)) {
  26163. _this._renderAxis(projectedPosition, mesh, globalViewport);
  26164. }
  26165. if (!_this.shouldDisplayLabel || _this.shouldDisplayLabel(mesh)) {
  26166. _this._renderLabel(mesh.name, projectedPosition, 12, function () { mesh.renderOverlay = !mesh.renderOverlay; }, function () { return mesh.renderOverlay ? 'red' : 'black'; });
  26167. }
  26168. }
  26169. // Cameras
  26170. var cameras = _this._scene.cameras;
  26171. for (index = 0; index < cameras.length; index++) {
  26172. var camera = cameras[index];
  26173. if (camera === _this._camera) {
  26174. continue;
  26175. }
  26176. projectedPosition = BABYLON.Vector3.Project(BABYLON.Vector3.Zero(), camera.getWorldMatrix(), _this._transformationMatrix, globalViewport);
  26177. if (!_this.shouldDisplayLabel || _this.shouldDisplayLabel(camera)) {
  26178. _this._renderLabel(camera.name, projectedPosition, 12, function () {
  26179. _this._camera.detachControl(engine.getRenderingCanvas());
  26180. _this._camera = camera;
  26181. _this._camera.attachControl(engine.getRenderingCanvas());
  26182. }, function () { return "purple"; });
  26183. }
  26184. }
  26185. // Lights
  26186. var lights = _this._scene.lights;
  26187. for (index = 0; index < lights.length; index++) {
  26188. var light = lights[index];
  26189. if (light.position) {
  26190. projectedPosition = BABYLON.Vector3.Project(light.getAbsolutePosition(), _this._identityMatrix, _this._transformationMatrix, globalViewport);
  26191. if (!_this.shouldDisplayLabel || _this.shouldDisplayLabel(light)) {
  26192. _this._renderLabel(light.name, projectedPosition, -20, function () {
  26193. light.setEnabled(!light.isEnabled());
  26194. }, function () { return light.isEnabled() ? "orange" : "gray"; });
  26195. }
  26196. }
  26197. }
  26198. }
  26199. _this._clickPosition = undefined;
  26200. };
  26201. }
  26202. DebugLayer.prototype._refreshMeshesTreeContent = function () {
  26203. while (this._treeSubsetDiv.hasChildNodes()) {
  26204. this._treeSubsetDiv.removeChild(this._treeSubsetDiv.lastChild);
  26205. }
  26206. // Add meshes
  26207. var sortedArray = this._scene.meshes.slice(0, this._scene.meshes.length);
  26208. sortedArray.sort(function (a, b) {
  26209. if (a.name === b.name) {
  26210. return 0;
  26211. }
  26212. return (a.name > b.name) ? 1 : -1;
  26213. });
  26214. for (var index = 0; index < sortedArray.length; index++) {
  26215. var mesh = sortedArray[index];
  26216. if (!mesh.isEnabled()) {
  26217. continue;
  26218. }
  26219. this._generateAdvancedCheckBox(this._treeSubsetDiv, mesh.name, mesh.getTotalVertices() + " verts", mesh.isVisible, function (element, m) {
  26220. m.isVisible = element.checked;
  26221. }, mesh);
  26222. }
  26223. };
  26224. DebugLayer.prototype._renderSingleAxis = function (zero, unit, unitText, label, color) {
  26225. this._drawingContext.beginPath();
  26226. this._drawingContext.moveTo(zero.x, zero.y);
  26227. this._drawingContext.lineTo(unit.x, unit.y);
  26228. this._drawingContext.strokeStyle = color;
  26229. this._drawingContext.lineWidth = 4;
  26230. this._drawingContext.stroke();
  26231. this._drawingContext.font = "normal 14px Segoe UI";
  26232. this._drawingContext.fillStyle = color;
  26233. this._drawingContext.fillText(label, unitText.x, unitText.y);
  26234. };
  26235. DebugLayer.prototype._renderAxis = function (projectedPosition, mesh, globalViewport) {
  26236. var position = mesh.getBoundingInfo().boundingSphere.center;
  26237. var worldMatrix = mesh.getWorldMatrix();
  26238. var unprojectedVector = BABYLON.Vector3.UnprojectFromTransform(projectedPosition.add(new BABYLON.Vector3(this._drawingCanvas.width * this.axisRatio, 0, 0)), globalViewport.width, globalViewport.height, worldMatrix, this._transformationMatrix);
  26239. var unit = (unprojectedVector.subtract(position)).length();
  26240. var xAxis = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(unit, 0, 0)), worldMatrix, this._transformationMatrix, globalViewport);
  26241. var xAxisText = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(unit * 1.5, 0, 0)), worldMatrix, this._transformationMatrix, globalViewport);
  26242. this._renderSingleAxis(projectedPosition, xAxis, xAxisText, "x", "#FF0000");
  26243. var yAxis = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(0, unit, 0)), worldMatrix, this._transformationMatrix, globalViewport);
  26244. var yAxisText = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(0, unit * 1.5, 0)), worldMatrix, this._transformationMatrix, globalViewport);
  26245. this._renderSingleAxis(projectedPosition, yAxis, yAxisText, "y", "#00FF00");
  26246. var zAxis = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(0, 0, unit)), worldMatrix, this._transformationMatrix, globalViewport);
  26247. var zAxisText = BABYLON.Vector3.Project(position.add(new BABYLON.Vector3(0, 0, unit * 1.5)), worldMatrix, this._transformationMatrix, globalViewport);
  26248. this._renderSingleAxis(projectedPosition, zAxis, zAxisText, "z", "#0000FF");
  26249. };
  26250. DebugLayer.prototype._renderLabel = function (text, projectedPosition, labelOffset, onClick, getFillStyle) {
  26251. if (projectedPosition.z > 0 && projectedPosition.z < 1.0) {
  26252. this._drawingContext.font = "normal 12px Segoe UI";
  26253. var textMetrics = this._drawingContext.measureText(text);
  26254. var centerX = projectedPosition.x - textMetrics.width / 2;
  26255. var centerY = projectedPosition.y;
  26256. var clientRect = this._drawingCanvas.getBoundingClientRect();
  26257. if (this._showUI && this._isClickInsideRect(clientRect.left * this._ratio + centerX - 5, clientRect.top * this._ratio + centerY - labelOffset - 12, textMetrics.width + 10, 17)) {
  26258. onClick();
  26259. }
  26260. this._drawingContext.beginPath();
  26261. this._drawingContext.rect(centerX - 5, centerY - labelOffset - 12, textMetrics.width + 10, 17);
  26262. this._drawingContext.fillStyle = getFillStyle();
  26263. this._drawingContext.globalAlpha = 0.5;
  26264. this._drawingContext.fill();
  26265. this._drawingContext.globalAlpha = 1.0;
  26266. this._drawingContext.strokeStyle = '#FFFFFF';
  26267. this._drawingContext.lineWidth = 1;
  26268. this._drawingContext.stroke();
  26269. this._drawingContext.fillStyle = "#FFFFFF";
  26270. this._drawingContext.fillText(text, centerX, centerY - labelOffset);
  26271. this._drawingContext.beginPath();
  26272. this._drawingContext.arc(projectedPosition.x, centerY, 5, 0, 2 * Math.PI, false);
  26273. this._drawingContext.fill();
  26274. }
  26275. };
  26276. DebugLayer.prototype._isClickInsideRect = function (x, y, width, height) {
  26277. if (!this._clickPosition) {
  26278. return false;
  26279. }
  26280. if (this._clickPosition.x < x || this._clickPosition.x > x + width) {
  26281. return false;
  26282. }
  26283. if (this._clickPosition.y < y || this._clickPosition.y > y + height) {
  26284. return false;
  26285. }
  26286. return true;
  26287. };
  26288. DebugLayer.prototype.isVisible = function () {
  26289. return this._enabled;
  26290. };
  26291. DebugLayer.prototype.hide = function () {
  26292. if (!this._enabled) {
  26293. return;
  26294. }
  26295. this._enabled = false;
  26296. var engine = this._scene.getEngine();
  26297. this._scene.unregisterBeforeRender(this._syncData);
  26298. this._scene.unregisterAfterRender(this._syncUI);
  26299. this._rootElement.removeChild(this._globalDiv);
  26300. window.removeEventListener("resize", this._syncPositions);
  26301. this._scene.forceShowBoundingBoxes = false;
  26302. this._scene.forceWireframe = false;
  26303. BABYLON.StandardMaterial.DiffuseTextureEnabled = true;
  26304. BABYLON.StandardMaterial.AmbientTextureEnabled = true;
  26305. BABYLON.StandardMaterial.SpecularTextureEnabled = true;
  26306. BABYLON.StandardMaterial.EmissiveTextureEnabled = true;
  26307. BABYLON.StandardMaterial.BumpTextureEnabled = true;
  26308. BABYLON.StandardMaterial.OpacityTextureEnabled = true;
  26309. BABYLON.StandardMaterial.ReflectionTextureEnabled = true;
  26310. BABYLON.StandardMaterial.LightmapEnabled = true;
  26311. this._scene.shadowsEnabled = true;
  26312. this._scene.particlesEnabled = true;
  26313. this._scene.postProcessesEnabled = true;
  26314. this._scene.collisionsEnabled = true;
  26315. this._scene.lightsEnabled = true;
  26316. this._scene.texturesEnabled = true;
  26317. this._scene.lensFlaresEnabled = true;
  26318. this._scene.proceduralTexturesEnabled = true;
  26319. this._scene.renderTargetsEnabled = true;
  26320. this._scene.probesEnabled = true;
  26321. engine.getRenderingCanvas().removeEventListener("click", this._onCanvasClick);
  26322. };
  26323. DebugLayer.prototype.show = function (showUI, camera, rootElement) {
  26324. if (showUI === void 0) { showUI = true; }
  26325. if (camera === void 0) { camera = null; }
  26326. if (rootElement === void 0) { rootElement = null; }
  26327. if (this._enabled) {
  26328. return;
  26329. }
  26330. this._enabled = true;
  26331. if (camera) {
  26332. this._camera = camera;
  26333. }
  26334. else {
  26335. this._camera = this._scene.activeCamera;
  26336. }
  26337. this._showUI = showUI;
  26338. var engine = this._scene.getEngine();
  26339. this._globalDiv = document.createElement("div");
  26340. this._rootElement = rootElement || document.body;
  26341. this._rootElement.appendChild(this._globalDiv);
  26342. this._generateDOMelements();
  26343. window.addEventListener("resize", this._syncPositions);
  26344. engine.getRenderingCanvas().addEventListener("click", this._onCanvasClick);
  26345. this._syncPositions();
  26346. this._scene.registerBeforeRender(this._syncData);
  26347. this._scene.registerAfterRender(this._syncUI);
  26348. };
  26349. DebugLayer.prototype._clearLabels = function () {
  26350. this._drawingContext.clearRect(0, 0, this._drawingCanvas.width, this._drawingCanvas.height);
  26351. for (var index = 0; index < this._scene.meshes.length; index++) {
  26352. var mesh = this._scene.meshes[index];
  26353. mesh.renderOverlay = false;
  26354. }
  26355. };
  26356. DebugLayer.prototype._generateheader = function (root, text) {
  26357. var header = document.createElement("div");
  26358. header.innerHTML = text + "&nbsp;";
  26359. header.style.textAlign = "right";
  26360. header.style.width = "100%";
  26361. header.style.color = "white";
  26362. header.style.backgroundColor = "Black";
  26363. header.style.padding = "5px 5px 4px 0px";
  26364. header.style.marginLeft = "-5px";
  26365. header.style.fontWeight = "bold";
  26366. root.appendChild(header);
  26367. };
  26368. DebugLayer.prototype._generateTexBox = function (root, title, color) {
  26369. var label = document.createElement("label");
  26370. label.innerHTML = title;
  26371. label.style.color = color;
  26372. root.appendChild(label);
  26373. root.appendChild(document.createElement("br"));
  26374. };
  26375. DebugLayer.prototype._generateAdvancedCheckBox = function (root, leftTitle, rightTitle, initialState, task, tag) {
  26376. if (tag === void 0) { tag = null; }
  26377. var label = document.createElement("label");
  26378. var boundingBoxesCheckbox = document.createElement("input");
  26379. boundingBoxesCheckbox.type = "checkbox";
  26380. boundingBoxesCheckbox.checked = initialState;
  26381. boundingBoxesCheckbox.addEventListener("change", function (evt) {
  26382. task(evt.target, tag);
  26383. });
  26384. label.appendChild(boundingBoxesCheckbox);
  26385. var container = document.createElement("span");
  26386. var leftPart = document.createElement("span");
  26387. var rightPart = document.createElement("span");
  26388. rightPart.style.cssFloat = "right";
  26389. leftPart.innerHTML = leftTitle;
  26390. rightPart.innerHTML = rightTitle;
  26391. rightPart.style.fontSize = "12px";
  26392. rightPart.style.maxWidth = "200px";
  26393. container.appendChild(leftPart);
  26394. container.appendChild(rightPart);
  26395. label.appendChild(container);
  26396. root.appendChild(label);
  26397. root.appendChild(document.createElement("br"));
  26398. };
  26399. DebugLayer.prototype._generateCheckBox = function (root, title, initialState, task, tag) {
  26400. if (tag === void 0) { tag = null; }
  26401. var label = document.createElement("label");
  26402. var checkBox = document.createElement("input");
  26403. checkBox.type = "checkbox";
  26404. checkBox.checked = initialState;
  26405. checkBox.addEventListener("change", function (evt) {
  26406. task(evt.target, tag);
  26407. });
  26408. label.appendChild(checkBox);
  26409. label.appendChild(document.createTextNode(title));
  26410. root.appendChild(label);
  26411. root.appendChild(document.createElement("br"));
  26412. };
  26413. DebugLayer.prototype._generateButton = function (root, title, task, tag) {
  26414. if (tag === void 0) { tag = null; }
  26415. var button = document.createElement("button");
  26416. button.innerHTML = title;
  26417. button.style.height = "24px";
  26418. button.style.color = "#444444";
  26419. button.style.border = "1px solid white";
  26420. button.className = "debugLayerButton";
  26421. button.addEventListener("click", function (evt) {
  26422. task(evt.target, tag);
  26423. });
  26424. root.appendChild(button);
  26425. root.appendChild(document.createElement("br"));
  26426. };
  26427. DebugLayer.prototype._generateRadio = function (root, title, name, initialState, task, tag) {
  26428. if (tag === void 0) { tag = null; }
  26429. var label = document.createElement("label");
  26430. var boundingBoxesRadio = document.createElement("input");
  26431. boundingBoxesRadio.type = "radio";
  26432. boundingBoxesRadio.name = name;
  26433. boundingBoxesRadio.checked = initialState;
  26434. boundingBoxesRadio.addEventListener("change", function (evt) {
  26435. task(evt.target, tag);
  26436. });
  26437. label.appendChild(boundingBoxesRadio);
  26438. label.appendChild(document.createTextNode(title));
  26439. root.appendChild(label);
  26440. root.appendChild(document.createElement("br"));
  26441. };
  26442. DebugLayer.prototype._generateDOMelements = function () {
  26443. var _this = this;
  26444. this._globalDiv.id = "DebugLayer";
  26445. this._globalDiv.style.position = "absolute";
  26446. this._globalDiv.style.fontFamily = "Segoe UI, Arial";
  26447. this._globalDiv.style.fontSize = "14px";
  26448. this._globalDiv.style.color = "white";
  26449. // Drawing canvas
  26450. this._drawingCanvas = document.createElement("canvas");
  26451. this._drawingCanvas.id = "DebugLayerDrawingCanvas";
  26452. this._drawingCanvas.style.position = "absolute";
  26453. this._drawingCanvas.style.pointerEvents = "none";
  26454. this._drawingCanvas.style.backgroundColor = "transparent";
  26455. this._drawingContext = this._drawingCanvas.getContext("2d");
  26456. this._globalDiv.appendChild(this._drawingCanvas);
  26457. if (this._showUI) {
  26458. var background = "rgba(128, 128, 128, 0.4)";
  26459. var border = "rgb(180, 180, 180) solid 1px";
  26460. // Stats
  26461. this._statsDiv = document.createElement("div");
  26462. this._statsDiv.id = "DebugLayerStats";
  26463. this._statsDiv.style.border = border;
  26464. this._statsDiv.style.position = "absolute";
  26465. this._statsDiv.style.background = background;
  26466. this._statsDiv.style.padding = "0px 0px 0px 5px";
  26467. this._generateheader(this._statsDiv, "STATISTICS");
  26468. this._statsSubsetDiv = document.createElement("div");
  26469. this._statsSubsetDiv.style.paddingTop = "5px";
  26470. this._statsSubsetDiv.style.paddingBottom = "5px";
  26471. this._statsSubsetDiv.style.overflowY = "auto";
  26472. this._statsDiv.appendChild(this._statsSubsetDiv);
  26473. // Tree
  26474. this._treeDiv = document.createElement("div");
  26475. this._treeDiv.id = "DebugLayerTree";
  26476. this._treeDiv.style.border = border;
  26477. this._treeDiv.style.position = "absolute";
  26478. this._treeDiv.style.background = background;
  26479. this._treeDiv.style.padding = "0px 0px 0px 5px";
  26480. this._treeDiv.style.display = "none";
  26481. this._generateheader(this._treeDiv, "MESHES TREE");
  26482. this._treeSubsetDiv = document.createElement("div");
  26483. this._treeSubsetDiv.style.paddingTop = "5px";
  26484. this._treeSubsetDiv.style.paddingRight = "5px";
  26485. this._treeSubsetDiv.style.overflowY = "auto";
  26486. this._treeSubsetDiv.style.maxHeight = "300px";
  26487. this._treeDiv.appendChild(this._treeSubsetDiv);
  26488. this._needToRefreshMeshesTree = true;
  26489. // Logs
  26490. this._logDiv = document.createElement("div");
  26491. this._logDiv.style.border = border;
  26492. this._logDiv.id = "DebugLayerLogs";
  26493. this._logDiv.style.position = "absolute";
  26494. this._logDiv.style.background = background;
  26495. this._logDiv.style.padding = "0px 0px 0px 5px";
  26496. this._logDiv.style.display = "none";
  26497. this._generateheader(this._logDiv, "LOGS");
  26498. this._logSubsetDiv = document.createElement("div");
  26499. this._logSubsetDiv.style.height = "127px";
  26500. this._logSubsetDiv.style.paddingTop = "5px";
  26501. this._logSubsetDiv.style.overflowY = "auto";
  26502. this._logSubsetDiv.style.fontSize = "12px";
  26503. this._logSubsetDiv.style.fontFamily = "consolas";
  26504. this._logSubsetDiv.innerHTML = BABYLON.Tools.LogCache;
  26505. this._logDiv.appendChild(this._logSubsetDiv);
  26506. BABYLON.Tools.OnNewCacheEntry = function (entry) {
  26507. _this._logSubsetDiv.innerHTML = entry + _this._logSubsetDiv.innerHTML;
  26508. };
  26509. // Options
  26510. this._optionsDiv = document.createElement("div");
  26511. this._optionsDiv.id = "DebugLayerOptions";
  26512. this._optionsDiv.style.border = border;
  26513. this._optionsDiv.style.position = "absolute";
  26514. this._optionsDiv.style.background = background;
  26515. this._optionsDiv.style.padding = "0px 0px 0px 5px";
  26516. this._optionsDiv.style.overflowY = "auto";
  26517. this._generateheader(this._optionsDiv, "OPTIONS");
  26518. this._optionsSubsetDiv = document.createElement("div");
  26519. this._optionsSubsetDiv.style.paddingTop = "5px";
  26520. this._optionsSubsetDiv.style.paddingBottom = "5px";
  26521. this._optionsSubsetDiv.style.overflowY = "auto";
  26522. this._optionsSubsetDiv.style.maxHeight = "200px";
  26523. this._optionsDiv.appendChild(this._optionsSubsetDiv);
  26524. this._generateTexBox(this._optionsSubsetDiv, "<b>Windows:</b>", this.accentColor);
  26525. this._generateCheckBox(this._optionsSubsetDiv, "Statistics", this._displayStatistics, function (element) { _this._displayStatistics = element.checked; });
  26526. this._generateCheckBox(this._optionsSubsetDiv, "Logs", this._displayLogs, function (element) { _this._displayLogs = element.checked; });
  26527. this._generateCheckBox(this._optionsSubsetDiv, "Meshes tree", this._displayTree, function (element) {
  26528. _this._displayTree = element.checked;
  26529. _this._needToRefreshMeshesTree = true;
  26530. });
  26531. this._optionsSubsetDiv.appendChild(document.createElement("br"));
  26532. this._generateTexBox(this._optionsSubsetDiv, "<b>General:</b>", this.accentColor);
  26533. this._generateCheckBox(this._optionsSubsetDiv, "Bounding boxes", this._scene.forceShowBoundingBoxes, function (element) { _this._scene.forceShowBoundingBoxes = element.checked; });
  26534. this._generateCheckBox(this._optionsSubsetDiv, "Clickable labels", this._labelsEnabled, function (element) {
  26535. _this._labelsEnabled = element.checked;
  26536. if (!_this._labelsEnabled) {
  26537. _this._clearLabels();
  26538. }
  26539. });
  26540. this._generateCheckBox(this._optionsSubsetDiv, "Generate user marks (F12)", BABYLON.Tools.PerformanceLogLevel === BABYLON.Tools.PerformanceUserMarkLogLevel, function (element) {
  26541. if (element.checked) {
  26542. BABYLON.Tools.PerformanceLogLevel = BABYLON.Tools.PerformanceUserMarkLogLevel;
  26543. }
  26544. else {
  26545. BABYLON.Tools.PerformanceLogLevel = BABYLON.Tools.PerformanceNoneLogLevel;
  26546. }
  26547. });
  26548. ;
  26549. this._optionsSubsetDiv.appendChild(document.createElement("br"));
  26550. this._generateTexBox(this._optionsSubsetDiv, "<b>Rendering mode:</b>", this.accentColor);
  26551. this._generateRadio(this._optionsSubsetDiv, "Solid", "renderMode", !this._scene.forceWireframe && !this._scene.forcePointsCloud, function (element) {
  26552. if (element.checked) {
  26553. _this._scene.forceWireframe = false;
  26554. _this._scene.forcePointsCloud = false;
  26555. }
  26556. });
  26557. this._generateRadio(this._optionsSubsetDiv, "Wireframe", "renderMode", this._scene.forceWireframe, function (element) {
  26558. if (element.checked) {
  26559. _this._scene.forceWireframe = true;
  26560. _this._scene.forcePointsCloud = false;
  26561. }
  26562. });
  26563. this._generateRadio(this._optionsSubsetDiv, "Point", "renderMode", this._scene.forcePointsCloud, function (element) {
  26564. if (element.checked) {
  26565. _this._scene.forceWireframe = false;
  26566. _this._scene.forcePointsCloud = true;
  26567. }
  26568. });
  26569. this._optionsSubsetDiv.appendChild(document.createElement("br"));
  26570. this._generateTexBox(this._optionsSubsetDiv, "<b>Texture channels:</b>", this.accentColor);
  26571. this._generateCheckBox(this._optionsSubsetDiv, "Diffuse", BABYLON.StandardMaterial.DiffuseTextureEnabled, function (element) { BABYLON.StandardMaterial.DiffuseTextureEnabled = element.checked; });
  26572. this._generateCheckBox(this._optionsSubsetDiv, "Ambient", BABYLON.StandardMaterial.AmbientTextureEnabled, function (element) { BABYLON.StandardMaterial.AmbientTextureEnabled = element.checked; });
  26573. this._generateCheckBox(this._optionsSubsetDiv, "Specular", BABYLON.StandardMaterial.SpecularTextureEnabled, function (element) { BABYLON.StandardMaterial.SpecularTextureEnabled = element.checked; });
  26574. this._generateCheckBox(this._optionsSubsetDiv, "Emissive", BABYLON.StandardMaterial.EmissiveTextureEnabled, function (element) { BABYLON.StandardMaterial.EmissiveTextureEnabled = element.checked; });
  26575. this._generateCheckBox(this._optionsSubsetDiv, "Bump", BABYLON.StandardMaterial.BumpTextureEnabled, function (element) { BABYLON.StandardMaterial.BumpTextureEnabled = element.checked; });
  26576. this._generateCheckBox(this._optionsSubsetDiv, "Opacity", BABYLON.StandardMaterial.OpacityTextureEnabled, function (element) { BABYLON.StandardMaterial.OpacityTextureEnabled = element.checked; });
  26577. this._generateCheckBox(this._optionsSubsetDiv, "Reflection", BABYLON.StandardMaterial.ReflectionTextureEnabled, function (element) { BABYLON.StandardMaterial.ReflectionTextureEnabled = element.checked; });
  26578. this._generateCheckBox(this._optionsSubsetDiv, "Fresnel", BABYLON.StandardMaterial.FresnelEnabled, function (element) { BABYLON.StandardMaterial.FresnelEnabled = element.checked; });
  26579. this._generateCheckBox(this._optionsSubsetDiv, "Lightmap", BABYLON.StandardMaterial.LightmapEnabled, function (element) { BABYLON.StandardMaterial.LightmapEnabled = element.checked; });
  26580. this._optionsSubsetDiv.appendChild(document.createElement("br"));
  26581. this._generateTexBox(this._optionsSubsetDiv, "<b>Options:</b>", this.accentColor);
  26582. this._generateCheckBox(this._optionsSubsetDiv, "Animations", this._scene.animationsEnabled, function (element) { _this._scene.animationsEnabled = element.checked; });
  26583. this._generateCheckBox(this._optionsSubsetDiv, "Collisions", this._scene.collisionsEnabled, function (element) { _this._scene.collisionsEnabled = element.checked; });
  26584. this._generateCheckBox(this._optionsSubsetDiv, "Fog", this._scene.fogEnabled, function (element) { _this._scene.fogEnabled = element.checked; });
  26585. this._generateCheckBox(this._optionsSubsetDiv, "Lens flares", this._scene.lensFlaresEnabled, function (element) { _this._scene.lensFlaresEnabled = element.checked; });
  26586. this._generateCheckBox(this._optionsSubsetDiv, "Lights", this._scene.lightsEnabled, function (element) { _this._scene.lightsEnabled = element.checked; });
  26587. this._generateCheckBox(this._optionsSubsetDiv, "Particles", this._scene.particlesEnabled, function (element) { _this._scene.particlesEnabled = element.checked; });
  26588. this._generateCheckBox(this._optionsSubsetDiv, "Post-processes", this._scene.postProcessesEnabled, function (element) { _this._scene.postProcessesEnabled = element.checked; });
  26589. this._generateCheckBox(this._optionsSubsetDiv, "Probes", this._scene.probesEnabled, function (element) { _this._scene.probesEnabled = element.checked; });
  26590. this._generateCheckBox(this._optionsSubsetDiv, "Procedural textures", this._scene.proceduralTexturesEnabled, function (element) { _this._scene.proceduralTexturesEnabled = element.checked; });
  26591. this._generateCheckBox(this._optionsSubsetDiv, "Render targets", this._scene.renderTargetsEnabled, function (element) { _this._scene.renderTargetsEnabled = element.checked; });
  26592. this._generateCheckBox(this._optionsSubsetDiv, "Shadows", this._scene.shadowsEnabled, function (element) { _this._scene.shadowsEnabled = element.checked; });
  26593. this._generateCheckBox(this._optionsSubsetDiv, "Skeletons", this._scene.skeletonsEnabled, function (element) { _this._scene.skeletonsEnabled = element.checked; });
  26594. this._generateCheckBox(this._optionsSubsetDiv, "Sprites", this._scene.spritesEnabled, function (element) { _this._scene.spritesEnabled = element.checked; });
  26595. this._generateCheckBox(this._optionsSubsetDiv, "Textures", this._scene.texturesEnabled, function (element) { _this._scene.texturesEnabled = element.checked; });
  26596. if (BABYLON.AudioEngine && BABYLON.Engine.audioEngine.canUseWebAudio) {
  26597. this._optionsSubsetDiv.appendChild(document.createElement("br"));
  26598. this._generateTexBox(this._optionsSubsetDiv, "<b>Audio:</b>", this.accentColor);
  26599. this._generateRadio(this._optionsSubsetDiv, "Headphones", "panningModel", this._scene.headphone, function (element) {
  26600. if (element.checked) {
  26601. _this._scene.headphone = true;
  26602. }
  26603. });
  26604. this._generateRadio(this._optionsSubsetDiv, "Normal Speakers", "panningModel", !this._scene.headphone, function (element) {
  26605. if (element.checked) {
  26606. _this._scene.headphone = false;
  26607. }
  26608. });
  26609. this._generateCheckBox(this._optionsSubsetDiv, "Disable audio", !this._scene.audioEnabled, function (element) {
  26610. _this._scene.audioEnabled = !element.checked;
  26611. });
  26612. }
  26613. this._optionsSubsetDiv.appendChild(document.createElement("br"));
  26614. this._generateTexBox(this._optionsSubsetDiv, "<b>Tools:</b>", this.accentColor);
  26615. this._generateButton(this._optionsSubsetDiv, "Dump rendertargets", function (element) { _this._scene.dumpNextRenderTargets = true; });
  26616. this._optionsSubsetDiv.appendChild(document.createElement("br"));
  26617. this._globalDiv.appendChild(this._statsDiv);
  26618. this._globalDiv.appendChild(this._logDiv);
  26619. this._globalDiv.appendChild(this._optionsDiv);
  26620. this._globalDiv.appendChild(this._treeDiv);
  26621. }
  26622. };
  26623. DebugLayer.prototype._displayStats = function () {
  26624. var scene = this._scene;
  26625. var engine = scene.getEngine();
  26626. var glInfo = engine.getGlInfo();
  26627. this._statsSubsetDiv.innerHTML = "Babylon.js v" + BABYLON.Engine.Version + " - <b>" + BABYLON.Tools.Format(engine.getFps(), 0) + " fps</b><br><br>"
  26628. + "<div style='column-count: 2;-moz-column-count:2;-webkit-column-count:2'>"
  26629. + "<b>Count</b><br>"
  26630. + "Total meshes: " + scene.meshes.length + "<br>"
  26631. + "Total vertices: " + scene.getTotalVertices() + "<br>"
  26632. + "Total materials: " + scene.materials.length + "<br>"
  26633. + "Total textures: " + scene.textures.length + "<br>"
  26634. + "Active meshes: " + scene.getActiveMeshes().length + "<br>"
  26635. + "Active indices: " + scene.getActiveIndices() + "<br>"
  26636. + "Active bones: " + scene.getActiveBones() + "<br>"
  26637. + "Active particles: " + scene.getActiveParticles() + "<br>"
  26638. + "<b>Draw calls: " + engine.drawCalls + "</b><br><br>"
  26639. + "<b>Duration</b><br>"
  26640. + "Meshes selection:</i> " + BABYLON.Tools.Format(scene.getEvaluateActiveMeshesDuration()) + " ms<br>"
  26641. + "Render Targets: " + BABYLON.Tools.Format(scene.getRenderTargetsDuration()) + " ms<br>"
  26642. + "Particles: " + BABYLON.Tools.Format(scene.getParticlesDuration()) + " ms<br>"
  26643. + "Sprites: " + BABYLON.Tools.Format(scene.getSpritesDuration()) + " ms<br><br>"
  26644. + "Render: <b>" + BABYLON.Tools.Format(scene.getRenderDuration()) + " ms</b><br>"
  26645. + "Frame: " + BABYLON.Tools.Format(scene.getLastFrameDuration()) + " ms<br>"
  26646. + "Potential FPS: " + BABYLON.Tools.Format(1000.0 / scene.getLastFrameDuration(), 0) + "<br><br>"
  26647. + "</div>"
  26648. + "<div style='column-count: 2;-moz-column-count:2;-webkit-column-count:2'>"
  26649. + "<b>Extensions</b><br>"
  26650. + "Std derivatives: " + (engine.getCaps().standardDerivatives ? "Yes" : "No") + "<br>"
  26651. + "Compressed textures: " + (engine.getCaps().s3tc ? "Yes" : "No") + "<br>"
  26652. + "Hardware instances: " + (engine.getCaps().instancedArrays ? "Yes" : "No") + "<br>"
  26653. + "Texture float: " + (engine.getCaps().textureFloat ? "Yes" : "No") + "<br>"
  26654. + "32bits indices: " + (engine.getCaps().uintIndices ? "Yes" : "No") + "<br>"
  26655. + "<b>Caps.</b><br>"
  26656. + "Max textures units: " + engine.getCaps().maxTexturesImageUnits + "<br>"
  26657. + "Max textures size: " + engine.getCaps().maxTextureSize + "<br>"
  26658. + "Max anisotropy: " + engine.getCaps().maxAnisotropy + "<br><br><br>"
  26659. + "</div><br>"
  26660. + "<b>Info</b><br>"
  26661. + glInfo.version + "<br>"
  26662. + glInfo.renderer + "<br>";
  26663. if (this.customStatsFunction) {
  26664. this._statsSubsetDiv.innerHTML += this._statsSubsetDiv.innerHTML;
  26665. }
  26666. };
  26667. return DebugLayer;
  26668. })();
  26669. BABYLON.DebugLayer = DebugLayer;
  26670. })(BABYLON || (BABYLON = {}));
  26671. var BABYLON;
  26672. (function (BABYLON) {
  26673. var DefaultLoadingScreen = (function () {
  26674. function DefaultLoadingScreen(_renderingCanvas, _loadingText, _loadingDivBackgroundColor) {
  26675. var _this = this;
  26676. if (_loadingText === void 0) { _loadingText = ""; }
  26677. if (_loadingDivBackgroundColor === void 0) { _loadingDivBackgroundColor = "black"; }
  26678. this._renderingCanvas = _renderingCanvas;
  26679. this._loadingText = _loadingText;
  26680. this._loadingDivBackgroundColor = _loadingDivBackgroundColor;
  26681. // Resize
  26682. this._resizeLoadingUI = function () {
  26683. var canvasRect = _this._renderingCanvas.getBoundingClientRect();
  26684. _this._loadingDiv.style.position = "absolute";
  26685. _this._loadingDiv.style.left = canvasRect.left + "px";
  26686. _this._loadingDiv.style.top = canvasRect.top + "px";
  26687. _this._loadingDiv.style.width = canvasRect.width + "px";
  26688. _this._loadingDiv.style.height = canvasRect.height + "px";
  26689. };
  26690. }
  26691. DefaultLoadingScreen.prototype.displayLoadingUI = function () {
  26692. var _this = this;
  26693. this._loadingDiv = document.createElement("div");
  26694. this._loadingDiv.style.opacity = "0";
  26695. this._loadingDiv.style.transition = "opacity 1.5s ease";
  26696. // Loading text
  26697. this._loadingTextDiv = document.createElement("div");
  26698. this._loadingTextDiv.style.position = "absolute";
  26699. this._loadingTextDiv.style.left = "0";
  26700. this._loadingTextDiv.style.top = "50%";
  26701. this._loadingTextDiv.style.marginTop = "80px";
  26702. this._loadingTextDiv.style.width = "100%";
  26703. this._loadingTextDiv.style.height = "20px";
  26704. this._loadingTextDiv.style.fontFamily = "Arial";
  26705. this._loadingTextDiv.style.fontSize = "14px";
  26706. this._loadingTextDiv.style.color = "white";
  26707. this._loadingTextDiv.style.textAlign = "center";
  26708. this._loadingTextDiv.innerHTML = "Loading";
  26709. this._loadingDiv.appendChild(this._loadingTextDiv);
  26710. //set the predefined text
  26711. this._loadingTextDiv.innerHTML = this._loadingText;
  26712. // Loading img
  26713. var imgBack = new Image();
  26714. imgBack.src = "data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAGQAAABkCAYAAABw4pVUAAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAJcEhZcwAADsMAAA7DAcdvqGQAAAAYdEVYdFNvZnR3YXJlAHBhaW50Lm5ldCA0LjAuM4zml1AAAARbSURBVHhe7Z09aFNRFMc716kuLrq4FdyLq4Wi4CAoRQcR0UJBUBdRiuLSIYMo6CA4FF2sgw6CFAdFUOpSQYcWO4hD26UQCfXrIQrx/JJzw1OSWq3NPeL/B4Fy+0jg/HO+7j3vpUcI8b/Q39+/49ihfWdPHT94Yf/e3Se3bd263f8lus218TPn6vV6Ya8Wi/MzNRNmj18iusX9W1evmP1/EKNEIVG6CMbG6E3bt+fT++pHha8NoHdT72bLE8NDg7tGU64gLLndV4Wc4m8j/pS+vr4tGB/DT16v3Fyr8dvBe/jbit8BL0AES9LX1iPAz+BR/hFiLVCynj95dPzNy6fv3IZ/k4L3948Sq7FzYGBg4vLFGxitabuOFCbWNKGrMnbiUuo18KaV6tIHv6YtvL9/nOgE31jCktmrY7k6+/zhE4yP4Vf7hiNqh/BWWEl8mzDol4p22Lf7cIdvdUMEvv0Y2S9fE5S1hLzpqTsPkiep//gFGPnR3Yl7GL5p/xYFBrTwM+iXio3GqpwDGL5p/xYNIX7XG8Q6IJRgdIzf1KBBgafII7oMidhyQtVFaMA2Bt7il4huQRhaXphbcR2g4RXqBzKAGHiCCwGFVUAj/m/RTRDj29cvn10I0PZ3LghH5f4CL1EFlQmqqXK3jDDKFxmhQ3Yt6oQseUZGKmMnTpsOqc8o1F9kBOMjQlOLeqEeIyOc6JV6jYLJD/+XyIFvnzdgl9aXRQ5I2qZDK1SpospMqaoqON/wZZGDciLnMMiXRS7IF4hhqMTNTdk7CFu+LHLhR7BQqBvPDJUUQqCGvCMATHUgBmhWNgApmdOda9YpM+VwRYfuyyIXDK8hBlilNerLIheMZCKGwlUAyru6GlwOgPUbRxADdJ9FAChxXY864viyyEXqPxhc0M2TAfAbatSdRyHtXymhByEdRnE3ky+JnHAIhSA0h74kckETmHoQbSgGwJrCIRMEPSRIBCRIMAhZaYhaggQhJXUJEoRU9mofKwh+F22dLRRfEjlJM7w6KQwCoQpBOKTyJZETjmwRxKqtGV8SOSkNOGjKPQppBEgDDkFgpxdBVGkFgaYQQXRIFQSObk0P5ZFIpAZRHXsQ0r0hCluBWKkuvVbYCkQaCdL5ehBScudJP4yY+rLISdps1NBDEJKXMMmoSfggWC4ZQRR17oFYXph7hSiquIKQ+hJGTX1J5MYSPD/GVdNzsgLBwZVCVyAQAkF0ohiI/c1fS6tNXq9UfEnkhudmIQolsS+J3Hh/UtNDzQLhj42VKJFInqLwFYiUU5ToA+HdfI0JevUpQUAIn+vSz2lHIuUV/dJOIHhOY/IWVWGBIHQtzs88s9zyWBuTgcBLzGOmeNnfF/QslSDgMeQW85i3DOQxuipxAkCyZ8SIm4Omp+7MMlCB59j6sKZcMoM4iIEoeI2J9AKxrFobZx0v4vYInuHFS4J1GQRCAGaLEYQXfyMML5XSQgghhBBCCCH+cXp6vgNhKpSKX/XdOAAAAABJRU5ErkJggg==";
  26715. imgBack.style.position = "absolute";
  26716. imgBack.style.left = "50%";
  26717. imgBack.style.top = "50%";
  26718. imgBack.style.marginLeft = "-50px";
  26719. imgBack.style.marginTop = "-50px";
  26720. imgBack.style.transition = "transform 1.0s ease";
  26721. imgBack.style.webkitTransition = "-webkit-transform 1.0s ease";
  26722. var deg = 360;
  26723. var onTransitionEnd = function () {
  26724. deg += 360;
  26725. imgBack.style.transform = "rotateZ(" + deg + "deg)";
  26726. imgBack.style.webkitTransform = "rotateZ(" + deg + "deg)";
  26727. };
  26728. imgBack.addEventListener("transitionend", onTransitionEnd);
  26729. imgBack.addEventListener("webkitTransitionEnd", onTransitionEnd);
  26730. this._loadingDiv.appendChild(imgBack);
  26731. // front image
  26732. var imgFront = new Image();
  26733. imgFront.src = "data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAGQAAABkCAYAAABw4pVUAAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAJcEhZcwAADsMAAA7DAcdvqGQAAAAYdEVYdFNvZnR3YXJlAHBhaW50Lm5ldCA0LjAuM4zml1AAAAYJSURBVHhe7Zy/qx1FFMff/2Av2Nvbi4WFiiAEY/OQ2IgQsbCJQoqkCAgpFLXyoZURLfwBIiIpgqZJoYQYlWelNsIrNOxDJcrzfHe+G97dnTl75u7euzv7zgcWHrlnZmfOmXPmzI/NjuM4juM4juM4juM4juM4juM4juM4juM45fPic08/uHf5/CvffH7lnT8PfrtxdHS0n3p+/fHGl5+89/prr5599iEWd8bg0rkXHoFyqehKnlxQpjYSDHTm9JMPsGrHylOPPXofvICKXMcIGtXdf/76AYbm6xyNW9e/eAtKC7rbKLXnvHHx5Sf4auc4Ek7OQkFU1Dap/vv37k/wSjblZANFiFIGzw98hhizwqBgs04mCBdQRNCHidoAEtY+lLIvtSdoGFeyql2ZH57HBH4sE7O+o/r9l+8/ZXUni68+2jsHBQQ9qNRGeP/tSxdSYQX/roUcpL4/f3vtM9TD+jTq92n1LQ7jxF1hhGPtwWL3gGccy8JuS1r8sVWBGXNVdSKMYjBGPUJjCzooiGuSpnwlnnOGP2dhHRSLNgpHp2oMKIriK8TmG4Qh/rwW8D6pps9b9im+LDDipXOqMVJrAngBfg9i98gevWKA+/nnCod3Dr5GfaHaDgidVym6HKRjGIkpqthcAVKGxNqBImbEo66kjCih8AOpNmkUmbMuUrR8kEqiU6FvHZLGAPJ71JCYSyhiBqmwFE2GoD6jLGIfDHtG6EzoU4dK21PCqIRMEF0FGRjFzGDtIkXVAdATvsqfT9CJ0JcOFdYiFIsiMlqYy1YOFpQo2OddqBtyEaq9y+efoVh5oPHoROjLKn0j3JIE5Ka8UqZRtGrMnneX6yVofOhDh94MSbznTcpqmDOt1vyQzOgaJAF4F3JBfIXesrNEGWWmjIX7UBZ6jRJbBMLg/DmJiKUGVHleIpnVNTa+jakzkAviJqLhi4MC9XQGBrZeKJZESSrKy7ik0VGFWhQBRDTHIACKQ5l9nAjy75gya4a2w+Jhs0FJdc0xX/GwUbAqFBkZi7QpJ2w16WUbjFyK9MJF3KaoEM74KhVtLrQOrsmRxkbdHEqmSC/c+EuGnIFkjW7Ih2Kr4CCMIvNG2hrrgLpCjiFloooYCjyYrzCRyvhyBthkIPuQtsZGdnbMTezyDiU71KTC5zr7aVsHbsz2tllrEkS5UHwU1tq1HbtPW4UbeB0O7xx8R5EsMJql+BheUmHjkNVmIRP7LutoM3+D4O4tG7vCkNO9ESZ4lL3J6rKRMPx4qKbD/A0icf8CG7tC7kTahnMTwleuYSrsS7GatRAvfZh1tTm5BmmQCdZ8a0Sefe28xUrRBkmFLKy8KTIKUDRX0Y1xagPgwbaIdeFnQULmKak3xvwNMkVGgok/N5XNoehJvejRlCDl9escI28dJU0tZ++nBTJE9mEF647x5Ehbo4s5hDOKFIU0PdofeA5F5k1q63zIWmQqNI/P3ZubjFTqKxQ3jyjHAOX0RdlgVO9hzRFpczRcjZ3Gbxxpc7Qj6+5pTYF2OFXawNI+yDGf1k2NcvOlzBQeDQ/t7zD7DsEDpJ2xATXaNtDWUS4IzP4DS2ljajAVu57SUkYw245ptxZxA5JiZaJ0DswudGn3kYUy54426EjoT4dZfYbccxC2nI92cDkZHQr96jD4AGkMDKeSy/COBsRe6VTSKFN6irLeaCh3IteQjt1E5+oudsG/b/2DfZ5AqsYo8vMDK9LB1HzSsLWvlGThdxXvC6+NsqyPPWP0pMINtbdsajfVeC6f/GZ+cdAofQoB1d+Hf9waY98I7+RXWab3Lt4zYkjHtTnlOLXHYMsCh1zWeQYehu1zfNPOOiys/d91LAKEBSgh6MJMbSA82AaHofDgAIwbgvVvlLNS11nModMm4UZergLHZBZrodmBuA3lBB1thdorSjkOmATMDwg/UBQVtglqQyx6fbEJ+H3IWIapjYAjAfeIgeCMHldueJvFaqDaAHhwf8qNsEEQ1iQbOoUUGIbCLRc8+Bvfp4jyd2FEijuO4ziO4ziO4ziO4ziO4ziO4ziO4ziOUzw7O/8D0P7rcZ/GEboAAAAASUVORK5CYII=";
  26734. imgFront.style.position = "absolute";
  26735. imgFront.style.left = "50%";
  26736. imgFront.style.top = "50%";
  26737. imgFront.style.marginLeft = "-50px";
  26738. imgFront.style.marginTop = "-50px";
  26739. this._loadingDiv.appendChild(imgFront);
  26740. this._resizeLoadingUI();
  26741. window.addEventListener("resize", this._resizeLoadingUI);
  26742. this._loadingDiv.style.backgroundColor = this._loadingDivBackgroundColor;
  26743. document.body.appendChild(this._loadingDiv);
  26744. setTimeout(function () {
  26745. _this._loadingDiv.style.opacity = "1";
  26746. imgBack.style.transform = "rotateZ(360deg)";
  26747. imgBack.style.webkitTransform = "rotateZ(360deg)";
  26748. }, 0);
  26749. };
  26750. DefaultLoadingScreen.prototype.hideLoadingUI = function () {
  26751. var _this = this;
  26752. if (!this._loadingDiv) {
  26753. return;
  26754. }
  26755. var onTransitionEnd = function () {
  26756. if (!_this._loadingDiv) {
  26757. return;
  26758. }
  26759. document.body.removeChild(_this._loadingDiv);
  26760. window.removeEventListener("resize", _this._resizeLoadingUI);
  26761. _this._loadingDiv = null;
  26762. };
  26763. this._loadingDiv.style.opacity = "0";
  26764. this._loadingDiv.addEventListener("transitionend", onTransitionEnd);
  26765. };
  26766. Object.defineProperty(DefaultLoadingScreen.prototype, "loadingUIText", {
  26767. set: function (text) {
  26768. this._loadingText = text;
  26769. if (this._loadingTextDiv) {
  26770. this._loadingTextDiv.innerHTML = this._loadingText;
  26771. }
  26772. },
  26773. enumerable: true,
  26774. configurable: true
  26775. });
  26776. Object.defineProperty(DefaultLoadingScreen.prototype, "loadingUIBackgroundColor", {
  26777. get: function () {
  26778. return this._loadingDivBackgroundColor;
  26779. },
  26780. set: function (color) {
  26781. this._loadingDivBackgroundColor = color;
  26782. if (!this._loadingDiv) {
  26783. return;
  26784. }
  26785. this._loadingDiv.style.backgroundColor = this._loadingDivBackgroundColor;
  26786. },
  26787. enumerable: true,
  26788. configurable: true
  26789. });
  26790. return DefaultLoadingScreen;
  26791. })();
  26792. BABYLON.DefaultLoadingScreen = DefaultLoadingScreen;
  26793. })(BABYLON || (BABYLON = {}));
  26794. var BABYLON;
  26795. (function (BABYLON) {
  26796. var SIMDVector3 = (function () {
  26797. function SIMDVector3() {
  26798. }
  26799. SIMDVector3.TransformCoordinatesToRefSIMD = function (vector, transformation, result) {
  26800. var v = SIMD.float32x4.loadXYZ(vector._data, 0);
  26801. var m0 = SIMD.float32x4.load(transformation.m, 0);
  26802. var m1 = SIMD.float32x4.load(transformation.m, 4);
  26803. var m2 = SIMD.float32x4.load(transformation.m, 8);
  26804. var m3 = SIMD.float32x4.load(transformation.m, 12);
  26805. var r = SIMD.float32x4.add(SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(v, 0, 0, 0, 0), m0), SIMD.float32x4.mul(SIMD.float32x4.swizzle(v, 1, 1, 1, 1), m1)), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(v, 2, 2, 2, 2), m2), m3));
  26806. r = SIMD.float32x4.div(r, SIMD.float32x4.swizzle(r, 3, 3, 3, 3));
  26807. SIMD.float32x4.storeXYZ(result._data, 0, r);
  26808. };
  26809. SIMDVector3.TransformCoordinatesFromFloatsToRefSIMD = function (x, y, z, transformation, result) {
  26810. var v0 = SIMD.float32x4.splat(x);
  26811. var v1 = SIMD.float32x4.splat(y);
  26812. var v2 = SIMD.float32x4.splat(z);
  26813. var m0 = SIMD.float32x4.load(transformation.m, 0);
  26814. var m1 = SIMD.float32x4.load(transformation.m, 4);
  26815. var m2 = SIMD.float32x4.load(transformation.m, 8);
  26816. var m3 = SIMD.float32x4.load(transformation.m, 12);
  26817. var r = SIMD.float32x4.add(SIMD.float32x4.add(SIMD.float32x4.mul(v0, m0), SIMD.float32x4.mul(v1, m1)), SIMD.float32x4.add(SIMD.float32x4.mul(v2, m2), m3));
  26818. r = SIMD.float32x4.div(r, SIMD.float32x4.swizzle(r, 3, 3, 3, 3));
  26819. SIMD.float32x4.storeXYZ(result._data, 0, r);
  26820. };
  26821. return SIMDVector3;
  26822. })();
  26823. BABYLON.SIMDVector3 = SIMDVector3;
  26824. var SIMDMatrix = (function () {
  26825. function SIMDMatrix() {
  26826. }
  26827. SIMDMatrix.prototype.multiplyToArraySIMD = function (other, result, offset) {
  26828. if (offset === void 0) { offset = 0; }
  26829. var tm = this.m;
  26830. var om = other.m;
  26831. var om0 = SIMD.float32x4.load(om, 0);
  26832. var om1 = SIMD.float32x4.load(om, 4);
  26833. var om2 = SIMD.float32x4.load(om, 8);
  26834. var om3 = SIMD.float32x4.load(om, 12);
  26835. var tm0 = SIMD.float32x4.load(tm, 0);
  26836. SIMD.float32x4.store(result, offset + 0, SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm0, 0, 0, 0, 0), om0), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm0, 1, 1, 1, 1), om1), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm0, 2, 2, 2, 2), om2), SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm0, 3, 3, 3, 3), om3)))));
  26837. var tm1 = SIMD.float32x4.load(tm, 4);
  26838. SIMD.float32x4.store(result, offset + 4, SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm1, 0, 0, 0, 0), om0), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm1, 1, 1, 1, 1), om1), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm1, 2, 2, 2, 2), om2), SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm1, 3, 3, 3, 3), om3)))));
  26839. var tm2 = SIMD.float32x4.load(tm, 8);
  26840. SIMD.float32x4.store(result, offset + 8, SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm2, 0, 0, 0, 0), om0), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm2, 1, 1, 1, 1), om1), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm2, 2, 2, 2, 2), om2), SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm2, 3, 3, 3, 3), om3)))));
  26841. var tm3 = SIMD.float32x4.load(tm, 12);
  26842. SIMD.float32x4.store(result, offset + 12, SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm3, 0, 0, 0, 0), om0), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm3, 1, 1, 1, 1), om1), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm3, 2, 2, 2, 2), om2), SIMD.float32x4.mul(SIMD.float32x4.swizzle(tm3, 3, 3, 3, 3), om3)))));
  26843. };
  26844. SIMDMatrix.prototype.invertToRefSIMD = function (other) {
  26845. var src = this.m;
  26846. var dest = other.m;
  26847. var row0, row1, row2, row3;
  26848. var tmp1;
  26849. var minor0, minor1, minor2, minor3;
  26850. var det;
  26851. // Load the 4 rows
  26852. var src0 = SIMD.float32x4.load(src, 0);
  26853. var src1 = SIMD.float32x4.load(src, 4);
  26854. var src2 = SIMD.float32x4.load(src, 8);
  26855. var src3 = SIMD.float32x4.load(src, 12);
  26856. // Transpose the source matrix. Sort of. Not a true transpose operation
  26857. tmp1 = SIMD.float32x4.shuffle(src0, src1, 0, 1, 4, 5);
  26858. row1 = SIMD.float32x4.shuffle(src2, src3, 0, 1, 4, 5);
  26859. row0 = SIMD.float32x4.shuffle(tmp1, row1, 0, 2, 4, 6);
  26860. row1 = SIMD.float32x4.shuffle(row1, tmp1, 1, 3, 5, 7);
  26861. tmp1 = SIMD.float32x4.shuffle(src0, src1, 2, 3, 6, 7);
  26862. row3 = SIMD.float32x4.shuffle(src2, src3, 2, 3, 6, 7);
  26863. row2 = SIMD.float32x4.shuffle(tmp1, row3, 0, 2, 4, 6);
  26864. row3 = SIMD.float32x4.shuffle(row3, tmp1, 1, 3, 5, 7);
  26865. // This is a true transposition, but it will lead to an incorrect result
  26866. //tmp1 = SIMD.float32x4.shuffle(src0, src1, 0, 1, 4, 5);
  26867. //tmp2 = SIMD.float32x4.shuffle(src2, src3, 0, 1, 4, 5);
  26868. //row0 = SIMD.float32x4.shuffle(tmp1, tmp2, 0, 2, 4, 6);
  26869. //row1 = SIMD.float32x4.shuffle(tmp1, tmp2, 1, 3, 5, 7);
  26870. //tmp1 = SIMD.float32x4.shuffle(src0, src1, 2, 3, 6, 7);
  26871. //tmp2 = SIMD.float32x4.shuffle(src2, src3, 2, 3, 6, 7);
  26872. //row2 = SIMD.float32x4.shuffle(tmp1, tmp2, 0, 2, 4, 6);
  26873. //row3 = SIMD.float32x4.shuffle(tmp1, tmp2, 1, 3, 5, 7);
  26874. // ----
  26875. tmp1 = SIMD.float32x4.mul(row2, row3);
  26876. tmp1 = SIMD.float32x4.swizzle(tmp1, 1, 0, 3, 2); // 0xB1 = 10110001
  26877. minor0 = SIMD.float32x4.mul(row1, tmp1);
  26878. minor1 = SIMD.float32x4.mul(row0, tmp1);
  26879. tmp1 = SIMD.float32x4.swizzle(tmp1, 2, 3, 0, 1); // 0x4E = 01001110
  26880. minor0 = SIMD.float32x4.sub(SIMD.float32x4.mul(row1, tmp1), minor0);
  26881. minor1 = SIMD.float32x4.sub(SIMD.float32x4.mul(row0, tmp1), minor1);
  26882. minor1 = SIMD.float32x4.swizzle(minor1, 2, 3, 0, 1); // 0x4E = 01001110
  26883. // ----
  26884. tmp1 = SIMD.float32x4.mul(row1, row2);
  26885. tmp1 = SIMD.float32x4.swizzle(tmp1, 1, 0, 3, 2); // 0xB1 = 10110001
  26886. minor0 = SIMD.float32x4.add(SIMD.float32x4.mul(row3, tmp1), minor0);
  26887. minor3 = SIMD.float32x4.mul(row0, tmp1);
  26888. tmp1 = SIMD.float32x4.swizzle(tmp1, 2, 3, 0, 1); // 0x4E = 01001110
  26889. minor0 = SIMD.float32x4.sub(minor0, SIMD.float32x4.mul(row3, tmp1));
  26890. minor3 = SIMD.float32x4.sub(SIMD.float32x4.mul(row0, tmp1), minor3);
  26891. minor3 = SIMD.float32x4.swizzle(minor3, 2, 3, 0, 1); // 0x4E = 01001110
  26892. // ----
  26893. tmp1 = SIMD.float32x4.mul(SIMD.float32x4.swizzle(row1, 2, 3, 0, 1), row3); // 0x4E = 01001110
  26894. tmp1 = SIMD.float32x4.swizzle(tmp1, 1, 0, 3, 2); // 0xB1 = 10110001
  26895. row2 = SIMD.float32x4.swizzle(row2, 2, 3, 0, 1); // 0x4E = 01001110
  26896. minor0 = SIMD.float32x4.add(SIMD.float32x4.mul(row2, tmp1), minor0);
  26897. minor2 = SIMD.float32x4.mul(row0, tmp1);
  26898. tmp1 = SIMD.float32x4.swizzle(tmp1, 2, 3, 0, 1); // 0x4E = 01001110
  26899. minor0 = SIMD.float32x4.sub(minor0, SIMD.float32x4.mul(row2, tmp1));
  26900. minor2 = SIMD.float32x4.sub(SIMD.float32x4.mul(row0, tmp1), minor2);
  26901. minor2 = SIMD.float32x4.swizzle(minor2, 2, 3, 0, 1); // 0x4E = 01001110
  26902. // ----
  26903. tmp1 = SIMD.float32x4.mul(row0, row1);
  26904. tmp1 = SIMD.float32x4.swizzle(tmp1, 1, 0, 3, 2); // 0xB1 = 10110001
  26905. minor2 = SIMD.float32x4.add(SIMD.float32x4.mul(row3, tmp1), minor2);
  26906. minor3 = SIMD.float32x4.sub(SIMD.float32x4.mul(row2, tmp1), minor3);
  26907. tmp1 = SIMD.float32x4.swizzle(tmp1, 2, 3, 0, 1); // 0x4E = 01001110
  26908. minor2 = SIMD.float32x4.sub(SIMD.float32x4.mul(row3, tmp1), minor2);
  26909. minor3 = SIMD.float32x4.sub(minor3, SIMD.float32x4.mul(row2, tmp1));
  26910. // ----
  26911. tmp1 = SIMD.float32x4.mul(row0, row3);
  26912. tmp1 = SIMD.float32x4.swizzle(tmp1, 1, 0, 3, 2); // 0xB1 = 10110001
  26913. minor1 = SIMD.float32x4.sub(minor1, SIMD.float32x4.mul(row2, tmp1));
  26914. minor2 = SIMD.float32x4.add(SIMD.float32x4.mul(row1, tmp1), minor2);
  26915. tmp1 = SIMD.float32x4.swizzle(tmp1, 2, 3, 0, 1); // 0x4E = 01001110
  26916. minor1 = SIMD.float32x4.add(SIMD.float32x4.mul(row2, tmp1), minor1);
  26917. minor2 = SIMD.float32x4.sub(minor2, SIMD.float32x4.mul(row1, tmp1));
  26918. // ----
  26919. tmp1 = SIMD.float32x4.mul(row0, row2);
  26920. tmp1 = SIMD.float32x4.swizzle(tmp1, 1, 0, 3, 2); // 0xB1 = 10110001
  26921. minor1 = SIMD.float32x4.add(SIMD.float32x4.mul(row3, tmp1), minor1);
  26922. minor3 = SIMD.float32x4.sub(minor3, SIMD.float32x4.mul(row1, tmp1));
  26923. tmp1 = SIMD.float32x4.swizzle(tmp1, 2, 3, 0, 1); // 0x4E = 01001110
  26924. minor1 = SIMD.float32x4.sub(minor1, SIMD.float32x4.mul(row3, tmp1));
  26925. minor3 = SIMD.float32x4.add(SIMD.float32x4.mul(row1, tmp1), minor3);
  26926. // Compute determinant
  26927. det = SIMD.float32x4.mul(row0, minor0);
  26928. det = SIMD.float32x4.add(SIMD.float32x4.swizzle(det, 2, 3, 0, 1), det); // 0x4E = 01001110
  26929. det = SIMD.float32x4.add(SIMD.float32x4.swizzle(det, 1, 0, 3, 2), det); // 0xB1 = 10110001
  26930. tmp1 = SIMD.float32x4.reciprocalApproximation(det);
  26931. det = SIMD.float32x4.sub(SIMD.float32x4.add(tmp1, tmp1), SIMD.float32x4.mul(det, SIMD.float32x4.mul(tmp1, tmp1)));
  26932. det = SIMD.float32x4.swizzle(det, 0, 0, 0, 0);
  26933. // These shuffles aren't necessary if the faulty transposition is done
  26934. // up at the top of this function.
  26935. //minor0 = SIMD.float32x4.swizzle(minor0, 2, 1, 0, 3);
  26936. //minor1 = SIMD.float32x4.swizzle(minor1, 2, 1, 0, 3);
  26937. //minor2 = SIMD.float32x4.swizzle(minor2, 2, 1, 0, 3);
  26938. //minor3 = SIMD.float32x4.swizzle(minor3, 2, 1, 0, 3);
  26939. // Compute final values by multiplying with 1/det
  26940. minor0 = SIMD.float32x4.mul(det, minor0);
  26941. minor1 = SIMD.float32x4.mul(det, minor1);
  26942. minor2 = SIMD.float32x4.mul(det, minor2);
  26943. minor3 = SIMD.float32x4.mul(det, minor3);
  26944. SIMD.float32x4.store(dest, 0, minor0);
  26945. SIMD.float32x4.store(dest, 4, minor1);
  26946. SIMD.float32x4.store(dest, 8, minor2);
  26947. SIMD.float32x4.store(dest, 12, minor3);
  26948. return this;
  26949. };
  26950. SIMDMatrix.LookAtLHToRefSIMD = function (eyeRef, targetRef, upRef, result) {
  26951. var out = result.m;
  26952. var center = SIMD.float32x4(targetRef.x, targetRef.y, targetRef.z, 0);
  26953. var eye = SIMD.float32x4(eyeRef.x, eyeRef.y, eyeRef.z, 0);
  26954. var up = SIMD.float32x4(upRef.x, upRef.y, upRef.z, 0);
  26955. // cc.kmVec3Subtract(f, pCenter, pEye);
  26956. var f = SIMD.float32x4.sub(center, eye);
  26957. // cc.kmVec3Normalize(f, f);
  26958. var tmp = SIMD.float32x4.mul(f, f);
  26959. tmp = SIMD.float32x4.add(tmp, SIMD.float32x4.add(SIMD.float32x4.swizzle(tmp, 1, 2, 0, 3), SIMD.float32x4.swizzle(tmp, 2, 0, 1, 3)));
  26960. f = SIMD.float32x4.mul(f, SIMD.float32x4.reciprocalSqrtApproximation(tmp));
  26961. // cc.kmVec3Assign(up, pUp);
  26962. // cc.kmVec3Normalize(up, up);
  26963. tmp = SIMD.float32x4.mul(up, up);
  26964. tmp = SIMD.float32x4.add(tmp, SIMD.float32x4.add(SIMD.float32x4.swizzle(tmp, 1, 2, 0, 3), SIMD.float32x4.swizzle(tmp, 2, 0, 1, 3)));
  26965. up = SIMD.float32x4.mul(up, SIMD.float32x4.reciprocalSqrtApproximation(tmp));
  26966. // cc.kmVec3Cross(s, f, up);
  26967. var s = SIMD.float32x4.sub(SIMD.float32x4.mul(SIMD.float32x4.swizzle(f, 1, 2, 0, 3), SIMD.float32x4.swizzle(up, 2, 0, 1, 3)), SIMD.float32x4.mul(SIMD.float32x4.swizzle(f, 2, 0, 1, 3), SIMD.float32x4.swizzle(up, 1, 2, 0, 3)));
  26968. // cc.kmVec3Normalize(s, s);
  26969. tmp = SIMD.float32x4.mul(s, s);
  26970. tmp = SIMD.float32x4.add(tmp, SIMD.float32x4.add(SIMD.float32x4.swizzle(tmp, 1, 2, 0, 3), SIMD.float32x4.swizzle(tmp, 2, 0, 1, 3)));
  26971. s = SIMD.float32x4.mul(s, SIMD.float32x4.reciprocalSqrtApproximation(tmp));
  26972. // cc.kmVec3Cross(u, s, f);
  26973. var u = SIMD.float32x4.sub(SIMD.float32x4.mul(SIMD.float32x4.swizzle(s, 1, 2, 0, 3), SIMD.float32x4.swizzle(f, 2, 0, 1, 3)), SIMD.float32x4.mul(SIMD.float32x4.swizzle(s, 2, 0, 1, 3), SIMD.float32x4.swizzle(f, 1, 2, 0, 3)));
  26974. // cc.kmVec3Normalize(s, s);
  26975. tmp = SIMD.float32x4.mul(s, s);
  26976. tmp = SIMD.float32x4.add(tmp, SIMD.float32x4.add(SIMD.float32x4.swizzle(tmp, 1, 2, 0, 3), SIMD.float32x4.swizzle(tmp, 2, 0, 1, 3)));
  26977. s = SIMD.float32x4.mul(s, SIMD.float32x4.reciprocalSqrtApproximation(tmp));
  26978. var zero = SIMD.float32x4.splat(0.0);
  26979. s = SIMD.float32x4.neg(s);
  26980. var tmp01 = SIMD.float32x4.shuffle(s, u, 0, 1, 4, 5);
  26981. var tmp23 = SIMD.float32x4.shuffle(f, zero, 0, 1, 4, 5);
  26982. var a0 = SIMD.float32x4.shuffle(tmp01, tmp23, 0, 2, 4, 6);
  26983. var a1 = SIMD.float32x4.shuffle(tmp01, tmp23, 1, 3, 5, 7);
  26984. tmp01 = SIMD.float32x4.shuffle(s, u, 2, 3, 6, 7);
  26985. tmp23 = SIMD.float32x4.shuffle(f, zero, 2, 3, 6, 7);
  26986. var a2 = SIMD.float32x4.shuffle(tmp01, tmp23, 0, 2, 4, 6);
  26987. var a3 = SIMD.float32x4(0.0, 0.0, 0.0, 1.0);
  26988. var b0 = SIMD.float32x4(1.0, 0.0, 0.0, 0.0);
  26989. var b1 = SIMD.float32x4(0.0, 1.0, 0.0, 0.0);
  26990. var b2 = SIMD.float32x4(0.0, 0.0, 1.0, 0.0);
  26991. var b3 = SIMD.float32x4.neg(eye);
  26992. b3 = SIMD.float32x4.withW(b3, 1.0);
  26993. SIMD.float32x4.store(out, 0, SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(b0, 0, 0, 0, 0), a0), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(b0, 1, 1, 1, 1), a1), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(b0, 2, 2, 2, 2), a2), SIMD.float32x4.mul(SIMD.float32x4.swizzle(b0, 3, 3, 3, 3), a3)))));
  26994. SIMD.float32x4.store(out, 4, SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(b1, 0, 0, 0, 0), a0), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(b1, 1, 1, 1, 1), a1), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(b1, 2, 2, 2, 2), a2), SIMD.float32x4.mul(SIMD.float32x4.swizzle(b1, 3, 3, 3, 3), a3)))));
  26995. SIMD.float32x4.store(out, 8, SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(b2, 0, 0, 0, 0), a0), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(b2, 1, 1, 1, 1), a1), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(b2, 2, 2, 2, 2), a2), SIMD.float32x4.mul(SIMD.float32x4.swizzle(b2, 3, 3, 3, 3), a3)))));
  26996. SIMD.float32x4.store(out, 12, SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(b3, 0, 0, 0, 0), a0), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(b3, 1, 1, 1, 1), a1), SIMD.float32x4.add(SIMD.float32x4.mul(SIMD.float32x4.swizzle(b3, 2, 2, 2, 2), a2), SIMD.float32x4.mul(SIMD.float32x4.swizzle(b3, 3, 3, 3, 3), a3)))));
  26997. };
  26998. return SIMDMatrix;
  26999. })();
  27000. BABYLON.SIMDMatrix = SIMDMatrix;
  27001. var previousMultiplyToArray = BABYLON.Matrix.prototype.multiplyToArray;
  27002. var previousInvertToRef = BABYLON.Matrix.prototype.invertToRef;
  27003. var previousLookAtLHToRef = BABYLON.Matrix.LookAtLHToRef;
  27004. var previousTransformCoordinatesToRef = BABYLON.Vector3.TransformCoordinatesToRef;
  27005. var previousTransformCoordinatesFromFloatsToRef = BABYLON.Vector3.TransformCoordinatesFromFloatsToRef;
  27006. var SIMDHelper = (function () {
  27007. function SIMDHelper() {
  27008. }
  27009. Object.defineProperty(SIMDHelper, "IsEnabled", {
  27010. get: function () {
  27011. return SIMDHelper._isEnabled;
  27012. },
  27013. enumerable: true,
  27014. configurable: true
  27015. });
  27016. SIMDHelper.DisableSIMD = function () {
  27017. // Replace functions
  27018. BABYLON.Matrix.prototype.multiplyToArray = previousMultiplyToArray;
  27019. BABYLON.Matrix.prototype.invertToRef = previousInvertToRef;
  27020. BABYLON.Matrix.LookAtLHToRef = previousLookAtLHToRef;
  27021. BABYLON.Vector3.TransformCoordinatesToRef = previousTransformCoordinatesToRef;
  27022. BABYLON.Vector3.TransformCoordinatesFromFloatsToRef = previousTransformCoordinatesFromFloatsToRef;
  27023. SIMDHelper._isEnabled = false;
  27024. };
  27025. SIMDHelper.EnableSIMD = function () {
  27026. if (window.SIMD === undefined) {
  27027. return;
  27028. }
  27029. // Replace functions
  27030. BABYLON.Matrix.prototype.multiplyToArray = SIMDMatrix.prototype.multiplyToArraySIMD;
  27031. BABYLON.Matrix.prototype.invertToRef = SIMDMatrix.prototype.invertToRefSIMD;
  27032. BABYLON.Matrix.LookAtLHToRef = SIMDMatrix.LookAtLHToRefSIMD;
  27033. BABYLON.Vector3.TransformCoordinatesToRef = SIMDVector3.TransformCoordinatesToRefSIMD;
  27034. BABYLON.Vector3.TransformCoordinatesFromFloatsToRef = SIMDVector3.TransformCoordinatesFromFloatsToRefSIMD;
  27035. Object.defineProperty(BABYLON.Vector3.prototype, "x", {
  27036. get: function () { return this._data[0]; },
  27037. set: function (value) {
  27038. if (!this._data) {
  27039. this._data = new Float32Array(3);
  27040. }
  27041. this._data[0] = value;
  27042. }
  27043. });
  27044. Object.defineProperty(BABYLON.Vector3.prototype, "y", {
  27045. get: function () { return this._data[1]; },
  27046. set: function (value) {
  27047. this._data[1] = value;
  27048. }
  27049. });
  27050. Object.defineProperty(BABYLON.Vector3.prototype, "z", {
  27051. get: function () { return this._data[2]; },
  27052. set: function (value) {
  27053. this._data[2] = value;
  27054. }
  27055. });
  27056. SIMDHelper._isEnabled = true;
  27057. };
  27058. SIMDHelper._isEnabled = false;
  27059. return SIMDHelper;
  27060. })();
  27061. BABYLON.SIMDHelper = SIMDHelper;
  27062. })(BABYLON || (BABYLON = {}));
  27063. var BABYLON;
  27064. (function (BABYLON) {
  27065. var ShaderMaterial = (function (_super) {
  27066. __extends(ShaderMaterial, _super);
  27067. function ShaderMaterial(name, scene, shaderPath, options) {
  27068. _super.call(this, name, scene);
  27069. this._textures = new Array();
  27070. this._floats = new Array();
  27071. this._floatsArrays = {};
  27072. this._colors3 = new Array();
  27073. this._colors4 = new Array();
  27074. this._vectors2 = new Array();
  27075. this._vectors3 = new Array();
  27076. this._vectors4 = new Array();
  27077. this._matrices = new Array();
  27078. this._matrices3x3 = new Array();
  27079. this._matrices2x2 = new Array();
  27080. this._cachedWorldViewMatrix = new BABYLON.Matrix();
  27081. this._shaderPath = shaderPath;
  27082. options.needAlphaBlending = options.needAlphaBlending || false;
  27083. options.needAlphaTesting = options.needAlphaTesting || false;
  27084. options.attributes = options.attributes || ["position", "normal", "uv"];
  27085. options.uniforms = options.uniforms || ["worldViewProjection"];
  27086. options.samplers = options.samplers || [];
  27087. options.defines = options.defines || [];
  27088. this._options = options;
  27089. }
  27090. ShaderMaterial.prototype.needAlphaBlending = function () {
  27091. return this._options.needAlphaBlending;
  27092. };
  27093. ShaderMaterial.prototype.needAlphaTesting = function () {
  27094. return this._options.needAlphaTesting;
  27095. };
  27096. ShaderMaterial.prototype._checkUniform = function (uniformName) {
  27097. if (this._options.uniforms.indexOf(uniformName) === -1) {
  27098. this._options.uniforms.push(uniformName);
  27099. }
  27100. };
  27101. ShaderMaterial.prototype.setTexture = function (name, texture) {
  27102. if (this._options.samplers.indexOf(name) === -1) {
  27103. this._options.samplers.push(name);
  27104. }
  27105. this._textures[name] = texture;
  27106. return this;
  27107. };
  27108. ShaderMaterial.prototype.setFloat = function (name, value) {
  27109. this._checkUniform(name);
  27110. this._floats[name] = value;
  27111. return this;
  27112. };
  27113. ShaderMaterial.prototype.setFloats = function (name, value) {
  27114. this._checkUniform(name);
  27115. this._floatsArrays[name] = value;
  27116. return this;
  27117. };
  27118. ShaderMaterial.prototype.setColor3 = function (name, value) {
  27119. this._checkUniform(name);
  27120. this._colors3[name] = value;
  27121. return this;
  27122. };
  27123. ShaderMaterial.prototype.setColor4 = function (name, value) {
  27124. this._checkUniform(name);
  27125. this._colors4[name] = value;
  27126. return this;
  27127. };
  27128. ShaderMaterial.prototype.setVector2 = function (name, value) {
  27129. this._checkUniform(name);
  27130. this._vectors2[name] = value;
  27131. return this;
  27132. };
  27133. ShaderMaterial.prototype.setVector3 = function (name, value) {
  27134. this._checkUniform(name);
  27135. this._vectors3[name] = value;
  27136. return this;
  27137. };
  27138. ShaderMaterial.prototype.setVector4 = function (name, value) {
  27139. this._checkUniform(name);
  27140. this._vectors4[name] = value;
  27141. return this;
  27142. };
  27143. ShaderMaterial.prototype.setMatrix = function (name, value) {
  27144. this._checkUniform(name);
  27145. this._matrices[name] = value;
  27146. return this;
  27147. };
  27148. ShaderMaterial.prototype.setMatrix3x3 = function (name, value) {
  27149. this._checkUniform(name);
  27150. this._matrices3x3[name] = value;
  27151. return this;
  27152. };
  27153. ShaderMaterial.prototype.setMatrix2x2 = function (name, value) {
  27154. this._checkUniform(name);
  27155. this._matrices2x2[name] = value;
  27156. return this;
  27157. };
  27158. ShaderMaterial.prototype.isReady = function (mesh, useInstances) {
  27159. var scene = this.getScene();
  27160. var engine = scene.getEngine();
  27161. if (!this.checkReadyOnEveryCall) {
  27162. if (this._renderId === scene.getRenderId()) {
  27163. return true;
  27164. }
  27165. }
  27166. // Instances
  27167. var defines = [];
  27168. var fallbacks = new BABYLON.EffectFallbacks();
  27169. if (useInstances) {
  27170. defines.push("#define INSTANCES");
  27171. }
  27172. for (var index = 0; index < this._options.defines.length; index++) {
  27173. defines.push(this._options.defines[index]);
  27174. }
  27175. // Bones
  27176. if (mesh && mesh.useBones && mesh.computeBonesUsingShaders) {
  27177. defines.push("#define BONES");
  27178. defines.push("#define BonesPerMesh " + (mesh.skeleton.bones.length + 1));
  27179. defines.push("#define BONES4");
  27180. fallbacks.addFallback(0, "BONES4");
  27181. }
  27182. // Alpha test
  27183. if (engine.getAlphaTesting()) {
  27184. defines.push("#define ALPHATEST");
  27185. }
  27186. var previousEffect = this._effect;
  27187. var join = defines.join("\n");
  27188. this._effect = engine.createEffect(this._shaderPath, this._options.attributes, this._options.uniforms, this._options.samplers, join, fallbacks, this.onCompiled, this.onError);
  27189. if (!this._effect.isReady()) {
  27190. return false;
  27191. }
  27192. if (previousEffect !== this._effect) {
  27193. scene.resetCachedMaterial();
  27194. }
  27195. this._renderId = scene.getRenderId();
  27196. return true;
  27197. };
  27198. ShaderMaterial.prototype.bindOnlyWorldMatrix = function (world) {
  27199. var scene = this.getScene();
  27200. if (this._options.uniforms.indexOf("world") !== -1) {
  27201. this._effect.setMatrix("world", world);
  27202. }
  27203. if (this._options.uniforms.indexOf("worldView") !== -1) {
  27204. world.multiplyToRef(scene.getViewMatrix(), this._cachedWorldViewMatrix);
  27205. this._effect.setMatrix("worldView", this._cachedWorldViewMatrix);
  27206. }
  27207. if (this._options.uniforms.indexOf("worldViewProjection") !== -1) {
  27208. this._effect.setMatrix("worldViewProjection", world.multiply(scene.getTransformMatrix()));
  27209. }
  27210. };
  27211. ShaderMaterial.prototype.bind = function (world, mesh) {
  27212. // Std values
  27213. this.bindOnlyWorldMatrix(world);
  27214. if (this.getScene().getCachedMaterial() !== this) {
  27215. if (this._options.uniforms.indexOf("view") !== -1) {
  27216. this._effect.setMatrix("view", this.getScene().getViewMatrix());
  27217. }
  27218. if (this._options.uniforms.indexOf("projection") !== -1) {
  27219. this._effect.setMatrix("projection", this.getScene().getProjectionMatrix());
  27220. }
  27221. if (this._options.uniforms.indexOf("viewProjection") !== -1) {
  27222. this._effect.setMatrix("viewProjection", this.getScene().getTransformMatrix());
  27223. }
  27224. // Bones
  27225. if (mesh && mesh.useBones && mesh.computeBonesUsingShaders) {
  27226. this._effect.setMatrices("mBones", mesh.skeleton.getTransformMatrices());
  27227. }
  27228. // Texture
  27229. for (var name in this._textures) {
  27230. this._effect.setTexture(name, this._textures[name]);
  27231. }
  27232. // Float
  27233. for (name in this._floats) {
  27234. this._effect.setFloat(name, this._floats[name]);
  27235. }
  27236. // Float s
  27237. for (name in this._floatsArrays) {
  27238. this._effect.setArray(name, this._floatsArrays[name]);
  27239. }
  27240. // Color3
  27241. for (name in this._colors3) {
  27242. this._effect.setColor3(name, this._colors3[name]);
  27243. }
  27244. // Color4
  27245. for (name in this._colors4) {
  27246. var color = this._colors4[name];
  27247. this._effect.setFloat4(name, color.r, color.g, color.b, color.a);
  27248. }
  27249. // Vector2
  27250. for (name in this._vectors2) {
  27251. this._effect.setVector2(name, this._vectors2[name]);
  27252. }
  27253. // Vector3
  27254. for (name in this._vectors3) {
  27255. this._effect.setVector3(name, this._vectors3[name]);
  27256. }
  27257. // Vector4
  27258. for (name in this._vectors4) {
  27259. this._effect.setVector4(name, this._vectors4[name]);
  27260. }
  27261. // Matrix
  27262. for (name in this._matrices) {
  27263. this._effect.setMatrix(name, this._matrices[name]);
  27264. }
  27265. // Matrix 3x3
  27266. for (name in this._matrices3x3) {
  27267. this._effect.setMatrix3x3(name, this._matrices3x3[name]);
  27268. }
  27269. // Matrix 2x2
  27270. for (name in this._matrices2x2) {
  27271. this._effect.setMatrix2x2(name, this._matrices2x2[name]);
  27272. }
  27273. }
  27274. _super.prototype.bind.call(this, world, mesh);
  27275. };
  27276. ShaderMaterial.prototype.clone = function (name) {
  27277. var newShaderMaterial = new ShaderMaterial(name, this.getScene(), this._shaderPath, this._options);
  27278. return newShaderMaterial;
  27279. };
  27280. ShaderMaterial.prototype.dispose = function (forceDisposeEffect) {
  27281. for (var name in this._textures) {
  27282. this._textures[name].dispose();
  27283. }
  27284. this._textures = [];
  27285. _super.prototype.dispose.call(this, forceDisposeEffect);
  27286. };
  27287. return ShaderMaterial;
  27288. })(BABYLON.Material);
  27289. BABYLON.ShaderMaterial = ShaderMaterial;
  27290. })(BABYLON || (BABYLON = {}));
  27291. var BABYLON;
  27292. (function (BABYLON) {
  27293. var Internals;
  27294. (function (Internals) {
  27295. // Based on demo done by Brandon Jones - http://media.tojicode.com/webgl-samples/dds.html
  27296. // All values and structures referenced from:
  27297. // http://msdn.microsoft.com/en-us/library/bb943991.aspx/
  27298. var DDS_MAGIC = 0x20534444;
  27299. var DDSD_CAPS = 0x1, DDSD_HEIGHT = 0x2, DDSD_WIDTH = 0x4, DDSD_PITCH = 0x8, DDSD_PIXELFORMAT = 0x1000, DDSD_MIPMAPCOUNT = 0x20000, DDSD_LINEARSIZE = 0x80000, DDSD_DEPTH = 0x800000;
  27300. var DDSCAPS_COMPLEX = 0x8, DDSCAPS_MIPMAP = 0x400000, DDSCAPS_TEXTURE = 0x1000;
  27301. var DDSCAPS2_CUBEMAP = 0x200, DDSCAPS2_CUBEMAP_POSITIVEX = 0x400, DDSCAPS2_CUBEMAP_NEGATIVEX = 0x800, DDSCAPS2_CUBEMAP_POSITIVEY = 0x1000, DDSCAPS2_CUBEMAP_NEGATIVEY = 0x2000, DDSCAPS2_CUBEMAP_POSITIVEZ = 0x4000, DDSCAPS2_CUBEMAP_NEGATIVEZ = 0x8000, DDSCAPS2_VOLUME = 0x200000;
  27302. var DDPF_ALPHAPIXELS = 0x1, DDPF_ALPHA = 0x2, DDPF_FOURCC = 0x4, DDPF_RGB = 0x40, DDPF_YUV = 0x200, DDPF_LUMINANCE = 0x20000;
  27303. function FourCCToInt32(value) {
  27304. return value.charCodeAt(0) +
  27305. (value.charCodeAt(1) << 8) +
  27306. (value.charCodeAt(2) << 16) +
  27307. (value.charCodeAt(3) << 24);
  27308. }
  27309. function Int32ToFourCC(value) {
  27310. return String.fromCharCode(value & 0xff, (value >> 8) & 0xff, (value >> 16) & 0xff, (value >> 24) & 0xff);
  27311. }
  27312. var FOURCC_DXT1 = FourCCToInt32("DXT1");
  27313. var FOURCC_DXT3 = FourCCToInt32("DXT3");
  27314. var FOURCC_DXT5 = FourCCToInt32("DXT5");
  27315. var headerLengthInt = 31; // The header length in 32 bit ints
  27316. // Offsets into the header array
  27317. var off_magic = 0;
  27318. var off_size = 1;
  27319. var off_flags = 2;
  27320. var off_height = 3;
  27321. var off_width = 4;
  27322. var off_mipmapCount = 7;
  27323. var off_pfFlags = 20;
  27324. var off_pfFourCC = 21;
  27325. var off_RGBbpp = 22;
  27326. var off_RMask = 23;
  27327. var off_GMask = 24;
  27328. var off_BMask = 25;
  27329. var off_AMask = 26;
  27330. var off_caps1 = 27;
  27331. var off_caps2 = 28;
  27332. ;
  27333. var DDSTools = (function () {
  27334. function DDSTools() {
  27335. }
  27336. DDSTools.GetDDSInfo = function (arrayBuffer) {
  27337. var header = new Int32Array(arrayBuffer, 0, headerLengthInt);
  27338. var mipmapCount = 1;
  27339. if (header[off_flags] & DDSD_MIPMAPCOUNT) {
  27340. mipmapCount = Math.max(1, header[off_mipmapCount]);
  27341. }
  27342. return {
  27343. width: header[off_width],
  27344. height: header[off_height],
  27345. mipmapCount: mipmapCount,
  27346. isFourCC: (header[off_pfFlags] & DDPF_FOURCC) === DDPF_FOURCC,
  27347. isRGB: (header[off_pfFlags] & DDPF_RGB) === DDPF_RGB,
  27348. isLuminance: (header[off_pfFlags] & DDPF_LUMINANCE) === DDPF_LUMINANCE,
  27349. isCube: (header[off_caps2] & DDSCAPS2_CUBEMAP) === DDSCAPS2_CUBEMAP
  27350. };
  27351. };
  27352. DDSTools.GetRGBAArrayBuffer = function (width, height, dataOffset, dataLength, arrayBuffer) {
  27353. var byteArray = new Uint8Array(dataLength);
  27354. var srcData = new Uint8Array(arrayBuffer);
  27355. var index = 0;
  27356. for (var y = height - 1; y >= 0; y--) {
  27357. for (var x = 0; x < width; x++) {
  27358. var srcPos = dataOffset + (x + y * width) * 4;
  27359. byteArray[index + 2] = srcData[srcPos];
  27360. byteArray[index + 1] = srcData[srcPos + 1];
  27361. byteArray[index] = srcData[srcPos + 2];
  27362. byteArray[index + 3] = srcData[srcPos + 3];
  27363. index += 4;
  27364. }
  27365. }
  27366. return byteArray;
  27367. };
  27368. DDSTools.GetRGBArrayBuffer = function (width, height, dataOffset, dataLength, arrayBuffer) {
  27369. var byteArray = new Uint8Array(dataLength);
  27370. var srcData = new Uint8Array(arrayBuffer);
  27371. var index = 0;
  27372. for (var y = height - 1; y >= 0; y--) {
  27373. for (var x = 0; x < width; x++) {
  27374. var srcPos = dataOffset + (x + y * width) * 3;
  27375. byteArray[index + 2] = srcData[srcPos];
  27376. byteArray[index + 1] = srcData[srcPos + 1];
  27377. byteArray[index] = srcData[srcPos + 2];
  27378. index += 3;
  27379. }
  27380. }
  27381. return byteArray;
  27382. };
  27383. DDSTools.GetLuminanceArrayBuffer = function (width, height, dataOffset, dataLength, arrayBuffer) {
  27384. var byteArray = new Uint8Array(dataLength);
  27385. var srcData = new Uint8Array(arrayBuffer);
  27386. var index = 0;
  27387. for (var y = height - 1; y >= 0; y--) {
  27388. for (var x = 0; x < width; x++) {
  27389. var srcPos = dataOffset + (x + y * width);
  27390. byteArray[index] = srcData[srcPos];
  27391. index++;
  27392. }
  27393. }
  27394. return byteArray;
  27395. };
  27396. DDSTools.UploadDDSLevels = function (gl, ext, arrayBuffer, info, loadMipmaps, faces) {
  27397. var header = new Int32Array(arrayBuffer, 0, headerLengthInt), fourCC, blockBytes, internalFormat, width, height, dataLength, dataOffset, byteArray, mipmapCount, i;
  27398. if (header[off_magic] != DDS_MAGIC) {
  27399. BABYLON.Tools.Error("Invalid magic number in DDS header");
  27400. return;
  27401. }
  27402. if (!info.isFourCC && !info.isRGB && !info.isLuminance) {
  27403. BABYLON.Tools.Error("Unsupported format, must contain a FourCC, RGB or LUMINANCE code");
  27404. return;
  27405. }
  27406. if (info.isFourCC) {
  27407. fourCC = header[off_pfFourCC];
  27408. switch (fourCC) {
  27409. case FOURCC_DXT1:
  27410. blockBytes = 8;
  27411. internalFormat = ext.COMPRESSED_RGBA_S3TC_DXT1_EXT;
  27412. break;
  27413. case FOURCC_DXT3:
  27414. blockBytes = 16;
  27415. internalFormat = ext.COMPRESSED_RGBA_S3TC_DXT3_EXT;
  27416. break;
  27417. case FOURCC_DXT5:
  27418. blockBytes = 16;
  27419. internalFormat = ext.COMPRESSED_RGBA_S3TC_DXT5_EXT;
  27420. break;
  27421. default:
  27422. console.error("Unsupported FourCC code:", Int32ToFourCC(fourCC));
  27423. return;
  27424. }
  27425. }
  27426. mipmapCount = 1;
  27427. if (header[off_flags] & DDSD_MIPMAPCOUNT && loadMipmaps !== false) {
  27428. mipmapCount = Math.max(1, header[off_mipmapCount]);
  27429. }
  27430. var bpp = header[off_RGBbpp];
  27431. for (var face = 0; face < faces; face++) {
  27432. var sampler = faces === 1 ? gl.TEXTURE_2D : (gl.TEXTURE_CUBE_MAP_POSITIVE_X + face);
  27433. width = header[off_width];
  27434. height = header[off_height];
  27435. dataOffset = header[off_size] + 4;
  27436. for (i = 0; i < mipmapCount; ++i) {
  27437. if (info.isRGB) {
  27438. if (bpp === 24) {
  27439. dataLength = width * height * 3;
  27440. byteArray = DDSTools.GetRGBArrayBuffer(width, height, dataOffset, dataLength, arrayBuffer);
  27441. gl.texImage2D(sampler, i, gl.RGB, width, height, 0, gl.RGB, gl.UNSIGNED_BYTE, byteArray);
  27442. }
  27443. else {
  27444. dataLength = width * height * 4;
  27445. byteArray = DDSTools.GetRGBAArrayBuffer(width, height, dataOffset, dataLength, arrayBuffer);
  27446. gl.texImage2D(sampler, i, gl.RGBA, width, height, 0, gl.RGBA, gl.UNSIGNED_BYTE, byteArray);
  27447. }
  27448. }
  27449. else if (info.isLuminance) {
  27450. var unpackAlignment = gl.getParameter(gl.UNPACK_ALIGNMENT);
  27451. var unpaddedRowSize = width;
  27452. var paddedRowSize = Math.floor((width + unpackAlignment - 1) / unpackAlignment) * unpackAlignment;
  27453. dataLength = paddedRowSize * (height - 1) + unpaddedRowSize;
  27454. byteArray = DDSTools.GetLuminanceArrayBuffer(width, height, dataOffset, dataLength, arrayBuffer);
  27455. gl.texImage2D(sampler, i, gl.LUMINANCE, width, height, 0, gl.LUMINANCE, gl.UNSIGNED_BYTE, byteArray);
  27456. }
  27457. else {
  27458. dataLength = Math.max(4, width) / 4 * Math.max(4, height) / 4 * blockBytes;
  27459. byteArray = new Uint8Array(arrayBuffer, dataOffset, dataLength);
  27460. gl.compressedTexImage2D(sampler, i, internalFormat, width, height, 0, byteArray);
  27461. }
  27462. dataOffset += dataLength;
  27463. width *= 0.5;
  27464. height *= 0.5;
  27465. width = Math.max(1.0, width);
  27466. height = Math.max(1.0, height);
  27467. }
  27468. }
  27469. };
  27470. return DDSTools;
  27471. })();
  27472. Internals.DDSTools = DDSTools;
  27473. })(Internals = BABYLON.Internals || (BABYLON.Internals = {}));
  27474. })(BABYLON || (BABYLON = {}));
  27475. var BABYLON;
  27476. (function (BABYLON) {
  27477. var CannonJSPlugin = (function () {
  27478. function CannonJSPlugin() {
  27479. this._registeredMeshes = [];
  27480. this._physicsMaterials = [];
  27481. this.updateBodyPosition = function (mesh) {
  27482. for (var index = 0; index < this._registeredMeshes.length; index++) {
  27483. var registeredMesh = this._registeredMeshes[index];
  27484. if (registeredMesh.mesh === mesh || registeredMesh.mesh === mesh.parent) {
  27485. var body = registeredMesh.body;
  27486. var center = mesh.getBoundingInfo().boundingBox.center;
  27487. body.position.set(center.x, center.y, center.z);
  27488. body.quaternion.copy(mesh.rotationQuaternion);
  27489. if (registeredMesh.deltaRotation) {
  27490. var tmpQ = new CANNON.Quaternion(-0.7071067811865475, 0, 0, 0.7071067811865475);
  27491. body.quaternion = body.quaternion.mult(tmpQ);
  27492. }
  27493. //TODO - If the body is heightmap-based, this won't work correctly. find a good fix.
  27494. return;
  27495. }
  27496. }
  27497. };
  27498. }
  27499. CannonJSPlugin.prototype.initialize = function (iterations) {
  27500. if (iterations === void 0) { iterations = 10; }
  27501. this._world = new CANNON.World();
  27502. this._world.broadphase = new CANNON.NaiveBroadphase();
  27503. this._world.solver.iterations = iterations;
  27504. };
  27505. CannonJSPlugin.prototype._checkWithEpsilon = function (value) {
  27506. return value < BABYLON.PhysicsEngine.Epsilon ? BABYLON.PhysicsEngine.Epsilon : value;
  27507. };
  27508. CannonJSPlugin.prototype.runOneStep = function (delta) {
  27509. this._world.step(delta);
  27510. for (var index = 0; index < this._registeredMeshes.length; index++) {
  27511. var registeredMesh = this._registeredMeshes[index];
  27512. if (registeredMesh.isChild) {
  27513. continue;
  27514. }
  27515. // Body position
  27516. var bodyX = registeredMesh.body.position.x, bodyY = registeredMesh.body.position.y, bodyZ = registeredMesh.body.position.z;
  27517. registeredMesh.mesh.position.x = bodyX + registeredMesh.delta.x;
  27518. registeredMesh.mesh.position.y = bodyY + registeredMesh.delta.y;
  27519. registeredMesh.mesh.position.z = bodyZ + registeredMesh.delta.z;
  27520. registeredMesh.mesh.rotationQuaternion.copyFrom(registeredMesh.body.quaternion);
  27521. if (registeredMesh.deltaRotation) {
  27522. registeredMesh.mesh.rotationQuaternion.multiplyInPlace(registeredMesh.deltaRotation);
  27523. }
  27524. }
  27525. };
  27526. CannonJSPlugin.prototype.setGravity = function (gravity) {
  27527. this._world.gravity.set(gravity.x, gravity.y, gravity.z);
  27528. };
  27529. CannonJSPlugin.prototype.registerMesh = function (mesh, impostor, options) {
  27530. this.unregisterMesh(mesh);
  27531. if (!mesh.rotationQuaternion) {
  27532. mesh.rotationQuaternion = BABYLON.Quaternion.RotationYawPitchRoll(mesh.rotation.y, mesh.rotation.x, mesh.rotation.z);
  27533. }
  27534. mesh.computeWorldMatrix(true);
  27535. var shape = this._createShape(mesh, impostor);
  27536. return this._createRigidBodyFromShape(shape, mesh, options);
  27537. };
  27538. CannonJSPlugin.prototype._createShape = function (mesh, impostor) {
  27539. //get the correct bounding box
  27540. var oldQuaternion = mesh.rotationQuaternion;
  27541. mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1);
  27542. mesh.computeWorldMatrix(true);
  27543. var returnValue;
  27544. switch (impostor) {
  27545. case BABYLON.PhysicsEngine.SphereImpostor:
  27546. var bbox = mesh.getBoundingInfo().boundingBox;
  27547. var radiusX = bbox.maximumWorld.x - bbox.minimumWorld.x;
  27548. var radiusY = bbox.maximumWorld.y - bbox.minimumWorld.y;
  27549. var radiusZ = bbox.maximumWorld.z - bbox.minimumWorld.z;
  27550. returnValue = new CANNON.Sphere(Math.max(this._checkWithEpsilon(radiusX), this._checkWithEpsilon(radiusY), this._checkWithEpsilon(radiusZ)) / 2);
  27551. break;
  27552. //TMP also for cylinder - TODO Cannon supports cylinder natively.
  27553. case BABYLON.PhysicsEngine.CylinderImpostor:
  27554. BABYLON.Tools.Warn("CylinderImposter not yet implemented, using BoxImposter instead");
  27555. case BABYLON.PhysicsEngine.BoxImpostor:
  27556. bbox = mesh.getBoundingInfo().boundingBox;
  27557. var min = bbox.minimumWorld;
  27558. var max = bbox.maximumWorld;
  27559. var box = max.subtract(min).scale(0.5);
  27560. returnValue = new CANNON.Box(new CANNON.Vec3(this._checkWithEpsilon(box.x), this._checkWithEpsilon(box.y), this._checkWithEpsilon(box.z)));
  27561. break;
  27562. case BABYLON.PhysicsEngine.PlaneImpostor:
  27563. BABYLON.Tools.Warn("Attention, Cannon.js PlaneImposter might not behave as you wish. Consider using BoxImposter instead");
  27564. returnValue = new CANNON.Plane();
  27565. break;
  27566. case BABYLON.PhysicsEngine.MeshImpostor:
  27567. var rawVerts = mesh.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  27568. var rawFaces = mesh.getIndices();
  27569. returnValue = this._createConvexPolyhedron(rawVerts, rawFaces, mesh);
  27570. break;
  27571. case BABYLON.PhysicsEngine.HeightmapImpostor:
  27572. returnValue = this._createHeightmap(mesh);
  27573. break;
  27574. }
  27575. mesh.rotationQuaternion = oldQuaternion;
  27576. return returnValue;
  27577. };
  27578. CannonJSPlugin.prototype._createConvexPolyhedron = function (rawVerts, rawFaces, mesh) {
  27579. var verts = [], faces = [];
  27580. mesh.computeWorldMatrix(true);
  27581. // Get vertices
  27582. for (var i = 0; i < rawVerts.length; i += 3) {
  27583. var transformed = BABYLON.Vector3.Zero();
  27584. BABYLON.Vector3.TransformNormalFromFloatsToRef(rawVerts[i], rawVerts[i + 1], rawVerts[i + 2], mesh.getWorldMatrix(), transformed);
  27585. verts.push(new CANNON.Vec3(transformed.x, transformed.y, transformed.z));
  27586. }
  27587. // Get faces
  27588. for (var j = 0; j < rawFaces.length; j += 3) {
  27589. faces.push([rawFaces[j], rawFaces[j + 2], rawFaces[j + 1]]);
  27590. }
  27591. var shape = new CANNON.ConvexPolyhedron(verts, faces);
  27592. return shape;
  27593. };
  27594. CannonJSPlugin.prototype._createHeightmap = function (mesh) {
  27595. var pos = mesh.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  27596. if (pos[0] !== pos[pos.length - 1]) {
  27597. console.log("ERROR");
  27598. return;
  27599. }
  27600. var matrix = [];
  27601. //dimension
  27602. var dim = -pos[0];
  27603. //array size
  27604. var arraySize = -1;
  27605. for (var i = 0; i < pos.length; i = i + 3) {
  27606. if (pos[i + 2] === pos[2]) {
  27607. arraySize++;
  27608. }
  27609. else {
  27610. break;
  27611. }
  27612. }
  27613. //calculate element size
  27614. var elementSize = dim * 2 / arraySize;
  27615. //calculate the matrix for cannon's heightfield
  27616. for (var i = 0; i < pos.length; i = i + 3) {
  27617. var x = Math.round((pos[i + 0]) / elementSize + arraySize / 2);
  27618. var z = Math.round(((pos[i + 2]) / elementSize - arraySize / 2) * -1);
  27619. if (!matrix[x]) {
  27620. matrix[x] = [];
  27621. }
  27622. matrix[x][z] = pos[i + 1];
  27623. }
  27624. var shape = new CANNON.Heightfield(matrix, {
  27625. elementSize: elementSize
  27626. });
  27627. //For future reference, needed for body transformation
  27628. shape.dim = dim;
  27629. return shape;
  27630. };
  27631. CannonJSPlugin.prototype._addMaterial = function (friction, restitution) {
  27632. var index;
  27633. var mat;
  27634. for (index = 0; index < this._physicsMaterials.length; index++) {
  27635. mat = this._physicsMaterials[index];
  27636. if (mat.friction === friction && mat.restitution === restitution) {
  27637. return mat;
  27638. }
  27639. }
  27640. var currentMat = new CANNON.Material("mat");
  27641. this._physicsMaterials.push(currentMat);
  27642. for (index = 0; index < this._physicsMaterials.length; index++) {
  27643. mat = this._physicsMaterials[index];
  27644. var contactMaterial = new CANNON.ContactMaterial(mat, currentMat, { friction: friction, restitution: restitution });
  27645. this._world.addContactMaterial(contactMaterial);
  27646. }
  27647. return currentMat;
  27648. };
  27649. CannonJSPlugin.prototype._createRigidBodyFromShape = function (shape, mesh, options) {
  27650. if (!mesh.rotationQuaternion) {
  27651. mesh.rotationQuaternion = BABYLON.Quaternion.RotationYawPitchRoll(mesh.rotation.y, mesh.rotation.x, mesh.rotation.z);
  27652. }
  27653. // The delta between the mesh position and the mesh bounding box center
  27654. var bbox = mesh.getBoundingInfo().boundingBox;
  27655. var deltaPosition = mesh.position.subtract(bbox.center);
  27656. var deltaRotation;
  27657. var material = this._addMaterial(options.friction, options.restitution);
  27658. var body = new CANNON.Body({
  27659. mass: options.mass,
  27660. material: material,
  27661. position: new CANNON.Vec3(bbox.center.x, bbox.center.y, bbox.center.z)
  27662. });
  27663. body.quaternion = new CANNON.Quaternion(mesh.rotationQuaternion.x, mesh.rotationQuaternion.y, mesh.rotationQuaternion.z, mesh.rotationQuaternion.w);
  27664. //is shape is a plane or a heightmap, it must be rotated 90 degs in the X axis.
  27665. if (shape.type === CANNON.Shape.types.PLANE || shape.type === CANNON.Shape.types.HEIGHTFIELD) {
  27666. //-90 DEG in X, precalculated
  27667. var tmpQ = new CANNON.Quaternion(-0.7071067811865475, 0, 0, 0.7071067811865475);
  27668. body.quaternion = body.quaternion.mult(tmpQ);
  27669. //Invert!
  27670. deltaRotation = new BABYLON.Quaternion(0.7071067811865475, 0, 0, 0.7071067811865475);
  27671. }
  27672. //If it is a heightfield, if should be centered.
  27673. if (shape.type === CANNON.Shape.types.HEIGHTFIELD) {
  27674. body.position = body.position.vadd(new CANNON.Vec3(-shape.dim, 0, shape.dim));
  27675. //add it inverted to the delta
  27676. deltaPosition.x += shape.dim;
  27677. deltaPosition.z -= shape.dim;
  27678. }
  27679. //add the shape
  27680. body.addShape(shape);
  27681. this._world.add(body);
  27682. this._registeredMeshes.push({ mesh: mesh, body: body, material: material, delta: deltaPosition, deltaRotation: deltaRotation });
  27683. return body;
  27684. };
  27685. CannonJSPlugin.prototype.registerMeshesAsCompound = function (parts, options) {
  27686. var initialMesh = parts[0].mesh;
  27687. this.unregisterMesh(initialMesh);
  27688. initialMesh.computeWorldMatrix(true);
  27689. var initialShape = this._createShape(initialMesh, parts[0].impostor);
  27690. var body = this._createRigidBodyFromShape(initialShape, initialMesh, options);
  27691. for (var index = 1; index < parts.length; index++) {
  27692. var mesh = parts[index].mesh;
  27693. mesh.computeWorldMatrix(true);
  27694. var shape = this._createShape(mesh, parts[index].impostor);
  27695. var localPosition = mesh.position;
  27696. body.addShape(shape, new CANNON.Vec3(localPosition.x, localPosition.y, localPosition.z));
  27697. }
  27698. return body;
  27699. };
  27700. CannonJSPlugin.prototype._unbindBody = function (body) {
  27701. for (var index = 0; index < this._registeredMeshes.length; index++) {
  27702. var registeredMesh = this._registeredMeshes[index];
  27703. if (registeredMesh.body === body) {
  27704. this._world.remove(registeredMesh.body);
  27705. registeredMesh.body = null;
  27706. registeredMesh.delta = null;
  27707. registeredMesh.deltaRotation = null;
  27708. }
  27709. }
  27710. };
  27711. CannonJSPlugin.prototype.unregisterMesh = function (mesh) {
  27712. for (var index = 0; index < this._registeredMeshes.length; index++) {
  27713. var registeredMesh = this._registeredMeshes[index];
  27714. if (registeredMesh.mesh === mesh) {
  27715. // Remove body
  27716. if (registeredMesh.body) {
  27717. this._unbindBody(registeredMesh.body);
  27718. }
  27719. this._registeredMeshes.splice(index, 1);
  27720. return;
  27721. }
  27722. }
  27723. };
  27724. CannonJSPlugin.prototype.applyImpulse = function (mesh, force, contactPoint) {
  27725. var worldPoint = new CANNON.Vec3(contactPoint.x, contactPoint.y, contactPoint.z);
  27726. var impulse = new CANNON.Vec3(force.x, force.y, force.z);
  27727. for (var index = 0; index < this._registeredMeshes.length; index++) {
  27728. var registeredMesh = this._registeredMeshes[index];
  27729. if (registeredMesh.mesh === mesh) {
  27730. registeredMesh.body.applyImpulse(impulse, worldPoint);
  27731. return;
  27732. }
  27733. }
  27734. };
  27735. CannonJSPlugin.prototype.createLink = function (mesh1, mesh2, pivot1, pivot2) {
  27736. var body1 = null, body2 = null;
  27737. for (var index = 0; index < this._registeredMeshes.length; index++) {
  27738. var registeredMesh = this._registeredMeshes[index];
  27739. if (registeredMesh.mesh === mesh1) {
  27740. body1 = registeredMesh.body;
  27741. }
  27742. else if (registeredMesh.mesh === mesh2) {
  27743. body2 = registeredMesh.body;
  27744. }
  27745. }
  27746. if (!body1 || !body2) {
  27747. return false;
  27748. }
  27749. var constraint = new CANNON.PointToPointConstraint(body1, new CANNON.Vec3(pivot1.x, pivot1.y, pivot1.z), body2, new CANNON.Vec3(pivot2.x, pivot2.y, pivot2.z));
  27750. this._world.addConstraint(constraint);
  27751. return true;
  27752. };
  27753. CannonJSPlugin.prototype.dispose = function () {
  27754. while (this._registeredMeshes.length) {
  27755. this.unregisterMesh(this._registeredMeshes[0].mesh);
  27756. }
  27757. };
  27758. CannonJSPlugin.prototype.isSupported = function () {
  27759. return window.CANNON !== undefined;
  27760. };
  27761. CannonJSPlugin.prototype.getWorldObject = function () {
  27762. return this._world;
  27763. };
  27764. CannonJSPlugin.prototype.getPhysicsBodyOfMesh = function (mesh) {
  27765. for (var index = 0; index < this._registeredMeshes.length; index++) {
  27766. var registeredMesh = this._registeredMeshes[index];
  27767. if (registeredMesh.mesh === mesh) {
  27768. return registeredMesh.body;
  27769. }
  27770. }
  27771. return null;
  27772. };
  27773. return CannonJSPlugin;
  27774. })();
  27775. BABYLON.CannonJSPlugin = CannonJSPlugin;
  27776. })(BABYLON || (BABYLON = {}));
  27777. var BABYLON;
  27778. (function (BABYLON) {
  27779. var OimoJSPlugin = (function () {
  27780. function OimoJSPlugin() {
  27781. this._registeredMeshes = [];
  27782. /**
  27783. * Update the body position according to the mesh position
  27784. * @param mesh
  27785. */
  27786. this.updateBodyPosition = function (mesh) {
  27787. for (var index = 0; index < this._registeredMeshes.length; index++) {
  27788. var registeredMesh = this._registeredMeshes[index];
  27789. var body = registeredMesh.body.body;
  27790. var updated = false;
  27791. var newPosition;
  27792. if (registeredMesh.mesh === mesh || registeredMesh.mesh === mesh.parent) {
  27793. mesh.computeWorldMatrix(true);
  27794. newPosition = mesh.getBoundingInfo().boundingBox.center;
  27795. updated = true;
  27796. }
  27797. else if (registeredMesh.mesh.parent === mesh) {
  27798. mesh.computeWorldMatrix(true);
  27799. registeredMesh.mesh.computeWorldMatrix(true);
  27800. newPosition = registeredMesh.mesh.getAbsolutePosition();
  27801. updated = true;
  27802. }
  27803. if (updated) {
  27804. body.setPosition(new OIMO.Vec3(newPosition.x, newPosition.y, newPosition.z));
  27805. body.setQuaternion(mesh.rotationQuaternion);
  27806. body.sleeping = false;
  27807. //force Oimo to update the body's position
  27808. body.updatePosition(1);
  27809. }
  27810. }
  27811. };
  27812. }
  27813. OimoJSPlugin.prototype._checkWithEpsilon = function (value) {
  27814. return value < BABYLON.PhysicsEngine.Epsilon ? BABYLON.PhysicsEngine.Epsilon : value;
  27815. };
  27816. OimoJSPlugin.prototype.initialize = function (iterations) {
  27817. this._world = new OIMO.World(null, null, iterations);
  27818. this._world.clear();
  27819. };
  27820. OimoJSPlugin.prototype.setGravity = function (gravity) {
  27821. this._world.gravity = gravity;
  27822. };
  27823. OimoJSPlugin.prototype.registerMesh = function (mesh, impostor, options) {
  27824. this.unregisterMesh(mesh);
  27825. if (!mesh.rotationQuaternion) {
  27826. mesh.rotationQuaternion = BABYLON.Quaternion.RotationYawPitchRoll(mesh.rotation.y, mesh.rotation.x, mesh.rotation.z);
  27827. }
  27828. mesh.computeWorldMatrix(true);
  27829. var bbox = mesh.getBoundingInfo().boundingBox;
  27830. // The delta between the mesh position and the mesh bounding box center
  27831. var deltaPosition = mesh.position.subtract(bbox.center);
  27832. //calculate rotation to fit Oimo's needs (Euler...)
  27833. var rot = new OIMO.Euler().setFromQuaternion({ x: mesh.rotationQuaternion.x, y: mesh.rotationQuaternion.y, z: mesh.rotationQuaternion.z, s: mesh.rotationQuaternion.w });
  27834. //get the correct bounding box
  27835. var oldQuaternion = mesh.rotationQuaternion;
  27836. mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1);
  27837. mesh.computeWorldMatrix(true);
  27838. var bodyConfig = {
  27839. pos: [bbox.center.x, bbox.center.y, bbox.center.z],
  27840. rot: [rot.x / OIMO.TO_RAD, rot.y / OIMO.TO_RAD, rot.z / OIMO.TO_RAD],
  27841. move: options.mass != 0,
  27842. config: [options.mass, options.friction, options.restitution],
  27843. world: this._world
  27844. };
  27845. // register mesh
  27846. switch (impostor) {
  27847. case BABYLON.PhysicsEngine.SphereImpostor:
  27848. var radiusX = bbox.maximumWorld.x - bbox.minimumWorld.x;
  27849. var radiusY = bbox.maximumWorld.y - bbox.minimumWorld.y;
  27850. var radiusZ = bbox.maximumWorld.z - bbox.minimumWorld.z;
  27851. var size = Math.max(this._checkWithEpsilon(radiusX), this._checkWithEpsilon(radiusY), this._checkWithEpsilon(radiusZ)) / 2;
  27852. bodyConfig.type = 'sphere';
  27853. bodyConfig.size = [size];
  27854. break;
  27855. case BABYLON.PhysicsEngine.PlaneImpostor:
  27856. //Oimo "fakes" a cylinder as a box, so why don't we!
  27857. case BABYLON.PhysicsEngine.CylinderImpostor:
  27858. case BABYLON.PhysicsEngine.BoxImpostor:
  27859. var min = bbox.minimumWorld;
  27860. var max = bbox.maximumWorld;
  27861. var box = max.subtract(min);
  27862. var sizeX = this._checkWithEpsilon(box.x);
  27863. var sizeY = this._checkWithEpsilon(box.y);
  27864. var sizeZ = this._checkWithEpsilon(box.z);
  27865. bodyConfig.type = 'box';
  27866. bodyConfig.size = [sizeX, sizeY, sizeZ];
  27867. break;
  27868. }
  27869. var body = new OIMO.Body(bodyConfig);
  27870. //We have to access the rigid body's properties to set the quaternion.
  27871. //The setQuaternion function of Oimo only sets the newOrientation that is only set after an impulse is given or a collision.
  27872. //body.body.orientation = new OIMO.Quat(mesh.rotationQuaternion.w, mesh.rotationQuaternion.x, mesh.rotationQuaternion.y, mesh.rotationQuaternion.z);
  27873. //TEST
  27874. //body.body.resetQuaternion(new OIMO.Quat(mesh.rotationQuaternion.w, mesh.rotationQuaternion.x, mesh.rotationQuaternion.y, mesh.rotationQuaternion.z));
  27875. //update the internal rotation matrix
  27876. //body.body.syncShapes();
  27877. this._registeredMeshes.push({
  27878. mesh: mesh,
  27879. body: body,
  27880. delta: deltaPosition
  27881. });
  27882. //for the sake of consistency.
  27883. mesh.rotationQuaternion = oldQuaternion;
  27884. return body;
  27885. };
  27886. OimoJSPlugin.prototype.registerMeshesAsCompound = function (parts, options) {
  27887. var types = [], sizes = [], positions = [], rotations = [];
  27888. var initialMesh = parts[0].mesh;
  27889. for (var index = 0; index < parts.length; index++) {
  27890. var part = parts[index];
  27891. var bodyParameters = this._createBodyAsCompound(part, options, initialMesh);
  27892. types.push(bodyParameters.type);
  27893. sizes.push.apply(sizes, bodyParameters.size);
  27894. positions.push.apply(positions, bodyParameters.pos);
  27895. rotations.push.apply(rotations, bodyParameters.rot);
  27896. }
  27897. var body = new OIMO.Body({
  27898. type: types,
  27899. size: sizes,
  27900. pos: positions,
  27901. rot: rotations,
  27902. move: options.mass != 0,
  27903. config: [options.mass, options.friction, options.restitution],
  27904. world: this._world
  27905. });
  27906. //Reset the body's rotation to be of the initial mesh's.
  27907. var rot = new OIMO.Euler().setFromQuaternion({ x: initialMesh.rotationQuaternion.x, y: initialMesh.rotationQuaternion.y, z: initialMesh.rotationQuaternion.z, s: initialMesh.rotationQuaternion.w });
  27908. body.resetRotation(rot.x / OIMO.TO_RAD, rot.y / OIMO.TO_RAD, rot.z / OIMO.TO_RAD);
  27909. this._registeredMeshes.push({
  27910. mesh: initialMesh,
  27911. body: body
  27912. });
  27913. return body;
  27914. };
  27915. OimoJSPlugin.prototype._createBodyAsCompound = function (part, options, initialMesh) {
  27916. var mesh = part.mesh;
  27917. if (!mesh.rotationQuaternion) {
  27918. mesh.rotationQuaternion = BABYLON.Quaternion.RotationYawPitchRoll(mesh.rotation.y, mesh.rotation.x, mesh.rotation.z);
  27919. }
  27920. // We need the bounding box/sphere info to compute the physics body
  27921. mesh.computeWorldMatrix(true);
  27922. var rot = new OIMO.Euler().setFromQuaternion({ x: mesh.rotationQuaternion.x, y: mesh.rotationQuaternion.y, z: mesh.rotationQuaternion.z, s: mesh.rotationQuaternion.w });
  27923. var bodyParameters = {
  27924. pos: [mesh.position.x, mesh.position.y, mesh.position.z],
  27925. //A bug in Oimo (Body class) prevents us from using rot directly.
  27926. rot: [0, 0, 0],
  27927. //For future reference, if the bug will ever be fixed.
  27928. realRot: [rot.x / OIMO.TO_RAD, rot.y / OIMO.TO_RAD, rot.z / OIMO.TO_RAD]
  27929. };
  27930. var oldQuaternion = mesh.rotationQuaternion;
  27931. mesh.rotationQuaternion = new BABYLON.Quaternion(0, 0, 0, 1);
  27932. mesh.computeWorldMatrix(true);
  27933. switch (part.impostor) {
  27934. case BABYLON.PhysicsEngine.SphereImpostor:
  27935. var bbox = mesh.getBoundingInfo().boundingBox;
  27936. var radiusX = bbox.maximumWorld.x - bbox.minimumWorld.x;
  27937. var radiusY = bbox.maximumWorld.y - bbox.minimumWorld.y;
  27938. var radiusZ = bbox.maximumWorld.z - bbox.minimumWorld.z;
  27939. var size = Math.max(this._checkWithEpsilon(radiusX), this._checkWithEpsilon(radiusY), this._checkWithEpsilon(radiusZ)) / 2;
  27940. bodyParameters.type = 'sphere';
  27941. bodyParameters.size = [size, size, size];
  27942. break;
  27943. case BABYLON.PhysicsEngine.PlaneImpostor:
  27944. case BABYLON.PhysicsEngine.CylinderImpostor:
  27945. case BABYLON.PhysicsEngine.BoxImpostor:
  27946. bbox = mesh.getBoundingInfo().boundingBox;
  27947. var min = bbox.minimumWorld;
  27948. var max = bbox.maximumWorld;
  27949. var box = max.subtract(min);
  27950. var sizeX = this._checkWithEpsilon(box.x);
  27951. var sizeY = this._checkWithEpsilon(box.y);
  27952. var sizeZ = this._checkWithEpsilon(box.z);
  27953. bodyParameters.type = 'box';
  27954. bodyParameters.size = [sizeX, sizeY, sizeZ];
  27955. break;
  27956. }
  27957. mesh.rotationQuaternion = oldQuaternion;
  27958. return bodyParameters;
  27959. };
  27960. OimoJSPlugin.prototype.unregisterMesh = function (mesh) {
  27961. for (var index = 0; index < this._registeredMeshes.length; index++) {
  27962. var registeredMesh = this._registeredMeshes[index];
  27963. if (registeredMesh.mesh === mesh || registeredMesh.mesh === mesh.parent) {
  27964. if (registeredMesh.body) {
  27965. this._world.removeRigidBody(registeredMesh.body.body);
  27966. this._unbindBody(registeredMesh.body);
  27967. }
  27968. this._registeredMeshes.splice(index, 1);
  27969. return;
  27970. }
  27971. }
  27972. };
  27973. OimoJSPlugin.prototype._unbindBody = function (body) {
  27974. for (var index = 0; index < this._registeredMeshes.length; index++) {
  27975. var registeredMesh = this._registeredMeshes[index];
  27976. if (registeredMesh.body === body) {
  27977. registeredMesh.body = null;
  27978. }
  27979. }
  27980. };
  27981. OimoJSPlugin.prototype.applyImpulse = function (mesh, force, contactPoint) {
  27982. for (var index = 0; index < this._registeredMeshes.length; index++) {
  27983. var registeredMesh = this._registeredMeshes[index];
  27984. if (registeredMesh.mesh === mesh || registeredMesh.mesh === mesh.parent) {
  27985. // Get object mass to have a behaviour similar to cannon.js
  27986. var mass = registeredMesh.body.body.massInfo.mass;
  27987. // The force is scaled with the mass of object
  27988. registeredMesh.body.body.applyImpulse(contactPoint.scale(OIMO.INV_SCALE), force.scale(OIMO.INV_SCALE * mass));
  27989. return;
  27990. }
  27991. }
  27992. };
  27993. OimoJSPlugin.prototype.createLink = function (mesh1, mesh2, pivot1, pivot2, options) {
  27994. var body1 = null, body2 = null;
  27995. for (var index = 0; index < this._registeredMeshes.length; index++) {
  27996. var registeredMesh = this._registeredMeshes[index];
  27997. if (registeredMesh.mesh === mesh1) {
  27998. body1 = registeredMesh.body.body;
  27999. }
  28000. else if (registeredMesh.mesh === mesh2) {
  28001. body2 = registeredMesh.body.body;
  28002. }
  28003. }
  28004. if (!body1 || !body2) {
  28005. return false;
  28006. }
  28007. if (!options) {
  28008. options = {};
  28009. }
  28010. new OIMO.Link({
  28011. type: options.type,
  28012. body1: body1,
  28013. body2: body2,
  28014. min: options.min,
  28015. max: options.max,
  28016. axe1: options.axe1,
  28017. axe2: options.axe2,
  28018. pos1: [pivot1.x, pivot1.y, pivot1.z],
  28019. pos2: [pivot2.x, pivot2.y, pivot2.z],
  28020. collision: options.collision,
  28021. spring: options.spring,
  28022. world: this._world
  28023. });
  28024. return true;
  28025. };
  28026. OimoJSPlugin.prototype.dispose = function () {
  28027. this._world.clear();
  28028. while (this._registeredMeshes.length) {
  28029. this.unregisterMesh(this._registeredMeshes[0].mesh);
  28030. }
  28031. };
  28032. OimoJSPlugin.prototype.isSupported = function () {
  28033. return OIMO !== undefined;
  28034. };
  28035. OimoJSPlugin.prototype.getWorldObject = function () {
  28036. return this._world;
  28037. };
  28038. OimoJSPlugin.prototype.getPhysicsBodyOfMesh = function (mesh) {
  28039. for (var index = 0; index < this._registeredMeshes.length; index++) {
  28040. var registeredMesh = this._registeredMeshes[index];
  28041. if (registeredMesh.mesh === mesh) {
  28042. return registeredMesh.body;
  28043. }
  28044. }
  28045. return null;
  28046. };
  28047. OimoJSPlugin.prototype._getLastShape = function (body) {
  28048. var lastShape = body.shapes;
  28049. while (lastShape.next) {
  28050. lastShape = lastShape.next;
  28051. }
  28052. return lastShape;
  28053. };
  28054. OimoJSPlugin.prototype.runOneStep = function (time) {
  28055. this._world.step();
  28056. // Update the position of all registered meshes
  28057. var i = this._registeredMeshes.length;
  28058. var m;
  28059. while (i--) {
  28060. var body = this._registeredMeshes[i].body.body;
  28061. var mesh = this._registeredMeshes[i].mesh;
  28062. if (!this._registeredMeshes[i].delta) {
  28063. this._registeredMeshes[i].delta = BABYLON.Vector3.Zero();
  28064. }
  28065. if (!body.sleeping) {
  28066. //TODO check that
  28067. if (body.shapes.next) {
  28068. var parentShape = this._getLastShape(body);
  28069. mesh.position.x = parentShape.position.x * OIMO.WORLD_SCALE;
  28070. mesh.position.y = parentShape.position.y * OIMO.WORLD_SCALE;
  28071. mesh.position.z = parentShape.position.z * OIMO.WORLD_SCALE;
  28072. }
  28073. else {
  28074. mesh.position.copyFrom(body.getPosition()).addInPlace(this._registeredMeshes[i].delta);
  28075. }
  28076. mesh.rotationQuaternion.copyFrom(body.getQuaternion());
  28077. mesh.computeWorldMatrix();
  28078. }
  28079. }
  28080. };
  28081. return OimoJSPlugin;
  28082. })();
  28083. BABYLON.OimoJSPlugin = OimoJSPlugin;
  28084. })(BABYLON || (BABYLON = {}));
  28085. var BABYLON;
  28086. (function (BABYLON) {
  28087. var DisplayPassPostProcess = (function (_super) {
  28088. __extends(DisplayPassPostProcess, _super);
  28089. function DisplayPassPostProcess(name, ratio, camera, samplingMode, engine, reusable) {
  28090. _super.call(this, name, "displayPass", ["passSampler"], ["passSampler"], ratio, camera, samplingMode, engine, reusable);
  28091. }
  28092. return DisplayPassPostProcess;
  28093. })(BABYLON.PostProcess);
  28094. BABYLON.DisplayPassPostProcess = DisplayPassPostProcess;
  28095. })(BABYLON || (BABYLON = {}));
  28096. var BABYLON;
  28097. (function (BABYLON) {
  28098. var SimplificationSettings = (function () {
  28099. function SimplificationSettings(quality, distance, optimizeMesh) {
  28100. this.quality = quality;
  28101. this.distance = distance;
  28102. this.optimizeMesh = optimizeMesh;
  28103. }
  28104. return SimplificationSettings;
  28105. })();
  28106. BABYLON.SimplificationSettings = SimplificationSettings;
  28107. var SimplificationQueue = (function () {
  28108. function SimplificationQueue() {
  28109. this.running = false;
  28110. this._simplificationArray = [];
  28111. }
  28112. SimplificationQueue.prototype.addTask = function (task) {
  28113. this._simplificationArray.push(task);
  28114. };
  28115. SimplificationQueue.prototype.executeNext = function () {
  28116. var task = this._simplificationArray.pop();
  28117. if (task) {
  28118. this.running = true;
  28119. this.runSimplification(task);
  28120. }
  28121. else {
  28122. this.running = false;
  28123. }
  28124. };
  28125. SimplificationQueue.prototype.runSimplification = function (task) {
  28126. var _this = this;
  28127. if (task.parallelProcessing) {
  28128. //parallel simplifier
  28129. task.settings.forEach(function (setting) {
  28130. var simplifier = _this.getSimplifier(task);
  28131. simplifier.simplify(setting, function (newMesh) {
  28132. task.mesh.addLODLevel(setting.distance, newMesh);
  28133. newMesh.isVisible = true;
  28134. //check if it is the last
  28135. if (setting.quality === task.settings[task.settings.length - 1].quality && task.successCallback) {
  28136. //all done, run the success callback.
  28137. task.successCallback();
  28138. }
  28139. _this.executeNext();
  28140. });
  28141. });
  28142. }
  28143. else {
  28144. //single simplifier.
  28145. var simplifier = this.getSimplifier(task);
  28146. var runDecimation = function (setting, callback) {
  28147. simplifier.simplify(setting, function (newMesh) {
  28148. task.mesh.addLODLevel(setting.distance, newMesh);
  28149. newMesh.isVisible = true;
  28150. //run the next quality level
  28151. callback();
  28152. });
  28153. };
  28154. BABYLON.AsyncLoop.Run(task.settings.length, function (loop) {
  28155. runDecimation(task.settings[loop.index], function () {
  28156. loop.executeNext();
  28157. });
  28158. }, function () {
  28159. //execution ended, run the success callback.
  28160. if (task.successCallback) {
  28161. task.successCallback();
  28162. }
  28163. _this.executeNext();
  28164. });
  28165. }
  28166. };
  28167. SimplificationQueue.prototype.getSimplifier = function (task) {
  28168. switch (task.simplificationType) {
  28169. case SimplificationType.QUADRATIC:
  28170. default:
  28171. return new QuadraticErrorSimplification(task.mesh);
  28172. }
  28173. };
  28174. return SimplificationQueue;
  28175. })();
  28176. BABYLON.SimplificationQueue = SimplificationQueue;
  28177. /**
  28178. * The implemented types of simplification.
  28179. * At the moment only Quadratic Error Decimation is implemented.
  28180. */
  28181. (function (SimplificationType) {
  28182. SimplificationType[SimplificationType["QUADRATIC"] = 0] = "QUADRATIC";
  28183. })(BABYLON.SimplificationType || (BABYLON.SimplificationType = {}));
  28184. var SimplificationType = BABYLON.SimplificationType;
  28185. var DecimationTriangle = (function () {
  28186. function DecimationTriangle(vertices) {
  28187. this.vertices = vertices;
  28188. this.error = new Array(4);
  28189. this.deleted = false;
  28190. this.isDirty = false;
  28191. this.deletePending = false;
  28192. this.borderFactor = 0;
  28193. }
  28194. return DecimationTriangle;
  28195. })();
  28196. BABYLON.DecimationTriangle = DecimationTriangle;
  28197. var DecimationVertex = (function () {
  28198. function DecimationVertex(position, id) {
  28199. this.position = position;
  28200. this.id = id;
  28201. this.isBorder = true;
  28202. this.q = new QuadraticMatrix();
  28203. this.triangleCount = 0;
  28204. this.triangleStart = 0;
  28205. this.originalOffsets = [];
  28206. }
  28207. DecimationVertex.prototype.updatePosition = function (newPosition) {
  28208. this.position.copyFrom(newPosition);
  28209. };
  28210. return DecimationVertex;
  28211. })();
  28212. BABYLON.DecimationVertex = DecimationVertex;
  28213. var QuadraticMatrix = (function () {
  28214. function QuadraticMatrix(data) {
  28215. this.data = new Array(10);
  28216. for (var i = 0; i < 10; ++i) {
  28217. if (data && data[i]) {
  28218. this.data[i] = data[i];
  28219. }
  28220. else {
  28221. this.data[i] = 0;
  28222. }
  28223. }
  28224. }
  28225. QuadraticMatrix.prototype.det = function (a11, a12, a13, a21, a22, a23, a31, a32, a33) {
  28226. var det = this.data[a11] * this.data[a22] * this.data[a33] + this.data[a13] * this.data[a21] * this.data[a32] +
  28227. this.data[a12] * this.data[a23] * this.data[a31] - this.data[a13] * this.data[a22] * this.data[a31] -
  28228. this.data[a11] * this.data[a23] * this.data[a32] - this.data[a12] * this.data[a21] * this.data[a33];
  28229. return det;
  28230. };
  28231. QuadraticMatrix.prototype.addInPlace = function (matrix) {
  28232. for (var i = 0; i < 10; ++i) {
  28233. this.data[i] += matrix.data[i];
  28234. }
  28235. };
  28236. QuadraticMatrix.prototype.addArrayInPlace = function (data) {
  28237. for (var i = 0; i < 10; ++i) {
  28238. this.data[i] += data[i];
  28239. }
  28240. };
  28241. QuadraticMatrix.prototype.add = function (matrix) {
  28242. var m = new QuadraticMatrix();
  28243. for (var i = 0; i < 10; ++i) {
  28244. m.data[i] = this.data[i] + matrix.data[i];
  28245. }
  28246. return m;
  28247. };
  28248. QuadraticMatrix.FromData = function (a, b, c, d) {
  28249. return new QuadraticMatrix(QuadraticMatrix.DataFromNumbers(a, b, c, d));
  28250. };
  28251. //returning an array to avoid garbage collection
  28252. QuadraticMatrix.DataFromNumbers = function (a, b, c, d) {
  28253. return [a * a, a * b, a * c, a * d, b * b, b * c, b * d, c * c, c * d, d * d];
  28254. };
  28255. return QuadraticMatrix;
  28256. })();
  28257. BABYLON.QuadraticMatrix = QuadraticMatrix;
  28258. var Reference = (function () {
  28259. function Reference(vertexId, triangleId) {
  28260. this.vertexId = vertexId;
  28261. this.triangleId = triangleId;
  28262. }
  28263. return Reference;
  28264. })();
  28265. BABYLON.Reference = Reference;
  28266. /**
  28267. * An implementation of the Quadratic Error simplification algorithm.
  28268. * Original paper : http://www1.cs.columbia.edu/~cs4162/html05s/garland97.pdf
  28269. * Ported mostly from QSlim and http://voxels.blogspot.de/2014/05/quadric-mesh-simplification-with-source.html to babylon JS
  28270. * @author RaananW
  28271. */
  28272. var QuadraticErrorSimplification = (function () {
  28273. function QuadraticErrorSimplification(_mesh) {
  28274. this._mesh = _mesh;
  28275. this.initialized = false;
  28276. this.syncIterations = 5000;
  28277. this.aggressiveness = 7;
  28278. this.decimationIterations = 100;
  28279. this.boundingBoxEpsilon = BABYLON.Engine.Epsilon;
  28280. }
  28281. QuadraticErrorSimplification.prototype.simplify = function (settings, successCallback) {
  28282. var _this = this;
  28283. this.initDecimatedMesh();
  28284. //iterating through the submeshes array, one after the other.
  28285. BABYLON.AsyncLoop.Run(this._mesh.subMeshes.length, function (loop) {
  28286. _this.initWithMesh(loop.index, function () {
  28287. _this.runDecimation(settings, loop.index, function () {
  28288. loop.executeNext();
  28289. });
  28290. }, settings.optimizeMesh);
  28291. }, function () {
  28292. setTimeout(function () {
  28293. successCallback(_this._reconstructedMesh);
  28294. }, 0);
  28295. });
  28296. };
  28297. QuadraticErrorSimplification.prototype.isTriangleOnBoundingBox = function (triangle) {
  28298. var _this = this;
  28299. var gCount = 0;
  28300. triangle.vertices.forEach(function (vertex) {
  28301. var count = 0;
  28302. var vPos = vertex.position;
  28303. var bbox = _this._mesh.getBoundingInfo().boundingBox;
  28304. if (bbox.maximum.x - vPos.x < _this.boundingBoxEpsilon || vPos.x - bbox.minimum.x > _this.boundingBoxEpsilon)
  28305. ++count;
  28306. if (bbox.maximum.y === vPos.y || vPos.y === bbox.minimum.y)
  28307. ++count;
  28308. if (bbox.maximum.z === vPos.z || vPos.z === bbox.minimum.z)
  28309. ++count;
  28310. if (count > 1) {
  28311. ++gCount;
  28312. }
  28313. ;
  28314. });
  28315. if (gCount > 1) {
  28316. console.log(triangle, gCount);
  28317. }
  28318. return gCount > 1;
  28319. };
  28320. QuadraticErrorSimplification.prototype.runDecimation = function (settings, submeshIndex, successCallback) {
  28321. var _this = this;
  28322. var targetCount = ~~(this.triangles.length * settings.quality);
  28323. var deletedTriangles = 0;
  28324. var triangleCount = this.triangles.length;
  28325. var iterationFunction = function (iteration, callback) {
  28326. setTimeout(function () {
  28327. if (iteration % 5 === 0) {
  28328. _this.updateMesh(iteration === 0);
  28329. }
  28330. for (var i = 0; i < _this.triangles.length; ++i) {
  28331. _this.triangles[i].isDirty = false;
  28332. }
  28333. var threshold = 0.000000001 * Math.pow((iteration + 3), _this.aggressiveness);
  28334. var trianglesIterator = function (i) {
  28335. var tIdx = ~~(((_this.triangles.length / 2) + i) % _this.triangles.length);
  28336. var t = _this.triangles[tIdx];
  28337. if (!t)
  28338. return;
  28339. if (t.error[3] > threshold || t.deleted || t.isDirty) {
  28340. return;
  28341. }
  28342. for (var j = 0; j < 3; ++j) {
  28343. if (t.error[j] < threshold) {
  28344. var deleted0 = [];
  28345. var deleted1 = [];
  28346. var v0 = t.vertices[j];
  28347. var v1 = t.vertices[(j + 1) % 3];
  28348. if (v0.isBorder !== v1.isBorder)
  28349. continue;
  28350. var p = BABYLON.Vector3.Zero();
  28351. var n = BABYLON.Vector3.Zero();
  28352. var uv = BABYLON.Vector2.Zero();
  28353. var color = new BABYLON.Color4(0, 0, 0, 1);
  28354. _this.calculateError(v0, v1, p, n, uv, color);
  28355. var delTr = [];
  28356. if (_this.isFlipped(v0, v1, p, deleted0, t.borderFactor, delTr))
  28357. continue;
  28358. if (_this.isFlipped(v1, v0, p, deleted1, t.borderFactor, delTr))
  28359. continue;
  28360. if (deleted0.indexOf(true) < 0 || deleted1.indexOf(true) < 0)
  28361. continue;
  28362. var uniqueArray = [];
  28363. delTr.forEach(function (deletedT) {
  28364. if (uniqueArray.indexOf(deletedT) === -1) {
  28365. deletedT.deletePending = true;
  28366. uniqueArray.push(deletedT);
  28367. }
  28368. });
  28369. if (uniqueArray.length % 2 !== 0) {
  28370. continue;
  28371. }
  28372. v0.q = v1.q.add(v0.q);
  28373. v0.updatePosition(p);
  28374. var tStart = _this.references.length;
  28375. deletedTriangles = _this.updateTriangles(v0, v0, deleted0, deletedTriangles);
  28376. deletedTriangles = _this.updateTriangles(v0, v1, deleted1, deletedTriangles);
  28377. var tCount = _this.references.length - tStart;
  28378. if (tCount <= v0.triangleCount) {
  28379. if (tCount) {
  28380. for (var c = 0; c < tCount; c++) {
  28381. _this.references[v0.triangleStart + c] = _this.references[tStart + c];
  28382. }
  28383. }
  28384. }
  28385. else {
  28386. v0.triangleStart = tStart;
  28387. }
  28388. v0.triangleCount = tCount;
  28389. break;
  28390. }
  28391. }
  28392. };
  28393. BABYLON.AsyncLoop.SyncAsyncForLoop(_this.triangles.length, _this.syncIterations, trianglesIterator, callback, function () { return (triangleCount - deletedTriangles <= targetCount); });
  28394. }, 0);
  28395. };
  28396. BABYLON.AsyncLoop.Run(this.decimationIterations, function (loop) {
  28397. if (triangleCount - deletedTriangles <= targetCount)
  28398. loop.breakLoop();
  28399. else {
  28400. iterationFunction(loop.index, function () {
  28401. loop.executeNext();
  28402. });
  28403. }
  28404. }, function () {
  28405. setTimeout(function () {
  28406. //reconstruct this part of the mesh
  28407. _this.reconstructMesh(submeshIndex);
  28408. successCallback();
  28409. }, 0);
  28410. });
  28411. };
  28412. QuadraticErrorSimplification.prototype.initWithMesh = function (submeshIndex, callback, optimizeMesh) {
  28413. var _this = this;
  28414. this.vertices = [];
  28415. this.triangles = [];
  28416. var positionData = this._mesh.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  28417. var indices = this._mesh.getIndices();
  28418. var submesh = this._mesh.subMeshes[submeshIndex];
  28419. var findInVertices = function (positionToSearch) {
  28420. if (optimizeMesh) {
  28421. for (var ii = 0; ii < _this.vertices.length; ++ii) {
  28422. if (_this.vertices[ii].position.equals(positionToSearch)) {
  28423. return _this.vertices[ii];
  28424. }
  28425. }
  28426. }
  28427. return null;
  28428. };
  28429. var vertexReferences = [];
  28430. var vertexInit = function (i) {
  28431. var offset = i + submesh.verticesStart;
  28432. var position = BABYLON.Vector3.FromArray(positionData, offset * 3);
  28433. var vertex = findInVertices(position) || new DecimationVertex(position, _this.vertices.length);
  28434. vertex.originalOffsets.push(offset);
  28435. if (vertex.id === _this.vertices.length) {
  28436. _this.vertices.push(vertex);
  28437. }
  28438. vertexReferences.push(vertex.id);
  28439. };
  28440. //var totalVertices = mesh.getTotalVertices();
  28441. var totalVertices = submesh.verticesCount;
  28442. BABYLON.AsyncLoop.SyncAsyncForLoop(totalVertices, (this.syncIterations / 4) >> 0, vertexInit, function () {
  28443. var indicesInit = function (i) {
  28444. var offset = (submesh.indexStart / 3) + i;
  28445. var pos = (offset * 3);
  28446. var i0 = indices[pos + 0];
  28447. var i1 = indices[pos + 1];
  28448. var i2 = indices[pos + 2];
  28449. var v0 = _this.vertices[vertexReferences[i0 - submesh.verticesStart]];
  28450. var v1 = _this.vertices[vertexReferences[i1 - submesh.verticesStart]];
  28451. var v2 = _this.vertices[vertexReferences[i2 - submesh.verticesStart]];
  28452. var triangle = new DecimationTriangle([v0, v1, v2]);
  28453. triangle.originalOffset = pos;
  28454. _this.triangles.push(triangle);
  28455. };
  28456. BABYLON.AsyncLoop.SyncAsyncForLoop(submesh.indexCount / 3, _this.syncIterations, indicesInit, function () {
  28457. _this.init(callback);
  28458. });
  28459. });
  28460. };
  28461. QuadraticErrorSimplification.prototype.init = function (callback) {
  28462. var _this = this;
  28463. var triangleInit1 = function (i) {
  28464. var t = _this.triangles[i];
  28465. t.normal = BABYLON.Vector3.Cross(t.vertices[1].position.subtract(t.vertices[0].position), t.vertices[2].position.subtract(t.vertices[0].position)).normalize();
  28466. for (var j = 0; j < 3; j++) {
  28467. t.vertices[j].q.addArrayInPlace(QuadraticMatrix.DataFromNumbers(t.normal.x, t.normal.y, t.normal.z, -(BABYLON.Vector3.Dot(t.normal, t.vertices[0].position))));
  28468. }
  28469. };
  28470. BABYLON.AsyncLoop.SyncAsyncForLoop(this.triangles.length, this.syncIterations, triangleInit1, function () {
  28471. var triangleInit2 = function (i) {
  28472. var t = _this.triangles[i];
  28473. for (var j = 0; j < 3; ++j) {
  28474. t.error[j] = _this.calculateError(t.vertices[j], t.vertices[(j + 1) % 3]);
  28475. }
  28476. t.error[3] = Math.min(t.error[0], t.error[1], t.error[2]);
  28477. };
  28478. BABYLON.AsyncLoop.SyncAsyncForLoop(_this.triangles.length, _this.syncIterations, triangleInit2, function () {
  28479. _this.initialized = true;
  28480. callback();
  28481. });
  28482. });
  28483. };
  28484. QuadraticErrorSimplification.prototype.reconstructMesh = function (submeshIndex) {
  28485. var newTriangles = [];
  28486. var i;
  28487. for (i = 0; i < this.vertices.length; ++i) {
  28488. this.vertices[i].triangleCount = 0;
  28489. }
  28490. var t;
  28491. var j;
  28492. for (i = 0; i < this.triangles.length; ++i) {
  28493. if (!this.triangles[i].deleted) {
  28494. t = this.triangles[i];
  28495. for (j = 0; j < 3; ++j) {
  28496. t.vertices[j].triangleCount = 1;
  28497. }
  28498. newTriangles.push(t);
  28499. }
  28500. }
  28501. var newPositionData = (this._reconstructedMesh.getVerticesData(BABYLON.VertexBuffer.PositionKind) || []);
  28502. var newNormalData = (this._reconstructedMesh.getVerticesData(BABYLON.VertexBuffer.NormalKind) || []);
  28503. var newUVsData = (this._reconstructedMesh.getVerticesData(BABYLON.VertexBuffer.UVKind) || []);
  28504. var newColorsData = (this._reconstructedMesh.getVerticesData(BABYLON.VertexBuffer.ColorKind) || []);
  28505. var normalData = this._mesh.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  28506. var uvs = this._mesh.getVerticesData(BABYLON.VertexBuffer.UVKind);
  28507. var colorsData = this._mesh.getVerticesData(BABYLON.VertexBuffer.ColorKind);
  28508. var vertexCount = 0;
  28509. for (i = 0; i < this.vertices.length; ++i) {
  28510. var vertex = this.vertices[i];
  28511. vertex.id = vertexCount;
  28512. if (vertex.triangleCount) {
  28513. vertex.originalOffsets.forEach(function (originalOffset) {
  28514. newPositionData.push(vertex.position.x);
  28515. newPositionData.push(vertex.position.y);
  28516. newPositionData.push(vertex.position.z);
  28517. newNormalData.push(normalData[originalOffset * 3]);
  28518. newNormalData.push(normalData[(originalOffset * 3) + 1]);
  28519. newNormalData.push(normalData[(originalOffset * 3) + 2]);
  28520. if (uvs && uvs.length) {
  28521. newUVsData.push(uvs[(originalOffset * 2)]);
  28522. newUVsData.push(uvs[(originalOffset * 2) + 1]);
  28523. }
  28524. else if (colorsData && colorsData.length) {
  28525. newColorsData.push(colorsData[(originalOffset * 4)]);
  28526. newColorsData.push(colorsData[(originalOffset * 4) + 1]);
  28527. newColorsData.push(colorsData[(originalOffset * 4) + 2]);
  28528. newColorsData.push(colorsData[(originalOffset * 4) + 3]);
  28529. }
  28530. ++vertexCount;
  28531. });
  28532. }
  28533. }
  28534. var startingIndex = this._reconstructedMesh.getTotalIndices();
  28535. var startingVertex = this._reconstructedMesh.getTotalVertices();
  28536. var submeshesArray = this._reconstructedMesh.subMeshes;
  28537. this._reconstructedMesh.subMeshes = [];
  28538. var newIndicesArray = this._reconstructedMesh.getIndices(); //[];
  28539. var originalIndices = this._mesh.getIndices();
  28540. for (i = 0; i < newTriangles.length; ++i) {
  28541. t = newTriangles[i]; //now get the new referencing point for each vertex
  28542. [0, 1, 2].forEach(function (idx) {
  28543. var id = originalIndices[t.originalOffset + idx];
  28544. var offset = t.vertices[idx].originalOffsets.indexOf(id);
  28545. if (offset < 0)
  28546. offset = 0;
  28547. newIndicesArray.push(t.vertices[idx].id + offset + startingVertex);
  28548. });
  28549. }
  28550. //overwriting the old vertex buffers and indices.
  28551. this._reconstructedMesh.setIndices(newIndicesArray);
  28552. this._reconstructedMesh.setVerticesData(BABYLON.VertexBuffer.PositionKind, newPositionData);
  28553. this._reconstructedMesh.setVerticesData(BABYLON.VertexBuffer.NormalKind, newNormalData);
  28554. if (newUVsData.length > 0)
  28555. this._reconstructedMesh.setVerticesData(BABYLON.VertexBuffer.UVKind, newUVsData);
  28556. if (newColorsData.length > 0)
  28557. this._reconstructedMesh.setVerticesData(BABYLON.VertexBuffer.ColorKind, newColorsData);
  28558. //create submesh
  28559. var originalSubmesh = this._mesh.subMeshes[submeshIndex];
  28560. if (submeshIndex > 0) {
  28561. this._reconstructedMesh.subMeshes = [];
  28562. submeshesArray.forEach(function (submesh) {
  28563. new BABYLON.SubMesh(submesh.materialIndex, submesh.verticesStart, submesh.verticesCount, /* 0, newPositionData.length/3, */ submesh.indexStart, submesh.indexCount, submesh.getMesh());
  28564. });
  28565. var newSubmesh = new BABYLON.SubMesh(originalSubmesh.materialIndex, startingVertex, vertexCount, /* 0, newPositionData.length / 3, */ startingIndex, newTriangles.length * 3, this._reconstructedMesh);
  28566. }
  28567. };
  28568. QuadraticErrorSimplification.prototype.initDecimatedMesh = function () {
  28569. this._reconstructedMesh = new BABYLON.Mesh(this._mesh.name + "Decimated", this._mesh.getScene());
  28570. this._reconstructedMesh.material = this._mesh.material;
  28571. this._reconstructedMesh.parent = this._mesh.parent;
  28572. this._reconstructedMesh.isVisible = false;
  28573. };
  28574. QuadraticErrorSimplification.prototype.isFlipped = function (vertex1, vertex2, point, deletedArray, borderFactor, delTr) {
  28575. for (var i = 0; i < vertex1.triangleCount; ++i) {
  28576. var t = this.triangles[this.references[vertex1.triangleStart + i].triangleId];
  28577. if (t.deleted)
  28578. continue;
  28579. var s = this.references[vertex1.triangleStart + i].vertexId;
  28580. var v1 = t.vertices[(s + 1) % 3];
  28581. var v2 = t.vertices[(s + 2) % 3];
  28582. if ((v1 === vertex2 || v2 === vertex2) /* && !this.isTriangleOnBoundingBox(t)*/) {
  28583. deletedArray[i] = true;
  28584. delTr.push(t);
  28585. continue;
  28586. }
  28587. var d1 = v1.position.subtract(point);
  28588. d1 = d1.normalize();
  28589. var d2 = v2.position.subtract(point);
  28590. d2 = d2.normalize();
  28591. if (Math.abs(BABYLON.Vector3.Dot(d1, d2)) > 0.999)
  28592. return true;
  28593. var normal = BABYLON.Vector3.Cross(d1, d2).normalize();
  28594. deletedArray[i] = false;
  28595. if (BABYLON.Vector3.Dot(normal, t.normal) < 0.2)
  28596. return true;
  28597. }
  28598. return false;
  28599. };
  28600. QuadraticErrorSimplification.prototype.updateTriangles = function (origVertex, vertex, deletedArray, deletedTriangles) {
  28601. var newDeleted = deletedTriangles;
  28602. for (var i = 0; i < vertex.triangleCount; ++i) {
  28603. var ref = this.references[vertex.triangleStart + i];
  28604. var t = this.triangles[ref.triangleId];
  28605. if (t.deleted)
  28606. continue;
  28607. if (deletedArray[i] && t.deletePending) {
  28608. t.deleted = true;
  28609. newDeleted++;
  28610. continue;
  28611. }
  28612. t.vertices[ref.vertexId] = origVertex;
  28613. t.isDirty = true;
  28614. t.error[0] = this.calculateError(t.vertices[0], t.vertices[1]) + (t.borderFactor / 2);
  28615. t.error[1] = this.calculateError(t.vertices[1], t.vertices[2]) + (t.borderFactor / 2);
  28616. t.error[2] = this.calculateError(t.vertices[2], t.vertices[0]) + (t.borderFactor / 2);
  28617. t.error[3] = Math.min(t.error[0], t.error[1], t.error[2]);
  28618. this.references.push(ref);
  28619. }
  28620. return newDeleted;
  28621. };
  28622. QuadraticErrorSimplification.prototype.identifyBorder = function () {
  28623. for (var i = 0; i < this.vertices.length; ++i) {
  28624. var vCount = [];
  28625. var vId = [];
  28626. var v = this.vertices[i];
  28627. var j;
  28628. for (j = 0; j < v.triangleCount; ++j) {
  28629. var triangle = this.triangles[this.references[v.triangleStart + j].triangleId];
  28630. for (var ii = 0; ii < 3; ii++) {
  28631. var ofs = 0;
  28632. var vv = triangle.vertices[ii];
  28633. while (ofs < vCount.length) {
  28634. if (vId[ofs] === vv.id)
  28635. break;
  28636. ++ofs;
  28637. }
  28638. if (ofs === vCount.length) {
  28639. vCount.push(1);
  28640. vId.push(vv.id);
  28641. }
  28642. else {
  28643. vCount[ofs]++;
  28644. }
  28645. }
  28646. }
  28647. for (j = 0; j < vCount.length; ++j) {
  28648. if (vCount[j] === 1) {
  28649. this.vertices[vId[j]].isBorder = true;
  28650. }
  28651. else {
  28652. this.vertices[vId[j]].isBorder = false;
  28653. }
  28654. }
  28655. }
  28656. };
  28657. QuadraticErrorSimplification.prototype.updateMesh = function (identifyBorders) {
  28658. if (identifyBorders === void 0) { identifyBorders = false; }
  28659. var i;
  28660. if (!identifyBorders) {
  28661. var newTrianglesVector = [];
  28662. for (i = 0; i < this.triangles.length; ++i) {
  28663. if (!this.triangles[i].deleted) {
  28664. newTrianglesVector.push(this.triangles[i]);
  28665. }
  28666. }
  28667. this.triangles = newTrianglesVector;
  28668. }
  28669. for (i = 0; i < this.vertices.length; ++i) {
  28670. this.vertices[i].triangleCount = 0;
  28671. this.vertices[i].triangleStart = 0;
  28672. }
  28673. var t;
  28674. var j;
  28675. var v;
  28676. for (i = 0; i < this.triangles.length; ++i) {
  28677. t = this.triangles[i];
  28678. for (j = 0; j < 3; ++j) {
  28679. v = t.vertices[j];
  28680. v.triangleCount++;
  28681. }
  28682. }
  28683. var tStart = 0;
  28684. for (i = 0; i < this.vertices.length; ++i) {
  28685. this.vertices[i].triangleStart = tStart;
  28686. tStart += this.vertices[i].triangleCount;
  28687. this.vertices[i].triangleCount = 0;
  28688. }
  28689. var newReferences = new Array(this.triangles.length * 3);
  28690. for (i = 0; i < this.triangles.length; ++i) {
  28691. t = this.triangles[i];
  28692. for (j = 0; j < 3; ++j) {
  28693. v = t.vertices[j];
  28694. newReferences[v.triangleStart + v.triangleCount] = new Reference(j, i);
  28695. v.triangleCount++;
  28696. }
  28697. }
  28698. this.references = newReferences;
  28699. if (identifyBorders) {
  28700. this.identifyBorder();
  28701. }
  28702. };
  28703. QuadraticErrorSimplification.prototype.vertexError = function (q, point) {
  28704. var x = point.x;
  28705. var y = point.y;
  28706. var z = point.z;
  28707. return q.data[0] * x * x + 2 * q.data[1] * x * y + 2 * q.data[2] * x * z + 2 * q.data[3] * x + q.data[4] * y * y
  28708. + 2 * q.data[5] * y * z + 2 * q.data[6] * y + q.data[7] * z * z + 2 * q.data[8] * z + q.data[9];
  28709. };
  28710. QuadraticErrorSimplification.prototype.calculateError = function (vertex1, vertex2, pointResult, normalResult, uvResult, colorResult) {
  28711. var q = vertex1.q.add(vertex2.q);
  28712. var border = vertex1.isBorder && vertex2.isBorder;
  28713. var error = 0;
  28714. var qDet = q.det(0, 1, 2, 1, 4, 5, 2, 5, 7);
  28715. if (qDet !== 0 && !border) {
  28716. if (!pointResult) {
  28717. pointResult = BABYLON.Vector3.Zero();
  28718. }
  28719. pointResult.x = -1 / qDet * (q.det(1, 2, 3, 4, 5, 6, 5, 7, 8));
  28720. pointResult.y = 1 / qDet * (q.det(0, 2, 3, 1, 5, 6, 2, 7, 8));
  28721. pointResult.z = -1 / qDet * (q.det(0, 1, 3, 1, 4, 6, 2, 5, 8));
  28722. error = this.vertexError(q, pointResult);
  28723. }
  28724. else {
  28725. var p3 = (vertex1.position.add(vertex2.position)).divide(new BABYLON.Vector3(2, 2, 2));
  28726. //var norm3 = (vertex1.normal.add(vertex2.normal)).divide(new Vector3(2, 2, 2)).normalize();
  28727. var error1 = this.vertexError(q, vertex1.position);
  28728. var error2 = this.vertexError(q, vertex2.position);
  28729. var error3 = this.vertexError(q, p3);
  28730. error = Math.min(error1, error2, error3);
  28731. if (error === error1) {
  28732. if (pointResult) {
  28733. pointResult.copyFrom(vertex1.position);
  28734. }
  28735. }
  28736. else if (error === error2) {
  28737. if (pointResult) {
  28738. pointResult.copyFrom(vertex2.position);
  28739. }
  28740. }
  28741. else {
  28742. if (pointResult) {
  28743. pointResult.copyFrom(p3);
  28744. }
  28745. }
  28746. }
  28747. return error;
  28748. };
  28749. return QuadraticErrorSimplification;
  28750. })();
  28751. BABYLON.QuadraticErrorSimplification = QuadraticErrorSimplification;
  28752. })(BABYLON || (BABYLON = {}));
  28753. var BABYLON;
  28754. (function (BABYLON) {
  28755. var serializeLight = function (light) {
  28756. var serializationObject = {};
  28757. serializationObject.name = light.name;
  28758. serializationObject.id = light.id;
  28759. serializationObject.tags = BABYLON.Tags.GetTags(light);
  28760. if (light instanceof BABYLON.PointLight) {
  28761. serializationObject.type = 0;
  28762. serializationObject.position = (light).position.asArray();
  28763. }
  28764. else if (light instanceof BABYLON.DirectionalLight) {
  28765. serializationObject.type = 1;
  28766. var directionalLight = light;
  28767. serializationObject.position = directionalLight.position.asArray();
  28768. serializationObject.direction = directionalLight.direction.asArray();
  28769. }
  28770. else if (light instanceof BABYLON.SpotLight) {
  28771. serializationObject.type = 2;
  28772. var spotLight = light;
  28773. serializationObject.position = spotLight.position.asArray();
  28774. serializationObject.direction = spotLight.position.asArray();
  28775. serializationObject.angle = spotLight.angle;
  28776. serializationObject.exponent = spotLight.exponent;
  28777. }
  28778. else if (light instanceof BABYLON.HemisphericLight) {
  28779. serializationObject.type = 3;
  28780. var hemisphericLight = light;
  28781. serializationObject.direction = hemisphericLight.direction.asArray();
  28782. serializationObject.groundColor = hemisphericLight.groundColor.asArray();
  28783. }
  28784. if (light.intensity) {
  28785. serializationObject.intensity = light.intensity;
  28786. }
  28787. serializationObject.range = light.range;
  28788. serializationObject.diffuse = light.diffuse.asArray();
  28789. serializationObject.specular = light.specular.asArray();
  28790. return serializationObject;
  28791. };
  28792. var serializeFresnelParameter = function (fresnelParameter) {
  28793. var serializationObject = {};
  28794. serializationObject.isEnabled = fresnelParameter.isEnabled;
  28795. serializationObject.leftColor = fresnelParameter.leftColor;
  28796. serializationObject.rightColor = fresnelParameter.rightColor;
  28797. serializationObject.bias = fresnelParameter.bias;
  28798. serializationObject.power = fresnelParameter.power;
  28799. return serializationObject;
  28800. };
  28801. var serializeAnimation;
  28802. var appendAnimations = function (source, destination) {
  28803. if (source.animations) {
  28804. destination.animations = [];
  28805. for (var animationIndex = 0; animationIndex < source.animations.length; animationIndex++) {
  28806. var animation = source.animations[animationIndex];
  28807. destination.animations.push(serializeAnimation(animation));
  28808. }
  28809. }
  28810. };
  28811. var serializeCamera = function (camera) {
  28812. var serializationObject = {};
  28813. serializationObject.name = camera.name;
  28814. serializationObject.tags = BABYLON.Tags.GetTags(camera);
  28815. serializationObject.id = camera.id;
  28816. serializationObject.position = camera.position.asArray();
  28817. // Parent
  28818. if (camera.parent) {
  28819. serializationObject.parentId = camera.parent.id;
  28820. }
  28821. serializationObject.fov = camera.fov;
  28822. serializationObject.minZ = camera.minZ;
  28823. serializationObject.maxZ = camera.maxZ;
  28824. serializationObject.inertia = camera.inertia;
  28825. //setting the type
  28826. if (camera instanceof BABYLON.FreeCamera) {
  28827. serializationObject.type = "FreeCamera";
  28828. }
  28829. else if (camera instanceof BABYLON.ArcRotateCamera) {
  28830. serializationObject.type = "ArcRotateCamera";
  28831. }
  28832. else if (camera instanceof BABYLON.AnaglyphArcRotateCamera) {
  28833. serializationObject.type = "AnaglyphArcRotateCamera";
  28834. }
  28835. else if (camera instanceof BABYLON.GamepadCamera) {
  28836. serializationObject.type = "GamepadCamera";
  28837. }
  28838. else if (camera instanceof BABYLON.AnaglyphFreeCamera) {
  28839. serializationObject.type = "AnaglyphFreeCamera";
  28840. }
  28841. else if (camera instanceof BABYLON.DeviceOrientationCamera) {
  28842. serializationObject.type = "DeviceOrientationCamera";
  28843. }
  28844. else if (camera instanceof BABYLON.FollowCamera) {
  28845. serializationObject.type = "FollowCamera";
  28846. }
  28847. else if (camera instanceof BABYLON.TouchCamera) {
  28848. serializationObject.type = "TouchCamera";
  28849. }
  28850. else if (camera instanceof BABYLON.VirtualJoysticksCamera) {
  28851. serializationObject.type = "VirtualJoysticksCamera";
  28852. }
  28853. else if (camera instanceof BABYLON.WebVRFreeCamera) {
  28854. serializationObject.type = "WebVRFreeCamera";
  28855. }
  28856. else if (camera instanceof BABYLON.VRDeviceOrientationFreeCamera) {
  28857. serializationObject.type = "VRDeviceOrientationFreeCamera";
  28858. }
  28859. //special properties of specific cameras
  28860. if (camera instanceof BABYLON.ArcRotateCamera || camera instanceof BABYLON.AnaglyphArcRotateCamera) {
  28861. var arcCamera = camera;
  28862. serializationObject.alpha = arcCamera.alpha;
  28863. serializationObject.beta = arcCamera.beta;
  28864. serializationObject.radius = arcCamera.radius;
  28865. if (arcCamera.target && arcCamera.target.id) {
  28866. serializationObject.lockedTargetId = arcCamera.target.id;
  28867. }
  28868. }
  28869. else if (camera instanceof BABYLON.FollowCamera) {
  28870. var followCam = camera;
  28871. serializationObject.radius = followCam.radius;
  28872. serializationObject.heightOffset = followCam.heightOffset;
  28873. serializationObject.rotationOffset = followCam.rotationOffset;
  28874. }
  28875. else if (camera instanceof BABYLON.AnaglyphFreeCamera || camera instanceof BABYLON.AnaglyphArcRotateCamera) {
  28876. //eye space is a private member and can only be access like this. Without changing the implementation this is the best way to get it.
  28877. if (camera['_interaxialDistance'] !== undefined) {
  28878. serializationObject.interaxial_distance = BABYLON.Tools.ToDegrees(camera['_interaxialDistance']);
  28879. }
  28880. }
  28881. //general properties that not all cameras have. The [] is due to typescript's type safety
  28882. if (camera['speed'] !== undefined) {
  28883. serializationObject.speed = camera['speed'];
  28884. }
  28885. if (camera['target'] && camera['target'] instanceof BABYLON.Vector3) {
  28886. serializationObject.target = camera['target'].asArray();
  28887. }
  28888. // Target
  28889. if (camera['rotation'] && camera['rotation'] instanceof BABYLON.Vector3) {
  28890. serializationObject.rotation = camera['rotation'].asArray();
  28891. }
  28892. // Locked target
  28893. if (camera['lockedTarget'] && camera['lockedTarget'].id) {
  28894. serializationObject.lockedTargetId = camera['lockedTarget'].id;
  28895. }
  28896. serializationObject.checkCollisions = camera['checkCollisions'] || false;
  28897. serializationObject.applyGravity = camera['applyGravity'] || false;
  28898. if (camera['ellipsoid']) {
  28899. serializationObject.ellipsoid = camera['ellipsoid'].asArray();
  28900. }
  28901. // Animations
  28902. appendAnimations(camera, serializationObject);
  28903. // Layer mask
  28904. serializationObject.layerMask = camera.layerMask;
  28905. return serializationObject;
  28906. };
  28907. serializeAnimation = function (animation) {
  28908. var serializationObject = {};
  28909. serializationObject.name = animation.name;
  28910. serializationObject.property = animation.targetProperty;
  28911. serializationObject.framePerSecond = animation.framePerSecond;
  28912. serializationObject.dataType = animation.dataType;
  28913. serializationObject.loopBehavior = animation.loopMode;
  28914. var dataType = animation.dataType;
  28915. serializationObject.keys = [];
  28916. var keys = animation.getKeys();
  28917. for (var index = 0; index < keys.length; index++) {
  28918. var animationKey = keys[index];
  28919. var key = {};
  28920. key.frame = animationKey.frame;
  28921. switch (dataType) {
  28922. case BABYLON.Animation.ANIMATIONTYPE_FLOAT:
  28923. key.values = [animationKey.value];
  28924. break;
  28925. case BABYLON.Animation.ANIMATIONTYPE_QUATERNION:
  28926. case BABYLON.Animation.ANIMATIONTYPE_MATRIX:
  28927. case BABYLON.Animation.ANIMATIONTYPE_VECTOR3:
  28928. key.values = animationKey.value.asArray();
  28929. break;
  28930. }
  28931. serializationObject.keys.push(key);
  28932. }
  28933. return serializationObject;
  28934. };
  28935. var serializeMultiMaterial = function (material) {
  28936. var serializationObject = {};
  28937. serializationObject.name = material.name;
  28938. serializationObject.id = material.id;
  28939. serializationObject.tags = BABYLON.Tags.GetTags(material);
  28940. serializationObject.materials = [];
  28941. for (var matIndex = 0; matIndex < material.subMaterials.length; matIndex++) {
  28942. var subMat = material.subMaterials[matIndex];
  28943. if (subMat) {
  28944. serializationObject.materials.push(subMat.id);
  28945. }
  28946. else {
  28947. serializationObject.materials.push(null);
  28948. }
  28949. }
  28950. return serializationObject;
  28951. };
  28952. var serializeTexture;
  28953. var serializeMaterial = function (material) {
  28954. var serializationObject = {};
  28955. serializationObject.name = material.name;
  28956. serializationObject.ambient = material.ambientColor.asArray();
  28957. serializationObject.diffuse = material.diffuseColor.asArray();
  28958. serializationObject.specular = material.specularColor.asArray();
  28959. serializationObject.specularPower = material.specularPower;
  28960. serializationObject.emissive = material.emissiveColor.asArray();
  28961. serializationObject.useReflectionFresnelFromSpecular = serializationObject.useReflectionFresnelFromSpecular;
  28962. serializationObject.useEmissiveAsIllumination = serializationObject.useEmissiveAsIllumination;
  28963. serializationObject.alpha = material.alpha;
  28964. serializationObject.id = material.id;
  28965. serializationObject.tags = BABYLON.Tags.GetTags(material);
  28966. serializationObject.backFaceCulling = material.backFaceCulling;
  28967. if (material.diffuseTexture) {
  28968. serializationObject.diffuseTexture = serializeTexture(material.diffuseTexture);
  28969. }
  28970. if (material.diffuseFresnelParameters) {
  28971. serializationObject.diffuseFresnelParameters = serializeFresnelParameter(material.diffuseFresnelParameters);
  28972. }
  28973. if (material.ambientTexture) {
  28974. serializationObject.ambientTexture = serializeTexture(material.ambientTexture);
  28975. }
  28976. if (material.opacityTexture) {
  28977. serializationObject.opacityTexture = serializeTexture(material.opacityTexture);
  28978. }
  28979. if (material.opacityFresnelParameters) {
  28980. serializationObject.opacityFresnelParameters = serializeFresnelParameter(material.opacityFresnelParameters);
  28981. }
  28982. if (material.reflectionTexture) {
  28983. serializationObject.reflectionTexture = serializeTexture(material.reflectionTexture);
  28984. }
  28985. if (material.reflectionFresnelParameters) {
  28986. serializationObject.reflectionFresnelParameters = serializeFresnelParameter(material.reflectionFresnelParameters);
  28987. }
  28988. if (material.emissiveTexture) {
  28989. serializationObject.emissiveTexture = serializeTexture(material.emissiveTexture);
  28990. }
  28991. if (material.lightmapTexture) {
  28992. serializationObject.lightmapTexture = serializeTexture(material.lightmapTexture);
  28993. serializationObject.useLightmapAsShadowmap = material.useLightmapAsShadowmap;
  28994. }
  28995. if (material.emissiveFresnelParameters) {
  28996. serializationObject.emissiveFresnelParameters = serializeFresnelParameter(material.emissiveFresnelParameters);
  28997. }
  28998. if (material.specularTexture) {
  28999. serializationObject.specularTexture = serializeTexture(material.specularTexture);
  29000. }
  29001. if (material.bumpTexture) {
  29002. serializationObject.bumpTexture = serializeTexture(material.bumpTexture);
  29003. }
  29004. return serializationObject;
  29005. };
  29006. serializeTexture = function (texture) {
  29007. var serializationObject = {};
  29008. if (!texture.name) {
  29009. return null;
  29010. }
  29011. if (texture instanceof BABYLON.CubeTexture) {
  29012. serializationObject.name = texture.name;
  29013. serializationObject.hasAlpha = texture.hasAlpha;
  29014. serializationObject.isCube = true;
  29015. serializationObject.level = texture.level;
  29016. serializationObject.coordinatesMode = texture.coordinatesMode;
  29017. return serializationObject;
  29018. }
  29019. var index;
  29020. if (texture instanceof BABYLON.MirrorTexture) {
  29021. var mirrorTexture = texture;
  29022. serializationObject.renderTargetSize = mirrorTexture.getRenderSize();
  29023. serializationObject.renderList = [];
  29024. for (index = 0; index < mirrorTexture.renderList.length; index++) {
  29025. serializationObject.renderList.push(mirrorTexture.renderList[index].id);
  29026. }
  29027. serializationObject.mirrorPlane = mirrorTexture.mirrorPlane.asArray();
  29028. }
  29029. else if (texture instanceof BABYLON.RenderTargetTexture) {
  29030. var renderTargetTexture = texture;
  29031. serializationObject.renderTargetSize = renderTargetTexture.getRenderSize();
  29032. serializationObject.renderList = [];
  29033. for (index = 0; index < renderTargetTexture.renderList.length; index++) {
  29034. serializationObject.renderList.push(renderTargetTexture.renderList[index].id);
  29035. }
  29036. }
  29037. var regularTexture = texture;
  29038. serializationObject.name = texture.name;
  29039. serializationObject.hasAlpha = texture.hasAlpha;
  29040. serializationObject.level = texture.level;
  29041. serializationObject.coordinatesIndex = texture.coordinatesIndex;
  29042. serializationObject.coordinatesMode = texture.coordinatesMode;
  29043. serializationObject.uOffset = regularTexture.uOffset;
  29044. serializationObject.vOffset = regularTexture.vOffset;
  29045. serializationObject.uScale = regularTexture.uScale;
  29046. serializationObject.vScale = regularTexture.vScale;
  29047. serializationObject.uAng = regularTexture.uAng;
  29048. serializationObject.vAng = regularTexture.vAng;
  29049. serializationObject.wAng = regularTexture.wAng;
  29050. serializationObject.wrapU = texture.wrapU;
  29051. serializationObject.wrapV = texture.wrapV;
  29052. // Animations
  29053. appendAnimations(texture, serializationObject);
  29054. return serializationObject;
  29055. };
  29056. var serializeSkeleton = function (skeleton) {
  29057. var serializationObject = {};
  29058. serializationObject.name = skeleton.name;
  29059. serializationObject.id = skeleton.id;
  29060. serializationObject.bones = [];
  29061. for (var index = 0; index < skeleton.bones.length; index++) {
  29062. var bone = skeleton.bones[index];
  29063. var serializedBone = {
  29064. parentBoneIndex: bone.getParent() ? skeleton.bones.indexOf(bone.getParent()) : -1,
  29065. name: bone.name,
  29066. matrix: bone.getLocalMatrix().toArray()
  29067. };
  29068. serializationObject.bones.push(serializedBone);
  29069. if (bone.animations && bone.animations.length > 0) {
  29070. serializedBone.animation = serializeAnimation(bone.animations[0]);
  29071. }
  29072. }
  29073. return serializationObject;
  29074. };
  29075. var serializeParticleSystem = function (particleSystem) {
  29076. var serializationObject = {};
  29077. serializationObject.emitterId = particleSystem.emitter.id;
  29078. serializationObject.capacity = particleSystem.getCapacity();
  29079. if (particleSystem.particleTexture) {
  29080. serializationObject.textureName = particleSystem.particleTexture.name;
  29081. }
  29082. serializationObject.minAngularSpeed = particleSystem.minAngularSpeed;
  29083. serializationObject.maxAngularSpeed = particleSystem.maxAngularSpeed;
  29084. serializationObject.minSize = particleSystem.minSize;
  29085. serializationObject.maxSize = particleSystem.maxSize;
  29086. serializationObject.minLifeTime = particleSystem.minLifeTime;
  29087. serializationObject.maxLifeTime = particleSystem.maxLifeTime;
  29088. serializationObject.emitRate = particleSystem.emitRate;
  29089. serializationObject.minEmitBox = particleSystem.minEmitBox.asArray();
  29090. serializationObject.maxEmitBox = particleSystem.maxEmitBox.asArray();
  29091. serializationObject.gravity = particleSystem.gravity.asArray();
  29092. serializationObject.direction1 = particleSystem.direction1.asArray();
  29093. serializationObject.direction2 = particleSystem.direction2.asArray();
  29094. serializationObject.color1 = particleSystem.color1.asArray();
  29095. serializationObject.color2 = particleSystem.color2.asArray();
  29096. serializationObject.colorDead = particleSystem.colorDead.asArray();
  29097. serializationObject.updateSpeed = particleSystem.updateSpeed;
  29098. serializationObject.targetStopDuration = particleSystem.targetStopDuration;
  29099. serializationObject.textureMask = particleSystem.textureMask.asArray();
  29100. serializationObject.blendMode = particleSystem.blendMode;
  29101. return serializationObject;
  29102. };
  29103. var serializeLensFlareSystem = function (lensFlareSystem) {
  29104. var serializationObject = {};
  29105. serializationObject.emitterId = lensFlareSystem.getEmitter().id;
  29106. serializationObject.borderLimit = lensFlareSystem.borderLimit;
  29107. serializationObject.flares = [];
  29108. for (var index = 0; index < lensFlareSystem.lensFlares.length; index++) {
  29109. var flare = lensFlareSystem.lensFlares[index];
  29110. serializationObject.flares.push({
  29111. size: flare.size,
  29112. position: flare.position,
  29113. color: flare.color.asArray(),
  29114. textureName: BABYLON.Tools.GetFilename(flare.texture.name)
  29115. });
  29116. }
  29117. return serializationObject;
  29118. };
  29119. var serializeShadowGenerator = function (light) {
  29120. var serializationObject = {};
  29121. var shadowGenerator = light.getShadowGenerator();
  29122. serializationObject.lightId = light.id;
  29123. serializationObject.mapSize = shadowGenerator.getShadowMap().getRenderSize();
  29124. serializationObject.useVarianceShadowMap = shadowGenerator.useVarianceShadowMap;
  29125. serializationObject.usePoissonSampling = shadowGenerator.usePoissonSampling;
  29126. serializationObject.renderList = [];
  29127. for (var meshIndex = 0; meshIndex < shadowGenerator.getShadowMap().renderList.length; meshIndex++) {
  29128. var mesh = shadowGenerator.getShadowMap().renderList[meshIndex];
  29129. serializationObject.renderList.push(mesh.id);
  29130. }
  29131. return serializationObject;
  29132. };
  29133. var serializedGeometries = [];
  29134. var serializeVertexData;
  29135. var serializeTorusKnot;
  29136. var serializePlane;
  29137. var serializeGround;
  29138. var serializeTorus;
  29139. var serializeCylinder;
  29140. var serializeSphere;
  29141. var serializeBox;
  29142. var serializeGeometry = function (geometry, serializationGeometries) {
  29143. if (serializedGeometries[geometry.id]) {
  29144. return;
  29145. }
  29146. if (geometry instanceof BABYLON.Geometry.Primitives.Box) {
  29147. serializationGeometries.boxes.push(serializeBox(geometry));
  29148. }
  29149. else if (geometry instanceof BABYLON.Geometry.Primitives.Sphere) {
  29150. serializationGeometries.spheres.push(serializeSphere(geometry));
  29151. }
  29152. else if (geometry instanceof BABYLON.Geometry.Primitives.Cylinder) {
  29153. serializationGeometries.cylinders.push(serializeCylinder(geometry));
  29154. }
  29155. else if (geometry instanceof BABYLON.Geometry.Primitives.Torus) {
  29156. serializationGeometries.toruses.push(serializeTorus(geometry));
  29157. }
  29158. else if (geometry instanceof BABYLON.Geometry.Primitives.Ground) {
  29159. serializationGeometries.grounds.push(serializeGround(geometry));
  29160. }
  29161. else if (geometry instanceof BABYLON.Geometry.Primitives.Plane) {
  29162. serializationGeometries.planes.push(serializePlane(geometry));
  29163. }
  29164. else if (geometry instanceof BABYLON.Geometry.Primitives.TorusKnot) {
  29165. serializationGeometries.torusKnots.push(serializeTorusKnot(geometry));
  29166. }
  29167. else if (geometry instanceof BABYLON.Geometry.Primitives._Primitive) {
  29168. throw new Error("Unknown primitive type");
  29169. }
  29170. else {
  29171. serializationGeometries.vertexData.push(serializeVertexData(geometry));
  29172. }
  29173. serializedGeometries[geometry.id] = true;
  29174. };
  29175. var serializeGeometryBase = function (geometry) {
  29176. var serializationObject = {};
  29177. serializationObject.id = geometry.id;
  29178. if (BABYLON.Tags.HasTags(geometry)) {
  29179. serializationObject.tags = BABYLON.Tags.GetTags(geometry);
  29180. }
  29181. return serializationObject;
  29182. };
  29183. serializeVertexData = function (vertexData) {
  29184. var serializationObject = serializeGeometryBase(vertexData);
  29185. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.PositionKind)) {
  29186. serializationObject.positions = vertexData.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  29187. }
  29188. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) {
  29189. serializationObject.normals = vertexData.getVerticesData(BABYLON.VertexBuffer.NormalKind);
  29190. }
  29191. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  29192. serializationObject.uvs = vertexData.getVerticesData(BABYLON.VertexBuffer.UVKind);
  29193. }
  29194. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  29195. serializationObject.uvs2 = vertexData.getVerticesData(BABYLON.VertexBuffer.UV2Kind);
  29196. }
  29197. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.UV3Kind)) {
  29198. serializationObject.uvs3 = vertexData.getVerticesData(BABYLON.VertexBuffer.UV3Kind);
  29199. }
  29200. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.UV4Kind)) {
  29201. serializationObject.uvs4 = vertexData.getVerticesData(BABYLON.VertexBuffer.UV4Kind);
  29202. }
  29203. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.UV5Kind)) {
  29204. serializationObject.uvs5 = vertexData.getVerticesData(BABYLON.VertexBuffer.UV5Kind);
  29205. }
  29206. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.UV6Kind)) {
  29207. serializationObject.uvs6 = vertexData.getVerticesData(BABYLON.VertexBuffer.UV6Kind);
  29208. }
  29209. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.ColorKind)) {
  29210. serializationObject.colors = vertexData.getVerticesData(BABYLON.VertexBuffer.ColorKind);
  29211. }
  29212. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesIndicesKind)) {
  29213. serializationObject.matricesIndices = vertexData.getVerticesData(BABYLON.VertexBuffer.MatricesIndicesKind);
  29214. serializationObject.matricesIndices._isExpanded = true;
  29215. }
  29216. if (vertexData.isVerticesDataPresent(BABYLON.VertexBuffer.MatricesWeightsKind)) {
  29217. serializationObject.matricesWeights = vertexData.getVerticesData(BABYLON.VertexBuffer.MatricesWeightsKind);
  29218. }
  29219. serializationObject.indices = vertexData.getIndices();
  29220. return serializationObject;
  29221. };
  29222. var serializePrimitive = function (primitive) {
  29223. var serializationObject = serializeGeometryBase(primitive);
  29224. serializationObject.canBeRegenerated = primitive.canBeRegenerated();
  29225. return serializationObject;
  29226. };
  29227. serializeBox = function (box) {
  29228. var serializationObject = serializePrimitive(box);
  29229. serializationObject.size = box.size;
  29230. return serializationObject;
  29231. };
  29232. serializeSphere = function (sphere) {
  29233. var serializationObject = serializePrimitive(sphere);
  29234. serializationObject.segments = sphere.segments;
  29235. serializationObject.diameter = sphere.diameter;
  29236. return serializationObject;
  29237. };
  29238. serializeCylinder = function (cylinder) {
  29239. var serializationObject = serializePrimitive(cylinder);
  29240. serializationObject.height = cylinder.height;
  29241. serializationObject.diameterTop = cylinder.diameterTop;
  29242. serializationObject.diameterBottom = cylinder.diameterBottom;
  29243. serializationObject.tessellation = cylinder.tessellation;
  29244. return serializationObject;
  29245. };
  29246. serializeTorus = function (torus) {
  29247. var serializationObject = serializePrimitive(torus);
  29248. serializationObject.diameter = torus.diameter;
  29249. serializationObject.thickness = torus.thickness;
  29250. serializationObject.tessellation = torus.tessellation;
  29251. return serializationObject;
  29252. };
  29253. serializeGround = function (ground) {
  29254. var serializationObject = serializePrimitive(ground);
  29255. serializationObject.width = ground.width;
  29256. serializationObject.height = ground.height;
  29257. serializationObject.subdivisions = ground.subdivisions;
  29258. return serializationObject;
  29259. };
  29260. serializePlane = function (plane) {
  29261. var serializationObject = serializePrimitive(plane);
  29262. serializationObject.size = plane.size;
  29263. return serializationObject;
  29264. };
  29265. serializeTorusKnot = function (torusKnot) {
  29266. var serializationObject = serializePrimitive(torusKnot);
  29267. serializationObject.radius = torusKnot.radius;
  29268. serializationObject.tube = torusKnot.tube;
  29269. serializationObject.radialSegments = torusKnot.radialSegments;
  29270. serializationObject.tubularSegments = torusKnot.tubularSegments;
  29271. serializationObject.p = torusKnot.p;
  29272. serializationObject.q = torusKnot.q;
  29273. return serializationObject;
  29274. };
  29275. var serializeMesh = function (mesh, serializationScene) {
  29276. var serializationObject = {};
  29277. serializationObject.name = mesh.name;
  29278. serializationObject.id = mesh.id;
  29279. if (BABYLON.Tags.HasTags(mesh)) {
  29280. serializationObject.tags = BABYLON.Tags.GetTags(mesh);
  29281. }
  29282. serializationObject.position = mesh.position.asArray();
  29283. if (mesh.rotationQuaternion) {
  29284. serializationObject.rotationQuaternion = mesh.rotationQuaternion.asArray();
  29285. }
  29286. else if (mesh.rotation) {
  29287. serializationObject.rotation = mesh.rotation.asArray();
  29288. }
  29289. serializationObject.scaling = mesh.scaling.asArray();
  29290. serializationObject.localMatrix = mesh.getPivotMatrix().asArray();
  29291. serializationObject.isEnabled = mesh.isEnabled();
  29292. serializationObject.isVisible = mesh.isVisible;
  29293. serializationObject.infiniteDistance = mesh.infiniteDistance;
  29294. serializationObject.pickable = mesh.isPickable;
  29295. serializationObject.receiveShadows = mesh.receiveShadows;
  29296. serializationObject.billboardMode = mesh.billboardMode;
  29297. serializationObject.visibility = mesh.visibility;
  29298. serializationObject.checkCollisions = mesh.checkCollisions;
  29299. // Parent
  29300. if (mesh.parent) {
  29301. serializationObject.parentId = mesh.parent.id;
  29302. }
  29303. // Geometry
  29304. var geometry = mesh._geometry;
  29305. if (geometry) {
  29306. var geometryId = geometry.id;
  29307. serializationObject.geometryId = geometryId;
  29308. if (!mesh.getScene().getGeometryByID(geometryId)) {
  29309. // geometry was in the memory but not added to the scene, nevertheless it's better to serialize to be able to reload the mesh with its geometry
  29310. serializeGeometry(geometry, serializationScene.geometries);
  29311. }
  29312. // SubMeshes
  29313. serializationObject.subMeshes = [];
  29314. for (var subIndex = 0; subIndex < mesh.subMeshes.length; subIndex++) {
  29315. var subMesh = mesh.subMeshes[subIndex];
  29316. serializationObject.subMeshes.push({
  29317. materialIndex: subMesh.materialIndex,
  29318. verticesStart: subMesh.verticesStart,
  29319. verticesCount: subMesh.verticesCount,
  29320. indexStart: subMesh.indexStart,
  29321. indexCount: subMesh.indexCount
  29322. });
  29323. }
  29324. }
  29325. // Material
  29326. if (mesh.material) {
  29327. serializationObject.materialId = mesh.material.id;
  29328. }
  29329. else {
  29330. mesh.material = null;
  29331. }
  29332. // Skeleton
  29333. if (mesh.skeleton) {
  29334. serializationObject.skeletonId = mesh.skeleton.id;
  29335. }
  29336. // Physics
  29337. if (mesh.getPhysicsImpostor() !== BABYLON.PhysicsEngine.NoImpostor) {
  29338. serializationObject.physicsMass = mesh.getPhysicsMass();
  29339. serializationObject.physicsFriction = mesh.getPhysicsFriction();
  29340. serializationObject.physicsRestitution = mesh.getPhysicsRestitution();
  29341. switch (mesh.getPhysicsImpostor()) {
  29342. case BABYLON.PhysicsEngine.BoxImpostor:
  29343. serializationObject.physicsImpostor = 1;
  29344. break;
  29345. case BABYLON.PhysicsEngine.SphereImpostor:
  29346. serializationObject.physicsImpostor = 2;
  29347. break;
  29348. }
  29349. }
  29350. // Instances
  29351. serializationObject.instances = [];
  29352. for (var index = 0; index < mesh.instances.length; index++) {
  29353. var instance = mesh.instances[index];
  29354. var serializationInstance = {
  29355. name: instance.name,
  29356. position: instance.position.asArray(),
  29357. rotation: instance.rotation.asArray(),
  29358. rotationQuaternion: instance.rotationQuaternion.asArray(),
  29359. scaling: instance.scaling.asArray()
  29360. };
  29361. serializationObject.instances.push(serializationInstance);
  29362. // Animations
  29363. appendAnimations(instance, serializationInstance);
  29364. }
  29365. // Animations
  29366. appendAnimations(mesh, serializationObject);
  29367. // Layer mask
  29368. serializationObject.layerMask = mesh.layerMask;
  29369. return serializationObject;
  29370. };
  29371. var finalizeSingleMesh = function (mesh, serializationObject) {
  29372. //only works if the mesh is already loaded
  29373. if (mesh.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADED || mesh.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_NONE) {
  29374. //serialize material
  29375. if (mesh.material) {
  29376. if (mesh.material instanceof BABYLON.StandardMaterial) {
  29377. serializationObject.materials = serializationObject.materials || [];
  29378. if (!serializationObject.materials.some(function (mat) { return (mat.id === mesh.material.id); })) {
  29379. serializationObject.materials.push(serializeMaterial(mesh.material));
  29380. }
  29381. }
  29382. else if (mesh.material instanceof BABYLON.MultiMaterial) {
  29383. serializationObject.multiMaterials = serializationObject.multiMaterials || [];
  29384. if (!serializationObject.multiMaterials.some(function (mat) { return (mat.id === mesh.material.id); })) {
  29385. serializationObject.multiMaterials.push(serializeMultiMaterial(mesh.material));
  29386. }
  29387. }
  29388. }
  29389. //serialize geometry
  29390. var geometry = mesh._geometry;
  29391. if (geometry) {
  29392. if (!serializationObject.geometries) {
  29393. serializationObject.geometries = {};
  29394. serializationObject.geometries.boxes = [];
  29395. serializationObject.geometries.spheres = [];
  29396. serializationObject.geometries.cylinders = [];
  29397. serializationObject.geometries.toruses = [];
  29398. serializationObject.geometries.grounds = [];
  29399. serializationObject.geometries.planes = [];
  29400. serializationObject.geometries.torusKnots = [];
  29401. serializationObject.geometries.vertexData = [];
  29402. }
  29403. serializeGeometry(geometry, serializationObject.geometries);
  29404. }
  29405. // Skeletons
  29406. if (mesh.skeleton) {
  29407. serializationObject.skeletons = serializationObject.skeletons || [];
  29408. serializationObject.skeletons.push(serializeSkeleton(mesh.skeleton));
  29409. }
  29410. //serialize the actual mesh
  29411. serializationObject.meshes = serializationObject.meshes || [];
  29412. serializationObject.meshes.push(serializeMesh(mesh, serializationObject));
  29413. }
  29414. };
  29415. var SceneSerializer = (function () {
  29416. function SceneSerializer() {
  29417. }
  29418. SceneSerializer.Serialize = function (scene) {
  29419. var serializationObject = {};
  29420. // Scene
  29421. serializationObject.useDelayedTextureLoading = scene.useDelayedTextureLoading;
  29422. serializationObject.autoClear = scene.autoClear;
  29423. serializationObject.clearColor = scene.clearColor.asArray();
  29424. serializationObject.ambientColor = scene.ambientColor.asArray();
  29425. serializationObject.gravity = scene.gravity.asArray();
  29426. // Fog
  29427. if (scene.fogMode && scene.fogMode !== 0) {
  29428. serializationObject.fogMode = scene.fogMode;
  29429. serializationObject.fogColor = scene.fogColor.asArray();
  29430. serializationObject.fogStart = scene.fogStart;
  29431. serializationObject.fogEnd = scene.fogEnd;
  29432. serializationObject.fogDensity = scene.fogDensity;
  29433. }
  29434. // Lights
  29435. serializationObject.lights = [];
  29436. var index;
  29437. var light;
  29438. for (index = 0; index < scene.lights.length; index++) {
  29439. light = scene.lights[index];
  29440. serializationObject.lights.push(serializeLight(light));
  29441. }
  29442. // Cameras
  29443. serializationObject.cameras = [];
  29444. for (index = 0; index < scene.cameras.length; index++) {
  29445. var camera = scene.cameras[index];
  29446. serializationObject.cameras.push(serializeCamera(camera));
  29447. }
  29448. if (scene.activeCamera) {
  29449. serializationObject.activeCameraID = scene.activeCamera.id;
  29450. }
  29451. // Materials
  29452. serializationObject.materials = [];
  29453. serializationObject.multiMaterials = [];
  29454. var material;
  29455. for (index = 0; index < scene.materials.length; index++) {
  29456. material = scene.materials[index];
  29457. serializationObject.materials.push(serializeMaterial(material));
  29458. }
  29459. // MultiMaterials
  29460. serializationObject.multiMaterials = [];
  29461. for (index = 0; index < scene.multiMaterials.length; index++) {
  29462. var multiMaterial = scene.multiMaterials[index];
  29463. serializationObject.multiMaterials.push(serializeMultiMaterial(multiMaterial));
  29464. }
  29465. for (index = 0; index < scene.materials.length; index++) {
  29466. material = scene.materials[index];
  29467. if (material instanceof BABYLON.StandardMaterial) {
  29468. serializationObject.materials.push(serializeMaterial(material));
  29469. }
  29470. else if (material instanceof BABYLON.MultiMaterial) {
  29471. serializationObject.multiMaterials.push(serializeMultiMaterial(material));
  29472. }
  29473. }
  29474. // Skeletons
  29475. serializationObject.skeletons = [];
  29476. for (index = 0; index < scene.skeletons.length; index++) {
  29477. serializationObject.skeletons.push(serializeSkeleton(scene.skeletons[index]));
  29478. }
  29479. // Geometries
  29480. serializationObject.geometries = {};
  29481. serializationObject.geometries.boxes = [];
  29482. serializationObject.geometries.spheres = [];
  29483. serializationObject.geometries.cylinders = [];
  29484. serializationObject.geometries.toruses = [];
  29485. serializationObject.geometries.grounds = [];
  29486. serializationObject.geometries.planes = [];
  29487. serializationObject.geometries.torusKnots = [];
  29488. serializationObject.geometries.vertexData = [];
  29489. serializedGeometries = [];
  29490. var geometries = scene.getGeometries();
  29491. for (index = 0; index < geometries.length; index++) {
  29492. var geometry = geometries[index];
  29493. if (geometry.isReady()) {
  29494. serializeGeometry(geometry, serializationObject.geometries);
  29495. }
  29496. }
  29497. // Meshes
  29498. serializationObject.meshes = [];
  29499. for (index = 0; index < scene.meshes.length; index++) {
  29500. var abstractMesh = scene.meshes[index];
  29501. if (abstractMesh instanceof BABYLON.Mesh) {
  29502. var mesh = abstractMesh;
  29503. if (mesh.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_LOADED || mesh.delayLoadState === BABYLON.Engine.DELAYLOADSTATE_NONE) {
  29504. serializationObject.meshes.push(serializeMesh(mesh, serializationObject));
  29505. }
  29506. }
  29507. }
  29508. // Particles Systems
  29509. serializationObject.particleSystems = [];
  29510. for (index = 0; index < scene.particleSystems.length; index++) {
  29511. serializationObject.particleSystems.push(serializeParticleSystem(scene.particleSystems[index]));
  29512. }
  29513. // Lens flares
  29514. serializationObject.lensFlareSystems = [];
  29515. for (index = 0; index < scene.lensFlareSystems.length; index++) {
  29516. serializationObject.lensFlareSystems.push(serializeLensFlareSystem(scene.lensFlareSystems[index]));
  29517. }
  29518. // Shadows
  29519. serializationObject.shadowGenerators = [];
  29520. for (index = 0; index < scene.lights.length; index++) {
  29521. light = scene.lights[index];
  29522. if (light.getShadowGenerator()) {
  29523. serializationObject.shadowGenerators.push(serializeShadowGenerator(light));
  29524. }
  29525. }
  29526. return serializationObject;
  29527. };
  29528. SceneSerializer.SerializeMesh = function (toSerialize /* Mesh || Mesh[] */, withParents, withChildren) {
  29529. if (withParents === void 0) { withParents = false; }
  29530. if (withChildren === void 0) { withChildren = false; }
  29531. var serializationObject = {};
  29532. toSerialize = (toSerialize instanceof Array) ? toSerialize : [toSerialize];
  29533. if (withParents || withChildren) {
  29534. //deliberate for loop! not for each, appended should be processed as well.
  29535. for (var i = 0; i < toSerialize.length; ++i) {
  29536. if (withChildren) {
  29537. toSerialize[i].getDescendants().forEach(function (node) {
  29538. if (node instanceof BABYLON.Mesh && (toSerialize.indexOf(node) < 0)) {
  29539. toSerialize.push(node);
  29540. }
  29541. });
  29542. }
  29543. //make sure the array doesn't contain the object already
  29544. if (withParents && toSerialize[i].parent && (toSerialize.indexOf(toSerialize[i].parent) < 0)) {
  29545. toSerialize.push(toSerialize[i].parent);
  29546. }
  29547. }
  29548. }
  29549. toSerialize.forEach(function (mesh) {
  29550. finalizeSingleMesh(mesh, serializationObject);
  29551. });
  29552. return serializationObject;
  29553. };
  29554. return SceneSerializer;
  29555. })();
  29556. BABYLON.SceneSerializer = SceneSerializer;
  29557. })(BABYLON || (BABYLON = {}));
  29558. var BABYLON;
  29559. (function (BABYLON) {
  29560. // Unique ID when we import meshes from Babylon to CSG
  29561. var currentCSGMeshId = 0;
  29562. // # class Vertex
  29563. // Represents a vertex of a polygon. Use your own vertex class instead of this
  29564. // one to provide additional features like texture coordinates and vertex
  29565. // colors. Custom vertex classes need to provide a `pos` property and `clone()`,
  29566. // `flip()`, and `interpolate()` methods that behave analogous to the ones
  29567. // defined by `BABYLON.CSG.Vertex`. This class provides `normal` so convenience
  29568. // functions like `BABYLON.CSG.sphere()` can return a smooth vertex normal, but `normal`
  29569. // is not used anywhere else.
  29570. // Same goes for uv, it allows to keep the original vertex uv coordinates of the 2 meshes
  29571. var Vertex = (function () {
  29572. function Vertex(pos, normal, uv) {
  29573. this.pos = pos;
  29574. this.normal = normal;
  29575. this.uv = uv;
  29576. }
  29577. Vertex.prototype.clone = function () {
  29578. return new Vertex(this.pos.clone(), this.normal.clone(), this.uv.clone());
  29579. };
  29580. // Invert all orientation-specific data (e.g. vertex normal). Called when the
  29581. // orientation of a polygon is flipped.
  29582. Vertex.prototype.flip = function () {
  29583. this.normal = this.normal.scale(-1);
  29584. };
  29585. // Create a new vertex between this vertex and `other` by linearly
  29586. // interpolating all properties using a parameter of `t`. Subclasses should
  29587. // override this to interpolate additional properties.
  29588. Vertex.prototype.interpolate = function (other, t) {
  29589. return new Vertex(BABYLON.Vector3.Lerp(this.pos, other.pos, t), BABYLON.Vector3.Lerp(this.normal, other.normal, t), BABYLON.Vector2.Lerp(this.uv, other.uv, t));
  29590. };
  29591. return Vertex;
  29592. })();
  29593. // # class Plane
  29594. // Represents a plane in 3D space.
  29595. var Plane = (function () {
  29596. function Plane(normal, w) {
  29597. this.normal = normal;
  29598. this.w = w;
  29599. }
  29600. Plane.FromPoints = function (a, b, c) {
  29601. var v0 = c.subtract(a);
  29602. var v1 = b.subtract(a);
  29603. if (v0.lengthSquared() === 0 || v1.lengthSquared() === 0) {
  29604. return null;
  29605. }
  29606. var n = BABYLON.Vector3.Normalize(BABYLON.Vector3.Cross(v0, v1));
  29607. return new Plane(n, BABYLON.Vector3.Dot(n, a));
  29608. };
  29609. Plane.prototype.clone = function () {
  29610. return new Plane(this.normal.clone(), this.w);
  29611. };
  29612. Plane.prototype.flip = function () {
  29613. this.normal.scaleInPlace(-1);
  29614. this.w = -this.w;
  29615. };
  29616. // Split `polygon` by this plane if needed, then put the polygon or polygon
  29617. // fragments in the appropriate lists. Coplanar polygons go into either
  29618. // `coplanarFront` or `coplanarBack` depending on their orientation with
  29619. // respect to this plane. Polygons in front or in back of this plane go into
  29620. // either `front` or `back`.
  29621. Plane.prototype.splitPolygon = function (polygon, coplanarFront, coplanarBack, front, back) {
  29622. var COPLANAR = 0;
  29623. var FRONT = 1;
  29624. var BACK = 2;
  29625. var SPANNING = 3;
  29626. // Classify each point as well as the entire polygon into one of the above
  29627. // four classes.
  29628. var polygonType = 0;
  29629. var types = [];
  29630. var i;
  29631. var t;
  29632. for (i = 0; i < polygon.vertices.length; i++) {
  29633. t = BABYLON.Vector3.Dot(this.normal, polygon.vertices[i].pos) - this.w;
  29634. var type = (t < -Plane.EPSILON) ? BACK : (t > Plane.EPSILON) ? FRONT : COPLANAR;
  29635. polygonType |= type;
  29636. types.push(type);
  29637. }
  29638. // Put the polygon in the correct list, splitting it when necessary.
  29639. switch (polygonType) {
  29640. case COPLANAR:
  29641. (BABYLON.Vector3.Dot(this.normal, polygon.plane.normal) > 0 ? coplanarFront : coplanarBack).push(polygon);
  29642. break;
  29643. case FRONT:
  29644. front.push(polygon);
  29645. break;
  29646. case BACK:
  29647. back.push(polygon);
  29648. break;
  29649. case SPANNING:
  29650. var f = [], b = [];
  29651. for (i = 0; i < polygon.vertices.length; i++) {
  29652. var j = (i + 1) % polygon.vertices.length;
  29653. var ti = types[i], tj = types[j];
  29654. var vi = polygon.vertices[i], vj = polygon.vertices[j];
  29655. if (ti !== BACK)
  29656. f.push(vi);
  29657. if (ti !== FRONT)
  29658. b.push(ti !== BACK ? vi.clone() : vi);
  29659. if ((ti | tj) === SPANNING) {
  29660. t = (this.w - BABYLON.Vector3.Dot(this.normal, vi.pos)) / BABYLON.Vector3.Dot(this.normal, vj.pos.subtract(vi.pos));
  29661. var v = vi.interpolate(vj, t);
  29662. f.push(v);
  29663. b.push(v.clone());
  29664. }
  29665. }
  29666. var poly;
  29667. if (f.length >= 3) {
  29668. poly = new Polygon(f, polygon.shared);
  29669. if (poly.plane)
  29670. front.push(poly);
  29671. }
  29672. if (b.length >= 3) {
  29673. poly = new Polygon(b, polygon.shared);
  29674. if (poly.plane)
  29675. back.push(poly);
  29676. }
  29677. break;
  29678. }
  29679. };
  29680. // `BABYLON.CSG.Plane.EPSILON` is the tolerance used by `splitPolygon()` to decide if a
  29681. // point is on the plane.
  29682. Plane.EPSILON = 1e-5;
  29683. return Plane;
  29684. })();
  29685. // # class Polygon
  29686. // Represents a convex polygon. The vertices used to initialize a polygon must
  29687. // be coplanar and form a convex loop.
  29688. //
  29689. // Each convex polygon has a `shared` property, which is shared between all
  29690. // polygons that are clones of each other or were split from the same polygon.
  29691. // This can be used to define per-polygon properties (such as surface color).
  29692. var Polygon = (function () {
  29693. function Polygon(vertices, shared) {
  29694. this.vertices = vertices;
  29695. this.shared = shared;
  29696. this.plane = Plane.FromPoints(vertices[0].pos, vertices[1].pos, vertices[2].pos);
  29697. }
  29698. Polygon.prototype.clone = function () {
  29699. var vertices = this.vertices.map(function (v) { return v.clone(); });
  29700. return new Polygon(vertices, this.shared);
  29701. };
  29702. Polygon.prototype.flip = function () {
  29703. this.vertices.reverse().map(function (v) { v.flip(); });
  29704. this.plane.flip();
  29705. };
  29706. return Polygon;
  29707. })();
  29708. // # class Node
  29709. // Holds a node in a BSP tree. A BSP tree is built from a collection of polygons
  29710. // by picking a polygon to split along. That polygon (and all other coplanar
  29711. // polygons) are added directly to that node and the other polygons are added to
  29712. // the front and/or back subtrees. This is not a leafy BSP tree since there is
  29713. // no distinction between internal and leaf nodes.
  29714. var Node = (function () {
  29715. function Node(polygons) {
  29716. this.plane = null;
  29717. this.front = null;
  29718. this.back = null;
  29719. this.polygons = [];
  29720. if (polygons) {
  29721. this.build(polygons);
  29722. }
  29723. }
  29724. Node.prototype.clone = function () {
  29725. var node = new Node();
  29726. node.plane = this.plane && this.plane.clone();
  29727. node.front = this.front && this.front.clone();
  29728. node.back = this.back && this.back.clone();
  29729. node.polygons = this.polygons.map(function (p) { return p.clone(); });
  29730. return node;
  29731. };
  29732. // Convert solid space to empty space and empty space to solid space.
  29733. Node.prototype.invert = function () {
  29734. for (var i = 0; i < this.polygons.length; i++) {
  29735. this.polygons[i].flip();
  29736. }
  29737. if (this.plane) {
  29738. this.plane.flip();
  29739. }
  29740. if (this.front) {
  29741. this.front.invert();
  29742. }
  29743. if (this.back) {
  29744. this.back.invert();
  29745. }
  29746. var temp = this.front;
  29747. this.front = this.back;
  29748. this.back = temp;
  29749. };
  29750. // Recursively remove all polygons in `polygons` that are inside this BSP
  29751. // tree.
  29752. Node.prototype.clipPolygons = function (polygons) {
  29753. if (!this.plane)
  29754. return polygons.slice();
  29755. var front = [], back = [];
  29756. for (var i = 0; i < polygons.length; i++) {
  29757. this.plane.splitPolygon(polygons[i], front, back, front, back);
  29758. }
  29759. if (this.front) {
  29760. front = this.front.clipPolygons(front);
  29761. }
  29762. if (this.back) {
  29763. back = this.back.clipPolygons(back);
  29764. }
  29765. else {
  29766. back = [];
  29767. }
  29768. return front.concat(back);
  29769. };
  29770. // Remove all polygons in this BSP tree that are inside the other BSP tree
  29771. // `bsp`.
  29772. Node.prototype.clipTo = function (bsp) {
  29773. this.polygons = bsp.clipPolygons(this.polygons);
  29774. if (this.front)
  29775. this.front.clipTo(bsp);
  29776. if (this.back)
  29777. this.back.clipTo(bsp);
  29778. };
  29779. // Return a list of all polygons in this BSP tree.
  29780. Node.prototype.allPolygons = function () {
  29781. var polygons = this.polygons.slice();
  29782. if (this.front)
  29783. polygons = polygons.concat(this.front.allPolygons());
  29784. if (this.back)
  29785. polygons = polygons.concat(this.back.allPolygons());
  29786. return polygons;
  29787. };
  29788. // Build a BSP tree out of `polygons`. When called on an existing tree, the
  29789. // new polygons are filtered down to the bottom of the tree and become new
  29790. // nodes there. Each set of polygons is partitioned using the first polygon
  29791. // (no heuristic is used to pick a good split).
  29792. Node.prototype.build = function (polygons) {
  29793. if (!polygons.length)
  29794. return;
  29795. if (!this.plane)
  29796. this.plane = polygons[0].plane.clone();
  29797. var front = [], back = [];
  29798. for (var i = 0; i < polygons.length; i++) {
  29799. this.plane.splitPolygon(polygons[i], this.polygons, this.polygons, front, back);
  29800. }
  29801. if (front.length) {
  29802. if (!this.front)
  29803. this.front = new Node();
  29804. this.front.build(front);
  29805. }
  29806. if (back.length) {
  29807. if (!this.back)
  29808. this.back = new Node();
  29809. this.back.build(back);
  29810. }
  29811. };
  29812. return Node;
  29813. })();
  29814. var CSG = (function () {
  29815. function CSG() {
  29816. this.polygons = new Array();
  29817. }
  29818. // Convert BABYLON.Mesh to BABYLON.CSG
  29819. CSG.FromMesh = function (mesh) {
  29820. var vertex, normal, uv, position, polygon, polygons = new Array(), vertices;
  29821. var matrix, meshPosition, meshRotation, meshRotationQuaternion, meshScaling;
  29822. if (mesh instanceof BABYLON.Mesh) {
  29823. mesh.computeWorldMatrix(true);
  29824. matrix = mesh.getWorldMatrix();
  29825. meshPosition = mesh.position.clone();
  29826. meshRotation = mesh.rotation.clone();
  29827. if (mesh.rotationQuaternion) {
  29828. meshRotationQuaternion = mesh.rotationQuaternion.clone();
  29829. }
  29830. meshScaling = mesh.scaling.clone();
  29831. }
  29832. else {
  29833. throw 'BABYLON.CSG: Wrong Mesh type, must be BABYLON.Mesh';
  29834. }
  29835. var indices = mesh.getIndices(), positions = mesh.getVerticesData(BABYLON.VertexBuffer.PositionKind), normals = mesh.getVerticesData(BABYLON.VertexBuffer.NormalKind), uvs = mesh.getVerticesData(BABYLON.VertexBuffer.UVKind);
  29836. var subMeshes = mesh.subMeshes;
  29837. for (var sm = 0, sml = subMeshes.length; sm < sml; sm++) {
  29838. for (var i = subMeshes[sm].indexStart, il = subMeshes[sm].indexCount + subMeshes[sm].indexStart; i < il; i += 3) {
  29839. vertices = [];
  29840. for (var j = 0; j < 3; j++) {
  29841. var sourceNormal = new BABYLON.Vector3(normals[indices[i + j] * 3], normals[indices[i + j] * 3 + 1], normals[indices[i + j] * 3 + 2]);
  29842. uv = new BABYLON.Vector2(uvs[indices[i + j] * 2], uvs[indices[i + j] * 2 + 1]);
  29843. var sourcePosition = new BABYLON.Vector3(positions[indices[i + j] * 3], positions[indices[i + j] * 3 + 1], positions[indices[i + j] * 3 + 2]);
  29844. position = BABYLON.Vector3.TransformCoordinates(sourcePosition, matrix);
  29845. normal = BABYLON.Vector3.TransformNormal(sourceNormal, matrix);
  29846. vertex = new Vertex(position, normal, uv);
  29847. vertices.push(vertex);
  29848. }
  29849. polygon = new Polygon(vertices, { subMeshId: sm, meshId: currentCSGMeshId, materialIndex: subMeshes[sm].materialIndex });
  29850. // To handle the case of degenerated triangle
  29851. // polygon.plane == null <=> the polygon does not represent 1 single plane <=> the triangle is degenerated
  29852. if (polygon.plane)
  29853. polygons.push(polygon);
  29854. }
  29855. }
  29856. var csg = CSG.FromPolygons(polygons);
  29857. csg.matrix = matrix;
  29858. csg.position = meshPosition;
  29859. csg.rotation = meshRotation;
  29860. csg.scaling = meshScaling;
  29861. csg.rotationQuaternion = meshRotationQuaternion;
  29862. currentCSGMeshId++;
  29863. return csg;
  29864. };
  29865. // Construct a BABYLON.CSG solid from a list of `BABYLON.CSG.Polygon` instances.
  29866. CSG.FromPolygons = function (polygons) {
  29867. var csg = new CSG();
  29868. csg.polygons = polygons;
  29869. return csg;
  29870. };
  29871. CSG.prototype.clone = function () {
  29872. var csg = new CSG();
  29873. csg.polygons = this.polygons.map(function (p) { return p.clone(); });
  29874. csg.copyTransformAttributes(this);
  29875. return csg;
  29876. };
  29877. CSG.prototype.toPolygons = function () {
  29878. return this.polygons;
  29879. };
  29880. CSG.prototype.union = function (csg) {
  29881. var a = new Node(this.clone().polygons);
  29882. var b = new Node(csg.clone().polygons);
  29883. a.clipTo(b);
  29884. b.clipTo(a);
  29885. b.invert();
  29886. b.clipTo(a);
  29887. b.invert();
  29888. a.build(b.allPolygons());
  29889. return CSG.FromPolygons(a.allPolygons()).copyTransformAttributes(this);
  29890. };
  29891. CSG.prototype.unionInPlace = function (csg) {
  29892. var a = new Node(this.polygons);
  29893. var b = new Node(csg.polygons);
  29894. a.clipTo(b);
  29895. b.clipTo(a);
  29896. b.invert();
  29897. b.clipTo(a);
  29898. b.invert();
  29899. a.build(b.allPolygons());
  29900. this.polygons = a.allPolygons();
  29901. };
  29902. CSG.prototype.subtract = function (csg) {
  29903. var a = new Node(this.clone().polygons);
  29904. var b = new Node(csg.clone().polygons);
  29905. a.invert();
  29906. a.clipTo(b);
  29907. b.clipTo(a);
  29908. b.invert();
  29909. b.clipTo(a);
  29910. b.invert();
  29911. a.build(b.allPolygons());
  29912. a.invert();
  29913. return CSG.FromPolygons(a.allPolygons()).copyTransformAttributes(this);
  29914. };
  29915. CSG.prototype.subtractInPlace = function (csg) {
  29916. var a = new Node(this.polygons);
  29917. var b = new Node(csg.polygons);
  29918. a.invert();
  29919. a.clipTo(b);
  29920. b.clipTo(a);
  29921. b.invert();
  29922. b.clipTo(a);
  29923. b.invert();
  29924. a.build(b.allPolygons());
  29925. a.invert();
  29926. this.polygons = a.allPolygons();
  29927. };
  29928. CSG.prototype.intersect = function (csg) {
  29929. var a = new Node(this.clone().polygons);
  29930. var b = new Node(csg.clone().polygons);
  29931. a.invert();
  29932. b.clipTo(a);
  29933. b.invert();
  29934. a.clipTo(b);
  29935. b.clipTo(a);
  29936. a.build(b.allPolygons());
  29937. a.invert();
  29938. return CSG.FromPolygons(a.allPolygons()).copyTransformAttributes(this);
  29939. };
  29940. CSG.prototype.intersectInPlace = function (csg) {
  29941. var a = new Node(this.polygons);
  29942. var b = new Node(csg.polygons);
  29943. a.invert();
  29944. b.clipTo(a);
  29945. b.invert();
  29946. a.clipTo(b);
  29947. b.clipTo(a);
  29948. a.build(b.allPolygons());
  29949. a.invert();
  29950. this.polygons = a.allPolygons();
  29951. };
  29952. // Return a new BABYLON.CSG solid with solid and empty space switched. This solid is
  29953. // not modified.
  29954. CSG.prototype.inverse = function () {
  29955. var csg = this.clone();
  29956. csg.inverseInPlace();
  29957. return csg;
  29958. };
  29959. CSG.prototype.inverseInPlace = function () {
  29960. this.polygons.map(function (p) { p.flip(); });
  29961. };
  29962. // This is used to keep meshes transformations so they can be restored
  29963. // when we build back a Babylon Mesh
  29964. // NB : All CSG operations are performed in world coordinates
  29965. CSG.prototype.copyTransformAttributes = function (csg) {
  29966. this.matrix = csg.matrix;
  29967. this.position = csg.position;
  29968. this.rotation = csg.rotation;
  29969. this.scaling = csg.scaling;
  29970. this.rotationQuaternion = csg.rotationQuaternion;
  29971. return this;
  29972. };
  29973. // Build Raw mesh from CSG
  29974. // Coordinates here are in world space
  29975. CSG.prototype.buildMeshGeometry = function (name, scene, keepSubMeshes) {
  29976. var matrix = this.matrix.clone();
  29977. matrix.invert();
  29978. var mesh = new BABYLON.Mesh(name, scene), vertices = [], indices = [], normals = [], uvs = [], vertex = BABYLON.Vector3.Zero(), normal = BABYLON.Vector3.Zero(), uv = BABYLON.Vector2.Zero(), polygons = this.polygons, polygonIndices = [0, 0, 0], polygon, vertice_dict = {}, vertex_idx, currentIndex = 0, subMesh_dict = {}, subMesh_obj;
  29979. if (keepSubMeshes) {
  29980. // Sort Polygons, since subMeshes are indices range
  29981. polygons.sort(function (a, b) {
  29982. if (a.shared.meshId === b.shared.meshId) {
  29983. return a.shared.subMeshId - b.shared.subMeshId;
  29984. }
  29985. else {
  29986. return a.shared.meshId - b.shared.meshId;
  29987. }
  29988. });
  29989. }
  29990. for (var i = 0, il = polygons.length; i < il; i++) {
  29991. polygon = polygons[i];
  29992. // Building SubMeshes
  29993. if (!subMesh_dict[polygon.shared.meshId]) {
  29994. subMesh_dict[polygon.shared.meshId] = {};
  29995. }
  29996. if (!subMesh_dict[polygon.shared.meshId][polygon.shared.subMeshId]) {
  29997. subMesh_dict[polygon.shared.meshId][polygon.shared.subMeshId] = {
  29998. indexStart: +Infinity,
  29999. indexEnd: -Infinity,
  30000. materialIndex: polygon.shared.materialIndex
  30001. };
  30002. }
  30003. subMesh_obj = subMesh_dict[polygon.shared.meshId][polygon.shared.subMeshId];
  30004. for (var j = 2, jl = polygon.vertices.length; j < jl; j++) {
  30005. polygonIndices[0] = 0;
  30006. polygonIndices[1] = j - 1;
  30007. polygonIndices[2] = j;
  30008. for (var k = 0; k < 3; k++) {
  30009. vertex.copyFrom(polygon.vertices[polygonIndices[k]].pos);
  30010. normal.copyFrom(polygon.vertices[polygonIndices[k]].normal);
  30011. uv.copyFrom(polygon.vertices[polygonIndices[k]].uv);
  30012. var localVertex = BABYLON.Vector3.TransformCoordinates(vertex, matrix);
  30013. var localNormal = BABYLON.Vector3.TransformNormal(normal, matrix);
  30014. vertex_idx = vertice_dict[localVertex.x + ',' + localVertex.y + ',' + localVertex.z];
  30015. // Check if 2 points can be merged
  30016. if (!(typeof vertex_idx !== 'undefined' &&
  30017. normals[vertex_idx * 3] === localNormal.x &&
  30018. normals[vertex_idx * 3 + 1] === localNormal.y &&
  30019. normals[vertex_idx * 3 + 2] === localNormal.z &&
  30020. uvs[vertex_idx * 2] === uv.x &&
  30021. uvs[vertex_idx * 2 + 1] === uv.y)) {
  30022. vertices.push(localVertex.x, localVertex.y, localVertex.z);
  30023. uvs.push(uv.x, uv.y);
  30024. normals.push(normal.x, normal.y, normal.z);
  30025. vertex_idx = vertice_dict[localVertex.x + ',' + localVertex.y + ',' + localVertex.z] = (vertices.length / 3) - 1;
  30026. }
  30027. indices.push(vertex_idx);
  30028. subMesh_obj.indexStart = Math.min(currentIndex, subMesh_obj.indexStart);
  30029. subMesh_obj.indexEnd = Math.max(currentIndex, subMesh_obj.indexEnd);
  30030. currentIndex++;
  30031. }
  30032. }
  30033. }
  30034. mesh.setVerticesData(BABYLON.VertexBuffer.PositionKind, vertices);
  30035. mesh.setVerticesData(BABYLON.VertexBuffer.NormalKind, normals);
  30036. mesh.setVerticesData(BABYLON.VertexBuffer.UVKind, uvs);
  30037. mesh.setIndices(indices);
  30038. if (keepSubMeshes) {
  30039. // We offset the materialIndex by the previous number of materials in the CSG mixed meshes
  30040. var materialIndexOffset = 0, materialMaxIndex;
  30041. mesh.subMeshes = new Array();
  30042. for (var m in subMesh_dict) {
  30043. materialMaxIndex = -1;
  30044. for (var sm in subMesh_dict[m]) {
  30045. subMesh_obj = subMesh_dict[m][sm];
  30046. BABYLON.SubMesh.CreateFromIndices(subMesh_obj.materialIndex + materialIndexOffset, subMesh_obj.indexStart, subMesh_obj.indexEnd - subMesh_obj.indexStart + 1, mesh);
  30047. materialMaxIndex = Math.max(subMesh_obj.materialIndex, materialMaxIndex);
  30048. }
  30049. materialIndexOffset += ++materialMaxIndex;
  30050. }
  30051. }
  30052. return mesh;
  30053. };
  30054. // Build Mesh from CSG taking material and transforms into account
  30055. CSG.prototype.toMesh = function (name, material, scene, keepSubMeshes) {
  30056. var mesh = this.buildMeshGeometry(name, scene, keepSubMeshes);
  30057. mesh.material = material;
  30058. mesh.position.copyFrom(this.position);
  30059. mesh.rotation.copyFrom(this.rotation);
  30060. if (this.rotationQuaternion) {
  30061. mesh.rotationQuaternion = this.rotationQuaternion.clone();
  30062. }
  30063. mesh.scaling.copyFrom(this.scaling);
  30064. mesh.computeWorldMatrix(true);
  30065. return mesh;
  30066. };
  30067. return CSG;
  30068. })();
  30069. BABYLON.CSG = CSG;
  30070. })(BABYLON || (BABYLON = {}));
  30071. var BABYLON;
  30072. (function (BABYLON) {
  30073. var VRDistortionCorrectionPostProcess = (function (_super) {
  30074. __extends(VRDistortionCorrectionPostProcess, _super);
  30075. //ANY
  30076. function VRDistortionCorrectionPostProcess(name, camera, isRightEye, vrMetrics) {
  30077. var _this = this;
  30078. _super.call(this, name, "vrDistortionCorrection", [
  30079. 'LensCenter',
  30080. 'Scale',
  30081. 'ScaleIn',
  30082. 'HmdWarpParam'
  30083. ], null, vrMetrics.postProcessScaleFactor, camera, BABYLON.Texture.BILINEAR_SAMPLINGMODE, null, null);
  30084. this._isRightEye = isRightEye;
  30085. this._distortionFactors = vrMetrics.distortionK;
  30086. this._postProcessScaleFactor = vrMetrics.postProcessScaleFactor;
  30087. this._lensCenterOffset = vrMetrics.lensCenterOffset;
  30088. this.onSizeChanged = function () {
  30089. _this.aspectRatio = _this.width * .5 / _this.height;
  30090. _this._scaleIn = new BABYLON.Vector2(2, 2 / _this.aspectRatio);
  30091. _this._scaleFactor = new BABYLON.Vector2(.5 * (1 / _this._postProcessScaleFactor), .5 * (1 / _this._postProcessScaleFactor) * _this.aspectRatio);
  30092. _this._lensCenter = new BABYLON.Vector2(_this._isRightEye ? 0.5 - _this._lensCenterOffset * 0.5 : 0.5 + _this._lensCenterOffset * 0.5, 0.5);
  30093. };
  30094. this.onApply = function (effect) {
  30095. effect.setFloat2("LensCenter", _this._lensCenter.x, _this._lensCenter.y);
  30096. effect.setFloat2("Scale", _this._scaleFactor.x, _this._scaleFactor.y);
  30097. effect.setFloat2("ScaleIn", _this._scaleIn.x, _this._scaleIn.y);
  30098. effect.setFloat4("HmdWarpParam", _this._distortionFactors[0], _this._distortionFactors[1], _this._distortionFactors[2], _this._distortionFactors[3]);
  30099. };
  30100. }
  30101. return VRDistortionCorrectionPostProcess;
  30102. })(BABYLON.PostProcess);
  30103. BABYLON.VRDistortionCorrectionPostProcess = VRDistortionCorrectionPostProcess;
  30104. })(BABYLON || (BABYLON = {}));
  30105. // Mainly based on these 2 articles :
  30106. // Creating an universal virtual touch joystick working for all Touch models thanks to Hand.JS : http://blogs.msdn.com/b/davrous/archive/2013/02/22/creating-an-universal-virtual-touch-joystick-working-for-all-touch-models-thanks-to-hand-js.aspx
  30107. // & on Seb Lee-Delisle original work: http://seb.ly/2011/04/multi-touch-game-controller-in-javascripthtml5-for-ipad/
  30108. var BABYLON;
  30109. (function (BABYLON) {
  30110. (function (JoystickAxis) {
  30111. JoystickAxis[JoystickAxis["X"] = 0] = "X";
  30112. JoystickAxis[JoystickAxis["Y"] = 1] = "Y";
  30113. JoystickAxis[JoystickAxis["Z"] = 2] = "Z";
  30114. })(BABYLON.JoystickAxis || (BABYLON.JoystickAxis = {}));
  30115. var JoystickAxis = BABYLON.JoystickAxis;
  30116. var VirtualJoystick = (function () {
  30117. function VirtualJoystick(leftJoystick) {
  30118. var _this = this;
  30119. if (leftJoystick) {
  30120. this._leftJoystick = true;
  30121. }
  30122. else {
  30123. this._leftJoystick = false;
  30124. }
  30125. this._joystickIndex = VirtualJoystick._globalJoystickIndex;
  30126. VirtualJoystick._globalJoystickIndex++;
  30127. // By default left & right arrow keys are moving the X
  30128. // and up & down keys are moving the Y
  30129. this._axisTargetedByLeftAndRight = JoystickAxis.X;
  30130. this._axisTargetedByUpAndDown = JoystickAxis.Y;
  30131. this.reverseLeftRight = false;
  30132. this.reverseUpDown = false;
  30133. // collections of pointers
  30134. this._touches = new BABYLON.SmartCollection();
  30135. this.deltaPosition = BABYLON.Vector3.Zero();
  30136. this._joystickSensibility = 25;
  30137. this._inversedSensibility = 1 / (this._joystickSensibility / 1000);
  30138. this._rotationSpeed = 25;
  30139. this._inverseRotationSpeed = 1 / (this._rotationSpeed / 1000);
  30140. this._rotateOnAxisRelativeToMesh = false;
  30141. this._onResize = function (evt) {
  30142. VirtualJoystick.vjCanvasWidth = window.innerWidth;
  30143. VirtualJoystick.vjCanvasHeight = window.innerHeight;
  30144. VirtualJoystick.vjCanvas.width = VirtualJoystick.vjCanvasWidth;
  30145. VirtualJoystick.vjCanvas.height = VirtualJoystick.vjCanvasHeight;
  30146. VirtualJoystick.halfWidth = VirtualJoystick.vjCanvasWidth / 2;
  30147. VirtualJoystick.halfHeight = VirtualJoystick.vjCanvasHeight / 2;
  30148. };
  30149. // injecting a canvas element on top of the canvas 3D game
  30150. if (!VirtualJoystick.vjCanvas) {
  30151. window.addEventListener("resize", this._onResize, false);
  30152. VirtualJoystick.vjCanvas = document.createElement("canvas");
  30153. VirtualJoystick.vjCanvasWidth = window.innerWidth;
  30154. VirtualJoystick.vjCanvasHeight = window.innerHeight;
  30155. VirtualJoystick.vjCanvas.width = window.innerWidth;
  30156. VirtualJoystick.vjCanvas.height = window.innerHeight;
  30157. VirtualJoystick.vjCanvas.style.width = "100%";
  30158. VirtualJoystick.vjCanvas.style.height = "100%";
  30159. VirtualJoystick.vjCanvas.style.position = "absolute";
  30160. VirtualJoystick.vjCanvas.style.backgroundColor = "transparent";
  30161. VirtualJoystick.vjCanvas.style.top = "0px";
  30162. VirtualJoystick.vjCanvas.style.left = "0px";
  30163. VirtualJoystick.vjCanvas.style.zIndex = "5";
  30164. VirtualJoystick.vjCanvas.style.msTouchAction = "none";
  30165. // Support for jQuery PEP polyfill
  30166. VirtualJoystick.vjCanvas.setAttribute("touch-action", "none");
  30167. VirtualJoystick.vjCanvasContext = VirtualJoystick.vjCanvas.getContext('2d');
  30168. VirtualJoystick.vjCanvasContext.strokeStyle = "#ffffff";
  30169. VirtualJoystick.vjCanvasContext.lineWidth = 2;
  30170. document.body.appendChild(VirtualJoystick.vjCanvas);
  30171. }
  30172. VirtualJoystick.halfWidth = VirtualJoystick.vjCanvas.width / 2;
  30173. VirtualJoystick.halfHeight = VirtualJoystick.vjCanvas.height / 2;
  30174. this.pressed = false;
  30175. // default joystick color
  30176. this._joystickColor = "cyan";
  30177. this._joystickPointerID = -1;
  30178. // current joystick position
  30179. this._joystickPointerPos = new BABYLON.Vector2(0, 0);
  30180. this._joystickPreviousPointerPos = new BABYLON.Vector2(0, 0);
  30181. // origin joystick position
  30182. this._joystickPointerStartPos = new BABYLON.Vector2(0, 0);
  30183. this._deltaJoystickVector = new BABYLON.Vector2(0, 0);
  30184. this._onPointerDownHandlerRef = function (evt) {
  30185. _this._onPointerDown(evt);
  30186. };
  30187. this._onPointerMoveHandlerRef = function (evt) {
  30188. _this._onPointerMove(evt);
  30189. };
  30190. this._onPointerOutHandlerRef = function (evt) {
  30191. _this._onPointerUp(evt);
  30192. };
  30193. this._onPointerUpHandlerRef = function (evt) {
  30194. _this._onPointerUp(evt);
  30195. };
  30196. VirtualJoystick.vjCanvas.addEventListener('pointerdown', this._onPointerDownHandlerRef, false);
  30197. VirtualJoystick.vjCanvas.addEventListener('pointermove', this._onPointerMoveHandlerRef, false);
  30198. VirtualJoystick.vjCanvas.addEventListener('pointerup', this._onPointerUpHandlerRef, false);
  30199. VirtualJoystick.vjCanvas.addEventListener('pointerout', this._onPointerUpHandlerRef, false);
  30200. VirtualJoystick.vjCanvas.addEventListener("contextmenu", function (evt) {
  30201. evt.preventDefault(); // Disables system menu
  30202. }, false);
  30203. requestAnimationFrame(function () { _this._drawVirtualJoystick(); });
  30204. }
  30205. VirtualJoystick.prototype.setJoystickSensibility = function (newJoystickSensibility) {
  30206. this._joystickSensibility = newJoystickSensibility;
  30207. this._inversedSensibility = 1 / (this._joystickSensibility / 1000);
  30208. };
  30209. VirtualJoystick.prototype._onPointerDown = function (e) {
  30210. var positionOnScreenCondition;
  30211. e.preventDefault();
  30212. if (this._leftJoystick === true) {
  30213. positionOnScreenCondition = (e.clientX < VirtualJoystick.halfWidth);
  30214. }
  30215. else {
  30216. positionOnScreenCondition = (e.clientX > VirtualJoystick.halfWidth);
  30217. }
  30218. if (positionOnScreenCondition && this._joystickPointerID < 0) {
  30219. // First contact will be dedicated to the virtual joystick
  30220. this._joystickPointerID = e.pointerId;
  30221. this._joystickPointerStartPos.x = e.clientX;
  30222. this._joystickPointerStartPos.y = e.clientY;
  30223. this._joystickPointerPos = this._joystickPointerStartPos.clone();
  30224. this._joystickPreviousPointerPos = this._joystickPointerStartPos.clone();
  30225. this._deltaJoystickVector.x = 0;
  30226. this._deltaJoystickVector.y = 0;
  30227. this.pressed = true;
  30228. this._touches.add(e.pointerId.toString(), e);
  30229. }
  30230. else {
  30231. // You can only trigger the action buttons with a joystick declared
  30232. if (VirtualJoystick._globalJoystickIndex < 2 && this._action) {
  30233. this._action();
  30234. this._touches.add(e.pointerId.toString(), { x: e.clientX, y: e.clientY, prevX: e.clientX, prevY: e.clientY });
  30235. }
  30236. }
  30237. };
  30238. VirtualJoystick.prototype._onPointerMove = function (e) {
  30239. // If the current pointer is the one associated to the joystick (first touch contact)
  30240. if (this._joystickPointerID == e.pointerId) {
  30241. this._joystickPointerPos.x = e.clientX;
  30242. this._joystickPointerPos.y = e.clientY;
  30243. this._deltaJoystickVector = this._joystickPointerPos.clone();
  30244. this._deltaJoystickVector = this._deltaJoystickVector.subtract(this._joystickPointerStartPos);
  30245. var directionLeftRight = this.reverseLeftRight ? -1 : 1;
  30246. var deltaJoystickX = directionLeftRight * this._deltaJoystickVector.x / this._inversedSensibility;
  30247. switch (this._axisTargetedByLeftAndRight) {
  30248. case JoystickAxis.X:
  30249. this.deltaPosition.x = Math.min(1, Math.max(-1, deltaJoystickX));
  30250. break;
  30251. case JoystickAxis.Y:
  30252. this.deltaPosition.y = Math.min(1, Math.max(-1, deltaJoystickX));
  30253. break;
  30254. case JoystickAxis.Z:
  30255. this.deltaPosition.z = Math.min(1, Math.max(-1, deltaJoystickX));
  30256. break;
  30257. }
  30258. var directionUpDown = this.reverseUpDown ? 1 : -1;
  30259. var deltaJoystickY = directionUpDown * this._deltaJoystickVector.y / this._inversedSensibility;
  30260. switch (this._axisTargetedByUpAndDown) {
  30261. case JoystickAxis.X:
  30262. this.deltaPosition.x = Math.min(1, Math.max(-1, deltaJoystickY));
  30263. break;
  30264. case JoystickAxis.Y:
  30265. this.deltaPosition.y = Math.min(1, Math.max(-1, deltaJoystickY));
  30266. break;
  30267. case JoystickAxis.Z:
  30268. this.deltaPosition.z = Math.min(1, Math.max(-1, deltaJoystickY));
  30269. break;
  30270. }
  30271. }
  30272. else {
  30273. if (this._touches.item(e.pointerId.toString())) {
  30274. this._touches.item(e.pointerId.toString()).x = e.clientX;
  30275. this._touches.item(e.pointerId.toString()).y = e.clientY;
  30276. }
  30277. }
  30278. };
  30279. VirtualJoystick.prototype._onPointerUp = function (e) {
  30280. if (this._joystickPointerID == e.pointerId) {
  30281. VirtualJoystick.vjCanvasContext.clearRect(this._joystickPointerStartPos.x - 63, this._joystickPointerStartPos.y - 63, 126, 126);
  30282. VirtualJoystick.vjCanvasContext.clearRect(this._joystickPreviousPointerPos.x - 41, this._joystickPreviousPointerPos.y - 41, 82, 82);
  30283. this._joystickPointerID = -1;
  30284. this.pressed = false;
  30285. }
  30286. else {
  30287. var touch = this._touches.item(e.pointerId.toString());
  30288. if (touch) {
  30289. VirtualJoystick.vjCanvasContext.clearRect(touch.prevX - 43, touch.prevY - 43, 86, 86);
  30290. }
  30291. }
  30292. this._deltaJoystickVector.x = 0;
  30293. this._deltaJoystickVector.y = 0;
  30294. this._touches.remove(e.pointerId.toString());
  30295. };
  30296. /**
  30297. * Change the color of the virtual joystick
  30298. * @param newColor a string that must be a CSS color value (like "red") or the hexa value (like "#FF0000")
  30299. */
  30300. VirtualJoystick.prototype.setJoystickColor = function (newColor) {
  30301. this._joystickColor = newColor;
  30302. };
  30303. VirtualJoystick.prototype.setActionOnTouch = function (action) {
  30304. this._action = action;
  30305. };
  30306. // Define which axis you'd like to control for left & right
  30307. VirtualJoystick.prototype.setAxisForLeftRight = function (axis) {
  30308. switch (axis) {
  30309. case JoystickAxis.X:
  30310. case JoystickAxis.Y:
  30311. case JoystickAxis.Z:
  30312. this._axisTargetedByLeftAndRight = axis;
  30313. break;
  30314. default:
  30315. this._axisTargetedByLeftAndRight = JoystickAxis.X;
  30316. break;
  30317. }
  30318. };
  30319. // Define which axis you'd like to control for up & down
  30320. VirtualJoystick.prototype.setAxisForUpDown = function (axis) {
  30321. switch (axis) {
  30322. case JoystickAxis.X:
  30323. case JoystickAxis.Y:
  30324. case JoystickAxis.Z:
  30325. this._axisTargetedByUpAndDown = axis;
  30326. break;
  30327. default:
  30328. this._axisTargetedByUpAndDown = JoystickAxis.Y;
  30329. break;
  30330. }
  30331. };
  30332. VirtualJoystick.prototype._clearCanvas = function () {
  30333. if (this._leftJoystick) {
  30334. VirtualJoystick.vjCanvasContext.clearRect(0, 0, VirtualJoystick.vjCanvasWidth / 2, VirtualJoystick.vjCanvasHeight);
  30335. }
  30336. else {
  30337. VirtualJoystick.vjCanvasContext.clearRect(VirtualJoystick.vjCanvasWidth / 2, 0, VirtualJoystick.vjCanvasWidth, VirtualJoystick.vjCanvasHeight);
  30338. }
  30339. };
  30340. VirtualJoystick.prototype._drawVirtualJoystick = function () {
  30341. var _this = this;
  30342. if (this.pressed) {
  30343. this._touches.forEach(function (touch) {
  30344. if (touch.pointerId === _this._joystickPointerID) {
  30345. VirtualJoystick.vjCanvasContext.clearRect(_this._joystickPointerStartPos.x - 63, _this._joystickPointerStartPos.y - 63, 126, 126);
  30346. VirtualJoystick.vjCanvasContext.clearRect(_this._joystickPreviousPointerPos.x - 41, _this._joystickPreviousPointerPos.y - 41, 82, 82);
  30347. VirtualJoystick.vjCanvasContext.beginPath();
  30348. VirtualJoystick.vjCanvasContext.lineWidth = 6;
  30349. VirtualJoystick.vjCanvasContext.strokeStyle = _this._joystickColor;
  30350. VirtualJoystick.vjCanvasContext.arc(_this._joystickPointerStartPos.x, _this._joystickPointerStartPos.y, 40, 0, Math.PI * 2, true);
  30351. VirtualJoystick.vjCanvasContext.stroke();
  30352. VirtualJoystick.vjCanvasContext.closePath();
  30353. VirtualJoystick.vjCanvasContext.beginPath();
  30354. VirtualJoystick.vjCanvasContext.strokeStyle = _this._joystickColor;
  30355. VirtualJoystick.vjCanvasContext.lineWidth = 2;
  30356. VirtualJoystick.vjCanvasContext.arc(_this._joystickPointerStartPos.x, _this._joystickPointerStartPos.y, 60, 0, Math.PI * 2, true);
  30357. VirtualJoystick.vjCanvasContext.stroke();
  30358. VirtualJoystick.vjCanvasContext.closePath();
  30359. VirtualJoystick.vjCanvasContext.beginPath();
  30360. VirtualJoystick.vjCanvasContext.strokeStyle = _this._joystickColor;
  30361. VirtualJoystick.vjCanvasContext.arc(_this._joystickPointerPos.x, _this._joystickPointerPos.y, 40, 0, Math.PI * 2, true);
  30362. VirtualJoystick.vjCanvasContext.stroke();
  30363. VirtualJoystick.vjCanvasContext.closePath();
  30364. _this._joystickPreviousPointerPos = _this._joystickPointerPos.clone();
  30365. }
  30366. else {
  30367. VirtualJoystick.vjCanvasContext.clearRect(touch.prevX - 43, touch.prevY - 43, 86, 86);
  30368. VirtualJoystick.vjCanvasContext.beginPath();
  30369. VirtualJoystick.vjCanvasContext.fillStyle = "white";
  30370. VirtualJoystick.vjCanvasContext.beginPath();
  30371. VirtualJoystick.vjCanvasContext.strokeStyle = "red";
  30372. VirtualJoystick.vjCanvasContext.lineWidth = 6;
  30373. VirtualJoystick.vjCanvasContext.arc(touch.x, touch.y, 40, 0, Math.PI * 2, true);
  30374. VirtualJoystick.vjCanvasContext.stroke();
  30375. VirtualJoystick.vjCanvasContext.closePath();
  30376. touch.prevX = touch.x;
  30377. touch.prevY = touch.y;
  30378. }
  30379. ;
  30380. });
  30381. }
  30382. requestAnimationFrame(function () { _this._drawVirtualJoystick(); });
  30383. };
  30384. VirtualJoystick.prototype.releaseCanvas = function () {
  30385. if (VirtualJoystick.vjCanvas) {
  30386. VirtualJoystick.vjCanvas.removeEventListener('pointerdown', this._onPointerDownHandlerRef);
  30387. VirtualJoystick.vjCanvas.removeEventListener('pointermove', this._onPointerMoveHandlerRef);
  30388. VirtualJoystick.vjCanvas.removeEventListener('pointerup', this._onPointerUpHandlerRef);
  30389. VirtualJoystick.vjCanvas.removeEventListener('pointerout', this._onPointerUpHandlerRef);
  30390. window.removeEventListener("resize", this._onResize);
  30391. document.body.removeChild(VirtualJoystick.vjCanvas);
  30392. VirtualJoystick.vjCanvas = null;
  30393. }
  30394. };
  30395. // Used to draw the virtual joystick inside a 2D canvas on top of the WebGL rendering canvas
  30396. VirtualJoystick._globalJoystickIndex = 0;
  30397. return VirtualJoystick;
  30398. })();
  30399. BABYLON.VirtualJoystick = VirtualJoystick;
  30400. })(BABYLON || (BABYLON = {}));
  30401. var BABYLON;
  30402. (function (BABYLON) {
  30403. // We're mainly based on the logic defined into the FreeCamera code
  30404. var VirtualJoysticksCamera = (function (_super) {
  30405. __extends(VirtualJoysticksCamera, _super);
  30406. function VirtualJoysticksCamera(name, position, scene) {
  30407. _super.call(this, name, position, scene);
  30408. this._leftjoystick = new BABYLON.VirtualJoystick(true);
  30409. this._leftjoystick.setAxisForUpDown(BABYLON.JoystickAxis.Z);
  30410. this._leftjoystick.setAxisForLeftRight(BABYLON.JoystickAxis.X);
  30411. this._leftjoystick.setJoystickSensibility(0.15);
  30412. this._rightjoystick = new BABYLON.VirtualJoystick(false);
  30413. this._rightjoystick.setAxisForUpDown(BABYLON.JoystickAxis.X);
  30414. this._rightjoystick.setAxisForLeftRight(BABYLON.JoystickAxis.Y);
  30415. this._rightjoystick.reverseUpDown = true;
  30416. this._rightjoystick.setJoystickSensibility(0.05);
  30417. this._rightjoystick.setJoystickColor("yellow");
  30418. }
  30419. VirtualJoysticksCamera.prototype.getLeftJoystick = function () {
  30420. return this._leftjoystick;
  30421. };
  30422. VirtualJoysticksCamera.prototype.getRightJoystick = function () {
  30423. return this._rightjoystick;
  30424. };
  30425. VirtualJoysticksCamera.prototype._checkInputs = function () {
  30426. var speed = this._computeLocalCameraSpeed() * 50;
  30427. var cameraTransform = BABYLON.Matrix.RotationYawPitchRoll(this.rotation.y, this.rotation.x, 0);
  30428. var deltaTransform = BABYLON.Vector3.TransformCoordinates(new BABYLON.Vector3(this._leftjoystick.deltaPosition.x * speed, this._leftjoystick.deltaPosition.y * speed, this._leftjoystick.deltaPosition.z * speed), cameraTransform);
  30429. this.cameraDirection = this.cameraDirection.add(deltaTransform);
  30430. this.cameraRotation = this.cameraRotation.addVector3(this._rightjoystick.deltaPosition);
  30431. if (!this._leftjoystick.pressed) {
  30432. this._leftjoystick.deltaPosition = this._leftjoystick.deltaPosition.scale(0.9);
  30433. }
  30434. if (!this._rightjoystick.pressed) {
  30435. this._rightjoystick.deltaPosition = this._rightjoystick.deltaPosition.scale(0.9);
  30436. }
  30437. _super.prototype._checkInputs.call(this);
  30438. };
  30439. VirtualJoysticksCamera.prototype.dispose = function () {
  30440. this._leftjoystick.releaseCanvas();
  30441. _super.prototype.dispose.call(this);
  30442. };
  30443. return VirtualJoysticksCamera;
  30444. })(BABYLON.FreeCamera);
  30445. BABYLON.VirtualJoysticksCamera = VirtualJoysticksCamera;
  30446. })(BABYLON || (BABYLON = {}));
  30447. var BABYLON;
  30448. (function (BABYLON) {
  30449. var AnaglyphPostProcess = (function (_super) {
  30450. __extends(AnaglyphPostProcess, _super);
  30451. function AnaglyphPostProcess(name, ratio, camera, samplingMode, engine, reusable) {
  30452. _super.call(this, name, "anaglyph", null, ["leftSampler"], ratio, camera, samplingMode, engine, reusable);
  30453. }
  30454. return AnaglyphPostProcess;
  30455. })(BABYLON.PostProcess);
  30456. BABYLON.AnaglyphPostProcess = AnaglyphPostProcess;
  30457. })(BABYLON || (BABYLON = {}));
  30458. var BABYLON;
  30459. (function (BABYLON) {
  30460. var OutlineRenderer = (function () {
  30461. function OutlineRenderer(scene) {
  30462. this._scene = scene;
  30463. }
  30464. OutlineRenderer.prototype.render = function (subMesh, batch, useOverlay) {
  30465. var _this = this;
  30466. if (useOverlay === void 0) { useOverlay = false; }
  30467. var scene = this._scene;
  30468. var engine = this._scene.getEngine();
  30469. var hardwareInstancedRendering = (engine.getCaps().instancedArrays !== null) && (batch.visibleInstances[subMesh._id] !== null) && (batch.visibleInstances[subMesh._id] !== undefined);
  30470. if (!this.isReady(subMesh, hardwareInstancedRendering)) {
  30471. return;
  30472. }
  30473. var mesh = subMesh.getRenderingMesh();
  30474. var material = subMesh.getMaterial();
  30475. engine.enableEffect(this._effect);
  30476. this._effect.setFloat("offset", useOverlay ? 0 : mesh.outlineWidth);
  30477. this._effect.setColor4("color", useOverlay ? mesh.overlayColor : mesh.outlineColor, useOverlay ? mesh.overlayAlpha : 1.0);
  30478. this._effect.setMatrix("viewProjection", scene.getTransformMatrix());
  30479. // Bones
  30480. if (mesh.useBones && mesh.computeBonesUsingShaders) {
  30481. this._effect.setMatrices("mBones", mesh.skeleton.getTransformMatrices());
  30482. }
  30483. mesh._bind(subMesh, this._effect, BABYLON.Material.TriangleFillMode);
  30484. // Alpha test
  30485. if (material && material.needAlphaTesting()) {
  30486. var alphaTexture = material.getAlphaTestTexture();
  30487. this._effect.setTexture("diffuseSampler", alphaTexture);
  30488. this._effect.setMatrix("diffuseMatrix", alphaTexture.getTextureMatrix());
  30489. }
  30490. mesh._processRendering(subMesh, this._effect, BABYLON.Material.TriangleFillMode, batch, hardwareInstancedRendering, function (isInstance, world) { _this._effect.setMatrix("world", world); });
  30491. };
  30492. OutlineRenderer.prototype.isReady = function (subMesh, useInstances) {
  30493. var defines = [];
  30494. var attribs = [BABYLON.VertexBuffer.PositionKind, BABYLON.VertexBuffer.NormalKind];
  30495. var mesh = subMesh.getMesh();
  30496. var material = subMesh.getMaterial();
  30497. // Alpha test
  30498. if (material && material.needAlphaTesting()) {
  30499. defines.push("#define ALPHATEST");
  30500. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  30501. attribs.push(BABYLON.VertexBuffer.UVKind);
  30502. defines.push("#define UV1");
  30503. }
  30504. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  30505. attribs.push(BABYLON.VertexBuffer.UV2Kind);
  30506. defines.push("#define UV2");
  30507. }
  30508. }
  30509. // Bones
  30510. if (mesh.useBones && mesh.computeBonesUsingShaders) {
  30511. attribs.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  30512. attribs.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  30513. defines.push("#define BONES");
  30514. defines.push("#define BonesPerMesh " + (mesh.skeleton.bones.length + 1));
  30515. }
  30516. // Instances
  30517. if (useInstances) {
  30518. defines.push("#define INSTANCES");
  30519. attribs.push("world0");
  30520. attribs.push("world1");
  30521. attribs.push("world2");
  30522. attribs.push("world3");
  30523. }
  30524. // Get correct effect
  30525. var join = defines.join("\n");
  30526. if (this._cachedDefines !== join) {
  30527. this._cachedDefines = join;
  30528. this._effect = this._scene.getEngine().createEffect("outline", attribs, ["world", "mBones", "viewProjection", "diffuseMatrix", "offset", "color"], ["diffuseSampler"], join);
  30529. }
  30530. return this._effect.isReady();
  30531. };
  30532. return OutlineRenderer;
  30533. })();
  30534. BABYLON.OutlineRenderer = OutlineRenderer;
  30535. })(BABYLON || (BABYLON = {}));
  30536. var BABYLON;
  30537. (function (BABYLON) {
  30538. var MeshAssetTask = (function () {
  30539. function MeshAssetTask(name, meshesNames, rootUrl, sceneFilename) {
  30540. this.name = name;
  30541. this.meshesNames = meshesNames;
  30542. this.rootUrl = rootUrl;
  30543. this.sceneFilename = sceneFilename;
  30544. this.isCompleted = false;
  30545. }
  30546. MeshAssetTask.prototype.run = function (scene, onSuccess, onError) {
  30547. var _this = this;
  30548. BABYLON.SceneLoader.ImportMesh(this.meshesNames, this.rootUrl, this.sceneFilename, scene, function (meshes, particleSystems, skeletons) {
  30549. _this.loadedMeshes = meshes;
  30550. _this.loadedParticleSystems = particleSystems;
  30551. _this.loadedSkeletons = skeletons;
  30552. _this.isCompleted = true;
  30553. if (_this.onSuccess) {
  30554. _this.onSuccess(_this);
  30555. }
  30556. onSuccess();
  30557. }, null, function () {
  30558. if (_this.onError) {
  30559. _this.onError(_this);
  30560. }
  30561. onError();
  30562. });
  30563. };
  30564. return MeshAssetTask;
  30565. })();
  30566. BABYLON.MeshAssetTask = MeshAssetTask;
  30567. var TextFileAssetTask = (function () {
  30568. function TextFileAssetTask(name, url) {
  30569. this.name = name;
  30570. this.url = url;
  30571. this.isCompleted = false;
  30572. }
  30573. TextFileAssetTask.prototype.run = function (scene, onSuccess, onError) {
  30574. var _this = this;
  30575. BABYLON.Tools.LoadFile(this.url, function (data) {
  30576. _this.text = data;
  30577. _this.isCompleted = true;
  30578. if (_this.onSuccess) {
  30579. _this.onSuccess(_this);
  30580. }
  30581. onSuccess();
  30582. }, null, scene.database, false, function () {
  30583. if (_this.onError) {
  30584. _this.onError(_this);
  30585. }
  30586. onError();
  30587. });
  30588. };
  30589. return TextFileAssetTask;
  30590. })();
  30591. BABYLON.TextFileAssetTask = TextFileAssetTask;
  30592. var BinaryFileAssetTask = (function () {
  30593. function BinaryFileAssetTask(name, url) {
  30594. this.name = name;
  30595. this.url = url;
  30596. this.isCompleted = false;
  30597. }
  30598. BinaryFileAssetTask.prototype.run = function (scene, onSuccess, onError) {
  30599. var _this = this;
  30600. BABYLON.Tools.LoadFile(this.url, function (data) {
  30601. _this.data = data;
  30602. _this.isCompleted = true;
  30603. if (_this.onSuccess) {
  30604. _this.onSuccess(_this);
  30605. }
  30606. onSuccess();
  30607. }, null, scene.database, true, function () {
  30608. if (_this.onError) {
  30609. _this.onError(_this);
  30610. }
  30611. onError();
  30612. });
  30613. };
  30614. return BinaryFileAssetTask;
  30615. })();
  30616. BABYLON.BinaryFileAssetTask = BinaryFileAssetTask;
  30617. var ImageAssetTask = (function () {
  30618. function ImageAssetTask(name, url) {
  30619. this.name = name;
  30620. this.url = url;
  30621. this.isCompleted = false;
  30622. }
  30623. ImageAssetTask.prototype.run = function (scene, onSuccess, onError) {
  30624. var _this = this;
  30625. var img = new Image();
  30626. img.onload = function () {
  30627. _this.image = img;
  30628. _this.isCompleted = true;
  30629. if (_this.onSuccess) {
  30630. _this.onSuccess(_this);
  30631. }
  30632. onSuccess();
  30633. };
  30634. img.onerror = function () {
  30635. if (_this.onError) {
  30636. _this.onError(_this);
  30637. }
  30638. onError();
  30639. };
  30640. img.src = this.url;
  30641. };
  30642. return ImageAssetTask;
  30643. })();
  30644. BABYLON.ImageAssetTask = ImageAssetTask;
  30645. var TextureAssetTask = (function () {
  30646. function TextureAssetTask(name, url, noMipmap, invertY, samplingMode) {
  30647. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  30648. this.name = name;
  30649. this.url = url;
  30650. this.noMipmap = noMipmap;
  30651. this.invertY = invertY;
  30652. this.samplingMode = samplingMode;
  30653. this.isCompleted = false;
  30654. }
  30655. TextureAssetTask.prototype.run = function (scene, onSuccess, onError) {
  30656. var _this = this;
  30657. var onload = function () {
  30658. _this.isCompleted = true;
  30659. if (_this.onSuccess) {
  30660. _this.onSuccess(_this);
  30661. }
  30662. onSuccess();
  30663. };
  30664. var onerror = function () {
  30665. if (_this.onError) {
  30666. _this.onError(_this);
  30667. }
  30668. onError();
  30669. };
  30670. this.texture = new BABYLON.Texture(this.url, scene, this.noMipmap, this.invertY, this.samplingMode, onload, onError);
  30671. };
  30672. return TextureAssetTask;
  30673. })();
  30674. BABYLON.TextureAssetTask = TextureAssetTask;
  30675. var AssetsManager = (function () {
  30676. function AssetsManager(scene) {
  30677. this._tasks = new Array();
  30678. this._waitingTasksCount = 0;
  30679. this.useDefaultLoadingScreen = true;
  30680. this._scene = scene;
  30681. }
  30682. AssetsManager.prototype.addMeshTask = function (taskName, meshesNames, rootUrl, sceneFilename) {
  30683. var task = new MeshAssetTask(taskName, meshesNames, rootUrl, sceneFilename);
  30684. this._tasks.push(task);
  30685. return task;
  30686. };
  30687. AssetsManager.prototype.addTextFileTask = function (taskName, url) {
  30688. var task = new TextFileAssetTask(taskName, url);
  30689. this._tasks.push(task);
  30690. return task;
  30691. };
  30692. AssetsManager.prototype.addBinaryFileTask = function (taskName, url) {
  30693. var task = new BinaryFileAssetTask(taskName, url);
  30694. this._tasks.push(task);
  30695. return task;
  30696. };
  30697. AssetsManager.prototype.addImageTask = function (taskName, url) {
  30698. var task = new ImageAssetTask(taskName, url);
  30699. this._tasks.push(task);
  30700. return task;
  30701. };
  30702. AssetsManager.prototype.addTextureTask = function (taskName, url, noMipmap, invertY, samplingMode) {
  30703. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  30704. var task = new TextureAssetTask(taskName, url, noMipmap, invertY, samplingMode);
  30705. this._tasks.push(task);
  30706. return task;
  30707. };
  30708. AssetsManager.prototype._decreaseWaitingTasksCount = function () {
  30709. this._waitingTasksCount--;
  30710. if (this._waitingTasksCount === 0) {
  30711. if (this.onFinish) {
  30712. this.onFinish(this._tasks);
  30713. }
  30714. this._scene.getEngine().hideLoadingUI();
  30715. }
  30716. };
  30717. AssetsManager.prototype._runTask = function (task) {
  30718. var _this = this;
  30719. task.run(this._scene, function () {
  30720. if (_this.onTaskSuccess) {
  30721. _this.onTaskSuccess(task);
  30722. }
  30723. _this._decreaseWaitingTasksCount();
  30724. }, function () {
  30725. if (_this.onTaskError) {
  30726. _this.onTaskError(task);
  30727. }
  30728. _this._decreaseWaitingTasksCount();
  30729. });
  30730. };
  30731. AssetsManager.prototype.reset = function () {
  30732. this._tasks = new Array();
  30733. return this;
  30734. };
  30735. AssetsManager.prototype.load = function () {
  30736. this._waitingTasksCount = this._tasks.length;
  30737. if (this._waitingTasksCount === 0) {
  30738. if (this.onFinish) {
  30739. this.onFinish(this._tasks);
  30740. }
  30741. return this;
  30742. }
  30743. if (this.useDefaultLoadingScreen) {
  30744. this._scene.getEngine().displayLoadingUI();
  30745. }
  30746. for (var index = 0; index < this._tasks.length; index++) {
  30747. var task = this._tasks[index];
  30748. this._runTask(task);
  30749. }
  30750. return this;
  30751. };
  30752. return AssetsManager;
  30753. })();
  30754. BABYLON.AssetsManager = AssetsManager;
  30755. })(BABYLON || (BABYLON = {}));
  30756. var BABYLON;
  30757. (function (BABYLON) {
  30758. var VRDeviceOrientationFreeCamera = (function (_super) {
  30759. __extends(VRDeviceOrientationFreeCamera, _super);
  30760. function VRDeviceOrientationFreeCamera(name, position, scene, compensateDistortion) {
  30761. if (compensateDistortion === void 0) { compensateDistortion = true; }
  30762. _super.call(this, name, position, scene);
  30763. this._alpha = 0;
  30764. this._beta = 0;
  30765. this._gamma = 0;
  30766. var metrics = BABYLON.VRCameraMetrics.GetDefault();
  30767. metrics.compensateDistortion = compensateDistortion;
  30768. this.setCameraRigMode(BABYLON.Camera.RIG_MODE_VR, { vrCameraMetrics: metrics });
  30769. this._deviceOrientationHandler = this._onOrientationEvent.bind(this);
  30770. }
  30771. VRDeviceOrientationFreeCamera.prototype._onOrientationEvent = function (evt) {
  30772. this._alpha = +evt.alpha | 0;
  30773. this._beta = +evt.beta | 0;
  30774. this._gamma = +evt.gamma | 0;
  30775. if (this._gamma < 0) {
  30776. this._gamma = 90 + this._gamma;
  30777. }
  30778. else {
  30779. // Incline it in the correct angle.
  30780. this._gamma = 270 - this._gamma;
  30781. }
  30782. this.rotation.x = this._gamma / 180.0 * Math.PI;
  30783. this.rotation.y = -this._alpha / 180.0 * Math.PI;
  30784. this.rotation.z = this._beta / 180.0 * Math.PI;
  30785. };
  30786. VRDeviceOrientationFreeCamera.prototype.attachControl = function (element, noPreventDefault) {
  30787. _super.prototype.attachControl.call(this, element, noPreventDefault);
  30788. window.addEventListener("deviceorientation", this._deviceOrientationHandler);
  30789. };
  30790. VRDeviceOrientationFreeCamera.prototype.detachControl = function (element) {
  30791. _super.prototype.detachControl.call(this, element);
  30792. window.removeEventListener("deviceorientation", this._deviceOrientationHandler);
  30793. };
  30794. return VRDeviceOrientationFreeCamera;
  30795. })(BABYLON.FreeCamera);
  30796. BABYLON.VRDeviceOrientationFreeCamera = VRDeviceOrientationFreeCamera;
  30797. })(BABYLON || (BABYLON = {}));
  30798. var BABYLON;
  30799. (function (BABYLON) {
  30800. var WebVRFreeCamera = (function (_super) {
  30801. __extends(WebVRFreeCamera, _super);
  30802. function WebVRFreeCamera(name, position, scene, compensateDistortion) {
  30803. if (compensateDistortion === void 0) { compensateDistortion = true; }
  30804. _super.call(this, name, position, scene);
  30805. this._hmdDevice = null;
  30806. this._sensorDevice = null;
  30807. this._cacheState = null;
  30808. this._cacheQuaternion = new BABYLON.Quaternion();
  30809. this._cacheRotation = BABYLON.Vector3.Zero();
  30810. this._vrEnabled = false;
  30811. var metrics = BABYLON.VRCameraMetrics.GetDefault();
  30812. metrics.compensateDistortion = compensateDistortion;
  30813. this.setCameraRigMode(BABYLON.Camera.RIG_MODE_VR, { vrCameraMetrics: metrics });
  30814. this._getWebVRDevices = this._getWebVRDevices.bind(this);
  30815. }
  30816. WebVRFreeCamera.prototype._getWebVRDevices = function (devices) {
  30817. var size = devices.length;
  30818. var i = 0;
  30819. // Reset devices.
  30820. this._sensorDevice = null;
  30821. this._hmdDevice = null;
  30822. // Search for a HmdDevice.
  30823. while (i < size && this._hmdDevice === null) {
  30824. if (devices[i] instanceof HMDVRDevice) {
  30825. this._hmdDevice = devices[i];
  30826. }
  30827. i++;
  30828. }
  30829. i = 0;
  30830. while (i < size && this._sensorDevice === null) {
  30831. if (devices[i] instanceof PositionSensorVRDevice && (!this._hmdDevice || devices[i].hardwareUnitId === this._hmdDevice.hardwareUnitId)) {
  30832. this._sensorDevice = devices[i];
  30833. }
  30834. i++;
  30835. }
  30836. this._vrEnabled = this._sensorDevice && this._hmdDevice ? true : false;
  30837. };
  30838. WebVRFreeCamera.prototype._checkInputs = function () {
  30839. if (this._vrEnabled) {
  30840. this._cacheState = this._sensorDevice.getState();
  30841. this._cacheQuaternion.copyFromFloats(this._cacheState.orientation.x, this._cacheState.orientation.y, this._cacheState.orientation.z, this._cacheState.orientation.w);
  30842. this._cacheQuaternion.toEulerAnglesToRef(this._cacheRotation);
  30843. this.rotation.x = -this._cacheRotation.z;
  30844. this.rotation.y = -this._cacheRotation.y;
  30845. this.rotation.z = this._cacheRotation.x;
  30846. }
  30847. _super.prototype._checkInputs.call(this);
  30848. };
  30849. WebVRFreeCamera.prototype.attachControl = function (element, noPreventDefault) {
  30850. _super.prototype.attachControl.call(this, element, noPreventDefault);
  30851. if (navigator.getVRDevices) {
  30852. navigator.getVRDevices().then(this._getWebVRDevices);
  30853. }
  30854. else if (navigator.mozGetVRDevices) {
  30855. navigator.mozGetVRDevices(this._getWebVRDevices);
  30856. }
  30857. };
  30858. WebVRFreeCamera.prototype.detachControl = function (element) {
  30859. _super.prototype.detachControl.call(this, element);
  30860. this._vrEnabled = false;
  30861. };
  30862. return WebVRFreeCamera;
  30863. })(BABYLON.FreeCamera);
  30864. BABYLON.WebVRFreeCamera = WebVRFreeCamera;
  30865. })(BABYLON || (BABYLON = {}));
  30866. var BABYLON;
  30867. (function (BABYLON) {
  30868. // Standard optimizations
  30869. var SceneOptimization = (function () {
  30870. function SceneOptimization(priority) {
  30871. if (priority === void 0) { priority = 0; }
  30872. this.priority = priority;
  30873. this.apply = function (scene) {
  30874. return true; // Return true if everything that can be done was applied
  30875. };
  30876. }
  30877. return SceneOptimization;
  30878. })();
  30879. BABYLON.SceneOptimization = SceneOptimization;
  30880. var TextureOptimization = (function (_super) {
  30881. __extends(TextureOptimization, _super);
  30882. function TextureOptimization(priority, maximumSize) {
  30883. var _this = this;
  30884. if (priority === void 0) { priority = 0; }
  30885. if (maximumSize === void 0) { maximumSize = 1024; }
  30886. _super.call(this, priority);
  30887. this.priority = priority;
  30888. this.maximumSize = maximumSize;
  30889. this.apply = function (scene) {
  30890. var allDone = true;
  30891. for (var index = 0; index < scene.textures.length; index++) {
  30892. var texture = scene.textures[index];
  30893. if (!texture.canRescale) {
  30894. continue;
  30895. }
  30896. var currentSize = texture.getSize();
  30897. var maxDimension = Math.max(currentSize.width, currentSize.height);
  30898. if (maxDimension > _this.maximumSize) {
  30899. texture.scale(0.5);
  30900. allDone = false;
  30901. }
  30902. }
  30903. return allDone;
  30904. };
  30905. }
  30906. return TextureOptimization;
  30907. })(SceneOptimization);
  30908. BABYLON.TextureOptimization = TextureOptimization;
  30909. var HardwareScalingOptimization = (function (_super) {
  30910. __extends(HardwareScalingOptimization, _super);
  30911. function HardwareScalingOptimization(priority, maximumScale) {
  30912. var _this = this;
  30913. if (priority === void 0) { priority = 0; }
  30914. if (maximumScale === void 0) { maximumScale = 2; }
  30915. _super.call(this, priority);
  30916. this.priority = priority;
  30917. this.maximumScale = maximumScale;
  30918. this._currentScale = 1;
  30919. this.apply = function (scene) {
  30920. _this._currentScale++;
  30921. scene.getEngine().setHardwareScalingLevel(_this._currentScale);
  30922. return _this._currentScale >= _this.maximumScale;
  30923. };
  30924. }
  30925. return HardwareScalingOptimization;
  30926. })(SceneOptimization);
  30927. BABYLON.HardwareScalingOptimization = HardwareScalingOptimization;
  30928. var ShadowsOptimization = (function (_super) {
  30929. __extends(ShadowsOptimization, _super);
  30930. function ShadowsOptimization() {
  30931. _super.apply(this, arguments);
  30932. this.apply = function (scene) {
  30933. scene.shadowsEnabled = false;
  30934. return true;
  30935. };
  30936. }
  30937. return ShadowsOptimization;
  30938. })(SceneOptimization);
  30939. BABYLON.ShadowsOptimization = ShadowsOptimization;
  30940. var PostProcessesOptimization = (function (_super) {
  30941. __extends(PostProcessesOptimization, _super);
  30942. function PostProcessesOptimization() {
  30943. _super.apply(this, arguments);
  30944. this.apply = function (scene) {
  30945. scene.postProcessesEnabled = false;
  30946. return true;
  30947. };
  30948. }
  30949. return PostProcessesOptimization;
  30950. })(SceneOptimization);
  30951. BABYLON.PostProcessesOptimization = PostProcessesOptimization;
  30952. var LensFlaresOptimization = (function (_super) {
  30953. __extends(LensFlaresOptimization, _super);
  30954. function LensFlaresOptimization() {
  30955. _super.apply(this, arguments);
  30956. this.apply = function (scene) {
  30957. scene.lensFlaresEnabled = false;
  30958. return true;
  30959. };
  30960. }
  30961. return LensFlaresOptimization;
  30962. })(SceneOptimization);
  30963. BABYLON.LensFlaresOptimization = LensFlaresOptimization;
  30964. var ParticlesOptimization = (function (_super) {
  30965. __extends(ParticlesOptimization, _super);
  30966. function ParticlesOptimization() {
  30967. _super.apply(this, arguments);
  30968. this.apply = function (scene) {
  30969. scene.particlesEnabled = false;
  30970. return true;
  30971. };
  30972. }
  30973. return ParticlesOptimization;
  30974. })(SceneOptimization);
  30975. BABYLON.ParticlesOptimization = ParticlesOptimization;
  30976. var RenderTargetsOptimization = (function (_super) {
  30977. __extends(RenderTargetsOptimization, _super);
  30978. function RenderTargetsOptimization() {
  30979. _super.apply(this, arguments);
  30980. this.apply = function (scene) {
  30981. scene.renderTargetsEnabled = false;
  30982. return true;
  30983. };
  30984. }
  30985. return RenderTargetsOptimization;
  30986. })(SceneOptimization);
  30987. BABYLON.RenderTargetsOptimization = RenderTargetsOptimization;
  30988. var MergeMeshesOptimization = (function (_super) {
  30989. __extends(MergeMeshesOptimization, _super);
  30990. function MergeMeshesOptimization() {
  30991. var _this = this;
  30992. _super.apply(this, arguments);
  30993. this._canBeMerged = function (abstractMesh) {
  30994. if (!(abstractMesh instanceof BABYLON.Mesh)) {
  30995. return false;
  30996. }
  30997. var mesh = abstractMesh;
  30998. if (!mesh.isVisible || !mesh.isEnabled()) {
  30999. return false;
  31000. }
  31001. if (mesh.instances.length > 0) {
  31002. return false;
  31003. }
  31004. if (mesh.skeleton || mesh.hasLODLevels) {
  31005. return false;
  31006. }
  31007. return true;
  31008. };
  31009. this.apply = function (scene, updateSelectionTree) {
  31010. var globalPool = scene.meshes.slice(0);
  31011. var globalLength = globalPool.length;
  31012. for (var index = 0; index < globalLength; index++) {
  31013. var currentPool = new Array();
  31014. var current = globalPool[index];
  31015. // Checks
  31016. if (!_this._canBeMerged(current)) {
  31017. continue;
  31018. }
  31019. currentPool.push(current);
  31020. // Find compatible meshes
  31021. for (var subIndex = index + 1; subIndex < globalLength; subIndex++) {
  31022. var otherMesh = globalPool[subIndex];
  31023. if (!_this._canBeMerged(otherMesh)) {
  31024. continue;
  31025. }
  31026. if (otherMesh.material !== current.material) {
  31027. continue;
  31028. }
  31029. if (otherMesh.checkCollisions !== current.checkCollisions) {
  31030. continue;
  31031. }
  31032. currentPool.push(otherMesh);
  31033. globalLength--;
  31034. globalPool.splice(subIndex, 1);
  31035. subIndex--;
  31036. }
  31037. if (currentPool.length < 2) {
  31038. continue;
  31039. }
  31040. // Merge meshes
  31041. BABYLON.Mesh.MergeMeshes(currentPool);
  31042. }
  31043. if (updateSelectionTree != undefined) {
  31044. if (updateSelectionTree) {
  31045. scene.createOrUpdateSelectionOctree();
  31046. }
  31047. }
  31048. else if (MergeMeshesOptimization.UpdateSelectionTree) {
  31049. scene.createOrUpdateSelectionOctree();
  31050. }
  31051. return true;
  31052. };
  31053. }
  31054. Object.defineProperty(MergeMeshesOptimization, "UpdateSelectionTree", {
  31055. get: function () {
  31056. return MergeMeshesOptimization._UpdateSelectionTree;
  31057. },
  31058. set: function (value) {
  31059. MergeMeshesOptimization._UpdateSelectionTree = value;
  31060. },
  31061. enumerable: true,
  31062. configurable: true
  31063. });
  31064. MergeMeshesOptimization._UpdateSelectionTree = false;
  31065. return MergeMeshesOptimization;
  31066. })(SceneOptimization);
  31067. BABYLON.MergeMeshesOptimization = MergeMeshesOptimization;
  31068. // Options
  31069. var SceneOptimizerOptions = (function () {
  31070. function SceneOptimizerOptions(targetFrameRate, trackerDuration) {
  31071. if (targetFrameRate === void 0) { targetFrameRate = 60; }
  31072. if (trackerDuration === void 0) { trackerDuration = 2000; }
  31073. this.targetFrameRate = targetFrameRate;
  31074. this.trackerDuration = trackerDuration;
  31075. this.optimizations = new Array();
  31076. }
  31077. SceneOptimizerOptions.LowDegradationAllowed = function (targetFrameRate) {
  31078. var result = new SceneOptimizerOptions(targetFrameRate);
  31079. var priority = 0;
  31080. result.optimizations.push(new MergeMeshesOptimization(priority));
  31081. result.optimizations.push(new ShadowsOptimization(priority));
  31082. result.optimizations.push(new LensFlaresOptimization(priority));
  31083. // Next priority
  31084. priority++;
  31085. result.optimizations.push(new PostProcessesOptimization(priority));
  31086. result.optimizations.push(new ParticlesOptimization(priority));
  31087. // Next priority
  31088. priority++;
  31089. result.optimizations.push(new TextureOptimization(priority, 1024));
  31090. return result;
  31091. };
  31092. SceneOptimizerOptions.ModerateDegradationAllowed = function (targetFrameRate) {
  31093. var result = new SceneOptimizerOptions(targetFrameRate);
  31094. var priority = 0;
  31095. result.optimizations.push(new MergeMeshesOptimization(priority));
  31096. result.optimizations.push(new ShadowsOptimization(priority));
  31097. result.optimizations.push(new LensFlaresOptimization(priority));
  31098. // Next priority
  31099. priority++;
  31100. result.optimizations.push(new PostProcessesOptimization(priority));
  31101. result.optimizations.push(new ParticlesOptimization(priority));
  31102. // Next priority
  31103. priority++;
  31104. result.optimizations.push(new TextureOptimization(priority, 512));
  31105. // Next priority
  31106. priority++;
  31107. result.optimizations.push(new RenderTargetsOptimization(priority));
  31108. // Next priority
  31109. priority++;
  31110. result.optimizations.push(new HardwareScalingOptimization(priority, 2));
  31111. return result;
  31112. };
  31113. SceneOptimizerOptions.HighDegradationAllowed = function (targetFrameRate) {
  31114. var result = new SceneOptimizerOptions(targetFrameRate);
  31115. var priority = 0;
  31116. result.optimizations.push(new MergeMeshesOptimization(priority));
  31117. result.optimizations.push(new ShadowsOptimization(priority));
  31118. result.optimizations.push(new LensFlaresOptimization(priority));
  31119. // Next priority
  31120. priority++;
  31121. result.optimizations.push(new PostProcessesOptimization(priority));
  31122. result.optimizations.push(new ParticlesOptimization(priority));
  31123. // Next priority
  31124. priority++;
  31125. result.optimizations.push(new TextureOptimization(priority, 256));
  31126. // Next priority
  31127. priority++;
  31128. result.optimizations.push(new RenderTargetsOptimization(priority));
  31129. // Next priority
  31130. priority++;
  31131. result.optimizations.push(new HardwareScalingOptimization(priority, 4));
  31132. return result;
  31133. };
  31134. return SceneOptimizerOptions;
  31135. })();
  31136. BABYLON.SceneOptimizerOptions = SceneOptimizerOptions;
  31137. // Scene optimizer tool
  31138. var SceneOptimizer = (function () {
  31139. function SceneOptimizer() {
  31140. }
  31141. SceneOptimizer._CheckCurrentState = function (scene, options, currentPriorityLevel, onSuccess, onFailure) {
  31142. // TODO: add an epsilon
  31143. if (scene.getEngine().getFps() >= options.targetFrameRate) {
  31144. if (onSuccess) {
  31145. onSuccess();
  31146. }
  31147. return;
  31148. }
  31149. // Apply current level of optimizations
  31150. var allDone = true;
  31151. var noOptimizationApplied = true;
  31152. for (var index = 0; index < options.optimizations.length; index++) {
  31153. var optimization = options.optimizations[index];
  31154. if (optimization.priority === currentPriorityLevel) {
  31155. noOptimizationApplied = false;
  31156. allDone = allDone && optimization.apply(scene);
  31157. }
  31158. }
  31159. // If no optimization was applied, this is a failure :(
  31160. if (noOptimizationApplied) {
  31161. if (onFailure) {
  31162. onFailure();
  31163. }
  31164. return;
  31165. }
  31166. // If all optimizations were done, move to next level
  31167. if (allDone) {
  31168. currentPriorityLevel++;
  31169. }
  31170. // Let's the system running for a specific amount of time before checking FPS
  31171. scene.executeWhenReady(function () {
  31172. setTimeout(function () {
  31173. SceneOptimizer._CheckCurrentState(scene, options, currentPriorityLevel, onSuccess, onFailure);
  31174. }, options.trackerDuration);
  31175. });
  31176. };
  31177. SceneOptimizer.OptimizeAsync = function (scene, options, onSuccess, onFailure) {
  31178. if (!options) {
  31179. options = SceneOptimizerOptions.ModerateDegradationAllowed();
  31180. }
  31181. // Let's the system running for a specific amount of time before checking FPS
  31182. scene.executeWhenReady(function () {
  31183. setTimeout(function () {
  31184. SceneOptimizer._CheckCurrentState(scene, options, 0, onSuccess, onFailure);
  31185. }, options.trackerDuration);
  31186. });
  31187. };
  31188. return SceneOptimizer;
  31189. })();
  31190. BABYLON.SceneOptimizer = SceneOptimizer;
  31191. })(BABYLON || (BABYLON = {}));
  31192. var BABYLON;
  31193. (function (BABYLON) {
  31194. var Internals;
  31195. (function (Internals) {
  31196. var MeshLODLevel = (function () {
  31197. function MeshLODLevel(distance, mesh) {
  31198. this.distance = distance;
  31199. this.mesh = mesh;
  31200. }
  31201. return MeshLODLevel;
  31202. })();
  31203. Internals.MeshLODLevel = MeshLODLevel;
  31204. })(Internals = BABYLON.Internals || (BABYLON.Internals = {}));
  31205. })(BABYLON || (BABYLON = {}));
  31206. var BABYLON;
  31207. (function (BABYLON) {
  31208. var RawTexture = (function (_super) {
  31209. __extends(RawTexture, _super);
  31210. function RawTexture(data, width, height, format, scene, generateMipMaps, invertY, samplingMode) {
  31211. if (generateMipMaps === void 0) { generateMipMaps = true; }
  31212. if (invertY === void 0) { invertY = false; }
  31213. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  31214. _super.call(this, null, scene, !generateMipMaps, invertY);
  31215. this.format = format;
  31216. this._texture = scene.getEngine().createRawTexture(data, width, height, format, generateMipMaps, invertY, samplingMode);
  31217. this.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  31218. this.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  31219. }
  31220. RawTexture.prototype.update = function (data) {
  31221. this.getScene().getEngine().updateRawTexture(this._texture, data, this.format, this._invertY);
  31222. };
  31223. // Statics
  31224. RawTexture.CreateLuminanceTexture = function (data, width, height, scene, generateMipMaps, invertY, samplingMode) {
  31225. if (generateMipMaps === void 0) { generateMipMaps = true; }
  31226. if (invertY === void 0) { invertY = false; }
  31227. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  31228. return new RawTexture(data, width, height, BABYLON.Engine.TEXTUREFORMAT_LUMINANCE, scene, generateMipMaps, invertY, samplingMode);
  31229. };
  31230. RawTexture.CreateLuminanceAlphaTexture = function (data, width, height, scene, generateMipMaps, invertY, samplingMode) {
  31231. if (generateMipMaps === void 0) { generateMipMaps = true; }
  31232. if (invertY === void 0) { invertY = false; }
  31233. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  31234. return new RawTexture(data, width, height, BABYLON.Engine.TEXTUREFORMAT_LUMINANCE_ALPHA, scene, generateMipMaps, invertY, samplingMode);
  31235. };
  31236. RawTexture.CreateAlphaTexture = function (data, width, height, scene, generateMipMaps, invertY, samplingMode) {
  31237. if (generateMipMaps === void 0) { generateMipMaps = true; }
  31238. if (invertY === void 0) { invertY = false; }
  31239. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  31240. return new RawTexture(data, width, height, BABYLON.Engine.TEXTUREFORMAT_ALPHA, scene, generateMipMaps, invertY, samplingMode);
  31241. };
  31242. RawTexture.CreateRGBTexture = function (data, width, height, scene, generateMipMaps, invertY, samplingMode) {
  31243. if (generateMipMaps === void 0) { generateMipMaps = true; }
  31244. if (invertY === void 0) { invertY = false; }
  31245. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  31246. return new RawTexture(data, width, height, BABYLON.Engine.TEXTUREFORMAT_RGB, scene, generateMipMaps, invertY, samplingMode);
  31247. };
  31248. RawTexture.CreateRGBATexture = function (data, width, height, scene, generateMipMaps, invertY, samplingMode) {
  31249. if (generateMipMaps === void 0) { generateMipMaps = true; }
  31250. if (invertY === void 0) { invertY = false; }
  31251. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.TRILINEAR_SAMPLINGMODE; }
  31252. return new RawTexture(data, width, height, BABYLON.Engine.TEXTUREFORMAT_RGBA, scene, generateMipMaps, invertY, samplingMode);
  31253. };
  31254. return RawTexture;
  31255. })(BABYLON.Texture);
  31256. BABYLON.RawTexture = RawTexture;
  31257. })(BABYLON || (BABYLON = {}));
  31258. var BABYLON;
  31259. (function (BABYLON) {
  31260. var IndexedVector2 = (function (_super) {
  31261. __extends(IndexedVector2, _super);
  31262. function IndexedVector2(original, index) {
  31263. _super.call(this, original.x, original.y);
  31264. this.index = index;
  31265. }
  31266. return IndexedVector2;
  31267. })(BABYLON.Vector2);
  31268. var PolygonPoints = (function () {
  31269. function PolygonPoints() {
  31270. this.elements = new Array();
  31271. }
  31272. PolygonPoints.prototype.add = function (originalPoints) {
  31273. var _this = this;
  31274. var result = new Array();
  31275. originalPoints.forEach(function (point) {
  31276. if (result.length === 0 || !point.equalsWithEpsilon(result[0])) {
  31277. var newPoint = new IndexedVector2(point, _this.elements.length);
  31278. result.push(newPoint);
  31279. _this.elements.push(newPoint);
  31280. }
  31281. });
  31282. return result;
  31283. };
  31284. PolygonPoints.prototype.computeBounds = function () {
  31285. var lmin = new BABYLON.Vector2(this.elements[0].x, this.elements[0].y);
  31286. var lmax = new BABYLON.Vector2(this.elements[0].x, this.elements[0].y);
  31287. this.elements.forEach(function (point) {
  31288. // x
  31289. if (point.x < lmin.x) {
  31290. lmin.x = point.x;
  31291. }
  31292. else if (point.x > lmax.x) {
  31293. lmax.x = point.x;
  31294. }
  31295. // y
  31296. if (point.y < lmin.y) {
  31297. lmin.y = point.y;
  31298. }
  31299. else if (point.y > lmax.y) {
  31300. lmax.y = point.y;
  31301. }
  31302. });
  31303. return {
  31304. min: lmin,
  31305. max: lmax,
  31306. width: lmax.x - lmin.x,
  31307. height: lmax.y - lmin.y
  31308. };
  31309. };
  31310. return PolygonPoints;
  31311. })();
  31312. var Polygon = (function () {
  31313. function Polygon() {
  31314. }
  31315. Polygon.Rectangle = function (xmin, ymin, xmax, ymax) {
  31316. return [
  31317. new BABYLON.Vector2(xmin, ymin),
  31318. new BABYLON.Vector2(xmax, ymin),
  31319. new BABYLON.Vector2(xmax, ymax),
  31320. new BABYLON.Vector2(xmin, ymax)
  31321. ];
  31322. };
  31323. Polygon.Circle = function (radius, cx, cy, numberOfSides) {
  31324. if (cx === void 0) { cx = 0; }
  31325. if (cy === void 0) { cy = 0; }
  31326. if (numberOfSides === void 0) { numberOfSides = 32; }
  31327. var result = new Array();
  31328. var angle = 0;
  31329. var increment = (Math.PI * 2) / numberOfSides;
  31330. for (var i = 0; i < numberOfSides; i++) {
  31331. result.push(new BABYLON.Vector2(cx + Math.cos(angle) * radius, cy + Math.sin(angle) * radius));
  31332. angle -= increment;
  31333. }
  31334. return result;
  31335. };
  31336. Polygon.Parse = function (input) {
  31337. var floats = input.split(/[^-+eE\.\d]+/).map(parseFloat).filter(function (val) { return (!isNaN(val)); });
  31338. var i, result = [];
  31339. for (i = 0; i < (floats.length & 0x7FFFFFFE); i += 2) {
  31340. result.push(new BABYLON.Vector2(floats[i], floats[i + 1]));
  31341. }
  31342. return result;
  31343. };
  31344. Polygon.StartingAt = function (x, y) {
  31345. return BABYLON.Path2.StartingAt(x, y);
  31346. };
  31347. return Polygon;
  31348. })();
  31349. BABYLON.Polygon = Polygon;
  31350. var PolygonMeshBuilder = (function () {
  31351. function PolygonMeshBuilder(name, contours, scene) {
  31352. this._points = new PolygonPoints();
  31353. this._outlinepoints = new PolygonPoints();
  31354. this._holes = [];
  31355. if (!("poly2tri" in window)) {
  31356. throw "PolygonMeshBuilder cannot be used because poly2tri is not referenced";
  31357. }
  31358. this._name = name;
  31359. this._scene = scene;
  31360. var points;
  31361. if (contours instanceof BABYLON.Path2) {
  31362. points = contours.getPoints();
  31363. }
  31364. else {
  31365. points = contours;
  31366. }
  31367. this._swctx = new poly2tri.SweepContext(this._points.add(points));
  31368. this._outlinepoints.add(points);
  31369. }
  31370. PolygonMeshBuilder.prototype.addHole = function (hole) {
  31371. this._swctx.addHole(this._points.add(hole));
  31372. var holepoints = new PolygonPoints();
  31373. holepoints.add(hole);
  31374. this._holes.push(holepoints);
  31375. return this;
  31376. };
  31377. PolygonMeshBuilder.prototype.build = function (updatable, depth) {
  31378. var _this = this;
  31379. if (updatable === void 0) { updatable = false; }
  31380. var result = new BABYLON.Mesh(this._name, this._scene);
  31381. var normals = [];
  31382. var positions = [];
  31383. var uvs = [];
  31384. var bounds = this._points.computeBounds();
  31385. this._points.elements.forEach(function (p) {
  31386. normals.push(0, 1.0, 0);
  31387. positions.push(p.x, 0, p.y);
  31388. uvs.push((p.x - bounds.min.x) / bounds.width, (p.y - bounds.min.y) / bounds.height);
  31389. });
  31390. var indices = [];
  31391. this._swctx.triangulate();
  31392. this._swctx.getTriangles().forEach(function (triangle) {
  31393. triangle.getPoints().forEach(function (point) {
  31394. indices.push(point.index);
  31395. });
  31396. });
  31397. if (depth > 0) {
  31398. var positionscount = (positions.length / 3); //get the current pointcount
  31399. this._points.elements.forEach(function (p) {
  31400. normals.push(0, -1.0, 0);
  31401. positions.push(p.x, -depth, p.y);
  31402. uvs.push(1 - (p.x - bounds.min.x) / bounds.width, 1 - (p.y - bounds.min.y) / bounds.height);
  31403. });
  31404. var p1; //we need to change order of point so the triangles are made in the rigth way.
  31405. var p2;
  31406. var poscounter = 0;
  31407. this._swctx.getTriangles().forEach(function (triangle) {
  31408. triangle.getPoints().forEach(function (point) {
  31409. switch (poscounter) {
  31410. case 0:
  31411. p1 = point;
  31412. break;
  31413. case 1:
  31414. p2 = point;
  31415. break;
  31416. case 2:
  31417. indices.push(point.index + positionscount);
  31418. indices.push(p2.index + positionscount);
  31419. indices.push(p1.index + positionscount);
  31420. poscounter = -1;
  31421. break;
  31422. }
  31423. poscounter++;
  31424. //indices.push((<IndexedVector2>point).index + positionscount);
  31425. });
  31426. });
  31427. //Add the sides
  31428. this.addSide(positions, normals, uvs, indices, bounds, this._outlinepoints, depth, false);
  31429. this._holes.forEach(function (hole) {
  31430. _this.addSide(positions, normals, uvs, indices, bounds, hole, depth, true);
  31431. });
  31432. }
  31433. result.setVerticesData(BABYLON.VertexBuffer.PositionKind, positions, updatable);
  31434. result.setVerticesData(BABYLON.VertexBuffer.NormalKind, normals, updatable);
  31435. result.setVerticesData(BABYLON.VertexBuffer.UVKind, uvs, updatable);
  31436. result.setIndices(indices);
  31437. return result;
  31438. };
  31439. PolygonMeshBuilder.prototype.addSide = function (positions, normals, uvs, indices, bounds, points, depth, flip) {
  31440. var StartIndex = positions.length / 3;
  31441. var ulength = 0;
  31442. for (var i = 0; i < points.elements.length; i++) {
  31443. var p = points.elements[i];
  31444. var p1;
  31445. if ((i + 1) > points.elements.length - 1) {
  31446. p1 = points.elements[0];
  31447. }
  31448. else {
  31449. p1 = points.elements[i + 1];
  31450. }
  31451. positions.push(p.x, 0, p.y);
  31452. positions.push(p.x, -depth, p.y);
  31453. positions.push(p1.x, 0, p1.y);
  31454. positions.push(p1.x, -depth, p1.y);
  31455. var v1 = new BABYLON.Vector3(p.x, 0, p.y);
  31456. var v2 = new BABYLON.Vector3(p1.x, 0, p1.y);
  31457. var v3 = v2.subtract(v1);
  31458. var v4 = new BABYLON.Vector3(0, 1, 0);
  31459. var vn = BABYLON.Vector3.Cross(v3, v4);
  31460. vn = vn.normalize();
  31461. uvs.push(ulength / bounds.width, 0);
  31462. uvs.push(ulength / bounds.width, 1);
  31463. ulength += v3.length();
  31464. uvs.push((ulength / bounds.width), 0);
  31465. uvs.push((ulength / bounds.width), 1);
  31466. if (!flip) {
  31467. normals.push(-vn.x, -vn.y, -vn.z);
  31468. normals.push(-vn.x, -vn.y, -vn.z);
  31469. normals.push(-vn.x, -vn.y, -vn.z);
  31470. normals.push(-vn.x, -vn.y, -vn.z);
  31471. indices.push(StartIndex);
  31472. indices.push(StartIndex + 1);
  31473. indices.push(StartIndex + 2);
  31474. indices.push(StartIndex + 1);
  31475. indices.push(StartIndex + 3);
  31476. indices.push(StartIndex + 2);
  31477. }
  31478. else {
  31479. normals.push(vn.x, vn.y, vn.z);
  31480. normals.push(vn.x, vn.y, vn.z);
  31481. normals.push(vn.x, vn.y, vn.z);
  31482. normals.push(vn.x, vn.y, vn.z);
  31483. indices.push(StartIndex);
  31484. indices.push(StartIndex + 2);
  31485. indices.push(StartIndex + 1);
  31486. indices.push(StartIndex + 1);
  31487. indices.push(StartIndex + 2);
  31488. indices.push(StartIndex + 3);
  31489. }
  31490. StartIndex += 4;
  31491. }
  31492. ;
  31493. };
  31494. return PolygonMeshBuilder;
  31495. })();
  31496. BABYLON.PolygonMeshBuilder = PolygonMeshBuilder;
  31497. })(BABYLON || (BABYLON = {}));
  31498. var BABYLON;
  31499. (function (BABYLON) {
  31500. var Octree = (function () {
  31501. function Octree(creationFunc, maxBlockCapacity, maxDepth) {
  31502. if (maxDepth === void 0) { maxDepth = 2; }
  31503. this.maxDepth = maxDepth;
  31504. this.dynamicContent = new Array();
  31505. this._maxBlockCapacity = maxBlockCapacity || 64;
  31506. this._selectionContent = new BABYLON.SmartArray(1024);
  31507. this._creationFunc = creationFunc;
  31508. }
  31509. // Methods
  31510. Octree.prototype.update = function (worldMin, worldMax, entries) {
  31511. Octree._CreateBlocks(worldMin, worldMax, entries, this._maxBlockCapacity, 0, this.maxDepth, this, this._creationFunc);
  31512. };
  31513. Octree.prototype.addMesh = function (entry) {
  31514. for (var index = 0; index < this.blocks.length; index++) {
  31515. var block = this.blocks[index];
  31516. block.addEntry(entry);
  31517. }
  31518. };
  31519. Octree.prototype.select = function (frustumPlanes, allowDuplicate) {
  31520. this._selectionContent.reset();
  31521. for (var index = 0; index < this.blocks.length; index++) {
  31522. var block = this.blocks[index];
  31523. block.select(frustumPlanes, this._selectionContent, allowDuplicate);
  31524. }
  31525. if (allowDuplicate) {
  31526. this._selectionContent.concat(this.dynamicContent);
  31527. }
  31528. else {
  31529. this._selectionContent.concatWithNoDuplicate(this.dynamicContent);
  31530. }
  31531. return this._selectionContent;
  31532. };
  31533. Octree.prototype.intersects = function (sphereCenter, sphereRadius, allowDuplicate) {
  31534. this._selectionContent.reset();
  31535. for (var index = 0; index < this.blocks.length; index++) {
  31536. var block = this.blocks[index];
  31537. block.intersects(sphereCenter, sphereRadius, this._selectionContent, allowDuplicate);
  31538. }
  31539. if (allowDuplicate) {
  31540. this._selectionContent.concat(this.dynamicContent);
  31541. }
  31542. else {
  31543. this._selectionContent.concatWithNoDuplicate(this.dynamicContent);
  31544. }
  31545. return this._selectionContent;
  31546. };
  31547. Octree.prototype.intersectsRay = function (ray) {
  31548. this._selectionContent.reset();
  31549. for (var index = 0; index < this.blocks.length; index++) {
  31550. var block = this.blocks[index];
  31551. block.intersectsRay(ray, this._selectionContent);
  31552. }
  31553. this._selectionContent.concatWithNoDuplicate(this.dynamicContent);
  31554. return this._selectionContent;
  31555. };
  31556. Octree._CreateBlocks = function (worldMin, worldMax, entries, maxBlockCapacity, currentDepth, maxDepth, target, creationFunc) {
  31557. target.blocks = new Array();
  31558. var blockSize = new BABYLON.Vector3((worldMax.x - worldMin.x) / 2, (worldMax.y - worldMin.y) / 2, (worldMax.z - worldMin.z) / 2);
  31559. // Segmenting space
  31560. for (var x = 0; x < 2; x++) {
  31561. for (var y = 0; y < 2; y++) {
  31562. for (var z = 0; z < 2; z++) {
  31563. var localMin = worldMin.add(blockSize.multiplyByFloats(x, y, z));
  31564. var localMax = worldMin.add(blockSize.multiplyByFloats(x + 1, y + 1, z + 1));
  31565. var block = new BABYLON.OctreeBlock(localMin, localMax, maxBlockCapacity, currentDepth + 1, maxDepth, creationFunc);
  31566. block.addEntries(entries);
  31567. target.blocks.push(block);
  31568. }
  31569. }
  31570. }
  31571. };
  31572. Octree.CreationFuncForMeshes = function (entry, block) {
  31573. if (!entry.isBlocked && entry.getBoundingInfo().boundingBox.intersectsMinMax(block.minPoint, block.maxPoint)) {
  31574. block.entries.push(entry);
  31575. }
  31576. };
  31577. Octree.CreationFuncForSubMeshes = function (entry, block) {
  31578. if (entry.getBoundingInfo().boundingBox.intersectsMinMax(block.minPoint, block.maxPoint)) {
  31579. block.entries.push(entry);
  31580. }
  31581. };
  31582. return Octree;
  31583. })();
  31584. BABYLON.Octree = Octree;
  31585. })(BABYLON || (BABYLON = {}));
  31586. var BABYLON;
  31587. (function (BABYLON) {
  31588. var OctreeBlock = (function () {
  31589. function OctreeBlock(minPoint, maxPoint, capacity, depth, maxDepth, creationFunc) {
  31590. this.entries = new Array();
  31591. this._boundingVectors = new Array();
  31592. this._capacity = capacity;
  31593. this._depth = depth;
  31594. this._maxDepth = maxDepth;
  31595. this._creationFunc = creationFunc;
  31596. this._minPoint = minPoint;
  31597. this._maxPoint = maxPoint;
  31598. this._boundingVectors.push(minPoint.clone());
  31599. this._boundingVectors.push(maxPoint.clone());
  31600. this._boundingVectors.push(minPoint.clone());
  31601. this._boundingVectors[2].x = maxPoint.x;
  31602. this._boundingVectors.push(minPoint.clone());
  31603. this._boundingVectors[3].y = maxPoint.y;
  31604. this._boundingVectors.push(minPoint.clone());
  31605. this._boundingVectors[4].z = maxPoint.z;
  31606. this._boundingVectors.push(maxPoint.clone());
  31607. this._boundingVectors[5].z = minPoint.z;
  31608. this._boundingVectors.push(maxPoint.clone());
  31609. this._boundingVectors[6].x = minPoint.x;
  31610. this._boundingVectors.push(maxPoint.clone());
  31611. this._boundingVectors[7].y = minPoint.y;
  31612. }
  31613. Object.defineProperty(OctreeBlock.prototype, "capacity", {
  31614. // Property
  31615. get: function () {
  31616. return this._capacity;
  31617. },
  31618. enumerable: true,
  31619. configurable: true
  31620. });
  31621. Object.defineProperty(OctreeBlock.prototype, "minPoint", {
  31622. get: function () {
  31623. return this._minPoint;
  31624. },
  31625. enumerable: true,
  31626. configurable: true
  31627. });
  31628. Object.defineProperty(OctreeBlock.prototype, "maxPoint", {
  31629. get: function () {
  31630. return this._maxPoint;
  31631. },
  31632. enumerable: true,
  31633. configurable: true
  31634. });
  31635. // Methods
  31636. OctreeBlock.prototype.addEntry = function (entry) {
  31637. if (this.blocks) {
  31638. for (var index = 0; index < this.blocks.length; index++) {
  31639. var block = this.blocks[index];
  31640. block.addEntry(entry);
  31641. }
  31642. return;
  31643. }
  31644. this._creationFunc(entry, this);
  31645. if (this.entries.length > this.capacity && this._depth < this._maxDepth) {
  31646. this.createInnerBlocks();
  31647. }
  31648. };
  31649. OctreeBlock.prototype.addEntries = function (entries) {
  31650. for (var index = 0; index < entries.length; index++) {
  31651. var mesh = entries[index];
  31652. this.addEntry(mesh);
  31653. }
  31654. };
  31655. OctreeBlock.prototype.select = function (frustumPlanes, selection, allowDuplicate) {
  31656. if (BABYLON.BoundingBox.IsInFrustum(this._boundingVectors, frustumPlanes)) {
  31657. if (this.blocks) {
  31658. for (var index = 0; index < this.blocks.length; index++) {
  31659. var block = this.blocks[index];
  31660. block.select(frustumPlanes, selection, allowDuplicate);
  31661. }
  31662. return;
  31663. }
  31664. if (allowDuplicate) {
  31665. selection.concat(this.entries);
  31666. }
  31667. else {
  31668. selection.concatWithNoDuplicate(this.entries);
  31669. }
  31670. }
  31671. };
  31672. OctreeBlock.prototype.intersects = function (sphereCenter, sphereRadius, selection, allowDuplicate) {
  31673. if (BABYLON.BoundingBox.IntersectsSphere(this._minPoint, this._maxPoint, sphereCenter, sphereRadius)) {
  31674. if (this.blocks) {
  31675. for (var index = 0; index < this.blocks.length; index++) {
  31676. var block = this.blocks[index];
  31677. block.intersects(sphereCenter, sphereRadius, selection, allowDuplicate);
  31678. }
  31679. return;
  31680. }
  31681. if (allowDuplicate) {
  31682. selection.concat(this.entries);
  31683. }
  31684. else {
  31685. selection.concatWithNoDuplicate(this.entries);
  31686. }
  31687. }
  31688. };
  31689. OctreeBlock.prototype.intersectsRay = function (ray, selection) {
  31690. if (ray.intersectsBoxMinMax(this._minPoint, this._maxPoint)) {
  31691. if (this.blocks) {
  31692. for (var index = 0; index < this.blocks.length; index++) {
  31693. var block = this.blocks[index];
  31694. block.intersectsRay(ray, selection);
  31695. }
  31696. return;
  31697. }
  31698. selection.concatWithNoDuplicate(this.entries);
  31699. }
  31700. };
  31701. OctreeBlock.prototype.createInnerBlocks = function () {
  31702. BABYLON.Octree._CreateBlocks(this._minPoint, this._maxPoint, this.entries, this._capacity, this._depth, this._maxDepth, this, this._creationFunc);
  31703. };
  31704. return OctreeBlock;
  31705. })();
  31706. BABYLON.OctreeBlock = OctreeBlock;
  31707. })(BABYLON || (BABYLON = {}));
  31708. var BABYLON;
  31709. (function (BABYLON) {
  31710. var BlurPostProcess = (function (_super) {
  31711. __extends(BlurPostProcess, _super);
  31712. function BlurPostProcess(name, direction, blurWidth, ratio, camera, samplingMode, engine, reusable) {
  31713. var _this = this;
  31714. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.BILINEAR_SAMPLINGMODE; }
  31715. _super.call(this, name, "blur", ["screenSize", "direction", "blurWidth"], null, ratio, camera, samplingMode, engine, reusable);
  31716. this.direction = direction;
  31717. this.blurWidth = blurWidth;
  31718. this.onApply = function (effect) {
  31719. effect.setFloat2("screenSize", _this.width, _this.height);
  31720. effect.setVector2("direction", _this.direction);
  31721. effect.setFloat("blurWidth", _this.blurWidth);
  31722. };
  31723. }
  31724. return BlurPostProcess;
  31725. })(BABYLON.PostProcess);
  31726. BABYLON.BlurPostProcess = BlurPostProcess;
  31727. })(BABYLON || (BABYLON = {}));
  31728. var BABYLON;
  31729. (function (BABYLON) {
  31730. var RefractionPostProcess = (function (_super) {
  31731. __extends(RefractionPostProcess, _super);
  31732. function RefractionPostProcess(name, refractionTextureUrl, color, depth, colorLevel, ratio, camera, samplingMode, engine, reusable) {
  31733. var _this = this;
  31734. _super.call(this, name, "refraction", ["baseColor", "depth", "colorLevel"], ["refractionSampler"], ratio, camera, samplingMode, engine, reusable);
  31735. this.color = color;
  31736. this.depth = depth;
  31737. this.colorLevel = colorLevel;
  31738. this.onActivate = function (cam) {
  31739. _this._refRexture = _this._refRexture || new BABYLON.Texture(refractionTextureUrl, cam.getScene());
  31740. };
  31741. this.onApply = function (effect) {
  31742. effect.setColor3("baseColor", _this.color);
  31743. effect.setFloat("depth", _this.depth);
  31744. effect.setFloat("colorLevel", _this.colorLevel);
  31745. effect.setTexture("refractionSampler", _this._refRexture);
  31746. };
  31747. }
  31748. // Methods
  31749. RefractionPostProcess.prototype.dispose = function (camera) {
  31750. if (this._refRexture) {
  31751. this._refRexture.dispose();
  31752. }
  31753. _super.prototype.dispose.call(this, camera);
  31754. };
  31755. return RefractionPostProcess;
  31756. })(BABYLON.PostProcess);
  31757. BABYLON.RefractionPostProcess = RefractionPostProcess;
  31758. })(BABYLON || (BABYLON = {}));
  31759. var BABYLON;
  31760. (function (BABYLON) {
  31761. var BlackAndWhitePostProcess = (function (_super) {
  31762. __extends(BlackAndWhitePostProcess, _super);
  31763. function BlackAndWhitePostProcess(name, ratio, camera, samplingMode, engine, reusable) {
  31764. _super.call(this, name, "blackAndWhite", null, null, ratio, camera, samplingMode, engine, reusable);
  31765. }
  31766. return BlackAndWhitePostProcess;
  31767. })(BABYLON.PostProcess);
  31768. BABYLON.BlackAndWhitePostProcess = BlackAndWhitePostProcess;
  31769. })(BABYLON || (BABYLON = {}));
  31770. var BABYLON;
  31771. (function (BABYLON) {
  31772. var ConvolutionPostProcess = (function (_super) {
  31773. __extends(ConvolutionPostProcess, _super);
  31774. function ConvolutionPostProcess(name, kernel, ratio, camera, samplingMode, engine, reusable) {
  31775. var _this = this;
  31776. _super.call(this, name, "convolution", ["kernel", "screenSize"], null, ratio, camera, samplingMode, engine, reusable);
  31777. this.kernel = kernel;
  31778. this.onApply = function (effect) {
  31779. effect.setFloat2("screenSize", _this.width, _this.height);
  31780. effect.setArray("kernel", _this.kernel);
  31781. };
  31782. }
  31783. // Statics
  31784. // Based on http://en.wikipedia.org/wiki/Kernel_(image_processing)
  31785. ConvolutionPostProcess.EdgeDetect0Kernel = [1, 0, -1, 0, 0, 0, -1, 0, 1];
  31786. ConvolutionPostProcess.EdgeDetect1Kernel = [0, 1, 0, 1, -4, 1, 0, 1, 0];
  31787. ConvolutionPostProcess.EdgeDetect2Kernel = [-1, -1, -1, -1, 8, -1, -1, -1, -1];
  31788. ConvolutionPostProcess.SharpenKernel = [0, -1, 0, -1, 5, -1, 0, -1, 0];
  31789. ConvolutionPostProcess.EmbossKernel = [-2, -1, 0, -1, 1, 1, 0, 1, 2];
  31790. ConvolutionPostProcess.GaussianKernel = [0, 1, 0, 1, 1, 1, 0, 1, 0];
  31791. return ConvolutionPostProcess;
  31792. })(BABYLON.PostProcess);
  31793. BABYLON.ConvolutionPostProcess = ConvolutionPostProcess;
  31794. })(BABYLON || (BABYLON = {}));
  31795. var BABYLON;
  31796. (function (BABYLON) {
  31797. var FilterPostProcess = (function (_super) {
  31798. __extends(FilterPostProcess, _super);
  31799. function FilterPostProcess(name, kernelMatrix, ratio, camera, samplingMode, engine, reusable) {
  31800. var _this = this;
  31801. _super.call(this, name, "filter", ["kernelMatrix"], null, ratio, camera, samplingMode, engine, reusable);
  31802. this.kernelMatrix = kernelMatrix;
  31803. this.onApply = function (effect) {
  31804. effect.setMatrix("kernelMatrix", _this.kernelMatrix);
  31805. };
  31806. }
  31807. return FilterPostProcess;
  31808. })(BABYLON.PostProcess);
  31809. BABYLON.FilterPostProcess = FilterPostProcess;
  31810. })(BABYLON || (BABYLON = {}));
  31811. var BABYLON;
  31812. (function (BABYLON) {
  31813. var FxaaPostProcess = (function (_super) {
  31814. __extends(FxaaPostProcess, _super);
  31815. function FxaaPostProcess(name, ratio, camera, samplingMode, engine, reusable) {
  31816. var _this = this;
  31817. _super.call(this, name, "fxaa", ["texelSize"], null, ratio, camera, samplingMode, engine, reusable);
  31818. this.onSizeChanged = function () {
  31819. _this.texelWidth = 1.0 / _this.width;
  31820. _this.texelHeight = 1.0 / _this.height;
  31821. };
  31822. this.onApply = function (effect) {
  31823. effect.setFloat2("texelSize", _this.texelWidth, _this.texelHeight);
  31824. };
  31825. }
  31826. return FxaaPostProcess;
  31827. })(BABYLON.PostProcess);
  31828. BABYLON.FxaaPostProcess = FxaaPostProcess;
  31829. })(BABYLON || (BABYLON = {}));
  31830. var BABYLON;
  31831. (function (BABYLON) {
  31832. var StereoscopicInterlacePostProcess = (function (_super) {
  31833. __extends(StereoscopicInterlacePostProcess, _super);
  31834. function StereoscopicInterlacePostProcess(name, camB, postProcessA, isStereoscopicHoriz, samplingMode) {
  31835. var _this = this;
  31836. _super.call(this, name, "stereoscopicInterlace", ['stepSize'], ['camASampler'], 1, camB, samplingMode, camB.getScene().getEngine(), false, isStereoscopicHoriz ? "#define IS_STEREOSCOPIC_HORIZ 1" : undefined);
  31837. this._stepSize = new BABYLON.Vector2(1 / this.width, 1 / this.height);
  31838. this.onSizeChanged = function () {
  31839. _this._stepSize = new BABYLON.Vector2(1 / _this.width, 1 / _this.height);
  31840. };
  31841. this.onApply = function (effect) {
  31842. effect.setTextureFromPostProcess("camASampler", postProcessA);
  31843. effect.setFloat2("stepSize", _this._stepSize.x, _this._stepSize.y);
  31844. };
  31845. }
  31846. return StereoscopicInterlacePostProcess;
  31847. })(BABYLON.PostProcess);
  31848. BABYLON.StereoscopicInterlacePostProcess = StereoscopicInterlacePostProcess;
  31849. })(BABYLON || (BABYLON = {}));
  31850. var BABYLON;
  31851. (function (BABYLON) {
  31852. var LensFlare = (function () {
  31853. function LensFlare(size, position, color, imgUrl, system) {
  31854. this.size = size;
  31855. this.position = position;
  31856. this.dispose = function () {
  31857. if (this.texture) {
  31858. this.texture.dispose();
  31859. }
  31860. // Remove from scene
  31861. var index = this._system.lensFlares.indexOf(this);
  31862. this._system.lensFlares.splice(index, 1);
  31863. };
  31864. this.color = color || new BABYLON.Color3(1, 1, 1);
  31865. this.texture = imgUrl ? new BABYLON.Texture(imgUrl, system.getScene(), true) : null;
  31866. this._system = system;
  31867. system.lensFlares.push(this);
  31868. }
  31869. return LensFlare;
  31870. })();
  31871. BABYLON.LensFlare = LensFlare;
  31872. })(BABYLON || (BABYLON = {}));
  31873. var BABYLON;
  31874. (function (BABYLON) {
  31875. var LensFlareSystem = (function () {
  31876. function LensFlareSystem(name, emitter, scene) {
  31877. this.name = name;
  31878. this.lensFlares = new Array();
  31879. this.borderLimit = 300;
  31880. this.layerMask = 0x0FFFFFFF;
  31881. this._vertexDeclaration = [2];
  31882. this._vertexStrideSize = 2 * 4;
  31883. this._isEnabled = true;
  31884. this._scene = scene;
  31885. this._emitter = emitter;
  31886. scene.lensFlareSystems.push(this);
  31887. this.meshesSelectionPredicate = function (m) { return m.material && m.isVisible && m.isEnabled() && m.isBlocker && ((m.layerMask & scene.activeCamera.layerMask) != 0); };
  31888. // VBO
  31889. var vertices = [];
  31890. vertices.push(1, 1);
  31891. vertices.push(-1, 1);
  31892. vertices.push(-1, -1);
  31893. vertices.push(1, -1);
  31894. this._vertexBuffer = scene.getEngine().createVertexBuffer(vertices);
  31895. // Indices
  31896. var indices = [];
  31897. indices.push(0);
  31898. indices.push(1);
  31899. indices.push(2);
  31900. indices.push(0);
  31901. indices.push(2);
  31902. indices.push(3);
  31903. this._indexBuffer = scene.getEngine().createIndexBuffer(indices);
  31904. // Effects
  31905. this._effect = this._scene.getEngine().createEffect("lensFlare", ["position"], ["color", "viewportMatrix"], ["textureSampler"], "");
  31906. }
  31907. Object.defineProperty(LensFlareSystem.prototype, "isEnabled", {
  31908. get: function () {
  31909. return this._isEnabled;
  31910. },
  31911. set: function (value) {
  31912. this._isEnabled = value;
  31913. },
  31914. enumerable: true,
  31915. configurable: true
  31916. });
  31917. LensFlareSystem.prototype.getScene = function () {
  31918. return this._scene;
  31919. };
  31920. LensFlareSystem.prototype.getEmitter = function () {
  31921. return this._emitter;
  31922. };
  31923. LensFlareSystem.prototype.setEmitter = function (newEmitter) {
  31924. this._emitter = newEmitter;
  31925. };
  31926. LensFlareSystem.prototype.getEmitterPosition = function () {
  31927. return this._emitter.getAbsolutePosition ? this._emitter.getAbsolutePosition() : this._emitter.position;
  31928. };
  31929. LensFlareSystem.prototype.computeEffectivePosition = function (globalViewport) {
  31930. var position = this.getEmitterPosition();
  31931. position = BABYLON.Vector3.Project(position, BABYLON.Matrix.Identity(), this._scene.getTransformMatrix(), globalViewport);
  31932. this._positionX = position.x;
  31933. this._positionY = position.y;
  31934. position = BABYLON.Vector3.TransformCoordinates(this.getEmitterPosition(), this._scene.getViewMatrix());
  31935. if (position.z > 0) {
  31936. if ((this._positionX > globalViewport.x) && (this._positionX < globalViewport.x + globalViewport.width)) {
  31937. if ((this._positionY > globalViewport.y) && (this._positionY < globalViewport.y + globalViewport.height))
  31938. return true;
  31939. }
  31940. }
  31941. return false;
  31942. };
  31943. LensFlareSystem.prototype._isVisible = function () {
  31944. if (!this._isEnabled) {
  31945. return false;
  31946. }
  31947. var emitterPosition = this.getEmitterPosition();
  31948. var direction = emitterPosition.subtract(this._scene.activeCamera.position);
  31949. var distance = direction.length();
  31950. direction.normalize();
  31951. var ray = new BABYLON.Ray(this._scene.activeCamera.position, direction);
  31952. var pickInfo = this._scene.pickWithRay(ray, this.meshesSelectionPredicate, true);
  31953. return !pickInfo.hit || pickInfo.distance > distance;
  31954. };
  31955. LensFlareSystem.prototype.render = function () {
  31956. if (!this._effect.isReady())
  31957. return false;
  31958. var engine = this._scene.getEngine();
  31959. var viewport = this._scene.activeCamera.viewport;
  31960. var globalViewport = viewport.toGlobal(engine);
  31961. // Position
  31962. if (!this.computeEffectivePosition(globalViewport)) {
  31963. return false;
  31964. }
  31965. // Visibility
  31966. if (!this._isVisible()) {
  31967. return false;
  31968. }
  31969. // Intensity
  31970. var awayX;
  31971. var awayY;
  31972. if (this._positionX < this.borderLimit + globalViewport.x) {
  31973. awayX = this.borderLimit + globalViewport.x - this._positionX;
  31974. }
  31975. else if (this._positionX > globalViewport.x + globalViewport.width - this.borderLimit) {
  31976. awayX = this._positionX - globalViewport.x - globalViewport.width + this.borderLimit;
  31977. }
  31978. else {
  31979. awayX = 0;
  31980. }
  31981. if (this._positionY < this.borderLimit + globalViewport.y) {
  31982. awayY = this.borderLimit + globalViewport.y - this._positionY;
  31983. }
  31984. else if (this._positionY > globalViewport.y + globalViewport.height - this.borderLimit) {
  31985. awayY = this._positionY - globalViewport.y - globalViewport.height + this.borderLimit;
  31986. }
  31987. else {
  31988. awayY = 0;
  31989. }
  31990. var away = (awayX > awayY) ? awayX : awayY;
  31991. if (away > this.borderLimit) {
  31992. away = this.borderLimit;
  31993. }
  31994. var intensity = 1.0 - (away / this.borderLimit);
  31995. if (intensity < 0) {
  31996. return false;
  31997. }
  31998. if (intensity > 1.0) {
  31999. intensity = 1.0;
  32000. }
  32001. // Position
  32002. var centerX = globalViewport.x + globalViewport.width / 2;
  32003. var centerY = globalViewport.y + globalViewport.height / 2;
  32004. var distX = centerX - this._positionX;
  32005. var distY = centerY - this._positionY;
  32006. // Effects
  32007. engine.enableEffect(this._effect);
  32008. engine.setState(false);
  32009. engine.setDepthBuffer(false);
  32010. engine.setAlphaMode(BABYLON.Engine.ALPHA_ONEONE);
  32011. // VBOs
  32012. engine.bindBuffers(this._vertexBuffer, this._indexBuffer, this._vertexDeclaration, this._vertexStrideSize, this._effect);
  32013. // Flares
  32014. for (var index = 0; index < this.lensFlares.length; index++) {
  32015. var flare = this.lensFlares[index];
  32016. var x = centerX - (distX * flare.position);
  32017. var y = centerY - (distY * flare.position);
  32018. var cw = flare.size;
  32019. var ch = flare.size * engine.getAspectRatio(this._scene.activeCamera);
  32020. var cx = 2 * (x / globalViewport.width) - 1.0;
  32021. var cy = 1.0 - 2 * (y / globalViewport.height);
  32022. var viewportMatrix = BABYLON.Matrix.FromValues(cw / 2, 0, 0, 0, 0, ch / 2, 0, 0, 0, 0, 1, 0, cx, cy, 0, 1);
  32023. this._effect.setMatrix("viewportMatrix", viewportMatrix);
  32024. // Texture
  32025. this._effect.setTexture("textureSampler", flare.texture);
  32026. // Color
  32027. this._effect.setFloat4("color", flare.color.r * intensity, flare.color.g * intensity, flare.color.b * intensity, 1.0);
  32028. // Draw order
  32029. engine.draw(true, 0, 6);
  32030. }
  32031. engine.setDepthBuffer(true);
  32032. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  32033. return true;
  32034. };
  32035. LensFlareSystem.prototype.dispose = function () {
  32036. if (this._vertexBuffer) {
  32037. this._scene.getEngine()._releaseBuffer(this._vertexBuffer);
  32038. this._vertexBuffer = null;
  32039. }
  32040. if (this._indexBuffer) {
  32041. this._scene.getEngine()._releaseBuffer(this._indexBuffer);
  32042. this._indexBuffer = null;
  32043. }
  32044. while (this.lensFlares.length) {
  32045. this.lensFlares[0].dispose();
  32046. }
  32047. // Remove from scene
  32048. var index = this._scene.lensFlareSystems.indexOf(this);
  32049. this._scene.lensFlareSystems.splice(index, 1);
  32050. };
  32051. return LensFlareSystem;
  32052. })();
  32053. BABYLON.LensFlareSystem = LensFlareSystem;
  32054. })(BABYLON || (BABYLON = {}));
  32055. var BABYLON;
  32056. (function (BABYLON) {
  32057. // We're mainly based on the logic defined into the FreeCamera code
  32058. var DeviceOrientationCamera = (function (_super) {
  32059. __extends(DeviceOrientationCamera, _super);
  32060. function DeviceOrientationCamera(name, position, scene) {
  32061. var _this = this;
  32062. _super.call(this, name, position, scene);
  32063. this._offsetX = null;
  32064. this._offsetY = null;
  32065. this._orientationGamma = 0;
  32066. this._orientationBeta = 0;
  32067. this._initialOrientationGamma = 0;
  32068. this._initialOrientationBeta = 0;
  32069. this.angularSensibility = 10000.0;
  32070. this.moveSensibility = 50.0;
  32071. window.addEventListener("resize", function () {
  32072. _this._initialOrientationGamma = null;
  32073. }, false);
  32074. }
  32075. DeviceOrientationCamera.prototype.attachControl = function (canvas, noPreventDefault) {
  32076. var _this = this;
  32077. if (this._attachedCanvas) {
  32078. return;
  32079. }
  32080. this._attachedCanvas = canvas;
  32081. if (!this._orientationChanged) {
  32082. this._orientationChanged = function (evt) {
  32083. if (!_this._initialOrientationGamma) {
  32084. _this._initialOrientationGamma = evt.gamma;
  32085. _this._initialOrientationBeta = evt.beta;
  32086. }
  32087. _this._orientationGamma = evt.gamma;
  32088. _this._orientationBeta = evt.beta;
  32089. _this._offsetY = (_this._initialOrientationBeta - _this._orientationBeta);
  32090. _this._offsetX = (_this._initialOrientationGamma - _this._orientationGamma);
  32091. };
  32092. }
  32093. window.addEventListener("deviceorientation", this._orientationChanged);
  32094. };
  32095. DeviceOrientationCamera.prototype.detachControl = function (canvas) {
  32096. if (this._attachedCanvas != canvas) {
  32097. return;
  32098. }
  32099. window.removeEventListener("deviceorientation", this._orientationChanged);
  32100. this._attachedCanvas = null;
  32101. this._orientationGamma = 0;
  32102. this._orientationBeta = 0;
  32103. this._initialOrientationGamma = 0;
  32104. this._initialOrientationBeta = 0;
  32105. };
  32106. DeviceOrientationCamera.prototype._checkInputs = function () {
  32107. if (!this._offsetX) {
  32108. return;
  32109. }
  32110. this.cameraRotation.y -= this._offsetX / this.angularSensibility;
  32111. var speed = this._computeLocalCameraSpeed();
  32112. var direction = new BABYLON.Vector3(0, 0, speed * this._offsetY / this.moveSensibility);
  32113. BABYLON.Matrix.RotationYawPitchRollToRef(this.rotation.y, this.rotation.x, 0, this._cameraRotationMatrix);
  32114. this.cameraDirection.addInPlace(BABYLON.Vector3.TransformCoordinates(direction, this._cameraRotationMatrix));
  32115. _super.prototype._checkInputs.call(this);
  32116. };
  32117. return DeviceOrientationCamera;
  32118. })(BABYLON.FreeCamera);
  32119. BABYLON.DeviceOrientationCamera = DeviceOrientationCamera;
  32120. })(BABYLON || (BABYLON = {}));
  32121. var BABYLON;
  32122. (function (BABYLON) {
  32123. var Gamepads = (function () {
  32124. function Gamepads(ongamedpadconnected) {
  32125. var _this = this;
  32126. this.babylonGamepads = [];
  32127. this.oneGamepadConnected = false;
  32128. this.isMonitoring = false;
  32129. this.gamepadEventSupported = 'GamepadEvent' in window;
  32130. this.gamepadSupportAvailable = (navigator.getGamepads ||
  32131. !!navigator.webkitGetGamepads || !!navigator.msGetGamepads || !!navigator.webkitGamepads);
  32132. this.buttonADataURL = "data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAEAAAABACAYAAACqaXHeAAAABGdBTUEAAK/INwWK6QAAABl0RVh0U29mdHdhcmUAQWRvYmUgSW1hZ2VSZWFkeXHJZTwAAA9aSURBVHja7FtpbBzneX7m3otcihSpm9Z9UJalxPKhVLZlp6ktNzEaxE0CtAnQAgnSoPWPBi3syuiPwordFi5Qt2haFygCoylSV4Vby6os1I3kOLYrS65kXXQoypJJSaFEUTyXy925+rzfzC6HFFlL1kpAIe7i5czO7H7zPs97ft8MtTAMcSu/dNzirxkCZgiYIWCGgBkCZgi4hV/mDR5fSxAt+0ZiX0ucDxMSTJLK+f83BFSA6TFgK75OclshouKBFbA+xaV4k7Z+fD6sNRlmjYFXQMu4NiUVS/oHe5/ecnHo3MYxd7QthN9UcsdW6FqEPwgDOFbqpAajL2VlTrTULzj4Ow8+s4+nipSxWMoxIUkyrl/pGswFtIR7WzHgDCX77K7vfHNkbOA+AryjYZadb27OIJdzCNZBKmXw4kbk35qPsTEfJbeEkZESentHMdBfGtY142gu1bDvqV/925f4tQJlNCaj4hXX7RHXS0AFuJEAXvfHr/zmk67vPjir0V68aFEe8xtuQ6O1FHlrEXLmHBiaDUtzYBlpNYjrF+GFZfhhCcPeBQy53ehzT+H8QBe6uwfRf7l8xjKsvX/y5X98jl8fThDhJ4i46QQkrS5I6v7oX7/++77vPtLUlFnZtnIRlubvxRxnHbJmE79sxD/SqG0oZk8MFarRqufUkQAFrxcXSkfx0eB+nOggKX2jHYZhvf79r/z4L2IiipO84aYRkASfefnAX695p3P3c9mM/UufuaMVdzRvxVx7A0xaWdOMqVULJ6Z3TZv6KmHo0ztK6CkfxpHe3Th0pAuF0fLbn1u+9cmv3vW77bE3fGoSPi0BVfAvvPEHm9rPv//iooWz5m9Z/wCWZx+Go9UrN48QTD9IGMZ1cJIzTPisRQclPMrhME4W9mDfB2+i+2z/+TXz7/z2E7/85+9OIuGGE6BV3H77zm/d33nx6Ktr18zFg2t+DQude2n1tLJ8tcJ90vDhpG5Am7qTkJAQErywiLOld7G3/d9xvL0Hy1vWPbbtS3//00Q4hDeaAFXintrx1fu7+jp2r13bgofX/gaazbVkJQdLT9P6VqRFDSu2hIgXlBUBLgtCr3cce47/CMePX0Rr08qtzz7+8k8TpfKGtcKq1jPZre7oObyjdWkGd628l7AXwvMCeL7HjO6qrS8S1E5kTE9tfbiur665ccU9EB1EF9Ep0WXesEZIJb9j5/b/XUtzNrt29Rw0og2lchmBVqLo8LSAHlCixbTpddGm8Y7pjkttCCUP+JQy3FiatNuxdvUx9F4ayopO/OL9sQeEN4oA/eHn577oWPbGVes11PsrUBxjDafze1Te1VzouqnK2TgmLQljQqmrnAsT+iaPVb5b2co7EC+QhBgUeM1R1AcrsGp9Jy6+4W8U3fZ8r+e3EnOI2uaAX3l+zgNB4O9rW5/B8tY5WGo9BtOrJ4uMfUl+uj0B8HTmPXj8Pex86xVEnTDBBSE2r78fX9i09RPyZfT2A5ceIMSPwDOH8JH7Kk5+fAHtR0Zh6MZ9e7534Wc3wgO0sXLhD9OpFOa0egjGMhguD8BgTJooMfPbV1h/umz25ondcFP90IzY2iTgrfY9uH31aqSc9CeSEHkBEyITv28M8XMGc2/z0HGCpWCs8BS/9sWrDYOrJuCBZ+vu5sUfXbicia5kYGzUw4DWTwJKbApSjHuTBBjT2H68zg0MD4KlEwabZi0Y7wd85u/3O9/B6sVrPlEXeiF9nMmRxPt6Qf4y/HyIbh3HwkdF1zefGt5fUwK8wP2WAGwh02MFE/5ogYr3Qg/STL0W3d8aB1ppa+Pw0uI2Tz6/134Mg+UoIGZlZ2HMLaJYHkPICr6//RBamvPj/UA4dYKsegGrXqAXMaqNsDT6SreOY5Gu/FptCeBFN+caAphGiKFiGaOjA3AJHoGt6r7GgNbjqjo5yQkBUVHQ8PaJExjiaZ2yue12nO27gCNdHSptvf/xGdw11I2UZSmvCIJgQiJMhoEfeqpNDvUSRvUB5hMX9fUecg0aBi+Hm2uaAz633bmbm1VN8+h07LfKJdkOkQB2fL4BTlsj8No4YLG2putMSjwjp3QNvZdH8YsiExV501isFjU30lpF7D8dVfCA8sFHp7BuWYtaIwiCsCrCSDVhh9IX8k0CoHsoMQ84FrfFAE3zQAK0VaLzO9tK79XKAxSj+aYALt3XLfNipZD1v492YexrE/sP0zBgUIQIoYaflAXbz16CzyY6YKqYl8uheTarRioD7xAxCQHUpv18L1Yud+Iloujtk4zQo9WZcKURqjbHclzKvj0Gvcw8UA6oY2WqonSuGQGb5I+TJgEFEsB4daXzc0eopabcX13W0BXwgAnRZL4Q62s8ppnR/pFz/QjF+tRvxeIsY/cizGwRt83P4czACL8HdA1JUivCNGVogvdkNkgaGDNe4CvXFyJ8n+B5XGLJ1FmJXJ53AzjZKgGbatkKL5c/liNWIPO8uM/4VO2uKCQZjLmBqQAGJ4EmI8NMabDTOuyUobYXmPlCEpiqA1IkYdWSBpjpEDl6wsrF9aAjqHNOPXDyXAGprAknY5B0btOGGk/GlfE1taqofCNuuYNIJ+omOiZ1rpUHtEYWjkpWoP5EWV2sb5isA7aIQTHHxaIniNADui8PIs0Eb6SY/Z0UQc+j+mXYuoM7Vy/Age7zkBUyCZGLhRLSOYcWpfXFA1wPhqup8JNKq5UkKeoqSHxPLSoqnUQtw5ioc60IyE/VkOji8mYE2nZELNgCXLaOkGDFJBg4OzCMDEcxCfAzS1pQX5fHSNDLClLGwmwzls6vQ09hGFJYegdZ1hha2bqIBNelB5Qjog02TzpFNVEquYpMuTSYr/lcQPKPJHoRQ8W1GYO3lDgpO9pPWTEZEQGnuodg5Hyk66Lyd8fKOQQ6gqyWict7GeuWz8HQyWEFw+bB7ksF3Nk2V1nfpZTLQqSLslzXlDmHpsQ1osVoy/Solwf/GpdErpaAQUqjWxL2GWcWaSfAMIis7RBwiuCdtD1OgmNHBJCg7r4uZBnbdjaaq+3YewB+USYicY8juYPnMtloqdCjG3f39eO+3JKIAFadSiiZigBdgdcqItMxsmZbIbvUIKlzzQjoEgLGRjU2KTp8AjRCkzEnAG0mtQh8Ku0oAqok8JzP+Lw0MkB3jpKjKpapaL5WKZxafDdBqoC6O8LtyMAQhoZdzG7MwLU8FUYKPINcl+qimismRj26v2I71I3jDxfdpM41I6CTsmG4X0djKyc8RYu9t0Vl2QJbBJ5xFPiICJIg1hdhR3fs5HnWeldleZXABLA98b7Y5HtjkgwNEtbTN4iFC5oI3I1CTsAbsfVjAizJB3Qbx9HphRp6eqr3TDprSYA0FI/3ntOxbpUNM2OjpEcE6HYEWkhIKw+ICeBxi+T09F1WZU+iJq2n8fRDf4Ymu3XSrcOIgg8H9uOFn31fNUVC0oddZ7B5YxtDwlTgo66SEici2fokwCJjju0hw7J54WypQsB7tSRAza+H+nld30Y+m2b7SS+Qn9PKFl1egRciHIfWpxC8x+7tdA97+3zUcNyWX4Ci/THOoD2x/hmlQTox+3gDjWYeg/4gmF853xjBpUsjaGnJR24fu36FNzX5pmfY7EPStlSLIgb6gwk616QRYk8tS88/l/2PT/loyqbQkEmhPpNGNp1CmvtieQHvONGtL4sdy9Hjp5kkpTWmSzM7L529hErHs0cCpt2qW00BymDV3JXSU8HkAXKIjtNnedxS48m4Mr5cR9YlMrx+XTqNRmbP2ZkMOjvHKir/PNa5pouiitFjH44iZ6YwO5tFAy+eo6SdpOUJyhBQTJR+HT9HYLJaFve0PqQmTQLaVOCdmIRIWE+wrmWTzG8iAugF7qgWjSWkGbYa32EjJQTkGFv5dBZNJKCeHdb77UPXZP1rWhKLZ4Rqjv2Fz86lLMNlpusCY9BnqTNUIyTgrVhhs7rVq2KoW2TSxWlXLOCqWX4svmpzZdEjWvgQcdVWPnu+i4ClUS+HyLIFnsVf/9eBduw8eKYy2D1XMxO8Jg+IB9wl+3s/uAC3qKMpXY88m/ecnUHaSis3Na8Ab1UtaCh3j1y+sm8m9o0J+9Fv9MR4Zhw6DufTWasOebsOs+xZKHJOtvtQtertulrwV+0BtH5yWvyW7CxubsCTX9+KUQZ4ga7qmdGUFmrya8QWHwcxlReMF8Mw4QETrR8oy7tq2ivH5Tvya8n8aXZMGc4An/nRDpy52FfR8b5KCJCImt8YkYF/KDtnegfwz3sPodGajQajCTk9z/4mQ6iphMWv9AA9IeMWdyYdn+gBkVc5amwHWV6lHvVaI2YZzfinN95Ngv/htcT/p31CRNbdV8l8e++xD5HPNeHxhx5Bgf18kTN5T1kvjBfEjGjBJCai4gnjHqAnlvqS8e9NeujEjEul/NokDbai4V/2voafHD1S0evdWLeb8ojMNyly5fS//ffbcD0L33j4K4RX4rtMh/UUGLXmr6BWXN9MEFAhYfzmZ6hcXI+TpISRH8061Ui68gTWGUJP4aU9P8ZrB39S+Xkx1ummPSMkbebnJcxU1jm4D5eGhvB7j32HJcpUJHhxLIfxTZpxwGa8eKrHC51a9Tmp+N5P1RsQ01cJAwEflHw8/+pfYn/HgaQ+n7/a1vd6k+BUS2XvVD401TXhu488gQ0r71QUuLJsrWT8mSYtfkBMm0BAmFhNrgDX4oRqqeaJMw4c6TyIv/qPP0Xf8KUJ6sXuP1XluuEEyGsD5TXKgsqBNQvW4RtbnkDb4ttJQlGt/IQqLMJE7tWqOSBZCSrL6dFSqq3AnzhzDC/tewHt5w4nr3suvgN0+P8o3TeegFe3vYDHtj+xhLt/Q3kkeW5d693YuuHXsWHZPcixW4tCwo+trVU9QEs8G6HFqW5kdBiHTu3H64dfxpGuK8r665Tv7tz2D6e/tP23cT0E1OA5QR2iiIbs1i9u/9qTPPC12CtwlIofjZVvW/BZ3LVsC5bPW4u5DQuxaPay2NpRIuy61IkLA+dw8hdHceDUPpw49z9TXUysvWPXtl3bQ4yQtMJ1a18DAsbvRO/atvM5DXXPPbp9yzP8+GXBXTkngKYBdTWvE5RXdm87+HQEfLh2T57UIAdM95Js9+04LKSDbLzG31+Omxpx9xfxKR6AukkhMP0aKuUHsag5VEzE3fGSddsUVu6KFzIE+H/iJry0mX+bu8VfMwTMEDBDwAwBMwTMEHALv/5XgAEASpR5N6rB30UAAAAASUVORK5CYII=";
  32133. this._callbackGamepadConnected = ongamedpadconnected;
  32134. if (this.gamepadSupportAvailable) {
  32135. // Checking if the gamepad connected event is supported (like in Firefox)
  32136. if (this.gamepadEventSupported) {
  32137. window.addEventListener('gamepadconnected', function (evt) {
  32138. _this._onGamepadConnected(evt);
  32139. }, false);
  32140. window.addEventListener('gamepaddisconnected', function (evt) {
  32141. _this._onGamepadDisconnected(evt);
  32142. }, false);
  32143. }
  32144. else {
  32145. this._startMonitoringGamepads();
  32146. }
  32147. if (!this.oneGamepadConnected) {
  32148. this._insertGamepadDOMInstructions();
  32149. }
  32150. }
  32151. else {
  32152. this._insertGamepadDOMNotSupported();
  32153. }
  32154. }
  32155. Gamepads.prototype._insertGamepadDOMInstructions = function () {
  32156. Gamepads.gamepadDOMInfo = document.createElement("div");
  32157. var buttonAImage = document.createElement("img");
  32158. buttonAImage.src = this.buttonADataURL;
  32159. var spanMessage = document.createElement("span");
  32160. spanMessage.innerHTML = "<strong>to activate gamepad</strong>";
  32161. Gamepads.gamepadDOMInfo.appendChild(buttonAImage);
  32162. Gamepads.gamepadDOMInfo.appendChild(spanMessage);
  32163. Gamepads.gamepadDOMInfo.style.position = "absolute";
  32164. Gamepads.gamepadDOMInfo.style.width = "100%";
  32165. Gamepads.gamepadDOMInfo.style.height = "48px";
  32166. Gamepads.gamepadDOMInfo.style.bottom = "0px";
  32167. Gamepads.gamepadDOMInfo.style.backgroundColor = "rgba(1, 1, 1, 0.15)";
  32168. Gamepads.gamepadDOMInfo.style.textAlign = "center";
  32169. Gamepads.gamepadDOMInfo.style.zIndex = "10";
  32170. buttonAImage.style.position = "relative";
  32171. buttonAImage.style.bottom = "8px";
  32172. spanMessage.style.position = "relative";
  32173. spanMessage.style.fontSize = "32px";
  32174. spanMessage.style.bottom = "32px";
  32175. spanMessage.style.color = "green";
  32176. document.body.appendChild(Gamepads.gamepadDOMInfo);
  32177. };
  32178. Gamepads.prototype._insertGamepadDOMNotSupported = function () {
  32179. Gamepads.gamepadDOMInfo = document.createElement("div");
  32180. var spanMessage = document.createElement("span");
  32181. spanMessage.innerHTML = "<strong>gamepad not supported</strong>";
  32182. Gamepads.gamepadDOMInfo.appendChild(spanMessage);
  32183. Gamepads.gamepadDOMInfo.style.position = "absolute";
  32184. Gamepads.gamepadDOMInfo.style.width = "100%";
  32185. Gamepads.gamepadDOMInfo.style.height = "40px";
  32186. Gamepads.gamepadDOMInfo.style.bottom = "0px";
  32187. Gamepads.gamepadDOMInfo.style.backgroundColor = "rgba(1, 1, 1, 0.15)";
  32188. Gamepads.gamepadDOMInfo.style.textAlign = "center";
  32189. Gamepads.gamepadDOMInfo.style.zIndex = "10";
  32190. spanMessage.style.position = "relative";
  32191. spanMessage.style.fontSize = "32px";
  32192. spanMessage.style.color = "red";
  32193. document.body.appendChild(Gamepads.gamepadDOMInfo);
  32194. };
  32195. Gamepads.prototype.dispose = function () {
  32196. if (Gamepads.gamepadDOMInfo) {
  32197. document.body.removeChild(Gamepads.gamepadDOMInfo);
  32198. }
  32199. };
  32200. Gamepads.prototype._onGamepadConnected = function (evt) {
  32201. var newGamepad = this._addNewGamepad(evt.gamepad);
  32202. if (this._callbackGamepadConnected)
  32203. this._callbackGamepadConnected(newGamepad);
  32204. this._startMonitoringGamepads();
  32205. };
  32206. Gamepads.prototype._addNewGamepad = function (gamepad) {
  32207. if (!this.oneGamepadConnected) {
  32208. this.oneGamepadConnected = true;
  32209. if (Gamepads.gamepadDOMInfo) {
  32210. document.body.removeChild(Gamepads.gamepadDOMInfo);
  32211. Gamepads.gamepadDOMInfo = null;
  32212. }
  32213. }
  32214. var newGamepad;
  32215. if (gamepad.id.search("Xbox 360") !== -1 || gamepad.id.search("xinput") !== -1) {
  32216. newGamepad = new Xbox360Pad(gamepad.id, gamepad.index, gamepad);
  32217. }
  32218. else {
  32219. newGamepad = new GenericPad(gamepad.id, gamepad.index, gamepad);
  32220. }
  32221. this.babylonGamepads.push(newGamepad);
  32222. return newGamepad;
  32223. };
  32224. Gamepads.prototype._onGamepadDisconnected = function (evt) {
  32225. // Remove the gamepad from the list of gamepads to monitor.
  32226. for (var i in this.babylonGamepads) {
  32227. if (this.babylonGamepads[i].index == evt.gamepad.index) {
  32228. this.babylonGamepads.splice(i, 1);
  32229. break;
  32230. }
  32231. }
  32232. // If no gamepads are left, stop the polling loop.
  32233. if (this.babylonGamepads.length == 0) {
  32234. this._stopMonitoringGamepads();
  32235. }
  32236. };
  32237. Gamepads.prototype._startMonitoringGamepads = function () {
  32238. if (!this.isMonitoring) {
  32239. this.isMonitoring = true;
  32240. this._checkGamepadsStatus();
  32241. }
  32242. };
  32243. Gamepads.prototype._stopMonitoringGamepads = function () {
  32244. this.isMonitoring = false;
  32245. };
  32246. Gamepads.prototype._checkGamepadsStatus = function () {
  32247. var _this = this;
  32248. // updating gamepad objects
  32249. this._updateGamepadObjects();
  32250. for (var i in this.babylonGamepads) {
  32251. this.babylonGamepads[i].update();
  32252. }
  32253. if (this.isMonitoring) {
  32254. if (window.requestAnimationFrame) {
  32255. window.requestAnimationFrame(function () { _this._checkGamepadsStatus(); });
  32256. }
  32257. else if (window.mozRequestAnimationFrame) {
  32258. window.mozRequestAnimationFrame(function () { _this._checkGamepadsStatus(); });
  32259. }
  32260. else if (window.webkitRequestAnimationFrame) {
  32261. window.webkitRequestAnimationFrame(function () { _this._checkGamepadsStatus(); });
  32262. }
  32263. }
  32264. };
  32265. // This function is called only on Chrome, which does not yet support
  32266. // connection/disconnection events, but requires you to monitor
  32267. // an array for changes.
  32268. Gamepads.prototype._updateGamepadObjects = function () {
  32269. var gamepads = navigator.getGamepads ? navigator.getGamepads() : (navigator.webkitGetGamepads ? navigator.webkitGetGamepads() : []);
  32270. for (var i = 0; i < gamepads.length; i++) {
  32271. if (gamepads[i]) {
  32272. if (!(gamepads[i].index in this.babylonGamepads)) {
  32273. var newGamepad = this._addNewGamepad(gamepads[i]);
  32274. if (this._callbackGamepadConnected) {
  32275. this._callbackGamepadConnected(newGamepad);
  32276. }
  32277. }
  32278. else {
  32279. this.babylonGamepads[i].browserGamepad = gamepads[i];
  32280. }
  32281. }
  32282. }
  32283. };
  32284. return Gamepads;
  32285. })();
  32286. BABYLON.Gamepads = Gamepads;
  32287. var StickValues = (function () {
  32288. function StickValues(x, y) {
  32289. this.x = x;
  32290. this.y = y;
  32291. }
  32292. return StickValues;
  32293. })();
  32294. BABYLON.StickValues = StickValues;
  32295. var Gamepad = (function () {
  32296. function Gamepad(id, index, browserGamepad) {
  32297. this.id = id;
  32298. this.index = index;
  32299. this.browserGamepad = browserGamepad;
  32300. if (this.browserGamepad.axes.length >= 2) {
  32301. this._leftStick = { x: this.browserGamepad.axes[0], y: this.browserGamepad.axes[1] };
  32302. }
  32303. if (this.browserGamepad.axes.length >= 4) {
  32304. this._rightStick = { x: this.browserGamepad.axes[2], y: this.browserGamepad.axes[3] };
  32305. }
  32306. }
  32307. Gamepad.prototype.onleftstickchanged = function (callback) {
  32308. this._onleftstickchanged = callback;
  32309. };
  32310. Gamepad.prototype.onrightstickchanged = function (callback) {
  32311. this._onrightstickchanged = callback;
  32312. };
  32313. Object.defineProperty(Gamepad.prototype, "leftStick", {
  32314. get: function () {
  32315. return this._leftStick;
  32316. },
  32317. set: function (newValues) {
  32318. if (this._onleftstickchanged && (this._leftStick.x !== newValues.x || this._leftStick.y !== newValues.y)) {
  32319. this._onleftstickchanged(newValues);
  32320. }
  32321. this._leftStick = newValues;
  32322. },
  32323. enumerable: true,
  32324. configurable: true
  32325. });
  32326. Object.defineProperty(Gamepad.prototype, "rightStick", {
  32327. get: function () {
  32328. return this._rightStick;
  32329. },
  32330. set: function (newValues) {
  32331. if (this._onrightstickchanged && (this._rightStick.x !== newValues.x || this._rightStick.y !== newValues.y)) {
  32332. this._onrightstickchanged(newValues);
  32333. }
  32334. this._rightStick = newValues;
  32335. },
  32336. enumerable: true,
  32337. configurable: true
  32338. });
  32339. Gamepad.prototype.update = function () {
  32340. if (this._leftStick) {
  32341. this.leftStick = { x: this.browserGamepad.axes[0], y: this.browserGamepad.axes[1] };
  32342. }
  32343. if (this._rightStick) {
  32344. this.rightStick = { x: this.browserGamepad.axes[2], y: this.browserGamepad.axes[3] };
  32345. }
  32346. };
  32347. return Gamepad;
  32348. })();
  32349. BABYLON.Gamepad = Gamepad;
  32350. var GenericPad = (function (_super) {
  32351. __extends(GenericPad, _super);
  32352. function GenericPad(id, index, gamepad) {
  32353. _super.call(this, id, index, gamepad);
  32354. this.id = id;
  32355. this.index = index;
  32356. this.gamepad = gamepad;
  32357. this._buttons = new Array(gamepad.buttons.length);
  32358. }
  32359. GenericPad.prototype.onbuttondown = function (callback) {
  32360. this._onbuttondown = callback;
  32361. };
  32362. GenericPad.prototype.onbuttonup = function (callback) {
  32363. this._onbuttonup = callback;
  32364. };
  32365. GenericPad.prototype._setButtonValue = function (newValue, currentValue, buttonIndex) {
  32366. if (newValue !== currentValue) {
  32367. if (this._onbuttondown && newValue === 1) {
  32368. this._onbuttondown(buttonIndex);
  32369. }
  32370. if (this._onbuttonup && newValue === 0) {
  32371. this._onbuttonup(buttonIndex);
  32372. }
  32373. }
  32374. return newValue;
  32375. };
  32376. GenericPad.prototype.update = function () {
  32377. _super.prototype.update.call(this);
  32378. for (var index = 0; index < this._buttons.length; index++) {
  32379. this._buttons[index] = this._setButtonValue(this.gamepad.buttons[index].value, this._buttons[index], index);
  32380. }
  32381. };
  32382. return GenericPad;
  32383. })(Gamepad);
  32384. BABYLON.GenericPad = GenericPad;
  32385. (function (Xbox360Button) {
  32386. Xbox360Button[Xbox360Button["A"] = 0] = "A";
  32387. Xbox360Button[Xbox360Button["B"] = 1] = "B";
  32388. Xbox360Button[Xbox360Button["X"] = 2] = "X";
  32389. Xbox360Button[Xbox360Button["Y"] = 3] = "Y";
  32390. Xbox360Button[Xbox360Button["Start"] = 4] = "Start";
  32391. Xbox360Button[Xbox360Button["Back"] = 5] = "Back";
  32392. Xbox360Button[Xbox360Button["LB"] = 6] = "LB";
  32393. Xbox360Button[Xbox360Button["RB"] = 7] = "RB";
  32394. Xbox360Button[Xbox360Button["LeftStick"] = 8] = "LeftStick";
  32395. Xbox360Button[Xbox360Button["RightStick"] = 9] = "RightStick";
  32396. })(BABYLON.Xbox360Button || (BABYLON.Xbox360Button = {}));
  32397. var Xbox360Button = BABYLON.Xbox360Button;
  32398. (function (Xbox360Dpad) {
  32399. Xbox360Dpad[Xbox360Dpad["Up"] = 0] = "Up";
  32400. Xbox360Dpad[Xbox360Dpad["Down"] = 1] = "Down";
  32401. Xbox360Dpad[Xbox360Dpad["Left"] = 2] = "Left";
  32402. Xbox360Dpad[Xbox360Dpad["Right"] = 3] = "Right";
  32403. })(BABYLON.Xbox360Dpad || (BABYLON.Xbox360Dpad = {}));
  32404. var Xbox360Dpad = BABYLON.Xbox360Dpad;
  32405. var Xbox360Pad = (function (_super) {
  32406. __extends(Xbox360Pad, _super);
  32407. function Xbox360Pad() {
  32408. _super.apply(this, arguments);
  32409. this._leftTrigger = 0;
  32410. this._rightTrigger = 0;
  32411. this._buttonA = 0;
  32412. this._buttonB = 0;
  32413. this._buttonX = 0;
  32414. this._buttonY = 0;
  32415. this._buttonBack = 0;
  32416. this._buttonStart = 0;
  32417. this._buttonLB = 0;
  32418. this._buttonRB = 0;
  32419. this._buttonLeftStick = 0;
  32420. this._buttonRightStick = 0;
  32421. this._dPadUp = 0;
  32422. this._dPadDown = 0;
  32423. this._dPadLeft = 0;
  32424. this._dPadRight = 0;
  32425. }
  32426. Xbox360Pad.prototype.onlefttriggerchanged = function (callback) {
  32427. this._onlefttriggerchanged = callback;
  32428. };
  32429. Xbox360Pad.prototype.onrighttriggerchanged = function (callback) {
  32430. this._onrighttriggerchanged = callback;
  32431. };
  32432. Object.defineProperty(Xbox360Pad.prototype, "leftTrigger", {
  32433. get: function () {
  32434. return this._leftTrigger;
  32435. },
  32436. set: function (newValue) {
  32437. if (this._onlefttriggerchanged && this._leftTrigger !== newValue) {
  32438. this._onlefttriggerchanged(newValue);
  32439. }
  32440. this._leftTrigger = newValue;
  32441. },
  32442. enumerable: true,
  32443. configurable: true
  32444. });
  32445. Object.defineProperty(Xbox360Pad.prototype, "rightTrigger", {
  32446. get: function () {
  32447. return this._rightTrigger;
  32448. },
  32449. set: function (newValue) {
  32450. if (this._onrighttriggerchanged && this._rightTrigger !== newValue) {
  32451. this._onrighttriggerchanged(newValue);
  32452. }
  32453. this._rightTrigger = newValue;
  32454. },
  32455. enumerable: true,
  32456. configurable: true
  32457. });
  32458. Xbox360Pad.prototype.onbuttondown = function (callback) {
  32459. this._onbuttondown = callback;
  32460. };
  32461. Xbox360Pad.prototype.onbuttonup = function (callback) {
  32462. this._onbuttonup = callback;
  32463. };
  32464. Xbox360Pad.prototype.ondpaddown = function (callback) {
  32465. this._ondpaddown = callback;
  32466. };
  32467. Xbox360Pad.prototype.ondpadup = function (callback) {
  32468. this._ondpadup = callback;
  32469. };
  32470. Xbox360Pad.prototype._setButtonValue = function (newValue, currentValue, buttonType) {
  32471. if (newValue !== currentValue) {
  32472. if (this._onbuttondown && newValue === 1) {
  32473. this._onbuttondown(buttonType);
  32474. }
  32475. if (this._onbuttonup && newValue === 0) {
  32476. this._onbuttonup(buttonType);
  32477. }
  32478. }
  32479. return newValue;
  32480. };
  32481. Xbox360Pad.prototype._setDPadValue = function (newValue, currentValue, buttonType) {
  32482. if (newValue !== currentValue) {
  32483. if (this._ondpaddown && newValue === 1) {
  32484. this._ondpaddown(buttonType);
  32485. }
  32486. if (this._ondpadup && newValue === 0) {
  32487. this._ondpadup(buttonType);
  32488. }
  32489. }
  32490. return newValue;
  32491. };
  32492. Object.defineProperty(Xbox360Pad.prototype, "buttonA", {
  32493. get: function () {
  32494. return this._buttonA;
  32495. },
  32496. set: function (value) {
  32497. this._buttonA = this._setButtonValue(value, this._buttonA, Xbox360Button.A);
  32498. },
  32499. enumerable: true,
  32500. configurable: true
  32501. });
  32502. Object.defineProperty(Xbox360Pad.prototype, "buttonB", {
  32503. get: function () {
  32504. return this._buttonB;
  32505. },
  32506. set: function (value) {
  32507. this._buttonB = this._setButtonValue(value, this._buttonB, Xbox360Button.B);
  32508. },
  32509. enumerable: true,
  32510. configurable: true
  32511. });
  32512. Object.defineProperty(Xbox360Pad.prototype, "buttonX", {
  32513. get: function () {
  32514. return this._buttonX;
  32515. },
  32516. set: function (value) {
  32517. this._buttonX = this._setButtonValue(value, this._buttonX, Xbox360Button.X);
  32518. },
  32519. enumerable: true,
  32520. configurable: true
  32521. });
  32522. Object.defineProperty(Xbox360Pad.prototype, "buttonY", {
  32523. get: function () {
  32524. return this._buttonY;
  32525. },
  32526. set: function (value) {
  32527. this._buttonY = this._setButtonValue(value, this._buttonY, Xbox360Button.Y);
  32528. },
  32529. enumerable: true,
  32530. configurable: true
  32531. });
  32532. Object.defineProperty(Xbox360Pad.prototype, "buttonStart", {
  32533. get: function () {
  32534. return this._buttonStart;
  32535. },
  32536. set: function (value) {
  32537. this._buttonStart = this._setButtonValue(value, this._buttonStart, Xbox360Button.Start);
  32538. },
  32539. enumerable: true,
  32540. configurable: true
  32541. });
  32542. Object.defineProperty(Xbox360Pad.prototype, "buttonBack", {
  32543. get: function () {
  32544. return this._buttonBack;
  32545. },
  32546. set: function (value) {
  32547. this._buttonBack = this._setButtonValue(value, this._buttonBack, Xbox360Button.Back);
  32548. },
  32549. enumerable: true,
  32550. configurable: true
  32551. });
  32552. Object.defineProperty(Xbox360Pad.prototype, "buttonLB", {
  32553. get: function () {
  32554. return this._buttonLB;
  32555. },
  32556. set: function (value) {
  32557. this._buttonLB = this._setButtonValue(value, this._buttonLB, Xbox360Button.LB);
  32558. },
  32559. enumerable: true,
  32560. configurable: true
  32561. });
  32562. Object.defineProperty(Xbox360Pad.prototype, "buttonRB", {
  32563. get: function () {
  32564. return this._buttonRB;
  32565. },
  32566. set: function (value) {
  32567. this._buttonRB = this._setButtonValue(value, this._buttonRB, Xbox360Button.RB);
  32568. },
  32569. enumerable: true,
  32570. configurable: true
  32571. });
  32572. Object.defineProperty(Xbox360Pad.prototype, "buttonLeftStick", {
  32573. get: function () {
  32574. return this._buttonLeftStick;
  32575. },
  32576. set: function (value) {
  32577. this._buttonLeftStick = this._setButtonValue(value, this._buttonLeftStick, Xbox360Button.LeftStick);
  32578. },
  32579. enumerable: true,
  32580. configurable: true
  32581. });
  32582. Object.defineProperty(Xbox360Pad.prototype, "buttonRightStick", {
  32583. get: function () {
  32584. return this._buttonRightStick;
  32585. },
  32586. set: function (value) {
  32587. this._buttonRightStick = this._setButtonValue(value, this._buttonRightStick, Xbox360Button.RightStick);
  32588. },
  32589. enumerable: true,
  32590. configurable: true
  32591. });
  32592. Object.defineProperty(Xbox360Pad.prototype, "dPadUp", {
  32593. get: function () {
  32594. return this._dPadUp;
  32595. },
  32596. set: function (value) {
  32597. this._dPadUp = this._setDPadValue(value, this._dPadUp, Xbox360Dpad.Up);
  32598. },
  32599. enumerable: true,
  32600. configurable: true
  32601. });
  32602. Object.defineProperty(Xbox360Pad.prototype, "dPadDown", {
  32603. get: function () {
  32604. return this._dPadDown;
  32605. },
  32606. set: function (value) {
  32607. this._dPadDown = this._setDPadValue(value, this._dPadDown, Xbox360Dpad.Down);
  32608. },
  32609. enumerable: true,
  32610. configurable: true
  32611. });
  32612. Object.defineProperty(Xbox360Pad.prototype, "dPadLeft", {
  32613. get: function () {
  32614. return this._dPadLeft;
  32615. },
  32616. set: function (value) {
  32617. this._dPadLeft = this._setDPadValue(value, this._dPadLeft, Xbox360Dpad.Left);
  32618. },
  32619. enumerable: true,
  32620. configurable: true
  32621. });
  32622. Object.defineProperty(Xbox360Pad.prototype, "dPadRight", {
  32623. get: function () {
  32624. return this._dPadRight;
  32625. },
  32626. set: function (value) {
  32627. this._dPadRight = this._setDPadValue(value, this._dPadRight, Xbox360Dpad.Right);
  32628. },
  32629. enumerable: true,
  32630. configurable: true
  32631. });
  32632. Xbox360Pad.prototype.update = function () {
  32633. _super.prototype.update.call(this);
  32634. this.buttonA = this.browserGamepad.buttons[0].value;
  32635. this.buttonB = this.browserGamepad.buttons[1].value;
  32636. this.buttonX = this.browserGamepad.buttons[2].value;
  32637. this.buttonY = this.browserGamepad.buttons[3].value;
  32638. this.buttonLB = this.browserGamepad.buttons[4].value;
  32639. this.buttonRB = this.browserGamepad.buttons[5].value;
  32640. this.leftTrigger = this.browserGamepad.buttons[6].value;
  32641. this.rightTrigger = this.browserGamepad.buttons[7].value;
  32642. this.buttonBack = this.browserGamepad.buttons[8].value;
  32643. this.buttonStart = this.browserGamepad.buttons[9].value;
  32644. this.buttonLeftStick = this.browserGamepad.buttons[10].value;
  32645. this.buttonRightStick = this.browserGamepad.buttons[11].value;
  32646. this.dPadUp = this.browserGamepad.buttons[12].value;
  32647. this.dPadDown = this.browserGamepad.buttons[13].value;
  32648. this.dPadLeft = this.browserGamepad.buttons[14].value;
  32649. this.dPadRight = this.browserGamepad.buttons[15].value;
  32650. };
  32651. return Xbox360Pad;
  32652. })(Gamepad);
  32653. BABYLON.Xbox360Pad = Xbox360Pad;
  32654. })(BABYLON || (BABYLON = {}));
  32655. var BABYLON;
  32656. (function (BABYLON) {
  32657. // We're mainly based on the logic defined into the FreeCamera code
  32658. var GamepadCamera = (function (_super) {
  32659. __extends(GamepadCamera, _super);
  32660. function GamepadCamera(name, position, scene) {
  32661. var _this = this;
  32662. _super.call(this, name, position, scene);
  32663. this.angularSensibility = 200;
  32664. this.moveSensibility = 75;
  32665. this._gamepads = new BABYLON.Gamepads(function (gamepad) { _this._onNewGameConnected(gamepad); });
  32666. }
  32667. GamepadCamera.prototype._onNewGameConnected = function (gamepad) {
  32668. // Only the first gamepad can control the camera
  32669. if (gamepad.index === 0) {
  32670. this._gamepad = gamepad;
  32671. }
  32672. };
  32673. GamepadCamera.prototype._checkInputs = function () {
  32674. if (this._gamepad) {
  32675. var LSValues = this._gamepad.leftStick;
  32676. var normalizedLX = LSValues.x / this.moveSensibility;
  32677. var normalizedLY = LSValues.y / this.moveSensibility;
  32678. LSValues.x = Math.abs(normalizedLX) > 0.005 ? 0 + normalizedLX : 0;
  32679. LSValues.y = Math.abs(normalizedLY) > 0.005 ? 0 + normalizedLY : 0;
  32680. var RSValues = this._gamepad.rightStick;
  32681. var normalizedRX = RSValues.x / this.angularSensibility;
  32682. var normalizedRY = RSValues.y / this.angularSensibility;
  32683. RSValues.x = Math.abs(normalizedRX) > 0.001 ? 0 + normalizedRX : 0;
  32684. RSValues.y = Math.abs(normalizedRY) > 0.001 ? 0 + normalizedRY : 0;
  32685. var cameraTransform = BABYLON.Matrix.RotationYawPitchRoll(this.rotation.y, this.rotation.x, 0);
  32686. var speed = this._computeLocalCameraSpeed() * 50.0;
  32687. var deltaTransform = BABYLON.Vector3.TransformCoordinates(new BABYLON.Vector3(LSValues.x * speed, 0, -LSValues.y * speed), cameraTransform);
  32688. this.cameraDirection = this.cameraDirection.add(deltaTransform);
  32689. this.cameraRotation = this.cameraRotation.add(new BABYLON.Vector2(RSValues.y, RSValues.x));
  32690. }
  32691. _super.prototype._checkInputs.call(this);
  32692. };
  32693. GamepadCamera.prototype.dispose = function () {
  32694. this._gamepads.dispose();
  32695. _super.prototype.dispose.call(this);
  32696. };
  32697. return GamepadCamera;
  32698. })(BABYLON.FreeCamera);
  32699. BABYLON.GamepadCamera = GamepadCamera;
  32700. })(BABYLON || (BABYLON = {}));
  32701. var BABYLON;
  32702. (function (BABYLON) {
  32703. var Analyser = (function () {
  32704. function Analyser(scene) {
  32705. this.SMOOTHING = 0.75;
  32706. this.FFT_SIZE = 512;
  32707. this.BARGRAPHAMPLITUDE = 256;
  32708. this.DEBUGCANVASPOS = { x: 20, y: 20 };
  32709. this.DEBUGCANVASSIZE = { width: 320, height: 200 };
  32710. this._scene = scene;
  32711. this._audioEngine = BABYLON.Engine.audioEngine;
  32712. if (this._audioEngine.canUseWebAudio) {
  32713. this._webAudioAnalyser = this._audioEngine.audioContext.createAnalyser();
  32714. this._webAudioAnalyser.minDecibels = -140;
  32715. this._webAudioAnalyser.maxDecibels = 0;
  32716. this._byteFreqs = new Uint8Array(this._webAudioAnalyser.frequencyBinCount);
  32717. this._byteTime = new Uint8Array(this._webAudioAnalyser.frequencyBinCount);
  32718. this._floatFreqs = new Float32Array(this._webAudioAnalyser.frequencyBinCount);
  32719. }
  32720. }
  32721. Analyser.prototype.getFrequencyBinCount = function () {
  32722. if (this._audioEngine.canUseWebAudio) {
  32723. return this._webAudioAnalyser.frequencyBinCount;
  32724. }
  32725. else {
  32726. return 0;
  32727. }
  32728. };
  32729. Analyser.prototype.getByteFrequencyData = function () {
  32730. if (this._audioEngine.canUseWebAudio) {
  32731. this._webAudioAnalyser.smoothingTimeConstant = this.SMOOTHING;
  32732. this._webAudioAnalyser.fftSize = this.FFT_SIZE;
  32733. this._webAudioAnalyser.getByteFrequencyData(this._byteFreqs);
  32734. }
  32735. return this._byteFreqs;
  32736. };
  32737. Analyser.prototype.getByteTimeDomainData = function () {
  32738. if (this._audioEngine.canUseWebAudio) {
  32739. this._webAudioAnalyser.smoothingTimeConstant = this.SMOOTHING;
  32740. this._webAudioAnalyser.fftSize = this.FFT_SIZE;
  32741. this._webAudioAnalyser.getByteTimeDomainData(this._byteTime);
  32742. }
  32743. return this._byteTime;
  32744. };
  32745. Analyser.prototype.getFloatFrequencyData = function () {
  32746. if (this._audioEngine.canUseWebAudio) {
  32747. this._webAudioAnalyser.smoothingTimeConstant = this.SMOOTHING;
  32748. this._webAudioAnalyser.fftSize = this.FFT_SIZE;
  32749. this._webAudioAnalyser.getFloatFrequencyData(this._floatFreqs);
  32750. }
  32751. return this._floatFreqs;
  32752. };
  32753. Analyser.prototype.drawDebugCanvas = function () {
  32754. var _this = this;
  32755. if (this._audioEngine.canUseWebAudio) {
  32756. if (!this._debugCanvas) {
  32757. this._debugCanvas = document.createElement("canvas");
  32758. this._debugCanvas.width = this.DEBUGCANVASSIZE.width;
  32759. this._debugCanvas.height = this.DEBUGCANVASSIZE.height;
  32760. this._debugCanvas.style.position = "absolute";
  32761. this._debugCanvas.style.top = this.DEBUGCANVASPOS.y + "px";
  32762. this._debugCanvas.style.left = this.DEBUGCANVASPOS.x + "px";
  32763. this._debugCanvasContext = this._debugCanvas.getContext("2d");
  32764. document.body.appendChild(this._debugCanvas);
  32765. this._registerFunc = function () {
  32766. _this.drawDebugCanvas();
  32767. };
  32768. this._scene.registerBeforeRender(this._registerFunc);
  32769. }
  32770. if (this._registerFunc) {
  32771. var workingArray = this.getByteFrequencyData();
  32772. this._debugCanvasContext.fillStyle = 'rgb(0, 0, 0)';
  32773. this._debugCanvasContext.fillRect(0, 0, this.DEBUGCANVASSIZE.width, this.DEBUGCANVASSIZE.height);
  32774. // Draw the frequency domain chart.
  32775. for (var i = 0; i < this.getFrequencyBinCount(); i++) {
  32776. var value = workingArray[i];
  32777. var percent = value / this.BARGRAPHAMPLITUDE;
  32778. var height = this.DEBUGCANVASSIZE.height * percent;
  32779. var offset = this.DEBUGCANVASSIZE.height - height - 1;
  32780. var barWidth = this.DEBUGCANVASSIZE.width / this.getFrequencyBinCount();
  32781. var hue = i / this.getFrequencyBinCount() * 360;
  32782. this._debugCanvasContext.fillStyle = 'hsl(' + hue + ', 100%, 50%)';
  32783. this._debugCanvasContext.fillRect(i * barWidth, offset, barWidth, height);
  32784. }
  32785. }
  32786. }
  32787. };
  32788. Analyser.prototype.stopDebugCanvas = function () {
  32789. if (this._debugCanvas) {
  32790. this._scene.unregisterBeforeRender(this._registerFunc);
  32791. this._registerFunc = null;
  32792. document.body.removeChild(this._debugCanvas);
  32793. this._debugCanvas = null;
  32794. this._debugCanvasContext = null;
  32795. }
  32796. };
  32797. Analyser.prototype.connectAudioNodes = function (inputAudioNode, outputAudioNode) {
  32798. if (this._audioEngine.canUseWebAudio) {
  32799. inputAudioNode.connect(this._webAudioAnalyser);
  32800. this._webAudioAnalyser.connect(outputAudioNode);
  32801. }
  32802. };
  32803. Analyser.prototype.dispose = function () {
  32804. if (this._audioEngine.canUseWebAudio) {
  32805. this._webAudioAnalyser.disconnect();
  32806. }
  32807. };
  32808. return Analyser;
  32809. })();
  32810. BABYLON.Analyser = Analyser;
  32811. })(BABYLON || (BABYLON = {}));
  32812. var BABYLON;
  32813. (function (BABYLON) {
  32814. var AudioEngine = (function () {
  32815. function AudioEngine() {
  32816. this._audioContext = null;
  32817. this._audioContextInitialized = false;
  32818. this.canUseWebAudio = false;
  32819. this.WarnedWebAudioUnsupported = false;
  32820. if (typeof window.AudioContext !== 'undefined' || typeof window.webkitAudioContext !== 'undefined') {
  32821. window.AudioContext = window.AudioContext || window.webkitAudioContext;
  32822. this.canUseWebAudio = true;
  32823. }
  32824. }
  32825. Object.defineProperty(AudioEngine.prototype, "audioContext", {
  32826. get: function () {
  32827. if (!this._audioContextInitialized) {
  32828. this._initializeAudioContext();
  32829. }
  32830. return this._audioContext;
  32831. },
  32832. enumerable: true,
  32833. configurable: true
  32834. });
  32835. AudioEngine.prototype._initializeAudioContext = function () {
  32836. try {
  32837. if (this.canUseWebAudio) {
  32838. this._audioContext = new AudioContext();
  32839. // create a global volume gain node
  32840. this.masterGain = this._audioContext.createGain();
  32841. this.masterGain.gain.value = 1;
  32842. this.masterGain.connect(this._audioContext.destination);
  32843. this._audioContextInitialized = true;
  32844. }
  32845. }
  32846. catch (e) {
  32847. this.canUseWebAudio = false;
  32848. BABYLON.Tools.Error("Web Audio: " + e.message);
  32849. }
  32850. };
  32851. AudioEngine.prototype.dispose = function () {
  32852. if (this.canUseWebAudio && this._audioContextInitialized) {
  32853. if (this._connectedAnalyser) {
  32854. this._connectedAnalyser.stopDebugCanvas();
  32855. this._connectedAnalyser.dispose();
  32856. this.masterGain.disconnect();
  32857. this.masterGain.connect(this._audioContext.destination);
  32858. this._connectedAnalyser = null;
  32859. }
  32860. this.masterGain.gain.value = 1;
  32861. }
  32862. this.WarnedWebAudioUnsupported = false;
  32863. };
  32864. AudioEngine.prototype.getGlobalVolume = function () {
  32865. if (this.canUseWebAudio && this._audioContextInitialized) {
  32866. return this.masterGain.gain.value;
  32867. }
  32868. else {
  32869. return -1;
  32870. }
  32871. };
  32872. AudioEngine.prototype.setGlobalVolume = function (newVolume) {
  32873. if (this.canUseWebAudio && this._audioContextInitialized) {
  32874. this.masterGain.gain.value = newVolume;
  32875. }
  32876. };
  32877. AudioEngine.prototype.connectToAnalyser = function (analyser) {
  32878. if (this._connectedAnalyser) {
  32879. this._connectedAnalyser.stopDebugCanvas();
  32880. }
  32881. if (this.canUseWebAudio && this._audioContextInitialized) {
  32882. this._connectedAnalyser = analyser;
  32883. this.masterGain.disconnect();
  32884. this._connectedAnalyser.connectAudioNodes(this.masterGain, this._audioContext.destination);
  32885. }
  32886. };
  32887. return AudioEngine;
  32888. })();
  32889. BABYLON.AudioEngine = AudioEngine;
  32890. })(BABYLON || (BABYLON = {}));
  32891. var BABYLON;
  32892. (function (BABYLON) {
  32893. var Sound = (function () {
  32894. /**
  32895. * Create a sound and attach it to a scene
  32896. * @param name Name of your sound
  32897. * @param urlOrArrayBuffer Url to the sound to load async or ArrayBuffer
  32898. * @param readyToPlayCallback Provide a callback function if you'd like to load your code once the sound is ready to be played
  32899. * @param options Objects to provide with the current available options: autoplay, loop, volume, spatialSound, maxDistance, rolloffFactor, refDistance, distanceModel, panningModel
  32900. */
  32901. function Sound(name, urlOrArrayBuffer, scene, readyToPlayCallback, options) {
  32902. var _this = this;
  32903. this.autoplay = false;
  32904. this.loop = false;
  32905. this.useCustomAttenuation = false;
  32906. this.spatialSound = false;
  32907. this.refDistance = 1;
  32908. this.rolloffFactor = 1;
  32909. this.maxDistance = 100;
  32910. this.distanceModel = "linear";
  32911. this._panningModel = "equalpower";
  32912. this._playbackRate = 1;
  32913. this._startTime = 0;
  32914. this._startOffset = 0;
  32915. this._position = BABYLON.Vector3.Zero();
  32916. this._localDirection = new BABYLON.Vector3(1, 0, 0);
  32917. this._volume = 1;
  32918. this._isLoaded = false;
  32919. this._isReadyToPlay = false;
  32920. this.isPlaying = false;
  32921. this.isPaused = false;
  32922. this._isDirectional = false;
  32923. // Used if you'd like to create a directional sound.
  32924. // If not set, the sound will be omnidirectional
  32925. this._coneInnerAngle = 360;
  32926. this._coneOuterAngle = 360;
  32927. this._coneOuterGain = 0;
  32928. this._isOutputConnected = false;
  32929. this.name = name;
  32930. this._scene = scene;
  32931. this._readyToPlayCallback = readyToPlayCallback;
  32932. // Default custom attenuation function is a linear attenuation
  32933. this._customAttenuationFunction = function (currentVolume, currentDistance, maxDistance, refDistance, rolloffFactor) {
  32934. if (currentDistance < maxDistance) {
  32935. return currentVolume * (1 - currentDistance / maxDistance);
  32936. }
  32937. else {
  32938. return 0;
  32939. }
  32940. };
  32941. if (options) {
  32942. this.autoplay = options.autoplay || false;
  32943. this.loop = options.loop || false;
  32944. // if volume === 0, we need another way to check this option
  32945. if (options.volume !== undefined) {
  32946. this._volume = options.volume;
  32947. }
  32948. this.spatialSound = options.spatialSound || false;
  32949. this.maxDistance = options.maxDistance || 100;
  32950. this.useCustomAttenuation = options.useCustomAttenuation || false;
  32951. this.rolloffFactor = options.rolloffFactor || 1;
  32952. this.refDistance = options.refDistance || 1;
  32953. this.distanceModel = options.distanceModel || "linear";
  32954. this._playbackRate = options.playbackRate || 1;
  32955. }
  32956. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  32957. this._soundGain = BABYLON.Engine.audioEngine.audioContext.createGain();
  32958. this._soundGain.gain.value = this._volume;
  32959. this._inputAudioNode = this._soundGain;
  32960. this._ouputAudioNode = this._soundGain;
  32961. if (this.spatialSound) {
  32962. this._createSpatialParameters();
  32963. }
  32964. this._scene.mainSoundTrack.AddSound(this);
  32965. // if no parameter is passed, you need to call setAudioBuffer yourself to prepare the sound
  32966. if (urlOrArrayBuffer) {
  32967. // If it's an URL
  32968. if (typeof (urlOrArrayBuffer) === "string") {
  32969. BABYLON.Tools.LoadFile(urlOrArrayBuffer, function (data) { _this._soundLoaded(data); }, null, null, true);
  32970. }
  32971. else {
  32972. if (urlOrArrayBuffer instanceof ArrayBuffer) {
  32973. this._soundLoaded(urlOrArrayBuffer);
  32974. }
  32975. else {
  32976. BABYLON.Tools.Error("Parameter must be a URL to the sound or an ArrayBuffer of the sound.");
  32977. }
  32978. }
  32979. }
  32980. }
  32981. else {
  32982. // Adding an empty sound to avoid breaking audio calls for non Web Audio browsers
  32983. this._scene.mainSoundTrack.AddSound(this);
  32984. if (!BABYLON.Engine.audioEngine.WarnedWebAudioUnsupported) {
  32985. BABYLON.Tools.Error("Web Audio is not supported by your browser.");
  32986. BABYLON.Engine.audioEngine.WarnedWebAudioUnsupported = true;
  32987. }
  32988. // Simulating a ready to play event to avoid breaking code for non web audio browsers
  32989. if (this._readyToPlayCallback) {
  32990. window.setTimeout(function () {
  32991. _this._readyToPlayCallback();
  32992. }, 1000);
  32993. }
  32994. }
  32995. }
  32996. Sound.prototype.dispose = function () {
  32997. if (BABYLON.Engine.audioEngine.canUseWebAudio && this._isReadyToPlay) {
  32998. if (this.isPlaying) {
  32999. this.stop();
  33000. }
  33001. this._isReadyToPlay = false;
  33002. if (this.soundTrackId === -1) {
  33003. this._scene.mainSoundTrack.RemoveSound(this);
  33004. }
  33005. else {
  33006. this._scene.soundTracks[this.soundTrackId].RemoveSound(this);
  33007. }
  33008. if (this._soundGain) {
  33009. this._soundGain.disconnect();
  33010. this._soundGain = null;
  33011. }
  33012. if (this._soundPanner) {
  33013. this._soundPanner.disconnect();
  33014. this._soundPanner = null;
  33015. }
  33016. if (this._soundSource) {
  33017. this._soundSource.disconnect();
  33018. this._soundSource = null;
  33019. }
  33020. this._audioBuffer = null;
  33021. if (this._connectedMesh) {
  33022. this._connectedMesh.unregisterAfterWorldMatrixUpdate(this._registerFunc);
  33023. this._connectedMesh = null;
  33024. }
  33025. }
  33026. };
  33027. Sound.prototype._soundLoaded = function (audioData) {
  33028. var _this = this;
  33029. this._isLoaded = true;
  33030. BABYLON.Engine.audioEngine.audioContext.decodeAudioData(audioData, function (buffer) {
  33031. _this._audioBuffer = buffer;
  33032. _this._isReadyToPlay = true;
  33033. if (_this.autoplay) {
  33034. _this.play();
  33035. }
  33036. if (_this._readyToPlayCallback) {
  33037. _this._readyToPlayCallback();
  33038. }
  33039. }, function () { BABYLON.Tools.Error("Error while decoding audio data for: " + _this.name); });
  33040. };
  33041. Sound.prototype.setAudioBuffer = function (audioBuffer) {
  33042. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  33043. this._audioBuffer = audioBuffer;
  33044. this._isReadyToPlay = true;
  33045. }
  33046. };
  33047. Sound.prototype.updateOptions = function (options) {
  33048. if (options) {
  33049. this.loop = options.loop || this.loop;
  33050. this.maxDistance = options.maxDistance || this.maxDistance;
  33051. this.useCustomAttenuation = options.useCustomAttenuation || this.useCustomAttenuation;
  33052. this.rolloffFactor = options.rolloffFactor || this.rolloffFactor;
  33053. this.refDistance = options.refDistance || this.refDistance;
  33054. this.distanceModel = options.distanceModel || this.distanceModel;
  33055. this._playbackRate = options.playbackRate || this._playbackRate;
  33056. this._updateSpatialParameters();
  33057. if (this.isPlaying) {
  33058. this._soundSource.playbackRate.value = this._playbackRate;
  33059. }
  33060. }
  33061. };
  33062. Sound.prototype._createSpatialParameters = function () {
  33063. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  33064. if (this._scene.headphone) {
  33065. this._panningModel = "HRTF";
  33066. }
  33067. this._soundPanner = BABYLON.Engine.audioEngine.audioContext.createPanner();
  33068. this._updateSpatialParameters();
  33069. this._soundPanner.connect(this._ouputAudioNode);
  33070. this._inputAudioNode = this._soundPanner;
  33071. }
  33072. };
  33073. Sound.prototype._updateSpatialParameters = function () {
  33074. if (this.spatialSound) {
  33075. if (this.useCustomAttenuation) {
  33076. // Tricks to disable in a way embedded Web Audio attenuation
  33077. this._soundPanner.distanceModel = "linear";
  33078. this._soundPanner.maxDistance = Number.MAX_VALUE;
  33079. this._soundPanner.refDistance = 1;
  33080. this._soundPanner.rolloffFactor = 1;
  33081. this._soundPanner.panningModel = this._panningModel;
  33082. }
  33083. else {
  33084. this._soundPanner.distanceModel = this.distanceModel;
  33085. this._soundPanner.maxDistance = this.maxDistance;
  33086. this._soundPanner.refDistance = this.refDistance;
  33087. this._soundPanner.rolloffFactor = this.rolloffFactor;
  33088. this._soundPanner.panningModel = this._panningModel;
  33089. }
  33090. }
  33091. };
  33092. Sound.prototype.switchPanningModelToHRTF = function () {
  33093. this._panningModel = "HRTF";
  33094. this._switchPanningModel();
  33095. };
  33096. Sound.prototype.switchPanningModelToEqualPower = function () {
  33097. this._panningModel = "equalpower";
  33098. this._switchPanningModel();
  33099. };
  33100. Sound.prototype._switchPanningModel = function () {
  33101. if (BABYLON.Engine.audioEngine.canUseWebAudio && this.spatialSound) {
  33102. this._soundPanner.panningModel = this._panningModel;
  33103. }
  33104. };
  33105. Sound.prototype.connectToSoundTrackAudioNode = function (soundTrackAudioNode) {
  33106. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  33107. if (this._isOutputConnected) {
  33108. this._ouputAudioNode.disconnect();
  33109. }
  33110. this._ouputAudioNode.connect(soundTrackAudioNode);
  33111. this._isOutputConnected = true;
  33112. }
  33113. };
  33114. /**
  33115. * Transform this sound into a directional source
  33116. * @param coneInnerAngle Size of the inner cone in degree
  33117. * @param coneOuterAngle Size of the outer cone in degree
  33118. * @param coneOuterGain Volume of the sound outside the outer cone (between 0.0 and 1.0)
  33119. */
  33120. Sound.prototype.setDirectionalCone = function (coneInnerAngle, coneOuterAngle, coneOuterGain) {
  33121. if (coneOuterAngle < coneInnerAngle) {
  33122. BABYLON.Tools.Error("setDirectionalCone(): outer angle of the cone must be superior or equal to the inner angle.");
  33123. return;
  33124. }
  33125. this._coneInnerAngle = coneInnerAngle;
  33126. this._coneOuterAngle = coneOuterAngle;
  33127. this._coneOuterGain = coneOuterGain;
  33128. this._isDirectional = true;
  33129. if (this.isPlaying && this.loop) {
  33130. this.stop();
  33131. this.play();
  33132. }
  33133. };
  33134. Sound.prototype.setPosition = function (newPosition) {
  33135. this._position = newPosition;
  33136. if (BABYLON.Engine.audioEngine.canUseWebAudio && this.spatialSound) {
  33137. this._soundPanner.setPosition(this._position.x, this._position.y, this._position.z);
  33138. }
  33139. };
  33140. Sound.prototype.setLocalDirectionToMesh = function (newLocalDirection) {
  33141. this._localDirection = newLocalDirection;
  33142. if (BABYLON.Engine.audioEngine.canUseWebAudio && this._connectedMesh && this.isPlaying) {
  33143. this._updateDirection();
  33144. }
  33145. };
  33146. Sound.prototype._updateDirection = function () {
  33147. var mat = this._connectedMesh.getWorldMatrix();
  33148. var direction = BABYLON.Vector3.TransformNormal(this._localDirection, mat);
  33149. direction.normalize();
  33150. this._soundPanner.setOrientation(direction.x, direction.y, direction.z);
  33151. };
  33152. Sound.prototype.updateDistanceFromListener = function () {
  33153. if (BABYLON.Engine.audioEngine.canUseWebAudio && this._connectedMesh && this.useCustomAttenuation) {
  33154. var distance = this._connectedMesh.getDistanceToCamera(this._scene.activeCamera);
  33155. this._soundGain.gain.value = this._customAttenuationFunction(this._volume, distance, this.maxDistance, this.refDistance, this.rolloffFactor);
  33156. }
  33157. };
  33158. Sound.prototype.setAttenuationFunction = function (callback) {
  33159. this._customAttenuationFunction = callback;
  33160. };
  33161. /**
  33162. * Play the sound
  33163. * @param time (optional) Start the sound after X seconds. Start immediately (0) by default.
  33164. */
  33165. Sound.prototype.play = function (time) {
  33166. var _this = this;
  33167. if (this._isReadyToPlay && this._scene.audioEnabled) {
  33168. try {
  33169. var startTime = time ? BABYLON.Engine.audioEngine.audioContext.currentTime + time : BABYLON.Engine.audioEngine.audioContext.currentTime;
  33170. if (!this._soundSource) {
  33171. if (this.spatialSound) {
  33172. this._soundPanner.setPosition(this._position.x, this._position.y, this._position.z);
  33173. if (this._isDirectional) {
  33174. this._soundPanner.coneInnerAngle = this._coneInnerAngle;
  33175. this._soundPanner.coneOuterAngle = this._coneOuterAngle;
  33176. this._soundPanner.coneOuterGain = this._coneOuterGain;
  33177. if (this._connectedMesh) {
  33178. this._updateDirection();
  33179. }
  33180. else {
  33181. this._soundPanner.setOrientation(this._localDirection.x, this._localDirection.y, this._localDirection.z);
  33182. }
  33183. }
  33184. }
  33185. }
  33186. this._soundSource = BABYLON.Engine.audioEngine.audioContext.createBufferSource();
  33187. this._soundSource.buffer = this._audioBuffer;
  33188. this._soundSource.connect(this._inputAudioNode);
  33189. this._soundSource.loop = this.loop;
  33190. this._soundSource.playbackRate.value = this._playbackRate;
  33191. this._startTime = startTime;
  33192. this._soundSource.onended = function () { _this._onended(); };
  33193. this._soundSource.start(this._startTime, this.isPaused ? this._startOffset % this._soundSource.buffer.duration : 0);
  33194. this.isPlaying = true;
  33195. this.isPaused = false;
  33196. }
  33197. catch (ex) {
  33198. BABYLON.Tools.Error("Error while trying to play audio: " + this.name + ", " + ex.message);
  33199. }
  33200. }
  33201. };
  33202. Sound.prototype._onended = function () {
  33203. this.isPlaying = false;
  33204. if (this.onended) {
  33205. this.onended();
  33206. }
  33207. };
  33208. /**
  33209. * Stop the sound
  33210. * @param time (optional) Stop the sound after X seconds. Stop immediately (0) by default.
  33211. */
  33212. Sound.prototype.stop = function (time) {
  33213. if (this.isPlaying) {
  33214. var stopTime = time ? BABYLON.Engine.audioEngine.audioContext.currentTime + time : BABYLON.Engine.audioEngine.audioContext.currentTime;
  33215. this._soundSource.stop(stopTime);
  33216. this.isPlaying = false;
  33217. }
  33218. };
  33219. Sound.prototype.pause = function () {
  33220. if (this.isPlaying) {
  33221. this.stop(0);
  33222. this._startOffset += BABYLON.Engine.audioEngine.audioContext.currentTime - this._startTime;
  33223. this.isPaused = true;
  33224. }
  33225. };
  33226. Sound.prototype.setVolume = function (newVolume, time) {
  33227. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  33228. if (time) {
  33229. this._soundGain.gain.linearRampToValueAtTime(this._volume, BABYLON.Engine.audioEngine.audioContext.currentTime);
  33230. this._soundGain.gain.linearRampToValueAtTime(newVolume, time);
  33231. }
  33232. else {
  33233. this._soundGain.gain.value = newVolume;
  33234. }
  33235. }
  33236. this._volume = newVolume;
  33237. };
  33238. Sound.prototype.setPlaybackRate = function (newPlaybackRate) {
  33239. this._playbackRate = newPlaybackRate;
  33240. if (this.isPlaying) {
  33241. this._soundSource.playbackRate.value = this._playbackRate;
  33242. }
  33243. };
  33244. Sound.prototype.getVolume = function () {
  33245. return this._volume;
  33246. };
  33247. Sound.prototype.attachToMesh = function (meshToConnectTo) {
  33248. var _this = this;
  33249. this._connectedMesh = meshToConnectTo;
  33250. if (!this.spatialSound) {
  33251. this.spatialSound = true;
  33252. this._createSpatialParameters();
  33253. if (this.isPlaying && this.loop) {
  33254. this.stop();
  33255. this.play();
  33256. }
  33257. }
  33258. this._onRegisterAfterWorldMatrixUpdate(this._connectedMesh);
  33259. this._registerFunc = function (connectedMesh) { return _this._onRegisterAfterWorldMatrixUpdate(connectedMesh); };
  33260. meshToConnectTo.registerAfterWorldMatrixUpdate(this._registerFunc);
  33261. };
  33262. Sound.prototype._onRegisterAfterWorldMatrixUpdate = function (connectedMesh) {
  33263. this.setPosition(connectedMesh.getBoundingInfo().boundingSphere.centerWorld);
  33264. if (BABYLON.Engine.audioEngine.canUseWebAudio && this._isDirectional && this.isPlaying) {
  33265. this._updateDirection();
  33266. }
  33267. };
  33268. return Sound;
  33269. })();
  33270. BABYLON.Sound = Sound;
  33271. })(BABYLON || (BABYLON = {}));
  33272. var BABYLON;
  33273. (function (BABYLON) {
  33274. var SoundTrack = (function () {
  33275. function SoundTrack(scene, options) {
  33276. this.id = -1;
  33277. this._isMainTrack = false;
  33278. this._isInitialized = false;
  33279. this._scene = scene;
  33280. this.soundCollection = new Array();
  33281. this._options = options;
  33282. if (!this._isMainTrack) {
  33283. this._scene.soundTracks.push(this);
  33284. this.id = this._scene.soundTracks.length - 1;
  33285. }
  33286. }
  33287. SoundTrack.prototype._initializeSoundTrackAudioGraph = function () {
  33288. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  33289. this._outputAudioNode = BABYLON.Engine.audioEngine.audioContext.createGain();
  33290. this._outputAudioNode.connect(BABYLON.Engine.audioEngine.masterGain);
  33291. if (this._options) {
  33292. if (this._options.volume) {
  33293. this._outputAudioNode.gain.value = this._options.volume;
  33294. }
  33295. if (this._options.mainTrack) {
  33296. this._isMainTrack = this._options.mainTrack;
  33297. }
  33298. }
  33299. this._isInitialized = true;
  33300. }
  33301. };
  33302. SoundTrack.prototype.dispose = function () {
  33303. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  33304. if (this._connectedAnalyser) {
  33305. this._connectedAnalyser.stopDebugCanvas();
  33306. }
  33307. while (this.soundCollection.length) {
  33308. this.soundCollection[0].dispose();
  33309. }
  33310. if (this._outputAudioNode) {
  33311. this._outputAudioNode.disconnect();
  33312. }
  33313. this._outputAudioNode = null;
  33314. }
  33315. };
  33316. SoundTrack.prototype.AddSound = function (sound) {
  33317. if (!this._isInitialized) {
  33318. this._initializeSoundTrackAudioGraph();
  33319. }
  33320. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  33321. sound.connectToSoundTrackAudioNode(this._outputAudioNode);
  33322. }
  33323. if (sound.soundTrackId) {
  33324. if (sound.soundTrackId === -1) {
  33325. this._scene.mainSoundTrack.RemoveSound(sound);
  33326. }
  33327. else {
  33328. this._scene.soundTracks[sound.soundTrackId].RemoveSound(sound);
  33329. }
  33330. }
  33331. this.soundCollection.push(sound);
  33332. sound.soundTrackId = this.id;
  33333. };
  33334. SoundTrack.prototype.RemoveSound = function (sound) {
  33335. var index = this.soundCollection.indexOf(sound);
  33336. if (index !== -1) {
  33337. this.soundCollection.splice(index, 1);
  33338. }
  33339. };
  33340. SoundTrack.prototype.setVolume = function (newVolume) {
  33341. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  33342. this._outputAudioNode.gain.value = newVolume;
  33343. }
  33344. };
  33345. SoundTrack.prototype.switchPanningModelToHRTF = function () {
  33346. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  33347. for (var i = 0; i < this.soundCollection.length; i++) {
  33348. this.soundCollection[i].switchPanningModelToHRTF();
  33349. }
  33350. }
  33351. };
  33352. SoundTrack.prototype.switchPanningModelToEqualPower = function () {
  33353. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  33354. for (var i = 0; i < this.soundCollection.length; i++) {
  33355. this.soundCollection[i].switchPanningModelToEqualPower();
  33356. }
  33357. }
  33358. };
  33359. SoundTrack.prototype.connectToAnalyser = function (analyser) {
  33360. if (this._connectedAnalyser) {
  33361. this._connectedAnalyser.stopDebugCanvas();
  33362. }
  33363. this._connectedAnalyser = analyser;
  33364. if (BABYLON.Engine.audioEngine.canUseWebAudio) {
  33365. this._outputAudioNode.disconnect();
  33366. this._connectedAnalyser.connectAudioNodes(this._outputAudioNode, BABYLON.Engine.audioEngine.masterGain);
  33367. }
  33368. };
  33369. return SoundTrack;
  33370. })();
  33371. BABYLON.SoundTrack = SoundTrack;
  33372. })(BABYLON || (BABYLON = {}));
  33373. var BABYLON;
  33374. (function (BABYLON) {
  33375. var DepthRenderer = (function () {
  33376. function DepthRenderer(scene, type) {
  33377. var _this = this;
  33378. if (type === void 0) { type = BABYLON.Engine.TEXTURETYPE_FLOAT; }
  33379. this._viewMatrix = BABYLON.Matrix.Zero();
  33380. this._projectionMatrix = BABYLON.Matrix.Zero();
  33381. this._transformMatrix = BABYLON.Matrix.Zero();
  33382. this._worldViewProjection = BABYLON.Matrix.Zero();
  33383. this._scene = scene;
  33384. var engine = scene.getEngine();
  33385. // Render target
  33386. this._depthMap = new BABYLON.RenderTargetTexture("depthMap", { width: engine.getRenderWidth(), height: engine.getRenderHeight() }, this._scene, false, true, type);
  33387. this._depthMap.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  33388. this._depthMap.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  33389. this._depthMap.refreshRate = 1;
  33390. this._depthMap.renderParticles = false;
  33391. this._depthMap.renderList = null;
  33392. // set default depth value to 1.0 (far away)
  33393. this._depthMap.onClear = function (engine) {
  33394. engine.clear(new BABYLON.Color4(1.0, 1.0, 1.0, 1.0), true, true);
  33395. };
  33396. // Custom render function
  33397. var renderSubMesh = function (subMesh) {
  33398. var mesh = subMesh.getRenderingMesh();
  33399. var scene = _this._scene;
  33400. var engine = scene.getEngine();
  33401. // Culling
  33402. engine.setState(subMesh.getMaterial().backFaceCulling);
  33403. // Managing instances
  33404. var batch = mesh._getInstancesRenderList(subMesh._id);
  33405. if (batch.mustReturn) {
  33406. return;
  33407. }
  33408. var hardwareInstancedRendering = (engine.getCaps().instancedArrays !== null) && (batch.visibleInstances[subMesh._id] !== null);
  33409. if (_this.isReady(subMesh, hardwareInstancedRendering)) {
  33410. engine.enableEffect(_this._effect);
  33411. mesh._bind(subMesh, _this._effect, BABYLON.Material.TriangleFillMode);
  33412. var material = subMesh.getMaterial();
  33413. _this._effect.setMatrix("viewProjection", scene.getTransformMatrix());
  33414. _this._effect.setFloat("far", scene.activeCamera.maxZ);
  33415. // Alpha test
  33416. if (material && material.needAlphaTesting()) {
  33417. var alphaTexture = material.getAlphaTestTexture();
  33418. _this._effect.setTexture("diffuseSampler", alphaTexture);
  33419. _this._effect.setMatrix("diffuseMatrix", alphaTexture.getTextureMatrix());
  33420. }
  33421. // Bones
  33422. if (mesh.useBones && mesh.computeBonesUsingShaders) {
  33423. _this._effect.setMatrices("mBones", mesh.skeleton.getTransformMatrices());
  33424. }
  33425. // Draw
  33426. mesh._processRendering(subMesh, _this._effect, BABYLON.Material.TriangleFillMode, batch, hardwareInstancedRendering, function (isInstance, world) { return _this._effect.setMatrix("world", world); });
  33427. }
  33428. };
  33429. this._depthMap.customRenderFunction = function (opaqueSubMeshes, alphaTestSubMeshes) {
  33430. var index;
  33431. for (index = 0; index < opaqueSubMeshes.length; index++) {
  33432. renderSubMesh(opaqueSubMeshes.data[index]);
  33433. }
  33434. for (index = 0; index < alphaTestSubMeshes.length; index++) {
  33435. renderSubMesh(alphaTestSubMeshes.data[index]);
  33436. }
  33437. };
  33438. }
  33439. DepthRenderer.prototype.isReady = function (subMesh, useInstances) {
  33440. var defines = [];
  33441. var attribs = [BABYLON.VertexBuffer.PositionKind];
  33442. var mesh = subMesh.getMesh();
  33443. var scene = mesh.getScene();
  33444. var material = subMesh.getMaterial();
  33445. // Alpha test
  33446. if (material && material.needAlphaTesting()) {
  33447. defines.push("#define ALPHATEST");
  33448. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  33449. attribs.push(BABYLON.VertexBuffer.UVKind);
  33450. defines.push("#define UV1");
  33451. }
  33452. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  33453. attribs.push(BABYLON.VertexBuffer.UV2Kind);
  33454. defines.push("#define UV2");
  33455. }
  33456. }
  33457. // Bones
  33458. if (mesh.useBones && mesh.computeBonesUsingShaders) {
  33459. attribs.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  33460. attribs.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  33461. defines.push("#define BONES");
  33462. defines.push("#define BonesPerMesh " + (mesh.skeleton.bones.length + 1));
  33463. }
  33464. // Instances
  33465. if (useInstances) {
  33466. defines.push("#define INSTANCES");
  33467. attribs.push("world0");
  33468. attribs.push("world1");
  33469. attribs.push("world2");
  33470. attribs.push("world3");
  33471. }
  33472. // Get correct effect
  33473. var join = defines.join("\n");
  33474. if (this._cachedDefines !== join) {
  33475. this._cachedDefines = join;
  33476. this._effect = this._scene.getEngine().createEffect("depth", attribs, ["world", "mBones", "viewProjection", "diffuseMatrix", "far"], ["diffuseSampler"], join);
  33477. }
  33478. return this._effect.isReady();
  33479. };
  33480. DepthRenderer.prototype.getDepthMap = function () {
  33481. return this._depthMap;
  33482. };
  33483. // Methods
  33484. DepthRenderer.prototype.dispose = function () {
  33485. this._depthMap.dispose();
  33486. };
  33487. return DepthRenderer;
  33488. })();
  33489. BABYLON.DepthRenderer = DepthRenderer;
  33490. })(BABYLON || (BABYLON = {}));
  33491. var BABYLON;
  33492. (function (BABYLON) {
  33493. var SSAORenderingPipeline = (function (_super) {
  33494. __extends(SSAORenderingPipeline, _super);
  33495. /**
  33496. * @constructor
  33497. * @param {string} name - The rendering pipeline name
  33498. * @param {BABYLON.Scene} scene - The scene linked to this pipeline
  33499. * @param {any} ratio - The size of the postprocesses. Can be a number shared between passes or an object for more precision: { ssaoRatio: 0.5, combineRatio: 1.0 }
  33500. * @param {BABYLON.Camera[]} cameras - The array of cameras that the rendering pipeline will be attached to
  33501. */
  33502. function SSAORenderingPipeline(name, scene, ratio, cameras) {
  33503. var _this = this;
  33504. _super.call(this, scene.getEngine(), name);
  33505. // Members
  33506. /**
  33507. * The PassPostProcess id in the pipeline that contains the original scene color
  33508. * @type {string}
  33509. */
  33510. this.SSAOOriginalSceneColorEffect = "SSAOOriginalSceneColorEffect";
  33511. /**
  33512. * The SSAO PostProcess id in the pipeline
  33513. * @type {string}
  33514. */
  33515. this.SSAORenderEffect = "SSAORenderEffect";
  33516. /**
  33517. * The horizontal blur PostProcess id in the pipeline
  33518. * @type {string}
  33519. */
  33520. this.SSAOBlurHRenderEffect = "SSAOBlurHRenderEffect";
  33521. /**
  33522. * The vertical blur PostProcess id in the pipeline
  33523. * @type {string}
  33524. */
  33525. this.SSAOBlurVRenderEffect = "SSAOBlurVRenderEffect";
  33526. /**
  33527. * The PostProcess id in the pipeline that combines the SSAO-Blur output with the original scene color (SSAOOriginalSceneColorEffect)
  33528. * @type {string}
  33529. */
  33530. this.SSAOCombineRenderEffect = "SSAOCombineRenderEffect";
  33531. /**
  33532. * The output strength of the SSAO post-process. Default value is 1.0.
  33533. * @type {number}
  33534. */
  33535. this.totalStrength = 1.0;
  33536. /**
  33537. * The radius around the analyzed pixel used by the SSAO post-process. Default value is 0.0002
  33538. * @type {number}
  33539. */
  33540. this.radius = 0.0002;
  33541. /**
  33542. * Related to fallOff, used to interpolate SSAO samples (first interpolate function input) based on the occlusion difference of each pixel
  33543. * Must not be equal to fallOff and superior to fallOff.
  33544. * Default value is 0.0075
  33545. * @type {number}
  33546. */
  33547. this.area = 0.0075;
  33548. /**
  33549. * Related to area, used to interpolate SSAO samples (second interpolate function input) based on the occlusion difference of each pixel
  33550. * Must not be equal to area and inferior to area.
  33551. * Default value is 0.0002
  33552. * @type {number}
  33553. */
  33554. this.fallOff = 0.0002;
  33555. this._firstUpdate = true;
  33556. this._scene = scene;
  33557. // Set up assets
  33558. this._createRandomTexture();
  33559. this._depthTexture = scene.enableDepthRenderer().getDepthMap(); // Force depth renderer "on"
  33560. var ssaoRatio = ratio.ssaoRatio || ratio;
  33561. var combineRatio = ratio.combineRatio || ratio;
  33562. this._originalColorPostProcess = new BABYLON.PassPostProcess("SSAOOriginalSceneColor", combineRatio, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, scene.getEngine(), false);
  33563. this._createSSAOPostProcess(ssaoRatio);
  33564. this._blurHPostProcess = new BABYLON.BlurPostProcess("SSAOBlurH", new BABYLON.Vector2(2.0, 0.0), 2.0, ssaoRatio, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, scene.getEngine(), false);
  33565. this._blurVPostProcess = new BABYLON.BlurPostProcess("SSAOBlurV", new BABYLON.Vector2(0.0, 2.0), 2.0, ssaoRatio, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, scene.getEngine(), false);
  33566. this._createSSAOCombinePostProcess(combineRatio);
  33567. // Set up pipeline
  33568. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), this.SSAOOriginalSceneColorEffect, function () { return _this._originalColorPostProcess; }, true));
  33569. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), this.SSAORenderEffect, function () { return _this._ssaoPostProcess; }, true));
  33570. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), this.SSAOBlurHRenderEffect, function () { return _this._blurHPostProcess; }, true));
  33571. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), this.SSAOBlurVRenderEffect, function () { return _this._blurVPostProcess; }, true));
  33572. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), this.SSAOCombineRenderEffect, function () { return _this._ssaoCombinePostProcess; }, true));
  33573. // Finish
  33574. scene.postProcessRenderPipelineManager.addPipeline(this);
  33575. if (cameras)
  33576. scene.postProcessRenderPipelineManager.attachCamerasToRenderPipeline(name, cameras);
  33577. }
  33578. // Public Methods
  33579. /**
  33580. * Returns the horizontal blur PostProcess
  33581. * @return {BABYLON.BlurPostProcess} The horizontal blur post-process
  33582. */
  33583. SSAORenderingPipeline.prototype.getBlurHPostProcess = function () {
  33584. return this._blurHPostProcess;
  33585. };
  33586. /**
  33587. * Returns the vertical blur PostProcess
  33588. * @return {BABYLON.BlurPostProcess} The vertical blur post-process
  33589. */
  33590. SSAORenderingPipeline.prototype.getBlurVPostProcess = function () {
  33591. return this._blurVPostProcess;
  33592. };
  33593. /**
  33594. * Removes the internal pipeline assets and detatches the pipeline from the scene cameras
  33595. */
  33596. SSAORenderingPipeline.prototype.dispose = function (disableDepthRender) {
  33597. if (disableDepthRender === void 0) { disableDepthRender = false; }
  33598. this._scene.postProcessRenderPipelineManager.detachCamerasFromRenderPipeline(this._name, this._scene.cameras);
  33599. this._originalColorPostProcess = undefined;
  33600. this._ssaoPostProcess = undefined;
  33601. this._blurHPostProcess = undefined;
  33602. this._blurVPostProcess = undefined;
  33603. this._ssaoCombinePostProcess = undefined;
  33604. this._randomTexture.dispose();
  33605. if (disableDepthRender)
  33606. this._scene.disableDepthRenderer();
  33607. };
  33608. // Private Methods
  33609. SSAORenderingPipeline.prototype._createSSAOPostProcess = function (ratio) {
  33610. var _this = this;
  33611. var sampleSphere = [
  33612. 0.5381, 0.1856, -0.4319,
  33613. 0.1379, 0.2486, 0.4430,
  33614. 0.3371, 0.5679, -0.0057,
  33615. -0.6999, -0.0451, -0.0019,
  33616. 0.0689, -0.1598, -0.8547,
  33617. 0.0560, 0.0069, -0.1843,
  33618. -0.0146, 0.1402, 0.0762,
  33619. 0.0100, -0.1924, -0.0344,
  33620. -0.3577, -0.5301, -0.4358,
  33621. -0.3169, 0.1063, 0.0158,
  33622. 0.0103, -0.5869, 0.0046,
  33623. -0.0897, -0.4940, 0.3287,
  33624. 0.7119, -0.0154, -0.0918,
  33625. -0.0533, 0.0596, -0.5411,
  33626. 0.0352, -0.0631, 0.5460,
  33627. -0.4776, 0.2847, -0.0271
  33628. ];
  33629. var samplesFactor = 1.0 / 16.0;
  33630. this._ssaoPostProcess = new BABYLON.PostProcess("ssao", "ssao", ["sampleSphere", "samplesFactor", "randTextureTiles", "totalStrength", "radius", "area", "fallOff"], ["randomSampler"], ratio, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, this._scene.getEngine(), false);
  33631. this._ssaoPostProcess.onApply = function (effect) {
  33632. if (_this._firstUpdate) {
  33633. effect.setArray3("sampleSphere", sampleSphere);
  33634. effect.setFloat("samplesFactor", samplesFactor);
  33635. effect.setFloat("randTextureTiles", 4.0 / ratio);
  33636. _this._firstUpdate = false;
  33637. }
  33638. effect.setFloat("totalStrength", _this.totalStrength);
  33639. effect.setFloat("radius", _this.radius);
  33640. effect.setFloat("area", _this.area);
  33641. effect.setFloat("fallOff", _this.fallOff);
  33642. effect.setTexture("textureSampler", _this._depthTexture);
  33643. effect.setTexture("randomSampler", _this._randomTexture);
  33644. };
  33645. };
  33646. SSAORenderingPipeline.prototype._createSSAOCombinePostProcess = function (ratio) {
  33647. var _this = this;
  33648. this._ssaoCombinePostProcess = new BABYLON.PostProcess("ssaoCombine", "ssaoCombine", [], ["originalColor"], ratio, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, this._scene.getEngine(), false);
  33649. this._ssaoCombinePostProcess.onApply = function (effect) {
  33650. effect.setTextureFromPostProcess("originalColor", _this._originalColorPostProcess);
  33651. };
  33652. };
  33653. SSAORenderingPipeline.prototype._createRandomTexture = function () {
  33654. var size = 512;
  33655. this._randomTexture = new BABYLON.DynamicTexture("SSAORandomTexture", size, this._scene, false, BABYLON.Texture.BILINEAR_SAMPLINGMODE);
  33656. this._randomTexture.wrapU = BABYLON.Texture.WRAP_ADDRESSMODE;
  33657. this._randomTexture.wrapV = BABYLON.Texture.WRAP_ADDRESSMODE;
  33658. var context = this._randomTexture.getContext();
  33659. var rand = function (min, max) {
  33660. return Math.random() * (max - min) + min;
  33661. };
  33662. for (var x = 0; x < size; x++) {
  33663. for (var y = 0; y < size; y++) {
  33664. var randVector = BABYLON.Vector3.Zero();
  33665. randVector.x = Math.floor(rand(0.0, 1.0) * 255);
  33666. randVector.y = Math.floor(rand(0.0, 1.0) * 255);
  33667. randVector.z = Math.floor(rand(0.0, 1.0) * 255);
  33668. context.fillStyle = 'rgb(' + randVector.x + ', ' + randVector.y + ', ' + randVector.z + ')';
  33669. context.fillRect(x, y, 1, 1);
  33670. }
  33671. }
  33672. this._randomTexture.update(false);
  33673. };
  33674. return SSAORenderingPipeline;
  33675. })(BABYLON.PostProcessRenderPipeline);
  33676. BABYLON.SSAORenderingPipeline = SSAORenderingPipeline;
  33677. })(BABYLON || (BABYLON = {}));
  33678. var BABYLON;
  33679. (function (BABYLON) {
  33680. // Inspired by http://http.developer.nvidia.com/GPUGems3/gpugems3_ch13.html
  33681. var VolumetricLightScatteringPostProcess = (function (_super) {
  33682. __extends(VolumetricLightScatteringPostProcess, _super);
  33683. /**
  33684. * @constructor
  33685. * @param {string} name - The post-process name
  33686. * @param {any} ratio - The size of the post-process and/or internal pass (0.5 means that your postprocess will have a width = canvas.width 0.5 and a height = canvas.height 0.5)
  33687. * @param {BABYLON.Camera} camera - The camera that the post-process will be attached to
  33688. * @param {BABYLON.Mesh} mesh - The mesh used to create the light scattering
  33689. * @param {number} samples - The post-process quality, default 100
  33690. * @param {number} samplingMode - The post-process filtering mode
  33691. * @param {BABYLON.Engine} engine - The babylon engine
  33692. * @param {boolean} reusable - If the post-process is reusable
  33693. * @param {BABYLON.Scene} scene - The constructor needs a scene reference to initialize internal components. If "camera" is null (RenderPipelineà, "scene" must be provided
  33694. */
  33695. function VolumetricLightScatteringPostProcess(name, ratio, camera, mesh, samples, samplingMode, engine, reusable, scene) {
  33696. var _this = this;
  33697. if (samples === void 0) { samples = 100; }
  33698. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.BILINEAR_SAMPLINGMODE; }
  33699. _super.call(this, name, "volumetricLightScattering", ["decay", "exposure", "weight", "meshPositionOnScreen", "density"], ["lightScatteringSampler"], ratio.postProcessRatio || ratio, camera, samplingMode, engine, reusable, "#define NUM_SAMPLES " + samples);
  33700. this._screenCoordinates = BABYLON.Vector2.Zero();
  33701. /**
  33702. * Set if the post-process should use a custom position for the light source (true) or the internal mesh position (false)
  33703. * @type {boolean}
  33704. */
  33705. this.useCustomMeshPosition = false;
  33706. /**
  33707. * If the post-process should inverse the light scattering direction
  33708. * @type {boolean}
  33709. */
  33710. this.invert = true;
  33711. /**
  33712. * Set to true to use the diffuseColor instead of the diffuseTexture
  33713. * @type {boolean}
  33714. */
  33715. this.useDiffuseColor = false;
  33716. /**
  33717. * Array containing the excluded meshes not rendered in the internal pass
  33718. */
  33719. this.excludedMeshes = new Array();
  33720. /**
  33721. * Controls the overall intensity of the post-process
  33722. * @type {number}
  33723. */
  33724. this.exposure = 0.3;
  33725. /**
  33726. * Dissipates each sample's contribution in range [0, 1]
  33727. * @type {number}
  33728. */
  33729. this.decay = 0.96815;
  33730. /**
  33731. * Controls the overall intensity of each sample
  33732. * @type {number}
  33733. */
  33734. this.weight = 0.58767;
  33735. /**
  33736. * Controls the density of each sample
  33737. * @type {number}
  33738. */
  33739. this.density = 0.926;
  33740. scene = (camera === null) ? scene : camera.getScene(); // parameter "scene" can be null.
  33741. this._viewPort = new BABYLON.Viewport(0, 0, 1, 1).toGlobal(scene.getEngine());
  33742. // Configure mesh
  33743. this.mesh = (mesh !== null) ? mesh : VolumetricLightScatteringPostProcess.CreateDefaultMesh("VolumetricLightScatteringMesh", scene);
  33744. // Configure
  33745. this._createPass(scene, ratio.passRatio || ratio);
  33746. this.onApply = function (effect) {
  33747. _this._updateMeshScreenCoordinates(scene);
  33748. effect.setTexture("lightScatteringSampler", _this._volumetricLightScatteringRTT);
  33749. effect.setFloat("exposure", _this.exposure);
  33750. effect.setFloat("decay", _this.decay);
  33751. effect.setFloat("weight", _this.weight);
  33752. effect.setFloat("density", _this.density);
  33753. effect.setVector2("meshPositionOnScreen", _this._screenCoordinates);
  33754. };
  33755. }
  33756. VolumetricLightScatteringPostProcess.prototype.isReady = function (subMesh, useInstances) {
  33757. var mesh = subMesh.getMesh();
  33758. var defines = [];
  33759. var attribs = [BABYLON.VertexBuffer.PositionKind];
  33760. var material = subMesh.getMaterial();
  33761. var needUV = false;
  33762. // Render this.mesh as default
  33763. if (mesh === this.mesh) {
  33764. if (this.useDiffuseColor) {
  33765. defines.push("#define DIFFUSE_COLOR_RENDER");
  33766. }
  33767. else if (material) {
  33768. if (material.diffuseTexture !== undefined) {
  33769. defines.push("#define BASIC_RENDER");
  33770. }
  33771. else {
  33772. defines.push("#define DIFFUSE_COLOR_RENDER");
  33773. }
  33774. }
  33775. defines.push("#define NEED_UV");
  33776. needUV = true;
  33777. }
  33778. // Alpha test
  33779. if (material) {
  33780. if (material.needAlphaTesting()) {
  33781. defines.push("#define ALPHATEST");
  33782. }
  33783. if (material.opacityTexture !== undefined) {
  33784. defines.push("#define OPACITY");
  33785. if (material.opacityTexture.getAlphaFromRGB) {
  33786. defines.push("#define OPACITYRGB");
  33787. }
  33788. if (!needUV) {
  33789. defines.push("#define NEED_UV");
  33790. }
  33791. }
  33792. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  33793. attribs.push(BABYLON.VertexBuffer.UVKind);
  33794. defines.push("#define UV1");
  33795. }
  33796. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  33797. attribs.push(BABYLON.VertexBuffer.UV2Kind);
  33798. defines.push("#define UV2");
  33799. }
  33800. }
  33801. // Bones
  33802. if (mesh.useBones && mesh.computeBonesUsingShaders) {
  33803. attribs.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  33804. attribs.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  33805. defines.push("#define BONES");
  33806. defines.push("#define BonesPerMesh " + (mesh.skeleton.bones.length + 1));
  33807. }
  33808. // Instances
  33809. if (useInstances) {
  33810. defines.push("#define INSTANCES");
  33811. attribs.push("world0");
  33812. attribs.push("world1");
  33813. attribs.push("world2");
  33814. attribs.push("world3");
  33815. }
  33816. // Get correct effect
  33817. var join = defines.join("\n");
  33818. if (this._cachedDefines !== join) {
  33819. this._cachedDefines = join;
  33820. this._volumetricLightScatteringPass = mesh.getScene().getEngine().createEffect({ vertexElement: "depth", fragmentElement: "volumetricLightScatteringPass" }, attribs, ["world", "mBones", "viewProjection", "diffuseMatrix", "opacityLevel", "color"], ["diffuseSampler", "opacitySampler"], join);
  33821. }
  33822. return this._volumetricLightScatteringPass.isReady();
  33823. };
  33824. /**
  33825. * Sets the new light position for light scattering effect
  33826. * @param {BABYLON.Vector3} The new custom light position
  33827. */
  33828. VolumetricLightScatteringPostProcess.prototype.setCustomMeshPosition = function (position) {
  33829. this._customMeshPosition = position;
  33830. };
  33831. /**
  33832. * Returns the light position for light scattering effect
  33833. * @return {BABYLON.Vector3} The custom light position
  33834. */
  33835. VolumetricLightScatteringPostProcess.prototype.getCustomMeshPosition = function () {
  33836. return this._customMeshPosition;
  33837. };
  33838. /**
  33839. * Disposes the internal assets and detaches the post-process from the camera
  33840. */
  33841. VolumetricLightScatteringPostProcess.prototype.dispose = function (camera) {
  33842. var rttIndex = camera.getScene().customRenderTargets.indexOf(this._volumetricLightScatteringRTT);
  33843. if (rttIndex !== -1) {
  33844. camera.getScene().customRenderTargets.splice(rttIndex, 1);
  33845. }
  33846. this._volumetricLightScatteringRTT.dispose();
  33847. _super.prototype.dispose.call(this, camera);
  33848. };
  33849. /**
  33850. * Returns the render target texture used by the post-process
  33851. * @return {BABYLON.RenderTargetTexture} The render target texture used by the post-process
  33852. */
  33853. VolumetricLightScatteringPostProcess.prototype.getPass = function () {
  33854. return this._volumetricLightScatteringRTT;
  33855. };
  33856. // Private methods
  33857. VolumetricLightScatteringPostProcess.prototype._meshExcluded = function (mesh) {
  33858. if (this.excludedMeshes.length > 0 && this.excludedMeshes.indexOf(mesh) !== -1) {
  33859. return true;
  33860. }
  33861. return false;
  33862. };
  33863. VolumetricLightScatteringPostProcess.prototype._createPass = function (scene, ratio) {
  33864. var _this = this;
  33865. var engine = scene.getEngine();
  33866. this._volumetricLightScatteringRTT = new BABYLON.RenderTargetTexture("volumetricLightScatteringMap", { width: engine.getRenderWidth() * ratio, height: engine.getRenderHeight() * ratio }, scene, false, true, BABYLON.Engine.TEXTURETYPE_UNSIGNED_INT);
  33867. this._volumetricLightScatteringRTT.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  33868. this._volumetricLightScatteringRTT.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  33869. this._volumetricLightScatteringRTT.renderList = null;
  33870. this._volumetricLightScatteringRTT.renderParticles = false;
  33871. scene.customRenderTargets.push(this._volumetricLightScatteringRTT);
  33872. // Custom render function for submeshes
  33873. var renderSubMesh = function (subMesh) {
  33874. var mesh = subMesh.getRenderingMesh();
  33875. if (_this._meshExcluded(mesh)) {
  33876. return;
  33877. }
  33878. var scene = mesh.getScene();
  33879. var engine = scene.getEngine();
  33880. // Culling
  33881. engine.setState(subMesh.getMaterial().backFaceCulling);
  33882. // Managing instances
  33883. var batch = mesh._getInstancesRenderList(subMesh._id);
  33884. if (batch.mustReturn) {
  33885. return;
  33886. }
  33887. var hardwareInstancedRendering = (engine.getCaps().instancedArrays !== null) && (batch.visibleInstances[subMesh._id] !== null);
  33888. if (_this.isReady(subMesh, hardwareInstancedRendering)) {
  33889. engine.enableEffect(_this._volumetricLightScatteringPass);
  33890. mesh._bind(subMesh, _this._volumetricLightScatteringPass, BABYLON.Material.TriangleFillMode);
  33891. var material = subMesh.getMaterial();
  33892. _this._volumetricLightScatteringPass.setMatrix("viewProjection", scene.getTransformMatrix());
  33893. // Alpha test
  33894. if (material && (mesh === _this.mesh || material.needAlphaTesting() || material.opacityTexture !== undefined)) {
  33895. var alphaTexture = material.getAlphaTestTexture();
  33896. if ((_this.useDiffuseColor || alphaTexture === undefined) && mesh === _this.mesh) {
  33897. _this._volumetricLightScatteringPass.setColor3("color", material.diffuseColor);
  33898. }
  33899. if (material.needAlphaTesting() || (mesh === _this.mesh && alphaTexture && !_this.useDiffuseColor)) {
  33900. _this._volumetricLightScatteringPass.setTexture("diffuseSampler", alphaTexture);
  33901. if (alphaTexture) {
  33902. _this._volumetricLightScatteringPass.setMatrix("diffuseMatrix", alphaTexture.getTextureMatrix());
  33903. }
  33904. }
  33905. if (material.opacityTexture !== undefined) {
  33906. _this._volumetricLightScatteringPass.setTexture("opacitySampler", material.opacityTexture);
  33907. _this._volumetricLightScatteringPass.setFloat("opacityLevel", material.opacityTexture.level);
  33908. }
  33909. }
  33910. // Bones
  33911. if (mesh.useBones && mesh.computeBonesUsingShaders) {
  33912. _this._volumetricLightScatteringPass.setMatrices("mBones", mesh.skeleton.getTransformMatrices());
  33913. }
  33914. // Draw
  33915. mesh._processRendering(subMesh, _this._volumetricLightScatteringPass, BABYLON.Material.TriangleFillMode, batch, hardwareInstancedRendering, function (isInstance, world) { return _this._volumetricLightScatteringPass.setMatrix("world", world); });
  33916. }
  33917. };
  33918. // Render target texture callbacks
  33919. var savedSceneClearColor;
  33920. var sceneClearColor = new BABYLON.Color4(0.0, 0.0, 0.0, 1.0);
  33921. this._volumetricLightScatteringRTT.onBeforeRender = function () {
  33922. savedSceneClearColor = scene.clearColor;
  33923. scene.clearColor = sceneClearColor;
  33924. };
  33925. this._volumetricLightScatteringRTT.onAfterRender = function () {
  33926. scene.clearColor = savedSceneClearColor;
  33927. };
  33928. this._volumetricLightScatteringRTT.customRenderFunction = function (opaqueSubMeshes, alphaTestSubMeshes, transparentSubMeshes) {
  33929. var engine = scene.getEngine();
  33930. var index;
  33931. for (index = 0; index < opaqueSubMeshes.length; index++) {
  33932. renderSubMesh(opaqueSubMeshes.data[index]);
  33933. }
  33934. engine.setAlphaTesting(true);
  33935. for (index = 0; index < alphaTestSubMeshes.length; index++) {
  33936. renderSubMesh(alphaTestSubMeshes.data[index]);
  33937. }
  33938. engine.setAlphaTesting(false);
  33939. if (transparentSubMeshes.length) {
  33940. // Sort sub meshes
  33941. for (index = 0; index < transparentSubMeshes.length; index++) {
  33942. var submesh = transparentSubMeshes.data[index];
  33943. submesh._alphaIndex = submesh.getMesh().alphaIndex;
  33944. submesh._distanceToCamera = submesh.getBoundingInfo().boundingSphere.centerWorld.subtract(scene.activeCamera.position).length();
  33945. }
  33946. var sortedArray = transparentSubMeshes.data.slice(0, transparentSubMeshes.length);
  33947. sortedArray.sort(function (a, b) {
  33948. // Alpha index first
  33949. if (a._alphaIndex > b._alphaIndex) {
  33950. return 1;
  33951. }
  33952. if (a._alphaIndex < b._alphaIndex) {
  33953. return -1;
  33954. }
  33955. // Then distance to camera
  33956. if (a._distanceToCamera < b._distanceToCamera) {
  33957. return 1;
  33958. }
  33959. if (a._distanceToCamera > b._distanceToCamera) {
  33960. return -1;
  33961. }
  33962. return 0;
  33963. });
  33964. // Render sub meshes
  33965. engine.setAlphaMode(BABYLON.Engine.ALPHA_COMBINE);
  33966. for (index = 0; index < sortedArray.length; index++) {
  33967. renderSubMesh(sortedArray[index]);
  33968. }
  33969. engine.setAlphaMode(BABYLON.Engine.ALPHA_DISABLE);
  33970. }
  33971. };
  33972. };
  33973. VolumetricLightScatteringPostProcess.prototype._updateMeshScreenCoordinates = function (scene) {
  33974. var transform = scene.getTransformMatrix();
  33975. var pos = BABYLON.Vector3.Project(this.useCustomMeshPosition ? this._customMeshPosition : this.mesh.position, BABYLON.Matrix.Identity(), transform, this._viewPort);
  33976. this._screenCoordinates.x = pos.x / this._viewPort.width;
  33977. this._screenCoordinates.y = pos.y / this._viewPort.height;
  33978. if (this.invert)
  33979. this._screenCoordinates.y = 1.0 - this._screenCoordinates.y;
  33980. };
  33981. // Static methods
  33982. /**
  33983. * Creates a default mesh for the Volumeric Light Scattering post-process
  33984. * @param {string} The mesh name
  33985. * @param {BABYLON.Scene} The scene where to create the mesh
  33986. * @return {BABYLON.Mesh} the default mesh
  33987. */
  33988. VolumetricLightScatteringPostProcess.CreateDefaultMesh = function (name, scene) {
  33989. var mesh = BABYLON.Mesh.CreatePlane(name, 1, scene);
  33990. mesh.billboardMode = BABYLON.AbstractMesh.BILLBOARDMODE_ALL;
  33991. mesh.material = new BABYLON.StandardMaterial(name + "Material", scene);
  33992. return mesh;
  33993. };
  33994. return VolumetricLightScatteringPostProcess;
  33995. })(BABYLON.PostProcess);
  33996. BABYLON.VolumetricLightScatteringPostProcess = VolumetricLightScatteringPostProcess;
  33997. })(BABYLON || (BABYLON = {}));
  33998. var BABYLON;
  33999. (function (BABYLON) {
  34000. var LensRenderingPipeline = (function (_super) {
  34001. __extends(LensRenderingPipeline, _super);
  34002. /**
  34003. * @constructor
  34004. *
  34005. * Effect parameters are as follow:
  34006. * {
  34007. * chromatic_aberration: number; // from 0 to x (1 for realism)
  34008. * edge_blur: number; // from 0 to x (1 for realism)
  34009. * distortion: number; // from 0 to x (1 for realism)
  34010. * grain_amount: number; // from 0 to 1
  34011. * grain_texture: BABYLON.Texture; // texture to use for grain effect; if unset, use random B&W noise
  34012. * dof_focus_distance: number; // depth-of-field: focus distance; unset to disable (disabled by default)
  34013. * dof_aperture: number; // depth-of-field: focus blur bias (default: 1)
  34014. * dof_darken: number; // depth-of-field: darken that which is out of focus (from 0 to 1, disabled by default)
  34015. * dof_pentagon: boolean; // depth-of-field: makes a pentagon-like "bokeh" effect
  34016. * dof_gain: number; // depth-of-field: highlights gain; unset to disable (disabled by default)
  34017. * dof_threshold: number; // depth-of-field: highlights threshold (default: 1)
  34018. * blur_noise: boolean; // add a little bit of noise to the blur (default: true)
  34019. * }
  34020. * Note: if an effect parameter is unset, effect is disabled
  34021. *
  34022. * @param {string} name - The rendering pipeline name
  34023. * @param {object} parameters - An object containing all parameters (see above)
  34024. * @param {BABYLON.Scene} scene - The scene linked to this pipeline
  34025. * @param {number} ratio - The size of the postprocesses (0.5 means that your postprocess will have a width = canvas.width 0.5 and a height = canvas.height 0.5)
  34026. * @param {BABYLON.Camera[]} cameras - The array of cameras that the rendering pipeline will be attached to
  34027. */
  34028. function LensRenderingPipeline(name, parameters, scene, ratio, cameras) {
  34029. var _this = this;
  34030. if (ratio === void 0) { ratio = 1.0; }
  34031. _super.call(this, scene.getEngine(), name);
  34032. // Lens effects can be of the following:
  34033. // - chromatic aberration (slight shift of RGB colors)
  34034. // - blur on the edge of the lens
  34035. // - lens distortion
  34036. // - depth-of-field blur & highlights enhancing
  34037. // - depth-of-field 'bokeh' effect (shapes appearing in blurred areas)
  34038. // - grain effect (noise or custom texture)
  34039. // Two additional texture samplers are needed:
  34040. // - depth map (for depth-of-field)
  34041. // - grain texture
  34042. /**
  34043. * The chromatic aberration PostProcess id in the pipeline
  34044. * @type {string}
  34045. */
  34046. this.LensChromaticAberrationEffect = "LensChromaticAberrationEffect";
  34047. /**
  34048. * The highlights enhancing PostProcess id in the pipeline
  34049. * @type {string}
  34050. */
  34051. this.HighlightsEnhancingEffect = "HighlightsEnhancingEffect";
  34052. /**
  34053. * The depth-of-field PostProcess id in the pipeline
  34054. * @type {string}
  34055. */
  34056. this.LensDepthOfFieldEffect = "LensDepthOfFieldEffect";
  34057. this._scene = scene;
  34058. // Fetch texture samplers
  34059. this._depthTexture = scene.enableDepthRenderer().getDepthMap(); // Force depth renderer "on"
  34060. if (parameters.grain_texture) {
  34061. this._grainTexture = parameters.grain_texture;
  34062. }
  34063. else {
  34064. this._createGrainTexture();
  34065. }
  34066. // save parameters
  34067. this._edgeBlur = parameters.edge_blur ? parameters.edge_blur : 0;
  34068. this._grainAmount = parameters.grain_amount ? parameters.grain_amount : 0;
  34069. this._chromaticAberration = parameters.chromatic_aberration ? parameters.chromatic_aberration : 0;
  34070. this._distortion = parameters.distortion ? parameters.distortion : 0;
  34071. this._highlightsGain = parameters.dof_gain !== undefined ? parameters.dof_gain : -1;
  34072. this._highlightsThreshold = parameters.dof_threshold ? parameters.dof_threshold : 1;
  34073. this._dofDistance = parameters.dof_focus_distance !== undefined ? parameters.dof_focus_distance : -1;
  34074. this._dofAperture = parameters.dof_aperture ? parameters.dof_aperture : 1;
  34075. this._dofDarken = parameters.dof_darken ? parameters.dof_darken : 0;
  34076. this._dofPentagon = parameters.dof_pentagon !== undefined ? parameters.dof_pentagon : true;
  34077. this._blurNoise = parameters.blur_noise !== undefined ? parameters.blur_noise : true;
  34078. // Create effects
  34079. this._createChromaticAberrationPostProcess(ratio);
  34080. this._createHighlightsPostProcess(ratio);
  34081. this._createDepthOfFieldPostProcess(ratio / 4);
  34082. // Set up pipeline
  34083. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), this.LensChromaticAberrationEffect, function () { return _this._chromaticAberrationPostProcess; }, true));
  34084. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), this.HighlightsEnhancingEffect, function () { return _this._highlightsPostProcess; }, true));
  34085. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), this.LensDepthOfFieldEffect, function () { return _this._depthOfFieldPostProcess; }, true));
  34086. if (this._highlightsGain == -1) {
  34087. this._disableEffect(this.HighlightsEnhancingEffect, null);
  34088. }
  34089. // Finish
  34090. scene.postProcessRenderPipelineManager.addPipeline(this);
  34091. if (cameras) {
  34092. scene.postProcessRenderPipelineManager.attachCamerasToRenderPipeline(name, cameras);
  34093. }
  34094. }
  34095. // public methods (self explanatory)
  34096. LensRenderingPipeline.prototype.setEdgeBlur = function (amount) { this._edgeBlur = amount; };
  34097. LensRenderingPipeline.prototype.disableEdgeBlur = function () { this._edgeBlur = 0; };
  34098. LensRenderingPipeline.prototype.setGrainAmount = function (amount) { this._grainAmount = amount; };
  34099. LensRenderingPipeline.prototype.disableGrain = function () { this._grainAmount = 0; };
  34100. LensRenderingPipeline.prototype.setChromaticAberration = function (amount) { this._chromaticAberration = amount; };
  34101. LensRenderingPipeline.prototype.disableChromaticAberration = function () { this._chromaticAberration = 0; };
  34102. LensRenderingPipeline.prototype.setEdgeDistortion = function (amount) { this._distortion = amount; };
  34103. LensRenderingPipeline.prototype.disableEdgeDistortion = function () { this._distortion = 0; };
  34104. LensRenderingPipeline.prototype.setFocusDistance = function (amount) { this._dofDistance = amount; };
  34105. LensRenderingPipeline.prototype.disableDepthOfField = function () { this._dofDistance = -1; };
  34106. LensRenderingPipeline.prototype.setAperture = function (amount) { this._dofAperture = amount; };
  34107. LensRenderingPipeline.prototype.setDarkenOutOfFocus = function (amount) { this._dofDarken = amount; };
  34108. LensRenderingPipeline.prototype.enablePentagonBokeh = function () { this._dofPentagon = true; };
  34109. LensRenderingPipeline.prototype.disablePentagonBokeh = function () { this._dofPentagon = false; };
  34110. LensRenderingPipeline.prototype.enableNoiseBlur = function () { this._blurNoise = true; };
  34111. LensRenderingPipeline.prototype.disableNoiseBlur = function () { this._blurNoise = false; };
  34112. LensRenderingPipeline.prototype.setHighlightsGain = function (amount) {
  34113. this._highlightsGain = amount;
  34114. };
  34115. LensRenderingPipeline.prototype.setHighlightsThreshold = function (amount) {
  34116. if (this._highlightsGain == -1) {
  34117. this._highlightsGain = 1.0;
  34118. }
  34119. this._highlightsThreshold = amount;
  34120. };
  34121. LensRenderingPipeline.prototype.disableHighlights = function () {
  34122. this._highlightsGain = -1;
  34123. };
  34124. /**
  34125. * Removes the internal pipeline assets and detaches the pipeline from the scene cameras
  34126. */
  34127. LensRenderingPipeline.prototype.dispose = function (disableDepthRender) {
  34128. if (disableDepthRender === void 0) { disableDepthRender = false; }
  34129. this._scene.postProcessRenderPipelineManager.detachCamerasFromRenderPipeline(this._name, this._scene.cameras);
  34130. this._chromaticAberrationPostProcess = undefined;
  34131. this._highlightsPostProcess = undefined;
  34132. this._depthOfFieldPostProcess = undefined;
  34133. this._grainTexture.dispose();
  34134. if (disableDepthRender)
  34135. this._scene.disableDepthRenderer();
  34136. };
  34137. // colors shifting and distortion
  34138. LensRenderingPipeline.prototype._createChromaticAberrationPostProcess = function (ratio) {
  34139. var _this = this;
  34140. this._chromaticAberrationPostProcess = new BABYLON.PostProcess("LensChromaticAberration", "chromaticAberration", ["chromatic_aberration", "screen_width", "screen_height"], // uniforms
  34141. [], // samplers
  34142. ratio, null, BABYLON.Texture.TRILINEAR_SAMPLINGMODE, this._scene.getEngine(), false);
  34143. this._chromaticAberrationPostProcess.onApply = function (effect) {
  34144. effect.setFloat('chromatic_aberration', _this._chromaticAberration);
  34145. effect.setFloat('screen_width', _this._scene.getEngine().getRenderingCanvas().width);
  34146. effect.setFloat('screen_height', _this._scene.getEngine().getRenderingCanvas().height);
  34147. };
  34148. };
  34149. // highlights enhancing
  34150. LensRenderingPipeline.prototype._createHighlightsPostProcess = function (ratio) {
  34151. var _this = this;
  34152. this._highlightsPostProcess = new BABYLON.PostProcess("LensHighlights", "lensHighlights", ["pentagon", "gain", "threshold", "screen_width", "screen_height"], // uniforms
  34153. [], // samplers
  34154. ratio, null, BABYLON.Texture.TRILINEAR_SAMPLINGMODE, this._scene.getEngine(), false);
  34155. this._highlightsPostProcess.onApply = function (effect) {
  34156. effect.setFloat('gain', _this._highlightsGain);
  34157. effect.setFloat('threshold', _this._highlightsThreshold);
  34158. effect.setBool('pentagon', _this._dofPentagon);
  34159. effect.setTextureFromPostProcess("textureSampler", _this._chromaticAberrationPostProcess);
  34160. effect.setFloat('screen_width', _this._scene.getEngine().getRenderingCanvas().width);
  34161. effect.setFloat('screen_height', _this._scene.getEngine().getRenderingCanvas().height);
  34162. };
  34163. };
  34164. // colors shifting and distortion
  34165. LensRenderingPipeline.prototype._createDepthOfFieldPostProcess = function (ratio) {
  34166. var _this = this;
  34167. this._depthOfFieldPostProcess = new BABYLON.PostProcess("LensDepthOfField", "depthOfField", [
  34168. "grain_amount", "blur_noise", "screen_width", "screen_height", "distortion", "dof_enabled",
  34169. "screen_distance", "aperture", "darken", "edge_blur", "highlights", "near", "far"
  34170. ], ["depthSampler", "grainSampler", "highlightsSampler"], ratio, null, BABYLON.Texture.TRILINEAR_SAMPLINGMODE, this._scene.getEngine(), false);
  34171. this._depthOfFieldPostProcess.onApply = function (effect) {
  34172. effect.setTexture("depthSampler", _this._depthTexture);
  34173. effect.setTexture("grainSampler", _this._grainTexture);
  34174. effect.setTextureFromPostProcess("textureSampler", _this._highlightsPostProcess);
  34175. effect.setTextureFromPostProcess("highlightsSampler", _this._depthOfFieldPostProcess);
  34176. effect.setFloat('grain_amount', _this._grainAmount);
  34177. effect.setBool('blur_noise', _this._blurNoise);
  34178. effect.setFloat('screen_width', _this._scene.getEngine().getRenderingCanvas().width);
  34179. effect.setFloat('screen_height', _this._scene.getEngine().getRenderingCanvas().height);
  34180. effect.setFloat('distortion', _this._distortion);
  34181. effect.setBool('dof_enabled', (_this._dofDistance != -1));
  34182. effect.setFloat('screen_distance', 1.0 / (0.1 - 1.0 / _this._dofDistance));
  34183. effect.setFloat('aperture', _this._dofAperture);
  34184. effect.setFloat('darken', _this._dofDarken);
  34185. effect.setFloat('edge_blur', _this._edgeBlur);
  34186. effect.setBool('highlights', (_this._highlightsGain != -1));
  34187. effect.setFloat('near', _this._scene.activeCamera.minZ);
  34188. effect.setFloat('far', _this._scene.activeCamera.maxZ);
  34189. };
  34190. };
  34191. // creates a black and white random noise texture, 512x512
  34192. LensRenderingPipeline.prototype._createGrainTexture = function () {
  34193. var size = 512;
  34194. this._grainTexture = new BABYLON.DynamicTexture("LensNoiseTexture", size, this._scene, false, BABYLON.Texture.BILINEAR_SAMPLINGMODE);
  34195. this._grainTexture.wrapU = BABYLON.Texture.WRAP_ADDRESSMODE;
  34196. this._grainTexture.wrapV = BABYLON.Texture.WRAP_ADDRESSMODE;
  34197. var context = this._grainTexture.getContext();
  34198. var rand = function (min, max) {
  34199. return Math.random() * (max - min) + min;
  34200. };
  34201. var value;
  34202. for (var x = 0; x < size; x++) {
  34203. for (var y = 0; y < size; y++) {
  34204. value = Math.floor(rand(0.42, 0.58) * 255);
  34205. context.fillStyle = 'rgb(' + value + ', ' + value + ', ' + value + ')';
  34206. context.fillRect(x, y, 1, 1);
  34207. }
  34208. }
  34209. this._grainTexture.update(false);
  34210. };
  34211. return LensRenderingPipeline;
  34212. })(BABYLON.PostProcessRenderPipeline);
  34213. BABYLON.LensRenderingPipeline = LensRenderingPipeline;
  34214. })(BABYLON || (BABYLON = {}));
  34215. //
  34216. // This post-process allows the modification of rendered colors by using
  34217. // a 'look-up table' (LUT). This effect is also called Color Grading.
  34218. //
  34219. // The object needs to be provided an url to a texture containing the color
  34220. // look-up table: the texture must be 256 pixels wide and 16 pixels high.
  34221. // Use an image editing software to tweak the LUT to match your needs.
  34222. //
  34223. // For an example of a color LUT, see here:
  34224. // http://udn.epicgames.com/Three/rsrc/Three/ColorGrading/RGBTable16x1.png
  34225. // For explanations on color grading, see here:
  34226. // http://udn.epicgames.com/Three/ColorGrading.html
  34227. //
  34228. var BABYLON;
  34229. (function (BABYLON) {
  34230. var ColorCorrectionPostProcess = (function (_super) {
  34231. __extends(ColorCorrectionPostProcess, _super);
  34232. function ColorCorrectionPostProcess(name, colorTableUrl, ratio, camera, samplingMode, engine, reusable) {
  34233. var _this = this;
  34234. _super.call(this, name, 'colorCorrection', null, ['colorTable'], ratio, camera, samplingMode, engine, reusable);
  34235. this._colorTableTexture = new BABYLON.Texture(colorTableUrl, camera.getScene(), true, false, BABYLON.Texture.TRILINEAR_SAMPLINGMODE);
  34236. this._colorTableTexture.anisotropicFilteringLevel = 1;
  34237. this._colorTableTexture.wrapU = BABYLON.Texture.CLAMP_ADDRESSMODE;
  34238. this._colorTableTexture.wrapV = BABYLON.Texture.CLAMP_ADDRESSMODE;
  34239. this.onApply = function (effect) {
  34240. effect.setTexture("colorTable", _this._colorTableTexture);
  34241. };
  34242. }
  34243. return ColorCorrectionPostProcess;
  34244. })(BABYLON.PostProcess);
  34245. BABYLON.ColorCorrectionPostProcess = ColorCorrectionPostProcess;
  34246. })(BABYLON || (BABYLON = {}));
  34247. var BABYLON;
  34248. (function (BABYLON) {
  34249. var AnaglyphFreeCamera = (function (_super) {
  34250. __extends(AnaglyphFreeCamera, _super);
  34251. function AnaglyphFreeCamera(name, position, interaxialDistance, scene) {
  34252. _super.call(this, name, position, scene);
  34253. this.setCameraRigMode(BABYLON.Camera.RIG_MODE_STEREOSCOPIC_ANAGLYPH, { interaxialDistance: interaxialDistance });
  34254. }
  34255. return AnaglyphFreeCamera;
  34256. })(BABYLON.FreeCamera);
  34257. BABYLON.AnaglyphFreeCamera = AnaglyphFreeCamera;
  34258. var AnaglyphArcRotateCamera = (function (_super) {
  34259. __extends(AnaglyphArcRotateCamera, _super);
  34260. function AnaglyphArcRotateCamera(name, alpha, beta, radius, target, interaxialDistance, scene) {
  34261. _super.call(this, name, alpha, beta, radius, target, scene);
  34262. this.setCameraRigMode(BABYLON.Camera.RIG_MODE_STEREOSCOPIC_ANAGLYPH, { interaxialDistance: interaxialDistance });
  34263. }
  34264. return AnaglyphArcRotateCamera;
  34265. })(BABYLON.ArcRotateCamera);
  34266. BABYLON.AnaglyphArcRotateCamera = AnaglyphArcRotateCamera;
  34267. var AnaglyphGamepadCamera = (function (_super) {
  34268. __extends(AnaglyphGamepadCamera, _super);
  34269. function AnaglyphGamepadCamera(name, position, interaxialDistance, scene) {
  34270. _super.call(this, name, position, scene);
  34271. this.setCameraRigMode(BABYLON.Camera.RIG_MODE_STEREOSCOPIC_ANAGLYPH, { interaxialDistance: interaxialDistance });
  34272. }
  34273. return AnaglyphGamepadCamera;
  34274. })(BABYLON.GamepadCamera);
  34275. BABYLON.AnaglyphGamepadCamera = AnaglyphGamepadCamera;
  34276. var StereoscopicFreeCamera = (function (_super) {
  34277. __extends(StereoscopicFreeCamera, _super);
  34278. function StereoscopicFreeCamera(name, position, interaxialDistance, isSideBySide, scene) {
  34279. _super.call(this, name, position, scene);
  34280. this.setCameraRigMode(isSideBySide ? BABYLON.Camera.RIG_MODE_STEREOSCOPIC_SIDEBYSIDE_PARALLEL : BABYLON.Camera.RIG_MODE_STEREOSCOPIC_OVERUNDER, { interaxialDistance: interaxialDistance });
  34281. }
  34282. return StereoscopicFreeCamera;
  34283. })(BABYLON.FreeCamera);
  34284. BABYLON.StereoscopicFreeCamera = StereoscopicFreeCamera;
  34285. var StereoscopicArcRotateCamera = (function (_super) {
  34286. __extends(StereoscopicArcRotateCamera, _super);
  34287. function StereoscopicArcRotateCamera(name, alpha, beta, radius, target, interaxialDistance, isSideBySide, scene) {
  34288. _super.call(this, name, alpha, beta, radius, target, scene);
  34289. this.setCameraRigMode(isSideBySide ? BABYLON.Camera.RIG_MODE_STEREOSCOPIC_SIDEBYSIDE_PARALLEL : BABYLON.Camera.RIG_MODE_STEREOSCOPIC_OVERUNDER, { interaxialDistance: interaxialDistance });
  34290. }
  34291. return StereoscopicArcRotateCamera;
  34292. })(BABYLON.ArcRotateCamera);
  34293. BABYLON.StereoscopicArcRotateCamera = StereoscopicArcRotateCamera;
  34294. var StereoscopicGamepadCamera = (function (_super) {
  34295. __extends(StereoscopicGamepadCamera, _super);
  34296. function StereoscopicGamepadCamera(name, position, interaxialDistance, isSideBySide, scene) {
  34297. _super.call(this, name, position, scene);
  34298. this.setCameraRigMode(isSideBySide ? BABYLON.Camera.RIG_MODE_STEREOSCOPIC_SIDEBYSIDE_PARALLEL : BABYLON.Camera.RIG_MODE_STEREOSCOPIC_OVERUNDER, { interaxialDistance: interaxialDistance });
  34299. }
  34300. return StereoscopicGamepadCamera;
  34301. })(BABYLON.GamepadCamera);
  34302. BABYLON.StereoscopicGamepadCamera = StereoscopicGamepadCamera;
  34303. })(BABYLON || (BABYLON = {}));
  34304. var BABYLON;
  34305. (function (BABYLON) {
  34306. var HDRRenderingPipeline = (function (_super) {
  34307. __extends(HDRRenderingPipeline, _super);
  34308. /**
  34309. * @constructor
  34310. * @param {string} name - The rendering pipeline name
  34311. * @param {BABYLON.Scene} scene - The scene linked to this pipeline
  34312. * @param {any} ratio - The size of the postprocesses (0.5 means that your postprocess will have a width = canvas.width 0.5 and a height = canvas.height 0.5)
  34313. * @param {BABYLON.PostProcess} originalPostProcess - the custom original color post-process. Must be "reusable". Can be null.
  34314. * @param {BABYLON.Camera[]} cameras - The array of cameras that the rendering pipeline will be attached to
  34315. */
  34316. function HDRRenderingPipeline(name, scene, ratio, originalPostProcess, cameras) {
  34317. var _this = this;
  34318. if (originalPostProcess === void 0) { originalPostProcess = null; }
  34319. _super.call(this, scene.getEngine(), name);
  34320. /**
  34321. * Public members
  34322. */
  34323. // Gaussian Blur
  34324. /**
  34325. * Gaussian blur coefficient
  34326. * @type {number}
  34327. */
  34328. this.gaussCoeff = 0.3;
  34329. /**
  34330. * Gaussian blur mean
  34331. * @type {number}
  34332. */
  34333. this.gaussMean = 1.0;
  34334. /**
  34335. * Gaussian blur standard deviation
  34336. * @type {number}
  34337. */
  34338. this.gaussStandDev = 0.8;
  34339. // HDR
  34340. /**
  34341. * Exposure, controls the overall intensity of the pipeline
  34342. * @type {number}
  34343. */
  34344. this.exposure = 1.0;
  34345. /**
  34346. * Minimum luminance that the post-process can output. Luminance is >= 0
  34347. * @type {number}
  34348. */
  34349. this.minimumLuminance = 1.0;
  34350. /**
  34351. * Maximum luminance that the post-process can output. Must be suprerior to minimumLuminance
  34352. * @type {number}
  34353. */
  34354. this.maximumLuminance = 1e20;
  34355. /**
  34356. * Increase rate for luminance: eye adaptation speed to dark
  34357. * @type {number}
  34358. */
  34359. this.luminanceIncreaserate = 0.5;
  34360. /**
  34361. * Decrease rate for luminance: eye adaptation speed to bright
  34362. * @type {number}
  34363. */
  34364. this.luminanceDecreaseRate = 0.5;
  34365. // Bright pass
  34366. /**
  34367. * Minimum luminance needed to compute HDR
  34368. * @type {number}
  34369. */
  34370. this.brightThreshold = 0.8;
  34371. this._needUpdate = true;
  34372. this._scene = scene;
  34373. // Bright pass
  34374. this._createBrightPassPostProcess(scene, ratio);
  34375. // Down sample X4
  34376. this._createDownSampleX4PostProcess(scene, ratio);
  34377. // Create gaussian blur post-processes
  34378. this._createGaussianBlurPostProcess(scene, ratio);
  34379. // Texture adder
  34380. this._createTextureAdderPostProcess(scene, ratio);
  34381. // Luminance generator
  34382. this._createLuminanceGeneratorPostProcess(scene);
  34383. // HDR
  34384. this._createHDRPostProcess(scene, ratio);
  34385. // Pass postprocess
  34386. if (originalPostProcess === null) {
  34387. this._originalPostProcess = new BABYLON.PassPostProcess("hdr", ratio, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, scene.getEngine(), false);
  34388. }
  34389. else {
  34390. this._originalPostProcess = originalPostProcess;
  34391. }
  34392. // Configure pipeline
  34393. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), "HDRPassPostProcess", function () { return _this._originalPostProcess; }, true));
  34394. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), "HDRBrightPass", function () { return _this._brightPassPostProcess; }, true));
  34395. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), "HDRDownSampleX4", function () { return _this._downSampleX4PostProcess; }, true));
  34396. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), "HDRGaussianBlurH", function () { return _this._guassianBlurHPostProcess; }, true));
  34397. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), "HDRGaussianBlurV", function () { return _this._guassianBlurVPostProcess; }, true));
  34398. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), "HDRTextureAdder", function () { return _this._textureAdderPostProcess; }, true));
  34399. var addDownSamplerPostProcess = function (id) {
  34400. _this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), "HDRDownSampler" + id, function () { return _this._downSamplePostProcesses[id]; }, true));
  34401. };
  34402. for (var i = HDRRenderingPipeline.LUM_STEPS - 1; i >= 0; i--) {
  34403. addDownSamplerPostProcess(i);
  34404. }
  34405. this.addEffect(new BABYLON.PostProcessRenderEffect(scene.getEngine(), "HDR", function () { return _this._hdrPostProcess; }, true));
  34406. // Finish
  34407. scene.postProcessRenderPipelineManager.addPipeline(this);
  34408. if (cameras !== null) {
  34409. scene.postProcessRenderPipelineManager.attachCamerasToRenderPipeline(name, cameras);
  34410. }
  34411. this.update();
  34412. }
  34413. /**
  34414. * Tells the pipeline to update its post-processes
  34415. */
  34416. HDRRenderingPipeline.prototype.update = function () {
  34417. this._needUpdate = true;
  34418. };
  34419. /**
  34420. * Returns the current calculated luminance
  34421. */
  34422. HDRRenderingPipeline.prototype.getCurrentLuminance = function () {
  34423. return this._hdrCurrentLuminance;
  34424. };
  34425. /**
  34426. * Returns the currently drawn luminance
  34427. */
  34428. HDRRenderingPipeline.prototype.getOutputLuminance = function () {
  34429. return this._hdrOutputLuminance;
  34430. };
  34431. /**
  34432. * Releases the rendering pipeline and its internal effects. Detaches pipeline from cameras
  34433. */
  34434. HDRRenderingPipeline.prototype.dispose = function () {
  34435. this._originalPostProcess = undefined;
  34436. this._brightPassPostProcess = undefined;
  34437. this._downSampleX4PostProcess = undefined;
  34438. this._guassianBlurHPostProcess = undefined;
  34439. this._guassianBlurVPostProcess = undefined;
  34440. this._textureAdderPostProcess = undefined;
  34441. for (var i = HDRRenderingPipeline.LUM_STEPS - 1; i >= 0; i--) {
  34442. this._downSamplePostProcesses[i] = undefined;
  34443. }
  34444. this._hdrPostProcess = undefined;
  34445. this._scene.postProcessRenderPipelineManager.detachCamerasFromRenderPipeline(this._name, this._scene.cameras);
  34446. };
  34447. /**
  34448. * Creates the HDR post-process and computes the luminance adaptation
  34449. */
  34450. HDRRenderingPipeline.prototype._createHDRPostProcess = function (scene, ratio) {
  34451. var _this = this;
  34452. var hdrLastLuminance = 0.0;
  34453. this._hdrOutputLuminance = -1.0;
  34454. this._hdrCurrentLuminance = 1.0;
  34455. this._hdrPostProcess = new BABYLON.PostProcess("hdr", "hdr", ["exposure", "avgLuminance"], ["otherSampler"], ratio, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, scene.getEngine(), false, "#define HDR");
  34456. this._hdrPostProcess.onApply = function (effect) {
  34457. if (_this._hdrOutputLuminance < 0.0) {
  34458. _this._hdrOutputLuminance = _this._hdrCurrentLuminance;
  34459. }
  34460. else {
  34461. var dt = (hdrLastLuminance - (hdrLastLuminance + scene.getEngine().getDeltaTime())) / 1000.0;
  34462. if (_this._hdrCurrentLuminance < _this._hdrOutputLuminance + _this.luminanceDecreaseRate * dt) {
  34463. _this._hdrOutputLuminance += _this.luminanceDecreaseRate * dt;
  34464. }
  34465. else if (_this._hdrCurrentLuminance > _this._hdrOutputLuminance - _this.luminanceIncreaserate * dt) {
  34466. _this._hdrOutputLuminance -= _this.luminanceIncreaserate * dt;
  34467. }
  34468. else {
  34469. _this._hdrOutputLuminance = _this._hdrCurrentLuminance;
  34470. }
  34471. }
  34472. _this._hdrOutputLuminance = BABYLON.Tools.Clamp(_this._hdrOutputLuminance, _this.minimumLuminance, _this.maximumLuminance);
  34473. hdrLastLuminance += scene.getEngine().getDeltaTime();
  34474. effect.setTextureFromPostProcess("textureSampler", _this._textureAdderPostProcess);
  34475. effect.setTextureFromPostProcess("otherSampler", _this._originalPostProcess);
  34476. effect.setFloat("exposure", _this.exposure);
  34477. effect.setFloat("avgLuminance", _this._hdrOutputLuminance);
  34478. _this._needUpdate = false;
  34479. };
  34480. };
  34481. /**
  34482. * Texture Adder post-process
  34483. */
  34484. HDRRenderingPipeline.prototype._createTextureAdderPostProcess = function (scene, ratio) {
  34485. var _this = this;
  34486. this._textureAdderPostProcess = new BABYLON.PostProcess("hdr", "hdr", [], ["otherSampler"], ratio, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, scene.getEngine(), false, "#define TEXTURE_ADDER");
  34487. this._textureAdderPostProcess.onApply = function (effect) {
  34488. effect.setTextureFromPostProcess("otherSampler", _this._originalPostProcess);
  34489. };
  34490. };
  34491. /**
  34492. * Down sample X4 post-process
  34493. */
  34494. HDRRenderingPipeline.prototype._createDownSampleX4PostProcess = function (scene, ratio) {
  34495. var _this = this;
  34496. var downSampleX4Offsets = new Array(32);
  34497. this._downSampleX4PostProcess = new BABYLON.PostProcess("hdr", "hdr", ["dsOffsets"], [], ratio / 4, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, scene.getEngine(), false, "#define DOWN_SAMPLE_X4");
  34498. this._downSampleX4PostProcess.onApply = function (effect) {
  34499. if (_this._needUpdate) {
  34500. var id = 0;
  34501. for (var i = -2; i < 2; i++) {
  34502. for (var j = -2; j < 2; j++) {
  34503. downSampleX4Offsets[id] = (i + 0.5) * (1.0 / _this._downSampleX4PostProcess.width);
  34504. downSampleX4Offsets[id + 1] = (j + 0.5) * (1.0 / _this._downSampleX4PostProcess.height);
  34505. id += 2;
  34506. }
  34507. }
  34508. }
  34509. effect.setArray2("dsOffsets", downSampleX4Offsets);
  34510. };
  34511. };
  34512. /**
  34513. * Bright pass post-process
  34514. */
  34515. HDRRenderingPipeline.prototype._createBrightPassPostProcess = function (scene, ratio) {
  34516. var _this = this;
  34517. var brightOffsets = new Array(8);
  34518. var brightPassCallback = function (effect) {
  34519. if (_this._needUpdate) {
  34520. var sU = (1.0 / _this._brightPassPostProcess.width);
  34521. var sV = (1.0 / _this._brightPassPostProcess.height);
  34522. brightOffsets[0] = -0.5 * sU;
  34523. brightOffsets[1] = 0.5 * sV;
  34524. brightOffsets[2] = 0.5 * sU;
  34525. brightOffsets[3] = 0.5 * sV;
  34526. brightOffsets[4] = -0.5 * sU;
  34527. brightOffsets[5] = -0.5 * sV;
  34528. brightOffsets[6] = 0.5 * sU;
  34529. brightOffsets[7] = -0.5 * sV;
  34530. }
  34531. effect.setArray2("dsOffsets", brightOffsets);
  34532. effect.setFloat("brightThreshold", _this.brightThreshold);
  34533. };
  34534. this._brightPassPostProcess = new BABYLON.PostProcess("hdr", "hdr", ["dsOffsets", "brightThreshold"], [], ratio, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, scene.getEngine(), false, "#define BRIGHT_PASS");
  34535. this._brightPassPostProcess.onApply = brightPassCallback;
  34536. };
  34537. /**
  34538. * Luminance generator. Creates the luminance post-process and down sample post-processes
  34539. */
  34540. HDRRenderingPipeline.prototype._createLuminanceGeneratorPostProcess = function (scene) {
  34541. var _this = this;
  34542. var lumSteps = HDRRenderingPipeline.LUM_STEPS;
  34543. var luminanceOffsets = new Array(8);
  34544. var downSampleOffsets = new Array(18);
  34545. var halfDestPixelSize;
  34546. this._downSamplePostProcesses = new Array(lumSteps);
  34547. // Utils for luminance
  34548. var luminanceUpdateSourceOffsets = function (width, height) {
  34549. var sU = (1.0 / width);
  34550. var sV = (1.0 / height);
  34551. luminanceOffsets[0] = -0.5 * sU;
  34552. luminanceOffsets[1] = 0.5 * sV;
  34553. luminanceOffsets[2] = 0.5 * sU;
  34554. luminanceOffsets[3] = 0.5 * sV;
  34555. luminanceOffsets[4] = -0.5 * sU;
  34556. luminanceOffsets[5] = -0.5 * sV;
  34557. luminanceOffsets[6] = 0.5 * sU;
  34558. luminanceOffsets[7] = -0.5 * sV;
  34559. };
  34560. var luminanceUpdateDestOffsets = function (width, height) {
  34561. var id = 0;
  34562. for (var x = -1; x < 2; x++) {
  34563. for (var y = -1; y < 2; y++) {
  34564. downSampleOffsets[id] = (x) / width;
  34565. downSampleOffsets[id + 1] = (y) / height;
  34566. id += 2;
  34567. }
  34568. }
  34569. };
  34570. // Luminance callback
  34571. var luminanceCallback = function (effect) {
  34572. if (_this._needUpdate) {
  34573. luminanceUpdateSourceOffsets(_this._textureAdderPostProcess.width, _this._textureAdderPostProcess.height);
  34574. }
  34575. effect.setTextureFromPostProcess("textureSampler", _this._textureAdderPostProcess);
  34576. effect.setArray2("lumOffsets", luminanceOffsets);
  34577. };
  34578. // Down sample callbacks
  34579. var downSampleCallback = function (indice) {
  34580. var i = indice;
  34581. return function (effect) {
  34582. luminanceUpdateSourceOffsets(_this._downSamplePostProcesses[i].width, _this._downSamplePostProcesses[i].height);
  34583. luminanceUpdateDestOffsets(_this._downSamplePostProcesses[i].width, _this._downSamplePostProcesses[i].height);
  34584. halfDestPixelSize = 0.5 / _this._downSamplePostProcesses[i].width;
  34585. effect.setTextureFromPostProcess("textureSampler", _this._downSamplePostProcesses[i + 1]);
  34586. effect.setFloat("halfDestPixelSize", halfDestPixelSize);
  34587. effect.setArray2("dsOffsets", downSampleOffsets);
  34588. };
  34589. };
  34590. var downSampleAfterRenderCallback = function (effect) {
  34591. // Unpack result
  34592. var pixel = scene.getEngine().readPixels(0, 0, 1, 1);
  34593. var bit_shift = new BABYLON.Vector4(1.0 / (255.0 * 255.0 * 255.0), 1.0 / (255.0 * 255.0), 1.0 / 255.0, 1.0);
  34594. _this._hdrCurrentLuminance = (pixel[0] * bit_shift.x + pixel[1] * bit_shift.y + pixel[2] * bit_shift.z + pixel[3] * bit_shift.w) / 100.0;
  34595. };
  34596. // Create luminance post-process
  34597. var ratio = { width: Math.pow(3, lumSteps - 1), height: Math.pow(3, lumSteps - 1) };
  34598. this._downSamplePostProcesses[lumSteps - 1] = new BABYLON.PostProcess("hdr", "hdr", ["lumOffsets"], [], ratio, null, BABYLON.Texture.NEAREST_SAMPLINGMODE, scene.getEngine(), false, "#define LUMINANCE_GENERATOR", BABYLON.Engine.TEXTURETYPE_FLOAT);
  34599. this._downSamplePostProcesses[lumSteps - 1].onApply = luminanceCallback;
  34600. // Create down sample post-processes
  34601. for (var i = lumSteps - 2; i >= 0; i--) {
  34602. var length = Math.pow(3, i);
  34603. ratio = { width: length, height: length };
  34604. var defines = "#define DOWN_SAMPLE\n";
  34605. if (i === 0) {
  34606. defines += "#define FINAL_DOWN_SAMPLE\n"; // To pack the result
  34607. }
  34608. this._downSamplePostProcesses[i] = new BABYLON.PostProcess("hdr", "hdr", ["dsOffsets", "halfDestPixelSize"], [], ratio, null, BABYLON.Texture.NEAREST_SAMPLINGMODE, scene.getEngine(), false, defines, BABYLON.Engine.TEXTURETYPE_FLOAT);
  34609. this._downSamplePostProcesses[i].onApply = downSampleCallback(i);
  34610. if (i === 0) {
  34611. this._downSamplePostProcesses[i].onAfterRender = downSampleAfterRenderCallback;
  34612. }
  34613. }
  34614. };
  34615. /**
  34616. * Gaussian blur post-processes. Horizontal and Vertical
  34617. */
  34618. HDRRenderingPipeline.prototype._createGaussianBlurPostProcess = function (scene, ratio) {
  34619. var _this = this;
  34620. var blurOffsetsW = new Array(9);
  34621. var blurOffsetsH = new Array(9);
  34622. var blurWeights = new Array(9);
  34623. var uniforms = ["blurOffsets", "blurWeights"];
  34624. // Utils for gaussian blur
  34625. var calculateBlurOffsets = function (height) {
  34626. var lastOutputDimensions = {
  34627. width: scene.getEngine().getRenderWidth() * (ratio / 4),
  34628. height: scene.getEngine().getRenderHeight() * (ratio / 4)
  34629. };
  34630. for (var i = 0; i < 9; i++) {
  34631. var value = (i - 4.0) * (1.0 / (height === true ? lastOutputDimensions.height : lastOutputDimensions.width));
  34632. if (height) {
  34633. blurOffsetsH[i] = value;
  34634. }
  34635. else {
  34636. blurOffsetsW[i] = value;
  34637. }
  34638. }
  34639. };
  34640. var calculateWeights = function () {
  34641. var x = 0.0;
  34642. for (var i = 0; i < 9; i++) {
  34643. x = (i - 4.0) / 4.0;
  34644. blurWeights[i] = _this.gaussCoeff * (1.0 / Math.sqrt(2.0 * Math.PI * _this.gaussStandDev)) * Math.exp((-((x - _this.gaussMean) * (x - _this.gaussMean))) / (2.0 * _this.gaussStandDev * _this.gaussStandDev));
  34645. }
  34646. };
  34647. // Callback
  34648. var gaussianBlurCallback = function (height) {
  34649. return function (effect) {
  34650. if (_this._needUpdate) {
  34651. calculateWeights();
  34652. calculateBlurOffsets(height);
  34653. }
  34654. effect.setArray("blurOffsets", height ? blurOffsetsH : blurOffsetsW);
  34655. effect.setArray("blurWeights", blurWeights);
  34656. };
  34657. };
  34658. // Create horizontal gaussian blur post-processes
  34659. this._guassianBlurHPostProcess = new BABYLON.PostProcess("hdr", "hdr", uniforms, [], ratio / 4, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, scene.getEngine(), false, "#define GAUSSIAN_BLUR_H");
  34660. this._guassianBlurHPostProcess.onApply = gaussianBlurCallback(false);
  34661. // Create vertical gaussian blur post-process
  34662. this._guassianBlurVPostProcess = new BABYLON.PostProcess("hdr", "hdr", uniforms, [], ratio / 4, null, BABYLON.Texture.BILINEAR_SAMPLINGMODE, scene.getEngine(), false, "#define GAUSSIAN_BLUR_V");
  34663. this._guassianBlurVPostProcess.onApply = gaussianBlurCallback(true);
  34664. };
  34665. // Luminance generator
  34666. HDRRenderingPipeline.LUM_STEPS = 6;
  34667. return HDRRenderingPipeline;
  34668. })(BABYLON.PostProcessRenderPipeline);
  34669. BABYLON.HDRRenderingPipeline = HDRRenderingPipeline;
  34670. })(BABYLON || (BABYLON = {}));
  34671. var BABYLON;
  34672. (function (BABYLON) {
  34673. var FaceAdjacencies = (function () {
  34674. function FaceAdjacencies() {
  34675. this.edges = new Array();
  34676. this.edgesConnectedCount = 0;
  34677. }
  34678. return FaceAdjacencies;
  34679. })();
  34680. var EdgesRenderer = (function () {
  34681. // Beware when you use this class with complex objects as the adjacencies computation can be really long
  34682. function EdgesRenderer(source, epsilon, checkVerticesInsteadOfIndices) {
  34683. if (epsilon === void 0) { epsilon = 0.95; }
  34684. if (checkVerticesInsteadOfIndices === void 0) { checkVerticesInsteadOfIndices = false; }
  34685. this._linesPositions = new Array();
  34686. this._linesNormals = new Array();
  34687. this._linesIndices = new Array();
  34688. this._buffers = new Array();
  34689. this._checkVerticesInsteadOfIndices = false;
  34690. this._source = source;
  34691. this._checkVerticesInsteadOfIndices = checkVerticesInsteadOfIndices;
  34692. this._epsilon = epsilon;
  34693. this._prepareRessources();
  34694. this._generateEdgesLines();
  34695. }
  34696. EdgesRenderer.prototype._prepareRessources = function () {
  34697. if (this._lineShader) {
  34698. return;
  34699. }
  34700. this._lineShader = new BABYLON.ShaderMaterial("lineShader", this._source.getScene(), "line", {
  34701. attributes: ["position", "normal"],
  34702. uniforms: ["worldViewProjection", "color", "width", "aspectRatio"]
  34703. });
  34704. this._lineShader.disableDepthWrite = true;
  34705. this._lineShader.backFaceCulling = false;
  34706. };
  34707. EdgesRenderer.prototype.dispose = function () {
  34708. this._vb0.dispose();
  34709. this._vb1.dispose();
  34710. this._source.getScene().getEngine()._releaseBuffer(this._ib);
  34711. this._lineShader.dispose();
  34712. };
  34713. EdgesRenderer.prototype._processEdgeForAdjacencies = function (pa, pb, p0, p1, p2) {
  34714. if (pa === p0 && pb === p1 || pa === p1 && pb === p0) {
  34715. return 0;
  34716. }
  34717. if (pa === p1 && pb === p2 || pa === p2 && pb === p1) {
  34718. return 1;
  34719. }
  34720. if (pa === p2 && pb === p0 || pa === p0 && pb === p2) {
  34721. return 2;
  34722. }
  34723. return -1;
  34724. };
  34725. EdgesRenderer.prototype._processEdgeForAdjacenciesWithVertices = function (pa, pb, p0, p1, p2) {
  34726. if (pa.equalsWithEpsilon(p0) && pb.equalsWithEpsilon(p1) || pa.equalsWithEpsilon(p1) && pb.equalsWithEpsilon(p0)) {
  34727. return 0;
  34728. }
  34729. if (pa.equalsWithEpsilon(p1) && pb.equalsWithEpsilon(p2) || pa.equalsWithEpsilon(p2) && pb.equalsWithEpsilon(p1)) {
  34730. return 1;
  34731. }
  34732. if (pa.equalsWithEpsilon(p2) && pb.equalsWithEpsilon(p0) || pa.equalsWithEpsilon(p0) && pb.equalsWithEpsilon(p2)) {
  34733. return 2;
  34734. }
  34735. return -1;
  34736. };
  34737. EdgesRenderer.prototype._checkEdge = function (faceIndex, edge, faceNormals, p0, p1) {
  34738. var needToCreateLine;
  34739. if (edge === undefined) {
  34740. needToCreateLine = true;
  34741. }
  34742. else {
  34743. var dotProduct = BABYLON.Vector3.Dot(faceNormals[faceIndex], faceNormals[edge]);
  34744. needToCreateLine = dotProduct < this._epsilon;
  34745. }
  34746. if (needToCreateLine) {
  34747. var offset = this._linesPositions.length / 3;
  34748. var normal = p0.subtract(p1);
  34749. normal.normalize();
  34750. // Positions
  34751. this._linesPositions.push(p0.x);
  34752. this._linesPositions.push(p0.y);
  34753. this._linesPositions.push(p0.z);
  34754. this._linesPositions.push(p0.x);
  34755. this._linesPositions.push(p0.y);
  34756. this._linesPositions.push(p0.z);
  34757. this._linesPositions.push(p1.x);
  34758. this._linesPositions.push(p1.y);
  34759. this._linesPositions.push(p1.z);
  34760. this._linesPositions.push(p1.x);
  34761. this._linesPositions.push(p1.y);
  34762. this._linesPositions.push(p1.z);
  34763. // Normals
  34764. this._linesNormals.push(p1.x);
  34765. this._linesNormals.push(p1.y);
  34766. this._linesNormals.push(p1.z);
  34767. this._linesNormals.push(-1);
  34768. this._linesNormals.push(p1.x);
  34769. this._linesNormals.push(p1.y);
  34770. this._linesNormals.push(p1.z);
  34771. this._linesNormals.push(1);
  34772. this._linesNormals.push(p0.x);
  34773. this._linesNormals.push(p0.y);
  34774. this._linesNormals.push(p0.z);
  34775. this._linesNormals.push(-1);
  34776. this._linesNormals.push(p0.x);
  34777. this._linesNormals.push(p0.y);
  34778. this._linesNormals.push(p0.z);
  34779. this._linesNormals.push(1);
  34780. // Indices
  34781. this._linesIndices.push(offset);
  34782. this._linesIndices.push(offset + 1);
  34783. this._linesIndices.push(offset + 2);
  34784. this._linesIndices.push(offset);
  34785. this._linesIndices.push(offset + 2);
  34786. this._linesIndices.push(offset + 3);
  34787. }
  34788. };
  34789. EdgesRenderer.prototype._generateEdgesLines = function () {
  34790. var positions = this._source.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  34791. var indices = this._source.getIndices();
  34792. // First let's find adjacencies
  34793. var adjacencies = new Array();
  34794. var faceNormals = new Array();
  34795. var index;
  34796. var faceAdjacencies;
  34797. // Prepare faces
  34798. for (index = 0; index < indices.length; index += 3) {
  34799. faceAdjacencies = new FaceAdjacencies();
  34800. var p0Index = indices[index];
  34801. var p1Index = indices[index + 1];
  34802. var p2Index = indices[index + 2];
  34803. faceAdjacencies.p0 = new BABYLON.Vector3(positions[p0Index * 3], positions[p0Index * 3 + 1], positions[p0Index * 3 + 2]);
  34804. faceAdjacencies.p1 = new BABYLON.Vector3(positions[p1Index * 3], positions[p1Index * 3 + 1], positions[p1Index * 3 + 2]);
  34805. faceAdjacencies.p2 = new BABYLON.Vector3(positions[p2Index * 3], positions[p2Index * 3 + 1], positions[p2Index * 3 + 2]);
  34806. var faceNormal = BABYLON.Vector3.Cross(faceAdjacencies.p1.subtract(faceAdjacencies.p0), faceAdjacencies.p2.subtract(faceAdjacencies.p1));
  34807. faceNormal.normalize();
  34808. faceNormals.push(faceNormal);
  34809. adjacencies.push(faceAdjacencies);
  34810. }
  34811. // Scan
  34812. for (index = 0; index < adjacencies.length; index++) {
  34813. faceAdjacencies = adjacencies[index];
  34814. for (var otherIndex = index + 1; otherIndex < adjacencies.length; otherIndex++) {
  34815. var otherFaceAdjacencies = adjacencies[otherIndex];
  34816. if (faceAdjacencies.edgesConnectedCount === 3) {
  34817. break;
  34818. }
  34819. if (otherFaceAdjacencies.edgesConnectedCount === 3) {
  34820. continue;
  34821. }
  34822. var otherP0 = indices[otherIndex * 3];
  34823. var otherP1 = indices[otherIndex * 3 + 1];
  34824. var otherP2 = indices[otherIndex * 3 + 2];
  34825. for (var edgeIndex = 0; edgeIndex < 3; edgeIndex++) {
  34826. var otherEdgeIndex;
  34827. if (faceAdjacencies.edges[edgeIndex] !== undefined) {
  34828. continue;
  34829. }
  34830. switch (edgeIndex) {
  34831. case 0:
  34832. if (this._checkVerticesInsteadOfIndices) {
  34833. otherEdgeIndex = this._processEdgeForAdjacenciesWithVertices(faceAdjacencies.p0, faceAdjacencies.p1, otherFaceAdjacencies.p0, otherFaceAdjacencies.p1, otherFaceAdjacencies.p2);
  34834. }
  34835. else {
  34836. otherEdgeIndex = this._processEdgeForAdjacencies(indices[index * 3], indices[index * 3 + 1], otherP0, otherP1, otherP2);
  34837. }
  34838. break;
  34839. case 1:
  34840. if (this._checkVerticesInsteadOfIndices) {
  34841. otherEdgeIndex = this._processEdgeForAdjacenciesWithVertices(faceAdjacencies.p1, faceAdjacencies.p2, otherFaceAdjacencies.p0, otherFaceAdjacencies.p1, otherFaceAdjacencies.p2);
  34842. }
  34843. else {
  34844. otherEdgeIndex = this._processEdgeForAdjacencies(indices[index * 3 + 1], indices[index * 3 + 2], otherP0, otherP1, otherP2);
  34845. }
  34846. break;
  34847. case 2:
  34848. if (this._checkVerticesInsteadOfIndices) {
  34849. otherEdgeIndex = this._processEdgeForAdjacenciesWithVertices(faceAdjacencies.p2, faceAdjacencies.p0, otherFaceAdjacencies.p0, otherFaceAdjacencies.p1, otherFaceAdjacencies.p2);
  34850. }
  34851. else {
  34852. otherEdgeIndex = this._processEdgeForAdjacencies(indices[index * 3 + 2], indices[index * 3], otherP0, otherP1, otherP2);
  34853. }
  34854. break;
  34855. }
  34856. if (otherEdgeIndex === -1) {
  34857. continue;
  34858. }
  34859. faceAdjacencies.edges[edgeIndex] = otherIndex;
  34860. otherFaceAdjacencies.edges[otherEdgeIndex] = index;
  34861. faceAdjacencies.edgesConnectedCount++;
  34862. otherFaceAdjacencies.edgesConnectedCount++;
  34863. if (faceAdjacencies.edgesConnectedCount === 3) {
  34864. break;
  34865. }
  34866. }
  34867. }
  34868. }
  34869. // Create lines
  34870. for (index = 0; index < adjacencies.length; index++) {
  34871. // We need a line when a face has no adjacency on a specific edge or if all the adjacencies has an angle greater than epsilon
  34872. var current = adjacencies[index];
  34873. this._checkEdge(index, current.edges[0], faceNormals, current.p0, current.p1);
  34874. this._checkEdge(index, current.edges[1], faceNormals, current.p1, current.p2);
  34875. this._checkEdge(index, current.edges[2], faceNormals, current.p2, current.p0);
  34876. }
  34877. // Merge into a single mesh
  34878. var engine = this._source.getScene().getEngine();
  34879. this._vb0 = new BABYLON.VertexBuffer(engine, this._linesPositions, BABYLON.VertexBuffer.PositionKind, false);
  34880. this._vb1 = new BABYLON.VertexBuffer(engine, this._linesNormals, BABYLON.VertexBuffer.NormalKind, false, false, 4);
  34881. this._buffers[BABYLON.VertexBuffer.PositionKind] = this._vb0;
  34882. this._buffers[BABYLON.VertexBuffer.NormalKind] = this._vb1;
  34883. this._ib = engine.createIndexBuffer(this._linesIndices);
  34884. this._indicesCount = this._linesIndices.length;
  34885. };
  34886. EdgesRenderer.prototype.render = function () {
  34887. if (!this._lineShader.isReady()) {
  34888. return;
  34889. }
  34890. var scene = this._source.getScene();
  34891. var engine = scene.getEngine();
  34892. this._lineShader._preBind();
  34893. // VBOs
  34894. engine.bindMultiBuffers(this._buffers, this._ib, this._lineShader.getEffect());
  34895. scene.resetCachedMaterial();
  34896. this._lineShader.setColor4("color", this._source.edgesColor);
  34897. this._lineShader.setFloat("width", this._source.edgesWidth / 50.0);
  34898. this._lineShader.setFloat("aspectRatio", engine.getAspectRatio(scene.activeCamera));
  34899. this._lineShader.bind(this._source.getWorldMatrix());
  34900. // Draw order
  34901. engine.draw(true, 0, this._indicesCount);
  34902. this._lineShader.unbind();
  34903. engine.setDepthWrite(true);
  34904. };
  34905. return EdgesRenderer;
  34906. })();
  34907. BABYLON.EdgesRenderer = EdgesRenderer;
  34908. })(BABYLON || (BABYLON = {}));
  34909. var BABYLON;
  34910. (function (BABYLON) {
  34911. (function (TonemappingOperator) {
  34912. TonemappingOperator[TonemappingOperator["Hable"] = 0] = "Hable";
  34913. TonemappingOperator[TonemappingOperator["Reinhard"] = 1] = "Reinhard";
  34914. TonemappingOperator[TonemappingOperator["HejiDawson"] = 2] = "HejiDawson";
  34915. TonemappingOperator[TonemappingOperator["Photographic"] = 3] = "Photographic";
  34916. })(BABYLON.TonemappingOperator || (BABYLON.TonemappingOperator = {}));
  34917. var TonemappingOperator = BABYLON.TonemappingOperator;
  34918. ;
  34919. var TonemapPostProcess = (function (_super) {
  34920. __extends(TonemapPostProcess, _super);
  34921. function TonemapPostProcess(name, operator, exposureAdjustment, camera, samplingMode, engine, textureFormat) {
  34922. var _this = this;
  34923. if (samplingMode === void 0) { samplingMode = BABYLON.Texture.BILINEAR_SAMPLINGMODE; }
  34924. if (textureFormat === void 0) { textureFormat = BABYLON.Engine.TEXTURETYPE_UNSIGNED_INT; }
  34925. this._operator = operator;
  34926. this._exposureAdjustment = exposureAdjustment;
  34927. var params = ["_ExposureAdjustment"];
  34928. var defines = "#define ";
  34929. if (operator === TonemappingOperator.Hable)
  34930. defines += "HABLE_TONEMAPPING";
  34931. else if (operator === TonemappingOperator.Reinhard)
  34932. defines += "REINHARD_TONEMAPPING";
  34933. else if (operator === TonemappingOperator.HejiDawson)
  34934. defines += "OPTIMIZED_HEJIDAWSON_TONEMAPPING";
  34935. else if (operator === TonemappingOperator.Photographic)
  34936. defines += "PHOTOGRAPHIC_TONEMAPPING";
  34937. _super.call(this, name, "tonemap", params, null, 1.0, camera, samplingMode, engine, true, defines, textureFormat);
  34938. this.onApply = function (effect) {
  34939. effect.setFloat("_ExposureAdjustment", _this._exposureAdjustment);
  34940. };
  34941. }
  34942. return TonemapPostProcess;
  34943. })(BABYLON.PostProcess);
  34944. BABYLON.TonemapPostProcess = TonemapPostProcess;
  34945. })(BABYLON || (BABYLON = {}));
  34946. var BABYLON;
  34947. (function (BABYLON) {
  34948. var maxSimultaneousLights = 4;
  34949. var PBRMaterialDefines = (function (_super) {
  34950. __extends(PBRMaterialDefines, _super);
  34951. function PBRMaterialDefines() {
  34952. _super.call(this);
  34953. this.ALBEDO = false;
  34954. this.CLIPPLANE = false;
  34955. this.ALPHATEST = false;
  34956. this.FOG = false;
  34957. this.NORMAL = false;
  34958. this.UV1 = false;
  34959. this.UV2 = false;
  34960. this.VERTEXCOLOR = false;
  34961. this.VERTEXALPHA = false;
  34962. this.BONES = false;
  34963. this.BONES4 = false;
  34964. this.BonesPerMesh = 0;
  34965. this.INSTANCES = false;
  34966. this.POINTSIZE = false;
  34967. this._keys = Object.keys(this);
  34968. }
  34969. return PBRMaterialDefines;
  34970. })(BABYLON.MaterialDefines);
  34971. var PBRMaterial = (function (_super) {
  34972. __extends(PBRMaterial, _super);
  34973. function PBRMaterial(name, scene) {
  34974. _super.call(this, name, scene);
  34975. this.albedoColor = new BABYLON.Color3(1, 1, 1);
  34976. this._worldViewProjectionMatrix = BABYLON.Matrix.Zero();
  34977. this._globalAmbientColor = new BABYLON.Color3(0, 0, 0);
  34978. this._scaledDiffuse = new BABYLON.Color3();
  34979. this._scaledSpecular = new BABYLON.Color3();
  34980. this._defines = new PBRMaterialDefines();
  34981. this._cachedDefines = new PBRMaterialDefines();
  34982. this._cachedDefines.BonesPerMesh = -1;
  34983. }
  34984. PBRMaterial.prototype.needAlphaBlending = function () {
  34985. return this.alpha < 1.0;
  34986. };
  34987. PBRMaterial.prototype.needAlphaTesting = function () {
  34988. return false;
  34989. };
  34990. PBRMaterial.prototype.getAlphaTestTexture = function () {
  34991. return null;
  34992. };
  34993. // Methods
  34994. PBRMaterial.prototype.isReady = function (mesh, useInstances) {
  34995. if (this.checkReadyOnlyOnce) {
  34996. if (this._wasPreviouslyReady) {
  34997. return true;
  34998. }
  34999. }
  35000. var scene = this.getScene();
  35001. if (!this.checkReadyOnEveryCall) {
  35002. if (this._renderId === scene.getRenderId()) {
  35003. return true;
  35004. }
  35005. }
  35006. var engine = scene.getEngine();
  35007. var needNormals = false;
  35008. var needUVs = false;
  35009. this._defines.reset();
  35010. // Textures
  35011. if (scene.texturesEnabled) {
  35012. }
  35013. // Effect
  35014. if (scene.clipPlane) {
  35015. this._defines.CLIPPLANE = true;
  35016. }
  35017. if (engine.getAlphaTesting()) {
  35018. this._defines.ALPHATEST = true;
  35019. }
  35020. // Point size
  35021. if (this.pointsCloud || scene.forcePointsCloud) {
  35022. this._defines.POINTSIZE = true;
  35023. }
  35024. // Fog
  35025. if (scene.fogEnabled && mesh && mesh.applyFog && scene.fogMode !== BABYLON.Scene.FOGMODE_NONE && this.fogEnabled) {
  35026. this._defines.FOG = true;
  35027. }
  35028. // Lights
  35029. // Attribs
  35030. if (mesh) {
  35031. if (needNormals && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.NormalKind)) {
  35032. this._defines.NORMAL = true;
  35033. }
  35034. if (needUVs) {
  35035. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UVKind)) {
  35036. this._defines.UV1 = true;
  35037. }
  35038. if (mesh.isVerticesDataPresent(BABYLON.VertexBuffer.UV2Kind)) {
  35039. this._defines.UV2 = true;
  35040. }
  35041. }
  35042. if (mesh.useVertexColors && mesh.isVerticesDataPresent(BABYLON.VertexBuffer.ColorKind)) {
  35043. this._defines.VERTEXCOLOR = true;
  35044. if (mesh.hasVertexAlpha) {
  35045. this._defines.VERTEXALPHA = true;
  35046. }
  35047. }
  35048. if (mesh.useBones && mesh.computeBonesUsingShaders) {
  35049. this._defines.BONES = true;
  35050. this._defines.BonesPerMesh = (mesh.skeleton.bones.length + 1);
  35051. this._defines.BONES4 = true;
  35052. }
  35053. // Instances
  35054. if (useInstances) {
  35055. this._defines.INSTANCES = true;
  35056. }
  35057. }
  35058. // Get correct effect
  35059. if (!this._defines.isEqual(this._cachedDefines)) {
  35060. this._defines.cloneTo(this._cachedDefines);
  35061. scene.resetCachedMaterial();
  35062. // Fallbacks
  35063. var fallbacks = new BABYLON.EffectFallbacks();
  35064. if (this._defines.FOG) {
  35065. fallbacks.addFallback(1, "FOG");
  35066. }
  35067. if (this._defines.BONES4) {
  35068. fallbacks.addFallback(0, "BONES4");
  35069. }
  35070. //Attributes
  35071. var attribs = [BABYLON.VertexBuffer.PositionKind];
  35072. if (this._defines.NORMAL) {
  35073. attribs.push(BABYLON.VertexBuffer.NormalKind);
  35074. }
  35075. if (this._defines.UV1) {
  35076. attribs.push(BABYLON.VertexBuffer.UVKind);
  35077. }
  35078. if (this._defines.UV2) {
  35079. attribs.push(BABYLON.VertexBuffer.UV2Kind);
  35080. }
  35081. if (this._defines.VERTEXCOLOR) {
  35082. attribs.push(BABYLON.VertexBuffer.ColorKind);
  35083. }
  35084. if (this._defines.BONES) {
  35085. attribs.push(BABYLON.VertexBuffer.MatricesIndicesKind);
  35086. attribs.push(BABYLON.VertexBuffer.MatricesWeightsKind);
  35087. }
  35088. if (this._defines.INSTANCES) {
  35089. attribs.push("world0");
  35090. attribs.push("world1");
  35091. attribs.push("world2");
  35092. attribs.push("world3");
  35093. }
  35094. // Legacy browser patch
  35095. var join = this._defines.toString();
  35096. this._effect = scene.getEngine().createEffect("pbr", attribs, ["world", "view", "viewProjection", "vEyePosition", "vAlbedoColor",
  35097. "vFogInfos", "vFogColor", "pointSize",
  35098. "mBones",
  35099. "vClipPlane",
  35100. ], [], join, fallbacks, this.onCompiled, this.onError);
  35101. }
  35102. if (!this._effect.isReady()) {
  35103. return false;
  35104. }
  35105. this._renderId = scene.getRenderId();
  35106. this._wasPreviouslyReady = true;
  35107. return true;
  35108. };
  35109. PBRMaterial.prototype.bindOnlyWorldMatrix = function (world) {
  35110. this._effect.setMatrix("world", world);
  35111. };
  35112. PBRMaterial.prototype.bind = function (world, mesh) {
  35113. var scene = this.getScene();
  35114. // Matrices
  35115. this.bindOnlyWorldMatrix(world);
  35116. this._effect.setMatrix("viewProjection", scene.getTransformMatrix());
  35117. // Bones
  35118. if (mesh && mesh.useBones && mesh.computeBonesUsingShaders) {
  35119. this._effect.setMatrices("mBones", mesh.skeleton.getTransformMatrices());
  35120. }
  35121. if (scene.getCachedMaterial() !== this) {
  35122. // Clip plane
  35123. if (scene.clipPlane) {
  35124. var clipPlane = scene.clipPlane;
  35125. this._effect.setFloat4("vClipPlane", clipPlane.normal.x, clipPlane.normal.y, clipPlane.normal.z, clipPlane.d);
  35126. }
  35127. this._effect.setVector3("vEyePosition", scene.activeCamera.position);
  35128. }
  35129. // Point size
  35130. if (this.pointsCloud) {
  35131. this._effect.setFloat("pointSize", this.pointSize);
  35132. }
  35133. // Colors
  35134. this._effect.setColor4("vAlbedoColor", this.albedoColor, this.alpha * mesh.visibility);
  35135. // View
  35136. if (scene.fogEnabled && mesh.applyFog && scene.fogMode !== BABYLON.Scene.FOGMODE_NONE) {
  35137. this._effect.setMatrix("view", scene.getViewMatrix());
  35138. }
  35139. // Fog
  35140. if (scene.fogEnabled && mesh.applyFog && scene.fogMode !== BABYLON.Scene.FOGMODE_NONE) {
  35141. this._effect.setFloat4("vFogInfos", scene.fogMode, scene.fogStart, scene.fogEnd, scene.fogDensity);
  35142. this._effect.setColor3("vFogColor", scene.fogColor);
  35143. }
  35144. _super.prototype.bind.call(this, world, mesh);
  35145. };
  35146. PBRMaterial.prototype.getAnimatables = function () {
  35147. var results = [];
  35148. return results;
  35149. };
  35150. PBRMaterial.prototype.dispose = function (forceDisposeEffect) {
  35151. _super.prototype.dispose.call(this, forceDisposeEffect);
  35152. };
  35153. PBRMaterial.prototype.clone = function (name) {
  35154. var newPBRMaterial = new PBRMaterial(name, this.getScene());
  35155. // Base material
  35156. this.copyTo(newPBRMaterial);
  35157. // PBRMaterial material
  35158. newPBRMaterial.albedoColor = this.albedoColor.clone();
  35159. return newPBRMaterial;
  35160. };
  35161. return PBRMaterial;
  35162. })(BABYLON.Material);
  35163. BABYLON.PBRMaterial = PBRMaterial;
  35164. })(BABYLON || (BABYLON = {}));
  35165. var BABYLON;
  35166. (function (BABYLON) {
  35167. var ReflectionProbe = (function () {
  35168. function ReflectionProbe(name, size, scene, generateMipMaps) {
  35169. var _this = this;
  35170. if (generateMipMaps === void 0) { generateMipMaps = true; }
  35171. this.name = name;
  35172. this._viewMatrix = BABYLON.Matrix.Identity();
  35173. this._target = BABYLON.Vector3.Zero();
  35174. this._add = BABYLON.Vector3.Zero();
  35175. this.position = BABYLON.Vector3.Zero();
  35176. this._scene = scene;
  35177. this._scene.reflectionProbes.push(this);
  35178. this._renderTargetTexture = new BABYLON.RenderTargetTexture(name, size, scene, generateMipMaps, true, BABYLON.Engine.TEXTURETYPE_UNSIGNED_INT, true);
  35179. this._renderTargetTexture.onBeforeRender = function (faceIndex) {
  35180. switch (faceIndex) {
  35181. case 0:
  35182. _this._add.copyFromFloats(1, 0, 0);
  35183. break;
  35184. case 1:
  35185. _this._add.copyFromFloats(-1, 0, 0);
  35186. break;
  35187. case 2:
  35188. _this._add.copyFromFloats(0, -1, 0);
  35189. break;
  35190. case 3:
  35191. _this._add.copyFromFloats(0, 1, 0);
  35192. break;
  35193. case 4:
  35194. _this._add.copyFromFloats(0, 0, 1);
  35195. break;
  35196. case 5:
  35197. _this._add.copyFromFloats(0, 0, -1);
  35198. break;
  35199. }
  35200. if (_this._attachedMesh) {
  35201. _this.position.copyFrom(_this._attachedMesh.getAbsolutePosition());
  35202. }
  35203. _this.position.addToRef(_this._add, _this._target);
  35204. BABYLON.Matrix.LookAtLHToRef(_this.position, _this._target, BABYLON.Vector3.Up(), _this._viewMatrix);
  35205. scene.setTransformMatrix(_this._viewMatrix, _this._projectionMatrix);
  35206. };
  35207. this._renderTargetTexture.onAfterUnbind = function () {
  35208. scene.updateTransformMatrix(true);
  35209. };
  35210. this._projectionMatrix = BABYLON.Matrix.PerspectiveFovLH(Math.PI / 2, 1, scene.activeCamera.minZ, scene.activeCamera.maxZ);
  35211. }
  35212. Object.defineProperty(ReflectionProbe.prototype, "refreshRate", {
  35213. get: function () {
  35214. return this._renderTargetTexture.refreshRate;
  35215. },
  35216. set: function (value) {
  35217. this._renderTargetTexture.refreshRate = value;
  35218. },
  35219. enumerable: true,
  35220. configurable: true
  35221. });
  35222. ReflectionProbe.prototype.getScene = function () {
  35223. return this._scene;
  35224. };
  35225. Object.defineProperty(ReflectionProbe.prototype, "cubeTexture", {
  35226. get: function () {
  35227. return this._renderTargetTexture;
  35228. },
  35229. enumerable: true,
  35230. configurable: true
  35231. });
  35232. Object.defineProperty(ReflectionProbe.prototype, "renderList", {
  35233. get: function () {
  35234. return this._renderTargetTexture.renderList;
  35235. },
  35236. enumerable: true,
  35237. configurable: true
  35238. });
  35239. ReflectionProbe.prototype.attachToMesh = function (mesh) {
  35240. this._attachedMesh = mesh;
  35241. };
  35242. ReflectionProbe.prototype.dispose = function () {
  35243. var index = this._scene.reflectionProbes.indexOf(this);
  35244. if (index !== -1) {
  35245. // Remove from the scene if found
  35246. this._scene.reflectionProbes.splice(index, 1);
  35247. }
  35248. };
  35249. return ReflectionProbe;
  35250. })();
  35251. BABYLON.ReflectionProbe = ReflectionProbe;
  35252. })(BABYLON || (BABYLON = {}));
  35253. var BABYLON;
  35254. (function (BABYLON) {
  35255. var SolidParticle = (function () {
  35256. function SolidParticle(particleIndex, positionIndex, model, shapeId, idxInShape) {
  35257. this.color = new BABYLON.Color4(1, 1, 1, 1); // color
  35258. this.position = BABYLON.Vector3.Zero(); // position
  35259. this.rotation = BABYLON.Vector3.Zero(); // rotation
  35260. this.scale = new BABYLON.Vector3(1, 1, 1); // scale
  35261. this.uvs = new BABYLON.Vector4(0, 0, 1, 1); // uvs
  35262. this.velocity = BABYLON.Vector3.Zero(); // velocity
  35263. this.alive = true; // alive
  35264. this.idx = particleIndex;
  35265. this._pos = positionIndex;
  35266. this._model = model;
  35267. this.shapeId = shapeId;
  35268. this.idxInShape = idxInShape;
  35269. }
  35270. return SolidParticle;
  35271. })();
  35272. BABYLON.SolidParticle = SolidParticle;
  35273. var ModelShape = (function () {
  35274. function ModelShape(id, shape, shapeUV, posFunction, vtxFunction) {
  35275. this.shapeID = id;
  35276. this._shape = shape;
  35277. this._shapeUV = shapeUV;
  35278. this._positionFunction = posFunction;
  35279. this._vertexFunction = vtxFunction;
  35280. }
  35281. return ModelShape;
  35282. })();
  35283. BABYLON.ModelShape = ModelShape;
  35284. })(BABYLON || (BABYLON = {}));
  35285. var BABYLON;
  35286. (function (BABYLON) {
  35287. var SolidParticleSystem = (function () {
  35288. function SolidParticleSystem(name, scene) {
  35289. // public members
  35290. this.particles = new Array();
  35291. this.nbParticles = 0;
  35292. this.billboard = false;
  35293. this.counter = 0;
  35294. this._positions = new Array();
  35295. this._indices = new Array();
  35296. this._normals = new Array();
  35297. this._colors = new Array();
  35298. this._uvs = new Array();
  35299. this._index = 0; // indices index
  35300. this._shapeCounter = 0;
  35301. this._copy = new BABYLON.SolidParticle(null, null, null, null, null);
  35302. this._color = new BABYLON.Color4(0, 0, 0, 0);
  35303. this._computeParticleColor = true;
  35304. this._computeParticleTexture = true;
  35305. this._computeParticleRotation = true;
  35306. this._computeParticleVertex = false;
  35307. this._cam_axisZ = BABYLON.Vector3.Zero();
  35308. this._cam_axisY = BABYLON.Vector3.Zero();
  35309. this._cam_axisX = BABYLON.Vector3.Zero();
  35310. this._axisX = BABYLON.Axis.X;
  35311. this._axisY = BABYLON.Axis.Y;
  35312. this._axisZ = BABYLON.Axis.Z;
  35313. this._fakeCamPos = BABYLON.Vector3.Zero();
  35314. this._rotMatrix = new BABYLON.Matrix();
  35315. this._invertedMatrix = new BABYLON.Matrix();
  35316. this._rotated = BABYLON.Vector3.Zero();
  35317. this._quaternion = new BABYLON.Quaternion();
  35318. this._vertex = BABYLON.Vector3.Zero();
  35319. this._yaw = 0.0;
  35320. this._pitch = 0.0;
  35321. this._roll = 0.0;
  35322. this._halfroll = 0.0;
  35323. this._halfpitch = 0.0;
  35324. this._halfyaw = 0.0;
  35325. this._sinRoll = 0.0;
  35326. this._cosRoll = 0.0;
  35327. this._sinPitch = 0.0;
  35328. this._cosPitch = 0.0;
  35329. this._sinYaw = 0.0;
  35330. this._cosYaw = 0.0;
  35331. this.name = name;
  35332. this._scene = scene;
  35333. this._camera = scene.activeCamera;
  35334. }
  35335. // build the SPS mesh : returns the mesh
  35336. SolidParticleSystem.prototype.buildMesh = function (upgradable) {
  35337. if (upgradable === void 0) { upgradable = true; }
  35338. if (this.nbParticles === 0) {
  35339. var triangle = BABYLON.MeshBuilder.CreateDisc("", { radius: 1, tessellation: 3 }, this._scene);
  35340. this.addShape(triangle, 1);
  35341. triangle.dispose();
  35342. }
  35343. this._positions32 = new Float32Array(this._positions);
  35344. this._uvs32 = new Float32Array(this._uvs);
  35345. this._colors32 = new Float32Array(this._colors);
  35346. BABYLON.VertexData.ComputeNormals(this._positions32, this._indices, this._normals);
  35347. this._normals32 = new Float32Array(this._normals);
  35348. var vertexData = new BABYLON.VertexData();
  35349. vertexData.set(this._positions32, BABYLON.VertexBuffer.PositionKind);
  35350. vertexData.indices = this._indices;
  35351. vertexData.set(this._normals32, BABYLON.VertexBuffer.NormalKind);
  35352. if (this._uvs32) {
  35353. vertexData.set(this._uvs32, BABYLON.VertexBuffer.UVKind);
  35354. ;
  35355. }
  35356. if (this._colors32) {
  35357. vertexData.set(this._colors32, BABYLON.VertexBuffer.ColorKind);
  35358. }
  35359. var mesh = new BABYLON.Mesh(name, this._scene);
  35360. vertexData.applyToMesh(mesh, upgradable);
  35361. this.mesh = mesh;
  35362. // free memory
  35363. this._positions = null;
  35364. this._normals = null;
  35365. this._uvs = null;
  35366. this._colors = null;
  35367. return mesh;
  35368. };
  35369. //reset copy
  35370. SolidParticleSystem.prototype._resetCopy = function () {
  35371. this._copy.position.x = 0;
  35372. this._copy.position.y = 0;
  35373. this._copy.position.z = 0;
  35374. this._copy.rotation.x = 0;
  35375. this._copy.rotation.y = 0;
  35376. this._copy.rotation.z = 0;
  35377. this._copy.quaternion = null;
  35378. this._copy.scale.x = 1;
  35379. this._copy.scale.y = 1;
  35380. this._copy.scale.z = 1;
  35381. this._copy.uvs.x = 0;
  35382. this._copy.uvs.y = 0;
  35383. this._copy.uvs.z = 1;
  35384. this._copy.uvs.w = 1;
  35385. this._copy.color = null;
  35386. };
  35387. // _meshBuilder : inserts the shape model in the global SPS mesh
  35388. SolidParticleSystem.prototype._meshBuilder = function (p, shape, positions, meshInd, indices, meshUV, uvs, meshCol, colors, idx, idxInShape, options) {
  35389. var i;
  35390. var u = 0;
  35391. var c = 0;
  35392. this._resetCopy();
  35393. if (options && options.positionFunction) {
  35394. options.positionFunction(this._copy, idx, idxInShape);
  35395. }
  35396. if (this._copy.quaternion) {
  35397. this._quaternion.x = this._copy.quaternion.x;
  35398. this._quaternion.y = this._copy.quaternion.y;
  35399. this._quaternion.z = this._copy.quaternion.z;
  35400. this._quaternion.w = this._copy.quaternion.w;
  35401. }
  35402. else {
  35403. this._yaw = this._copy.rotation.y;
  35404. this._pitch = this._copy.rotation.x;
  35405. this._roll = this._copy.rotation.z;
  35406. this._quaternionRotationYPR();
  35407. }
  35408. this._quaternionToRotationMatrix();
  35409. for (i = 0; i < shape.length; i++) {
  35410. this._vertex.x = shape[i].x;
  35411. this._vertex.y = shape[i].y;
  35412. this._vertex.z = shape[i].z;
  35413. if (options && options.vertexFunction) {
  35414. options.vertexFunction(this._copy, this._vertex, i);
  35415. }
  35416. this._vertex.x *= this._copy.scale.x;
  35417. this._vertex.y *= this._copy.scale.y;
  35418. this._vertex.z *= this._copy.scale.z;
  35419. BABYLON.Vector3.TransformCoordinatesToRef(this._vertex, this._rotMatrix, this._rotated);
  35420. positions.push(this._copy.position.x + this._rotated.x, this._copy.position.y + this._rotated.y, this._copy.position.z + this._rotated.z);
  35421. if (meshUV) {
  35422. uvs.push((this._copy.uvs.z - this._copy.uvs.x) * meshUV[u] + this._copy.uvs.x, (this._copy.uvs.w - this._copy.uvs.y) * meshUV[u + 1] + this._copy.uvs.y);
  35423. u += 2;
  35424. }
  35425. if (this._copy.color) {
  35426. this._color = this._copy.color;
  35427. }
  35428. else if (meshCol && meshCol[c]) {
  35429. this._color.r = meshCol[c];
  35430. this._color.g = meshCol[c + 1];
  35431. this._color.b = meshCol[c + 2];
  35432. this._color.a = meshCol[c + 3];
  35433. }
  35434. else {
  35435. this._color.r = 1;
  35436. this._color.g = 1;
  35437. this._color.b = 1;
  35438. this._color.a = 1;
  35439. }
  35440. colors.push(this._color.r, this._color.g, this._color.b, this._color.a);
  35441. c += 4;
  35442. }
  35443. for (i = 0; i < meshInd.length; i++) {
  35444. indices.push(p + meshInd[i]);
  35445. }
  35446. };
  35447. // returns a shape array from positions array
  35448. SolidParticleSystem.prototype._posToShape = function (positions) {
  35449. var shape = [];
  35450. for (var i = 0; i < positions.length; i += 3) {
  35451. shape.push(new BABYLON.Vector3(positions[i], positions[i + 1], positions[i + 2]));
  35452. }
  35453. return shape;
  35454. };
  35455. // returns a shapeUV array from a Vector4 uvs
  35456. SolidParticleSystem.prototype._uvsToShapeUV = function (uvs) {
  35457. var shapeUV = [];
  35458. if (uvs) {
  35459. for (var i = 0; i < uvs.length; i++)
  35460. shapeUV.push(uvs[i]);
  35461. }
  35462. return shapeUV;
  35463. };
  35464. // adds a new particle object in the particles array and double links the particle (next/previous)
  35465. SolidParticleSystem.prototype._addParticle = function (p, idxpos, model, shapeId, idxInShape) {
  35466. this._particle = new BABYLON.SolidParticle(p, idxpos, model, shapeId, idxInShape);
  35467. this.particles.push(this._particle);
  35468. this._particle.previous = this._previousParticle;
  35469. if (this._previousParticle) {
  35470. this._previousParticle.next = this._particle;
  35471. }
  35472. this._previousParticle = this._particle;
  35473. };
  35474. // add solid particles from a shape model in the particles array
  35475. SolidParticleSystem.prototype.addShape = function (mesh, nb, options) {
  35476. var meshPos = mesh.getVerticesData(BABYLON.VertexBuffer.PositionKind);
  35477. var meshInd = mesh.getIndices();
  35478. var meshUV = mesh.getVerticesData(BABYLON.VertexBuffer.UVKind);
  35479. var meshCol = mesh.getVerticesData(BABYLON.VertexBuffer.ColorKind);
  35480. var shape = this._posToShape(meshPos);
  35481. var shapeUV = this._uvsToShapeUV(meshUV);
  35482. var posfunc = options ? options.positionFunction : null;
  35483. var vtxfunc = options ? options.vertexFunction : null;
  35484. var modelShape = new BABYLON.ModelShape(this._shapeCounter, shape, shapeUV, posfunc, vtxfunc);
  35485. // particles
  35486. for (var i = 0; i < nb; i++) {
  35487. this._meshBuilder(this._index, shape, this._positions, meshInd, this._indices, meshUV, this._uvs, meshCol, this._colors, this.nbParticles + i, i, options);
  35488. this._addParticle(this.nbParticles + i, this._positions.length, modelShape, this._shapeCounter, i);
  35489. this._index += shape.length;
  35490. }
  35491. this.nbParticles += nb;
  35492. this._shapeCounter++;
  35493. return this._shapeCounter;
  35494. };
  35495. // rebuilds a particle back to its just built status : if needed, recomputes the custom positions and vertices
  35496. SolidParticleSystem.prototype._rebuildParticle = function (particle) {
  35497. this._resetCopy();
  35498. if (particle._model._positionFunction) {
  35499. particle._model._positionFunction(this._copy, particle.idx, particle.idxInShape);
  35500. }
  35501. if (this._copy.quaternion) {
  35502. this._quaternion.x = this._copy.quaternion.x;
  35503. this._quaternion.y = this._copy.quaternion.y;
  35504. this._quaternion.z = this._copy.quaternion.z;
  35505. this._quaternion.w = this._copy.quaternion.w;
  35506. }
  35507. else {
  35508. this._yaw = this._copy.rotation.y;
  35509. this._pitch = this._copy.rotation.x;
  35510. this._roll = this._copy.rotation.z;
  35511. this._quaternionRotationYPR();
  35512. }
  35513. this._quaternionToRotationMatrix();
  35514. this._shape = particle._model._shape;
  35515. for (var pt = 0; pt < this._shape.length; pt++) {
  35516. this._vertex.x = this._shape[pt].x;
  35517. this._vertex.y = this._shape[pt].y;
  35518. this._vertex.z = this._shape[pt].z;
  35519. if (particle._model._vertexFunction) {
  35520. particle._model._vertexFunction(this._copy, this._vertex, pt); // recall to stored vertexFunction
  35521. }
  35522. this._vertex.x *= this._copy.scale.x;
  35523. this._vertex.y *= this._copy.scale.y;
  35524. this._vertex.z *= this._copy.scale.z;
  35525. BABYLON.Vector3.TransformCoordinatesToRef(this._vertex, this._rotMatrix, this._rotated);
  35526. this._positions32[particle._pos + pt * 3] = this._copy.position.x + this._rotated.x;
  35527. this._positions32[particle._pos + pt * 3 + 1] = this._copy.position.y + this._rotated.y;
  35528. this._positions32[particle._pos + pt * 3 + 2] = this._copy.position.z + this._rotated.z;
  35529. }
  35530. particle.position.x = 0;
  35531. particle.position.y = 0;
  35532. particle.position.z = 0;
  35533. particle.rotation.x = 0;
  35534. particle.rotation.y = 0;
  35535. particle.rotation.z = 0;
  35536. particle.quaternion = null;
  35537. particle.scale.x = 1;
  35538. particle.scale.y = 1;
  35539. particle.scale.z = 1;
  35540. };
  35541. // rebuilds the whole mesh and updates the VBO : custom positions and vertices are recomputed if needed
  35542. SolidParticleSystem.prototype.rebuildMesh = function () {
  35543. for (var p = 0; p < this.particles.length; p++) {
  35544. this._rebuildParticle(this.particles[p]);
  35545. }
  35546. this.mesh.updateVerticesData(BABYLON.VertexBuffer.PositionKind, this._positions32, false, false);
  35547. };
  35548. // sets all the particles : updates the VBO
  35549. SolidParticleSystem.prototype.setParticles = function (start, end, update) {
  35550. if (start === void 0) { start = 0; }
  35551. if (end === void 0) { end = this.nbParticles - 1; }
  35552. if (update === void 0) { update = true; }
  35553. // custom beforeUpdate
  35554. this.beforeUpdateParticles(start, end, update);
  35555. this._cam_axisX.x = 1;
  35556. this._cam_axisX.y = 0;
  35557. this._cam_axisX.z = 0;
  35558. this._cam_axisY.x = 0;
  35559. this._cam_axisY.y = 1;
  35560. this._cam_axisY.z = 0;
  35561. this._cam_axisZ.x = 0;
  35562. this._cam_axisZ.y = 0;
  35563. this._cam_axisZ.z = 1;
  35564. // if the particles will always face the camera
  35565. if (this.billboard) {
  35566. // compute a fake camera position : un-rotate the camera position by the current mesh rotation
  35567. this._yaw = this.mesh.rotation.y;
  35568. this._pitch = this.mesh.rotation.x;
  35569. this._roll = this.mesh.rotation.z;
  35570. this._quaternionRotationYPR();
  35571. this._quaternionToRotationMatrix();
  35572. this._rotMatrix.invertToRef(this._invertedMatrix);
  35573. BABYLON.Vector3.TransformCoordinatesToRef(this._camera.globalPosition, this._invertedMatrix, this._fakeCamPos);
  35574. // set two orthogonal vectors (_cam_axisX and and _cam_axisY) to the cam-mesh axis (_cam_axisZ)
  35575. (this._fakeCamPos).subtractToRef(this.mesh.position, this._cam_axisZ);
  35576. BABYLON.Vector3.CrossToRef(this._cam_axisZ, this._axisX, this._cam_axisY);
  35577. BABYLON.Vector3.CrossToRef(this._cam_axisZ, this._cam_axisY, this._cam_axisX);
  35578. this._cam_axisY.normalize();
  35579. this._cam_axisX.normalize();
  35580. this._cam_axisZ.normalize();
  35581. }
  35582. BABYLON.Matrix.IdentityToRef(this._rotMatrix);
  35583. var idx = 0;
  35584. var index = 0;
  35585. var colidx = 0;
  35586. var colorIndex = 0;
  35587. var uvidx = 0;
  35588. var uvIndex = 0;
  35589. // particle loop
  35590. for (var p = start; p <= end; p++) {
  35591. this._particle = this.particles[p];
  35592. this._shape = this._particle._model._shape;
  35593. this._shapeUV = this._particle._model._shapeUV;
  35594. // call to custom user function to update the particle properties
  35595. this.updateParticle(this._particle);
  35596. // particle rotation matrix
  35597. if (this.billboard) {
  35598. this._particle.rotation.x = 0.0;
  35599. this._particle.rotation.y = 0.0;
  35600. }
  35601. if (this._computeParticleRotation) {
  35602. if (this._particle.quaternion) {
  35603. this._quaternion.x = this._particle.quaternion.x;
  35604. this._quaternion.y = this._particle.quaternion.y;
  35605. this._quaternion.z = this._particle.quaternion.z;
  35606. this._quaternion.w = this._particle.quaternion.w;
  35607. }
  35608. else {
  35609. this._yaw = this._particle.rotation.y;
  35610. this._pitch = this._particle.rotation.x;
  35611. this._roll = this._particle.rotation.z;
  35612. this._quaternionRotationYPR();
  35613. }
  35614. this._quaternionToRotationMatrix();
  35615. }
  35616. for (var pt = 0; pt < this._shape.length; pt++) {
  35617. idx = index + pt * 3;
  35618. colidx = colorIndex + pt * 4;
  35619. uvidx = uvIndex + pt * 2;
  35620. this._vertex.x = this._shape[pt].x;
  35621. this._vertex.y = this._shape[pt].y;
  35622. this._vertex.z = this._shape[pt].z;
  35623. if (this._computeParticleVertex) {
  35624. this.updateParticleVertex(this._particle, this._vertex, pt);
  35625. }
  35626. this._vertex.x *= this._particle.scale.x;
  35627. this._vertex.y *= this._particle.scale.y;
  35628. this._vertex.z *= this._particle.scale.z;
  35629. BABYLON.Vector3.TransformCoordinatesToRef(this._vertex, this._rotMatrix, this._rotated);
  35630. this._positions32[idx] = this._particle.position.x + this._cam_axisX.x * this._rotated.x + this._cam_axisY.x * this._rotated.y + this._cam_axisZ.x * this._rotated.z;
  35631. this._positions32[idx + 1] = this._particle.position.y + this._cam_axisX.y * this._rotated.x + this._cam_axisY.y * this._rotated.y + this._cam_axisZ.y * this._rotated.z;
  35632. this._positions32[idx + 2] = this._particle.position.z + this._cam_axisX.z * this._rotated.x + this._cam_axisY.z * this._rotated.y + this._cam_axisZ.z * this._rotated.z;
  35633. if (this._computeParticleColor) {
  35634. this._colors32[colidx] = this._particle.color.r;
  35635. this._colors32[colidx + 1] = this._particle.color.g;
  35636. this._colors32[colidx + 2] = this._particle.color.b;
  35637. this._colors32[colidx + 3] = this._particle.color.a;
  35638. }
  35639. if (this._computeParticleTexture) {
  35640. this._uvs32[uvidx] = this._shapeUV[pt * 2] * (this._particle.uvs.z - this._particle.uvs.x) + this._particle.uvs.x;
  35641. this._uvs32[uvidx + 1] = this._shapeUV[pt * 2 + 1] * (this._particle.uvs.w - this._particle.uvs.y) + this._particle.uvs.y;
  35642. }
  35643. }
  35644. index = idx + 3;
  35645. colorIndex = colidx + 4;
  35646. uvIndex = uvidx + 2;
  35647. }
  35648. if (update) {
  35649. if (this._computeParticleColor) {
  35650. this.mesh.updateVerticesData(BABYLON.VertexBuffer.ColorKind, this._colors32, false, false);
  35651. }
  35652. if (this._computeParticleTexture) {
  35653. this.mesh.updateVerticesData(BABYLON.VertexBuffer.UVKind, this._uvs32, false, false);
  35654. }
  35655. this.mesh.updateVerticesData(BABYLON.VertexBuffer.PositionKind, this._positions32, false, false);
  35656. if (!this.mesh.areNormalsFrozen) {
  35657. BABYLON.VertexData.ComputeNormals(this._positions32, this._indices, this._normals32);
  35658. this.mesh.updateVerticesData(BABYLON.VertexBuffer.NormalKind, this._normals32, false, false);
  35659. }
  35660. }
  35661. this.afterUpdateParticles(start, end, update);
  35662. };
  35663. SolidParticleSystem.prototype._quaternionRotationYPR = function () {
  35664. this._halfroll = this._roll * 0.5;
  35665. this._halfpitch = this._pitch * 0.5;
  35666. this._halfyaw = this._yaw * 0.5;
  35667. this._sinRoll = Math.sin(this._halfroll);
  35668. this._cosRoll = Math.cos(this._halfroll);
  35669. this._sinPitch = Math.sin(this._halfpitch);
  35670. this._cosPitch = Math.cos(this._halfpitch);
  35671. this._sinYaw = Math.sin(this._halfyaw);
  35672. this._cosYaw = Math.cos(this._halfyaw);
  35673. this._quaternion.x = (this._cosYaw * this._sinPitch * this._cosRoll) + (this._sinYaw * this._cosPitch * this._sinRoll);
  35674. this._quaternion.y = (this._sinYaw * this._cosPitch * this._cosRoll) - (this._cosYaw * this._sinPitch * this._sinRoll);
  35675. this._quaternion.z = (this._cosYaw * this._cosPitch * this._sinRoll) - (this._sinYaw * this._sinPitch * this._cosRoll);
  35676. this._quaternion.w = (this._cosYaw * this._cosPitch * this._cosRoll) + (this._sinYaw * this._sinPitch * this._sinRoll);
  35677. };
  35678. SolidParticleSystem.prototype._quaternionToRotationMatrix = function () {
  35679. this._rotMatrix.m[0] = 1.0 - (2.0 * (this._quaternion.y * this._quaternion.y + this._quaternion.z * this._quaternion.z));
  35680. this._rotMatrix.m[1] = 2.0 * (this._quaternion.x * this._quaternion.y + this._quaternion.z * this._quaternion.w);
  35681. this._rotMatrix.m[2] = 2.0 * (this._quaternion.z * this._quaternion.x - this._quaternion.y * this._quaternion.w);
  35682. this._rotMatrix.m[3] = 0;
  35683. this._rotMatrix.m[4] = 2.0 * (this._quaternion.x * this._quaternion.y - this._quaternion.z * this._quaternion.w);
  35684. this._rotMatrix.m[5] = 1.0 - (2.0 * (this._quaternion.z * this._quaternion.z + this._quaternion.x * this._quaternion.x));
  35685. this._rotMatrix.m[6] = 2.0 * (this._quaternion.y * this._quaternion.z + this._quaternion.x * this._quaternion.w);
  35686. this._rotMatrix.m[7] = 0;
  35687. this._rotMatrix.m[8] = 2.0 * (this._quaternion.z * this._quaternion.x + this._quaternion.y * this._quaternion.w);
  35688. this._rotMatrix.m[9] = 2.0 * (this._quaternion.y * this._quaternion.z - this._quaternion.x * this._quaternion.w);
  35689. this._rotMatrix.m[10] = 1.0 - (2.0 * (this._quaternion.y * this._quaternion.y + this._quaternion.x * this._quaternion.x));
  35690. this._rotMatrix.m[11] = 0;
  35691. this._rotMatrix.m[12] = 0;
  35692. this._rotMatrix.m[13] = 0;
  35693. this._rotMatrix.m[14] = 0;
  35694. this._rotMatrix.m[15] = 1.0;
  35695. };
  35696. // dispose the SPS
  35697. SolidParticleSystem.prototype.dispose = function () {
  35698. this.mesh.dispose();
  35699. };
  35700. Object.defineProperty(SolidParticleSystem.prototype, "computeParticleRotation", {
  35701. // getters
  35702. get: function () {
  35703. return this._computeParticleRotation;
  35704. },
  35705. // Optimizer setters
  35706. set: function (val) {
  35707. this._computeParticleRotation = val;
  35708. },
  35709. enumerable: true,
  35710. configurable: true
  35711. });
  35712. Object.defineProperty(SolidParticleSystem.prototype, "computeParticleColor", {
  35713. get: function () {
  35714. return this._computeParticleColor;
  35715. },
  35716. set: function (val) {
  35717. this._computeParticleColor = val;
  35718. },
  35719. enumerable: true,
  35720. configurable: true
  35721. });
  35722. Object.defineProperty(SolidParticleSystem.prototype, "computeParticleTexture", {
  35723. get: function () {
  35724. return this._computeParticleTexture;
  35725. },
  35726. set: function (val) {
  35727. this._computeParticleTexture = val;
  35728. },
  35729. enumerable: true,
  35730. configurable: true
  35731. });
  35732. Object.defineProperty(SolidParticleSystem.prototype, "computeParticleVertex", {
  35733. get: function () {
  35734. return this._computeParticleVertex;
  35735. },
  35736. set: function (val) {
  35737. this._computeParticleVertex = val;
  35738. },
  35739. enumerable: true,
  35740. configurable: true
  35741. });
  35742. // =======================================================================
  35743. // Particle behavior logic
  35744. // these following methods may be overwritten by the user to fit his needs
  35745. // init : sets all particles first values and calls updateParticle to set them in space
  35746. // can be overwritten by the user
  35747. SolidParticleSystem.prototype.initParticles = function () {
  35748. };
  35749. // recycles a particle : can by overwritten by the user
  35750. SolidParticleSystem.prototype.recycleParticle = function (particle) {
  35751. return particle;
  35752. };
  35753. // updates a particle : can be overwritten by the user
  35754. // will be called on each particle by setParticles() :
  35755. // ex : just set a particle position or velocity and recycle conditions
  35756. SolidParticleSystem.prototype.updateParticle = function (particle) {
  35757. return particle;
  35758. };
  35759. // updates a vertex of a particle : can be overwritten by the user
  35760. // will be called on each vertex particle by setParticles() :
  35761. // particle : the current particle
  35762. // vertex : the current index of the current particle
  35763. // pt : the index of the current vertex in the particle shape
  35764. // ex : just set a vertex particle position
  35765. SolidParticleSystem.prototype.updateParticleVertex = function (particle, vertex, pt) {
  35766. return vertex;
  35767. };
  35768. // will be called before any other treatment by setParticles()
  35769. SolidParticleSystem.prototype.beforeUpdateParticles = function (start, stop, update) {
  35770. };
  35771. // will be called after all setParticles() treatments
  35772. SolidParticleSystem.prototype.afterUpdateParticles = function (start, stop, update) {
  35773. };
  35774. return SolidParticleSystem;
  35775. })();
  35776. BABYLON.SolidParticleSystem = SolidParticleSystem;
  35777. })(BABYLON || (BABYLON = {}));
  35778. BABYLON.Effect.ShadersStore={"anaglyphPixelShader":"precision highp float;\r\n\r\n// Samplers\r\nvarying vec2 vUV;\r\nuniform sampler2D textureSampler;\r\nuniform sampler2D leftSampler;\r\n\r\nvoid main(void)\r\n{\r\n vec4 leftFrag = texture2D(leftSampler, vUV);\r\n leftFrag = vec4(1.0, leftFrag.g, leftFrag.b, 1.0);\r\n\r\n\tvec4 rightFrag = texture2D(textureSampler, vUV);\r\n rightFrag = vec4(rightFrag.r, 1.0, 1.0, 1.0);\r\n\r\n gl_FragColor = vec4(rightFrag.rgb * leftFrag.rgb, 1.0);\r\n}","blackAndWhitePixelShader":"precision highp float;\r\n\r\n// Samplers\r\nvarying vec2 vUV;\r\nuniform sampler2D textureSampler;\r\n\r\nvoid main(void) \r\n{\r\n\tfloat luminance = dot(texture2D(textureSampler, vUV).rgb, vec3(0.3, 0.59, 0.11));\r\n\tgl_FragColor = vec4(luminance, luminance, luminance, 1.0);\r\n}","blurPixelShader":"precision highp float;\r\n\r\n// Samplers\r\nvarying vec2 vUV;\r\nuniform sampler2D textureSampler;\r\n\r\n// Parameters\r\nuniform vec2 screenSize;\r\nuniform vec2 direction;\r\nuniform float blurWidth;\r\n\r\nvoid main(void)\r\n{\r\n\tfloat weights[7];\r\n\tweights[0] = 0.05;\r\n\tweights[1] = 0.1;\r\n\tweights[2] = 0.2;\r\n\tweights[3] = 0.3;\r\n\tweights[4] = 0.2;\r\n\tweights[5] = 0.1;\r\n\tweights[6] = 0.05;\r\n\r\n\tvec2 texelSize = vec2(1.0 / screenSize.x, 1.0 / screenSize.y);\r\n\tvec2 texelStep = texelSize * direction * blurWidth;\r\n\tvec2 start = vUV - 3.0 * texelStep;\r\n\r\n\tvec4 baseColor = vec4(0., 0., 0., 0.);\r\n\tvec2 texelOffset = vec2(0., 0.);\r\n\r\n\tfor (int i = 0; i < 7; i++)\r\n\t{\r\n\t\tbaseColor += texture2D(textureSampler, start + texelOffset) * weights[i];\r\n\t\ttexelOffset += texelStep;\r\n\t}\r\n\r\n\tgl_FragColor = baseColor;\r\n}","brickPixelShader":"precision highp float;\r\n\r\nvarying vec2 vPosition;\r\nvarying vec2 vUV;\r\n\r\nuniform float numberOfBricksHeight;\r\nuniform float numberOfBricksWidth;\r\nuniform vec3 brickColor;\r\nuniform vec3 jointColor;\r\n\r\nfloat rand(vec2 n) {\r\n\treturn fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\r\n}\r\n\r\nfloat noise(vec2 n) {\r\n\tconst vec2 d = vec2(0.0, 1.0);\r\n\tvec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\r\n\treturn mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\r\n}\r\n\r\nfloat fbm(vec2 n) {\r\n\tfloat total = 0.0, amplitude = 1.0;\r\n\tfor (int i = 0; i < 4; i++) {\r\n\t\ttotal += noise(n) * amplitude;\r\n\t\tn += n;\r\n\t\tamplitude *= 0.5;\r\n\t}\r\n\treturn total;\r\n}\r\n\r\nfloat round(float number){\r\n\treturn sign(number)*floor(abs(number) + 0.5);\r\n}\r\n\r\nvoid main(void)\r\n{\r\n\tfloat brickW = 1.0 / numberOfBricksWidth;\r\n\tfloat brickH = 1.0 / numberOfBricksHeight;\r\n\tfloat jointWPercentage = 0.01;\r\n\tfloat jointHPercentage = 0.05;\r\n\tvec3 color = brickColor;\r\n\tfloat yi = vUV.y / brickH;\r\n\tfloat nyi = round(yi);\r\n\tfloat xi = vUV.x / brickW;\r\n\r\n\tif (mod(floor(yi), 2.0) == 0.0){\r\n\t\txi = xi - 0.5;\r\n\t}\r\n\r\n\tfloat nxi = round(xi);\r\n\tvec2 brickvUV = vec2((xi - floor(xi)) / brickH, (yi - floor(yi)) / brickW);\r\n\r\n\tif (yi < nyi + jointHPercentage && yi > nyi - jointHPercentage){\r\n\t\tcolor = mix(jointColor, vec3(0.37, 0.25, 0.25), (yi - nyi) / jointHPercentage + 0.2);\r\n\t}\r\n\telse if (xi < nxi + jointWPercentage && xi > nxi - jointWPercentage){\r\n\t\tcolor = mix(jointColor, vec3(0.44, 0.44, 0.44), (xi - nxi) / jointWPercentage + 0.2);\r\n\t}\r\n\telse {\r\n\t\tfloat brickColorSwitch = mod(floor(yi) + floor(xi), 3.0);\r\n\r\n\t\tif (brickColorSwitch == 0.0)\r\n\t\t\tcolor = mix(color, vec3(0.33, 0.33, 0.33), 0.3);\r\n\t\telse if (brickColorSwitch == 2.0)\r\n\t\t\tcolor = mix(color, vec3(0.11, 0.11, 0.11), 0.3);\r\n\t}\r\n\r\n\tgl_FragColor = vec4(color, 1.0);\r\n}","chromaticAberrationPixelShader":"// BABYLON.JS Chromatic Aberration GLSL Shader\r\n// Author: Olivier Guyot\r\n// Separates very slightly R, G and B colors on the edges of the screen\r\n// Inspired by Francois Tarlier & Martins Upitis\r\n\r\nprecision highp float;\r\n\r\n// samplers\r\nuniform sampler2D textureSampler;\t// original color\r\n\r\n// uniforms\r\nuniform float chromatic_aberration;\r\nuniform float screen_width;\r\nuniform float screen_height;\r\n\r\n// varyings\r\nvarying vec2 vUV;\r\n\r\nvoid main(void)\r\n{\r\n\tvec2 centered_screen_pos = vec2(vUV.x - 0.5, vUV.y - 0.5);\r\n\tfloat radius2 = centered_screen_pos.x*centered_screen_pos.x\r\n\t\t+ centered_screen_pos.y*centered_screen_pos.y;\r\n\tfloat radius = sqrt(radius2);\r\n\r\n\tvec4 original = texture2D(textureSampler, vUV);\r\n\r\n\tif (chromatic_aberration > 0.0) {\r\n\t\t//index of refraction of each color channel, causing chromatic dispersion\r\n\t\tvec3 ref_indices = vec3(-0.3, 0.0, 0.3);\r\n\t\tfloat ref_shiftX = chromatic_aberration * radius * 17.0 / screen_width;\r\n\t\tfloat ref_shiftY = chromatic_aberration * radius * 17.0 / screen_height;\r\n\r\n\t\t// shifts for red, green & blue\r\n\t\tvec2 ref_coords_r = vec2(vUV.x + ref_indices.r*ref_shiftX, vUV.y + ref_indices.r*ref_shiftY*0.5);\r\n\t\tvec2 ref_coords_g = vec2(vUV.x + ref_indices.g*ref_shiftX, vUV.y + ref_indices.g*ref_shiftY*0.5);\r\n\t\tvec2 ref_coords_b = vec2(vUV.x + ref_indices.b*ref_shiftX, vUV.y + ref_indices.b*ref_shiftY*0.5);\r\n\r\n\t\toriginal.r = texture2D(textureSampler, ref_coords_r).r;\r\n\t\toriginal.g = texture2D(textureSampler, ref_coords_g).g;\r\n\t\toriginal.b = texture2D(textureSampler, ref_coords_b).b;\r\n\t}\r\n\r\n\tgl_FragColor = original;\r\n}","cloudPixelShader":"precision highp float;\r\n\r\nvarying vec2 vUV;\r\n\r\nuniform vec4 skyColor;\r\nuniform vec4 cloudColor;\r\n\r\nfloat rand(vec2 n) {\r\n\treturn fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\r\n}\r\n\r\nfloat noise(vec2 n) {\r\n\tconst vec2 d = vec2(0.0, 1.0);\r\n\tvec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\r\n\treturn mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\r\n}\r\n\r\nfloat fbm(vec2 n) {\r\n\tfloat total = 0.0, amplitude = 1.0;\r\n\tfor (int i = 0; i < 4; i++) {\r\n\t\ttotal += noise(n) * amplitude;\r\n\t\tn += n;\r\n\t\tamplitude *= 0.5;\r\n\t}\r\n\treturn total;\r\n}\r\n\r\nvoid main() {\r\n\r\n\tvec2 p = vUV * 12.0;\r\n\tvec4 c = mix(skyColor, cloudColor, fbm(p));\r\n\tgl_FragColor = c;\r\n\r\n}\r\n\r\n","colorPixelShader":"precision highp float;\r\n\r\nuniform vec4 color;\r\n\r\nvoid main(void) {\r\n\tgl_FragColor = color;\r\n}","colorVertexShader":"precision highp float;\r\n\r\n// Attributes\r\nattribute vec3 position;\r\n\r\n// Uniforms\r\nuniform mat4 worldViewProjection;\r\n\r\nvoid main(void) {\r\n\tgl_Position = worldViewProjection * vec4(position, 1.0);\r\n}","colorCorrectionPixelShader":"precision highp float;\r\n\r\n// samplers\r\nuniform sampler2D textureSampler;\t// screen render\r\nuniform sampler2D colorTable;\t\t// color table with modified colors\r\n\r\n// varyings\r\nvarying vec2 vUV;\r\n\r\n// constants\r\nconst float SLICE_COUNT = 16.0;\t\t// how many slices in the color cube; 1 slice = 1 pixel\r\n// it means the image is 256x16 pixels\r\n\r\nvec4 sampleAs3DTexture(sampler2D texture, vec3 uv, float width) {\r\n\tfloat sliceSize = 1.0 / width; // space of 1 slice\r\n\tfloat slicePixelSize = sliceSize / width; // space of 1 pixel\r\n\tfloat sliceInnerSize = slicePixelSize * (width - 1.0); // space of width pixels\r\n\tfloat zSlice0 = min(floor(uv.z * width), width - 1.0);\r\n\tfloat zSlice1 = min(zSlice0 + 1.0, width - 1.0);\r\n\tfloat xOffset = slicePixelSize * 0.5 + uv.x * sliceInnerSize;\r\n\tfloat s0 = xOffset + (zSlice0 * sliceSize);\r\n\tfloat s1 = xOffset + (zSlice1 * sliceSize);\r\n\tvec4 slice0Color = texture2D(texture, vec2(s0, uv.y));\r\n\tvec4 slice1Color = texture2D(texture, vec2(s1, uv.y));\r\n\tfloat zOffset = mod(uv.z * width, 1.0);\r\n\tvec4 result = mix(slice0Color, slice1Color, zOffset);\r\n\treturn result;\r\n}\r\n\r\nvoid main(void)\r\n{\r\n\tvec4 screen_color = texture2D(textureSampler, vUV);\r\n\tgl_FragColor = sampleAs3DTexture(colorTable, screen_color.rgb, SLICE_COUNT);\r\n\r\n}","convolutionPixelShader":"precision highp float;\r\n\r\n// Samplers\r\nvarying vec2 vUV;\r\nuniform sampler2D textureSampler;\r\n\r\nuniform vec2 screenSize;\r\nuniform float kernel[9];\r\n\r\nvoid main(void)\r\n{\r\n\tvec2 onePixel = vec2(1.0, 1.0) / screenSize;\r\n\tvec4 colorSum =\r\n\t\ttexture2D(textureSampler, vUV + onePixel * vec2(-1, -1)) * kernel[0] +\r\n\t\ttexture2D(textureSampler, vUV + onePixel * vec2(0, -1)) * kernel[1] +\r\n\t\ttexture2D(textureSampler, vUV + onePixel * vec2(1, -1)) * kernel[2] +\r\n\t\ttexture2D(textureSampler, vUV + onePixel * vec2(-1, 0)) * kernel[3] +\r\n\t\ttexture2D(textureSampler, vUV + onePixel * vec2(0, 0)) * kernel[4] +\r\n\t\ttexture2D(textureSampler, vUV + onePixel * vec2(1, 0)) * kernel[5] +\r\n\t\ttexture2D(textureSampler, vUV + onePixel * vec2(-1, 1)) * kernel[6] +\r\n\t\ttexture2D(textureSampler, vUV + onePixel * vec2(0, 1)) * kernel[7] +\r\n\t\ttexture2D(textureSampler, vUV + onePixel * vec2(1, 1)) * kernel[8];\r\n\r\n\tfloat kernelWeight =\r\n\t\tkernel[0] +\r\n\t\tkernel[1] +\r\n\t\tkernel[2] +\r\n\t\tkernel[3] +\r\n\t\tkernel[4] +\r\n\t\tkernel[5] +\r\n\t\tkernel[6] +\r\n\t\tkernel[7] +\r\n\t\tkernel[8];\r\n\r\n\tif (kernelWeight <= 0.0) {\r\n\t\tkernelWeight = 1.0;\r\n\t}\r\n\r\n\tgl_FragColor = vec4((colorSum / kernelWeight).rgb, 1);\r\n}","defaultPixelShader":"precision highp float;\r\n\r\n// Constants\r\nuniform vec3 vEyePosition;\r\nuniform vec3 vAmbientColor;\r\nuniform vec4 vDiffuseColor;\r\n#ifdef SPECULARTERM\r\nuniform vec4 vSpecularColor;\r\n#endif\r\nuniform vec3 vEmissiveColor;\r\n\r\n// Input\r\nvarying vec3 vPositionW;\r\n\r\n#ifdef NORMAL\r\nvarying vec3 vNormalW;\r\n#endif\r\n\r\n#ifdef VERTEXCOLOR\r\nvarying vec4 vColor;\r\n#endif\r\n\r\n// Lights\r\n#ifdef LIGHT0\r\nuniform vec4 vLightData0;\r\nuniform vec4 vLightDiffuse0;\r\n#ifdef SPECULARTERM\r\nuniform vec3 vLightSpecular0;\r\n#endif\r\n#ifdef SHADOW0\r\nvarying vec4 vPositionFromLight0;\r\nuniform sampler2D shadowSampler0;\r\nuniform vec3 shadowsInfo0;\r\n#endif\r\n#ifdef SPOTLIGHT0\r\nuniform vec4 vLightDirection0;\r\n#endif\r\n#ifdef HEMILIGHT0\r\nuniform vec3 vLightGround0;\r\n#endif\r\n#endif\r\n\r\n#ifdef LIGHT1\r\nuniform vec4 vLightData1;\r\nuniform vec4 vLightDiffuse1;\r\n#ifdef SPECULARTERM\r\nuniform vec3 vLightSpecular1;\r\n#endif\r\n#ifdef SHADOW1\r\nvarying vec4 vPositionFromLight1;\r\nuniform sampler2D shadowSampler1;\r\nuniform vec3 shadowsInfo1;\r\n#endif\r\n#ifdef SPOTLIGHT1\r\nuniform vec4 vLightDirection1;\r\n#endif\r\n#ifdef HEMILIGHT1\r\nuniform vec3 vLightGround1;\r\n#endif\r\n#endif\r\n\r\n#ifdef LIGHT2\r\nuniform vec4 vLightData2;\r\nuniform vec4 vLightDiffuse2;\r\n#ifdef SPECULARTERM\r\nuniform vec3 vLightSpecular2;\r\n#endif\r\n#ifdef SHADOW2\r\nvarying vec4 vPositionFromLight2;\r\nuniform sampler2D shadowSampler2;\r\nuniform vec3 shadowsInfo2;\r\n#endif\r\n#ifdef SPOTLIGHT2\r\nuniform vec4 vLightDirection2;\r\n#endif\r\n#ifdef HEMILIGHT2\r\nuniform vec3 vLightGround2;\r\n#endif\r\n#endif\r\n\r\n#ifdef LIGHT3\r\nuniform vec4 vLightData3;\r\nuniform vec4 vLightDiffuse3;\r\n#ifdef SPECULARTERM\r\nuniform vec3 vLightSpecular3;\r\n#endif\r\n#ifdef SHADOW3\r\nvarying vec4 vPositionFromLight3;\r\nuniform sampler2D shadowSampler3;\r\nuniform vec3 shadowsInfo3;\r\n#endif\r\n#ifdef SPOTLIGHT3\r\nuniform vec4 vLightDirection3;\r\n#endif\r\n#ifdef HEMILIGHT3\r\nuniform vec3 vLightGround3;\r\n#endif\r\n#endif\r\n\r\n// Samplers\r\n#ifdef DIFFUSE\r\nvarying vec2 vDiffuseUV;\r\nuniform sampler2D diffuseSampler;\r\nuniform vec2 vDiffuseInfos;\r\n#endif\r\n\r\n#ifdef AMBIENT\r\nvarying vec2 vAmbientUV;\r\nuniform sampler2D ambientSampler;\r\nuniform vec2 vAmbientInfos;\r\n#endif\r\n\r\n#ifdef OPACITY\t\r\nvarying vec2 vOpacityUV;\r\nuniform sampler2D opacitySampler;\r\nuniform vec2 vOpacityInfos;\r\n#endif\r\n\r\n#ifdef EMISSIVE\r\nvarying vec2 vEmissiveUV;\r\nuniform vec2 vEmissiveInfos;\r\nuniform sampler2D emissiveSampler;\r\n#endif\r\n\r\n#ifdef LIGHTMAP\r\nvarying vec2 vLightmapUV;\r\nuniform vec2 vLightmapInfos;\r\nuniform sampler2D lightmapSampler;\r\n#endif\r\n\r\n#if defined(SPECULAR) && defined(SPECULARTERM)\r\nvarying vec2 vSpecularUV;\r\nuniform vec2 vSpecularInfos;\r\nuniform sampler2D specularSampler;\r\n#endif\r\n\r\n// Fresnel\r\n#ifdef FRESNEL\r\nfloat computeFresnelTerm(vec3 viewDirection, vec3 worldNormal, float bias, float power)\r\n{\r\n\tfloat fresnelTerm = pow(bias + abs(dot(viewDirection, worldNormal)), power);\r\n\treturn clamp(fresnelTerm, 0., 1.);\r\n}\r\n#endif\r\n\r\n#ifdef DIFFUSEFRESNEL\r\nuniform vec4 diffuseLeftColor;\r\nuniform vec4 diffuseRightColor;\r\n#endif\r\n\r\n#ifdef OPACITYFRESNEL\r\nuniform vec4 opacityParts;\r\n#endif\r\n\r\n#ifdef EMISSIVEFRESNEL\r\nuniform vec4 emissiveLeftColor;\r\nuniform vec4 emissiveRightColor;\r\n#endif\r\n\r\n// Reflection\r\n#ifdef REFLECTION\r\nuniform vec2 vReflectionInfos;\r\n\r\n#ifdef REFLECTIONMAP_3D\r\nuniform samplerCube reflectionCubeSampler;\r\n#else\r\nuniform sampler2D reflection2DSampler;\r\n#endif\r\n\r\n#ifdef REFLECTIONMAP_SKYBOX\r\n\tvarying vec3 vPositionUVW;\r\n#else\r\n#ifndef REFLECTIONMAP_SPHERICAL\r\n\tuniform mat4 reflectionMatrix;\r\n#endif\r\n#if defined(REFLECTIONMAP_SPHERICAL) || defined(REFLECTIONMAP_PROJECTION)\r\n\tuniform mat4 view;\r\n#endif\r\n#endif\r\n\r\nvec3 computeReflectionCoords(vec4 worldPos, vec3 worldNormal)\r\n{\r\n#ifdef REFLECTIONMAP_SPHERICAL\r\n\tvec3 viewDir = normalize(vec3(view * worldPos));\r\n\tvec3 viewNormal = normalize(vec3(view * vec4(worldNormal, 0.0)));\r\n\r\n\tvec3 r = reflect(viewDir, viewNormal);\r\n\tr.z = r.z - 1.0;\r\n\r\n\tfloat m = 2.0 * length(r);\r\n\r\n\treturn vec3(r.x / m + 0.5, 1.0 - r.y / m - 0.5, 0);\r\n#endif\r\n\r\n#ifdef REFLECTIONMAP_PLANAR\r\n\tvec3 viewDir = worldPos.xyz - vEyePosition;\r\n\tvec3 coords = normalize(reflect(viewDir, worldNormal));\r\n\r\n\treturn vec3(reflectionMatrix * vec4(coords, 1));\r\n#endif\r\n\r\n#ifdef REFLECTIONMAP_CUBIC\r\n\tvec3 viewDir = worldPos.xyz - vEyePosition;\r\n\tvec3 coords = reflect(viewDir, worldNormal);\r\n#ifdef INVERTCUBICMAP\r\n\tcoords.y = 1.0 - coords.y;\r\n#endif\r\n\treturn vec3(reflectionMatrix * vec4(coords, 0));\r\n#endif\r\n\r\n#ifdef REFLECTIONMAP_PROJECTION\r\n\treturn vec3(reflectionMatrix * (view * worldPos));\r\n#endif\r\n\r\n#ifdef REFLECTIONMAP_SKYBOX\r\n\treturn vPositionUVW;\r\n#endif\r\n\r\n#ifdef REFLECTIONMAP_EXPLICIT\r\n\treturn vec3(0, 0, 0);\r\n#endif\r\n}\r\n\r\n#ifdef REFLECTIONFRESNEL\r\nuniform vec4 reflectionLeftColor;\r\nuniform vec4 reflectionRightColor;\r\n#endif\r\n\r\n#endif\r\n\r\n// Shadows\r\n#ifdef SHADOWS\r\n\r\nfloat unpack(vec4 color)\r\n{\r\n\tconst vec4 bit_shift = vec4(1.0 / (255.0 * 255.0 * 255.0), 1.0 / (255.0 * 255.0), 1.0 / 255.0, 1.0);\r\n\treturn dot(color, bit_shift);\r\n}\r\n\r\nfloat unpackHalf(vec2 color)\r\n{\r\n\treturn color.x + (color.y / 255.0);\r\n}\r\n\r\nfloat computeShadow(vec4 vPositionFromLight, sampler2D shadowSampler, float darkness, float bias)\r\n{\r\n\tvec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\r\n\tdepth = 0.5 * depth + vec3(0.5);\r\n\tvec2 uv = depth.xy;\r\n\r\n\tif (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\r\n\t{\r\n\t\treturn 1.0;\r\n\t}\r\n\r\n\tfloat shadow = unpack(texture2D(shadowSampler, uv)) + bias;\r\n\r\n\tif (depth.z > shadow)\r\n\t{\r\n\t\treturn darkness;\r\n\t}\r\n\treturn 1.;\r\n}\r\n\r\nfloat computeShadowWithPCF(vec4 vPositionFromLight, sampler2D shadowSampler, float mapSize, float bias, float darkness)\r\n{\r\n\tvec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\r\n\tdepth = 0.5 * depth + vec3(0.5);\r\n\tvec2 uv = depth.xy;\r\n\r\n\tif (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\r\n\t{\r\n\t\treturn 1.0;\r\n\t}\r\n\r\n\tfloat visibility = 1.;\r\n\r\n\tvec2 poissonDisk[4];\r\n\tpoissonDisk[0] = vec2(-0.94201624, -0.39906216);\r\n\tpoissonDisk[1] = vec2(0.94558609, -0.76890725);\r\n\tpoissonDisk[2] = vec2(-0.094184101, -0.92938870);\r\n\tpoissonDisk[3] = vec2(0.34495938, 0.29387760);\r\n\r\n\t// Poisson Sampling\r\n\tfloat biasedDepth = depth.z - bias;\r\n\r\n\tif (unpack(texture2D(shadowSampler, uv + poissonDisk[0] / mapSize)) < biasedDepth) visibility -= 0.25;\r\n\tif (unpack(texture2D(shadowSampler, uv + poissonDisk[1] / mapSize)) < biasedDepth) visibility -= 0.25;\r\n\tif (unpack(texture2D(shadowSampler, uv + poissonDisk[2] / mapSize)) < biasedDepth) visibility -= 0.25;\r\n\tif (unpack(texture2D(shadowSampler, uv + poissonDisk[3] / mapSize)) < biasedDepth) visibility -= 0.25;\r\n\r\n\treturn min(1.0, visibility + darkness);\r\n}\r\n\r\n// Thanks to http://devmaster.net/\r\nfloat linstep(float low, float high, float v) {\r\n\treturn clamp((v - low) / (high - low), 0.0, 1.0);\r\n}\r\n\r\nfloat ChebychevInequality(vec2 moments, float compare, float bias)\r\n{\r\n\tfloat p = smoothstep(compare - bias, compare, moments.x);\r\n\tfloat variance = max(moments.y - moments.x * moments.x, 0.02);\r\n\tfloat d = compare - moments.x;\r\n\tfloat p_max = linstep(0.2, 1.0, variance / (variance + d * d));\r\n\r\n\treturn clamp(max(p, p_max), 0.0, 1.0);\r\n}\r\n\r\nfloat computeShadowWithVSM(vec4 vPositionFromLight, sampler2D shadowSampler, float bias, float darkness)\r\n{\r\n\tvec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\r\n\tdepth = 0.5 * depth + vec3(0.5);\r\n\tvec2 uv = depth.xy;\r\n\r\n\tif (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0 || depth.z >= 1.0)\r\n\t{\r\n\t\treturn 1.0;\r\n\t}\r\n\r\n\tvec4 texel = texture2D(shadowSampler, uv);\r\n\r\n\tvec2 moments = vec2(unpackHalf(texel.xy), unpackHalf(texel.zw));\r\n\treturn min(1.0, 1.0 - ChebychevInequality(moments, depth.z, bias) + darkness);\r\n}\r\n#endif\r\n\r\n// Bump\r\n#ifdef BUMP\r\n#extension GL_OES_standard_derivatives : enable\r\nvarying vec2 vBumpUV;\r\nuniform vec2 vBumpInfos;\r\nuniform sampler2D bumpSampler;\r\n\r\n// Thanks to http://www.thetenthplanet.de/archives/1180\r\nmat3 cotangent_frame(vec3 normal, vec3 p, vec2 uv)\r\n{\r\n\t// get edge vectors of the pixel triangle\r\n\tvec3 dp1 = dFdx(p);\r\n\tvec3 dp2 = dFdy(p);\r\n\tvec2 duv1 = dFdx(uv);\r\n\tvec2 duv2 = dFdy(uv);\r\n\r\n\t// solve the linear system\r\n\tvec3 dp2perp = cross(dp2, normal);\r\n\tvec3 dp1perp = cross(normal, dp1);\r\n\tvec3 tangent = dp2perp * duv1.x + dp1perp * duv2.x;\r\n\tvec3 binormal = dp2perp * duv1.y + dp1perp * duv2.y;\r\n\r\n\t// construct a scale-invariant frame \r\n\tfloat invmax = inversesqrt(max(dot(tangent, tangent), dot(binormal, binormal)));\r\n\treturn mat3(tangent * invmax, binormal * invmax, normal);\r\n}\r\n\r\nvec3 perturbNormal(vec3 viewDir)\r\n{\r\n\tvec3 map = texture2D(bumpSampler, vBumpUV).xyz;\r\n\tmap = map * 255. / 127. - 128. / 127.;\r\n\tmat3 TBN = cotangent_frame(vNormalW * vBumpInfos.y, -viewDir, vBumpUV);\r\n\treturn normalize(TBN * map);\r\n}\r\n#endif\r\n\r\n#ifdef CLIPPLANE\r\nvarying float fClipDistance;\r\n#endif\r\n\r\n// Fog\r\n#ifdef FOG\r\n\r\n#define FOGMODE_NONE 0.\r\n#define FOGMODE_EXP 1.\r\n#define FOGMODE_EXP2 2.\r\n#define FOGMODE_LINEAR 3.\r\n#define E 2.71828\r\n\r\nuniform vec4 vFogInfos;\r\nuniform vec3 vFogColor;\r\nvarying float fFogDistance;\r\n\r\nfloat CalcFogFactor()\r\n{\r\n\tfloat fogCoeff = 1.0;\r\n\tfloat fogStart = vFogInfos.y;\r\n\tfloat fogEnd = vFogInfos.z;\r\n\tfloat fogDensity = vFogInfos.w;\r\n\r\n\tif (FOGMODE_LINEAR == vFogInfos.x)\r\n\t{\r\n\t\tfogCoeff = (fogEnd - fFogDistance) / (fogEnd - fogStart);\r\n\t}\r\n\telse if (FOGMODE_EXP == vFogInfos.x)\r\n\t{\r\n\t\tfogCoeff = 1.0 / pow(E, fFogDistance * fogDensity);\r\n\t}\r\n\telse if (FOGMODE_EXP2 == vFogInfos.x)\r\n\t{\r\n\t\tfogCoeff = 1.0 / pow(E, fFogDistance * fFogDistance * fogDensity * fogDensity);\r\n\t}\r\n\r\n\treturn clamp(fogCoeff, 0.0, 1.0);\r\n}\r\n#endif\r\n\r\n// Light Computing\r\nstruct lightingInfo\r\n{\r\n\tvec3 diffuse;\r\n#ifdef SPECULARTERM\r\n\tvec3 specular;\r\n#endif\r\n};\r\n\r\nlightingInfo computeLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec3 diffuseColor, vec3 specularColor, float range, float glossiness) {\r\n\tlightingInfo result;\r\n\r\n\tvec3 lightVectorW;\r\n\tfloat attenuation = 1.0;\r\n\tif (lightData.w == 0.)\r\n\t{\r\n\t\tvec3 direction = lightData.xyz - vPositionW;\r\n\r\n\t\tattenuation = max(0., 1.0 - length(direction) / range);\r\n\t\tlightVectorW = normalize(direction);\r\n\t}\r\n\telse\r\n\t{\r\n\t\tlightVectorW = normalize(-lightData.xyz);\r\n\t}\r\n\r\n\t// diffuse\r\n\tfloat ndl = max(0., dot(vNormal, lightVectorW));\r\n\tresult.diffuse = ndl * diffuseColor * attenuation;\r\n\r\n#ifdef SPECULARTERM\r\n\t// Specular\r\n\tvec3 angleW = normalize(viewDirectionW + lightVectorW);\r\n\tfloat specComp = max(0., dot(vNormal, angleW));\r\n\tspecComp = pow(specComp, max(1., glossiness));\r\n\r\n\tresult.specular = specComp * specularColor * attenuation;\r\n#endif\r\n\treturn result;\r\n}\r\n\r\nlightingInfo computeSpotLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec4 lightDirection, vec3 diffuseColor, vec3 specularColor, float range, float glossiness) {\r\n\tlightingInfo result;\r\n\r\n\tvec3 direction = lightData.xyz - vPositionW;\r\n\tvec3 lightVectorW = normalize(direction);\r\n\tfloat attenuation = max(0., 1.0 - length(direction) / range);\r\n\r\n\t// diffuse\r\n\tfloat cosAngle = max(0., dot(-lightDirection.xyz, lightVectorW));\r\n\tfloat spotAtten = 0.0;\r\n\r\n\tif (cosAngle >= lightDirection.w)\r\n\t{\r\n\t\tcosAngle = max(0., pow(cosAngle, lightData.w));\r\n\t\tspotAtten = clamp((cosAngle - lightDirection.w) / (1. - cosAngle), 0.0, 1.0);\r\n\r\n\t\t// Diffuse\r\n\t\tfloat ndl = max(0., dot(vNormal, -lightDirection.xyz));\r\n\t\tresult.diffuse = ndl * spotAtten * diffuseColor * attenuation;\r\n\r\n#ifdef SPECULARTERM\r\n\t\t// Specular\r\n\t\tvec3 angleW = normalize(viewDirectionW - lightDirection.xyz);\r\n\t\tfloat specComp = max(0., dot(vNormal, angleW));\r\n\t\tspecComp = pow(specComp, max(1., glossiness));\r\n\r\n\t\tresult.specular = specComp * specularColor * spotAtten * attenuation;\r\n#endif\r\n\r\n\t\treturn result;\r\n\t}\r\n\r\n\tresult.diffuse = vec3(0.);\r\n#ifdef SPECULARTERM\r\n\tresult.specular = vec3(0.);\r\n#endif\r\n\r\n\treturn result;\r\n}\r\n\r\nlightingInfo computeHemisphericLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec3 diffuseColor, vec3 specularColor, vec3 groundColor, float glossiness) {\r\n\tlightingInfo result;\r\n\r\n\t// Diffuse\r\n\tfloat ndl = dot(vNormal, lightData.xyz) * 0.5 + 0.5;\r\n\tresult.diffuse = mix(groundColor, diffuseColor, ndl);\r\n\r\n#ifdef SPECULARTERM\r\n\t// Specular\r\n\tvec3 angleW = normalize(viewDirectionW + lightData.xyz);\r\n\tfloat specComp = max(0., dot(vNormal, angleW));\r\n\tspecComp = pow(specComp, max(1., glossiness));\r\n\r\n\tresult.specular = specComp * specularColor;\r\n#endif\r\n\r\n\treturn result;\r\n}\r\n\r\nvoid main(void) {\r\n\t// Clip plane\r\n#ifdef CLIPPLANE\r\n\tif (fClipDistance > 0.0)\r\n\t\tdiscard;\r\n#endif\r\n\r\n\tvec3 viewDirectionW = normalize(vEyePosition - vPositionW);\r\n\r\n\t// Base color\r\n\tvec4 baseColor = vec4(1., 1., 1., 1.);\r\n\tvec3 diffuseColor = vDiffuseColor.rgb;\r\n\r\n\t// Alpha\r\n\tfloat alpha = vDiffuseColor.a;\r\n\r\n#ifdef DIFFUSE\r\n\tbaseColor = texture2D(diffuseSampler, vDiffuseUV);\r\n\r\n#ifdef ALPHATEST\r\n\tif (baseColor.a < 0.4)\r\n\t\tdiscard;\r\n#endif\r\n\r\n#ifdef ALPHAFROMDIFFUSE\r\n\talpha *= baseColor.a;\r\n#endif\r\n\r\n\tbaseColor.rgb *= vDiffuseInfos.y;\r\n#endif\r\n\r\n#ifdef VERTEXCOLOR\r\n\tbaseColor.rgb *= vColor.rgb;\r\n#endif\r\n\r\n\t// Bump\r\n#ifdef NORMAL\r\n\tvec3 normalW = normalize(vNormalW);\r\n#else\r\n\tvec3 normalW = vec3(1.0, 1.0, 1.0);\r\n#endif\r\n\r\n\r\n#ifdef BUMP\r\n\tnormalW = perturbNormal(viewDirectionW);\r\n#endif\r\n\r\n\t// Ambient color\r\n\tvec3 baseAmbientColor = vec3(1., 1., 1.);\r\n\r\n#ifdef AMBIENT\r\n\tbaseAmbientColor = texture2D(ambientSampler, vAmbientUV).rgb * vAmbientInfos.y;\r\n#endif\r\n\r\n\r\n\t// Specular map\r\n#ifdef SPECULARTERM\r\n\tfloat glossiness = vSpecularColor.a;\r\n\tvec3 specularColor = vSpecularColor.rgb;\r\n\r\n#ifdef SPECULAR\r\n\tvec4 specularMapColor = texture2D(specularSampler, vSpecularUV);\r\n\tspecularColor = specularMapColor.rgb;\r\n#ifdef GLOSSINESS\r\n\tglossiness = glossiness * specularMapColor.a;\r\n#endif\r\n#endif\r\n#else\r\n\tfloat glossiness = 0.;\r\n#endif\r\n\r\n\t// Lighting\r\n\tvec3 diffuseBase = vec3(0., 0., 0.);\r\n#ifdef SPECULARTERM\r\n\tvec3 specularBase = vec3(0., 0., 0.);\r\n#endif\r\n\tfloat shadow = 1.;\r\n\r\n#ifdef LIGHT0\r\n#ifndef SPECULARTERM\r\n\tvec3 vLightSpecular0 = vec3(0.0);\r\n#endif\r\n#ifdef SPOTLIGHT0\r\n\tlightingInfo info = computeSpotLighting(viewDirectionW, normalW, vLightData0, vLightDirection0, vLightDiffuse0.rgb, vLightSpecular0, vLightDiffuse0.a, glossiness);\r\n#endif\r\n#ifdef HEMILIGHT0\r\n\tlightingInfo info = computeHemisphericLighting(viewDirectionW, normalW, vLightData0, vLightDiffuse0.rgb, vLightSpecular0, vLightGround0, glossiness);\r\n#endif\r\n#ifdef POINTDIRLIGHT0\r\n\tlightingInfo info = computeLighting(viewDirectionW, normalW, vLightData0, vLightDiffuse0.rgb, vLightSpecular0, vLightDiffuse0.a, glossiness);\r\n#endif\r\n#ifdef SHADOW0\r\n#ifdef SHADOWVSM0\r\n\tshadow = computeShadowWithVSM(vPositionFromLight0, shadowSampler0, shadowsInfo0.z, shadowsInfo0.x);\r\n#else\r\n#ifdef SHADOWPCF0\r\n\tshadow = computeShadowWithPCF(vPositionFromLight0, shadowSampler0, shadowsInfo0.y, shadowsInfo0.z, shadowsInfo0.x);\r\n#else\r\n\tshadow = computeShadow(vPositionFromLight0, shadowSampler0, shadowsInfo0.x, shadowsInfo0.z);\r\n#endif\r\n#endif\r\n#else\r\n\tshadow = 1.;\r\n#endif\r\n\tdiffuseBase += info.diffuse * shadow;\r\n#ifdef SPECULARTERM\r\n\tspecularBase += info.specular * shadow;\r\n#endif\r\n#endif\r\n\r\n#ifdef LIGHT1\r\n#ifndef SPECULARTERM\r\n\tvec3 vLightSpecular1 = vec3(0.0);\r\n#endif\r\n#ifdef SPOTLIGHT1\r\n\tinfo = computeSpotLighting(viewDirectionW, normalW, vLightData1, vLightDirection1, vLightDiffuse1.rgb, vLightSpecular1, vLightDiffuse1.a, glossiness);\r\n#endif\r\n#ifdef HEMILIGHT1\r\n\tinfo = computeHemisphericLighting(viewDirectionW, normalW, vLightData1, vLightDiffuse1.rgb, vLightSpecular1, vLightGround1, glossiness);\r\n#endif\r\n#ifdef POINTDIRLIGHT1\r\n\tinfo = computeLighting(viewDirectionW, normalW, vLightData1, vLightDiffuse1.rgb, vLightSpecular1, vLightDiffuse1.a, glossiness);\r\n#endif\r\n#ifdef SHADOW1\r\n#ifdef SHADOWVSM1\r\n\tshadow = computeShadowWithVSM(vPositionFromLight1, shadowSampler1, shadowsInfo1.z, shadowsInfo1.x);\r\n#else\r\n#ifdef SHADOWPCF1\r\n\tshadow = computeShadowWithPCF(vPositionFromLight1, shadowSampler1, shadowsInfo1.y, shadowsInfo1.z, shadowsInfo1.x);\r\n#else\r\n\tshadow = computeShadow(vPositionFromLight1, shadowSampler1, shadowsInfo1.x, shadowsInfo1.z);\r\n#endif\r\n#endif\r\n#else\r\n\tshadow = 1.;\r\n#endif\r\n\tdiffuseBase += info.diffuse * shadow;\r\n#ifdef SPECULARTERM\r\n\tspecularBase += info.specular * shadow;\r\n#endif\r\n#endif\r\n\r\n#ifdef LIGHT2\r\n#ifndef SPECULARTERM\r\n\tvec3 vLightSpecular2 = vec3(0.0);\r\n#endif\r\n#ifdef SPOTLIGHT2\r\n\tinfo = computeSpotLighting(viewDirectionW, normalW, vLightData2, vLightDirection2, vLightDiffuse2.rgb, vLightSpecular2, vLightDiffuse2.a, glossiness);\r\n#endif\r\n#ifdef HEMILIGHT2\r\n\tinfo = computeHemisphericLighting(viewDirectionW, normalW, vLightData2, vLightDiffuse2.rgb, vLightSpecular2, vLightGround2, glossiness);\r\n#endif\r\n#ifdef POINTDIRLIGHT2\r\n\tinfo = computeLighting(viewDirectionW, normalW, vLightData2, vLightDiffuse2.rgb, vLightSpecular2, vLightDiffuse2.a, glossiness);\r\n#endif\r\n#ifdef SHADOW2\r\n#ifdef SHADOWVSM2\r\n\tshadow = computeShadowWithVSM(vPositionFromLight2, shadowSampler2, shadowsInfo2.z, shadowsInfo2.x);\r\n#else\r\n#ifdef SHADOWPCF2\r\n\tshadow = computeShadowWithPCF(vPositionFromLight2, shadowSampler2, shadowsInfo2.y, shadowsInfo2.z, shadowsInfo2.x);\r\n#else\r\n\tshadow = computeShadow(vPositionFromLight2, shadowSampler2, shadowsInfo2.x, shadowsInfo2.z);\r\n#endif\t\r\n#endif\t\r\n#else\r\n\tshadow = 1.;\r\n#endif\r\n\tdiffuseBase += info.diffuse * shadow;\r\n#ifdef SPECULARTERM\r\n\tspecularBase += info.specular * shadow;\r\n#endif\r\n#endif\r\n\r\n#ifdef LIGHT3\r\n#ifndef SPECULARTERM\r\n\tvec3 vLightSpecular3 = vec3(0.0);\r\n#endif\r\n#ifdef SPOTLIGHT3\r\n\tinfo = computeSpotLighting(viewDirectionW, normalW, vLightData3, vLightDirection3, vLightDiffuse3.rgb, vLightSpecular3, vLightDiffuse3.a, glossiness);\r\n#endif\r\n#ifdef HEMILIGHT3\r\n\tinfo = computeHemisphericLighting(viewDirectionW, normalW, vLightData3, vLightDiffuse3.rgb, vLightSpecular3, vLightGround3, glossiness);\r\n#endif\r\n#ifdef POINTDIRLIGHT3\r\n\tinfo = computeLighting(viewDirectionW, normalW, vLightData3, vLightDiffuse3.rgb, vLightSpecular3, vLightDiffuse3.a, glossiness);\r\n#endif\r\n#ifdef SHADOW3\r\n#ifdef SHADOWVSM3\r\n\tshadow = computeShadowWithVSM(vPositionFromLight3, shadowSampler3, shadowsInfo3.z, shadowsInfo3.x);\r\n#else\r\n#ifdef SHADOWPCF3\r\n\tshadow = computeShadowWithPCF(vPositionFromLight3, shadowSampler3, shadowsInfo3.y, shadowsInfo3.z, shadowsInfo3.x);\r\n#else\r\n\tshadow = computeShadow(vPositionFromLight3, shadowSampler3, shadowsInfo3.x, shadowsInfo3.z);\r\n#endif\t\r\n#endif\t\r\n#else\r\n\tshadow = 1.;\r\n#endif\r\n\tdiffuseBase += info.diffuse * shadow;\r\n#ifdef SPECULARTERM\r\n\tspecularBase += info.specular * shadow;\r\n#endif\r\n#endif\r\n\r\n\t// Reflection\r\n\tvec3 reflectionColor = vec3(0., 0., 0.);\r\n\r\n\r\n#ifdef REFLECTION\r\n\tvec3 vReflectionUVW = computeReflectionCoords(vec4(vPositionW, 1.0), normalW);\r\n\r\n#ifdef REFLECTIONMAP_3D\r\n\tfloat bias = 0.;\r\n\r\n#ifdef ROUGHNESS\r\n\tbias = vReflectionInfos.y;\r\n#endif\r\n\r\n#ifdef SPECULARTERM\r\n#ifdef SPECULAR\r\n#ifdef GLOSSINESS\r\n\tbias *= (1.0 - specularMapColor.a);\r\n#endif\r\n#endif\r\n#endif\r\n\r\n\treflectionColor = textureCube(reflectionCubeSampler, vReflectionUVW, bias).rgb * vReflectionInfos.x * shadow;\r\n#else\r\n\tvec2 coords = vReflectionUVW.xy;\r\n\r\n#ifdef REFLECTIONMAP_PROJECTION\r\n\tcoords /= vReflectionUVW.z;\r\n#endif\r\n\r\n\tcoords.y = 1.0 - coords.y;\r\n\r\n\treflectionColor = texture2D(reflection2DSampler, coords).rgb * vReflectionInfos.x * shadow;\r\n#endif\r\n\r\n#ifdef REFLECTIONFRESNEL\r\n\tfloat reflectionFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, reflectionRightColor.a, reflectionLeftColor.a);\r\n\r\n#ifdef REFLECTIONFRESNELFROMSPECULAR\r\n#ifdef SPECULARTERM\r\n\treflectionColor *= specularColor.rgb * (1.0 - reflectionFresnelTerm) + reflectionFresnelTerm * reflectionRightColor.rgb;\r\n#else\r\n\treflectionColor *= reflectionLeftColor.rgb * (1.0 - reflectionFresnelTerm) + reflectionFresnelTerm * reflectionRightColor.rgb;\r\n#endif\r\n#else\r\n\treflectionColor *= reflectionLeftColor.rgb * (1.0 - reflectionFresnelTerm) + reflectionFresnelTerm * reflectionRightColor.rgb;\r\n#endif\r\n#endif\r\n#endif\r\n\r\n\r\n#ifdef OPACITY\r\n\tvec4 opacityMap = texture2D(opacitySampler, vOpacityUV);\r\n\r\n#ifdef OPACITYRGB\r\n\topacityMap.rgb = opacityMap.rgb * vec3(0.3, 0.59, 0.11);\r\n\talpha *= (opacityMap.x + opacityMap.y + opacityMap.z)* vOpacityInfos.y;\r\n#else\r\n\talpha *= opacityMap.a * vOpacityInfos.y;\r\n#endif\r\n\r\n#endif\r\n\r\n#ifdef VERTEXALPHA\r\n\talpha *= vColor.a;\r\n#endif\r\n\r\n#ifdef OPACITYFRESNEL\r\n\tfloat opacityFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, opacityParts.z, opacityParts.w);\r\n\r\n\talpha += opacityParts.x * (1.0 - opacityFresnelTerm) + opacityFresnelTerm * opacityParts.y;\r\n#endif\r\n\r\n\t// Emissive\r\n\tvec3 emissiveColor = vEmissiveColor;\r\n#ifdef EMISSIVE\r\n\temissiveColor += texture2D(emissiveSampler, vEmissiveUV).rgb * vEmissiveInfos.y;\r\n#endif\r\n\r\n#ifdef EMISSIVEFRESNEL\r\n\tfloat emissiveFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, emissiveRightColor.a, emissiveLeftColor.a);\r\n\r\n\temissiveColor *= emissiveLeftColor.rgb * (1.0 - emissiveFresnelTerm) + emissiveFresnelTerm * emissiveRightColor.rgb;\r\n#endif\r\n\r\n\t// Fresnel\r\n#ifdef DIFFUSEFRESNEL\r\n\tfloat diffuseFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, diffuseRightColor.a, diffuseLeftColor.a);\r\n\r\n\tdiffuseBase *= diffuseLeftColor.rgb * (1.0 - diffuseFresnelTerm) + diffuseFresnelTerm * diffuseRightColor.rgb;\r\n#endif\r\n\r\n\t// Composition\r\n#ifdef EMISSIVEASILLUMINATION\r\n\tvec3 finalDiffuse = clamp(diffuseBase * diffuseColor + vAmbientColor, 0.0, 1.0) * baseColor.rgb;\r\n#else\r\n\tvec3 finalDiffuse = clamp(diffuseBase * diffuseColor + emissiveColor + vAmbientColor, 0.0, 1.0) * baseColor.rgb;\r\n#endif\r\n\r\n#ifdef SPECULARTERM\r\n\tvec3 finalSpecular = specularBase * specularColor;\r\n#else\r\n\tvec3 finalSpecular = vec3(0.0);\r\n#endif\r\n\r\n#ifdef SPECULAROVERALPHA\r\n\talpha = clamp(alpha + dot(finalSpecular, vec3(0.3, 0.59, 0.11)), 0., 1.);\r\n#endif\r\n\r\n\t// Composition\r\n#ifdef EMISSIVEASILLUMINATION\r\n\tvec4 color = vec4(clamp(finalDiffuse * baseAmbientColor + finalSpecular + reflectionColor + emissiveColor, 0.0, 1.0), alpha);\r\n#else\r\n\tvec4 color = vec4(finalDiffuse * baseAmbientColor + finalSpecular + reflectionColor, alpha);\r\n#endif\r\n\r\n#ifdef LIGHTMAP\r\n\tvec3 lightmapColor = texture2D(lightmapSampler, vLightmapUV).rgb * vLightmapInfos.y;\r\n\r\n\t#ifdef USELIGHTMAPASSHADOWMAP\r\n\t\tcolor.rgb *= lightmapColor;\r\n\t#else\r\n\t\tcolor.rgb += lightmapColor;\r\n\t#endif\r\n#endif\r\n\r\n#ifdef FOG\r\n\tfloat fog = CalcFogFactor();\r\n\tcolor.rgb = fog * color.rgb + (1.0 - fog) * vFogColor;\r\n#endif\r\n\r\n\tgl_FragColor = color;\r\n}","defaultVertexShader":"precision highp float;\r\n\r\n// Attributes\r\nattribute vec3 position;\r\n#ifdef NORMAL\r\nattribute vec3 normal;\r\n#endif\r\n#ifdef UV1\r\nattribute vec2 uv;\r\n#endif\r\n#ifdef UV2\r\nattribute vec2 uv2;\r\n#endif\r\n#ifdef VERTEXCOLOR\r\nattribute vec4 color;\r\n#endif\r\n#ifdef BONES\r\nattribute vec4 matricesIndices;\r\nattribute vec4 matricesWeights;\r\n#endif\r\n\r\n// Uniforms\r\n\r\n#ifdef INSTANCES\r\nattribute vec4 world0;\r\nattribute vec4 world1;\r\nattribute vec4 world2;\r\nattribute vec4 world3;\r\n#else\r\nuniform mat4 world;\r\n#endif\r\n\r\nuniform mat4 view;\r\nuniform mat4 viewProjection;\r\n\r\n#ifdef DIFFUSE\r\nvarying vec2 vDiffuseUV;\r\nuniform mat4 diffuseMatrix;\r\nuniform vec2 vDiffuseInfos;\r\n#endif\r\n\r\n#ifdef AMBIENT\r\nvarying vec2 vAmbientUV;\r\nuniform mat4 ambientMatrix;\r\nuniform vec2 vAmbientInfos;\r\n#endif\r\n\r\n#ifdef OPACITY\r\nvarying vec2 vOpacityUV;\r\nuniform mat4 opacityMatrix;\r\nuniform vec2 vOpacityInfos;\r\n#endif\r\n\r\n#ifdef EMISSIVE\r\nvarying vec2 vEmissiveUV;\r\nuniform vec2 vEmissiveInfos;\r\nuniform mat4 emissiveMatrix;\r\n#endif\r\n\r\n#ifdef LIGHTMAP\r\nvarying vec2 vLightmapUV;\r\nuniform vec2 vLightmapInfos;\r\nuniform mat4 lightmapMatrix;\r\n#endif\r\n\r\n#if defined(SPECULAR) && defined(SPECULARTERM)\r\nvarying vec2 vSpecularUV;\r\nuniform vec2 vSpecularInfos;\r\nuniform mat4 specularMatrix;\r\n#endif\r\n\r\n#ifdef BUMP\r\nvarying vec2 vBumpUV;\r\nuniform vec2 vBumpInfos;\r\nuniform mat4 bumpMatrix;\r\n#endif\r\n\r\n#ifdef BONES\r\nuniform mat4 mBones[BonesPerMesh];\r\n#endif\r\n\r\n#ifdef POINTSIZE\r\nuniform float pointSize;\r\n#endif\r\n\r\n// Output\r\nvarying vec3 vPositionW;\r\n#ifdef NORMAL\r\nvarying vec3 vNormalW;\r\n#endif\r\n\r\n#ifdef VERTEXCOLOR\r\nvarying vec4 vColor;\r\n#endif\r\n\r\n#ifdef CLIPPLANE\r\nuniform vec4 vClipPlane;\r\nvarying float fClipDistance;\r\n#endif\r\n\r\n#ifdef FOG\r\nvarying float fFogDistance;\r\n#endif\r\n\r\n#ifdef SHADOWS\r\n#ifdef LIGHT0\r\nuniform mat4 lightMatrix0;\r\nvarying vec4 vPositionFromLight0;\r\n#endif\r\n#ifdef LIGHT1\r\nuniform mat4 lightMatrix1;\r\nvarying vec4 vPositionFromLight1;\r\n#endif\r\n#ifdef LIGHT2\r\nuniform mat4 lightMatrix2;\r\nvarying vec4 vPositionFromLight2;\r\n#endif\r\n#ifdef LIGHT3\r\nuniform mat4 lightMatrix3;\r\nvarying vec4 vPositionFromLight3;\r\n#endif\r\n#endif\r\n\r\n#ifdef REFLECTIONMAP_SKYBOX\r\nvarying vec3 vPositionUVW;\r\n#endif\r\n\r\nvoid main(void) {\r\n\tmat4 finalWorld;\r\n\r\n#ifdef REFLECTIONMAP_SKYBOX\r\n\tvPositionUVW = position;\r\n#endif \r\n\r\n#ifdef INSTANCES\r\n\tfinalWorld = mat4(world0, world1, world2, world3);\r\n#else\r\n\tfinalWorld = world;\r\n#endif\r\n\r\n#ifdef BONES\r\n\tmat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\r\n\tmat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\r\n\tmat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\r\n\r\n#ifdef BONES4\r\n\tmat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\r\n\tfinalWorld = finalWorld * (m0 + m1 + m2 + m3);\r\n#else\r\n\tfinalWorld = finalWorld * (m0 + m1 + m2);\r\n#endif \r\n\r\n#endif\r\n\tgl_Position = viewProjection * finalWorld * vec4(position, 1.0);\r\n\r\n\tvec4 worldPos = finalWorld * vec4(position, 1.0);\r\n\tvPositionW = vec3(worldPos);\r\n\r\n#ifdef NORMAL\r\n\tvNormalW = normalize(vec3(finalWorld * vec4(normal, 0.0)));\r\n#endif\r\n\r\n\t// Texture coordinates\r\n#ifndef UV1\r\n\tvec2 uv = vec2(0., 0.);\r\n#endif\r\n#ifndef UV2\r\n\tvec2 uv2 = vec2(0., 0.);\r\n#endif\r\n\r\n#ifdef DIFFUSE\r\n\tif (vDiffuseInfos.x == 0.)\r\n\t{\r\n\t\tvDiffuseUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\r\n\t}\r\n\telse\r\n\t{\r\n\t\tvDiffuseUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\r\n\t}\r\n#endif\r\n\r\n#ifdef AMBIENT\r\n\tif (vAmbientInfos.x == 0.)\r\n\t{\r\n\t\tvAmbientUV = vec2(ambientMatrix * vec4(uv, 1.0, 0.0));\r\n\t}\r\n\telse\r\n\t{\r\n\t\tvAmbientUV = vec2(ambientMatrix * vec4(uv2, 1.0, 0.0));\r\n\t}\r\n#endif\r\n\r\n#ifdef OPACITY\r\n\tif (vOpacityInfos.x == 0.)\r\n\t{\r\n\t\tvOpacityUV = vec2(opacityMatrix * vec4(uv, 1.0, 0.0));\r\n\t}\r\n\telse\r\n\t{\r\n\t\tvOpacityUV = vec2(opacityMatrix * vec4(uv2, 1.0, 0.0));\r\n\t}\r\n#endif\r\n\r\n#ifdef EMISSIVE\r\n\tif (vEmissiveInfos.x == 0.)\r\n\t{\r\n\t\tvEmissiveUV = vec2(emissiveMatrix * vec4(uv, 1.0, 0.0));\r\n\t}\r\n\telse\r\n\t{\r\n\t\tvEmissiveUV = vec2(emissiveMatrix * vec4(uv2, 1.0, 0.0));\r\n\t}\r\n#endif\r\n\r\n#ifdef LIGHTMAP\r\n\tif (vLightmapInfos.x == 0.)\r\n\t{\r\n\t\tvLightmapUV = vec2(lightmapMatrix * vec4(uv, 1.0, 0.0));\r\n\t}\r\n\telse\r\n\t{\r\n\t\tvLightmapUV = vec2(lightmapMatrix * vec4(uv2, 1.0, 0.0));\r\n\t}\r\n#endif\r\n\r\n#if defined(SPECULAR) && defined(SPECULARTERM)\r\n\tif (vSpecularInfos.x == 0.)\r\n\t{\r\n\t\tvSpecularUV = vec2(specularMatrix * vec4(uv, 1.0, 0.0));\r\n\t}\r\n\telse\r\n\t{\r\n\t\tvSpecularUV = vec2(specularMatrix * vec4(uv2, 1.0, 0.0));\r\n\t}\r\n#endif\r\n\r\n#ifdef BUMP\r\n\tif (vBumpInfos.x == 0.)\r\n\t{\r\n\t\tvBumpUV = vec2(bumpMatrix * vec4(uv, 1.0, 0.0));\r\n\t}\r\n\telse\r\n\t{\r\n\t\tvBumpUV = vec2(bumpMatrix * vec4(uv2, 1.0, 0.0));\r\n\t}\r\n#endif\r\n\r\n\t// Clip plane\r\n#ifdef CLIPPLANE\r\n\tfClipDistance = dot(worldPos, vClipPlane);\r\n#endif\r\n\r\n\t// Fog\r\n#ifdef FOG\r\n\tfFogDistance = (view * worldPos).z;\r\n#endif\r\n\r\n\t// Shadows\r\n#ifdef SHADOWS\r\n#ifdef LIGHT0\r\n\tvPositionFromLight0 = lightMatrix0 * worldPos;\r\n#endif\r\n#ifdef LIGHT1\r\n\tvPositionFromLight1 = lightMatrix1 * worldPos;\r\n#endif\r\n#ifdef LIGHT2\r\n\tvPositionFromLight2 = lightMatrix2 * worldPos;\r\n#endif\r\n#ifdef LIGHT3\r\n\tvPositionFromLight3 = lightMatrix3 * worldPos;\r\n#endif\r\n#endif\r\n\r\n\t// Vertex color\r\n#ifdef VERTEXCOLOR\r\n\tvColor = color;\r\n#endif\r\n\r\n\t// Point size\r\n#ifdef POINTSIZE\r\n\tgl_PointSize = pointSize;\r\n#endif\r\n}","depthPixelShader":"precision highp float;\r\n\r\n#ifdef ALPHATEST\r\nvarying vec2 vUV;\r\nuniform sampler2D diffuseSampler;\r\n#endif\r\n\r\nuniform float far;\r\n\r\nvoid main(void)\r\n{\r\n#ifdef ALPHATEST\r\n\tif (texture2D(diffuseSampler, vUV).a < 0.4)\r\n\t\tdiscard;\r\n#endif\r\n\r\n\tfloat depth = (gl_FragCoord.z / gl_FragCoord.w) / far;\r\n\tgl_FragColor = vec4(depth, depth * depth, 0.0, 1.0);\r\n}","depthVertexShader":"precision highp float;\r\n\r\n// Attribute\r\nattribute vec3 position;\r\n#ifdef BONES\r\nattribute vec4 matricesIndices;\r\nattribute vec4 matricesWeights;\r\n#endif\r\n\r\n// Uniform\r\n#ifdef INSTANCES\r\nattribute vec4 world0;\r\nattribute vec4 world1;\r\nattribute vec4 world2;\r\nattribute vec4 world3;\r\n#else\r\nuniform mat4 world;\r\n#endif\r\n\r\nuniform mat4 viewProjection;\r\n#ifdef BONES\r\nuniform mat4 mBones[BonesPerMesh];\r\n#endif\r\n\r\n#if defined(ALPHATEST) || defined(NEED_UV)\r\nvarying vec2 vUV;\r\nuniform mat4 diffuseMatrix;\r\n#ifdef UV1\r\nattribute vec2 uv;\r\n#endif\r\n#ifdef UV2\r\nattribute vec2 uv2;\r\n#endif\r\n#endif\r\n\r\nvoid main(void)\r\n{\r\n#ifdef INSTANCES\r\n\tmat4 finalWorld = mat4(world0, world1, world2, world3);\r\n#else\r\n\tmat4 finalWorld = world;\r\n#endif\r\n\r\n#ifdef BONES\r\n\tmat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\r\n\tmat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\r\n\tmat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\r\n\tmat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\r\n\tfinalWorld = finalWorld * (m0 + m1 + m2 + m3);\r\n\tgl_Position = viewProjection * finalWorld * vec4(position, 1.0);\r\n#else\r\n\tgl_Position = viewProjection * finalWorld * vec4(position, 1.0);\r\n#endif\r\n\r\n#if defined(ALPHATEST) || defined(BASIC_RENDER)\r\n#ifdef UV1\r\n\tvUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\r\n#endif\r\n#ifdef UV2\r\n\tvUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\r\n#endif\r\n#endif\r\n}","depthBoxBlurPixelShader":"precision highp float;\r\n\r\n// Samplers\r\nvarying vec2 vUV;\r\nuniform sampler2D textureSampler;\r\n\r\n// Parameters\r\nuniform vec2 screenSize;\r\n\r\nvoid main(void)\r\n{\r\n\tvec4 colorDepth = vec4(0.0);\r\n\r\n\tfor (int x = -OFFSET; x <= OFFSET; x++)\r\n\t\tfor (int y = -OFFSET; y <= OFFSET; y++)\r\n\t\t\tcolorDepth += texture2D(textureSampler, vUV + vec2(x, y) / screenSize);\r\n\r\n\tgl_FragColor = (colorDepth / float((OFFSET * 2 + 1) * (OFFSET * 2 + 1)));\r\n}","depthOfFieldPixelShader":"// BABYLON.JS Depth-of-field GLSL Shader\r\n// Author: Olivier Guyot\r\n// Does depth-of-field blur, edge blur\r\n// Inspired by Francois Tarlier & Martins Upitis\r\n\r\nprecision highp float;\r\n\r\n\r\n// samplers\r\nuniform sampler2D textureSampler;\r\nuniform sampler2D highlightsSampler;\r\nuniform sampler2D depthSampler;\r\nuniform sampler2D grainSampler;\r\n\r\n// uniforms\r\nuniform float grain_amount;\r\nuniform bool blur_noise;\r\nuniform float screen_width;\r\nuniform float screen_height;\r\nuniform float distortion;\r\nuniform bool dof_enabled;\r\n//uniform float focus_distance;\t\t// not needed; already used to compute screen distance\r\nuniform float screen_distance;\t\t// precomputed screen distance from lens center; based on focal length & desired focus distance\r\nuniform float aperture;\r\nuniform float darken;\r\nuniform float edge_blur;\r\nuniform bool highlights;\r\n\r\n// preconputed uniforms (not effect parameters)\r\nuniform float near;\r\nuniform float far;\r\n\r\n// varyings\r\nvarying vec2 vUV;\r\n\r\n// constants\r\n#define PI \t\t3.14159265\r\n#define TWOPI \t6.28318530\r\n#define inverse_focal_length 0.1\t// a property of the lens used\r\n\r\n// common calculations\r\nvec2 centered_screen_pos;\r\nvec2 distorted_coords;\r\nfloat radius2;\r\nfloat radius;\r\n\r\n\r\n// on-the-fly constant noise\r\nvec2 rand(vec2 co)\r\n{\r\n\tfloat noise1 = (fract(sin(dot(co, vec2(12.9898, 78.233))) * 43758.5453));\r\n\tfloat noise2 = (fract(sin(dot(co, vec2(12.9898, 78.233)*2.0)) * 43758.5453));\r\n\treturn clamp(vec2(noise1, noise2), 0.0, 1.0);\r\n}\r\n\r\n// applies edge distortion on texture coords\r\nvec2 getDistortedCoords(vec2 coords) {\r\n\r\n\tif (distortion == 0.0) { return coords; }\r\n\r\n\tvec2 direction = 1.0 * normalize(centered_screen_pos);\r\n\tvec2 dist_coords = vec2(0.5, 0.5);\r\n\tdist_coords.x = 0.5 + direction.x * radius2 * 1.0;\r\n\tdist_coords.y = 0.5 + direction.y * radius2 * 1.0;\r\n\tfloat dist_amount = clamp(distortion*0.23, 0.0, 1.0);\r\n\r\n\tdist_coords = mix(coords, dist_coords, dist_amount);\r\n\r\n\treturn dist_coords;\r\n}\r\n\r\n// sample screen with an offset (randomize offset angle for better smothness), returns partial sample weight\r\nfloat sampleScreen(inout vec4 color, const in vec2 offset, const in float weight) {\r\n\r\n\t// compute coords with offset (a random angle is added)\r\n\tvec2 coords = distorted_coords;\r\n\tfloat angle = rand(coords * 100.0).x * TWOPI;\r\n\tcoords += vec2(offset.x * cos(angle) - offset.y * sin(angle), offset.x * sin(angle) + offset.y * cos(angle));\r\n\r\n\tcolor += texture2D(textureSampler, coords)*weight;\r\n\r\n\treturn weight;\r\n}\r\n\r\n// returns blur level according to blur size required\r\nfloat getBlurLevel(float size) {\r\n\treturn min(3.0, ceil(size / 1.0));\r\n}\r\n\r\n// returns original screen color after blur\r\nvec4 getBlurColor(float size) {\r\n\r\n\tvec4 col = texture2D(textureSampler, distorted_coords);\r\n\tif (size == 0.0) { return col; }\r\n\r\n\t// there are max. 30 samples; the number of samples chosen is dependant on the blur size\r\n\t// there can be 10, 20 or 30 samples chosen; levels of blur are then 1, 2 or 3\r\n\tfloat blur_level = getBlurLevel(size);\r\n\r\n\tfloat w = (size / screen_width);\r\n\tfloat h = (size / screen_height);\r\n\tfloat total_weight = 1.0;\r\n\tvec2 sample_coords;\r\n\r\n\ttotal_weight += sampleScreen(col, vec2(-0.50*w, 0.24*h), 0.93);\r\n\ttotal_weight += sampleScreen(col, vec2(0.30*w, -0.75*h), 0.90);\r\n\ttotal_weight += sampleScreen(col, vec2(0.36*w, 0.96*h), 0.87);\r\n\ttotal_weight += sampleScreen(col, vec2(-1.08*w, -0.55*h), 0.85);\r\n\ttotal_weight += sampleScreen(col, vec2(1.33*w, -0.37*h), 0.83);\r\n\ttotal_weight += sampleScreen(col, vec2(-0.82*w, 1.31*h), 0.80);\r\n\ttotal_weight += sampleScreen(col, vec2(-0.31*w, -1.67*h), 0.78);\r\n\ttotal_weight += sampleScreen(col, vec2(1.47*w, 1.11*h), 0.76);\r\n\ttotal_weight += sampleScreen(col, vec2(-1.97*w, 0.19*h), 0.74);\r\n\ttotal_weight += sampleScreen(col, vec2(1.42*w, -1.57*h), 0.72);\r\n\r\n\tif (blur_level > 1.0) {\r\n\t\ttotal_weight += sampleScreen(col, vec2(0.01*w, 2.25*h), 0.70);\r\n\t\ttotal_weight += sampleScreen(col, vec2(-1.62*w, -1.74*h), 0.67);\r\n\t\ttotal_weight += sampleScreen(col, vec2(2.49*w, 0.20*h), 0.65);\r\n\t\ttotal_weight += sampleScreen(col, vec2(-2.07*w, 1.61*h), 0.63);\r\n\t\ttotal_weight += sampleScreen(col, vec2(0.46*w, -2.70*h), 0.61);\r\n\t\ttotal_weight += sampleScreen(col, vec2(1.55*w, 2.40*h), 0.59);\r\n\t\ttotal_weight += sampleScreen(col, vec2(-2.88*w, -0.75*h), 0.56);\r\n\t\ttotal_weight += sampleScreen(col, vec2(2.73*w, -1.44*h), 0.54);\r\n\t\ttotal_weight += sampleScreen(col, vec2(-1.08*w, 3.02*h), 0.52);\r\n\t\ttotal_weight += sampleScreen(col, vec2(-1.28*w, -3.05*h), 0.49);\r\n\t}\r\n\r\n\tif (blur_level > 2.0) {\r\n\t\ttotal_weight += sampleScreen(col, vec2(3.11*w, 1.43*h), 0.46);\r\n\t\ttotal_weight += sampleScreen(col, vec2(-3.36*w, 1.08*h), 0.44);\r\n\t\ttotal_weight += sampleScreen(col, vec2(1.80*w, -3.16*h), 0.41);\r\n\t\ttotal_weight += sampleScreen(col, vec2(0.83*w, 3.65*h), 0.38);\r\n\t\ttotal_weight += sampleScreen(col, vec2(-3.16*w, -2.19*h), 0.34);\r\n\t\ttotal_weight += sampleScreen(col, vec2(3.92*w, -0.53*h), 0.31);\r\n\t\ttotal_weight += sampleScreen(col, vec2(-2.59*w, 3.12*h), 0.26);\r\n\t\ttotal_weight += sampleScreen(col, vec2(-0.20*w, -4.15*h), 0.22);\r\n\t\ttotal_weight += sampleScreen(col, vec2(3.02*w, 3.00*h), 0.15);\r\n\t}\r\n\r\n\tcol /= total_weight;\t\t// scales color according to weights\r\n\r\n\t\t\t\t\t\t\t\t// darken if out of focus\r\n\tif (darken > 0.0) {\r\n\t\tcol.rgb *= clamp(0.3, 1.0, 1.05 - size*0.5*darken);\r\n\t}\r\n\r\n\t// blur levels debug\r\n\t// if(blur_level == 1.0) { col.b *= 0.5; }\r\n\t// if(blur_level == 2.0) { col.r *= 0.5; }\r\n\t// if(blur_level == 3.0) { col.g *= 0.5; }\r\n\r\n\treturn col;\r\n}\r\n\r\nvoid main(void)\r\n{\r\n\r\n\t// Common calc: position relative to screen center, screen radius, distorted coords, position in texel space\r\n\tcentered_screen_pos = vec2(vUV.x - 0.5, vUV.y - 0.5);\r\n\tradius2 = centered_screen_pos.x*centered_screen_pos.x + centered_screen_pos.y*centered_screen_pos.y;\r\n\tradius = sqrt(radius2);\r\n\tdistorted_coords = getDistortedCoords(vUV);\t\t// we distort the screen coordinates (lens \"magnifying\" effect)\r\n\tvec2 texels_coords = vec2(vUV.x * screen_width, vUV.y * screen_height);\t// varies from 0 to SCREEN_WIDTH or _HEIGHT\r\n\r\n\tfloat depth = texture2D(depthSampler, distorted_coords).r;\t// depth value from DepthRenderer: 0 to 1\r\n\tfloat distance = near + (far - near)*depth;\t\t// actual distance from the lens\r\n\tvec4 color = texture2D(textureSampler, vUV);\t// original raster\r\n\r\n\r\n\t\t\t\t\t\t\t\t\t\t\t\t\t// compute the circle of confusion size (CoC), i.e. blur radius depending on depth\r\n\t\t\t\t\t\t\t\t\t\t\t\t\t// screen_distance is precomputed in code\r\n\tfloat coc = abs(aperture * (screen_distance * (inverse_focal_length - 1.0 / distance) - 1.0));\r\n\r\n\t// disable blur\r\n\tif (dof_enabled == false || coc < 0.07) { coc = 0.0; }\r\n\r\n\t// blur from edge blur effect\r\n\tfloat edge_blur_amount = 0.0;\r\n\tif (edge_blur > 0.0) {\r\n\t\tedge_blur_amount = clamp((radius*2.0 - 1.0 + 0.15*edge_blur) * 1.5, 0.0, 1.0) * 1.3;\r\n\t}\r\n\r\n\t// total blur amount\r\n\tfloat blur_amount = max(edge_blur_amount, coc);\r\n\r\n\t// apply blur if necessary\r\n\tif (blur_amount == 0.0) {\r\n\t\tgl_FragColor = texture2D(textureSampler, distorted_coords);\r\n\t}\r\n\telse {\r\n\r\n\t\t// add blurred color\r\n\t\tgl_FragColor = getBlurColor(blur_amount * 1.7);\r\n\r\n\t\t// if we have computed highlights: enhance highlights\r\n\t\tif (highlights) {\r\n\t\t\tgl_FragColor.rgb += clamp(coc, 0.0, 1.0)*texture2D(highlightsSampler, distorted_coords).rgb;\r\n\t\t}\r\n\r\n\t\tif (blur_noise) {\r\n\t\t\t// we put a slight amount of noise in the blurred color\r\n\t\t\tvec2 noise = rand(distorted_coords) * 0.01 * blur_amount;\r\n\t\t\tvec2 blurred_coord = vec2(distorted_coords.x + noise.x, distorted_coords.y + noise.y);\r\n\t\t\tgl_FragColor = 0.04 * texture2D(textureSampler, blurred_coord) + 0.96 * gl_FragColor;\r\n\t\t}\r\n\t}\r\n\r\n\r\n\t// apply grain\r\n\tif (grain_amount > 0.0) {\r\n\t\tvec4 grain_color = texture2D(grainSampler, texels_coords*0.003);\r\n\t\tgl_FragColor.rgb += (-0.5 + grain_color.rgb) * 0.30 * grain_amount;\r\n\t}\r\n\r\n}\r\n","displayPassPixelShader":"precision highp float;\r\n\r\n// Samplers\r\nvarying vec2 vUV;\r\nuniform sampler2D textureSampler;\r\nuniform sampler2D passSampler;\r\n\r\nvoid main(void)\r\n{\r\n gl_FragColor = texture2D(passSampler, vUV);\r\n}","filterPixelShader":"precision highp float;\r\n\r\n// Samplers\r\nvarying vec2 vUV;\r\nuniform sampler2D textureSampler;\r\n\r\nuniform mat4 kernelMatrix;\r\n\r\nvoid main(void)\r\n{\r\n\tvec3 baseColor = texture2D(textureSampler, vUV).rgb;\r\n\tvec3 updatedColor = (kernelMatrix * vec4(baseColor, 1.0)).rgb;\r\n\r\n\tgl_FragColor = vec4(updatedColor, 1.0);\r\n}","firePixelShader":"precision highp float;\r\n\r\nuniform float time;\r\nuniform vec3 c1;\r\nuniform vec3 c2;\r\nuniform vec3 c3;\r\nuniform vec3 c4;\r\nuniform vec3 c5;\r\nuniform vec3 c6;\r\nuniform vec2 speed;\r\nuniform float shift;\r\nuniform float alphaThreshold;\r\n\r\nvarying vec2 vUV;\r\n\r\nfloat rand(vec2 n) {\r\n\treturn fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\r\n}\r\n\r\nfloat noise(vec2 n) {\r\n\tconst vec2 d = vec2(0.0, 1.0);\r\n\tvec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\r\n\treturn mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\r\n}\r\n\r\nfloat fbm(vec2 n) {\r\n\tfloat total = 0.0, amplitude = 1.0;\r\n\tfor (int i = 0; i < 4; i++) {\r\n\t\ttotal += noise(n) * amplitude;\r\n\t\tn += n;\r\n\t\tamplitude *= 0.5;\r\n\t}\r\n\treturn total;\r\n}\r\n\r\nvoid main() {\r\n\tvec2 p = vUV * 8.0;\r\n\tfloat q = fbm(p - time * 0.1);\r\n\tvec2 r = vec2(fbm(p + q + time * speed.x - p.x - p.y), fbm(p + q - time * speed.y));\r\n\tvec3 c = mix(c1, c2, fbm(p + r)) + mix(c3, c4, r.x) - mix(c5, c6, r.y);\r\n\tvec3 color = c * cos(shift * vUV.y);\r\n\tfloat luminance = dot(color.rgb, vec3(0.3, 0.59, 0.11));\r\n\r\n\tgl_FragColor = vec4(color, luminance * alphaThreshold + (1.0 - alphaThreshold));\r\n}","fxaaPixelShader":"precision highp float;\r\n\r\n#define FXAA_REDUCE_MIN (1.0/128.0)\r\n#define FXAA_REDUCE_MUL (1.0/8.0)\r\n#define FXAA_SPAN_MAX 8.0\r\n\r\nvarying vec2 vUV;\r\nuniform sampler2D textureSampler;\r\nuniform vec2 texelSize;\r\n\r\nvoid main(){\r\n\tvec2 localTexelSize = texelSize;\r\n\tvec4 rgbNW = texture2D(textureSampler, (vUV + vec2(-1.0, -1.0) * localTexelSize));\r\n\tvec4 rgbNE = texture2D(textureSampler, (vUV + vec2(1.0, -1.0) * localTexelSize));\r\n\tvec4 rgbSW = texture2D(textureSampler, (vUV + vec2(-1.0, 1.0) * localTexelSize));\r\n\tvec4 rgbSE = texture2D(textureSampler, (vUV + vec2(1.0, 1.0) * localTexelSize));\r\n\tvec4 rgbM = texture2D(textureSampler, vUV);\r\n\tvec4 luma = vec4(0.299, 0.587, 0.114, 1.0);\r\n\tfloat lumaNW = dot(rgbNW, luma);\r\n\tfloat lumaNE = dot(rgbNE, luma);\r\n\tfloat lumaSW = dot(rgbSW, luma);\r\n\tfloat lumaSE = dot(rgbSE, luma);\r\n\tfloat lumaM = dot(rgbM, luma);\r\n\tfloat lumaMin = min(lumaM, min(min(lumaNW, lumaNE), min(lumaSW, lumaSE)));\r\n\tfloat lumaMax = max(lumaM, max(max(lumaNW, lumaNE), max(lumaSW, lumaSE)));\r\n\r\n\tvec2 dir = vec2(-((lumaNW + lumaNE) - (lumaSW + lumaSE)), ((lumaNW + lumaSW) - (lumaNE + lumaSE)));\r\n\r\n\tfloat dirReduce = max(\r\n\t\t(lumaNW + lumaNE + lumaSW + lumaSE) * (0.25 * FXAA_REDUCE_MUL),\r\n\t\tFXAA_REDUCE_MIN);\r\n\r\n\tfloat rcpDirMin = 1.0 / (min(abs(dir.x), abs(dir.y)) + dirReduce);\r\n\tdir = min(vec2(FXAA_SPAN_MAX, FXAA_SPAN_MAX),\r\n\t\tmax(vec2(-FXAA_SPAN_MAX, -FXAA_SPAN_MAX),\r\n\t\tdir * rcpDirMin)) * localTexelSize;\r\n\r\n\tvec4 rgbA = 0.5 * (\r\n\t\ttexture2D(textureSampler, vUV + dir * (1.0 / 3.0 - 0.5)) +\r\n\t\ttexture2D(textureSampler, vUV + dir * (2.0 / 3.0 - 0.5)));\r\n\r\n\tvec4 rgbB = rgbA * 0.5 + 0.25 * (\r\n\t\ttexture2D(textureSampler, vUV + dir * -0.5) +\r\n\t\ttexture2D(textureSampler, vUV + dir * 0.5));\r\n\tfloat lumaB = dot(rgbB, luma);\r\n\tif ((lumaB < lumaMin) || (lumaB > lumaMax)) {\r\n\t\tgl_FragColor = rgbA;\r\n\t}\r\n\telse {\r\n\t\tgl_FragColor = rgbB;\r\n\t}\r\n}","grassPixelShader":"precision highp float;\r\n\r\nvarying vec2 vPosition;\r\nvarying vec2 vUV;\r\n\r\nuniform vec3 herb1Color;\r\nuniform vec3 herb2Color;\r\nuniform vec3 herb3Color;\r\nuniform vec3 groundColor;\r\n\r\nfloat rand(vec2 n) {\r\n\treturn fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\r\n}\r\n\r\nfloat noise(vec2 n) {\r\n\tconst vec2 d = vec2(0.0, 1.0);\r\n\tvec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\r\n\treturn mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\r\n}\r\n\r\nfloat fbm(vec2 n) {\r\n\tfloat total = 0.0, amplitude = 1.0;\r\n\tfor (int i = 0; i < 4; i++) {\r\n\t\ttotal += noise(n) * amplitude;\r\n\t\tn += n;\r\n\t\tamplitude *= 0.5;\r\n\t}\r\n\treturn total;\r\n}\r\n\r\nvoid main(void) {\r\n\tvec3 color = mix(groundColor, herb1Color, rand(gl_FragCoord.xy * 4.0));\r\n\tcolor = mix(color, herb2Color, rand(gl_FragCoord.xy * 8.0));\r\n\tcolor = mix(color, herb3Color, rand(gl_FragCoord.xy));\r\n\tcolor = mix(color, herb1Color, fbm(gl_FragCoord.xy * 16.0));\r\n\tgl_FragColor = vec4(color, 1.0);\r\n}","hdrPixelShader":"precision highp float;\r\n\r\nuniform sampler2D textureSampler;\r\nvarying vec2 vUV;\r\n\r\n#if defined(GAUSSIAN_BLUR_H) || defined(GAUSSIAN_BLUR_V)\r\nuniform float blurOffsets[9];\r\nuniform float blurWeights[9];\r\n\r\nvoid main(void) {\r\n\tvec4 color = vec4(0.0, 0.0, 0.0, 0.0);\r\n\r\n\tfor (int i = 0; i < 9; i++) {\r\n\t\t#ifdef GAUSSIAN_BLUR_H\r\n\t\tcolor += (texture2D(textureSampler, vUV + vec2(blurOffsets[i], 0.0)) * blurWeights[i]);\r\n\t\t#else\r\n\t\tcolor += (texture2D(textureSampler, vUV + vec2(0.0, blurOffsets[i])) * blurWeights[i]);\r\n\t\t#endif\r\n\t}\r\n\r\n\tcolor.a = 1.0;\r\n\tgl_FragColor = color;\r\n}\r\n#endif\r\n\r\n#if defined(TEXTURE_ADDER)\r\nuniform sampler2D otherSampler;\r\n\r\nvoid main() {\r\n\tvec4 sum = texture2D(textureSampler, vUV) + texture2D(otherSampler, vUV);\r\n\tsum.a = clamp(sum.a, 0.0, 1.0);\r\n\r\n\tgl_FragColor = sum;\r\n}\r\n#endif\r\n\r\n#if defined(LUMINANCE_GENERATOR)\r\nuniform vec2 lumOffsets[4];\r\n\r\nvoid main() {\r\n\tfloat average = 0.0;\r\n\tvec4 color = vec4(0.0, 0.0, 0.0, 0.0);\r\n\tfloat maximum = -1e20;\r\n\r\n\tfor (int i = 0; i < 4; i++) {\r\n\t\tcolor = texture2D(textureSampler, vUV + lumOffsets[i]);\r\n\r\n\t\tfloat GreyValue = length(color.rgb);\r\n\r\n\t\tmaximum = max(maximum, GreyValue);\r\n\t\taverage += (0.25 * log(1e-5 + GreyValue));\r\n\t}\r\n\r\n\taverage = exp(average);\r\n\r\n\tgl_FragColor = vec4(average, maximum, 0.0, 1.0);\r\n\r\n}\r\n#endif\r\n\r\n#if defined(DOWN_SAMPLE)\r\nuniform vec2 dsOffsets[9];\r\nuniform float halfDestPixelSize;\r\n\r\n#ifdef FINAL_DOWN_SAMPLE\r\nvec4 pack(float value) {\r\n\tconst vec4 bit_shift = vec4(255.0 * 255.0 * 255.0, 255.0 * 255.0, 255.0, 1.0);\r\n\tconst vec4 bit_mask = vec4(0.0, 1.0 / 255.0, 1.0 / 255.0, 1.0 / 255.0);\r\n\r\n\tvec4 res = fract(value * bit_shift);\r\n\tres -= res.xxyz * bit_mask;\r\n\r\n\treturn res;\r\n}\r\n#endif\r\n\r\nvoid main() {\r\n\tvec4 color = vec4(0.0, 0.0, 0.0, 0.0);\r\n\tfloat average = 0.0;\r\n\r\n\tfor (int i = 0; i < 9; i++) {\r\n\t\tcolor = texture2D(textureSampler, vUV + vec2(halfDestPixelSize, halfDestPixelSize) + dsOffsets[i]);\r\n\t\taverage += color.r;\r\n\t}\r\n\r\n\taverage /= 9.0;\r\n\r\n\t#ifndef FINAL_DOWN_SAMPLE\r\n\tgl_FragColor = vec4(average, average, 0.0, 1.0);\r\n\t#else\r\n\tgl_FragColor = pack(average);\r\n\t#endif\r\n}\r\n#endif\r\n\r\n#if defined(BRIGHT_PASS)\r\nuniform vec2 dsOffsets[4];\r\nuniform float brightThreshold;\r\n\r\nvoid main() {\r\n\tvec4 average = vec4(0.0, 0.0, 0.0, 0.0);\r\n\r\n\taverage = texture2D(textureSampler, vUV + vec2(dsOffsets[0].x, dsOffsets[0].y));\r\n\taverage += texture2D(textureSampler, vUV + vec2(dsOffsets[1].x, dsOffsets[1].y));\r\n\taverage += texture2D(textureSampler, vUV + vec2(dsOffsets[2].x, dsOffsets[2].y));\r\n\taverage += texture2D(textureSampler, vUV + vec2(dsOffsets[3].x, dsOffsets[3].y));\r\n\r\n\taverage *= 0.25;\r\n\r\n\tfloat luminance = length(average.rgb);\r\n\r\n\tif (luminance < brightThreshold) {\r\n\t\taverage = vec4(0.0, 0.0, 0.0, 1.0);\r\n\t}\r\n\r\n\tgl_FragColor = average;\r\n}\r\n#endif\r\n\r\n#if defined(DOWN_SAMPLE_X4)\r\nuniform vec2 dsOffsets[16];\r\n\r\nvoid main() {\r\n\tvec4 average = vec4(0.0, 0.0, 0.0, 0.0);\r\n\r\n\taverage = texture2D(textureSampler, vUV + dsOffsets[0]);\r\n\taverage += texture2D(textureSampler, vUV + dsOffsets[1]);\r\n\taverage += texture2D(textureSampler, vUV + dsOffsets[2]);\r\n\taverage += texture2D(textureSampler, vUV + dsOffsets[3]);\r\n\taverage += texture2D(textureSampler, vUV + dsOffsets[4]);\r\n\taverage += texture2D(textureSampler, vUV + dsOffsets[5]);\r\n\taverage += texture2D(textureSampler, vUV + dsOffsets[6]);\r\n\taverage += texture2D(textureSampler, vUV + dsOffsets[7]);\r\n\taverage += texture2D(textureSampler, vUV + dsOffsets[8]);\r\n\taverage += texture2D(textureSampler, vUV + dsOffsets[9]);\r\n\taverage += texture2D(textureSampler, vUV + dsOffsets[10]);\r\n\taverage += texture2D(textureSampler, vUV + dsOffsets[11]);\r\n\taverage += texture2D(textureSampler, vUV + dsOffsets[12]);\r\n\taverage += texture2D(textureSampler, vUV + dsOffsets[13]);\r\n\taverage += texture2D(textureSampler, vUV + dsOffsets[14]);\r\n\taverage += texture2D(textureSampler, vUV + dsOffsets[15]);\r\n\r\n\taverage /= 16.0;\r\n\r\n\tgl_FragColor = average;\r\n}\r\n#endif\r\n\r\n#if defined(HDR)\r\nuniform sampler2D otherSampler;\r\n\r\nuniform float exposure;\r\nuniform float avgLuminance;\r\n\r\nvoid main() {\r\n\tvec4 color = texture2D(textureSampler, vUV) + texture2D(otherSampler, vUV);\r\n\tvec4 adjustedColor = color / avgLuminance * exposure;\r\n\r\n\tcolor = adjustedColor;\r\n\tcolor.a = 1.0;\r\n\r\n\tgl_FragColor = color;\r\n}\r\n#endif\r\n","layerPixelShader":"precision highp float;\r\n\r\n// Samplers\r\nvarying vec2 vUV;\r\nuniform sampler2D textureSampler;\r\n\r\n// Color\r\nuniform vec4 color;\r\n\r\nvoid main(void) {\r\n\tvec4 baseColor = texture2D(textureSampler, vUV);\r\n\r\n\tgl_FragColor = baseColor * color;\r\n}","layerVertexShader":"precision highp float;\r\n\r\n// Attributes\r\nattribute vec2 position;\r\n\r\n// Uniforms\r\nuniform mat4 textureMatrix;\r\n\r\n// Output\r\nvarying vec2 vUV;\r\n\r\nconst vec2 madd = vec2(0.5, 0.5);\r\n\r\nvoid main(void) {\t\r\n\r\n\tvUV = vec2(textureMatrix * vec4(position * madd + madd, 1.0, 0.0));\r\n\tgl_Position = vec4(position, 0.0, 1.0);\r\n}","legacydefaultPixelShader":"precision highp float;\r\n\r\n#define MAP_PROJECTION\t4.\r\n\r\n// Constants\r\nuniform vec3 vEyePosition;\r\nuniform vec3 vAmbientColor;\r\nuniform vec4 vDiffuseColor;\r\n#ifdef SPECULARTERM\r\nuniform vec4 vSpecularColor;\r\n#endif\r\nuniform vec3 vEmissiveColor;\r\n\r\n// Input\r\nvarying vec3 vPositionW;\r\nvarying vec3 vNormalW;\r\n\r\n#ifdef VERTEXCOLOR\r\nvarying vec4 vColor;\r\n#endif\r\n\r\n// Lights\r\n#ifdef LIGHT0\r\nuniform vec4 vLightData0;\r\nuniform vec4 vLightDiffuse0;\r\n#ifdef SPECULARTERM\r\nuniform vec3 vLightSpecular0;\r\n#endif\r\n#ifdef SHADOW0\r\nvarying vec4 vPositionFromLight0;\r\nuniform sampler2D shadowSampler0;\r\n#endif\r\n#ifdef SPOTLIGHT0\r\nuniform vec4 vLightDirection0;\r\n#endif\r\n#ifdef HEMILIGHT0\r\nuniform vec3 vLightGround0;\r\n#endif\r\n#endif\r\n\r\n#ifdef LIGHT1\r\nuniform vec4 vLightData1;\r\nuniform vec4 vLightDiffuse1;\r\n#ifdef SPECULARTERM\r\nuniform vec3 vLightSpecular1;\r\n#endif\r\n#ifdef SHADOW1\r\nvarying vec4 vPositionFromLight1;\r\nuniform sampler2D shadowSampler1;\r\n#endif\r\n#ifdef SPOTLIGHT1\r\nuniform vec4 vLightDirection1;\r\n#endif\r\n#ifdef HEMILIGHT1\r\nuniform vec3 vLightGround1;\r\n#endif\r\n#endif\r\n\r\n#ifdef LIGHT2\r\nuniform vec4 vLightData2;\r\nuniform vec4 vLightDiffuse2;\r\n#ifdef SPECULARTERM\r\nuniform vec3 vLightSpecular2;\r\n#endif\r\n#ifdef SHADOW2\r\nvarying vec4 vPositionFromLight2;\r\nuniform sampler2D shadowSampler2;\r\n#endif\r\n#ifdef SPOTLIGHT2\r\nuniform vec4 vLightDirection2;\r\n#endif\r\n#ifdef HEMILIGHT2\r\nuniform vec3 vLightGround2;\r\n#endif\r\n#endif\r\n\r\n#ifdef LIGHT3\r\nuniform vec4 vLightData3;\r\nuniform vec4 vLightDiffuse3;\r\n#ifdef SPECULARTERM\r\nuniform vec3 vLightSpecular3;\r\n#endif\r\n#ifdef SHADOW3\r\nvarying vec4 vPositionFromLight3;\r\nuniform sampler2D shadowSampler3;\r\n#endif\r\n#ifdef SPOTLIGHT3\r\nuniform vec4 vLightDirection3;\r\n#endif\r\n#ifdef HEMILIGHT3\r\nuniform vec3 vLightGround3;\r\n#endif\r\n#endif\r\n\r\n// Samplers\r\n#ifdef DIFFUSE\r\nvarying vec2 vDiffuseUV;\r\nuniform sampler2D diffuseSampler;\r\nuniform vec2 vDiffuseInfos;\r\n#endif\r\n\r\n#ifdef AMBIENT\r\nvarying vec2 vAmbientUV;\r\nuniform sampler2D ambientSampler;\r\nuniform vec2 vAmbientInfos;\r\n#endif\r\n\r\n#ifdef OPACITY\t\r\nvarying vec2 vOpacityUV;\r\nuniform sampler2D opacitySampler;\r\nuniform vec2 vOpacityInfos;\r\n#endif\r\n\r\n#ifdef REFLECTION\r\nvarying vec3 vReflectionUVW;\r\n#ifdef REFLECTIONMAP_3D\r\nuniform samplerCube reflectionCubeSampler;\r\n#else\r\nuniform sampler2D reflection2DSampler;\r\n#endif\r\nuniform vec2 vReflectionInfos;\r\n#endif\r\n\r\n#ifdef EMISSIVE\r\nvarying vec2 vEmissiveUV;\r\nuniform vec2 vEmissiveInfos;\r\nuniform sampler2D emissiveSampler;\r\n#endif\r\n\r\n#if defined(SPECULAR) && defined(SPECULARTERM)\r\nvarying vec2 vSpecularUV;\r\nuniform vec2 vSpecularInfos;\r\nuniform sampler2D specularSampler;\r\n#endif\r\n\r\n// Fresnel\r\n#ifdef FRESNEL\r\nfloat computeFresnelTerm(vec3 viewDirection, vec3 worldNormal, float bias, float power)\r\n{\r\n\tfloat fresnelTerm = pow(bias + abs(dot(viewDirection, worldNormal)), power);\r\n\treturn clamp(fresnelTerm, 0., 1.);\r\n}\r\n#endif\r\n\r\n#ifdef DIFFUSEFRESNEL\r\nuniform vec4 diffuseLeftColor;\r\nuniform vec4 diffuseRightColor;\r\n#endif\r\n\r\n#ifdef OPACITYFRESNEL\r\nuniform vec4 opacityParts;\r\n#endif\r\n\r\n#ifdef REFLECTIONFRESNEL\r\nuniform vec4 reflectionLeftColor;\r\nuniform vec4 reflectionRightColor;\r\n#endif\r\n\r\n#ifdef EMISSIVEFRESNEL\r\nuniform vec4 emissiveLeftColor;\r\nuniform vec4 emissiveRightColor;\r\n#endif\r\n\r\n// Shadows\r\n#ifdef SHADOWS\r\n\r\nfloat unpack(vec4 color)\r\n{\r\n\tconst vec4 bitShift = vec4(1. / (255. * 255. * 255.), 1. / (255. * 255.), 1. / 255., 1.);\r\n\treturn dot(color, bitShift);\r\n}\r\n\r\nfloat unpackHalf(vec2 color)\r\n{\r\n\treturn color.x + (color.y / 255.0);\r\n}\r\n\r\nfloat computeShadow(vec4 vPositionFromLight, sampler2D shadowSampler)\r\n{\r\n\tvec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\r\n\tvec2 uv = 0.5 * depth.xy + vec2(0.5, 0.5);\r\n\r\n\tif (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\r\n\t{\r\n\t\treturn 1.0;\r\n\t}\r\n\r\n\tfloat shadow = unpack(texture2D(shadowSampler, uv));\r\n\r\n\tif (depth.z > shadow)\r\n\t{\r\n\t\treturn 0.;\r\n\t}\r\n\treturn 1.;\r\n}\r\n\r\n// Thanks to http://devmaster.net/\r\nfloat ChebychevInequality(vec2 moments, float t)\r\n{\r\n\tif (t <= moments.x)\r\n\t{\r\n\t\treturn 1.0;\r\n\t}\r\n\r\n\tfloat variance = moments.y - (moments.x * moments.x);\r\n\tvariance = max(variance, 0.);\r\n\r\n\tfloat d = t - moments.x;\r\n\treturn variance / (variance + d * d);\r\n}\r\n\r\nfloat computeShadowWithVSM(vec4 vPositionFromLight, sampler2D shadowSampler)\r\n{\r\n\tvec3 depth = vPositionFromLight.xyz / vPositionFromLight.w;\r\n\tvec2 uv = 0.5 * depth.xy + vec2(0.5, 0.5);\r\n\r\n\tif (uv.x < 0. || uv.x > 1.0 || uv.y < 0. || uv.y > 1.0)\r\n\t{\r\n\t\treturn 1.0;\r\n\t}\r\n\r\n\tvec4 texel = texture2D(shadowSampler, uv);\r\n\r\n\tvec2 moments = vec2(unpackHalf(texel.xy), unpackHalf(texel.zw));\r\n\treturn clamp(1.3 - ChebychevInequality(moments, depth.z), 0., 1.0);\r\n}\r\n#endif\r\n\r\n#ifdef CLIPPLANE\r\nvarying float fClipDistance;\r\n#endif\r\n\r\n// Fog\r\n#ifdef FOG\r\n\r\n#define FOGMODE_NONE 0.\r\n#define FOGMODE_EXP 1.\r\n#define FOGMODE_EXP2 2.\r\n#define FOGMODE_LINEAR 3.\r\n#define E 2.71828\r\n\r\nuniform vec4 vFogInfos;\r\nuniform vec3 vFogColor;\r\nvarying float fFogDistance;\r\n\r\nfloat CalcFogFactor()\r\n{\r\n\tfloat fogCoeff = 1.0;\r\n\tfloat fogStart = vFogInfos.y;\r\n\tfloat fogEnd = vFogInfos.z;\r\n\tfloat fogDensity = vFogInfos.w;\r\n\r\n\tif (FOGMODE_LINEAR == vFogInfos.x)\r\n\t{\r\n\t\tfogCoeff = (fogEnd - fFogDistance) / (fogEnd - fogStart);\r\n\t}\r\n\telse if (FOGMODE_EXP == vFogInfos.x)\r\n\t{\r\n\t\tfogCoeff = 1.0 / pow(E, fFogDistance * fogDensity);\r\n\t}\r\n\telse if (FOGMODE_EXP2 == vFogInfos.x)\r\n\t{\r\n\t\tfogCoeff = 1.0 / pow(E, fFogDistance * fFogDistance * fogDensity * fogDensity);\r\n\t}\r\n\r\n\treturn clamp(fogCoeff, 0.0, 1.0);\r\n}\r\n#endif\r\n\r\n// Light Computing\r\nmat3 computeLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec4 diffuseColor, vec3 specularColor) {\r\n\tmat3 result;\r\n\r\n\tvec3 lightVectorW;\r\n\tif (lightData.w == 0.)\r\n\t{\r\n\t\tlightVectorW = normalize(lightData.xyz - vPositionW);\r\n\t}\r\n\telse\r\n\t{\r\n\t\tlightVectorW = normalize(-lightData.xyz);\r\n\t}\r\n\r\n\t// diffuse\r\n\tfloat ndl = max(0., dot(vNormal, lightVectorW));\r\n\r\n\tresult[0] = ndl * diffuseColor.rgb;\r\n\r\n#ifdef SPECULARTERM\r\n\t// Specular\r\n\tvec3 angleW = normalize(viewDirectionW + lightVectorW);\r\n\tfloat specComp = max(0., dot(vNormal, angleW));\r\n\tspecComp = max(0., pow(specComp, max(1.0, vSpecularColor.a)));\r\n\tresult[1] = specComp * specularColor;\r\n#else\r\n\tresult[1] = vec3(0.);\r\n#endif\r\n\r\n\tresult[2] = vec3(0.);\r\n\r\n\treturn result;\r\n}\r\n\r\nmat3 computeSpotLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec4 lightDirection, vec4 diffuseColor, vec3 specularColor) {\r\n\tmat3 result;\r\n\r\n\tvec3 lightVectorW = normalize(lightData.xyz - vPositionW);\r\n\r\n\t// diffuse\r\n\tfloat cosAngle = max(0., dot(-lightDirection.xyz, lightVectorW));\r\n\tfloat spotAtten = 0.0;\r\n\r\n\tif (cosAngle >= lightDirection.w)\r\n\t{\r\n\t\tcosAngle = max(0., pow(cosAngle, lightData.w));\r\n\t\tspotAtten = max(0., (cosAngle - lightDirection.w) / (1. - cosAngle));\r\n\r\n\t\t// Diffuse\r\n\t\tfloat ndl = max(0., dot(vNormal, -lightDirection.xyz));\r\n\t\tresult[0] = ndl * spotAtten * diffuseColor.rgb;\r\n\r\n#ifdef SPECULARTERM\r\n\t\t// Specular\r\n\t\tvec3 angleW = normalize(viewDirectionW - lightDirection.xyz);\r\n\t\tfloat specComp = max(0., dot(vNormal, angleW));\r\n\t\tspecComp = pow(specComp, vSpecularColor.a);\r\n\t\tresult[1] = specComp * specularColor * spotAtten;\r\n#else\r\n\t\tresult[1] = vec3(0.);\r\n#endif\r\n\t\tresult[2] = vec3(0.);\r\n\r\n\t\treturn result;\r\n\t}\r\n\r\n\tresult[0] = vec3(0.);\r\n\tresult[1] = vec3(0.);\r\n\tresult[2] = vec3(0.);\r\n\r\n\treturn result;\r\n}\r\n\r\nmat3 computeHemisphericLighting(vec3 viewDirectionW, vec3 vNormal, vec4 lightData, vec4 diffuseColor, vec3 specularColor, vec3 groundColor) {\r\n\tmat3 result;\r\n\r\n\t// Diffuse\r\n\tfloat ndl = dot(vNormal, lightData.xyz) * 0.5 + 0.5;\r\n\tresult[0] = mix(groundColor, diffuseColor.rgb, ndl);\r\n\r\n#ifdef SPECULARTERM\r\n\t// Specular\r\n\tvec3 angleW = normalize(viewDirectionW + lightData.xyz);\r\n\tfloat specComp = max(0., dot(vNormal, angleW));\r\n\tspecComp = pow(specComp, vSpecularColor.a);\r\n\tresult[1] = specComp * specularColor;\r\n#else\r\n\tresult[1] = vec3(0.);\r\n#endif\r\n\r\n\tresult[2] = vec3(0.);\r\n\r\n\treturn result;\r\n}\r\n\r\nvoid main(void) {\r\n\t// Clip plane\r\n#ifdef CLIPPLANE\r\n\tif (fClipDistance > 0.0)\r\n\t\tdiscard;\r\n#endif\r\n\r\n\tvec3 viewDirectionW = normalize(vEyePosition - vPositionW);\r\n\r\n\t// Base color\r\n\tvec4 baseColor = vec4(1., 1., 1., 1.);\r\n\tvec3 diffuseColor = vDiffuseColor.rgb;\r\n\r\n#ifdef DIFFUSE\r\n\tbaseColor = texture2D(diffuseSampler, vDiffuseUV);\r\n\r\n#ifdef ALPHATEST\r\n\tif (baseColor.a < 0.4)\r\n\t\tdiscard;\r\n#endif\r\n\r\n\tbaseColor.rgb *= vDiffuseInfos.y;\r\n#endif\r\n\r\n#ifdef VERTEXCOLOR\r\n\tbaseColor.rgb *= vColor.rgb;\r\n#endif\r\n\r\n\t// Bump\r\n\tvec3 normalW = normalize(vNormalW);\r\n\r\n\t// Ambient color\r\n\tvec3 baseAmbientColor = vec3(1., 1., 1.);\r\n\r\n#ifdef AMBIENT\r\n\tbaseAmbientColor = texture2D(ambientSampler, vAmbientUV).rgb * vAmbientInfos.y;\r\n#endif\r\n\r\n\t// Lighting\r\n\tvec3 diffuseBase = vec3(0., 0., 0.);\r\n#ifdef SPECULARTERM\r\n\tvec3 specularBase = vec3(0., 0., 0.);\r\n#endif\r\n\tfloat shadow = 1.;\r\n\r\n#ifdef LIGHT0\r\n#ifndef SPECULARTERM\r\n\tvec3 vLightSpecular0 = vec3(0.0);\r\n#endif\r\n#ifdef SPOTLIGHT0\r\n\tmat3 info = computeSpotLighting(viewDirectionW, normalW, vLightData0, vLightDirection0, vLightDiffuse0, vLightSpecular0);\r\n#endif\r\n#ifdef HEMILIGHT0\r\n\tmat3 info = computeHemisphericLighting(viewDirectionW, normalW, vLightData0, vLightDiffuse0, vLightSpecular0, vLightGround0);\r\n#endif\r\n#ifdef POINTDIRLIGHT0\r\n\tmat3 info = computeLighting(viewDirectionW, normalW, vLightData0, vLightDiffuse0, vLightSpecular0);\r\n#endif\r\n#ifdef SHADOW0\r\n#ifdef SHADOWVSM0\r\n\tshadow = computeShadowWithVSM(vPositionFromLight0, shadowSampler0);\r\n#else\r\n\tshadow = computeShadow(vPositionFromLight0, shadowSampler0);\r\n#endif\r\n#else\r\n\tshadow = 1.;\r\n#endif\r\n\tdiffuseBase += info[0] * shadow;\r\n#ifdef SPECULARTERM\r\n\tspecularBase += info[1] * shadow;\r\n#endif\r\n#endif\r\n\r\n#ifdef LIGHT1\r\n#ifndef SPECULARTERM\r\n\tvec3 vLightSpecular1 = vec3(0.0);\r\n#endif\r\n#ifdef SPOTLIGHT1\r\n\tinfo = computeSpotLighting(viewDirectionW, normalW, vLightData1, vLightDirection1, vLightDiffuse1, vLightSpecular1);\r\n#endif\r\n#ifdef HEMILIGHT1\r\n\tinfo = computeHemisphericLighting(viewDirectionW, normalW, vLightData1, vLightDiffuse1, vLightSpecular1, vLightGround1);\r\n#endif\r\n#ifdef POINTDIRLIGHT1\r\n\tinfo = computeLighting(viewDirectionW, normalW, vLightData1, vLightDiffuse1, vLightSpecular1);\r\n#endif\r\n#ifdef SHADOW1\r\n#ifdef SHADOWVSM1\r\n\tshadow = computeShadowWithVSM(vPositionFromLight1, shadowSampler1);\r\n#else\r\n\tshadow = computeShadow(vPositionFromLight1, shadowSampler1);\r\n#endif\r\n#else\r\n\tshadow = 1.;\r\n#endif\r\n\tdiffuseBase += info[0] * shadow;\r\n#ifdef SPECULARTERM\r\n\tspecularBase += info[1] * shadow;\r\n#endif\r\n#endif\r\n\r\n#ifdef LIGHT2\r\n#ifndef SPECULARTERM\r\n\tvec3 vLightSpecular2 = vec3(0.0);\r\n#endif\r\n#ifdef SPOTLIGHT2\r\n\tinfo = computeSpotLighting(viewDirectionW, normalW, vLightData2, vLightDirection2, vLightDiffuse2, vLightSpecular2);\r\n#endif\r\n#ifdef HEMILIGHT2\r\n\tinfo = computeHemisphericLighting(viewDirectionW, normalW, vLightData2, vLightDiffuse2, vLightSpecular2, vLightGround2);\r\n#endif\r\n#ifdef POINTDIRLIGHT2\r\n\tinfo = computeLighting(viewDirectionW, normalW, vLightData2, vLightDiffuse2, vLightSpecular2);\r\n#endif\r\n#ifdef SHADOW2\r\n#ifdef SHADOWVSM2\r\n\tshadow = computeShadowWithVSM(vPositionFromLight2, shadowSampler2);\r\n#else\r\n\tshadow = computeShadow(vPositionFromLight2, shadowSampler2);\r\n#endif\t\r\n#else\r\n\tshadow = 1.;\r\n#endif\r\n\tdiffuseBase += info[0] * shadow;\r\n#ifdef SPECULARTERM\r\n\tspecularBase += info[1] * shadow;\r\n#endif\r\n#endif\r\n\r\n#ifdef LIGHT3\r\n#ifndef SPECULARTERM\r\n\tvec3 vLightSpecular3 = vec3(0.0);\r\n#endif\r\n#ifdef SPOTLIGHT3\r\n\tinfo = computeSpotLighting(viewDirectionW, normalW, vLightData3, vLightDirection3, vLightDiffuse3, vLightSpecular3);\r\n#endif\r\n#ifdef HEMILIGHT3\r\n\tinfo = computeHemisphericLighting(viewDirectionW, normalW, vLightData3, vLightDiffuse3, vLightSpecular3, vLightGround3);\r\n#endif\r\n#ifdef POINTDIRLIGHT3\r\n\tinfo = computeLighting(viewDirectionW, normalW, vLightData3, vLightDiffuse3, vLightSpecular3);\r\n#endif\r\n#ifdef SHADOW3\r\n#ifdef SHADOWVSM3\r\n\tshadow = computeShadowWithVSM(vPositionFromLight3, shadowSampler3);\r\n#else\r\n\tshadow = computeShadow(vPositionFromLight3, shadowSampler3);\r\n#endif\t\r\n#else\r\n\tshadow = 1.;\r\n#endif\r\n\tdiffuseBase += info[0] * shadow;\r\n#ifdef SPECULARTERM\r\n\tspecularBase += info[1] * shadow;\r\n#endif\r\n#endif\r\n\r\n\t// Reflection\r\n\tvec3 reflectionColor = vec3(0., 0., 0.);\r\n\r\n#ifdef REFLECTION\r\n#ifdef REFLECTIONMAP_3D\r\n\t\treflectionColor = textureCube(reflectionCubeSampler, vReflectionUVW).rgb * vReflectionInfos.x;\r\n#else\r\n\t\tvec2 coords = vReflectionUVW.xy;\r\n\r\n#ifdef REFLECTIONMAP_PROJECTION\r\n\t\tcoords /= vReflectionUVW.z;\r\n#endif\r\n\r\n\t\tcoords.y = 1.0 - coords.y;\r\n\r\n\t\treflectionColor = texture2D(reflection2DSampler, coords).rgb * vReflectionInfos.x;\r\n#endif\r\n\r\n#ifdef REFLECTIONFRESNEL\r\n\tfloat reflectionFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, reflectionRightColor.a, reflectionLeftColor.a);\r\n\r\n\treflectionColor *= reflectionLeftColor.rgb * (1.0 - reflectionFresnelTerm) + reflectionFresnelTerm * reflectionRightColor.rgb;\r\n#endif\r\n#endif\r\n\r\n\t// Alpha\r\n\tfloat alpha = vDiffuseColor.a;\r\n\r\n#ifdef OPACITY\r\n\tvec4 opacityMap = texture2D(opacitySampler, vOpacityUV);\r\n#ifdef OPACITYRGB\r\n\topacityMap.rgb = opacityMap.rgb * vec3(0.3, 0.59, 0.11);\r\n\talpha *= (opacityMap.x + opacityMap.y + opacityMap.z)* vOpacityInfos.y;\r\n#else\r\n\talpha *= opacityMap.a * vOpacityInfos.y;\r\n#endif\r\n#endif\r\n\r\n#ifdef VERTEXALPHA\r\n\talpha *= vColor.a;\r\n#endif\r\n\r\n#ifdef OPACITYFRESNEL\r\n\tfloat opacityFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, opacityParts.z, opacityParts.w);\r\n\r\n\talpha += opacityParts.x * (1.0 - opacityFresnelTerm) + opacityFresnelTerm * opacityParts.y;\r\n#endif\r\n\r\n\t// Emissive\r\n\tvec3 emissiveColor = vEmissiveColor;\r\n#ifdef EMISSIVE\r\n\temissiveColor += texture2D(emissiveSampler, vEmissiveUV).rgb * vEmissiveInfos.y;\r\n#endif\r\n\r\n#ifdef EMISSIVEFRESNEL\r\n\tfloat emissiveFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, emissiveRightColor.a, emissiveLeftColor.a);\r\n\r\n\temissiveColor *= emissiveLeftColor.rgb * (1.0 - emissiveFresnelTerm) + emissiveFresnelTerm * emissiveRightColor.rgb;\r\n#endif\r\n\r\n\t// Specular map\r\n#ifdef SPECULARTERM\r\n\tvec3 specularColor = vSpecularColor.rgb;\r\n#ifdef SPECULAR\r\n\tspecularColor = texture2D(specularSampler, vSpecularUV).rgb * vSpecularInfos.y;\r\n#endif\r\n#endif\r\n\r\n\t// Fresnel\r\n#ifdef DIFFUSEFRESNEL\r\n\tfloat diffuseFresnelTerm = computeFresnelTerm(viewDirectionW, normalW, diffuseRightColor.a, diffuseLeftColor.a);\r\n\r\n\tdiffuseBase *= diffuseLeftColor.rgb * (1.0 - diffuseFresnelTerm) + diffuseFresnelTerm * diffuseRightColor.rgb;\r\n#endif\r\n\r\n\t// Composition\r\n\tvec3 finalDiffuse = clamp(diffuseBase * diffuseColor + emissiveColor + vAmbientColor, 0.0, 1.0) * baseColor.rgb;\r\n#ifdef SPECULARTERM\r\n\tvec3 finalSpecular = specularBase * specularColor;\r\n#else\r\n\tvec3 finalSpecular = vec3(0.0);\r\n#endif\r\n\r\n\tvec4 color = vec4(finalDiffuse * baseAmbientColor + finalSpecular + reflectionColor, alpha);\r\n\r\n#ifdef FOG\r\n\tfloat fog = CalcFogFactor();\r\n\tcolor.rgb = fog * color.rgb + (1.0 - fog) * vFogColor;\r\n#endif\r\n\r\n\tgl_FragColor = color;\r\n}","legacydefaultVertexShader":"precision highp float;\r\n\r\n// Attributes\r\nattribute vec3 position;\r\nattribute vec3 normal;\r\n#ifdef UV1\r\nattribute vec2 uv;\r\n#endif\r\n#ifdef UV2\r\nattribute vec2 uv2;\r\n#endif\r\n#ifdef VERTEXCOLOR\r\nattribute vec4 color;\r\n#endif\r\n#ifdef BONES\r\nattribute vec4 matricesIndices;\r\nattribute vec4 matricesWeights;\r\n#endif\r\n\r\n// Uniforms\r\nuniform mat4 world;\r\nuniform mat4 view;\r\nuniform mat4 viewProjection;\r\n\r\n#ifdef DIFFUSE\r\nvarying vec2 vDiffuseUV;\r\nuniform mat4 diffuseMatrix;\r\nuniform vec2 vDiffuseInfos;\r\n#endif\r\n\r\n#ifdef AMBIENT\r\nvarying vec2 vAmbientUV;\r\nuniform mat4 ambientMatrix;\r\nuniform vec2 vAmbientInfos;\r\n#endif\r\n\r\n#ifdef OPACITY\r\nvarying vec2 vOpacityUV;\r\nuniform mat4 opacityMatrix;\r\nuniform vec2 vOpacityInfos;\r\n#endif\r\n\r\n#ifdef EMISSIVE\r\nvarying vec2 vEmissiveUV;\r\nuniform vec2 vEmissiveInfos;\r\nuniform mat4 emissiveMatrix;\r\n#endif\r\n\r\n#if defined(SPECULAR) && defined(SPECULARTERM)\r\nvarying vec2 vSpecularUV;\r\nuniform vec2 vSpecularInfos;\r\nuniform mat4 specularMatrix;\r\n#endif\r\n\r\n#ifdef BUMP\r\nvarying vec2 vBumpUV;\r\nuniform vec2 vBumpInfos;\r\nuniform mat4 bumpMatrix;\r\n#endif\r\n\r\n#ifdef BONES\r\nuniform mat4 mBones[BonesPerMesh];\r\n#endif\r\n\r\n// Output\r\nvarying vec3 vPositionW;\r\nvarying vec3 vNormalW;\r\n\r\n#ifdef VERTEXCOLOR\r\nvarying vec4 vColor;\r\n#endif\r\n\r\n#ifdef CLIPPLANE\r\nuniform vec4 vClipPlane;\r\nvarying float fClipDistance;\r\n#endif\r\n\r\n#ifdef FOG\r\nvarying float fFogDistance;\r\n#endif\r\n\r\n#ifdef SHADOWS\r\n#ifdef LIGHT0\r\nuniform mat4 lightMatrix0;\r\nvarying vec4 vPositionFromLight0;\r\n#endif\r\n#ifdef LIGHT1\r\nuniform mat4 lightMatrix1;\r\nvarying vec4 vPositionFromLight1;\r\n#endif\r\n#ifdef LIGHT2\r\nuniform mat4 lightMatrix2;\r\nvarying vec4 vPositionFromLight2;\r\n#endif\r\n#ifdef LIGHT3\r\nuniform mat4 lightMatrix3;\r\nvarying vec4 vPositionFromLight3;\r\n#endif\r\n#endif\r\n\r\n#ifdef REFLECTION\r\nuniform vec3 vEyePosition;\r\nvarying vec3 vReflectionUVW;\r\nuniform mat4 reflectionMatrix;\r\n\r\nvec3 computeReflectionCoords(vec4 worldPos, vec3 worldNormal)\r\n{\r\n#ifdef REFLECTIONMAP_SPHERICAL\r\n\tvec3 coords = vec3(view * vec4(worldNormal, 0.0));\r\n\r\n\treturn vec3(reflectionMatrix * vec4(coords, 1.0));\r\n#endif\r\n\r\n#ifdef REFLECTIONMAP_PLANAR\r\n\tvec3 viewDir = worldPos.xyz - vEyePosition;\r\n\tvec3 coords = normalize(reflect(viewDir, worldNormal));\r\n\r\n\treturn vec3(reflectionMatrix * vec4(coords, 1));\r\n#endif\r\n\r\n#ifdef REFLECTIONMAP_CUBIC\r\n\tvec3 viewDir = worldPos.xyz - vEyePosition;\r\n\tvec3 coords = reflect(viewDir, worldNormal);\r\n#ifdef INVERTCUBICMAP\r\n\tcoords.y = 1.0 - coords.y;\r\n#endif\r\n\treturn vec3(reflectionMatrix * vec4(coords, 0));\r\n#endif\r\n\r\n#ifdef REFLECTIONMAP_PROJECTION\r\n\treturn vec3(reflectionMatrix * (view * worldPos));\r\n#endif\r\n\r\n#ifdef REFLECTIONMAP_SKYBOX\r\n\treturn position;\r\n#endif\r\n\r\n#ifdef REFLECTIONMAP_EXPLICIT\r\n\treturn vec3(0, 0, 0);\r\n#endif\r\n}\r\n#endif\r\n\r\nvoid main(void) {\r\n\tmat4 finalWorld;\r\n\r\n#ifdef BONES\r\n\tmat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\r\n\tmat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\r\n\tmat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\r\n\r\n#ifdef BONES4\r\n\tmat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\r\n\tfinalWorld = world * (m0 + m1 + m2 + m3);\r\n#else\r\n\tfinalWorld = world * (m0 + m1 + m2);\r\n#endif \r\n\r\n#else\r\n\tfinalWorld = world;\r\n#endif\r\n\r\n\tgl_Position = viewProjection * finalWorld * vec4(position, 1.0);\r\n\r\n\tvec4 worldPos = finalWorld * vec4(position, 1.0);\r\n\tvPositionW = vec3(worldPos);\r\n\tvNormalW = normalize(vec3(finalWorld * vec4(normal, 0.0)));\r\n\r\n\t// Texture coordinates\r\n#ifndef UV1\r\n\tvec2 uv = vec2(0., 0.);\r\n#endif\r\n#ifndef UV2\r\n\tvec2 uv2 = vec2(0., 0.);\r\n#endif\r\n\r\n#ifdef DIFFUSE\r\n\tif (vDiffuseInfos.x == 0.)\r\n\t{\r\n\t\tvDiffuseUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\r\n\t}\r\n\telse\r\n\t{\r\n\t\tvDiffuseUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\r\n\t}\r\n#endif\r\n\r\n#ifdef AMBIENT\r\n\tif (vAmbientInfos.x == 0.)\r\n\t{\r\n\t\tvAmbientUV = vec2(ambientMatrix * vec4(uv, 1.0, 0.0));\r\n\t}\r\n\telse\r\n\t{\r\n\t\tvAmbientUV = vec2(ambientMatrix * vec4(uv2, 1.0, 0.0));\r\n\t}\r\n#endif\r\n\r\n#ifdef OPACITY\r\n\tif (vOpacityInfos.x == 0.)\r\n\t{\r\n\t\tvOpacityUV = vec2(opacityMatrix * vec4(uv, 1.0, 0.0));\r\n\t}\r\n\telse\r\n\t{\r\n\t\tvOpacityUV = vec2(opacityMatrix * vec4(uv2, 1.0, 0.0));\r\n\t}\r\n#endif\r\n\t\r\n#ifdef REFLECTION\r\n\tvReflectionUVW = computeReflectionCoords(vec4(vPositionW, 1.0), vNormalW);\r\n#endif\r\n\r\n#ifdef EMISSIVE\r\n\tif (vEmissiveInfos.x == 0.)\r\n\t{\r\n\t\tvEmissiveUV = vec2(emissiveMatrix * vec4(uv, 1.0, 0.0));\r\n\t}\r\n\telse\r\n\t{\r\n\t\tvEmissiveUV = vec2(emissiveMatrix * vec4(uv2, 1.0, 0.0));\r\n\t}\r\n#endif\r\n\r\n#if defined(SPECULAR) && defined(SPECULARTERM)\r\n\tif (vSpecularInfos.x == 0.)\r\n\t{\r\n\t\tvSpecularUV = vec2(specularMatrix * vec4(uv, 1.0, 0.0));\r\n\t}\r\n\telse\r\n\t{\r\n\t\tvSpecularUV = vec2(specularMatrix * vec4(uv2, 1.0, 0.0));\r\n\t}\r\n#endif\r\n\r\n#ifdef BUMP\r\n\tif (vBumpInfos.x == 0.)\r\n\t{\r\n\t\tvBumpUV = vec2(bumpMatrix * vec4(uv, 1.0, 0.0));\r\n\t}\r\n\telse\r\n\t{\r\n\t\tvBumpUV = vec2(bumpMatrix * vec4(uv2, 1.0, 0.0));\r\n\t}\r\n#endif\r\n\r\n\t// Clip plane\r\n#ifdef CLIPPLANE\r\n\tfClipDistance = dot(worldPos, vClipPlane);\r\n#endif\r\n\r\n\t// Fog\r\n#ifdef FOG\r\n\tfFogDistance = (view * worldPos).z;\r\n#endif\r\n\r\n\t// Shadows\r\n#ifdef SHADOWS\r\n#ifdef LIGHT0\r\n\tvPositionFromLight0 = lightMatrix0 * worldPos;\r\n#endif\r\n#ifdef LIGHT1\r\n\tvPositionFromLight1 = lightMatrix1 * worldPos;\r\n#endif\r\n#ifdef LIGHT2\r\n\tvPositionFromLight2 = lightMatrix2 * worldPos;\r\n#endif\r\n#ifdef LIGHT3\r\n\tvPositionFromLight3 = lightMatrix3 * worldPos;\r\n#endif\r\n#endif\r\n\r\n\t// Vertex color\r\n#ifdef VERTEXCOLOR\r\n\tvColor = color;\r\n#endif\r\n}","lensFlarePixelShader":"precision highp float;\r\n\r\n// Samplers\r\nvarying vec2 vUV;\r\nuniform sampler2D textureSampler;\r\n\r\n// Color\r\nuniform vec4 color;\r\n\r\nvoid main(void) {\r\n\tvec4 baseColor = texture2D(textureSampler, vUV);\r\n\r\n\tgl_FragColor = baseColor * color;\r\n}","lensFlareVertexShader":"precision highp float;\r\n\r\n// Attributes\r\nattribute vec2 position;\r\n\r\n// Uniforms\r\nuniform mat4 viewportMatrix;\r\n\r\n// Output\r\nvarying vec2 vUV;\r\n\r\nconst vec2 madd = vec2(0.5, 0.5);\r\n\r\nvoid main(void) {\t\r\n\r\n\tvUV = position * madd + madd;\r\n\tgl_Position = viewportMatrix * vec4(position, 0.0, 1.0);\r\n}","lensHighlightsPixelShader":"precision highp float;\r\n\r\n// samplers\r\nuniform sampler2D textureSampler;\t// original color\r\n\r\n// uniforms\r\nuniform float gain;\r\nuniform float threshold;\r\nuniform bool pentagon;\r\nuniform float screen_width;\r\nuniform float screen_height;\r\n\r\n// varyings\r\nvarying vec2 vUV;\r\n\r\n// apply luminance filter\r\nvec4 highlightColor(vec4 color) {\r\n\tvec4 highlight = color;\r\n\tfloat luminance = dot(highlight.rgb, vec3(0.2125, 0.7154, 0.0721));\r\n\tfloat lum_threshold;\r\n\tif (threshold > 1.0) { lum_threshold = 0.94 + 0.01 * threshold; }\r\n\telse { lum_threshold = 0.5 + 0.44 * threshold; }\r\n\r\n\tluminance = clamp((luminance - lum_threshold) * (1.0 / (1.0 - lum_threshold)), 0.0, 1.0);\r\n\r\n\thighlight *= luminance * gain;\r\n\thighlight.a = 1.0;\r\n\r\n\treturn highlight;\r\n}\r\n\r\nvoid main(void)\r\n{\r\n\tvec4 original = texture2D(textureSampler, vUV);\r\n\r\n\t// quick exit if no highlight computing\r\n\tif (gain == -1.0) {\r\n\t\tgl_FragColor = vec4(0.0, 0.0, 0.0, 1.0);\r\n\t\treturn;\r\n\t}\r\n\r\n\tfloat w = 2.0 / screen_width;\r\n\tfloat h = 2.0 / screen_height;\r\n\r\n\tfloat weight = 1.0;\r\n\r\n\t// compute blurred color\r\n\tvec4 blurred = vec4(0.0, 0.0, 0.0, 0.0);\r\n\r\n\tif (pentagon) {\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-0.84*w, 0.43*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(0.48*w, -1.29*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(0.61*w, 1.51*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-1.55*w, -0.74*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.71*w, -0.52*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-0.94*w, 1.59*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-0.40*w, -1.87*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.62*w, 1.16*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.09*w, 0.25*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.46*w, -1.71*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(0.08*w, 2.42*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-1.85*w, -1.89*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(2.89*w, 0.16*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.29*w, 1.88*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(0.40*w, -2.81*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.54*w, 2.26*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.60*w, -0.61*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(2.31*w, -1.30*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-0.83*w, 2.53*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-1.12*w, -2.48*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(2.60*w, 1.11*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.82*w, 0.99*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.50*w, -2.81*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(0.85*w, 3.33*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.94*w, -1.92*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(3.27*w, -0.53*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-1.95*w, 2.48*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-0.23*w, -3.04*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(2.17*w, 2.05*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.97*w, -0.04*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(2.25*w, -2.00*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-0.31*w, 3.08*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-1.94*w, -2.59*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(3.37*w, 0.64*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-3.13*w, 1.93*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.03*w, -3.65*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.60*w, 3.17*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-3.14*w, -1.19*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(3.00*w, -1.19*h)));\r\n\t}\r\n\telse {\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-0.85*w, 0.36*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(0.52*w, -1.14*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(0.46*w, 1.42*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-1.46*w, -0.83*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.79*w, -0.42*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-1.11*w, 1.62*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-0.29*w, -2.07*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.69*w, 1.39*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.28*w, 0.12*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.65*w, -1.69*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-0.08*w, 2.44*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-1.63*w, -1.90*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(2.55*w, 0.31*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.13*w, 1.52*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(0.56*w, -2.61*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.38*w, 2.34*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.64*w, -0.81*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(2.53*w, -1.21*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-1.06*w, 2.63*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-1.00*w, -2.69*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(2.59*w, 1.32*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.82*w, 0.78*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.57*w, -2.50*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(0.54*w, 2.93*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.39*w, -1.81*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(3.01*w, -0.28*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.04*w, 2.25*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-0.02*w, -3.05*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(2.09*w, 2.25*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-3.07*w, -0.25*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(2.44*w, -1.90*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-0.52*w, 3.05*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-1.68*w, -2.61*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(3.01*w, 0.79*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.76*w, 1.46*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.05*w, -2.94*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(1.21*w, 2.88*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(-2.84*w, -1.30*h)));\r\n\t\tblurred += highlightColor(texture2D(textureSampler, vUV + vec2(2.98*w, -0.96*h)));\r\n\t}\r\n\r\n\tblurred /= 39.0;\r\n\r\n\tgl_FragColor = blurred;\r\n\r\n\t//if(vUV.x > 0.5) { gl_FragColor.rgb *= 0.0; }\r\n}","linePixelShader":"precision highp float;\r\n\r\nuniform vec4 color;\r\n\r\nvoid main(void) {\r\n\tgl_FragColor = color;\r\n}","lineVertexShader":"precision highp float;\r\n\r\n// Attributes\r\nattribute vec3 position;\r\nattribute vec4 normal;\r\n\r\n// Uniforms\r\nuniform mat4 worldViewProjection;\r\n\r\nuniform float width;\r\nuniform float aspectRatio;\r\n\r\nvoid main(void) {\r\n\tvec4 viewPosition = worldViewProjection * vec4(position, 1.0);\r\n\tvec4 viewPositionNext = worldViewProjection * vec4(normal.xyz, 1.0);\r\n\r\n\tvec2 currentScreen = viewPosition.xy / viewPosition.w;\r\n\tvec2 nextScreen = viewPositionNext.xy / viewPositionNext.w;\r\n\r\n\tcurrentScreen.x *= aspectRatio;\r\n\tnextScreen.x *= aspectRatio;\r\n\r\n\tvec2 dir = normalize(nextScreen - currentScreen);\r\n\tvec2 normalDir = vec2(-dir.y, dir.x);\r\n\r\n\tnormalDir *= width / 2.0;\r\n\tnormalDir.x /= aspectRatio;\r\n\r\n\tvec4 offset = vec4(normalDir * normal.w, 0.0, 0.0);\r\n\tgl_Position = viewPosition + offset;\r\n}","marblePixelShader":"precision highp float;\r\n\r\nvarying vec2 vPosition;\r\nvarying vec2 vUV;\r\n\r\nuniform float numberOfTilesHeight;\r\nuniform float numberOfTilesWidth;\r\nuniform float amplitude;\r\nuniform vec3 brickColor;\r\nuniform vec3 jointColor;\r\n\r\nconst vec3 tileSize = vec3(1.1, 1.0, 1.1);\r\nconst vec3 tilePct = vec3(0.98, 1.0, 0.98);\r\n\r\nfloat rand(vec2 n) {\r\n\treturn fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\r\n}\r\n\r\nfloat noise(vec2 n) {\r\n\tconst vec2 d = vec2(0.0, 1.0);\r\n\tvec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\r\n\treturn mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\r\n}\r\n\r\nfloat turbulence(vec2 P)\r\n{\r\n\tfloat val = 0.0;\r\n\tfloat freq = 1.0;\r\n\tfor (int i = 0; i < 4; i++)\r\n\t{\r\n\t\tval += abs(noise(P*freq) / freq);\r\n\t\tfreq *= 2.07;\r\n\t}\r\n\treturn val;\r\n}\r\n\r\nfloat round(float number){\r\n\treturn sign(number)*floor(abs(number) + 0.5);\r\n}\r\n\r\nvec3 marble_color(float x)\r\n{\r\n\tvec3 col;\r\n\tx = 0.5*(x + 1.);\r\n\tx = sqrt(x); \r\n\tx = sqrt(x);\r\n\tx = sqrt(x);\r\n\tcol = vec3(.2 + .75*x); \r\n\tcol.b *= 0.95; \r\n\treturn col;\r\n}\r\n\r\nvoid main()\r\n{\r\n\tfloat brickW = 1.0 / numberOfTilesWidth;\r\n\tfloat brickH = 1.0 / numberOfTilesHeight;\r\n\tfloat jointWPercentage = 0.01;\r\n\tfloat jointHPercentage = 0.01;\r\n\tvec3 color = brickColor;\r\n\tfloat yi = vUV.y / brickH;\r\n\tfloat nyi = round(yi);\r\n\tfloat xi = vUV.x / brickW;\r\n\r\n\tif (mod(floor(yi), 2.0) == 0.0){\r\n\t\txi = xi - 0.5;\r\n\t}\r\n\r\n\tfloat nxi = round(xi);\r\n\tvec2 brickvUV = vec2((xi - floor(xi)) / brickH, (yi - floor(yi)) / brickW);\r\n\r\n\tif (yi < nyi + jointHPercentage && yi > nyi - jointHPercentage){\r\n\t\tcolor = mix(jointColor, vec3(0.37, 0.25, 0.25), (yi - nyi) / jointHPercentage + 0.2);\r\n\t}\r\n\telse if (xi < nxi + jointWPercentage && xi > nxi - jointWPercentage){\r\n\t\tcolor = mix(jointColor, vec3(0.44, 0.44, 0.44), (xi - nxi) / jointWPercentage + 0.2);\r\n\t}\r\n\telse {\r\n\t\tfloat t = 6.28 * brickvUV.x / (tileSize.x + noise(vec2(vUV)*6.0));\r\n\t\tt += amplitude * turbulence(brickvUV.xy);\r\n\t\tt = sin(t);\r\n\t\tcolor = marble_color(t);\r\n\t}\r\n\r\n\tgl_FragColor = vec4(color, 0.0);\r\n}","outlinePixelShader":"precision highp float;\r\n\r\nuniform vec4 color;\r\n\r\n#ifdef ALPHATEST\r\nvarying vec2 vUV;\r\nuniform sampler2D diffuseSampler;\r\n#endif\r\n\r\nvoid main(void) {\r\n#ifdef ALPHATEST\r\n\tif (texture2D(diffuseSampler, vUV).a < 0.4)\r\n\t\tdiscard;\r\n#endif\r\n\r\n\tgl_FragColor = color;\r\n}","outlineVertexShader":"precision highp float;\r\n\r\n// Attribute\r\nattribute vec3 position;\r\nattribute vec3 normal;\r\n\r\n#ifdef BONES\r\nattribute vec4 matricesIndices;\r\nattribute vec4 matricesWeights;\r\n#endif\r\n\r\n// Uniform\r\nuniform float offset;\r\n\r\n#ifdef INSTANCES\r\nattribute vec4 world0;\r\nattribute vec4 world1;\r\nattribute vec4 world2;\r\nattribute vec4 world3;\r\n#else\r\nuniform mat4 world;\r\n#endif\r\n\r\nuniform mat4 viewProjection;\r\n#ifdef BONES\r\nuniform mat4 mBones[BonesPerMesh];\r\n#endif\r\n\r\n#ifdef ALPHATEST\r\nvarying vec2 vUV;\r\nuniform mat4 diffuseMatrix;\r\n#ifdef UV1\r\nattribute vec2 uv;\r\n#endif\r\n#ifdef UV2\r\nattribute vec2 uv2;\r\n#endif\r\n#endif\r\n\r\nvoid main(void)\r\n{\r\n#ifdef INSTANCES\r\n\tmat4 finalWorld = mat4(world0, world1, world2, world3);\r\n#else\r\n\tmat4 finalWorld = world;\r\n#endif\r\n\r\n\tvec3 offsetPosition = position + normal * offset;\r\n\r\n#ifdef BONES\r\n\tmat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\r\n\tmat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\r\n\tmat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\r\n\tmat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\r\n\tfinalWorld = finalWorld * (m0 + m1 + m2 + m3);\r\n\tgl_Position = viewProjection * finalWorld * vec4(offsetPosition, 1.0);\r\n#else\r\n\tgl_Position = viewProjection * finalWorld * vec4(offsetPosition, 1.0);\r\n#endif\r\n\r\n#ifdef ALPHATEST\r\n#ifdef UV1\r\n\tvUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\r\n#endif\r\n#ifdef UV2\r\n\tvUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\r\n#endif\r\n#endif\r\n}","particlesPixelShader":"precision highp float;\r\n\r\n// Samplers\r\nvarying vec2 vUV;\r\nvarying vec4 vColor;\r\nuniform vec4 textureMask;\r\nuniform sampler2D diffuseSampler;\r\n\r\n#ifdef CLIPPLANE\r\nvarying float fClipDistance;\r\n#endif\r\n\r\nvoid main(void) {\r\n#ifdef CLIPPLANE\r\n\tif (fClipDistance > 0.0)\r\n\t\tdiscard;\r\n#endif\r\n\tvec4 baseColor = texture2D(diffuseSampler, vUV);\r\n\r\n\tgl_FragColor = (baseColor * textureMask + (vec4(1., 1., 1., 1.) - textureMask)) * vColor;\r\n}","particlesVertexShader":"precision highp float;\r\n\r\n// Attributes\r\nattribute vec3 position;\r\nattribute vec4 color;\r\nattribute vec4 options;\r\n\r\n// Uniforms\r\nuniform mat4 view;\r\nuniform mat4 projection;\r\n\r\n// Output\r\nvarying vec2 vUV;\r\nvarying vec4 vColor;\r\n\r\n#ifdef CLIPPLANE\r\nuniform vec4 vClipPlane;\r\nuniform mat4 invView;\r\nvarying float fClipDistance;\r\n#endif\r\n\r\nvoid main(void) {\t\r\n\tvec3 viewPos = (view * vec4(position, 1.0)).xyz; \r\n\tvec3 cornerPos;\r\n\tfloat size = options.y;\r\n\tfloat angle = options.x;\r\n\tvec2 offset = options.zw;\r\n\r\n\tcornerPos = vec3(offset.x - 0.5, offset.y - 0.5, 0.) * size;\r\n\r\n\t// Rotate\r\n\tvec3 rotatedCorner;\r\n\trotatedCorner.x = cornerPos.x * cos(angle) - cornerPos.y * sin(angle);\r\n\trotatedCorner.y = cornerPos.x * sin(angle) + cornerPos.y * cos(angle);\r\n\trotatedCorner.z = 0.;\r\n\r\n\t// Position\r\n\tviewPos += rotatedCorner;\r\n\tgl_Position = projection * vec4(viewPos, 1.0); \r\n\t\r\n\tvColor = color;\r\n\tvUV = offset;\r\n\r\n\t// Clip plane\r\n#ifdef CLIPPLANE\r\n\tvec4 worldPos = invView * vec4(viewPos, 1.0);\r\n\tfClipDistance = dot(worldPos, vClipPlane);\r\n#endif\r\n}","passPixelShader":"precision highp float;\r\n\r\n// Samplers\r\nvarying vec2 vUV;\r\nuniform sampler2D textureSampler;\r\n\r\nvoid main(void) \r\n{\r\n\tgl_FragColor = texture2D(textureSampler, vUV);\r\n}","pbrPixelShader":"precision highp float;\r\n\r\n// Constants\r\nuniform vec3 vEyePosition;\r\nuniform vec4 vAlbedoColor;\r\n\r\n// Input\r\nvarying vec3 vPositionW;\r\n\r\n#ifdef NORMAL\r\nvarying vec3 vNormalW;\r\n#endif\r\n\r\n#ifdef VERTEXCOLOR\r\nvarying vec4 vColor;\r\n#endif\r\n\r\n#ifdef CLIPPLANE\r\nvarying float fClipDistance;\r\n#endif\r\n\r\n// Fog\r\n#ifdef FOG\r\n\r\n#define FOGMODE_NONE 0.\r\n#define FOGMODE_EXP 1.\r\n#define FOGMODE_EXP2 2.\r\n#define FOGMODE_LINEAR 3.\r\n#define E 2.71828\r\n\r\nuniform vec4 vFogInfos;\r\nuniform vec3 vFogColor;\r\nvarying float fFogDistance;\r\n\r\nfloat CalcFogFactor()\r\n{\r\n\tfloat fogCoeff = 1.0;\r\n\tfloat fogStart = vFogInfos.y;\r\n\tfloat fogEnd = vFogInfos.z;\r\n\tfloat fogDensity = vFogInfos.w;\r\n\r\n\tif (FOGMODE_LINEAR == vFogInfos.x)\r\n\t{\r\n\t\tfogCoeff = (fogEnd - fFogDistance) / (fogEnd - fogStart);\r\n\t}\r\n\telse if (FOGMODE_EXP == vFogInfos.x)\r\n\t{\r\n\t\tfogCoeff = 1.0 / pow(E, fFogDistance * fogDensity);\r\n\t}\r\n\telse if (FOGMODE_EXP2 == vFogInfos.x)\r\n\t{\r\n\t\tfogCoeff = 1.0 / pow(E, fFogDistance * fFogDistance * fogDensity * fogDensity);\r\n\t}\r\n\r\n\treturn clamp(fogCoeff, 0.0, 1.0);\r\n}\r\n#endif\r\n\r\nvoid main(void) {\r\n\t// Clip plane\r\n#ifdef CLIPPLANE\r\n\tif (fClipDistance > 0.0)\r\n\t\tdiscard;\r\n#endif\r\n\r\n\tvec3 viewDirectionW = normalize(vEyePosition - vPositionW);\r\n\r\n\t// Base color\r\n\tvec3 baseColor = vAlbedoColor.rgb;\r\n\r\n\t// Alpha\r\n\tfloat alpha = vAlbedoColor.a;\r\n\r\n#ifdef VERTEXCOLOR\r\n\tbaseColor *= vColor.rgb;\r\n#endif\r\n\r\n#ifdef VERTEXALPHA\r\n\talpha *= vColor.a;\r\n#endif\r\n\r\n\t// Composition\r\n vec4 color = vec4(clamp(baseColor, 0.0, 1.0), alpha);\r\n\r\n#ifdef FOG\r\n\tfloat fog = CalcFogFactor();\r\n\tcolor.rgb = fog * color.rgb + (1.0 - fog) * vFogColor;\r\n#endif\r\n\r\n\tgl_FragColor = color;\r\n}","pbrVertexShader":"precision highp float;\r\n\r\n// Attributes\r\nattribute vec3 position;\r\n#ifdef NORMAL\r\nattribute vec3 normal;\r\n#endif\r\n#ifdef UV1\r\nattribute vec2 uv;\r\n#endif\r\n#ifdef UV2\r\nattribute vec2 uv2;\r\n#endif\r\n#ifdef VERTEXCOLOR\r\nattribute vec4 color;\r\n#endif\r\n#ifdef BONES\r\nattribute vec4 matricesIndices;\r\nattribute vec4 matricesWeights;\r\n#endif\r\n\r\n// Uniforms\r\n#ifdef INSTANCES\r\nattribute vec4 world0;\r\nattribute vec4 world1;\r\nattribute vec4 world2;\r\nattribute vec4 world3;\r\n#else\r\nuniform mat4 world;\r\n#endif\r\n\r\nuniform mat4 view;\r\nuniform mat4 viewProjection;\r\n\r\n#ifdef BONES\r\nuniform mat4 mBones[BonesPerMesh];\r\n#endif\r\n\r\n#ifdef POINTSIZE\r\nuniform float pointSize;\r\n#endif\r\n\r\n// Output\r\nvarying vec3 vPositionW;\r\n#ifdef NORMAL\r\nvarying vec3 vNormalW;\r\n#endif\r\n\r\n#ifdef VERTEXCOLOR\r\nvarying vec4 vColor;\r\n#endif\r\n\r\n#ifdef CLIPPLANE\r\nuniform vec4 vClipPlane;\r\nvarying float fClipDistance;\r\n#endif\r\n\r\n#ifdef FOG\r\nvarying float fFogDistance;\r\n#endif\r\n\r\nvoid main(void) {\r\n\tmat4 finalWorld;\r\n\r\n#ifdef INSTANCES\r\n\tfinalWorld = mat4(world0, world1, world2, world3);\r\n#else\r\n\tfinalWorld = world;\r\n#endif\r\n\r\n#ifdef BONES\r\n\tmat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\r\n\tmat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\r\n\tmat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\r\n\r\n#ifdef BONES4\r\n\tmat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\r\n\tfinalWorld = finalWorld * (m0 + m1 + m2 + m3);\r\n#else\r\n\tfinalWorld = finalWorld * (m0 + m1 + m2);\r\n#endif \r\n\r\n#endif\r\n\tgl_Position = viewProjection * finalWorld * vec4(position, 1.0);\r\n\r\n\tvec4 worldPos = finalWorld * vec4(position, 1.0);\r\n\tvPositionW = vec3(worldPos);\r\n\r\n#ifdef NORMAL\r\n\tvNormalW = normalize(vec3(finalWorld * vec4(normal, 0.0)));\r\n#endif\r\n\r\n\t// Texture coordinates\r\n#ifndef UV1\r\n\tvec2 uv = vec2(0., 0.);\r\n#endif\r\n#ifndef UV2\r\n\tvec2 uv2 = vec2(0., 0.);\r\n#endif\r\n\r\n\t// Clip plane\r\n#ifdef CLIPPLANE\r\n\tfClipDistance = dot(worldPos, vClipPlane);\r\n#endif\r\n\r\n\t// Fog\r\n#ifdef FOG\r\n\tfFogDistance = (view * worldPos).z;\r\n#endif\r\n\r\n\t// Vertex color\r\n#ifdef VERTEXCOLOR\r\n\tvColor = color;\r\n#endif\r\n\r\n\t// Point size\r\n#ifdef POINTSIZE\r\n\tgl_PointSize = pointSize;\r\n#endif\r\n}","postprocessVertexShader":"precision highp float;\r\n\r\n// Attributes\r\nattribute vec2 position;\r\n\r\n// Output\r\nvarying vec2 vUV;\r\n\r\nconst vec2 madd = vec2(0.5, 0.5);\r\n\r\nvoid main(void) {\t\r\n\r\n\tvUV = position * madd + madd;\r\n\tgl_Position = vec4(position, 0.0, 1.0);\r\n}","proceduralVertexShader":"precision highp float;\r\n\r\n// Attributes\r\nattribute vec2 position;\r\n\r\n// Output\r\nvarying vec2 vPosition;\r\nvarying vec2 vUV;\r\n\r\nconst vec2 madd = vec2(0.5, 0.5);\r\n\r\nvoid main(void) {\t\r\n\tvPosition = position;\r\n\tvUV = position * madd + madd;\r\n\tgl_Position = vec4(position, 0.0, 1.0);\r\n}","refractionPixelShader":"precision highp float;\r\n\r\n// Samplers\r\nvarying vec2 vUV;\r\nuniform sampler2D textureSampler;\r\nuniform sampler2D refractionSampler;\r\n\r\n// Parameters\r\nuniform vec3 baseColor;\r\nuniform float depth;\r\nuniform float colorLevel;\r\n\r\nvoid main() {\r\n\tfloat ref = 1.0 - texture2D(refractionSampler, vUV).r;\r\n\r\n\tvec2 uv = vUV - vec2(0.5);\r\n\tvec2 offset = uv * depth * ref;\r\n\tvec3 sourceColor = texture2D(textureSampler, vUV - offset).rgb;\r\n\r\n\tgl_FragColor = vec4(sourceColor + sourceColor * ref * colorLevel, 1.0);\r\n}","roadPixelShader":"precision highp float;\r\n\r\nvarying vec2 vUV; \r\nuniform vec3 roadColor;\r\n\r\nfloat rand(vec2 n) {\r\n\treturn fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\r\n}\r\n\r\nfloat noise(vec2 n) {\r\n\tconst vec2 d = vec2(0.0, 1.0);\r\n\tvec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\r\n\treturn mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\r\n}\r\n\r\nfloat fbm(vec2 n) {\r\n\tfloat total = 0.0, amplitude = 1.0;\r\n\tfor (int i = 0; i < 4; i++) {\r\n\t\ttotal += noise(n) * amplitude;\r\n\t\tn += n;\r\n\t\tamplitude *= 0.5;\r\n\t}\r\n\treturn total;\r\n}\r\n\r\nvoid main(void) {\r\n\tfloat ratioy = mod(gl_FragCoord.y * 100.0 , fbm(vUV * 2.0));\r\n\tvec3 color = roadColor * ratioy;\r\n\tgl_FragColor = vec4(color, 1.0);\r\n}","shadowMapPixelShader":"precision highp float;\r\n\r\nvec4 pack(float depth)\r\n{\r\n\tconst vec4 bit_shift = vec4(255.0 * 255.0 * 255.0, 255.0 * 255.0, 255.0, 1.0);\r\n\tconst vec4 bit_mask = vec4(0.0, 1.0 / 255.0, 1.0 / 255.0, 1.0 / 255.0);\r\n\r\n\tvec4 res = fract(depth * bit_shift);\r\n\tres -= res.xxyz * bit_mask;\r\n\r\n\treturn res;\r\n}\r\n\r\n// Thanks to http://devmaster.net/\r\nvec2 packHalf(float depth) \r\n{ \r\n\tconst vec2 bitOffset = vec2(1.0 / 255., 0.);\r\n\tvec2 color = vec2(depth, fract(depth * 255.));\r\n\r\n\treturn color - (color.yy * bitOffset);\r\n}\r\n\r\nvarying vec4 vPosition;\r\n\r\n#ifdef ALPHATEST\r\nvarying vec2 vUV;\r\nuniform sampler2D diffuseSampler;\r\n#endif\r\n\r\nvoid main(void)\r\n{\r\n#ifdef ALPHATEST\r\n\tif (texture2D(diffuseSampler, vUV).a < 0.4)\r\n\t\tdiscard;\r\n#endif\r\n\tfloat depth = vPosition.z / vPosition.w;\r\n\tdepth = depth * 0.5 + 0.5;\r\n\r\n#ifdef VSM\r\n\tfloat moment1 = depth;\r\n\tfloat moment2 = moment1 * moment1;\r\n\r\n\tgl_FragColor = vec4(packHalf(moment1), packHalf(moment2));\r\n#else\r\n\tgl_FragColor = pack(depth);\r\n#endif\r\n}","shadowMapVertexShader":"precision highp float;\r\n\r\n// Attribute\r\nattribute vec3 position;\r\n#ifdef BONES\r\nattribute vec4 matricesIndices;\r\nattribute vec4 matricesWeights;\r\n#endif\r\n\r\n// Uniform\r\n#ifdef INSTANCES\r\nattribute vec4 world0;\r\nattribute vec4 world1;\r\nattribute vec4 world2;\r\nattribute vec4 world3;\r\n#else\r\nuniform mat4 world;\r\n#endif\r\n\r\nuniform mat4 viewProjection;\r\n#ifdef BONES\r\nuniform mat4 mBones[BonesPerMesh];\r\n#endif\r\n\r\nvarying vec4 vPosition;\r\n\r\n#ifdef ALPHATEST\r\nvarying vec2 vUV;\r\nuniform mat4 diffuseMatrix;\r\n#ifdef UV1\r\nattribute vec2 uv;\r\n#endif\r\n#ifdef UV2\r\nattribute vec2 uv2;\r\n#endif\r\n#endif\r\n\r\nvoid main(void)\r\n{\r\n#ifdef INSTANCES\r\n\tmat4 finalWorld = mat4(world0, world1, world2, world3);\r\n#else\r\n\tmat4 finalWorld = world;\r\n#endif\r\n\r\n#ifdef BONES\r\n\tmat4 m0 = mBones[int(matricesIndices.x)] * matricesWeights.x;\r\n\tmat4 m1 = mBones[int(matricesIndices.y)] * matricesWeights.y;\r\n\tmat4 m2 = mBones[int(matricesIndices.z)] * matricesWeights.z;\r\n\tmat4 m3 = mBones[int(matricesIndices.w)] * matricesWeights.w;\r\n\tfinalWorld = finalWorld * (m0 + m1 + m2 + m3);\r\n#endif\r\n\r\n\tvPosition = viewProjection * finalWorld * vec4(position, 1.0);\r\n\tgl_Position = vPosition;\r\n\r\n#ifdef ALPHATEST\r\n#ifdef UV1\r\n\tvUV = vec2(diffuseMatrix * vec4(uv, 1.0, 0.0));\r\n#endif\r\n#ifdef UV2\r\n\tvUV = vec2(diffuseMatrix * vec4(uv2, 1.0, 0.0));\r\n#endif\r\n#endif\r\n}","spritesPixelShader":"precision highp float;\r\n\r\nuniform bool alphaTest;\r\n\r\nvarying vec4 vColor;\r\n\r\n// Samplers\r\nvarying vec2 vUV;\r\nuniform sampler2D diffuseSampler;\r\n\r\n// Fog\r\n#ifdef FOG\r\n\r\n#define FOGMODE_NONE 0.\r\n#define FOGMODE_EXP 1.\r\n#define FOGMODE_EXP2 2.\r\n#define FOGMODE_LINEAR 3.\r\n#define E 2.71828\r\n\r\nuniform vec4 vFogInfos;\r\nuniform vec3 vFogColor;\r\nvarying float fFogDistance;\r\n\r\nfloat CalcFogFactor()\r\n{\r\n\tfloat fogCoeff = 1.0;\r\n\tfloat fogStart = vFogInfos.y;\r\n\tfloat fogEnd = vFogInfos.z;\r\n\tfloat fogDensity = vFogInfos.w;\r\n\r\n\tif (FOGMODE_LINEAR == vFogInfos.x)\r\n\t{\r\n\t\tfogCoeff = (fogEnd - fFogDistance) / (fogEnd - fogStart);\r\n\t}\r\n\telse if (FOGMODE_EXP == vFogInfos.x)\r\n\t{\r\n\t\tfogCoeff = 1.0 / pow(E, fFogDistance * fogDensity);\r\n\t}\r\n\telse if (FOGMODE_EXP2 == vFogInfos.x)\r\n\t{\r\n\t\tfogCoeff = 1.0 / pow(E, fFogDistance * fFogDistance * fogDensity * fogDensity);\r\n\t}\r\n\r\n\treturn min(1., max(0., fogCoeff));\r\n}\r\n#endif\r\n\r\n\r\nvoid main(void) {\r\n\tvec4 baseColor = texture2D(diffuseSampler, vUV);\r\n\r\n\tif (alphaTest) \r\n\t{\r\n\t\tif (baseColor.a < 0.95)\r\n\t\t\tdiscard;\r\n\t}\r\n\r\n\tbaseColor *= vColor;\r\n\r\n#ifdef FOG\r\n\tfloat fog = CalcFogFactor();\r\n\tbaseColor.rgb = fog * baseColor.rgb + (1.0 - fog) * vFogColor;\r\n#endif\r\n\r\n\tgl_FragColor = baseColor;\r\n}","spritesVertexShader":"precision highp float;\r\n\r\n// Attributes\r\nattribute vec4 position;\r\nattribute vec4 options;\r\nattribute vec4 cellInfo;\r\nattribute vec4 color;\r\n\r\n// Uniforms\r\nuniform vec2 textureInfos;\r\nuniform mat4 view;\r\nuniform mat4 projection;\r\n\r\n// Output\r\nvarying vec2 vUV;\r\nvarying vec4 vColor;\r\n\r\n#ifdef FOG\r\nvarying float fFogDistance;\r\n#endif\r\n\r\nvoid main(void) {\t\r\n\tvec3 viewPos = (view * vec4(position.xyz, 1.0)).xyz; \r\n\tvec2 cornerPos;\r\n\t\r\n\tfloat angle = position.w;\r\n\tvec2 size = vec2(options.x, options.y);\r\n\tvec2 offset = options.zw;\r\n\tvec2 uvScale = textureInfos.xy;\r\n\r\n\tcornerPos = vec2(offset.x - 0.5, offset.y - 0.5) * size;\r\n\r\n\t// Rotate\r\n\tvec3 rotatedCorner;\r\n\trotatedCorner.x = cornerPos.x * cos(angle) - cornerPos.y * sin(angle);\r\n\trotatedCorner.y = cornerPos.x * sin(angle) + cornerPos.y * cos(angle);\r\n\trotatedCorner.z = 0.;\r\n\r\n\t// Position\r\n\tviewPos += rotatedCorner;\r\n\tgl_Position = projection * vec4(viewPos, 1.0); \r\n\r\n\t// Color\r\n\tvColor = color;\r\n\t\r\n\t// Texture\r\n\tvec2 uvOffset = vec2(abs(offset.x - cellInfo.x), 1.0 - abs(offset.y - cellInfo.y));\r\n\r\n\tvUV = (uvOffset + cellInfo.zw) * uvScale;\r\n\r\n\t// Fog\r\n#ifdef FOG\r\n\tfFogDistance = viewPos.z;\r\n#endif\r\n}","ssaoPixelShader":"precision highp float;\r\n\r\n#define SAMPLES 16\r\n\r\nuniform sampler2D textureSampler;\r\nuniform sampler2D randomSampler;\r\n\r\nuniform float randTextureTiles;\r\nuniform float samplesFactor;\r\nuniform vec3 sampleSphere[16];\r\n\r\nuniform float totalStrength;\r\nuniform float radius;\r\nuniform float area;\r\nuniform float fallOff;\r\n\r\nvarying vec2 vUV;\r\n\r\nconst vec2 offset1 = vec2(0.0, 0.001);\r\nconst vec2 offset2 = vec2(0.001, 0.0);\r\n\r\nvec3 normalFromDepth(const float depth, const vec2 coords) {\r\n\tfloat depth1 = texture2D(textureSampler, coords + offset1).r;\r\n\tfloat depth2 = texture2D(textureSampler, coords + offset2).r;\r\n\r\n vec3 p1 = vec3(offset1, depth1 - depth);\r\n vec3 p2 = vec3(offset2, depth2 - depth);\r\n\r\n vec3 normal = cross(p1, p2);\r\n normal.z = -normal.z;\r\n\r\n return normalize(normal);\r\n}\r\n\r\nvoid main(void)\r\n{\r\n\tconst float base = 0.2;\r\n\r\n\tvec3 random = texture2D(randomSampler, vUV * randTextureTiles).rgb;\r\n\tfloat depth = texture2D(textureSampler, vUV).r;\r\n\tvec3 position = vec3(vUV, depth);\r\n\tvec3 normal = normalFromDepth(depth, vUV);\r\n\tfloat radiusDepth = radius / depth;\r\n\tfloat occlusion = 0.0;\r\n\r\n\tvec3 ray;\r\n\tvec3 hemiRay;\r\n\tfloat occlusionDepth;\r\n\tfloat difference;\r\n\r\n\tfor (int i = 0; i < SAMPLES; i++)\r\n\t{\r\n\t\tray = radiusDepth * reflect(sampleSphere[i], random);\r\n\t\themiRay = position + sign(dot(ray, normal)) * ray;\r\n\r\n\t\tocclusionDepth = texture2D(textureSampler, clamp(hemiRay.xy, 0.0, 1.0)).r;\r\n\t\tdifference = depth - occlusionDepth;\r\n\r\n\t\tocclusion += step(fallOff, difference) * (1.0 - smoothstep(fallOff, area, difference));\r\n\t}\r\n\r\n\tfloat ao = 1.0 - totalStrength * occlusion * samplesFactor;\r\n\r\n\tfloat result = clamp(ao + base, 0.0, 1.0);\r\n\tgl_FragColor.r = result;\r\n\tgl_FragColor.g = result;\r\n\tgl_FragColor.b = result;\r\n\tgl_FragColor.a = 1.0;\r\n}\r\n","ssaoCombinePixelShader":"precision highp float;\r\n\r\nuniform sampler2D textureSampler;\r\nuniform sampler2D originalColor;\r\n\r\nvarying vec2 vUV;\r\n\r\nvoid main(void) {\r\n\tgl_FragColor = texture2D(originalColor, vUV) * texture2D(textureSampler, vUV);\r\n}\r\n","stereoscopicInterlacePixelShader":"precision highp float;\r\n\r\nconst vec3 TWO = vec3(2.0, 2.0, 2.0);\r\n\r\nvarying vec2 vUV;\r\nuniform sampler2D camASampler;\r\nuniform sampler2D textureSampler;\r\nuniform vec2 stepSize;\r\n\r\nvoid main(void)\r\n{\r\n bool useCamB;\r\n vec2 texCoord1;\r\n vec2 texCoord2;\r\n \r\n vec3 frag1;\r\n vec3 frag2;\r\n \r\n#ifdef IS_STEREOSCOPIC_HORIZ\r\n\t useCamB = vUV.x > 0.5;\r\n\t texCoord1 = vec2(useCamB ? (vUV.x - 0.5) * 2.0 : vUV.x * 2.0, vUV.y);\r\n\t texCoord2 = vec2(texCoord1.x + stepSize.x, vUV.y);\r\n#else\r\n\t useCamB = vUV.y > 0.5;\r\n\t texCoord1 = vec2(vUV.x, useCamB ? (vUV.y - 0.5) * 2.0 : vUV.y * 2.0);\r\n\t texCoord2 = vec2(vUV.x, texCoord1.y + stepSize.y);\r\n#endif\r\n \r\n // cannot assign a sampler to a variable, so must duplicate texture accesses\r\n if (useCamB){\r\n frag1 = texture2D(textureSampler, texCoord1).rgb;\r\n frag2 = texture2D(textureSampler, texCoord2).rgb;\r\n }else{\r\n frag1 = texture2D(camASampler , texCoord1).rgb;\r\n frag2 = texture2D(camASampler , texCoord2).rgb;\r\n }\r\n \r\n gl_FragColor = vec4((frag1 + frag2) / TWO, 1.0);\r\n}","tonemapPixelShader":"precision highp float;\r\n\r\n// Samplers\r\nvarying vec2 vUV;\r\nuniform sampler2D textureSampler;\r\n\r\n// Constants\r\nuniform float _ExposureAdjustment;\r\n\r\n#if defined(HABLE_TONEMAPPING)\r\n const float A = 0.15;\r\n const float B = 0.50;\r\n const float C = 0.10;\r\n const float D = 0.20;\r\n const float E = 0.02;\r\n const float F = 0.30;\r\n const float W = 11.2;\r\n#endif\r\n\r\nfloat Luminance(vec3 c)\r\n{\r\n return dot(c, vec3(0.22, 0.707, 0.071));\r\n}\r\n\r\nvoid main(void) \r\n{\r\n vec3 colour = texture2D(textureSampler, vUV).rgb;\r\n\r\n#if defined(REINHARD_TONEMAPPING)\r\n\r\n float lum = Luminance(colour.rgb); \r\n float lumTm = lum * _ExposureAdjustment;\r\n float scale = lumTm / (1.0 + lumTm); \r\n\r\n colour *= scale / lum;\r\n\r\n#elif defined(HABLE_TONEMAPPING)\r\n\r\n colour *= _ExposureAdjustment;\r\n\r\n const float ExposureBias = 2.0;\r\n vec3 x = ExposureBias * colour;\r\n\r\n vec3 curr = ((x * (A * x + C * B) + D * E) / (x * (A * x + B) + D * F)) - E / F;\r\n \r\n x = vec3(W, W, W);\r\n vec3 whiteScale = 1.0 / (((x * (A * x + C * B) + D * E) / (x * (A * x + B) + D * F)) - E / F);\r\n colour = curr * whiteScale;\r\n\r\n#elif defined(OPTIMIZED_HEJIDAWSON_TONEMAPPING)\r\n\r\n colour *= _ExposureAdjustment;\r\n \r\n vec3 X = max(vec3(0.0, 0.0, 0.0), colour - 0.004);\r\n vec3 retColor = (X * (6.2 * X + 0.5)) / (X * (6.2 * X + 1.7) + 0.06);\r\n\r\n colour = retColor * retColor;\r\n\r\n#elif defined(PHOTOGRAPHIC_TONEMAPPING)\r\n\r\n colour = vec3(1.0, 1.0, 1.0) - exp2(-_ExposureAdjustment * colour);\r\n\r\n#endif\r\n\r\n\tgl_FragColor = vec4(colour.rgb, 1.0);\r\n}","volumetricLightScatteringPixelShader":"precision highp float;\r\n\r\nuniform sampler2D textureSampler;\r\nuniform sampler2D lightScatteringSampler;\r\n\r\nuniform float decay;\r\nuniform float exposure;\r\nuniform float weight;\r\nuniform float density;\r\nuniform vec2 meshPositionOnScreen;\r\n\r\nvarying vec2 vUV;\r\n\r\nvoid main(void) {\r\n vec2 tc = vUV;\r\n\tvec2 deltaTexCoord = (tc - meshPositionOnScreen.xy);\r\n deltaTexCoord *= 1.0 / float(NUM_SAMPLES) * density;\r\n\r\n float illuminationDecay = 1.0;\r\n\r\n\tvec4 color = texture2D(lightScatteringSampler, tc) * 0.4;\r\n\r\n for(int i=0; i < NUM_SAMPLES; i++) {\r\n tc -= deltaTexCoord;\r\n\t\tvec4 sample = texture2D(lightScatteringSampler, tc) * 0.4;\r\n sample *= illuminationDecay * weight;\r\n color += sample;\r\n illuminationDecay *= decay;\r\n }\r\n\r\n vec4 realColor = texture2D(textureSampler, vUV);\r\n gl_FragColor = ((vec4((vec3(color.r, color.g, color.b) * exposure), 1)) + (realColor * (1.5 - 0.4)));\r\n}\r\n","volumetricLightScatteringPassPixelShader":"precision highp float;\r\n\r\n#if defined(ALPHATEST) || defined(NEED_UV)\r\nvarying vec2 vUV;\r\n#endif\r\n\r\n#if defined(ALPHATEST) || defined(BASIC_RENDER)\r\nuniform sampler2D diffuseSampler;\r\n#endif\r\n\r\n#if defined(DIFFUSE_COLOR_RENDER)\r\nuniform vec3 color;\r\n#endif\r\n\r\n#if defined(OPACITY)\r\nuniform sampler2D opacitySampler;\r\nuniform float opacityLevel;\r\n#endif\r\n\r\nvoid main(void)\r\n{\r\n#if defined(ALPHATEST) || defined(BASIC_RENDER)\r\n\tvec4 diffuseColor = texture2D(diffuseSampler, vUV);\r\n#endif\r\n\r\n#ifdef ALPHATEST\r\n\tif (diffuseColor.a < 0.4)\r\n\t\tdiscard;\r\n#endif\r\n\r\n#ifdef OPACITY\r\n\tvec4 opacityColor = texture2D(opacitySampler, vUV);\r\n\tfloat alpha = 1.0;\r\n\r\n\t#ifdef OPACITYRGB\r\n\topacityColor.rgb = opacityColor.rgb * vec3(0.3, 0.59, 0.11);\r\n\talpha *= (opacityColor.x + opacityColor.y + opacityColor.z) * opacityLevel;\r\n\t#else\r\n\talpha *= opacityColor.a * opacityLevel;\r\n\t#endif\r\n\r\n\t#if defined(BASIC_RENDER)\r\n\tgl_FragColor = vec4(diffuseColor.rgb, alpha);\r\n\t#elif defined(DIFFUSE_COLOR_RENDER)\r\n\tgl_FragColor = vec4(color.rgb, alpha);\r\n\t#else\r\n\tgl_FragColor = vec4(0.0, 0.0, 0.0, alpha);\r\n\t#endif\r\n\r\n\tgl_FragColor.a = alpha;\r\n#else\r\n\r\n\t#if defined(BASIC_RENDER)\r\n\tgl_FragColor = diffuseColor;\r\n\t#elif defined(DIFFUSE_COLOR_RENDER)\r\n\tgl_FragColor = vec4(color.rgb, 1.0);\r\n\t#else\r\n\tgl_FragColor = vec4(0.0, 0.0, 0.0, 1.0);\r\n\t#endif\r\n#endif\r\n\r\n}\r\n","vrDistortionCorrectionPixelShader":"precision highp float;\r\n\r\n// Samplers\r\nvarying vec2 vUV;\r\nuniform sampler2D textureSampler;\r\nuniform vec2 LensCenter;\r\nuniform vec2 Scale;\r\nuniform vec2 ScaleIn;\r\nuniform vec4 HmdWarpParam;\r\n\r\nvec2 HmdWarp(vec2 in01) {\r\n\r\n\tvec2 theta = (in01 - LensCenter) * ScaleIn; // Scales to [-1, 1]\r\n\tfloat rSq = theta.x * theta.x + theta.y * theta.y;\r\n\tvec2 rvector = theta * (HmdWarpParam.x + HmdWarpParam.y * rSq + HmdWarpParam.z * rSq * rSq + HmdWarpParam.w * rSq * rSq * rSq);\r\n\treturn LensCenter + Scale * rvector;\r\n}\r\n\r\nvoid main(void)\r\n{\r\n\tvec2 tc = HmdWarp(vUV);\r\n\tif (tc.x <0.0 || tc.x>1.0 || tc.y<0.0 || tc.y>1.0)\r\n\t\tgl_FragColor = vec4(0.0, 0.0, 0.0, 1.0);\r\n\telse{\r\n\t\tgl_FragColor = vec4(texture2D(textureSampler, tc).rgb, 1.0);\r\n\t}\r\n}","woodPixelShader":"precision highp float;\r\n\r\nvarying vec2 vPosition;\r\nvarying vec2 vUV;\r\n\r\nuniform float ampScale;\r\nuniform vec3 woodColor;\r\n\r\nfloat rand(vec2 n) {\r\n\treturn fract(cos(dot(n, vec2(12.9898, 4.1414))) * 43758.5453);\r\n}\r\n\r\nfloat noise(vec2 n) {\r\n\tconst vec2 d = vec2(0.0, 1.0);\r\n\tvec2 b = floor(n), f = smoothstep(vec2(0.0), vec2(1.0), fract(n));\r\n\treturn mix(mix(rand(b), rand(b + d.yx), f.x), mix(rand(b + d.xy), rand(b + d.yy), f.x), f.y);\r\n}\r\n\r\nfloat fbm(vec2 n) {\r\n\tfloat total = 0.0, amplitude = 1.0;\r\n\tfor (int i = 0; i < 4; i++) {\r\n\t\ttotal += noise(n) * amplitude;\r\n\t\tn += n;\r\n\t\tamplitude *= 0.5;\r\n\t}\r\n\treturn total;\r\n}\r\n\r\nvoid main(void) {\r\n\tfloat ratioy = mod(vUV.x * ampScale, 2.0 + fbm(vUV * 0.8));\r\n\tvec3 wood = woodColor * ratioy;\r\n\tgl_FragColor = vec4(wood, 1.0);\r\n}"};
  35779. BABYLON.CollisionWorker="var BABYLON;!function(t){var e=function(t,e,o,i){return t.x>o.x+i?!1:o.x-i>e.x?!1:t.y>o.y+i?!1:o.y-i>e.y?!1:t.z>o.z+i?!1:o.z-i>e.z?!1:!0},o=function(t,e,o,i){var s=e*e-4*t*o,r={root:0,found:!1};if(0>s)return r;var n=Math.sqrt(s),c=(-e-n)/(2*t),h=(-e+n)/(2*t);if(c>h){var a=h;h=c,c=a}return c>0&&i>c?(r.root=c,r.found=!0,r):h>0&&i>h?(r.root=h,r.found=!0,r):r},i=function(){function i(){this.radius=new t.Vector3(1,1,1),this.retry=0,this.basePointWorld=t.Vector3.Zero(),this.velocityWorld=t.Vector3.Zero(),this.normalizedVelocity=t.Vector3.Zero(),this._collisionPoint=t.Vector3.Zero(),this._planeIntersectionPoint=t.Vector3.Zero(),this._tempVector=t.Vector3.Zero(),this._tempVector2=t.Vector3.Zero(),this._tempVector3=t.Vector3.Zero(),this._tempVector4=t.Vector3.Zero(),this._edge=t.Vector3.Zero(),this._baseToVertex=t.Vector3.Zero(),this._destinationPoint=t.Vector3.Zero(),this._slidePlaneNormal=t.Vector3.Zero(),this._displacementVector=t.Vector3.Zero()}return i.prototype._initialize=function(e,o,i){this.velocity=o,t.Vector3.NormalizeToRef(o,this.normalizedVelocity),this.basePoint=e,e.multiplyToRef(this.radius,this.basePointWorld),o.multiplyToRef(this.radius,this.velocityWorld),this.velocityWorldLength=this.velocityWorld.length(),this.epsilon=i,this.collisionFound=!1},i.prototype._checkPointInTriangle=function(e,o,i,s,r){o.subtractToRef(e,this._tempVector),i.subtractToRef(e,this._tempVector2),t.Vector3.CrossToRef(this._tempVector,this._tempVector2,this._tempVector4);var n=t.Vector3.Dot(this._tempVector4,r);return 0>n?!1:(s.subtractToRef(e,this._tempVector3),t.Vector3.CrossToRef(this._tempVector2,this._tempVector3,this._tempVector4),n=t.Vector3.Dot(this._tempVector4,r),0>n?!1:(t.Vector3.CrossToRef(this._tempVector3,this._tempVector,this._tempVector4),n=t.Vector3.Dot(this._tempVector4,r),n>=0))},i.prototype._canDoCollision=function(o,i,s,r){var n=t.Vector3.Distance(this.basePointWorld,o),c=Math.max(this.radius.x,this.radius.y,this.radius.z);return n>this.velocityWorldLength+c+i?!1:e(s,r,this.basePointWorld,this.velocityWorldLength+c)?!0:!1},i.prototype._testTriangle=function(e,i,s,r,n,c){var h,a=!1;i||(i=[]),i[e]||(i[e]=new t.Plane(0,0,0,0),i[e].copyFromPoints(s,r,n));var l=i[e];if(c||l.isFrontFacingTo(this.normalizedVelocity,0)){var _=l.signedDistanceTo(this.basePoint),d=t.Vector3.Dot(l.normal,this.velocity);if(0==d){if(Math.abs(_)>=1)return;a=!0,h=0}else{h=(-1-_)/d;var V=(1-_)/d;if(h>V){var u=V;V=h,h=u}if(h>1||0>V)return;0>h&&(h=0),h>1&&(h=1)}this._collisionPoint.copyFromFloats(0,0,0);var P=!1,p=1;if(a||(this.basePoint.subtractToRef(l.normal,this._planeIntersectionPoint),this.velocity.scaleToRef(h,this._tempVector),this._planeIntersectionPoint.addInPlace(this._tempVector),this._checkPointInTriangle(this._planeIntersectionPoint,s,r,n,l.normal)&&(P=!0,p=h,this._collisionPoint.copyFrom(this._planeIntersectionPoint))),!P){var m=this.velocity.lengthSquared(),f=m;this.basePoint.subtractToRef(s,this._tempVector);var T=2*t.Vector3.Dot(this.velocity,this._tempVector),b=this._tempVector.lengthSquared()-1,y=o(f,T,b,p);y.found&&(p=y.root,P=!0,this._collisionPoint.copyFrom(s)),this.basePoint.subtractToRef(r,this._tempVector),T=2*t.Vector3.Dot(this.velocity,this._tempVector),b=this._tempVector.lengthSquared()-1,y=o(f,T,b,p),y.found&&(p=y.root,P=!0,this._collisionPoint.copyFrom(r)),this.basePoint.subtractToRef(n,this._tempVector),T=2*t.Vector3.Dot(this.velocity,this._tempVector),b=this._tempVector.lengthSquared()-1,y=o(f,T,b,p),y.found&&(p=y.root,P=!0,this._collisionPoint.copyFrom(n)),r.subtractToRef(s,this._edge),s.subtractToRef(this.basePoint,this._baseToVertex);var g=this._edge.lengthSquared(),v=t.Vector3.Dot(this._edge,this.velocity),R=t.Vector3.Dot(this._edge,this._baseToVertex);if(f=g*-m+v*v,T=g*(2*t.Vector3.Dot(this.velocity,this._baseToVertex))-2*v*R,b=g*(1-this._baseToVertex.lengthSquared())+R*R,y=o(f,T,b,p),y.found){var D=(v*y.root-R)/g;D>=0&&1>=D&&(p=y.root,P=!0,this._edge.scaleInPlace(D),s.addToRef(this._edge,this._collisionPoint))}n.subtractToRef(r,this._edge),r.subtractToRef(this.basePoint,this._baseToVertex),g=this._edge.lengthSquared(),v=t.Vector3.Dot(this._edge,this.velocity),R=t.Vector3.Dot(this._edge,this._baseToVertex),f=g*-m+v*v,T=g*(2*t.Vector3.Dot(this.velocity,this._baseToVertex))-2*v*R,b=g*(1-this._baseToVertex.lengthSquared())+R*R,y=o(f,T,b,p),y.found&&(D=(v*y.root-R)/g,D>=0&&1>=D&&(p=y.root,P=!0,this._edge.scaleInPlace(D),r.addToRef(this._edge,this._collisionPoint))),s.subtractToRef(n,this._edge),n.subtractToRef(this.basePoint,this._baseToVertex),g=this._edge.lengthSquared(),v=t.Vector3.Dot(this._edge,this.velocity),R=t.Vector3.Dot(this._edge,this._baseToVertex),f=g*-m+v*v,T=g*(2*t.Vector3.Dot(this.velocity,this._baseToVertex))-2*v*R,b=g*(1-this._baseToVertex.lengthSquared())+R*R,y=o(f,T,b,p),y.found&&(D=(v*y.root-R)/g,D>=0&&1>=D&&(p=y.root,P=!0,this._edge.scaleInPlace(D),n.addToRef(this._edge,this._collisionPoint)))}if(P){var x=p*this.velocity.length();(!this.collisionFound||x<this.nearestDistance)&&(this.intersectionPoint?this.intersectionPoint.copyFrom(this._collisionPoint):this.intersectionPoint=this._collisionPoint.clone(),this.nearestDistance=x,this.collisionFound=!0)}}},i.prototype._collide=function(t,e,o,i,s,r,n){for(var c=i;s>c;c+=3){var h=e[o[c]-r],a=e[o[c+1]-r],l=e[o[c+2]-r];this._testTriangle(c,t,l,a,h,n)}},i.prototype._getResponse=function(e,o){e.addToRef(o,this._destinationPoint),o.scaleInPlace(this.nearestDistance/o.length()),this.basePoint.addToRef(o,e),e.subtractToRef(this.intersectionPoint,this._slidePlaneNormal),this._slidePlaneNormal.normalize(),this._slidePlaneNormal.scaleToRef(this.epsilon,this._displacementVector),e.addInPlace(this._displacementVector),this.intersectionPoint.addInPlace(this._displacementVector),this._slidePlaneNormal.scaleInPlace(t.Plane.SignedDistanceToPlaneFromPositionAndNormal(this.intersectionPoint,this._slidePlaneNormal,this._destinationPoint)),this._destinationPoint.subtractInPlace(this._slidePlaneNormal),this._destinationPoint.subtractToRef(this.intersectionPoint,o)},i}();t.Collider=i}(BABYLON||(BABYLON={}));var BABYLON;!function(o){o.WorkerIncluded=!0;var e=function(){function o(){this._meshes={},this._geometries={}}return o.prototype.getMeshes=function(){return this._meshes},o.prototype.getGeometries=function(){return this._geometries},o.prototype.getMesh=function(o){return this._meshes[o]},o.prototype.addMesh=function(o){this._meshes[o.uniqueId]=o},o.prototype.removeMesh=function(o){delete this._meshes[o]},o.prototype.getGeometry=function(o){return this._geometries[o]},o.prototype.addGeometry=function(o){this._geometries[o.id]=o},o.prototype.removeGeometry=function(o){delete this._geometries[o]},o}();o.CollisionCache=e;var i=function(){function e(e,i,r){this.collider=e,this._collisionCache=i,this.finalPosition=r,this.collisionsScalingMatrix=o.Matrix.Zero(),this.collisionTranformationMatrix=o.Matrix.Zero()}return e.prototype.collideWithWorld=function(o,e,i,r){var t=.01;if(this.collider.retry>=i)return void this.finalPosition.copyFrom(o);this.collider._initialize(o,e,t);for(var s,l=this._collisionCache.getMeshes(),n=Object.keys(l),a=n.length,c=0;a>c;++c)if(s=n[c],parseInt(s)!=r){var d=l[s];d.checkCollisions&&this.checkCollision(d)}return this.collider.collisionFound?((0!==e.x||0!==e.y||0!==e.z)&&this.collider._getResponse(o,e),e.length()<=t?void this.finalPosition.copyFrom(o):(this.collider.retry++,void this.collideWithWorld(o,e,i,r))):void o.addToRef(e,this.finalPosition)},e.prototype.checkCollision=function(e){if(this.collider._canDoCollision(o.Vector3.FromArray(e.sphereCenter),e.sphereRadius,o.Vector3.FromArray(e.boxMinimum),o.Vector3.FromArray(e.boxMaximum))){o.Matrix.ScalingToRef(1/this.collider.radius.x,1/this.collider.radius.y,1/this.collider.radius.z,this.collisionsScalingMatrix);var i=o.Matrix.FromArray(e.worldMatrixFromCache);i.multiplyToRef(this.collisionsScalingMatrix,this.collisionTranformationMatrix),this.processCollisionsForSubMeshes(this.collisionTranformationMatrix,e)}},e.prototype.processCollisionsForSubMeshes=function(o,e){var i=e.subMeshes,r=i.length;if(!e.geometryId)return void console.log(\"no mesh geometry id\");var t=this._collisionCache.getGeometry(e.geometryId);if(!t)return void console.log(\"couldn't find geometry\",e.geometryId);for(var s=0;r>s;s++){var l=i[s];r>1&&!this.checkSubmeshCollision(l)||(this.collideForSubMesh(l,o,t),this.collider.collisionFound&&(this.collider.collidedMesh=e.uniqueId))}},e.prototype.collideForSubMesh=function(e,i,r){if(!r.positionsArray){r.positionsArray=[];for(var t=0,s=r.positions.length;s>t;t+=3){var l=o.Vector3.FromArray([r.positions[t],r.positions[t+1],r.positions[t+2]]);r.positionsArray.push(l)}}if(!e._lastColliderWorldVertices||!e._lastColliderTransformMatrix.equals(i)){e._lastColliderTransformMatrix=i.clone(),e._lastColliderWorldVertices=[],e._trianglePlanes=[];for(var n=e.verticesStart,a=e.verticesStart+e.verticesCount,t=n;a>t;t++)e._lastColliderWorldVertices.push(o.Vector3.TransformCoordinates(r.positionsArray[t],i))}this.collider._collide(e._trianglePlanes,e._lastColliderWorldVertices,r.indices,e.indexStart,e.indexStart+e.indexCount,e.verticesStart,e.hasMaterial)},e.prototype.checkSubmeshCollision=function(e){return this.collider._canDoCollision(o.Vector3.FromArray(e.sphereCenter),e.sphereRadius,o.Vector3.FromArray(e.boxMinimum),o.Vector3.FromArray(e.boxMaximum))},e}();o.CollideWorker=i;var r=function(){function r(){}return r.prototype.onInit=function(i){this._collisionCache=new e;var r={error:o.WorkerReplyType.SUCCESS,taskType:o.WorkerTaskType.INIT};postMessage(r,void 0)},r.prototype.onUpdate=function(e){var i=this,r={error:o.WorkerReplyType.SUCCESS,taskType:o.WorkerTaskType.UPDATE};try{for(var t in e.updatedGeometries)e.updatedGeometries.hasOwnProperty(t)&&this._collisionCache.addGeometry(e.updatedGeometries[t]);for(var s in e.updatedMeshes)e.updatedMeshes.hasOwnProperty(s)&&this._collisionCache.addMesh(e.updatedMeshes[s]);e.removedGeometries.forEach(function(o){i._collisionCache.removeGeometry(o)}),e.removedMeshes.forEach(function(o){i._collisionCache.removeMesh(o)})}catch(l){r.error=o.WorkerReplyType.UNKNOWN_ERROR}postMessage(r,void 0)},r.prototype.onCollision=function(e){var r=o.Vector3.Zero(),t=new o.Collider;t.radius=o.Vector3.FromArray(e.collider.radius);var s=new i(t,this._collisionCache,r);s.collideWithWorld(o.Vector3.FromArray(e.collider.position),o.Vector3.FromArray(e.collider.velocity),e.maximumRetry,e.excludedMeshUniqueId);var l={collidedMeshUniqueId:t.collidedMesh,collisionId:e.collisionId,newPosition:r.asArray()},n={error:o.WorkerReplyType.SUCCESS,taskType:o.WorkerTaskType.COLLIDE,payload:l};postMessage(n,void 0)},r}();o.CollisionDetectorTransferable=r;try{if(self&&self instanceof WorkerGlobalScope){window={},o.Collider||(importScripts(\"./babylon.collisionCoordinator.js\"),importScripts(\"./babylon.collider.js\"),importScripts(\"../Math/babylon.math.js\"));var t=new r,s=function(e){var i=e.data;switch(i.taskType){case o.WorkerTaskType.INIT:t.onInit(i.payload);break;case o.WorkerTaskType.COLLIDE:t.onCollision(i.payload);break;case o.WorkerTaskType.UPDATE:t.onUpdate(i.payload)}};self.onmessage=s}}catch(l){console.log(\"single worker init\")}}(BABYLON||(BABYLON={}));var BABYLON;!function(e){e.CollisionWorker=\"\",function(e){e[e.INIT=0]=\"INIT\",e[e.UPDATE=1]=\"UPDATE\",e[e.COLLIDE=2]=\"COLLIDE\"}(e.WorkerTaskType||(e.WorkerTaskType={}));var o=e.WorkerTaskType;!function(e){e[e.SUCCESS=0]=\"SUCCESS\",e[e.UNKNOWN_ERROR=1]=\"UNKNOWN_ERROR\"}(e.WorkerReplyType||(e.WorkerReplyType={}));var i=e.WorkerReplyType,t=function(){function t(){var r=this;this._scaledPosition=e.Vector3.Zero(),this._scaledVelocity=e.Vector3.Zero(),this.onMeshUpdated=function(e){r._addUpdateMeshesList[e.uniqueId]=t.SerializeMesh(e)},this.onGeometryUpdated=function(e){r._addUpdateGeometriesList[e.id]=t.SerializeGeometry(e)},this._afterRender=function(){if(r._init&&!(0==r._toRemoveGeometryArray.length&&0==r._toRemoveMeshesArray.length&&0==Object.keys(r._addUpdateGeometriesList).length&&0==Object.keys(r._addUpdateMeshesList).length||r._runningUpdated>4)){++r._runningUpdated;var e={updatedMeshes:r._addUpdateMeshesList,updatedGeometries:r._addUpdateGeometriesList,removedGeometries:r._toRemoveGeometryArray,removedMeshes:r._toRemoveMeshesArray},i={payload:e,taskType:o.UPDATE},t=[];for(var s in e.updatedGeometries)e.updatedGeometries.hasOwnProperty(s)&&(t.push(i.payload.updatedGeometries[s].indices.buffer),t.push(i.payload.updatedGeometries[s].normals.buffer),t.push(i.payload.updatedGeometries[s].positions.buffer));r._worker.postMessage(i,t),r._addUpdateMeshesList={},r._addUpdateGeometriesList={},r._toRemoveGeometryArray=[],r._toRemoveMeshesArray=[]}},this._onMessageFromWorker=function(t){var s=t.data;if(s.error!=i.SUCCESS)return void e.Tools.Warn(\"error returned from worker!\");switch(s.taskType){case o.INIT:r._init=!0,r._scene.meshes.forEach(function(e){r.onMeshAdded(e)}),r._scene.getGeometries().forEach(function(e){r.onGeometryAdded(e)});break;case o.UPDATE:r._runningUpdated--;break;case o.COLLIDE:r._runningCollisionTask=!1;var n=s.payload;if(!r._collisionsCallbackArray[n.collisionId])return;r._collisionsCallbackArray[n.collisionId](n.collisionId,e.Vector3.FromArray(n.newPosition),r._scene.getMeshByUniqueID(n.collidedMeshUniqueId)),r._collisionsCallbackArray[n.collisionId]=void 0}},this._collisionsCallbackArray=[],this._init=!1,this._runningUpdated=0,this._runningCollisionTask=!1,this._addUpdateMeshesList={},this._addUpdateGeometriesList={},this._toRemoveGeometryArray=[],this._toRemoveMeshesArray=[]}return t.prototype.getNewPosition=function(e,i,t,r,s,n,a){if(this._init&&!this._collisionsCallbackArray[a]&&!this._collisionsCallbackArray[a+1e5]){e.divideToRef(t.radius,this._scaledPosition),i.divideToRef(t.radius,this._scaledVelocity),this._collisionsCallbackArray[a]=n;var d={collider:{position:this._scaledPosition.asArray(),velocity:this._scaledVelocity.asArray(),radius:t.radius.asArray()},collisionId:a,excludedMeshUniqueId:s?s.uniqueId:null,maximumRetry:r},l={payload:d,taskType:o.COLLIDE};this._worker.postMessage(l)}},t.prototype.init=function(i){this._scene=i,this._scene.registerAfterRender(this._afterRender);var t=e.WorkerIncluded?e.Engine.CodeRepository+\"Collisions/babylon.collisionWorker.js\":URL.createObjectURL(new Blob([e.CollisionWorker],{type:\"application/javascript\"}));this._worker=new Worker(t),this._worker.onmessage=this._onMessageFromWorker;var r={payload:{},taskType:o.INIT};this._worker.postMessage(r)},t.prototype.destroy=function(){this._scene.unregisterAfterRender(this._afterRender),this._worker.terminate()},t.prototype.onMeshAdded=function(e){e.registerAfterWorldMatrixUpdate(this.onMeshUpdated),this.onMeshUpdated(e)},t.prototype.onMeshRemoved=function(e){this._toRemoveMeshesArray.push(e.uniqueId)},t.prototype.onGeometryAdded=function(e){e.onGeometryUpdated=this.onGeometryUpdated,this.onGeometryUpdated(e)},t.prototype.onGeometryDeleted=function(e){this._toRemoveGeometryArray.push(e.id)},t.SerializeMesh=function(o){var i=[];o.subMeshes&&(i=o.subMeshes.map(function(e,o){return{position:o,verticesStart:e.verticesStart,verticesCount:e.verticesCount,indexStart:e.indexStart,indexCount:e.indexCount,hasMaterial:!!e.getMaterial(),sphereCenter:e.getBoundingInfo().boundingSphere.centerWorld.asArray(),sphereRadius:e.getBoundingInfo().boundingSphere.radiusWorld,boxMinimum:e.getBoundingInfo().boundingBox.minimumWorld.asArray(),boxMaximum:e.getBoundingInfo().boundingBox.maximumWorld.asArray()}}));var t=null;return o instanceof e.Mesh?t=o.geometry?o.geometry.id:null:o instanceof e.InstancedMesh&&(t=o.sourceMesh&&o.sourceMesh.geometry?o.sourceMesh.geometry.id:null),{uniqueId:o.uniqueId,id:o.id,name:o.name,geometryId:t,sphereCenter:o.getBoundingInfo().boundingSphere.centerWorld.asArray(),sphereRadius:o.getBoundingInfo().boundingSphere.radiusWorld,boxMinimum:o.getBoundingInfo().boundingBox.minimumWorld.asArray(),boxMaximum:o.getBoundingInfo().boundingBox.maximumWorld.asArray(),worldMatrixFromCache:o.worldMatrixFromCache.asArray(),subMeshes:i,checkCollisions:o.checkCollisions}},t.SerializeGeometry=function(o){return{id:o.id,positions:new Float32Array(o.getVerticesData(e.VertexBuffer.PositionKind)||[]),normals:new Float32Array(o.getVerticesData(e.VertexBuffer.NormalKind)||[]),indices:new Int32Array(o.getIndices()||[])}},t}();e.CollisionCoordinatorWorker=t;var r=function(){function o(){this._scaledPosition=e.Vector3.Zero(),this._scaledVelocity=e.Vector3.Zero(),this._finalPosition=e.Vector3.Zero()}return o.prototype.getNewPosition=function(e,o,i,t,r,s,n){e.divideToRef(i.radius,this._scaledPosition),o.divideToRef(i.radius,this._scaledVelocity),i.collidedMesh=null,i.retry=0,i.initialVelocity=this._scaledVelocity,i.initialPosition=this._scaledPosition,this._collideWithWorld(this._scaledPosition,this._scaledVelocity,i,t,this._finalPosition,r),this._finalPosition.multiplyInPlace(i.radius),s(n,this._finalPosition,i.collidedMesh)},o.prototype.init=function(e){this._scene=e},o.prototype.destroy=function(){},o.prototype.onMeshAdded=function(e){},o.prototype.onMeshUpdated=function(e){},o.prototype.onMeshRemoved=function(e){},o.prototype.onGeometryAdded=function(e){},o.prototype.onGeometryUpdated=function(e){},o.prototype.onGeometryDeleted=function(e){},o.prototype._collideWithWorld=function(o,i,t,r,s,n){void 0===n&&(n=null);var a=10*e.Engine.CollisionsEpsilon;if(t.retry>=r)return void s.copyFrom(o);t._initialize(o,i,a);for(var d=0;d<this._scene.meshes.length;d++){var l=this._scene.meshes[d];l.isEnabled()&&l.checkCollisions&&l.subMeshes&&l!==n&&l._checkCollision(t)}return t.collisionFound?((0!==i.x||0!==i.y||0!==i.z)&&t._getResponse(o,i),i.length()<=a?void s.copyFrom(o):(t.retry++,void this._collideWithWorld(o,i,t,r,s,n))):void o.addToRef(i,s)},o}();e.CollisionCoordinatorLegacy=r}(BABYLON||(BABYLON={}));var BABYLON;!function(t){var i=function(){function i(t,i,n){void 0===t&&(t=0),void 0===i&&(i=0),void 0===n&&(n=0),this.r=t,this.g=i,this.b=n}return i.prototype.toString=function(){return\"{R: \"+this.r+\" G:\"+this.g+\" B:\"+this.b+\"}\"},i.prototype.toArray=function(t,i){return void 0===i&&(i=0),t[i]=this.r,t[i+1]=this.g,t[i+2]=this.b,this},i.prototype.toColor4=function(t){return void 0===t&&(t=1),new n(this.r,this.g,this.b,t)},i.prototype.asArray=function(){var t=[];return this.toArray(t,0),t},i.prototype.toLuminance=function(){return.3*this.r+.59*this.g+.11*this.b},i.prototype.multiply=function(t){return new i(this.r*t.r,this.g*t.g,this.b*t.b)},i.prototype.multiplyToRef=function(t,i){return i.r=this.r*t.r,i.g=this.g*t.g,i.b=this.b*t.b,this},i.prototype.equals=function(t){return t&&this.r===t.r&&this.g===t.g&&this.b===t.b},i.prototype.equalsFloats=function(t,i,n){return this.r===t&&this.g===i&&this.b===n},i.prototype.scale=function(t){return new i(this.r*t,this.g*t,this.b*t)},i.prototype.scaleToRef=function(t,i){return i.r=this.r*t,i.g=this.g*t,i.b=this.b*t,this},i.prototype.add=function(t){return new i(this.r+t.r,this.g+t.g,this.b+t.b)},i.prototype.addToRef=function(t,i){return i.r=this.r+t.r,i.g=this.g+t.g,i.b=this.b+t.b,this},i.prototype.subtract=function(t){return new i(this.r-t.r,this.g-t.g,this.b-t.b)},i.prototype.subtractToRef=function(t,i){return i.r=this.r-t.r,i.g=this.g-t.g,i.b=this.b-t.b,this},i.prototype.clone=function(){return new i(this.r,this.g,this.b)},i.prototype.copyFrom=function(t){return this.r=t.r,this.g=t.g,this.b=t.b,this},i.prototype.copyFromFloats=function(t,i,n){return this.r=t,this.g=i,this.b=n,this},i.prototype.toHexString=function(){var i=255*this.r|0,n=255*this.g|0,r=255*this.b|0;return\"#\"+t.Tools.ToHex(i)+t.Tools.ToHex(n)+t.Tools.ToHex(r)},i.FromHexString=function(n){if(\"#\"!==n.substring(0,1)||7!==n.length)return t.Tools.Warn(\"Color3.FromHexString must be called with a string like #FFFFFF\"),new i(0,0,0);var r=parseInt(n.substring(1,3),16),o=parseInt(n.substring(3,5),16),s=parseInt(n.substring(5,7),16);return i.FromInts(r,o,s)},i.FromArray=function(t,n){return void 0===n&&(n=0),new i(t[n],t[n+1],t[n+2])},i.FromInts=function(t,n,r){return new i(t/255,n/255,r/255)},i.Lerp=function(t,n,r){var o=t.r+(n.r-t.r)*r,s=t.g+(n.g-t.g)*r,e=t.b+(n.b-t.b)*r;return new i(o,s,e)},i.Red=function(){return new i(1,0,0)},i.Green=function(){return new i(0,1,0)},i.Blue=function(){return new i(0,0,1)},i.Black=function(){return new i(0,0,0)},i.White=function(){return new i(1,1,1)},i.Purple=function(){return new i(.5,0,.5)},i.Magenta=function(){return new i(1,0,1)},i.Yellow=function(){return new i(1,1,0)},i.Gray=function(){return new i(.5,.5,.5)},i}();t.Color3=i;var n=function(){function i(t,i,n,r){this.r=t,this.g=i,this.b=n,this.a=r}return i.prototype.addInPlace=function(t){return this.r+=t.r,this.g+=t.g,this.b+=t.b,this.a+=t.a,this},i.prototype.asArray=function(){var t=[];return this.toArray(t,0),t},i.prototype.toArray=function(t,i){return void 0===i&&(i=0),t[i]=this.r,t[i+1]=this.g,t[i+2]=this.b,t[i+3]=this.a,this},i.prototype.add=function(t){return new i(this.r+t.r,this.g+t.g,this.b+t.b,this.a+t.a)},i.prototype.subtract=function(t){return new i(this.r-t.r,this.g-t.g,this.b-t.b,this.a-t.a)},i.prototype.subtractToRef=function(t,i){return i.r=this.r-t.r,i.g=this.g-t.g,i.b=this.b-t.b,i.a=this.a-t.a,this},i.prototype.scale=function(t){return new i(this.r*t,this.g*t,this.b*t,this.a*t)},i.prototype.scaleToRef=function(t,i){return i.r=this.r*t,i.g=this.g*t,i.b=this.b*t,i.a=this.a*t,this},i.prototype.toString=function(){return\"{R: \"+this.r+\" G:\"+this.g+\" B:\"+this.b+\" A:\"+this.a+\"}\"},i.prototype.clone=function(){return new i(this.r,this.g,this.b,this.a)},i.prototype.copyFrom=function(t){return this.r=t.r,this.g=t.g,this.b=t.b,this.a=t.a,this},i.prototype.toHexString=function(){var i=255*this.r|0,n=255*this.g|0,r=255*this.b|0,o=255*this.a|0;return\"#\"+t.Tools.ToHex(i)+t.Tools.ToHex(n)+t.Tools.ToHex(r)+t.Tools.ToHex(o)},i.FromHexString=function(n){if(\"#\"!==n.substring(0,1)||9!==n.length)return t.Tools.Warn(\"Color4.FromHexString must be called with a string like #FFFFFFFF\"),new i(0,0,0,0);var r=parseInt(n.substring(1,3),16),o=parseInt(n.substring(3,5),16),s=parseInt(n.substring(5,7),16),e=parseInt(n.substring(7,9),16);return i.FromInts(r,o,s,e)},i.Lerp=function(t,n,r){var o=new i(0,0,0,0);return i.LerpToRef(t,n,r,o),o},i.LerpToRef=function(t,i,n,r){r.r=t.r+(i.r-t.r)*n,r.g=t.g+(i.g-t.g)*n,r.b=t.b+(i.b-t.b)*n,r.a=t.a+(i.a-t.a)*n},i.FromArray=function(t,n){return void 0===n&&(n=0),new i(t[n],t[n+1],t[n+2],t[n+3])},i.FromInts=function(t,n,r,o){return new i(t/255,n/255,r/255,o/255)},i}();t.Color4=n;var r=function(){function i(t,i){this.x=t,this.y=i}return i.prototype.toString=function(){return\"{X: \"+this.x+\" Y:\"+this.y+\"}\"},i.prototype.toArray=function(t,i){return void 0===i&&(i=0),t[i]=this.x,t[i+1]=this.y,this},i.prototype.asArray=function(){var t=[];return this.toArray(t,0),t},i.prototype.copyFrom=function(t){return this.x=t.x,this.y=t.y,this},i.prototype.copyFromFloats=function(t,i){return this.x=t,this.y=i,this},i.prototype.add=function(t){return new i(this.x+t.x,this.y+t.y)},i.prototype.addVector3=function(t){return new i(this.x+t.x,this.y+t.y)},i.prototype.subtract=function(t){return new i(this.x-t.x,this.y-t.y)},i.prototype.subtractInPlace=function(t){return this.x-=t.x,this.y-=t.y,this},i.prototype.multiplyInPlace=function(t){return this.x*=t.x,this.y*=t.y,this},i.prototype.multiply=function(t){return new i(this.x*t.x,this.y*t.y)},i.prototype.multiplyToRef=function(t,i){return i.x=this.x*t.x,i.y=this.y*t.y,this},i.prototype.multiplyByFloats=function(t,n){return new i(this.x*t,this.y*n)},i.prototype.divide=function(t){return new i(this.x/t.x,this.y/t.y)},i.prototype.divideToRef=function(t,i){return i.x=this.x/t.x,i.y=this.y/t.y,this},i.prototype.negate=function(){return new i(-this.x,-this.y)},i.prototype.scaleInPlace=function(t){return this.x*=t,this.y*=t,this},i.prototype.scale=function(t){return new i(this.x*t,this.y*t)},i.prototype.equals=function(t){return t&&this.x===t.x&&this.y===t.y},i.prototype.equalsWithEpsilon=function(i,n){return void 0===n&&(n=t.Engine.Epsilon),i&&t.Tools.WithinEpsilon(this.x,i.x,n)&&t.Tools.WithinEpsilon(this.y,i.y,n)},i.prototype.length=function(){return Math.sqrt(this.x*this.x+this.y*this.y)},i.prototype.lengthSquared=function(){return this.x*this.x+this.y*this.y},i.prototype.normalize=function(){var t=this.length();if(0===t)return this;var i=1/t;return this.x*=i,this.y*=i,this},i.prototype.clone=function(){return new i(this.x,this.y)},i.Zero=function(){return new i(0,0)},i.FromArray=function(t,n){return void 0===n&&(n=0),new i(t[n],t[n+1])},i.FromArrayToRef=function(t,i,n){n.x=t[i],n.y=t[i+1]},i.CatmullRom=function(t,n,r,o,s){var e=s*s,h=s*e,a=.5*(2*n.x+(-t.x+r.x)*s+(2*t.x-5*n.x+4*r.x-o.x)*e+(-t.x+3*n.x-3*r.x+o.x)*h),u=.5*(2*n.y+(-t.y+r.y)*s+(2*t.y-5*n.y+4*r.y-o.y)*e+(-t.y+3*n.y-3*r.y+o.y)*h);return new i(a,u)},i.Clamp=function(t,n,r){var o=t.x;o=o>r.x?r.x:o,o=o<n.x?n.x:o;var s=t.y;return s=s>r.y?r.y:s,s=s<n.y?n.y:s,new i(o,s)},i.Hermite=function(t,n,r,o,s){var e=s*s,h=s*e,a=2*h-3*e+1,u=-2*h+3*e,m=h-2*e+s,y=h-e,c=t.x*a+r.x*u+n.x*m+o.x*y,f=t.y*a+r.y*u+n.y*m+o.y*y;return new i(c,f)},i.Lerp=function(t,n,r){var o=t.x+(n.x-t.x)*r,s=t.y+(n.y-t.y)*r;return new i(o,s)},i.Dot=function(t,i){return t.x*i.x+t.y*i.y},i.Normalize=function(t){var i=t.clone();return i.normalize(),i},i.Minimize=function(t,n){var r=t.x<n.x?t.x:n.x,o=t.y<n.y?t.y:n.y;return new i(r,o)},i.Maximize=function(t,n){var r=t.x>n.x?t.x:n.x,o=t.y>n.y?t.y:n.y;return new i(r,o)},i.Transform=function(t,n){var r=t.x*n.m[0]+t.y*n.m[4],o=t.x*n.m[1]+t.y*n.m[5];return new i(r,o)},i.Distance=function(t,n){return Math.sqrt(i.DistanceSquared(t,n))},i.DistanceSquared=function(t,i){var n=t.x-i.x,r=t.y-i.y;return n*n+r*r},i}();t.Vector2=r;var o=function(){function i(t,i,n){this.x=t,this.y=i,this.z=n}return i.prototype.toString=function(){return\"{X: \"+this.x+\" Y:\"+this.y+\" Z:\"+this.z+\"}\"},i.prototype.asArray=function(){var t=[];return this.toArray(t,0),t},i.prototype.toArray=function(t,i){return void 0===i&&(i=0),t[i]=this.x,t[i+1]=this.y,t[i+2]=this.z,this},i.prototype.toQuaternion=function(){var t=new e(0,0,0,1),i=Math.cos(.5*(this.x+this.z)),n=Math.sin(.5*(this.x+this.z)),r=Math.cos(.5*(this.z-this.x)),o=Math.sin(.5*(this.z-this.x)),s=Math.cos(.5*this.y),h=Math.sin(.5*this.y);return t.x=r*h,t.y=-o*h,t.z=n*s,t.w=i*s,t},i.prototype.addInPlace=function(t){return this.x+=t.x,this.y+=t.y,this.z+=t.z,this},i.prototype.add=function(t){return new i(this.x+t.x,this.y+t.y,this.z+t.z)},i.prototype.addToRef=function(t,i){return i.x=this.x+t.x,i.y=this.y+t.y,i.z=this.z+t.z,this},i.prototype.subtractInPlace=function(t){return this.x-=t.x,this.y-=t.y,this.z-=t.z,this},i.prototype.subtract=function(t){return new i(this.x-t.x,this.y-t.y,this.z-t.z)},i.prototype.subtractToRef=function(t,i){return i.x=this.x-t.x,i.y=this.y-t.y,i.z=this.z-t.z,this},i.prototype.subtractFromFloats=function(t,n,r){return new i(this.x-t,this.y-n,this.z-r)},i.prototype.subtractFromFloatsToRef=function(t,i,n,r){return r.x=this.x-t,r.y=this.y-i,r.z=this.z-n,this},i.prototype.negate=function(){return new i(-this.x,-this.y,-this.z)},i.prototype.scaleInPlace=function(t){return this.x*=t,this.y*=t,this.z*=t,this},i.prototype.scale=function(t){return new i(this.x*t,this.y*t,this.z*t)},i.prototype.scaleToRef=function(t,i){i.x=this.x*t,i.y=this.y*t,i.z=this.z*t},i.prototype.equals=function(t){return t&&this.x===t.x&&this.y===t.y&&this.z===t.z},i.prototype.equalsWithEpsilon=function(i,n){return void 0===n&&(n=t.Engine.Epsilon),i&&t.Tools.WithinEpsilon(this.x,i.x,n)&&t.Tools.WithinEpsilon(this.y,i.y,n)&&t.Tools.WithinEpsilon(this.z,i.z,n)},i.prototype.equalsToFloats=function(t,i,n){return this.x===t&&this.y===i&&this.z===n},i.prototype.multiplyInPlace=function(t){return this.x*=t.x,this.y*=t.y,this.z*=t.z,this},i.prototype.multiply=function(t){return new i(this.x*t.x,this.y*t.y,this.z*t.z)},i.prototype.multiplyToRef=function(t,i){return i.x=this.x*t.x,i.y=this.y*t.y,i.z=this.z*t.z,this},i.prototype.multiplyByFloats=function(t,n,r){return new i(this.x*t,this.y*n,this.z*r)},i.prototype.divide=function(t){return new i(this.x/t.x,this.y/t.y,this.z/t.z)},i.prototype.divideToRef=function(t,i){return i.x=this.x/t.x,i.y=this.y/t.y,i.z=this.z/t.z,this},i.prototype.MinimizeInPlace=function(t){return t.x<this.x&&(this.x=t.x),t.y<this.y&&(this.y=t.y),t.z<this.z&&(this.z=t.z),this},i.prototype.MaximizeInPlace=function(t){return t.x>this.x&&(this.x=t.x),t.y>this.y&&(this.y=t.y),t.z>this.z&&(this.z=t.z),this},i.prototype.length=function(){return Math.sqrt(this.x*this.x+this.y*this.y+this.z*this.z)},i.prototype.lengthSquared=function(){return this.x*this.x+this.y*this.y+this.z*this.z},i.prototype.normalize=function(){var t=this.length();if(0===t||1===t)return this;var i=1/t;return this.x*=i,this.y*=i,this.z*=i,this},i.prototype.clone=function(){return new i(this.x,this.y,this.z)},i.prototype.copyFrom=function(t){return this.x=t.x,this.y=t.y,this.z=t.z,this},i.prototype.copyFromFloats=function(t,i,n){return this.x=t,this.y=i,this.z=n,this},i.GetClipFactor=function(t,n,r,o){var s=i.Dot(t,r)-o,e=i.Dot(n,r)-o,h=s/(s-e);return h},i.FromArray=function(t,n){return n||(n=0),new i(t[n],t[n+1],t[n+2])},i.FromFloatArray=function(t,n){return n||(n=0),new i(t[n],t[n+1],t[n+2])},i.FromArrayToRef=function(t,i,n){n.x=t[i],n.y=t[i+1],n.z=t[i+2]},i.FromFloatArrayToRef=function(t,i,n){n.x=t[i],n.y=t[i+1],n.z=t[i+2]},i.FromFloatsToRef=function(t,i,n,r){r.x=t,r.y=i,r.z=n},i.Zero=function(){return new i(0,0,0)},i.Up=function(){return new i(0,1,0)},i.TransformCoordinates=function(t,n){var r=i.Zero();return i.TransformCoordinatesToRef(t,n,r),r},i.TransformCoordinatesToRef=function(t,i,n){var r=t.x*i.m[0]+t.y*i.m[4]+t.z*i.m[8]+i.m[12],o=t.x*i.m[1]+t.y*i.m[5]+t.z*i.m[9]+i.m[13],s=t.x*i.m[2]+t.y*i.m[6]+t.z*i.m[10]+i.m[14],e=t.x*i.m[3]+t.y*i.m[7]+t.z*i.m[11]+i.m[15];n.x=r/e,n.y=o/e,n.z=s/e},i.TransformCoordinatesFromFloatsToRef=function(t,i,n,r,o){var s=t*r.m[0]+i*r.m[4]+n*r.m[8]+r.m[12],e=t*r.m[1]+i*r.m[5]+n*r.m[9]+r.m[13],h=t*r.m[2]+i*r.m[6]+n*r.m[10]+r.m[14],a=t*r.m[3]+i*r.m[7]+n*r.m[11]+r.m[15];o.x=s/a,o.y=e/a,o.z=h/a},i.TransformNormal=function(t,n){var r=i.Zero();return i.TransformNormalToRef(t,n,r),r},i.TransformNormalToRef=function(t,i,n){n.x=t.x*i.m[0]+t.y*i.m[4]+t.z*i.m[8],n.y=t.x*i.m[1]+t.y*i.m[5]+t.z*i.m[9],n.z=t.x*i.m[2]+t.y*i.m[6]+t.z*i.m[10]},i.TransformNormalFromFloatsToRef=function(t,i,n,r,o){o.x=t*r.m[0]+i*r.m[4]+n*r.m[8],o.y=t*r.m[1]+i*r.m[5]+n*r.m[9],o.z=t*r.m[2]+i*r.m[6]+n*r.m[10]},i.CatmullRom=function(t,n,r,o,s){var e=s*s,h=s*e,a=.5*(2*n.x+(-t.x+r.x)*s+(2*t.x-5*n.x+4*r.x-o.x)*e+(-t.x+3*n.x-3*r.x+o.x)*h),u=.5*(2*n.y+(-t.y+r.y)*s+(2*t.y-5*n.y+4*r.y-o.y)*e+(-t.y+3*n.y-3*r.y+o.y)*h),m=.5*(2*n.z+(-t.z+r.z)*s+(2*t.z-5*n.z+4*r.z-o.z)*e+(-t.z+3*n.z-3*r.z+o.z)*h);return new i(a,u,m)},i.Clamp=function(t,n,r){var o=t.x;o=o>r.x?r.x:o,o=o<n.x?n.x:o;var s=t.y;s=s>r.y?r.y:s,s=s<n.y?n.y:s;var e=t.z;return e=e>r.z?r.z:e,e=e<n.z?n.z:e,new i(o,s,e)},i.Hermite=function(t,n,r,o,s){var e=s*s,h=s*e,a=2*h-3*e+1,u=-2*h+3*e,m=h-2*e+s,y=h-e,c=t.x*a+r.x*u+n.x*m+o.x*y,f=t.y*a+r.y*u+n.y*m+o.y*y,p=t.z*a+r.z*u+n.z*m+o.z*y;return new i(c,f,p)},i.Lerp=function(t,n,r){var o=t.x+(n.x-t.x)*r,s=t.y+(n.y-t.y)*r,e=t.z+(n.z-t.z)*r;return new i(o,s,e)},i.Dot=function(t,i){return t.x*i.x+t.y*i.y+t.z*i.z},i.Cross=function(t,n){var r=i.Zero();return i.CrossToRef(t,n,r),r},i.CrossToRef=function(t,i,n){n.x=t.y*i.z-t.z*i.y,n.y=t.z*i.x-t.x*i.z,n.z=t.x*i.y-t.y*i.x},i.Normalize=function(t){var n=i.Zero();return i.NormalizeToRef(t,n),n},i.NormalizeToRef=function(t,i){i.copyFrom(t),i.normalize()},i.Project=function(t,n,r,o){var s=o.width,e=o.height,a=o.x,u=o.y,m=h.FromValues(s/2,0,0,0,0,-e/2,0,0,0,0,1,0,a+s/2,e/2+u,0,1),y=n.multiply(r).multiply(m);return i.TransformCoordinates(t,y)},i.UnprojectFromTransform=function(n,r,o,s,e){var h=s.multiply(e);h.invert(),n.x=n.x/r*2-1,n.y=-(n.y/o*2-1);var a=i.TransformCoordinates(n,h),u=n.x*h.m[3]+n.y*h.m[7]+n.z*h.m[11]+h.m[15];return t.Tools.WithinEpsilon(u,1)&&(a=a.scale(1/u)),a},i.Unproject=function(n,r,o,s,e,h){var a=s.multiply(e).multiply(h);a.invert();var u=new i(n.x/r*2-1,-(n.y/o*2-1),n.z),m=i.TransformCoordinates(u,a),y=u.x*a.m[3]+u.y*a.m[7]+u.z*a.m[11]+a.m[15];return t.Tools.WithinEpsilon(y,1)&&(m=m.scale(1/y)),m},i.Minimize=function(t,i){var n=t.clone();return n.MinimizeInPlace(i),n},i.Maximize=function(t,i){var n=t.clone();return n.MaximizeInPlace(i),n},i.Distance=function(t,n){return Math.sqrt(i.DistanceSquared(t,n))},i.DistanceSquared=function(t,i){var n=t.x-i.x,r=t.y-i.y,o=t.z-i.z;return n*n+r*r+o*o},i.Center=function(t,i){var n=t.add(i);return n.scaleInPlace(.5),n},i.RotationFromAxis=function(t,n,r){var o=i.Zero();return i.RotationFromAxisToRef(t,n,r,o),o},i.RotationFromAxisToRef=function(n,r,o,s){var e,h,a,u=i.Normalize(n),m=i.Normalize(o),y=c.X,f=c.Y,p=0,l=0,x=0,z=0,w=0,v=0,g=0,d=-1,T=0,R=0;t.Tools.WithinEpsilon(m.z,0,t.Engine.Epsilon)?v=1:t.Tools.WithinEpsilon(m.x,0,t.Engine.Epsilon)?z=1:(g=m.z/m.x,z=-g*Math.sqrt(1/(1+g*g)),v=Math.sqrt(1/(1+g*g))),h=new i(z,w,v),h.normalize(),a=i.Cross(m,h),a.normalize(),e=i.Cross(u,h),e.normalize(),i.Dot(m,e)<0&&(d=1),R=i.Dot(u,h),R=Math.min(1,Math.max(-1,R)),x=Math.acos(R)*d,i.Dot(h,y)<0&&(x=Math.PI+x,h=h.scaleInPlace(-1),a=a.scaleInPlace(-1),T++);var _,M;z=0,w=0,v=0,d=-1,t.Tools.WithinEpsilon(m.z,0,t.Engine.Epsilon)?z=1:(g=h.z/h.x,z=-g*Math.sqrt(1/(1+g*g)),v=Math.sqrt(1/(1+g*g))),_=new i(z,w,v),_.normalize(),M=i.Cross(_,h),M.normalize(),e=i.Cross(m,_),e.normalize(),i.Dot(h,e)<0&&(d=1),R=i.Dot(m,_),R=Math.min(1,Math.max(-1,R)),l=Math.acos(R)*d,i.Dot(M,f)<0&&(l=Math.PI+l,M=M.scaleInPlace(-1),_=_.scaleInPlace(-1),T++),d=-1,e=i.Cross(y,h),e.normalize(),i.Dot(e,f)<0&&(d=1),R=i.Dot(h,y),R=Math.min(1,Math.max(-1,R)),p=-Math.acos(R)*d,0>R&&2>T&&(p=Math.PI+p),s.x=l,s.y=p,s.z=x},i}();t.Vector3=o;var s=function(){function i(t,i,n,r){this.x=t,this.y=i,this.z=n,this.w=r}return i.prototype.toString=function(){return\"{X: \"+this.x+\" Y:\"+this.y+\" Z:\"+this.z+\"W:\"+this.w+\"}\"},i.prototype.asArray=function(){var t=[];return this.toArray(t,0),t},i.prototype.toArray=function(t,i){return void 0===i&&(i=0),t[i]=this.x,t[i+1]=this.y,t[i+2]=this.z,t[i+3]=this.w,this},i.prototype.addInPlace=function(t){return this.x+=t.x,this.y+=t.y,this.z+=t.z,this.w+=t.w,this},i.prototype.add=function(t){return new i(this.x+t.x,this.y+t.y,this.z+t.z,this.w+t.w)},i.prototype.addToRef=function(t,i){return i.x=this.x+t.x,i.y=this.y+t.y,i.z=this.z+t.z,i.w=this.w+t.w,this},i.prototype.subtractInPlace=function(t){return this.x-=t.x,this.y-=t.y,this.z-=t.z,this.w-=t.w,this},i.prototype.subtract=function(t){return new i(this.x-t.x,this.y-t.y,this.z-t.z,this.w-t.w)},i.prototype.subtractToRef=function(t,i){return i.x=this.x-t.x,i.y=this.y-t.y,i.z=this.z-t.z,i.w=this.w-t.w,this},i.prototype.subtractFromFloats=function(t,n,r,o){return new i(this.x-t,this.y-n,this.z-r,this.w-o)},i.prototype.subtractFromFloatsToRef=function(t,i,n,r,o){return o.x=this.x-t,o.y=this.y-i,o.z=this.z-n,o.w=this.w-r,this},i.prototype.negate=function(){return new i(-this.x,-this.y,-this.z,-this.w)},i.prototype.scaleInPlace=function(t){return this.x*=t,this.y*=t,this.z*=t,this.w*=t,this},i.prototype.scale=function(t){return new i(this.x*t,this.y*t,this.z*t,this.w*t)},i.prototype.scaleToRef=function(t,i){i.x=this.x*t,i.y=this.y*t,i.z=this.z*t,i.w=this.w*t},i.prototype.equals=function(t){return t&&this.x===t.x&&this.y===t.y&&this.z===t.z&&this.w===t.w},i.prototype.equalsWithEpsilon=function(i,n){return void 0===n&&(n=t.Engine.Epsilon),i&&t.Tools.WithinEpsilon(this.x,i.x,n)&&t.Tools.WithinEpsilon(this.y,i.y,n)&&t.Tools.WithinEpsilon(this.z,i.z,n)&&t.Tools.WithinEpsilon(this.w,i.w,n)},i.prototype.equalsToFloats=function(t,i,n,r){return this.x===t&&this.y===i&&this.z===n&&this.w===r},i.prototype.multiplyInPlace=function(t){return this.x*=t.x,this.y*=t.y,this.z*=t.z,this.w*=t.w,this},i.prototype.multiply=function(t){return new i(this.x*t.x,this.y*t.y,this.z*t.z,this.w*t.w)},i.prototype.multiplyToRef=function(t,i){return i.x=this.x*t.x,i.y=this.y*t.y,i.z=this.z*t.z,i.w=this.w*t.w,this},i.prototype.multiplyByFloats=function(t,n,r,o){return new i(this.x*t,this.y*n,this.z*r,this.w*o)},i.prototype.divide=function(t){return new i(this.x/t.x,this.y/t.y,this.z/t.z,this.w/t.w)},i.prototype.divideToRef=function(t,i){return i.x=this.x/t.x,i.y=this.y/t.y,i.z=this.z/t.z,i.w=this.w/t.w,this},i.prototype.MinimizeInPlace=function(t){return t.x<this.x&&(this.x=t.x),t.y<this.y&&(this.y=t.y),t.z<this.z&&(this.z=t.z),t.w<this.w&&(this.w=t.w),this},i.prototype.MaximizeInPlace=function(t){return t.x>this.x&&(this.x=t.x),t.y>this.y&&(this.y=t.y),t.z>this.z&&(this.z=t.z),t.w>this.w&&(this.w=t.w),this},i.prototype.length=function(){return Math.sqrt(this.x*this.x+this.y*this.y+this.z*this.z+this.w*this.w)},i.prototype.lengthSquared=function(){return this.x*this.x+this.y*this.y+this.z*this.z+this.w*this.w},i.prototype.normalize=function(){var t=this.length();if(0===t)return this;var i=1/t;return this.x*=i,this.y*=i,this.z*=i,this.w*=i,this},i.prototype.clone=function(){return new i(this.x,this.y,this.z,this.w)},i.prototype.copyFrom=function(t){return this.x=t.x,this.y=t.y,this.z=t.z,this.w=t.w,this},i.prototype.copyFromFloats=function(t,i,n,r){return this.x=t,this.y=i,this.z=n,this.w=r,this},i.FromArray=function(t,n){return n||(n=0),new i(t[n],t[n+1],t[n+2],t[n+3])},i.FromArrayToRef=function(t,i,n){n.x=t[i],n.y=t[i+1],n.z=t[i+2],n.w=t[i+3]},i.FromFloatArrayToRef=function(t,i,n){n.x=t[i],n.y=t[i+1],n.z=t[i+2],n.w=t[i+3]},i.FromFloatsToRef=function(t,i,n,r,o){o.x=t,o.y=i,o.z=n,o.w=r},i.Zero=function(){return new i(0,0,0,0)},i.Normalize=function(t){var n=i.Zero();return i.NormalizeToRef(t,n),n},i.NormalizeToRef=function(t,i){i.copyFrom(t),i.normalize()},i.Minimize=function(t,i){var n=t.clone();return n.MinimizeInPlace(i),n},i.Maximize=function(t,i){var n=t.clone();return n.MaximizeInPlace(i),n},i.Distance=function(t,n){return Math.sqrt(i.DistanceSquared(t,n))},i.DistanceSquared=function(t,i){var n=t.x-i.x,r=t.y-i.y,o=t.z-i.z,s=t.w-i.w;return n*n+r*r+o*o+s*s},i.Center=function(t,i){var n=t.add(i);return n.scaleInPlace(.5),n},i}();t.Vector4=s;var e=function(){function t(t,i,n,r){void 0===t&&(t=0),void 0===i&&(i=0),void 0===n&&(n=0),void 0===r&&(r=1),this.x=t,this.y=i,this.z=n,this.w=r}return t.prototype.toString=function(){return\"{X: \"+this.x+\" Y:\"+this.y+\" Z:\"+this.z+\" W:\"+this.w+\"}\"},t.prototype.asArray=function(){return[this.x,this.y,this.z,this.w]},t.prototype.equals=function(t){return t&&this.x===t.x&&this.y===t.y&&this.z===t.z&&this.w===t.w},t.prototype.clone=function(){return new t(this.x,this.y,this.z,this.w)},t.prototype.copyFrom=function(t){return this.x=t.x,this.y=t.y,this.z=t.z,this.w=t.w,this},t.prototype.copyFromFloats=function(t,i,n,r){return this.x=t,this.y=i,this.z=n,this.w=r,this},t.prototype.add=function(i){return new t(this.x+i.x,this.y+i.y,this.z+i.z,this.w+i.w)},t.prototype.subtract=function(i){return new t(this.x-i.x,this.y-i.y,this.z-i.z,this.w-i.w)},t.prototype.scale=function(i){return new t(this.x*i,this.y*i,this.z*i,this.w*i)},t.prototype.multiply=function(i){var n=new t(0,0,0,1);return this.multiplyToRef(i,n),n},t.prototype.multiplyToRef=function(t,i){var n=this.x*t.w+this.y*t.z-this.z*t.y+this.w*t.x,r=-this.x*t.z+this.y*t.w+this.z*t.x+this.w*t.y,o=this.x*t.y-this.y*t.x+this.z*t.w+this.w*t.z,s=-this.x*t.x-this.y*t.y-this.z*t.z+this.w*t.w;return i.copyFromFloats(n,r,o,s),this},t.prototype.multiplyInPlace=function(t){return this.multiplyToRef(t,this),this},t.prototype.length=function(){return Math.sqrt(this.x*this.x+this.y*this.y+this.z*this.z+this.w*this.w)},t.prototype.normalize=function(){var t=1/this.length();return this.x*=t,this.y*=t,this.z*=t,this.w*=t,this},t.prototype.toEulerAngles=function(){var t=o.Zero();return this.toEulerAnglesToRef(t),t},t.prototype.toEulerAnglesToRef=function(t){var i=this.x,n=this.y,r=this.z,o=this.w,s=i*n,e=i*r,h=o*n,a=o*r,u=o*i,m=n*r,y=i*i,c=n*n,f=y+c;return 0!==f&&1!==f?(t.x=Math.atan2(e+h,u-m),t.y=Math.acos(1-2*f),t.z=Math.atan2(e-h,u+m)):0===f?(t.x=0,t.y=0,t.z=Math.atan2(s-a,.5-c-r*r)):(t.x=Math.atan2(s-a,.5-c-r*r),t.y=Math.PI,t.z=0),this},t.prototype.toRotationMatrix=function(t){var i=this.x*this.x,n=this.y*this.y,r=this.z*this.z,o=this.x*this.y,s=this.z*this.w,e=this.z*this.x,h=this.y*this.w,a=this.y*this.z,u=this.x*this.w;return t.m[0]=1-2*(n+r),t.m[1]=2*(o+s),t.m[2]=2*(e-h),t.m[3]=0,t.m[4]=2*(o-s),t.m[5]=1-2*(r+i),t.m[6]=2*(a+u),t.m[7]=0,t.m[8]=2*(e+h),t.m[9]=2*(a-u),t.m[10]=1-2*(n+i),t.m[11]=0,t.m[12]=0,t.m[13]=0,t.m[14]=0,t.m[15]=1,this},t.prototype.fromRotationMatrix=function(i){return t.FromRotationMatrixToRef(i,this),this},t.FromRotationMatrix=function(i){var n=new t;return t.FromRotationMatrixToRef(i,n),n},t.FromRotationMatrixToRef=function(t,i){var n,r=t.m,o=r[0],s=r[4],e=r[8],h=r[1],a=r[5],u=r[9],m=r[2],y=r[6],c=r[10],f=o+a+c;f>0?(n=.5/Math.sqrt(f+1),i.w=.25/n,i.x=(y-u)*n,i.y=(e-m)*n,i.z=(h-s)*n):o>a&&o>c?(n=2*Math.sqrt(1+o-a-c),i.w=(y-u)/n,i.x=.25*n,i.y=(s+h)/n,i.z=(e+m)/n):a>c?(n=2*Math.sqrt(1+a-o-c),i.w=(e-m)/n,i.x=(s+h)/n,i.y=.25*n,i.z=(u+y)/n):(n=2*Math.sqrt(1+c-o-a),i.w=(h-s)/n,i.x=(e+m)/n,i.y=(u+y)/n,i.z=.25*n)},t.Inverse=function(i){return new t(-i.x,-i.y,-i.z,i.w)},t.Identity=function(){return new t(0,0,0,1)},t.RotationAxis=function(i,n){var r=new t,o=Math.sin(n/2);return i.normalize(),r.w=Math.cos(n/2),r.x=i.x*o,r.y=i.y*o,r.z=i.z*o,r},t.FromArray=function(i,n){return n||(n=0),new t(i[n],i[n+1],i[n+2],i[n+3])},t.RotationYawPitchRoll=function(i,n,r){var o=new t;return t.RotationYawPitchRollToRef(i,n,r,o),o},t.RotationYawPitchRollToRef=function(t,i,n,r){var o=.5*n,s=.5*i,e=.5*t,h=Math.sin(o),a=Math.cos(o),u=Math.sin(s),m=Math.cos(s),y=Math.sin(e),c=Math.cos(e);r.x=c*u*a+y*m*h,r.y=y*m*a-c*u*h,r.z=c*m*h-y*u*a,r.w=c*m*a+y*u*h},t.RotationAlphaBetaGamma=function(i,n,r){var o=new t;return t.RotationAlphaBetaGammaToRef(i,n,r,o),o},t.RotationAlphaBetaGammaToRef=function(t,i,n,r){var o=.5*(n+t),s=.5*(n-t),e=.5*i;r.x=Math.cos(s)*Math.sin(e),r.y=Math.sin(s)*Math.sin(e),r.z=Math.sin(o)*Math.cos(e),r.w=Math.cos(o)*Math.cos(e)},t.Slerp=function(i,n,r){var o,s,e=r,h=i.x*n.x+i.y*n.y+i.z*n.z+i.w*n.w,a=!1;if(0>h&&(a=!0,h=-h),h>.999999)s=1-e,o=a?-e:e;else{var u=Math.acos(h),m=1/Math.sin(u);s=Math.sin((1-e)*u)*m,o=a?-Math.sin(e*u)*m:Math.sin(e*u)*m}return new t(s*i.x+o*n.x,s*i.y+o*n.y,s*i.z+o*n.z,s*i.w+o*n.w)},t}();t.Quaternion=e;var h=function(){function i(){this.m=new Float32Array(16)}return i.prototype.isIdentity=function(){return 1!==this.m[0]||1!==this.m[5]||1!==this.m[10]||1!==this.m[15]?!1:0!==this.m[1]||0!==this.m[2]||0!==this.m[3]||0!==this.m[4]||0!==this.m[6]||0!==this.m[7]||0!==this.m[8]||0!==this.m[9]||0!==this.m[11]||0!==this.m[12]||0!==this.m[13]||0!==this.m[14]?!1:!0},i.prototype.determinant=function(){var t=this.m[10]*this.m[15]-this.m[11]*this.m[14],i=this.m[9]*this.m[15]-this.m[11]*this.m[13],n=this.m[9]*this.m[14]-this.m[10]*this.m[13],r=this.m[8]*this.m[15]-this.m[11]*this.m[12],o=this.m[8]*this.m[14]-this.m[10]*this.m[12],s=this.m[8]*this.m[13]-this.m[9]*this.m[12];return this.m[0]*(this.m[5]*t-this.m[6]*i+this.m[7]*n)-this.m[1]*(this.m[4]*t-this.m[6]*r+this.m[7]*o)+this.m[2]*(this.m[4]*i-this.m[5]*r+this.m[7]*s)-this.m[3]*(this.m[4]*n-this.m[5]*o+this.m[6]*s)},i.prototype.toArray=function(){return this.m},i.prototype.asArray=function(){return this.toArray()},i.prototype.invert=function(){return this.invertToRef(this),this},i.prototype.reset=function(){for(var t=0;16>t;t++)this.m[t]=0;return this},i.prototype.add=function(t){var n=new i;return this.addToRef(t,n),n},i.prototype.addToRef=function(t,i){for(var n=0;16>n;n++)i.m[n]=this.m[n]+t.m[n];return this},i.prototype.addToSelf=function(t){for(var i=0;16>i;i++)this.m[i]+=t.m[i];return this},i.prototype.invertToRef=function(t){var i=this.m[0],n=this.m[1],r=this.m[2],o=this.m[3],s=this.m[4],e=this.m[5],h=this.m[6],a=this.m[7],u=this.m[8],m=this.m[9],y=this.m[10],c=this.m[11],f=this.m[12],p=this.m[13],l=this.m[14],x=this.m[15],z=y*x-c*l,w=m*x-c*p,v=m*l-y*p,g=u*x-c*f,d=u*l-y*f,T=u*p-m*f,R=e*z-h*w+a*v,_=-(s*z-h*g+a*d),M=s*w-e*g+a*T,F=-(s*v-e*d+h*T),A=1/(i*R+n*_+r*M+o*F),b=h*x-a*l,P=e*x-a*p,C=e*l-h*p,I=s*x-a*f,E=s*l-h*f,q=s*p-e*f,L=h*c-a*y,D=e*c-a*m,S=e*y-h*m,Z=s*c-a*u,N=s*y-h*u,W=s*m-e*u;return t.m[0]=R*A,t.m[4]=_*A,t.m[8]=M*A,t.m[12]=F*A,t.m[1]=-(n*z-r*w+o*v)*A,t.m[5]=(i*z-r*g+o*d)*A,t.m[9]=-(i*w-n*g+o*T)*A,t.m[13]=(i*v-n*d+r*T)*A,t.m[2]=(n*b-r*P+o*C)*A,t.m[6]=-(i*b-r*I+o*E)*A,t.m[10]=(i*P-n*I+o*q)*A,t.m[14]=-(i*C-n*E+r*q)*A,t.m[3]=-(n*L-r*D+o*S)*A,t.m[7]=(i*L-r*Z+o*N)*A,t.m[11]=-(i*D-n*Z+o*W)*A,t.m[15]=(i*S-n*N+r*W)*A,this},i.prototype.setTranslation=function(t){return this.m[12]=t.x,this.m[13]=t.y,this.m[14]=t.z,this},i.prototype.multiply=function(t){var n=new i;return this.multiplyToRef(t,n),n},i.prototype.copyFrom=function(t){for(var i=0;16>i;i++)this.m[i]=t.m[i];return this},i.prototype.copyToArray=function(t,i){void 0===i&&(i=0);for(var n=0;16>n;n++)t[i+n]=this.m[n];return this},i.prototype.multiplyToRef=function(t,i){return this.multiplyToArray(t,i.m,0),this},i.prototype.multiplyToArray=function(t,i,n){var r=this.m[0],o=this.m[1],s=this.m[2],e=this.m[3],h=this.m[4],a=this.m[5],u=this.m[6],m=this.m[7],y=this.m[8],c=this.m[9],f=this.m[10],p=this.m[11],l=this.m[12],x=this.m[13],z=this.m[14],w=this.m[15],v=t.m[0],g=t.m[1],d=t.m[2],T=t.m[3],R=t.m[4],_=t.m[5],M=t.m[6],F=t.m[7],A=t.m[8],b=t.m[9],P=t.m[10],C=t.m[11],I=t.m[12],E=t.m[13],q=t.m[14],L=t.m[15];return i[n]=r*v+o*R+s*A+e*I,i[n+1]=r*g+o*_+s*b+e*E,i[n+2]=r*d+o*M+s*P+e*q,i[n+3]=r*T+o*F+s*C+e*L,i[n+4]=h*v+a*R+u*A+m*I,i[n+5]=h*g+a*_+u*b+m*E,i[n+6]=h*d+a*M+u*P+m*q,i[n+7]=h*T+a*F+u*C+m*L,i[n+8]=y*v+c*R+f*A+p*I,i[n+9]=y*g+c*_+f*b+p*E,i[n+10]=y*d+c*M+f*P+p*q,i[n+11]=y*T+c*F+f*C+p*L,i[n+12]=l*v+x*R+z*A+w*I,i[n+13]=l*g+x*_+z*b+w*E,i[n+14]=l*d+x*M+z*P+w*q,i[n+15]=l*T+x*F+z*C+w*L,this},i.prototype.equals=function(t){return t&&this.m[0]===t.m[0]&&this.m[1]===t.m[1]&&this.m[2]===t.m[2]&&this.m[3]===t.m[3]&&this.m[4]===t.m[4]&&this.m[5]===t.m[5]&&this.m[6]===t.m[6]&&this.m[7]===t.m[7]&&this.m[8]===t.m[8]&&this.m[9]===t.m[9]&&this.m[10]===t.m[10]&&this.m[11]===t.m[11]&&this.m[12]===t.m[12]&&this.m[13]===t.m[13]&&this.m[14]===t.m[14]&&this.m[15]===t.m[15]},i.prototype.clone=function(){return i.FromValues(this.m[0],this.m[1],this.m[2],this.m[3],this.m[4],this.m[5],this.m[6],this.m[7],this.m[8],this.m[9],this.m[10],this.m[11],this.m[12],this.m[13],this.m[14],this.m[15])},i.prototype.decompose=function(n,r,o){o.x=this.m[12],o.y=this.m[13],o.z=this.m[14];var s=t.Tools.Sign(this.m[0]*this.m[1]*this.m[2]*this.m[3])<0?-1:1,h=t.Tools.Sign(this.m[4]*this.m[5]*this.m[6]*this.m[7])<0?-1:1,a=t.Tools.Sign(this.m[8]*this.m[9]*this.m[10]*this.m[11])<0?-1:1;if(n.x=s*Math.sqrt(this.m[0]*this.m[0]+this.m[1]*this.m[1]+this.m[2]*this.m[2]),n.y=h*Math.sqrt(this.m[4]*this.m[4]+this.m[5]*this.m[5]+this.m[6]*this.m[6]),n.z=a*Math.sqrt(this.m[8]*this.m[8]+this.m[9]*this.m[9]+this.m[10]*this.m[10]),0===n.x||0===n.y||0===n.z)return r.x=0,r.y=0,r.z=0,r.w=1,!1;var u=i.FromValues(this.m[0]/n.x,this.m[1]/n.x,this.m[2]/n.x,0,this.m[4]/n.y,this.m[5]/n.y,this.m[6]/n.y,0,this.m[8]/n.z,this.m[9]/n.z,this.m[10]/n.z,0,0,0,0,1);return e.FromRotationMatrixToRef(u,r),!0},i.FromArray=function(t,n){var r=new i;return n||(n=0),i.FromArrayToRef(t,n,r),r},i.FromArrayToRef=function(t,i,n){for(var r=0;16>r;r++)n.m[r]=t[r+i]},i.FromFloat32ArrayToRefScaled=function(t,i,n,r){for(var o=0;16>o;o++)r.m[o]=t[o+i]*n},i.FromValuesToRef=function(t,i,n,r,o,s,e,h,a,u,m,y,c,f,p,l,x){x.m[0]=t,x.m[1]=i,x.m[2]=n,x.m[3]=r,x.m[4]=o,x.m[5]=s,x.m[6]=e,x.m[7]=h,x.m[8]=a,x.m[9]=u,x.m[10]=m,x.m[11]=y,x.m[12]=c,x.m[13]=f,x.m[14]=p,x.m[15]=l},i.FromValues=function(t,n,r,o,s,e,h,a,u,m,y,c,f,p,l,x){var z=new i;return z.m[0]=t,z.m[1]=n,z.m[2]=r,z.m[3]=o,z.m[4]=s,z.m[5]=e,z.m[6]=h,z.m[7]=a,z.m[8]=u,z.m[9]=m,z.m[10]=y,z.m[11]=c,z.m[12]=f,z.m[13]=p,z.m[14]=l,z.m[15]=x,z},i.Compose=function(t,n,r){var o=i.FromValues(t.x,0,0,0,0,t.y,0,0,0,0,t.z,0,0,0,0,1),s=i.Identity();return n.toRotationMatrix(s),o=o.multiply(s),o.setTranslation(r),o},i.Identity=function(){return i.FromValues(1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1)},i.IdentityToRef=function(t){i.FromValuesToRef(1,0,0,0,0,1,0,0,0,0,1,0,0,0,0,1,t)},i.Zero=function(){return i.FromValues(0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0)},i.RotationX=function(t){var n=new i;return i.RotationXToRef(t,n),n},i.Invert=function(t){var n=new i;return t.invertToRef(n),n},i.RotationXToRef=function(t,i){var n=Math.sin(t),r=Math.cos(t);i.m[0]=1,i.m[15]=1,i.m[5]=r,i.m[10]=r,i.m[9]=-n,i.m[6]=n,i.m[1]=0,i.m[2]=0,i.m[3]=0,i.m[4]=0,i.m[7]=0,i.m[8]=0,i.m[11]=0,i.m[12]=0,i.m[13]=0,i.m[14]=0},i.RotationY=function(t){var n=new i;return i.RotationYToRef(t,n),n},i.RotationYToRef=function(t,i){var n=Math.sin(t),r=Math.cos(t);i.m[5]=1,i.m[15]=1,i.m[0]=r,i.m[2]=-n,i.m[8]=n,i.m[10]=r,i.m[1]=0,i.m[3]=0,i.m[4]=0,i.m[6]=0,i.m[7]=0,i.m[9]=0,i.m[11]=0,i.m[12]=0,i.m[13]=0,i.m[14]=0},i.RotationZ=function(t){var n=new i;return i.RotationZToRef(t,n),n},i.RotationZToRef=function(t,i){var n=Math.sin(t),r=Math.cos(t);i.m[10]=1,i.m[15]=1,i.m[0]=r,i.m[1]=n,i.m[4]=-n,i.m[5]=r,i.m[2]=0,i.m[3]=0,i.m[6]=0,i.m[7]=0,i.m[8]=0,i.m[9]=0,i.m[11]=0,i.m[12]=0,i.m[13]=0,i.m[14]=0},i.RotationAxis=function(t,n){var r=i.Zero();return i.RotationAxisToRef(t,n,r),r},i.RotationAxisToRef=function(t,i,n){var r=Math.sin(-i),o=Math.cos(-i),s=1-o;t.normalize(),n.m[0]=t.x*t.x*s+o,n.m[1]=t.x*t.y*s-t.z*r,n.m[2]=t.x*t.z*s+t.y*r,n.m[3]=0,n.m[4]=t.y*t.x*s+t.z*r,n.m[5]=t.y*t.y*s+o,n.m[6]=t.y*t.z*s-t.x*r,n.m[7]=0,n.m[8]=t.z*t.x*s-t.y*r,n.m[9]=t.z*t.y*s+t.x*r,n.m[10]=t.z*t.z*s+o,n.m[11]=0,n.m[15]=1},i.RotationYawPitchRoll=function(t,n,r){var o=new i;return i.RotationYawPitchRollToRef(t,n,r,o),o},i.RotationYawPitchRollToRef=function(t,i,n,r){e.RotationYawPitchRollToRef(t,i,n,this._tempQuaternion),this._tempQuaternion.toRotationMatrix(r)},i.Scaling=function(t,n,r){var o=i.Zero();return i.ScalingToRef(t,n,r,o),o},i.ScalingToRef=function(t,i,n,r){\nr.m[0]=t,r.m[1]=0,r.m[2]=0,r.m[3]=0,r.m[4]=0,r.m[5]=i,r.m[6]=0,r.m[7]=0,r.m[8]=0,r.m[9]=0,r.m[10]=n,r.m[11]=0,r.m[12]=0,r.m[13]=0,r.m[14]=0,r.m[15]=1},i.Translation=function(t,n,r){var o=i.Identity();return i.TranslationToRef(t,n,r,o),o},i.TranslationToRef=function(t,n,r,o){i.FromValuesToRef(1,0,0,0,0,1,0,0,0,0,1,0,t,n,r,1,o)},i.LookAtLH=function(t,n,r){var o=i.Zero();return i.LookAtLHToRef(t,n,r,o),o},i.LookAtLHToRef=function(t,n,r,s){n.subtractToRef(t,this._zAxis),this._zAxis.normalize(),o.CrossToRef(r,this._zAxis,this._xAxis),0===this._xAxis.lengthSquared()?this._xAxis.x=1:this._xAxis.normalize(),o.CrossToRef(this._zAxis,this._xAxis,this._yAxis),this._yAxis.normalize();var e=-o.Dot(this._xAxis,t),h=-o.Dot(this._yAxis,t),a=-o.Dot(this._zAxis,t);return i.FromValuesToRef(this._xAxis.x,this._yAxis.x,this._zAxis.x,0,this._xAxis.y,this._yAxis.y,this._zAxis.y,0,this._xAxis.z,this._yAxis.z,this._zAxis.z,0,e,h,a,1,s)},i.OrthoLH=function(t,n,r,o){var s=i.Zero();return i.OrthoLHToRef(t,n,r,o,s),s},i.OrthoLHToRef=function(t,n,r,o,s){var e=2/t,h=2/n,a=1/(o-r),u=r/(r-o);i.FromValuesToRef(e,0,0,0,0,h,0,0,0,0,a,0,0,0,u,1,s)},i.OrthoOffCenterLH=function(t,n,r,o,s,e){var h=i.Zero();return i.OrthoOffCenterLHToRef(t,n,r,o,s,e,h),h},i.OrthoOffCenterLHToRef=function(t,i,n,r,o,s,e){e.m[0]=2/(i-t),e.m[1]=e.m[2]=e.m[3]=0,e.m[5]=2/(r-n),e.m[4]=e.m[6]=e.m[7]=0,e.m[10]=-1/(o-s),e.m[8]=e.m[9]=e.m[11]=0,e.m[12]=(t+i)/(t-i),e.m[13]=(r+n)/(n-r),e.m[14]=o/(o-s),e.m[15]=1},i.PerspectiveLH=function(t,n,r,o){var s=i.Zero();return s.m[0]=2*r/t,s.m[1]=s.m[2]=s.m[3]=0,s.m[5]=2*r/n,s.m[4]=s.m[6]=s.m[7]=0,s.m[10]=-o/(r-o),s.m[8]=s.m[9]=0,s.m[11]=1,s.m[12]=s.m[13]=s.m[15]=0,s.m[14]=r*o/(r-o),s},i.PerspectiveFovLH=function(t,n,r,o){var s=i.Zero();return i.PerspectiveFovLHToRef(t,n,r,o,s),s},i.PerspectiveFovLHToRef=function(i,n,r,o,s,e){void 0===e&&(e=t.Camera.FOVMODE_VERTICAL_FIXED);var h=1/Math.tan(.5*i),a=e===t.Camera.FOVMODE_VERTICAL_FIXED;a?s.m[0]=h/n:s.m[0]=h,s.m[1]=s.m[2]=s.m[3]=0,a?s.m[5]=h:s.m[5]=h*n,s.m[4]=s.m[6]=s.m[7]=0,s.m[8]=s.m[9]=0,s.m[10]=-o/(r-o),s.m[11]=1,s.m[12]=s.m[13]=s.m[15]=0,s.m[14]=r*o/(r-o)},i.GetFinalMatrix=function(t,n,r,o,s,e){var h=t.width,a=t.height,u=t.x,m=t.y,y=i.FromValues(h/2,0,0,0,0,-a/2,0,0,0,0,e-s,0,u+h/2,a/2+m,s,1);return n.multiply(r).multiply(o).multiply(y)},i.GetAsMatrix2x2=function(t){return new Float32Array([t.m[0],t.m[1],t.m[4],t.m[5]])},i.GetAsMatrix3x3=function(t){return new Float32Array([t.m[0],t.m[1],t.m[2],t.m[4],t.m[5],t.m[6],t.m[8],t.m[9],t.m[10]])},i.Transpose=function(t){var n=new i;return n.m[0]=t.m[0],n.m[1]=t.m[4],n.m[2]=t.m[8],n.m[3]=t.m[12],n.m[4]=t.m[1],n.m[5]=t.m[5],n.m[6]=t.m[9],n.m[7]=t.m[13],n.m[8]=t.m[2],n.m[9]=t.m[6],n.m[10]=t.m[10],n.m[11]=t.m[14],n.m[12]=t.m[3],n.m[13]=t.m[7],n.m[14]=t.m[11],n.m[15]=t.m[15],n},i.Reflection=function(t){var n=new i;return i.ReflectionToRef(t,n),n},i.ReflectionToRef=function(t,i){t.normalize();var n=t.normal.x,r=t.normal.y,o=t.normal.z,s=-2*n,e=-2*r,h=-2*o;i.m[0]=s*n+1,i.m[1]=e*n,i.m[2]=h*n,i.m[3]=0,i.m[4]=s*r,i.m[5]=e*r+1,i.m[6]=h*r,i.m[7]=0,i.m[8]=s*o,i.m[9]=e*o,i.m[10]=h*o+1,i.m[11]=0,i.m[12]=s*t.d,i.m[13]=e*t.d,i.m[14]=h*t.d,i.m[15]=1},i._tempQuaternion=new e,i._xAxis=o.Zero(),i._yAxis=o.Zero(),i._zAxis=o.Zero(),i}();t.Matrix=h;var a=function(){function t(t,i,n,r){this.normal=new o(t,i,n),this.d=r}return t.prototype.asArray=function(){return[this.normal.x,this.normal.y,this.normal.z,this.d]},t.prototype.clone=function(){return new t(this.normal.x,this.normal.y,this.normal.z,this.d)},t.prototype.normalize=function(){var t=Math.sqrt(this.normal.x*this.normal.x+this.normal.y*this.normal.y+this.normal.z*this.normal.z),i=0;return 0!==t&&(i=1/t),this.normal.x*=i,this.normal.y*=i,this.normal.z*=i,this.d*=i,this},t.prototype.transform=function(i){var n=h.Transpose(i),r=this.normal.x,o=this.normal.y,s=this.normal.z,e=this.d,a=r*n.m[0]+o*n.m[1]+s*n.m[2]+e*n.m[3],u=r*n.m[4]+o*n.m[5]+s*n.m[6]+e*n.m[7],m=r*n.m[8]+o*n.m[9]+s*n.m[10]+e*n.m[11],y=r*n.m[12]+o*n.m[13]+s*n.m[14]+e*n.m[15];return new t(a,u,m,y)},t.prototype.dotCoordinate=function(t){return this.normal.x*t.x+this.normal.y*t.y+this.normal.z*t.z+this.d},t.prototype.copyFromPoints=function(t,i,n){var r,o=i.x-t.x,s=i.y-t.y,e=i.z-t.z,h=n.x-t.x,a=n.y-t.y,u=n.z-t.z,m=s*u-e*a,y=e*h-o*u,c=o*a-s*h,f=Math.sqrt(m*m+y*y+c*c);return r=0!==f?1/f:0,this.normal.x=m*r,this.normal.y=y*r,this.normal.z=c*r,this.d=-(this.normal.x*t.x+this.normal.y*t.y+this.normal.z*t.z),this},t.prototype.isFrontFacingTo=function(t,i){var n=o.Dot(this.normal,t);return i>=n},t.prototype.signedDistanceTo=function(t){return o.Dot(t,this.normal)+this.d},t.FromArray=function(i){return new t(i[0],i[1],i[2],i[3])},t.FromPoints=function(i,n,r){var o=new t(0,0,0,0);return o.copyFromPoints(i,n,r),o},t.FromPositionAndNormal=function(i,n){var r=new t(0,0,0,0);return n.normalize(),r.normal=n,r.d=-(n.x*i.x+n.y*i.y+n.z*i.z),r},t.SignedDistanceToPlaneFromPositionAndNormal=function(t,i,n){var r=-(i.x*t.x+i.y*t.y+i.z*t.z);return o.Dot(n,i)+r},t}();t.Plane=a;var u=function(){function t(t,i,n,r){this.x=t,this.y=i,this.width=n,this.height=r}return t.prototype.toGlobal=function(i){var n=i.getRenderWidth(),r=i.getRenderHeight();return new t(this.x*n,this.y*r,this.width*n,this.height*r)},t}();t.Viewport=u;var m=function(){function t(){}return t.GetPlanes=function(i){for(var n=[],r=0;6>r;r++)n.push(new a(0,0,0,0));return t.GetPlanesToRef(i,n),n},t.GetPlanesToRef=function(t,i){i[0].normal.x=t.m[3]+t.m[2],i[0].normal.y=t.m[7]+t.m[6],i[0].normal.z=t.m[11]+t.m[10],i[0].d=t.m[15]+t.m[14],i[0].normalize(),i[1].normal.x=t.m[3]-t.m[2],i[1].normal.y=t.m[7]-t.m[6],i[1].normal.z=t.m[11]-t.m[10],i[1].d=t.m[15]-t.m[14],i[1].normalize(),i[2].normal.x=t.m[3]+t.m[0],i[2].normal.y=t.m[7]+t.m[4],i[2].normal.z=t.m[11]+t.m[8],i[2].d=t.m[15]+t.m[12],i[2].normalize(),i[3].normal.x=t.m[3]-t.m[0],i[3].normal.y=t.m[7]-t.m[4],i[3].normal.z=t.m[11]-t.m[8],i[3].d=t.m[15]-t.m[12],i[3].normalize(),i[4].normal.x=t.m[3]-t.m[1],i[4].normal.y=t.m[7]-t.m[5],i[4].normal.z=t.m[11]-t.m[9],i[4].d=t.m[15]-t.m[13],i[4].normalize(),i[5].normal.x=t.m[3]+t.m[1],i[5].normal.y=t.m[7]+t.m[5],i[5].normal.z=t.m[11]+t.m[9],i[5].d=t.m[15]+t.m[13],i[5].normalize()},t}();t.Frustum=m;var y=function(){function i(t,i,n){void 0===n&&(n=Number.MAX_VALUE),this.origin=t,this.direction=i,this.length=n}return i.prototype.intersectsBoxMinMax=function(t,i){var n,r,o,s,e=0,h=Number.MAX_VALUE;if(Math.abs(this.direction.x)<1e-7){if(this.origin.x<t.x||this.origin.x>i.x)return!1}else if(n=1/this.direction.x,r=(t.x-this.origin.x)*n,o=(i.x-this.origin.x)*n,o===-(1/0)&&(o=1/0),r>o&&(s=r,r=o,o=s),e=Math.max(r,e),h=Math.min(o,h),e>h)return!1;if(Math.abs(this.direction.y)<1e-7){if(this.origin.y<t.y||this.origin.y>i.y)return!1}else if(n=1/this.direction.y,r=(t.y-this.origin.y)*n,o=(i.y-this.origin.y)*n,o===-(1/0)&&(o=1/0),r>o&&(s=r,r=o,o=s),e=Math.max(r,e),h=Math.min(o,h),e>h)return!1;if(Math.abs(this.direction.z)<1e-7){if(this.origin.z<t.z||this.origin.z>i.z)return!1}else if(n=1/this.direction.z,r=(t.z-this.origin.z)*n,o=(i.z-this.origin.z)*n,o===-(1/0)&&(o=1/0),r>o&&(s=r,r=o,o=s),e=Math.max(r,e),h=Math.min(o,h),e>h)return!1;return!0},i.prototype.intersectsBox=function(t){return this.intersectsBoxMinMax(t.minimum,t.maximum)},i.prototype.intersectsSphere=function(t){var i=t.center.x-this.origin.x,n=t.center.y-this.origin.y,r=t.center.z-this.origin.z,o=i*i+n*n+r*r,s=t.radius*t.radius;if(s>=o)return!0;var e=i*this.direction.x+n*this.direction.y+r*this.direction.z;if(0>e)return!1;var h=o-e*e;return s>=h},i.prototype.intersectsTriangle=function(i,n,r){this._edge1||(this._edge1=o.Zero(),this._edge2=o.Zero(),this._pvec=o.Zero(),this._tvec=o.Zero(),this._qvec=o.Zero()),n.subtractToRef(i,this._edge1),r.subtractToRef(i,this._edge2),o.CrossToRef(this.direction,this._edge2,this._pvec);var s=o.Dot(this._edge1,this._pvec);if(0===s)return null;var e=1/s;this.origin.subtractToRef(i,this._tvec);var h=o.Dot(this._tvec,this._pvec)*e;if(0>h||h>1)return null;o.CrossToRef(this._tvec,this._edge1,this._qvec);var a=o.Dot(this.direction,this._qvec)*e;if(0>a||h+a>1)return null;var u=o.Dot(this._edge2,this._qvec)*e;return u>this.length?null:new t.IntersectionInfo(h,a,u)},i.CreateNew=function(t,n,r,s,e,h,a){var u=o.Unproject(new o(t,n,0),r,s,e,h,a),m=o.Unproject(new o(t,n,1),r,s,e,h,a),y=m.subtract(u);return y.normalize(),new i(u,y)},i.CreateNewFromTo=function(t,n,r){void 0===r&&(r=h.Identity());var o=n.subtract(t),s=Math.sqrt(o.x*o.x+o.y*o.y+o.z*o.z);return o.normalize(),i.Transform(new i(t,o,s),r)},i.Transform=function(t,n){var r=o.TransformCoordinates(t.origin,n),s=o.TransformNormal(t.direction,n);return new i(r,s,t.length)},i}();t.Ray=y,function(t){t[t.LOCAL=0]=\"LOCAL\",t[t.WORLD=1]=\"WORLD\"}(t.Space||(t.Space={}));var c=(t.Space,function(){function t(){}return t.X=new o(1,0,0),t.Y=new o(0,1,0),t.Z=new o(0,0,1),t}());t.Axis=c;var f=function(){function t(){}return t.interpolate=function(t,i,n,r,o){for(var s=1-3*r+3*i,e=3*r-6*i,h=3*i,a=t,u=0;5>u;u++){var m=a*a,y=m*a,c=s*y+e*m+h*a,f=1/(3*s*m+2*e*a+h);a-=(c-t)*f,a=Math.min(1,Math.max(0,a))}return 3*Math.pow(1-a,2)*a*n+3*(1-a)*Math.pow(a,2)*o+Math.pow(a,3)},t}();t.BezierCurve=f,function(t){t[t.CW=0]=\"CW\",t[t.CCW=1]=\"CCW\"}(t.Orientation||(t.Orientation={}));var p=t.Orientation,l=function(){function t(t){var i=this;this.degrees=function(){return 180*i._radians/Math.PI},this.radians=function(){return i._radians},this._radians=t,this._radians<0&&(this._radians+=2*Math.PI)}return t.BetweenTwoPoints=function(i,n){var r=n.subtract(i),o=Math.atan2(r.y,r.x);return new t(o)},t.FromRadians=function(i){return new t(i)},t.FromDegrees=function(i){return new t(i*Math.PI/180)},t}();t.Angle=l;var x=function(){function t(t,i,n){this.startPoint=t,this.midPoint=i,this.endPoint=n;var o=Math.pow(i.x,2)+Math.pow(i.y,2),s=(Math.pow(t.x,2)+Math.pow(t.y,2)-o)/2,e=(o-Math.pow(n.x,2)-Math.pow(n.y,2))/2,h=(t.x-i.x)*(i.y-n.y)-(i.x-n.x)*(t.y-i.y);this.centerPoint=new r((s*(i.y-n.y)-e*(t.y-i.y))/h,((t.x-i.x)*e-(i.x-n.x)*s)/h),this.radius=this.centerPoint.subtract(this.startPoint).length(),this.startAngle=l.BetweenTwoPoints(this.centerPoint,this.startPoint);var a=this.startAngle.degrees(),u=l.BetweenTwoPoints(this.centerPoint,this.midPoint).degrees(),m=l.BetweenTwoPoints(this.centerPoint,this.endPoint).degrees();u-a>180&&(u-=360),-180>u-a&&(u+=360),m-u>180&&(m-=360),-180>m-u&&(m+=360),this.orientation=0>u-a?p.CW:p.CCW,this.angle=l.FromDegrees(this.orientation===p.CW?a-m:m-a)}return t}();t.Arc2=x;var z=function(){function t(t){this.path=t,this._onchange=new Array,this.value=0,this.animations=new Array}return t.prototype.getPoint=function(){var t=this.path.getPointAtLengthPosition(this.value);return new o(t.x,0,t.y)},t.prototype.moveAhead=function(t){return void 0===t&&(t=.002),this.move(t),this},t.prototype.moveBack=function(t){return void 0===t&&(t=.002),this.move(-t),this},t.prototype.move=function(t){if(Math.abs(t)>1)throw\"step size should be less than 1.\";return this.value+=t,this.ensureLimits(),this.raiseOnChange(),this},t.prototype.ensureLimits=function(){for(;this.value>1;)this.value-=1;for(;this.value<0;)this.value+=1;return this},t.prototype.markAsDirty=function(t){return this.ensureLimits(),this.raiseOnChange(),this},t.prototype.raiseOnChange=function(){var t=this;return this._onchange.forEach(function(i){return i(t)}),this},t.prototype.onchange=function(t){return this._onchange.push(t),this},t}();t.PathCursor=z;var w=function(){function i(t,i){this._points=new Array,this._length=0,this.closed=!1,this._points.push(new r(t,i))}return i.prototype.addLineTo=function(i,n){if(closed)return t.Tools.Error(\"cannot add lines to closed paths\"),this;var o=new r(i,n),s=this._points[this._points.length-1];return this._points.push(o),this._length+=o.subtract(s).length(),this},i.prototype.addArcTo=function(i,n,o,s,e){if(void 0===e&&(e=36),closed)return t.Tools.Error(\"cannot add arcs to closed paths\"),this;var h=this._points[this._points.length-1],a=new r(i,n),u=new r(o,s),m=new x(h,a,u),y=m.angle.radians()/e;m.orientation===p.CW&&(y*=-1);for(var c=m.startAngle.radians()+y,f=0;e>f;f++){var l=Math.cos(c)*m.radius+m.centerPoint.x,z=Math.sin(c)*m.radius+m.centerPoint.y;this.addLineTo(l,z),c+=y}return this},i.prototype.close=function(){return this.closed=!0,this},i.prototype.length=function(){var t=this._length;if(!this.closed){var i=this._points[this._points.length-1],n=this._points[0];t+=n.subtract(i).length()}return t},i.prototype.getPoints=function(){return this._points},i.prototype.getPointAtLengthPosition=function(i){if(0>i||i>1)return t.Tools.Error(\"normalized length position should be between 0 and 1.\"),r.Zero();for(var n=i*this.length(),o=0,s=0;s<this._points.length;s++){var e=(s+1)%this._points.length,h=this._points[s],a=this._points[e],u=a.subtract(h),m=u.length()+o;if(n>=o&&m>=n){var y=u.normalize(),c=n-o;return new r(h.x+y.x*c,h.y+y.y*c)}o=m}return t.Tools.Error(\"internal error\"),r.Zero()},i.StartingAt=function(t,n){return new i(t,n)},i}();t.Path2=w;var v=function(){function i(t,i,n){this.path=t,this._curve=new Array,this._distances=new Array,this._tangents=new Array,this._normals=new Array,this._binormals=new Array;for(var r=0;r<t.length;r++)this._curve[r]=t[r].clone();this._raw=n||!1,this._compute(i)}return i.prototype.getCurve=function(){return this._curve},i.prototype.getTangents=function(){return this._tangents},i.prototype.getNormals=function(){return this._normals},i.prototype.getBinormals=function(){return this._binormals},i.prototype.getDistances=function(){return this._distances},i.prototype.update=function(t,i){for(var n=0;n<t.length;n++)this._curve[n].x=t[n].x,this._curve[n].y=t[n].y,this._curve[n].z=t[n].z;return this._compute(i),this},i.prototype._compute=function(t){var i=this._curve.length;this._tangents[0]=this._getFirstNonNullVector(0),this._raw||this._tangents[0].normalize(),this._tangents[i-1]=this._curve[i-1].subtract(this._curve[i-2]),this._raw||this._tangents[i-1].normalize();var n=this._tangents[0],r=this._normalVector(this._curve[0],n,t);this._normals[0]=r,this._raw||this._normals[0].normalize(),this._binormals[0]=o.Cross(n,this._normals[0]),this._raw||this._binormals[0].normalize(),this._distances[0]=0;for(var s,e,h,a,u=1;i>u;u++)s=this._getLastNonNullVector(u),i-1>u&&(e=this._getFirstNonNullVector(u),this._tangents[u]=s.add(e),this._tangents[u].normalize()),this._distances[u]=this._distances[u-1]+s.length(),h=this._tangents[u],a=this._binormals[u-1],this._normals[u]=o.Cross(a,h),this._raw||this._normals[u].normalize(),this._binormals[u]=o.Cross(h,this._normals[u]),this._raw||this._binormals[u].normalize()},i.prototype._getFirstNonNullVector=function(t){for(var i=1,n=this._curve[t+i].subtract(this._curve[t]);0===n.length()&&t+i+1<this._curve.length;)i++,n=this._curve[t+i].subtract(this._curve[t]);return n},i.prototype._getLastNonNullVector=function(t){for(var i=1,n=this._curve[t].subtract(this._curve[t-i]);0===n.length()&&t>i+1;)i++,n=this._curve[t].subtract(this._curve[t-i]);return n},i.prototype._normalVector=function(i,n,r){var s;if(void 0===r||null===r){var e;t.Tools.WithinEpsilon(n.y,1,t.Engine.Epsilon)?t.Tools.WithinEpsilon(n.x,1,t.Engine.Epsilon)?t.Tools.WithinEpsilon(n.z,1,t.Engine.Epsilon)||(e=new o(0,0,1)):e=new o(1,0,0):e=new o(0,-1,0),s=o.Cross(n,e)}else s=o.Cross(n,r),o.CrossToRef(s,n,s);return s.normalize(),s},i}();t.Path3D=v;var g=function(){function t(t){this._length=0,this._points=t,this._length=this._computeLength(t)}return t.CreateQuadraticBezier=function(i,n,r,s){s=s>2?s:3;for(var e=new Array,h=function(t,i,n,r){var o=(1-t)*(1-t)*i+2*t*(1-t)*n+t*t*r;return o},a=0;s>=a;a++)e.push(new o(h(a/s,i.x,n.x,r.x),h(a/s,i.y,n.y,r.y),h(a/s,i.z,n.z,r.z)));return new t(e)},t.CreateCubicBezier=function(i,n,r,s,e){e=e>3?e:4;for(var h=new Array,a=function(t,i,n,r,o){var s=(1-t)*(1-t)*(1-t)*i+3*t*(1-t)*(1-t)*n+3*t*t*(1-t)*r+t*t*t*o;return s},u=0;e>=u;u++)h.push(new o(a(u/e,i.x,n.x,r.x,s.x),a(u/e,i.y,n.y,r.y,s.y),a(u/e,i.z,n.z,r.z,s.z)));return new t(h)},t.CreateHermiteSpline=function(i,n,r,s,e){for(var h=new Array,a=1/e,u=0;e>=u;u++)h.push(o.Hermite(i,n,r,s,u*a));return new t(h)},t.prototype.getPoints=function(){return this._points},t.prototype.length=function(){return this._length},t.prototype[\"continue\"]=function(i){for(var n=this._points[this._points.length-1],r=this._points.slice(),o=i.getPoints(),s=1;s<o.length;s++)r.push(o[s].subtract(o[0]).add(n));var e=new t(r);return e},t.prototype._computeLength=function(t){for(var i=0,n=1;n<t.length;n++)i+=t[n].subtract(t[n-1]).length();return i},t}();t.Curve3=g;var d=function(){function t(t,i){void 0===t&&(t=o.Zero()),void 0===i&&(i=o.Up()),this.position=t,this.normal=i}return t.prototype.clone=function(){return new t(this.position.clone(),this.normal.clone())},t}();t.PositionNormalVertex=d;var T=function(){function t(t,i,n){void 0===t&&(t=o.Zero()),void 0===i&&(i=o.Up()),void 0===n&&(n=r.Zero()),this.position=t,this.normal=i,this.uv=n}return t.prototype.clone=function(){return new t(this.position.clone(),this.normal.clone(),this.uv.clone())},t}();t.PositionNormalTextureVertex=T}(BABYLON||(BABYLON={}));";
  35780. if (((typeof window != "undefined" && window.module) || (typeof module != "undefined")) && typeof module.exports != "undefined") {
  35781. module.exports = BABYLON;
  35782. };